Project
Inflammatory response time course, HUVEC (Wada, 2009)
Navigation
Downloads
Results for PATZ1_KLF4
Z-value: 2.54
Motif logo
Transcription factors associated with PATZ1_KLF4
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
PATZ1
|
ENSG00000100105.18 | PATZ1 |
|
KLF4
|
ENSG00000136826.15 | KLF4 |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| PATZ1 | hg38_v1_chr22_-_31346143_31346232, hg38_v1_chr22_-_31346317_31346364 | -0.60 | 1.5e-03 | Click! |
| KLF4 | hg38_v1_chr9_-_107489754_107489776 | 0.25 | 2.2e-01 | Click! |
Activity profile of PATZ1_KLF4 motif
Sorted Z-values of PATZ1_KLF4 motif
Network of associatons between targets according to the STRING database.
First level regulatory network of PATZ1_KLF4
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 7.4 | 22.1 | GO:2000754 | regulation of phospholipid scramblase activity(GO:1900161) positive regulation of phospholipid scramblase activity(GO:1900163) regulation of glucosylceramide catabolic process(GO:2000752) positive regulation of glucosylceramide catabolic process(GO:2000753) regulation of sphingomyelin catabolic process(GO:2000754) positive regulation of sphingomyelin catabolic process(GO:2000755) |
| 7.0 | 20.9 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 7.0 | 34.9 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 6.5 | 19.6 | GO:0009720 | detection of hormone stimulus(GO:0009720) |
| 5.4 | 16.2 | GO:0006117 | acetaldehyde metabolic process(GO:0006117) |
| 5.2 | 15.6 | GO:0044501 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 4.9 | 9.7 | GO:0002537 | nitric oxide production involved in inflammatory response(GO:0002537) |
| 4.9 | 19.4 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 4.8 | 14.4 | GO:0036304 | umbilical cord morphogenesis(GO:0036304) umbilical cord development(GO:0061027) |
| 4.4 | 22.2 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 4.4 | 13.2 | GO:0042946 | glucoside transport(GO:0042946) |
| 4.4 | 13.2 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 4.2 | 12.6 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 4.1 | 16.4 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 3.8 | 22.9 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 3.6 | 14.3 | GO:0032954 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 3.3 | 19.9 | GO:0061767 | negative regulation of lung blood pressure(GO:0061767) |
| 3.3 | 13.2 | GO:0033590 | response to cobalamin(GO:0033590) |
| 3.2 | 9.7 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 3.2 | 12.9 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
| 3.2 | 12.9 | GO:2001247 | positive regulation of phosphatidylcholine biosynthetic process(GO:2001247) |
| 3.2 | 9.6 | GO:0051040 | regulation of calcium-independent cell-cell adhesion(GO:0051040) |
| 3.1 | 9.2 | GO:0070428 | regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) |
| 3.0 | 23.9 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 2.9 | 8.7 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
| 2.9 | 17.4 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 2.8 | 8.3 | GO:0061182 | negative regulation of chondrocyte development(GO:0061182) |
| 2.7 | 19.0 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 2.7 | 2.7 | GO:0072610 | interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) |
| 2.7 | 2.7 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 2.5 | 7.6 | GO:0038156 | interleukin-3-mediated signaling pathway(GO:0038156) |
| 2.4 | 2.4 | GO:0032831 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
| 2.4 | 31.3 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
| 2.4 | 2.4 | GO:0036466 | synaptic vesicle recycling via endosome(GO:0036466) |
| 2.3 | 6.8 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 2.3 | 6.8 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 2.2 | 6.6 | GO:1903576 | response to L-arginine(GO:1903576) |
| 2.2 | 8.7 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
| 2.1 | 8.6 | GO:0043311 | positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
| 2.1 | 2.1 | GO:0006227 | dUDP biosynthetic process(GO:0006227) dTDP biosynthetic process(GO:0006233) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dTDP metabolic process(GO:0046072) dUDP metabolic process(GO:0046077) |
| 2.1 | 8.2 | GO:0070982 | L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 2.0 | 8.2 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 2.0 | 6.1 | GO:1904616 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 2.0 | 24.1 | GO:0030578 | PML body organization(GO:0030578) |
| 2.0 | 11.9 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 2.0 | 5.9 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 1.9 | 1.9 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 1.9 | 1.9 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 1.9 | 9.5 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 1.9 | 5.7 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 1.9 | 5.7 | GO:1903281 | positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 1.9 | 5.6 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 1.9 | 5.6 | GO:0018395 | peptidyl-lysine hydroxylation to 5-hydroxy-L-lysine(GO:0018395) histone arginine demethylation(GO:0070077) histone H3-R2 demethylation(GO:0070078) histone H4-R3 demethylation(GO:0070079) |
| 1.9 | 5.6 | GO:0060722 | spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 1.9 | 7.4 | GO:1904116 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 1.8 | 7.4 | GO:1903860 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 1.8 | 5.5 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 1.8 | 32.6 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 1.8 | 5.4 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
| 1.8 | 5.4 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 1.8 | 17.9 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 1.8 | 8.9 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 1.8 | 5.3 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 1.8 | 14.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 1.7 | 3.5 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
| 1.7 | 8.7 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 1.7 | 8.6 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 1.7 | 5.1 | GO:0032912 | negative regulation of transforming growth factor beta2 production(GO:0032912) |
| 1.7 | 6.8 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 1.7 | 1.7 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 1.7 | 6.7 | GO:0050823 | peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 1.7 | 15.0 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 1.7 | 14.9 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 1.6 | 4.8 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 1.6 | 8.0 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 1.6 | 4.8 | GO:0048320 | axial mesoderm formation(GO:0048320) |
| 1.6 | 4.8 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 1.6 | 9.6 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
| 1.6 | 31.8 | GO:0003373 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 1.6 | 4.8 | GO:2000661 | positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 1.6 | 6.3 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 1.6 | 14.2 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 1.6 | 11.0 | GO:0022614 | membrane to membrane docking(GO:0022614) |
| 1.6 | 6.2 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
| 1.5 | 1.5 | GO:0035698 | CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:0035698) regulation of CD8-positive, alpha-beta cytotoxic T cell extravasation(GO:2000452) |
| 1.5 | 15.4 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 1.5 | 7.7 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 1.5 | 19.9 | GO:0046940 | nucleoside monophosphate phosphorylation(GO:0046940) |
| 1.5 | 4.6 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 1.5 | 16.7 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 1.5 | 4.5 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 1.5 | 7.4 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
| 1.5 | 5.9 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 1.5 | 8.8 | GO:0060313 | negative regulation of blood vessel remodeling(GO:0060313) |
| 1.5 | 5.8 | GO:1904141 | positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 1.4 | 4.3 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 1.4 | 8.7 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 1.4 | 4.3 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 1.4 | 4.3 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
| 1.4 | 16.8 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 1.4 | 11.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 1.4 | 1.4 | GO:0071224 | cellular response to peptidoglycan(GO:0071224) |
| 1.4 | 6.9 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 1.4 | 17.9 | GO:0038129 | ERBB3 signaling pathway(GO:0038129) |
| 1.4 | 6.8 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
| 1.3 | 2.7 | GO:0071676 | negative regulation of mononuclear cell migration(GO:0071676) |
| 1.3 | 6.7 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
| 1.3 | 5.3 | GO:0046035 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 1.3 | 7.8 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 1.3 | 9.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 1.3 | 15.6 | GO:0061734 | parkin-mediated mitophagy in response to mitochondrial depolarization(GO:0061734) |
| 1.3 | 9.1 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 1.3 | 10.3 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 1.3 | 6.4 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 1.3 | 7.6 | GO:0007296 | vitellogenesis(GO:0007296) |
| 1.3 | 5.1 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 1.3 | 3.8 | GO:0021896 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 1.2 | 4.9 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 1.2 | 3.7 | GO:0032223 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 1.2 | 3.7 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 1.2 | 14.5 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 1.2 | 1.2 | GO:0032707 | negative regulation of interleukin-23 production(GO:0032707) |
| 1.2 | 3.6 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 1.2 | 4.8 | GO:2000158 | positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 1.2 | 3.6 | GO:1903570 | regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
| 1.2 | 3.6 | GO:1904933 | regulation of cell proliferation in midbrain(GO:1904933) |
| 1.2 | 4.7 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 1.2 | 3.5 | GO:0034241 | macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
| 1.2 | 5.9 | GO:2001074 | regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 1.2 | 3.5 | GO:0003343 | proepicardium development(GO:0003342) septum transversum development(GO:0003343) |
| 1.2 | 23.3 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 1.2 | 10.4 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 1.2 | 9.3 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 1.2 | 5.8 | GO:0001575 | globoside metabolic process(GO:0001575) |
| 1.2 | 9.3 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 1.2 | 2.3 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 1.1 | 16.1 | GO:0034651 | cortisol metabolic process(GO:0034650) cortisol biosynthetic process(GO:0034651) |
| 1.1 | 1.1 | GO:0001743 | optic placode formation(GO:0001743) |
| 1.1 | 4.6 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 1.1 | 6.8 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 1.1 | 6.8 | GO:0035105 | sterol regulatory element binding protein import into nucleus(GO:0035105) |
| 1.1 | 3.4 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 1.1 | 5.6 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 1.1 | 1.1 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 1.1 | 6.8 | GO:0070376 | regulation of ERK5 cascade(GO:0070376) |
| 1.1 | 3.4 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 1.1 | 3.4 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 1.1 | 6.7 | GO:0086098 | angiotensin-activated signaling pathway involved in heart process(GO:0086098) |
| 1.1 | 1.1 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 1.1 | 2.2 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 1.1 | 21.2 | GO:0060180 | female mating behavior(GO:0060180) |
| 1.1 | 2.2 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 1.1 | 8.8 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 1.1 | 6.6 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 1.1 | 3.3 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 1.1 | 15.4 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 1.1 | 3.3 | GO:0075732 | viral penetration into host nucleus(GO:0075732) multi-organism nuclear import(GO:1902594) |
| 1.1 | 3.3 | GO:0008355 | olfactory learning(GO:0008355) |
| 1.1 | 9.8 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 1.1 | 7.6 | GO:0071351 | interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
| 1.1 | 1.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 1.1 | 7.6 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 1.1 | 18.3 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 1.1 | 4.3 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
| 1.1 | 2.1 | GO:0090035 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 1.0 | 8.4 | GO:0032218 | riboflavin transport(GO:0032218) |
| 1.0 | 3.1 | GO:0038195 | urokinase plasminogen activator signaling pathway(GO:0038195) |
| 1.0 | 3.1 | GO:0090222 | centrosome-templated microtubule nucleation(GO:0090222) |
| 1.0 | 12.4 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
| 1.0 | 6.2 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 1.0 | 3.1 | GO:0019364 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 1.0 | 2.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 1.0 | 5.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 1.0 | 17.3 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 1.0 | 2.0 | GO:0002265 | astrocyte activation involved in immune response(GO:0002265) |
| 1.0 | 4.0 | GO:0090096 | regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 1.0 | 3.0 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 1.0 | 7.0 | GO:0033504 | floor plate development(GO:0033504) |
| 1.0 | 3.0 | GO:0035425 | autocrine signaling(GO:0035425) |
| 1.0 | 12.8 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 1.0 | 4.9 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 1.0 | 3.9 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 1.0 | 6.8 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 1.0 | 1.9 | GO:0014028 | notochord formation(GO:0014028) |
| 1.0 | 1.0 | GO:0061443 | endocardial cushion cell differentiation(GO:0061443) |
| 1.0 | 4.8 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 1.0 | 3.8 | GO:0010585 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 1.0 | 3.8 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.9 | 2.8 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.9 | 1.9 | GO:0051885 | positive regulation of anagen(GO:0051885) |
| 0.9 | 2.8 | GO:0007518 | myoblast fate determination(GO:0007518) |
| 0.9 | 3.8 | GO:0019418 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.9 | 0.9 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.9 | 6.5 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.9 | 6.5 | GO:0010813 | neuropeptide catabolic process(GO:0010813) |
| 0.9 | 2.8 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.9 | 0.9 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
| 0.9 | 12.0 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.9 | 2.8 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.9 | 0.9 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.9 | 1.8 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.9 | 9.1 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.9 | 5.5 | GO:1903435 | positive regulation of constitutive secretory pathway(GO:1903435) |
| 0.9 | 0.9 | GO:1904393 | regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) negative regulation of neuromuscular junction development(GO:1904397) |
| 0.9 | 2.7 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.9 | 1.8 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 0.9 | 5.4 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
| 0.9 | 1.8 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.9 | 1.8 | GO:1902218 | regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) |
| 0.9 | 2.7 | GO:0061386 | closure of optic fissure(GO:0061386) |
| 0.9 | 1.8 | GO:1904172 | regulation of bleb assembly(GO:1904170) positive regulation of bleb assembly(GO:1904172) |
| 0.9 | 2.7 | GO:0061026 | cardiac muscle tissue regeneration(GO:0061026) |
| 0.9 | 6.3 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.9 | 2.7 | GO:0061573 | endoplasmic reticulum polarization(GO:0061163) actin filament bundle retrograde transport(GO:0061573) actin filament bundle distribution(GO:0070650) |
| 0.9 | 4.4 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.9 | 1.8 | GO:0060434 | bronchus morphogenesis(GO:0060434) |
| 0.9 | 10.6 | GO:0032329 | serine transport(GO:0032329) |
| 0.9 | 2.6 | GO:0090176 | microtubule cytoskeleton organization involved in establishment of planar polarity(GO:0090176) |
| 0.9 | 4.4 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 0.9 | 3.5 | GO:0072086 | specification of loop of Henle identity(GO:0072086) |
| 0.9 | 2.6 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.9 | 0.9 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.9 | 1.7 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.9 | 7.0 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.9 | 2.6 | GO:0042713 | sperm ejaculation(GO:0042713) |
| 0.9 | 6.1 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.9 | 7.8 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.9 | 6.1 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.9 | 2.6 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.9 | 1.7 | GO:0051969 | regulation of transmission of nerve impulse(GO:0051969) |
| 0.9 | 11.2 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.9 | 3.4 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
| 0.9 | 10.3 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
| 0.9 | 7.7 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.9 | 3.4 | GO:2000681 | negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.9 | 11.9 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.8 | 3.4 | GO:0072218 | ascending thin limb development(GO:0072021) metanephric ascending thin limb development(GO:0072218) |
| 0.8 | 3.4 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
| 0.8 | 11.0 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.8 | 2.5 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.8 | 0.8 | GO:0031943 | regulation of glucocorticoid metabolic process(GO:0031943) |
| 0.8 | 1.7 | GO:0046730 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.8 | 5.0 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.8 | 2.5 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.8 | 10.0 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.8 | 3.3 | GO:1904923 | regulation of mitophagy in response to mitochondrial depolarization(GO:1904923) |
| 0.8 | 4.2 | GO:0003383 | apical constriction(GO:0003383) |
| 0.8 | 19.1 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.8 | 4.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.8 | 6.6 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.8 | 4.1 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.8 | 4.9 | GO:0034201 | response to oleic acid(GO:0034201) |
| 0.8 | 7.4 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.8 | 16.3 | GO:1903830 | magnesium ion transmembrane transport(GO:1903830) |
| 0.8 | 3.3 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.8 | 4.9 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.8 | 2.4 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.8 | 6.5 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.8 | 3.2 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.8 | 0.8 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.8 | 24.2 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.8 | 8.1 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.8 | 2.4 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.8 | 2.4 | GO:0036483 | neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.8 | 3.2 | GO:0072134 | nephrogenic mesenchyme morphogenesis(GO:0072134) |
| 0.8 | 0.8 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.8 | 3.2 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.8 | 2.4 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.8 | 2.4 | GO:1901899 | positive regulation of relaxation of cardiac muscle(GO:1901899) |
| 0.8 | 2.4 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.8 | 0.8 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
| 0.8 | 1.6 | GO:0003274 | endocardial cushion fusion(GO:0003274) |
| 0.8 | 0.8 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
| 0.8 | 0.8 | GO:0045763 | negative regulation of cellular amino acid metabolic process(GO:0045763) |
| 0.8 | 23.8 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.8 | 2.3 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.8 | 3.8 | GO:1903936 | cellular response to sodium arsenite(GO:1903936) |
| 0.8 | 2.3 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.8 | 2.3 | GO:1903233 | regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
| 0.8 | 2.3 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.8 | 12.2 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.8 | 9.9 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.8 | 3.0 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.8 | 3.0 | GO:0050925 | negative regulation of negative chemotaxis(GO:0050925) |
| 0.8 | 3.0 | GO:0034343 | detection of virus(GO:0009597) type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.8 | 2.3 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.7 | 14.8 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.7 | 1.5 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
| 0.7 | 1.5 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) nucleotide-sugar catabolic process(GO:0009227) |
| 0.7 | 15.5 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.7 | 7.3 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.7 | 1.5 | GO:0008614 | pyridoxine metabolic process(GO:0008614) pyridoxine biosynthetic process(GO:0008615) vitamin B6 biosynthetic process(GO:0042819) |
| 0.7 | 9.4 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.7 | 10.1 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.7 | 2.9 | GO:0072369 | regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 0.7 | 11.5 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
| 0.7 | 4.3 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.7 | 5.0 | GO:2001171 | positive regulation of ATP biosynthetic process(GO:2001171) |
| 0.7 | 2.9 | GO:0010957 | negative regulation of vitamin D biosynthetic process(GO:0010957) |
| 0.7 | 0.7 | GO:0051941 | regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) |
| 0.7 | 2.9 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.7 | 2.1 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.7 | 2.8 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.7 | 2.8 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.7 | 19.7 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.7 | 3.5 | GO:0015692 | lead ion transport(GO:0015692) copper ion transmembrane transport(GO:0035434) |
| 0.7 | 5.6 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.7 | 3.5 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
| 0.7 | 2.1 | GO:1903947 | positive regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903762) positive regulation of ventricular cardiac muscle cell action potential(GO:1903947) positive regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905026) positive regulation of membrane repolarization during cardiac muscle cell action potential(GO:1905033) |
| 0.7 | 4.9 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.7 | 2.1 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.7 | 2.1 | GO:0021764 | amygdala development(GO:0021764) |
| 0.7 | 2.1 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.7 | 2.1 | GO:0035498 | carnosine metabolic process(GO:0035498) |
| 0.7 | 5.5 | GO:0097052 | L-kynurenine metabolic process(GO:0097052) |
| 0.7 | 4.8 | GO:0090647 | modulation of age-related behavioral decline(GO:0090647) |
| 0.7 | 2.7 | GO:0016333 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.7 | 2.7 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
| 0.7 | 4.8 | GO:0001705 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.7 | 2.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.7 | 10.2 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.7 | 2.7 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
| 0.7 | 8.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.7 | 2.7 | GO:0000436 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
| 0.7 | 3.4 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.7 | 4.7 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.7 | 2.7 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
| 0.7 | 1.3 | GO:0070836 | caveola assembly(GO:0070836) |
| 0.7 | 5.3 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.7 | 2.0 | GO:1901994 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.7 | 2.0 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.7 | 2.0 | GO:0045643 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
| 0.7 | 4.6 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.7 | 1.3 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.7 | 5.3 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.7 | 0.7 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
| 0.7 | 5.9 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.7 | 3.3 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.7 | 2.6 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.7 | 1.3 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.7 | 2.0 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.7 | 0.7 | GO:0010840 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) circadian sleep/wake cycle, wakefulness(GO:0042746) |
| 0.7 | 1.3 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.7 | 7.2 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.6 | 1.3 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.6 | 1.9 | GO:0046108 | uridine metabolic process(GO:0046108) |
| 0.6 | 8.4 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.6 | 1.9 | GO:1904640 | response to methionine(GO:1904640) |
| 0.6 | 3.9 | GO:0032468 | Golgi calcium ion homeostasis(GO:0032468) |
| 0.6 | 1.9 | GO:0000472 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.6 | 7.7 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.6 | 5.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.6 | 1.9 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.6 | 1.9 | GO:1904637 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.6 | 4.5 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.6 | 2.5 | GO:0046184 | aldehyde biosynthetic process(GO:0046184) |
| 0.6 | 3.2 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.6 | 0.6 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.6 | 11.4 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.6 | 23.2 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.6 | 1.9 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.6 | 1.9 | GO:1902728 | positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 0.6 | 1.9 | GO:1900111 | positive regulation of histone H3-K9 dimethylation(GO:1900111) |
| 0.6 | 0.6 | GO:1904732 | regulation of electron carrier activity(GO:1904732) |
| 0.6 | 14.9 | GO:0006972 | hyperosmotic response(GO:0006972) |
| 0.6 | 4.3 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.6 | 2.5 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.6 | 3.7 | GO:0021623 | oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
| 0.6 | 5.5 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.6 | 4.9 | GO:1901631 | positive regulation of presynaptic membrane organization(GO:1901631) positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.6 | 9.2 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.6 | 9.7 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.6 | 2.4 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) |
| 0.6 | 7.2 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.6 | 2.4 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.6 | 4.2 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.6 | 4.2 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.6 | 2.4 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.6 | 1.2 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.6 | 3.0 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.6 | 1.8 | GO:0048687 | modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.6 | 5.9 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
| 0.6 | 1.2 | GO:0099543 | retrograde trans-synaptic signaling by soluble gas(GO:0098923) trans-synaptic signaling by soluble gas(GO:0099543) |
| 0.6 | 11.8 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.6 | 3.0 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.6 | 4.7 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.6 | 1.8 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.6 | 0.6 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.6 | 4.1 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.6 | 0.6 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
| 0.6 | 15.2 | GO:1902624 | positive regulation of neutrophil migration(GO:1902624) |
| 0.6 | 2.9 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.6 | 2.9 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.6 | 3.5 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
| 0.6 | 1.7 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.6 | 6.4 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.6 | 2.9 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.6 | 0.6 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.6 | 1.7 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.6 | 1.7 | GO:1903911 | excitatory chemical synaptic transmission(GO:0098976) positive regulation of receptor clustering(GO:1903911) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.6 | 0.6 | GO:0060327 | cytoplasmic actin-based contraction involved in cell motility(GO:0060327) |
| 0.6 | 6.8 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.6 | 3.4 | GO:0038172 | interleukin-33-mediated signaling pathway(GO:0038172) |
| 0.6 | 1.7 | GO:0019046 | release from viral latency(GO:0019046) |
| 0.6 | 57.8 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.6 | 1.1 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.6 | 6.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.6 | 7.8 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.6 | 1.1 | GO:1901858 | regulation of mitochondrial DNA metabolic process(GO:1901858) |
| 0.6 | 10.0 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.6 | 2.2 | GO:0015783 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.6 | 1.7 | GO:0001188 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.6 | 4.4 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.6 | 2.8 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.6 | 4.4 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
| 0.5 | 1.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.5 | 1.6 | GO:0033082 | regulation of extrathymic T cell differentiation(GO:0033082) sebum secreting cell proliferation(GO:1990654) |
| 0.5 | 1.6 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.5 | 3.3 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
| 0.5 | 11.9 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.5 | 1.6 | GO:0042137 | sequestering of neurotransmitter(GO:0042137) |
| 0.5 | 2.2 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
| 0.5 | 2.7 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.5 | 6.5 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.5 | 0.5 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.5 | 2.7 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.5 | 1.6 | GO:1904528 | positive regulation of microtubule binding(GO:1904528) |
| 0.5 | 0.5 | GO:0061317 | canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:0061317) |
| 0.5 | 3.7 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.5 | 1.6 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.5 | 2.1 | GO:0035750 | protein localization to myelin sheath abaxonal region(GO:0035750) |
| 0.5 | 1.6 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.5 | 1.1 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.5 | 3.7 | GO:0043696 | dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.5 | 1.6 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.5 | 2.6 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.5 | 8.8 | GO:0072619 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 0.5 | 1.5 | GO:0035281 | pre-miRNA export from nucleus(GO:0035281) |
| 0.5 | 1.5 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.5 | 1.0 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
| 0.5 | 3.6 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.5 | 4.6 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.5 | 6.7 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.5 | 0.5 | GO:0034128 | negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.5 | 4.1 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
| 0.5 | 2.5 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.5 | 0.5 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.5 | 1.5 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.5 | 1.5 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.5 | 3.0 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.5 | 8.6 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.5 | 1.5 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.5 | 1.5 | GO:1904692 | positive regulation of type B pancreatic cell proliferation(GO:1904692) |
| 0.5 | 0.5 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.5 | 3.0 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.5 | 1.0 | GO:0061743 | motor learning(GO:0061743) |
| 0.5 | 1.5 | GO:0035048 | splicing factor protein import into nucleus(GO:0035048) |
| 0.5 | 3.5 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.5 | 1.0 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.5 | 0.5 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.5 | 1.0 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.5 | 14.4 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) |
| 0.5 | 3.9 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.5 | 3.9 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.5 | 2.9 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.5 | 1.5 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.5 | 7.9 | GO:1901550 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.5 | 1.0 | GO:2001023 | regulation of response to drug(GO:2001023) |
| 0.5 | 3.9 | GO:0007068 | negative regulation of transcription during mitosis(GO:0007068) negative regulation of transcription from RNA polymerase II promoter during mitosis(GO:0007070) |
| 0.5 | 5.4 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.5 | 2.4 | GO:0030581 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.5 | 6.3 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.5 | 1.9 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.5 | 23.8 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.5 | 0.5 | GO:0014034 | neural crest cell fate commitment(GO:0014034) |
| 0.5 | 2.9 | GO:0046449 | creatinine metabolic process(GO:0046449) |
| 0.5 | 2.9 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.5 | 9.7 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.5 | 3.9 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.5 | 2.9 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.5 | 7.2 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.5 | 1.9 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.5 | 7.1 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.5 | 3.8 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.5 | 2.8 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.5 | 4.2 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.5 | 2.3 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.5 | 3.3 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.5 | 2.8 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
| 0.5 | 6.1 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.5 | 0.9 | GO:1900673 | olefin metabolic process(GO:1900673) |
| 0.5 | 8.4 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.5 | 1.9 | GO:0098957 | anterograde axonal transport of mitochondrion(GO:0098957) |
| 0.5 | 2.3 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 0.5 | 1.4 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
| 0.5 | 3.2 | GO:2000406 | positive regulation of T cell migration(GO:2000406) |
| 0.5 | 1.8 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.5 | 3.7 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) |
| 0.5 | 3.2 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.5 | 4.6 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.5 | 0.5 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.5 | 4.1 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.5 | 3.7 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.5 | 1.8 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.5 | 5.0 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.5 | 1.4 | GO:0035963 | cellular response to interleukin-13(GO:0035963) |
| 0.5 | 3.2 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.5 | 0.5 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.4 | 2.7 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.4 | 4.9 | GO:0034331 | cell junction maintenance(GO:0034331) |
| 0.4 | 3.1 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.4 | 1.3 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.4 | 1.3 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.4 | 2.2 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.4 | 14.5 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.4 | 0.4 | GO:0098971 | anterograde dendritic transport of neurotransmitter receptor complex(GO:0098971) |
| 0.4 | 1.8 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.4 | 1.3 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.4 | 1.3 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.4 | 2.2 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.4 | 3.1 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.4 | 4.8 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.4 | 1.3 | GO:0071393 | cellular response to progesterone stimulus(GO:0071393) |
| 0.4 | 2.2 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
| 0.4 | 1.3 | GO:0070625 | zymogen granule exocytosis(GO:0070625) |
| 0.4 | 11.1 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.4 | 4.3 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.4 | 4.3 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.4 | 1.3 | GO:0018012 | N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.4 | 2.1 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.4 | 3.8 | GO:0034465 | response to carbon monoxide(GO:0034465) |
| 0.4 | 0.4 | GO:1900063 | regulation of peroxisome organization(GO:1900063) |
| 0.4 | 1.3 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.4 | 3.8 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
| 0.4 | 6.7 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.4 | 2.5 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.4 | 0.4 | GO:0046066 | dGDP metabolic process(GO:0046066) |
| 0.4 | 0.8 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
| 0.4 | 1.6 | GO:1900533 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.4 | 1.2 | GO:0016094 | polyprenol biosynthetic process(GO:0016094) |
| 0.4 | 2.5 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.4 | 1.6 | GO:0002278 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
| 0.4 | 1.2 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 0.4 | 0.4 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.4 | 0.4 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
| 0.4 | 1.6 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.4 | 1.2 | GO:0071922 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.4 | 1.6 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.4 | 6.4 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.4 | 2.4 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.4 | 0.8 | GO:0051177 | meiotic sister chromatid cohesion(GO:0051177) |
| 0.4 | 1.2 | GO:0009608 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) positive regulation of fibril organization(GO:1902905) |
| 0.4 | 0.4 | GO:1902661 | positive regulation of glucose mediated signaling pathway(GO:1902661) |
| 0.4 | 6.3 | GO:0006700 | C21-steroid hormone biosynthetic process(GO:0006700) |
| 0.4 | 4.7 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.4 | 2.3 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.4 | 2.0 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.4 | 1.2 | GO:1903413 | cellular response to bile acid(GO:1903413) |
| 0.4 | 3.9 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.4 | 1.6 | GO:2000983 | regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.4 | 2.7 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.4 | 0.8 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.4 | 12.0 | GO:0018146 | keratan sulfate biosynthetic process(GO:0018146) |
| 0.4 | 6.6 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.4 | 3.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.4 | 31.6 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.4 | 2.3 | GO:0060356 | leucine import(GO:0060356) |
| 0.4 | 1.2 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.4 | 2.3 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.4 | 1.5 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.4 | 6.1 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.4 | 6.9 | GO:0010460 | positive regulation of heart rate(GO:0010460) |
| 0.4 | 2.7 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.4 | 0.8 | GO:0071874 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 0.4 | 1.9 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.4 | 1.1 | GO:0099624 | atrial cardiac muscle cell membrane repolarization(GO:0099624) |
| 0.4 | 0.8 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.4 | 1.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.4 | 2.3 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.4 | 3.0 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.4 | 11.7 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.4 | 6.0 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.4 | 1.1 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
| 0.4 | 2.6 | GO:1903859 | regulation of dendrite extension(GO:1903859) |
| 0.4 | 6.0 | GO:0098712 | L-glutamate import across plasma membrane(GO:0098712) |
| 0.4 | 9.0 | GO:0060117 | auditory receptor cell development(GO:0060117) |
| 0.4 | 0.7 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.4 | 1.5 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.4 | 0.7 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.4 | 1.1 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.4 | 1.1 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.4 | 0.4 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.4 | 1.5 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 0.4 | 4.0 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.4 | 0.7 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
| 0.4 | 0.7 | GO:0044752 | response to human chorionic gonadotropin(GO:0044752) |
| 0.4 | 1.5 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.4 | 1.4 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.4 | 0.4 | GO:1902908 | regulation of melanosome transport(GO:1902908) |
| 0.4 | 0.4 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.4 | 1.4 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.4 | 5.7 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.4 | 0.4 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.4 | 2.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.4 | 0.4 | GO:1990834 | response to odorant(GO:1990834) |
| 0.3 | 0.3 | GO:0060715 | syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.3 | 1.7 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.3 | 1.7 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.3 | 1.0 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.3 | 1.0 | GO:1904693 | midbrain morphogenesis(GO:1904693) |
| 0.3 | 2.4 | GO:2000047 | regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
| 0.3 | 1.0 | GO:0006579 | amino-acid betaine catabolic process(GO:0006579) |
| 0.3 | 1.7 | GO:0033183 | negative regulation of histone ubiquitination(GO:0033183) negative regulation of protein K63-linked ubiquitination(GO:1900045) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.3 | 1.0 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
| 0.3 | 0.3 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.3 | 10.3 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
| 0.3 | 3.4 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.3 | 0.7 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.3 | 4.8 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.3 | 2.4 | GO:0035934 | corticosterone secretion(GO:0035934) |
| 0.3 | 0.3 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.3 | 4.4 | GO:0060013 | righting reflex(GO:0060013) |
| 0.3 | 1.4 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.3 | 3.4 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.3 | 1.0 | GO:0050653 | chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.3 | 0.3 | GO:0098917 | retrograde trans-synaptic signaling(GO:0098917) |
| 0.3 | 1.0 | GO:0035803 | egg coat formation(GO:0035803) |
| 0.3 | 2.0 | GO:0034375 | high-density lipoprotein particle remodeling(GO:0034375) |
| 0.3 | 3.7 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.3 | 1.0 | GO:2000836 | androgen secretion(GO:0035935) testosterone secretion(GO:0035936) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) regulation of testosterone secretion(GO:2000843) positive regulation of testosterone secretion(GO:2000845) |
| 0.3 | 0.7 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.3 | 1.3 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
| 0.3 | 0.3 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.3 | 1.0 | GO:0072334 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.3 | 3.3 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.3 | 1.0 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.3 | 15.3 | GO:1901998 | toxin transport(GO:1901998) |
| 0.3 | 6.3 | GO:0035646 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.3 | 7.6 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.3 | 3.6 | GO:1903543 | positive regulation of exosomal secretion(GO:1903543) |
| 0.3 | 2.3 | GO:0086103 | G-protein coupled receptor signaling pathway involved in heart process(GO:0086103) |
| 0.3 | 2.6 | GO:0021854 | hypothalamus development(GO:0021854) |
| 0.3 | 7.2 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.3 | 1.6 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.3 | 0.7 | GO:1902253 | regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902253) |
| 0.3 | 0.7 | GO:0033046 | negative regulation of sister chromatid segregation(GO:0033046) negative regulation of mitotic sister chromatid segregation(GO:0033048) negative regulation of chromosome segregation(GO:0051985) |
| 0.3 | 1.6 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.3 | 1.3 | GO:0032439 | endosome localization(GO:0032439) |
| 0.3 | 0.6 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.3 | 2.6 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.3 | 2.9 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.3 | 3.5 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.3 | 1.0 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.3 | 0.3 | GO:0060405 | regulation of penile erection(GO:0060405) |
| 0.3 | 1.0 | GO:0003050 | regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.3 | 1.0 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.3 | 0.3 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.3 | 6.7 | GO:0031958 | corticosteroid receptor signaling pathway(GO:0031958) |
| 0.3 | 1.0 | GO:1904021 | negative regulation of G-protein coupled receptor internalization(GO:1904021) |
| 0.3 | 3.8 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
| 0.3 | 8.5 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.3 | 2.5 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.3 | 9.4 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.3 | 0.3 | GO:0048627 | myoblast development(GO:0048627) |
| 0.3 | 2.2 | GO:0043103 | hypoxanthine salvage(GO:0043103) |
| 0.3 | 8.7 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.3 | 1.2 | GO:1904569 | regulation of selenocysteine incorporation(GO:1904569) |
| 0.3 | 0.3 | GO:0089718 | amino acid import across plasma membrane(GO:0089718) |
| 0.3 | 1.6 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.3 | 0.6 | GO:0019230 | proprioception(GO:0019230) |
| 0.3 | 2.2 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.3 | 5.6 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
| 0.3 | 1.2 | GO:0035412 | regulation of catenin import into nucleus(GO:0035412) |
| 0.3 | 3.4 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.3 | 1.2 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.3 | 1.8 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.3 | 1.8 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.3 | 0.9 | GO:1902595 | regulation of DNA replication origin binding(GO:1902595) |
| 0.3 | 1.5 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.3 | 0.3 | GO:0072719 | cellular response to cisplatin(GO:0072719) |
| 0.3 | 5.8 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.3 | 0.6 | GO:1902688 | regulation of NAD metabolic process(GO:1902688) |
| 0.3 | 4.5 | GO:1990776 | response to angiotensin(GO:1990776) |
| 0.3 | 0.6 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
| 0.3 | 4.5 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.3 | 3.3 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.3 | 2.1 | GO:0001976 | neurological system process involved in regulation of systemic arterial blood pressure(GO:0001976) |
| 0.3 | 1.2 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.3 | 1.2 | GO:0002249 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.3 | 0.3 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.3 | 0.6 | GO:1901797 | negative regulation of signal transduction by p53 class mediator(GO:1901797) |
| 0.3 | 1.2 | GO:0061358 | negative regulation of Wnt protein secretion(GO:0061358) |
| 0.3 | 3.5 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.3 | 7.3 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.3 | 0.9 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.3 | 2.3 | GO:0034435 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.3 | 0.9 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.3 | 0.6 | GO:2000642 | negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.3 | 15.9 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.3 | 2.6 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.3 | 0.9 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.3 | 0.9 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.3 | 2.8 | GO:0090204 | protein localization to nuclear pore(GO:0090204) |
| 0.3 | 3.7 | GO:0046931 | pore complex assembly(GO:0046931) |
| 0.3 | 0.3 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.3 | 1.1 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.3 | 1.1 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.3 | 1.7 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.3 | 2.2 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.3 | 1.1 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.3 | 0.8 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.3 | 0.6 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.3 | 0.8 | GO:0014810 | positive regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014810) |
| 0.3 | 0.5 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.3 | 0.8 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.3 | 1.4 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.3 | 0.8 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.3 | 0.5 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.3 | 5.7 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.3 | 0.3 | GO:1904220 | regulation of serine C-palmitoyltransferase activity(GO:1904220) |
| 0.3 | 0.8 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.3 | 0.8 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.3 | 1.1 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.3 | 14.1 | GO:0018208 | peptidyl-proline modification(GO:0018208) |
| 0.3 | 4.6 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.3 | 0.5 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.3 | 1.6 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.3 | 1.3 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.3 | 1.1 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.3 | 1.1 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.3 | 4.8 | GO:2001222 | regulation of neuron migration(GO:2001222) |
| 0.3 | 0.3 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.3 | 0.5 | GO:0033029 | neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) |
| 0.3 | 1.6 | GO:0015942 | formate metabolic process(GO:0015942) |
| 0.3 | 4.0 | GO:0019054 | modulation by virus of host process(GO:0019054) |
| 0.3 | 1.6 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.3 | 3.7 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.3 | 0.8 | GO:0003218 | cardiac left ventricle formation(GO:0003218) |
| 0.3 | 1.1 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.3 | 0.8 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
| 0.3 | 0.5 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.3 | 6.0 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.3 | 0.3 | GO:0046833 | positive regulation of RNA export from nucleus(GO:0046833) |
| 0.3 | 1.8 | GO:0046618 | drug export(GO:0046618) |
| 0.3 | 0.3 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
| 0.3 | 0.3 | GO:0060638 | mesenchymal-epithelial cell signaling(GO:0060638) |
| 0.3 | 3.9 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.3 | 4.7 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.3 | 0.8 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.3 | 0.5 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.3 | 2.8 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.3 | 0.8 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.3 | 2.6 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
| 0.3 | 2.8 | GO:0015824 | proline transport(GO:0015824) |
| 0.3 | 1.0 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.3 | 1.3 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
| 0.3 | 0.5 | GO:1901253 | regulation of intracellular transport of viral material(GO:1901252) negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.3 | 0.5 | GO:0043324 | eye pigment biosynthetic process(GO:0006726) eye pigment metabolic process(GO:0042441) pigment metabolic process involved in developmental pigmentation(GO:0043324) pigment metabolic process involved in pigmentation(GO:0043474) |
| 0.3 | 0.5 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.3 | 5.3 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.3 | 1.3 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.3 | 3.0 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.3 | 1.5 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.3 | 1.0 | GO:0042262 | DNA protection(GO:0042262) |
| 0.3 | 6.0 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.3 | 0.3 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.3 | 1.5 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.2 | 4.5 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.2 | 1.0 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.2 | 2.0 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.2 | 5.4 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.2 | 3.9 | GO:0030913 | paranodal junction assembly(GO:0030913) |
| 0.2 | 1.0 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.2 | 3.9 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
| 0.2 | 0.7 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
| 0.2 | 1.5 | GO:0021984 | adenohypophysis development(GO:0021984) |
| 0.2 | 3.6 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.2 | 1.0 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.2 | 0.7 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.2 | 0.2 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.2 | 2.1 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.2 | 1.0 | GO:0090299 | regulation of neural crest formation(GO:0090299) negative regulation of neural crest formation(GO:0090301) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.2 | 2.6 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.2 | 1.2 | GO:0097396 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.2 | 5.9 | GO:0007616 | long-term memory(GO:0007616) |
| 0.2 | 0.5 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) |
| 0.2 | 0.7 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.2 | 0.9 | GO:0033606 | B cell receptor transport within lipid bilayer(GO:0032595) B cell receptor transport into membrane raft(GO:0032597) protein transport out of membrane raft(GO:0032599) chemokine receptor transport out of membrane raft(GO:0032600) negative regulation of transforming growth factor beta3 production(GO:0032913) chemokine receptor transport within lipid bilayer(GO:0033606) |
| 0.2 | 0.2 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.2 | 4.2 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) |
| 0.2 | 0.2 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) determination of liver left/right asymmetry(GO:0071910) |
| 0.2 | 5.6 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.2 | 0.7 | GO:0031120 | snRNA pseudouridine synthesis(GO:0031120) |
| 0.2 | 0.2 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.2 | 3.3 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.2 | 2.8 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.2 | 3.0 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
| 0.2 | 2.6 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
| 0.2 | 1.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.2 | 0.9 | GO:0035986 | senescence-associated heterochromatin focus assembly(GO:0035986) |
| 0.2 | 0.7 | GO:0071344 | diphosphate metabolic process(GO:0071344) |
| 0.2 | 1.8 | GO:0015840 | urea transport(GO:0015840) |
| 0.2 | 0.5 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.2 | 0.5 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.2 | 1.4 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.2 | 0.7 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.2 | 0.9 | GO:0002483 | antigen processing and presentation of endogenous peptide antigen(GO:0002483) |
| 0.2 | 1.4 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.2 | 2.7 | GO:0046885 | regulation of hormone biosynthetic process(GO:0046885) |
| 0.2 | 0.7 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.2 | 1.4 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.2 | 0.9 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.2 | 10.6 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.2 | 4.3 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
| 0.2 | 0.7 | GO:0090382 | phagosome maturation(GO:0090382) |
| 0.2 | 1.3 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.2 | 0.7 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.2 | 1.6 | GO:0048296 | regulation of isotype switching to IgA isotypes(GO:0048296) positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.2 | 0.4 | GO:0007343 | egg activation(GO:0007343) |
| 0.2 | 1.1 | GO:0048311 | mitochondrion distribution(GO:0048311) |
| 0.2 | 3.3 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.2 | 0.9 | GO:1904783 | positive regulation of NMDA glutamate receptor activity(GO:1904783) |
| 0.2 | 0.4 | GO:1904749 | regulation of protein localization to nucleolus(GO:1904749) |
| 0.2 | 1.5 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.2 | 0.7 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.2 | 0.2 | GO:0034442 | regulation of lipoprotein oxidation(GO:0034442) |
| 0.2 | 0.7 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.2 | 1.3 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
| 0.2 | 2.4 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.2 | 1.5 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.2 | 0.6 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.2 | 4.5 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.2 | 1.5 | GO:0002691 | regulation of cellular extravasation(GO:0002691) |
| 0.2 | 3.4 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.2 | 1.7 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.2 | 2.1 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.2 | 1.1 | GO:0030432 | peristalsis(GO:0030432) |
| 0.2 | 0.6 | GO:0010985 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) negative regulation of lipoprotein particle clearance(GO:0010985) |
| 0.2 | 0.6 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.2 | 0.6 | GO:0071962 | mitotic sister chromatid cohesion, centromeric(GO:0071962) |
| 0.2 | 0.8 | GO:0019605 | butyrate metabolic process(GO:0019605) |
| 0.2 | 2.5 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.2 | 1.7 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.2 | 1.9 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.2 | 0.6 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
| 0.2 | 1.7 | GO:0045776 | negative regulation of blood pressure(GO:0045776) |
| 0.2 | 3.1 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.2 | 3.8 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.2 | 0.6 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.2 | 0.4 | GO:1900138 | negative regulation of phospholipase A2 activity(GO:1900138) |
| 0.2 | 0.2 | GO:0019249 | lactate biosynthetic process(GO:0019249) |
| 0.2 | 1.5 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.2 | 0.8 | GO:0006531 | aspartate metabolic process(GO:0006531) |
| 0.2 | 0.8 | GO:0000961 | negative regulation of mitochondrial RNA catabolic process(GO:0000961) |
| 0.2 | 1.6 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.2 | 2.7 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.2 | 1.6 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.2 | 5.5 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.2 | 0.2 | GO:0036245 | cellular response to menadione(GO:0036245) |
| 0.2 | 0.6 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.2 | 1.8 | GO:0006089 | lactate metabolic process(GO:0006089) |
| 0.2 | 1.8 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.2 | 0.6 | GO:0006147 | guanine catabolic process(GO:0006147) |
| 0.2 | 4.2 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.2 | 0.6 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
| 0.2 | 0.8 | GO:0030472 | mitotic spindle organization in nucleus(GO:0030472) |
| 0.2 | 0.6 | GO:0000451 | rRNA 2'-O-methylation(GO:0000451) |
| 0.2 | 0.2 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
| 0.2 | 1.4 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.2 | 1.2 | GO:0045933 | positive regulation of muscle contraction(GO:0045933) |
| 0.2 | 0.2 | GO:0042816 | vitamin B6 metabolic process(GO:0042816) |
| 0.2 | 0.4 | GO:0009212 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) |
| 0.2 | 0.8 | GO:0006559 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.2 | 0.2 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.2 | 0.2 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
| 0.2 | 0.8 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.2 | 1.2 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.2 | 2.3 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.2 | 3.3 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.2 | 1.0 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.2 | 0.8 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.2 | 0.8 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.2 | 2.3 | GO:0097116 | gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.2 | 0.4 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.2 | 7.1 | GO:0035428 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.2 | 0.6 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.2 | 0.4 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.2 | 0.4 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
| 0.2 | 0.6 | GO:0033512 | L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
| 0.2 | 1.5 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.2 | 4.0 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.2 | 1.3 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.2 | 0.8 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.2 | 0.2 | GO:0007494 | midgut development(GO:0007494) |
| 0.2 | 0.4 | GO:1904415 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.2 | 0.9 | GO:0002158 | osteoclast proliferation(GO:0002158) |
| 0.2 | 1.1 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.2 | 0.7 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.2 | 0.4 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.2 | 2.6 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.2 | 21.4 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.2 | 5.0 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.2 | 5.3 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
| 0.2 | 0.6 | GO:2000616 | negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.2 | 2.2 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.2 | 0.2 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.2 | 1.1 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) |
| 0.2 | 0.7 | GO:0002118 | aggressive behavior(GO:0002118) |
| 0.2 | 2.0 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.2 | 0.5 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.2 | 0.2 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.2 | 0.2 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.2 | 0.9 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.2 | 0.7 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
| 0.2 | 0.5 | GO:1904328 | regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
| 0.2 | 12.7 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.2 | 0.4 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.2 | 0.9 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.2 | 1.6 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.2 | 6.5 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.2 | 0.4 | GO:1990927 | calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.2 | 5.9 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.2 | 2.5 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.2 | 0.5 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.2 | 0.7 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.2 | 1.4 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.2 | 2.8 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.2 | 0.5 | GO:1900424 | regulation of defense response to bacterium(GO:1900424) |
| 0.2 | 0.5 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
| 0.2 | 0.3 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.2 | 0.9 | GO:1904685 | positive regulation of metalloendopeptidase activity(GO:1904685) |
| 0.2 | 1.9 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.2 | 1.6 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.2 | 10.4 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
| 0.2 | 0.5 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.2 | 14.3 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
| 0.2 | 0.9 | GO:0044359 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) modification by host of symbiont molecular function(GO:0052428) |
| 0.2 | 0.5 | GO:1903259 | exon-exon junction complex disassembly(GO:1903259) |
| 0.2 | 5.3 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.2 | 1.7 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.2 | 1.4 | GO:0021769 | orbitofrontal cortex development(GO:0021769) |
| 0.2 | 2.6 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.2 | 0.9 | GO:0009804 | coumarin metabolic process(GO:0009804) |
| 0.2 | 0.7 | GO:2000490 | negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.2 | 3.9 | GO:0099514 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.2 | 0.5 | GO:0072014 | proximal tubule development(GO:0072014) |
| 0.2 | 0.3 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.2 | 0.3 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
| 0.2 | 7.4 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.2 | 0.7 | GO:0010523 | negative regulation of calcium ion transport into cytosol(GO:0010523) |
| 0.2 | 3.7 | GO:0035666 | TRIF-dependent toll-like receptor signaling pathway(GO:0035666) |
| 0.2 | 0.3 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.2 | 0.7 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
| 0.2 | 0.2 | GO:0061551 | trigeminal ganglion development(GO:0061551) |
| 0.2 | 1.3 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.2 | 0.7 | GO:0071435 | potassium ion export(GO:0071435) |
| 0.2 | 0.5 | GO:0007309 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) P granule organization(GO:0030719) |
| 0.2 | 0.3 | GO:0030974 | thiamine pyrophosphate transport(GO:0030974) |
| 0.2 | 15.6 | GO:0034340 | response to type I interferon(GO:0034340) |
| 0.2 | 0.7 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.2 | 0.6 | GO:2000543 | positive regulation of gastrulation(GO:2000543) |
| 0.2 | 4.8 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.2 | 0.5 | GO:0031577 | spindle checkpoint(GO:0031577) |
| 0.2 | 1.0 | GO:0045188 | regulation of circadian sleep/wake cycle, non-REM sleep(GO:0045188) |
| 0.2 | 0.2 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.2 | 1.6 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.2 | 2.5 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.2 | 1.1 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.2 | 0.6 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
| 0.2 | 0.3 | GO:0031427 | response to methotrexate(GO:0031427) |
| 0.2 | 8.1 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.2 | 0.3 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.2 | 1.3 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.2 | 0.6 | GO:0009822 | alkaloid catabolic process(GO:0009822) |
| 0.2 | 2.8 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.2 | 1.4 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.2 | 0.9 | GO:1902731 | negative regulation of chondrocyte proliferation(GO:1902731) |
| 0.2 | 0.2 | GO:0019401 | glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
| 0.2 | 1.1 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.2 | 0.2 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.2 | 21.9 | GO:0038096 | immune response-regulating cell surface receptor signaling pathway involved in phagocytosis(GO:0002433) Fc-gamma receptor signaling pathway involved in phagocytosis(GO:0038096) |
| 0.2 | 0.6 | GO:0016556 | mRNA modification(GO:0016556) |
| 0.2 | 0.8 | GO:0044144 | modulation of growth of symbiont involved in interaction with host(GO:0044144) |
| 0.2 | 1.2 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.2 | 1.1 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.2 | 0.6 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.2 | 0.6 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.2 | 0.3 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.1 | 1.0 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 | 3.6 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.1 | 0.6 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
| 0.1 | 0.9 | GO:0036499 | PERK-mediated unfolded protein response(GO:0036499) |
| 0.1 | 2.9 | GO:0045589 | regulatory T cell differentiation(GO:0045066) regulation of regulatory T cell differentiation(GO:0045589) |
| 0.1 | 7.7 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
| 0.1 | 0.3 | GO:0032928 | regulation of superoxide anion generation(GO:0032928) |
| 0.1 | 2.0 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.1 | 0.6 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 | 1.2 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.1 | 0.6 | GO:0014859 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.1 | 0.4 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 0.1 | 0.4 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.1 | 0.1 | GO:1902232 | regulation of positive thymic T cell selection(GO:1902232) |
| 0.1 | 0.4 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.1 | 0.6 | GO:1902544 | regulation of DNA N-glycosylase activity(GO:1902544) |
| 0.1 | 1.1 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.1 | 0.7 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.1 | 1.7 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.1 | 1.5 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 2.4 | GO:0042255 | ribosome assembly(GO:0042255) |
| 0.1 | 0.4 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 0.1 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.1 | 1.5 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 | 4.4 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.1 | 1.0 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 0.1 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.1 | 0.5 | GO:1901318 | negative regulation of sperm motility(GO:1901318) |
| 0.1 | 0.8 | GO:0001832 | blastocyst growth(GO:0001832) inner cell mass cell proliferation(GO:0001833) |
| 0.1 | 1.9 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.1 | 1.2 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.1 | 5.4 | GO:0019835 | cytolysis(GO:0019835) |
| 0.1 | 0.4 | GO:0039019 | pronephric nephron development(GO:0039019) |
| 0.1 | 0.1 | GO:0000706 | meiotic DNA double-strand break processing(GO:0000706) |
| 0.1 | 0.7 | GO:0060482 | lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
| 0.1 | 0.3 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 | 0.5 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 0.1 | 0.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.5 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 | 1.1 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.1 | 0.4 | GO:1903795 | regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.1 | 0.4 | GO:0022007 | neural plate morphogenesis(GO:0001839) neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.1 | 0.3 | GO:0031268 | pseudopodium organization(GO:0031268) |
| 0.1 | 1.3 | GO:0097300 | programmed necrotic cell death(GO:0097300) |
| 0.1 | 0.3 | GO:0035565 | regulation of pronephros size(GO:0035565) pronephros morphogenesis(GO:0072114) |
| 0.1 | 0.1 | GO:0007028 | cytoplasm organization(GO:0007028) |
| 0.1 | 0.3 | GO:0034402 | recruitment of 3'-end processing factors to RNA polymerase II holoenzyme complex(GO:0034402) |
| 0.1 | 1.7 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
| 0.1 | 3.2 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.1 | 0.3 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 | 1.7 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
| 0.1 | 3.0 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.1 | 0.6 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.1 | 0.5 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.1 | 1.0 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.1 | 0.9 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
| 0.1 | 0.2 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.1 | 0.6 | GO:0050802 | circadian sleep/wake cycle, sleep(GO:0050802) |
| 0.1 | 0.2 | GO:0003321 | positive regulation of blood pressure by epinephrine-norepinephrine(GO:0003321) |
| 0.1 | 0.2 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.1 | 0.2 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.1 | 0.6 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.1 | 0.4 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.1 | 1.1 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
| 0.1 | 0.2 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.1 | 0.1 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 0.1 | 0.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 | 1.0 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.1 | 0.4 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
| 0.1 | 0.2 | GO:0071104 | response to interleukin-9(GO:0071104) |
| 0.1 | 1.3 | GO:0061436 | regulation of water loss via skin(GO:0033561) establishment of skin barrier(GO:0061436) |
| 0.1 | 0.1 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
| 0.1 | 0.4 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.1 | 0.6 | GO:0015862 | uridine transport(GO:0015862) |
| 0.1 | 1.6 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.1 | 0.4 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.1 | 0.6 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 0.4 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.1 | 0.9 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.1 | 0.3 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
| 0.1 | 0.3 | GO:0042335 | cuticle development(GO:0042335) |
| 0.1 | 6.7 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.1 | 0.6 | GO:0071635 | negative regulation of transforming growth factor beta production(GO:0071635) |
| 0.1 | 0.7 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.1 | 0.8 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.1 | 0.3 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.1 | 0.2 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
| 0.1 | 0.1 | GO:0050755 | chemokine metabolic process(GO:0050755) |
| 0.1 | 0.1 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.1 | 1.8 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.1 | 1.0 | GO:1903580 | positive regulation of nucleoside metabolic process(GO:0045979) positive regulation of ATP metabolic process(GO:1903580) |
| 0.1 | 0.5 | GO:0010224 | response to UV-B(GO:0010224) |
| 0.1 | 0.3 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.1 | 0.1 | GO:0021831 | embryonic olfactory bulb interneuron precursor migration(GO:0021831) |
| 0.1 | 4.9 | GO:2000649 | regulation of sodium ion transmembrane transporter activity(GO:2000649) |
| 0.1 | 0.9 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 | 0.2 | GO:0002583 | regulation of antigen processing and presentation of peptide antigen(GO:0002583) |
| 0.1 | 0.1 | GO:1902524 | positive regulation of protein K48-linked ubiquitination(GO:1902524) |
| 0.1 | 1.0 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 | 11.5 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.3 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.1 | 2.2 | GO:0090129 | regulation of synapse maturation(GO:0090128) positive regulation of synapse maturation(GO:0090129) |
| 0.1 | 0.1 | GO:1903430 | negative regulation of cell maturation(GO:1903430) |
| 0.1 | 0.2 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.1 | 0.6 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.1 | 1.5 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.1 | 4.6 | GO:0032435 | negative regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032435) |
| 0.1 | 0.5 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.1 | 1.1 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.1 | 0.7 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.1 | 0.6 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.1 | 0.3 | GO:0014813 | skeletal muscle satellite cell commitment(GO:0014813) |
| 0.1 | 1.9 | GO:1903206 | negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
| 0.1 | 0.2 | GO:0099639 | neurotransmitter receptor transport, endosome to plasma membrane(GO:0099639) |
| 0.1 | 1.7 | GO:0072661 | protein targeting to plasma membrane(GO:0072661) |
| 0.1 | 0.1 | GO:1900155 | regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.1 | 0.6 | GO:0009134 | nucleoside diphosphate catabolic process(GO:0009134) |
| 0.1 | 4.5 | GO:1905037 | autophagosome organization(GO:1905037) |
| 0.1 | 0.4 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.1 | 0.2 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.1 | 0.4 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.1 | 1.0 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 | 0.2 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.1 | 3.7 | GO:0021762 | substantia nigra development(GO:0021762) |
| 0.1 | 0.2 | GO:0031077 | post-embryonic camera-type eye development(GO:0031077) |
| 0.1 | 0.1 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 0.1 | 5.6 | GO:0051058 | negative regulation of Ras protein signal transduction(GO:0046580) negative regulation of small GTPase mediated signal transduction(GO:0051058) |
| 0.1 | 0.1 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.1 | 1.7 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
| 0.1 | 0.5 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.1 | 0.6 | GO:1901970 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.1 | 0.4 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.1 | 2.4 | GO:0000768 | syncytium formation by plasma membrane fusion(GO:0000768) |
| 0.1 | 0.9 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.1 | 0.1 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
| 0.1 | 0.6 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.1 | 2.8 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.1 | 0.4 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.1 | 0.9 | GO:0048665 | neuron fate specification(GO:0048665) |
| 0.1 | 0.5 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
| 0.1 | 0.1 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.1 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.1 | 0.3 | GO:0034184 | regulation of maintenance of sister chromatid cohesion(GO:0034091) positive regulation of maintenance of sister chromatid cohesion(GO:0034093) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.1 | 0.1 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.1 | 0.2 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.1 | 0.4 | GO:1902412 | regulation of mitotic cytokinesis(GO:1902412) |
| 0.1 | 3.0 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.1 | 0.1 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
| 0.1 | 2.9 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) |
| 0.1 | 0.5 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.1 | 0.1 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
| 0.1 | 1.1 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.1 | 0.2 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.1 | 0.3 | GO:1904588 | cellular response to glycoprotein(GO:1904588) cellular response to thyrotropin-releasing hormone(GO:1905229) |
| 0.1 | 0.1 | GO:0035933 | glucocorticoid secretion(GO:0035933) |
| 0.1 | 0.1 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) |
| 0.1 | 0.2 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.1 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.1 | 4.1 | GO:0033275 | muscle filament sliding(GO:0030049) actin-myosin filament sliding(GO:0033275) |
| 0.1 | 0.2 | GO:0036035 | osteoclast development(GO:0036035) |
| 0.1 | 0.2 | GO:0032196 | transposition(GO:0032196) |
| 0.1 | 5.6 | GO:0071427 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
| 0.1 | 0.5 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.1 | 1.4 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.1 | 0.2 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 0.3 | GO:0086021 | SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
| 0.1 | 0.3 | GO:0070170 | regulation of tooth mineralization(GO:0070170) |
| 0.1 | 0.7 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.1 | 0.3 | GO:0016559 | peroxisome fission(GO:0016559) |
| 0.1 | 0.8 | GO:0014808 | release of sequestered calcium ion into cytosol by sarcoplasmic reticulum(GO:0014808) calcium ion transport from endoplasmic reticulum to cytosol(GO:1903514) |
| 0.1 | 0.1 | GO:0032621 | interleukin-18 production(GO:0032621) regulation of interleukin-18 production(GO:0032661) |
| 0.1 | 0.6 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.1 | 1.0 | GO:0006360 | transcription from RNA polymerase I promoter(GO:0006360) |
| 0.1 | 29.3 | GO:0008380 | RNA splicing(GO:0008380) |
| 0.1 | 0.7 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.1 | 0.1 | GO:0002717 | positive regulation of natural killer cell mediated immunity(GO:0002717) |
| 0.1 | 0.2 | GO:0035437 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.1 | 0.5 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
| 0.1 | 0.1 | GO:0032425 | positive regulation of mismatch repair(GO:0032425) |
| 0.1 | 0.6 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.1 | 0.1 | GO:0019883 | antigen processing and presentation of endogenous antigen(GO:0019883) |
| 0.1 | 0.1 | GO:0043366 | beta selection(GO:0043366) |
| 0.1 | 7.0 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.1 | 0.2 | GO:1902283 | negative regulation of primary amine oxidase activity(GO:1902283) |
| 0.1 | 0.4 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.1 | 0.2 | GO:0002922 | positive regulation of humoral immune response(GO:0002922) |
| 0.1 | 1.0 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 2.4 | GO:0008625 | extrinsic apoptotic signaling pathway via death domain receptors(GO:0008625) |
| 0.1 | 1.0 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 1.0 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.1 | 0.2 | GO:1990180 | mitochondrial tRNA processing(GO:0090646) mitochondrial tRNA 3'-end processing(GO:1990180) |
| 0.1 | 0.1 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.1 | 0.5 | GO:0007207 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.1 | 3.3 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.1 | 0.1 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
| 0.1 | 0.1 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.1 | 0.1 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.1 | 0.3 | GO:0071231 | cellular response to folic acid(GO:0071231) |
| 0.1 | 0.1 | GO:0015864 | pyrimidine nucleoside transport(GO:0015864) |
| 0.1 | 0.5 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) |
| 0.1 | 0.7 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.1 | 0.6 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.1 | 0.3 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.1 | 0.2 | GO:0071109 | superior temporal gyrus development(GO:0071109) |
| 0.1 | 0.1 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.1 | 0.6 | GO:0015816 | glycine transport(GO:0015816) |
| 0.1 | 1.0 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.1 | 0.7 | GO:1905145 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.1 | 0.3 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.1 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.1 | 0.1 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.1 | 1.3 | GO:0045123 | cellular extravasation(GO:0045123) |
| 0.1 | 0.1 | GO:0055064 | cellular chloride ion homeostasis(GO:0030644) chloride ion homeostasis(GO:0055064) |
| 0.1 | 0.2 | GO:0033037 | polysaccharide localization(GO:0033037) |
| 0.1 | 0.1 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.1 | 1.0 | GO:0097034 | mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.1 | 1.0 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.1 | 0.2 | GO:0060926 | cardiac pacemaker cell development(GO:0060926) |
| 0.1 | 0.2 | GO:0002765 | immune response-inhibiting signal transduction(GO:0002765) |
| 0.1 | 0.3 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.1 | 1.0 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.1 | 0.1 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.1 | 1.6 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 0.1 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 0.3 | GO:0070861 | regulation of protein exit from endoplasmic reticulum(GO:0070861) |
| 0.1 | 1.3 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.1 | 0.1 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.1 | 0.1 | GO:0002029 | desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) |
| 0.1 | 0.8 | GO:0098828 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.1 | 4.4 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.1 | 0.3 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 0.1 | 0.6 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.1 | 0.5 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
| 0.1 | 0.3 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 0.1 | 0.1 | GO:0046110 | xanthine metabolic process(GO:0046110) |
| 0.1 | 0.3 | GO:0072093 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
| 0.1 | 0.6 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.1 | 0.2 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.1 | 0.6 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.1 | 0.3 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 | 0.3 | GO:0006568 | tryptophan metabolic process(GO:0006568) |
| 0.1 | 0.2 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.1 | 0.2 | GO:0034969 | histone arginine methylation(GO:0034969) |
| 0.1 | 0.5 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 0.3 | GO:1904816 | regulation of protein localization to chromosome, telomeric region(GO:1904814) positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.1 | 0.1 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.1 | 0.3 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.1 | 0.3 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.1 | 0.7 | GO:0033622 | integrin activation(GO:0033622) |
| 0.1 | 4.4 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
| 0.1 | 0.2 | GO:0006500 | N-terminal protein palmitoylation(GO:0006500) |
| 0.1 | 0.5 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.1 | 0.1 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
| 0.1 | 0.8 | GO:0019433 | triglyceride catabolic process(GO:0019433) |
| 0.1 | 0.1 | GO:0043589 | skin morphogenesis(GO:0043589) |
| 0.0 | 2.0 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.8 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 1.5 | GO:0030199 | collagen fibril organization(GO:0030199) |
| 0.0 | 0.2 | GO:0016098 | monoterpenoid metabolic process(GO:0016098) |
| 0.0 | 0.2 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.0 | 0.1 | GO:1901053 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.0 | 0.1 | GO:0008272 | sulfate transport(GO:0008272) |
| 0.0 | 1.1 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.0 | 1.0 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.0 | 0.0 | GO:0043396 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) |
| 0.0 | 0.2 | GO:0071025 | RNA surveillance(GO:0071025) |
| 0.0 | 2.8 | GO:1901184 | regulation of ERBB signaling pathway(GO:1901184) |
| 0.0 | 0.0 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.0 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.0 | 1.4 | GO:0042267 | natural killer cell mediated cytotoxicity(GO:0042267) |
| 0.0 | 0.0 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
| 0.0 | 0.3 | GO:0034656 | nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.0 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.0 | 0.4 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
| 0.0 | 0.0 | GO:1903015 | regulation of exo-alpha-sialidase activity(GO:1903015) |
| 0.0 | 0.2 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
| 0.0 | 0.1 | GO:0042161 | lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
| 0.0 | 0.1 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 2.7 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.0 | 0.4 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.0 | 0.6 | GO:0006040 | amino sugar metabolic process(GO:0006040) |
| 0.0 | 0.0 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.0 | 0.1 | GO:1903010 | regulation of bone development(GO:1903010) |
| 0.0 | 0.1 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.0 | 0.0 | GO:0060061 | collateral sprouting in absence of injury(GO:0048669) Spemann organizer formation(GO:0060061) |
| 0.0 | 0.4 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.0 | GO:0051586 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.0 | 0.1 | GO:0002933 | lipid hydroxylation(GO:0002933) |
| 0.0 | 0.6 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.0 | 0.2 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.0 | 0.3 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.0 | 0.0 | GO:0051792 | medium-chain fatty acid biosynthetic process(GO:0051792) |
| 0.0 | 0.5 | GO:0001960 | negative regulation of cytokine-mediated signaling pathway(GO:0001960) |
| 0.0 | 0.1 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.0 | 0.9 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.0 | 0.1 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.0 | 0.2 | GO:0031017 | exocrine pancreas development(GO:0031017) |
| 0.0 | 0.1 | GO:0052651 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.0 | 0.4 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.0 | 0.1 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.0 | 0.5 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.0 | 0.9 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.0 | 0.4 | GO:0048596 | embryonic camera-type eye morphogenesis(GO:0048596) |
| 0.0 | 0.0 | GO:0072387 | flavin adenine dinucleotide metabolic process(GO:0072387) |
| 0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 1.9 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.0 | 0.1 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.0 | 0.1 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.0 | 0.2 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.5 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.1 | GO:0055075 | potassium ion homeostasis(GO:0055075) |
| 0.0 | 0.1 | GO:2001225 | regulation of chloride transport(GO:2001225) |
| 0.0 | 0.1 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.0 | 0.2 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.0 | 0.1 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.0 | 0.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
| 0.0 | 0.2 | GO:0090151 | establishment of protein localization to mitochondrial membrane(GO:0090151) |
| 0.0 | 0.0 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.0 | 0.2 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.1 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
| 0.0 | 0.1 | GO:0001969 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) negative regulation of activation of membrane attack complex(GO:0001971) |
| 0.0 | 0.8 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
| 0.0 | 0.1 | GO:0003417 | growth plate cartilage development(GO:0003417) |
| 0.0 | 0.1 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.0 | 0.0 | GO:1904383 | response to sodium phosphate(GO:1904383) |
| 0.0 | 0.1 | GO:0097475 | motor neuron migration(GO:0097475) |
| 0.0 | 0.1 | GO:0032740 | positive regulation of interleukin-17 production(GO:0032740) |
| 0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.1 | GO:0048749 | compound eye development(GO:0048749) |
| 0.0 | 0.2 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.0 | 0.1 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.4 | GO:0030317 | sperm motility(GO:0030317) |
| 0.0 | 0.0 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.0 | 0.5 | GO:0035825 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 | 0.2 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 | 0.1 | GO:0061709 | reticulophagy(GO:0061709) |
| 0.0 | 0.8 | GO:0050913 | sensory perception of bitter taste(GO:0050913) |
| 0.0 | 0.4 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.0 | 0.0 | GO:0005997 | xylulose metabolic process(GO:0005997) |
| 0.0 | 0.1 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
| 0.0 | 0.1 | GO:0070352 | positive regulation of white fat cell proliferation(GO:0070352) |
| 0.0 | 0.1 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.0 | GO:0002759 | regulation of antimicrobial humoral response(GO:0002759) |
| 0.0 | 0.1 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.0 | 0.1 | GO:0043584 | nose development(GO:0043584) |
| 0.0 | 0.2 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.0 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.2 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 0.0 | GO:0043455 | regulation of secondary metabolic process(GO:0043455) |
| 0.0 | 0.0 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.0 | 0.0 | GO:0036414 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.0 | 0.0 | GO:0021554 | optic nerve development(GO:0021554) |
| 0.0 | 0.1 | GO:0009253 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.0 | 0.1 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 0.0 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.0 | 0.3 | GO:0018345 | protein palmitoylation(GO:0018345) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 5.4 | 16.2 | GO:0035525 | NF-kappaB p50/p65 complex(GO:0035525) |
| 4.1 | 16.4 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 4.1 | 16.3 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 3.6 | 10.7 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 2.9 | 23.5 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 2.8 | 19.3 | GO:0042825 | TAP complex(GO:0042825) |
| 2.6 | 10.5 | GO:0035517 | PR-DUB complex(GO:0035517) |
| 2.5 | 2.5 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 2.5 | 9.9 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 2.4 | 7.2 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
| 2.4 | 21.2 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 2.2 | 13.3 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 2.2 | 10.9 | GO:0045160 | myosin I complex(GO:0045160) |
| 2.1 | 8.5 | GO:0097229 | sperm end piece(GO:0097229) |
| 2.0 | 8.0 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 2.0 | 9.8 | GO:0045293 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 1.6 | 12.9 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 1.6 | 4.8 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) proton-transporting ATP synthase complex(GO:0045259) |
| 1.6 | 1.6 | GO:0005889 | hydrogen:potassium-exchanging ATPase complex(GO:0005889) |
| 1.5 | 7.4 | GO:0031523 | Myb complex(GO:0031523) |
| 1.4 | 22.3 | GO:0005642 | annulate lamellae(GO:0005642) |
| 1.4 | 4.2 | GO:0008623 | CHRAC(GO:0008623) |
| 1.4 | 4.1 | GO:0060987 | lipid tube(GO:0060987) |
| 1.3 | 1.3 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 1.3 | 8.0 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 1.3 | 5.2 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 1.2 | 13.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 1.1 | 8.0 | GO:0071797 | LUBAC complex(GO:0071797) |
| 1.1 | 2.3 | GO:0070695 | FHF complex(GO:0070695) |
| 1.1 | 22.0 | GO:0005861 | troponin complex(GO:0005861) |
| 1.1 | 3.3 | GO:0030689 | Noc complex(GO:0030689) |
| 1.1 | 6.5 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 1.1 | 10.6 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 1.1 | 3.2 | GO:0016938 | kinesin I complex(GO:0016938) |
| 1.0 | 5.2 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 1.0 | 4.1 | GO:0030895 | apolipoprotein B mRNA editing enzyme complex(GO:0030895) |
| 1.0 | 6.2 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 1.0 | 3.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 1.0 | 17.4 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 1.0 | 3.0 | GO:0071065 | alpha9-beta1 integrin-vascular cell adhesion molecule-1 complex(GO:0071065) |
| 1.0 | 1.0 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
| 1.0 | 9.6 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 1.0 | 5.7 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.9 | 15.1 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.9 | 4.7 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.9 | 1.8 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.9 | 2.7 | GO:0044753 | amphisome(GO:0044753) |
| 0.9 | 8.7 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.9 | 13.0 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.9 | 7.8 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.9 | 3.4 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.9 | 0.9 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.9 | 9.4 | GO:0005638 | lamin filament(GO:0005638) |
| 0.8 | 13.5 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.8 | 0.8 | GO:0042565 | RNA nuclear export complex(GO:0042565) |
| 0.8 | 6.6 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.8 | 9.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.8 | 4.8 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.8 | 17.7 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.8 | 0.8 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.8 | 13.4 | GO:0032059 | bleb(GO:0032059) |
| 0.8 | 9.5 | GO:0070449 | elongin complex(GO:0070449) |
| 0.7 | 4.5 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.7 | 3.7 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.7 | 7.4 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.7 | 0.7 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.7 | 11.8 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.7 | 3.6 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.7 | 4.2 | GO:1990393 | 3M complex(GO:1990393) |
| 0.7 | 3.5 | GO:0070826 | paraferritin complex(GO:0070826) |
| 0.7 | 2.1 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.7 | 2.7 | GO:1990879 | CST complex(GO:1990879) |
| 0.7 | 3.4 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.7 | 6.0 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 0.7 | 6.0 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.7 | 2.0 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.7 | 2.0 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
| 0.6 | 3.9 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.6 | 5.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.6 | 6.9 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.6 | 5.0 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.6 | 2.5 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.6 | 5.6 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.6 | 1.2 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
| 0.6 | 3.7 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.6 | 3.1 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.6 | 2.5 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.6 | 2.5 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.6 | 8.6 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.6 | 3.0 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.6 | 2.4 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.6 | 0.6 | GO:0036502 | Derlin-1-VIMP complex(GO:0036502) |
| 0.6 | 3.0 | GO:0071942 | XPC complex(GO:0071942) |
| 0.6 | 3.0 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.6 | 6.6 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.6 | 3.0 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.6 | 4.1 | GO:0089701 | U2AF(GO:0089701) |
| 0.6 | 12.2 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.6 | 2.9 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.6 | 1.7 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.6 | 1.7 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.6 | 2.3 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.6 | 6.2 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.6 | 5.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.6 | 1.7 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.5 | 7.6 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.5 | 1.6 | GO:0030936 | collagen type XIII trimer(GO:0005600) transmembrane collagen trimer(GO:0030936) |
| 0.5 | 16.7 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.5 | 1.1 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.5 | 3.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.5 | 5.3 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.5 | 3.7 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.5 | 3.7 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.5 | 1.0 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.5 | 1.6 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.5 | 3.6 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.5 | 27.9 | GO:0030673 | axolemma(GO:0030673) |
| 0.5 | 3.1 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.5 | 1.5 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.5 | 13.1 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.5 | 2.0 | GO:1990742 | microvesicle(GO:1990742) |
| 0.5 | 3.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.5 | 1.5 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.5 | 3.0 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.5 | 2.0 | GO:1990578 | perinuclear endoplasmic reticulum membrane(GO:1990578) |
| 0.5 | 3.4 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.5 | 1.0 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.5 | 16.9 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.5 | 2.4 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.5 | 3.4 | GO:0032021 | NELF complex(GO:0032021) |
| 0.5 | 2.9 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.5 | 0.9 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.5 | 5.7 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.5 | 26.7 | GO:0002102 | podosome(GO:0002102) |
| 0.5 | 5.6 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.5 | 1.4 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.5 | 2.8 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.5 | 12.5 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.5 | 0.9 | GO:1903349 | extrinsic component of omegasome membrane(GO:0097629) omegasome membrane(GO:1903349) |
| 0.5 | 7.8 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.5 | 2.3 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.5 | 3.6 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.5 | 2.3 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.4 | 3.6 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.4 | 1.8 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.4 | 1.3 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.4 | 12.3 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.4 | 6.1 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.4 | 0.9 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.4 | 1.7 | GO:0044308 | axonal spine(GO:0044308) |
| 0.4 | 1.3 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.4 | 6.8 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.4 | 0.8 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.4 | 1.7 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.4 | 10.1 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.4 | 1.3 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.4 | 2.9 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.4 | 1.7 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.4 | 6.6 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.4 | 2.5 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.4 | 1.6 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.4 | 1.6 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.4 | 2.8 | GO:0072589 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.4 | 3.2 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.4 | 0.4 | GO:0030849 | autosome(GO:0030849) |
| 0.4 | 1.2 | GO:0043256 | laminin complex(GO:0043256) |
| 0.4 | 2.8 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.4 | 2.0 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.4 | 6.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.4 | 27.1 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.4 | 2.7 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.4 | 1.6 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.4 | 9.3 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.4 | 3.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.4 | 1.1 | GO:0033597 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.4 | 5.3 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.4 | 3.0 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.4 | 4.4 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.4 | 2.6 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.4 | 2.2 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.4 | 1.5 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.4 | 2.6 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.4 | 36.6 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.4 | 1.4 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.4 | 3.2 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.4 | 4.3 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.4 | 1.8 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.3 | 23.2 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.3 | 3.8 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.3 | 4.8 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.3 | 1.4 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.3 | 4.4 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.3 | 23.4 | GO:0098573 | intrinsic component of mitochondrial membrane(GO:0098573) |
| 0.3 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
| 0.3 | 3.0 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.3 | 4.0 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.3 | 3.3 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.3 | 4.3 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.3 | 1.0 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.3 | 0.6 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.3 | 7.5 | GO:0036038 | MKS complex(GO:0036038) |
| 0.3 | 8.4 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.3 | 2.3 | GO:0031045 | dense core granule(GO:0031045) |
| 0.3 | 1.6 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.3 | 1.0 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
| 0.3 | 6.7 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.3 | 1.0 | GO:0070701 | mucus layer(GO:0070701) |
| 0.3 | 4.1 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.3 | 1.6 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.3 | 3.1 | GO:0070187 | telosome(GO:0070187) |
| 0.3 | 3.7 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.3 | 6.8 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.3 | 1.5 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.3 | 1.8 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.3 | 2.7 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.3 | 1.5 | GO:0035363 | histone locus body(GO:0035363) |
| 0.3 | 3.0 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.3 | 3.3 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.3 | 0.9 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.3 | 14.7 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.3 | 4.2 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.3 | 8.1 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.3 | 3.6 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.3 | 2.1 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
| 0.3 | 0.9 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.3 | 1.2 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.3 | 1.2 | GO:0097413 | Lewy body(GO:0097413) |
| 0.3 | 0.9 | GO:0001534 | radial spoke(GO:0001534) |
| 0.3 | 2.9 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.3 | 6.6 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.3 | 3.4 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.3 | 4.0 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.3 | 1.7 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.3 | 1.1 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.3 | 1.4 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.3 | 2.8 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.3 | 0.6 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 0.3 | 21.0 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.3 | 3.9 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.3 | 3.1 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.3 | 5.3 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.3 | 0.8 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.3 | 35.6 | GO:0035578 | azurophil granule lumen(GO:0035578) |
| 0.3 | 1.6 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.3 | 2.5 | GO:0034709 | methylosome(GO:0034709) |
| 0.3 | 8.4 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.3 | 1.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.3 | 1.6 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.3 | 2.2 | GO:0042627 | chylomicron(GO:0042627) |
| 0.3 | 8.9 | GO:1990752 | microtubule end(GO:1990752) |
| 0.3 | 2.7 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.3 | 0.5 | GO:0060187 | cell pole(GO:0060187) |
| 0.3 | 1.3 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.3 | 0.5 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.3 | 24.0 | GO:0032432 | actin filament bundle(GO:0032432) |
| 0.3 | 1.3 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.3 | 0.3 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.3 | 14.1 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.3 | 1.0 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.3 | 10.1 | GO:0000791 | euchromatin(GO:0000791) |
| 0.3 | 0.8 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.3 | 2.3 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.3 | 3.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.3 | 8.9 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.3 | 1.5 | GO:0060171 | stereocilium membrane(GO:0060171) |
| 0.2 | 3.7 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.2 | 6.2 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.2 | 1.5 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.2 | 8.4 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.2 | 12.0 | GO:0043657 | host(GO:0018995) host cell(GO:0043657) |
| 0.2 | 2.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.2 | 0.7 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.2 | 2.6 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.2 | 9.8 | GO:0097610 | cell division site(GO:0032153) cleavage furrow(GO:0032154) cell division site part(GO:0032155) cell surface furrow(GO:0097610) |
| 0.2 | 3.3 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.2 | 0.7 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.2 | 3.1 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.2 | 0.7 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.2 | 2.4 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.2 | 1.9 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.2 | 1.9 | GO:0000235 | astral microtubule(GO:0000235) aster(GO:0005818) |
| 0.2 | 18.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.2 | 12.9 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.2 | 2.8 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.2 | 1.9 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.2 | 0.2 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.2 | 0.7 | GO:0019031 | viral envelope(GO:0019031) viral membrane(GO:0036338) |
| 0.2 | 12.5 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.2 | 2.3 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.2 | 26.3 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.2 | 6.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.2 | 2.5 | GO:0032797 | SMN complex(GO:0032797) |
| 0.2 | 5.9 | GO:0005605 | basal lamina(GO:0005605) |
| 0.2 | 1.8 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.2 | 0.2 | GO:0034665 | integrin alpha1-beta1 complex(GO:0034665) |
| 0.2 | 0.7 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.2 | 1.8 | GO:0031415 | NatA complex(GO:0031415) |
| 0.2 | 5.2 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.2 | 0.4 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.2 | 2.2 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 2.8 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.2 | 2.6 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.2 | 1.3 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.2 | 1.5 | GO:0000801 | central element(GO:0000801) |
| 0.2 | 0.8 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.2 | 1.2 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.2 | 1.0 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.2 | 1.0 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.2 | 0.8 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.2 | 5.3 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.2 | 2.0 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.2 | 1.6 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.2 | 2.0 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.2 | 1.9 | GO:0001741 | XY body(GO:0001741) |
| 0.2 | 6.6 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.2 | 1.9 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.2 | 3.3 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.2 | 37.9 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.2 | 0.2 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.2 | 0.8 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.2 | 1.7 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.2 | 9.3 | GO:0015030 | Cajal body(GO:0015030) |
| 0.2 | 4.0 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.2 | 4.5 | GO:0035267 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.2 | 0.5 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.2 | 1.6 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.2 | 0.7 | GO:0005767 | secondary lysosome(GO:0005767) |
| 0.2 | 1.6 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.2 | 1.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.2 | 12.3 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.2 | 0.5 | GO:0033011 | perinuclear theca(GO:0033011) |
| 0.2 | 5.6 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.2 | 7.2 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.2 | 2.0 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.2 | 3.0 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.2 | 1.3 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.2 | 0.5 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.2 | 2.8 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.2 | 4.9 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.2 | 2.0 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.2 | 1.0 | GO:0070470 | plasma membrane respiratory chain(GO:0070470) |
| 0.2 | 1.3 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.2 | 2.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.2 | 1.3 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.2 | 0.6 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
| 0.2 | 2.5 | GO:0042555 | MCM complex(GO:0042555) |
| 0.2 | 0.5 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.2 | 1.1 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.2 | 12.2 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.2 | 0.2 | GO:0043203 | axon hillock(GO:0043203) |
| 0.2 | 1.5 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.2 | 0.3 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.2 | 20.0 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.2 | 0.6 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.2 | 10.4 | GO:0000779 | condensed chromosome, centromeric region(GO:0000779) |
| 0.1 | 47.4 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
| 0.1 | 11.0 | GO:0005604 | basement membrane(GO:0005604) |
| 0.1 | 0.4 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.1 | 0.9 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.1 | 2.5 | GO:0060198 | clathrin-sculpted vesicle(GO:0060198) |
| 0.1 | 10.1 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
| 0.1 | 53.5 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.1 | 3.0 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.1 | 4.8 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.1 | 1.4 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.1 | 1.1 | GO:1905202 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.1 | 17.2 | GO:1904813 | ficolin-1-rich granule(GO:0101002) ficolin-1-rich granule lumen(GO:1904813) |
| 0.1 | 0.5 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.1 | 5.8 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 3.3 | GO:0016234 | inclusion body(GO:0016234) |
| 0.1 | 9.2 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.1 | 7.6 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.1 | 0.2 | GO:0097636 | intrinsic component of autophagosome membrane(GO:0097636) integral component of autophagosome membrane(GO:0097637) |
| 0.1 | 1.4 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.1 | 0.9 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.1 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 15.3 | GO:0044306 | neuron projection terminus(GO:0044306) |
| 0.1 | 1.7 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.1 | 0.1 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) spliceosomal tri-snRNP complex(GO:0097526) |
| 0.1 | 0.2 | GO:0034515 | proteasome storage granule(GO:0034515) |
| 0.1 | 1.0 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 5.0 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.1 | 14.7 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.1 | 3.4 | GO:0031231 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.1 | 1.7 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.1 | 51.3 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.1 | 5.3 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.1 | 0.3 | GO:0090543 | Flemming body(GO:0090543) |
| 0.1 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.1 | 1.2 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.1 | 0.6 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.1 | 1.1 | GO:0030904 | retromer complex(GO:0030904) |
| 0.1 | 1.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.1 | 2.0 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.1 | 19.7 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.1 | 4.0 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.1 | 0.5 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 0.1 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.1 | 0.6 | GO:0000221 | vacuolar proton-transporting V-type ATPase, V1 domain(GO:0000221) |
| 0.1 | 4.1 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.1 | 5.8 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
| 0.1 | 6.0 | GO:0070382 | exocytic vesicle(GO:0070382) |
| 0.1 | 2.3 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.1 | 5.3 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.1 | 0.5 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 1.8 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.1 | 0.3 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 7.8 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.1 | 0.8 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 3.0 | GO:1904724 | tertiary granule lumen(GO:1904724) |
| 0.1 | 2.5 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 4.1 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.1 | 0.3 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 0.5 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 8.7 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 3.1 | GO:0035770 | ribonucleoprotein granule(GO:0035770) |
| 0.1 | 1.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 0.5 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.1 | 1.1 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 59.4 | GO:0009986 | cell surface(GO:0009986) |
| 0.1 | 5.6 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.1 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.1 | 0.2 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.1 | 0.7 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 6.4 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 0.5 | GO:0045179 | apical cortex(GO:0045179) |
| 0.1 | 1.6 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.1 | 0.2 | GO:0042611 | MHC protein complex(GO:0042611) |
| 0.1 | 5.4 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.1 | 0.1 | GO:0005674 | transcription factor TFIIF complex(GO:0005674) |
| 0.1 | 0.2 | GO:0005953 | CAAX-protein geranylgeranyltransferase complex(GO:0005953) |
| 0.1 | 6.1 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.1 | 0.5 | GO:0005845 | mRNA cap binding complex(GO:0005845) |
| 0.1 | 0.4 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 0.2 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.1 | 3.3 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.1 | 0.8 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.1 | 0.4 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.1 | 0.8 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 1.4 | GO:0005776 | autophagosome(GO:0005776) |
| 0.1 | 2.0 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.1 | 0.3 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 0.4 | GO:1902555 | endoribonuclease complex(GO:1902555) |
| 0.1 | 2.1 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.1 | 0.3 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.0 | 0.7 | GO:0038201 | TORC2 complex(GO:0031932) TOR complex(GO:0038201) |
| 0.0 | 14.6 | GO:1990904 | ribonucleoprotein complex(GO:1990904) |
| 0.0 | 0.1 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.0 | 1.5 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.3 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.2 | GO:0030891 | VCB complex(GO:0030891) |
| 0.0 | 0.0 | GO:0019012 | virion(GO:0019012) virion part(GO:0044423) |
| 0.0 | 9.5 | GO:0043025 | neuronal cell body(GO:0043025) |
| 0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.2 | GO:0002177 | manchette(GO:0002177) |
| 0.0 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 1.8 | GO:0005903 | brush border(GO:0005903) |
| 0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.0 | 1.8 | GO:0005884 | actin filament(GO:0005884) |
| 0.0 | 0.9 | GO:0000793 | condensed chromosome(GO:0000793) |
| 0.0 | 0.1 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 29.3 | GO:0005615 | extracellular space(GO:0005615) |
| 0.0 | 0.3 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.2 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.2 | GO:0030286 | dynein complex(GO:0030286) |
| 0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.6 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.0 | 0.2 | GO:0001520 | outer dense fiber(GO:0001520) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 5.1 | 15.3 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 4.7 | 18.9 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 4.4 | 13.2 | GO:0042947 | glucoside transmembrane transporter activity(GO:0042947) |
| 3.9 | 11.6 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 3.8 | 19.0 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 3.7 | 15.0 | GO:0035939 | microsatellite binding(GO:0035939) |
| 3.7 | 14.9 | GO:0004360 | glutamine-fructose-6-phosphate transaminase (isomerizing) activity(GO:0004360) |
| 3.6 | 35.6 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 3.4 | 27.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 3.4 | 20.2 | GO:0042806 | fucose binding(GO:0042806) |
| 3.3 | 19.9 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 3.3 | 16.6 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 2.9 | 22.9 | GO:0046979 | TAP2 binding(GO:0046979) |
| 2.8 | 8.5 | GO:0009032 | thymidine phosphorylase activity(GO:0009032) pyrimidine-nucleoside phosphorylase activity(GO:0016154) |
| 2.8 | 11.3 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 2.7 | 16.4 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 2.5 | 7.6 | GO:0004912 | interleukin-3 receptor activity(GO:0004912) |
| 2.4 | 12.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 2.4 | 9.7 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 2.4 | 7.2 | GO:0005292 | high-affinity basic amino acid transmembrane transporter activity(GO:0005287) high-affinity arginine transmembrane transporter activity(GO:0005289) high-affinity lysine transmembrane transporter activity(GO:0005292) |
| 2.3 | 11.7 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 2.3 | 6.8 | GO:0033842 | N-acetyl-beta-glucosaminyl-glycoprotein 4-beta-N-acetylgalactosaminyltransferase activity(GO:0033842) |
| 2.2 | 10.8 | GO:0047280 | nicotinamide phosphoribosyltransferase activity(GO:0047280) |
| 2.1 | 15.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 2.1 | 6.3 | GO:0042008 | interleukin-18 receptor activity(GO:0042008) |
| 2.1 | 25.3 | GO:0030911 | TPR domain binding(GO:0030911) |
| 2.1 | 8.4 | GO:0016793 | dGTPase activity(GO:0008832) triphosphoric monoester hydrolase activity(GO:0016793) guanyl deoxyribonucleotide binding(GO:0032560) dGTP binding(GO:0032567) |
| 2.1 | 8.3 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 2.0 | 14.3 | GO:0015333 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 2.0 | 16.0 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 1.9 | 1.9 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 1.9 | 3.8 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 1.9 | 1.9 | GO:0046978 | TAP binding(GO:0046977) TAP1 binding(GO:0046978) |
| 1.9 | 5.6 | GO:0033746 | histone demethylase activity (H3-R2 specific)(GO:0033746) histone demethylase activity (H4-R3 specific)(GO:0033749) |
| 1.8 | 7.4 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 1.8 | 5.3 | GO:0004730 | pseudouridylate synthase activity(GO:0004730) |
| 1.8 | 22.8 | GO:0031014 | troponin T binding(GO:0031014) |
| 1.7 | 6.7 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 1.6 | 8.2 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 1.6 | 4.9 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 1.6 | 4.9 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 1.6 | 4.9 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 1.6 | 9.6 | GO:0004122 | cystathionine beta-synthase activity(GO:0004122) |
| 1.6 | 6.3 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 1.6 | 14.2 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 1.6 | 12.6 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 1.6 | 6.3 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 1.6 | 4.7 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 1.5 | 4.6 | GO:0047315 | kynurenine-glyoxylate transaminase activity(GO:0047315) |
| 1.5 | 10.5 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 1.5 | 6.0 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 1.5 | 5.9 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 1.5 | 5.9 | GO:0051734 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 1.4 | 5.8 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 1.4 | 4.3 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 1.4 | 29.8 | GO:0048185 | activin binding(GO:0048185) |
| 1.4 | 6.9 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 1.4 | 25.0 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 1.4 | 4.1 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 1.4 | 4.1 | GO:0070984 | SET domain binding(GO:0070984) |
| 1.4 | 9.6 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 1.4 | 5.4 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 1.3 | 7.8 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 1.3 | 5.2 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 1.3 | 3.9 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 1.3 | 14.2 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 1.3 | 3.8 | GO:0102008 | cytosolic dipeptidase activity(GO:0102008) |
| 1.3 | 5.1 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 1.2 | 11.1 | GO:0038049 | transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) |
| 1.2 | 6.1 | GO:0004803 | transposase activity(GO:0004803) |
| 1.2 | 5.8 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 1.2 | 24.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 1.2 | 31.1 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 1.2 | 5.8 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 1.1 | 4.6 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 1.1 | 3.4 | GO:0004056 | argininosuccinate lyase activity(GO:0004056) |
| 1.1 | 5.6 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 1.1 | 4.5 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 1.1 | 19.9 | GO:0031996 | thioesterase binding(GO:0031996) |
| 1.1 | 7.7 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 1.1 | 4.4 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 1.1 | 6.6 | GO:0048030 | disaccharide binding(GO:0048030) |
| 1.1 | 4.4 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 1.1 | 9.8 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 1.1 | 4.3 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 1.1 | 3.2 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 1.1 | 10.7 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 1.1 | 4.3 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 1.1 | 7.4 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 1.1 | 10.5 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 1.0 | 8.4 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 1.0 | 29.0 | GO:0031005 | filamin binding(GO:0031005) |
| 1.0 | 7.2 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 1.0 | 3.1 | GO:0034584 | piRNA binding(GO:0034584) |
| 1.0 | 4.1 | GO:0035501 | MH1 domain binding(GO:0035501) |
| 1.0 | 4.1 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 1.0 | 5.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 1.0 | 6.1 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 1.0 | 2.0 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) |
| 1.0 | 1.0 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 1.0 | 7.0 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 1.0 | 5.0 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 1.0 | 3.9 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 1.0 | 3.9 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 1.0 | 13.7 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 1.0 | 19.4 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 1.0 | 8.7 | GO:0048495 | Roundabout binding(GO:0048495) |
| 1.0 | 9.6 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 1.0 | 2.9 | GO:0035248 | alpha-1,4-N-acetylgalactosaminyltransferase activity(GO:0035248) |
| 0.9 | 22.7 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.9 | 2.8 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.9 | 17.6 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.9 | 11.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.9 | 4.6 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
| 0.9 | 3.7 | GO:0005277 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.9 | 3.7 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.9 | 4.5 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.9 | 6.2 | GO:0016672 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) |
| 0.9 | 2.6 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.9 | 2.6 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
| 0.9 | 6.9 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.9 | 6.0 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.9 | 12.9 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.9 | 6.9 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.9 | 8.5 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.9 | 2.6 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.8 | 3.4 | GO:0030298 | receptor signaling protein tyrosine kinase activator activity(GO:0030298) |
| 0.8 | 5.1 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.8 | 7.6 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.8 | 2.5 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.8 | 12.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.8 | 1.7 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.8 | 8.3 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.8 | 3.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.8 | 5.7 | GO:0005497 | androgen binding(GO:0005497) |
| 0.8 | 2.4 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.8 | 3.2 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.8 | 0.8 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.8 | 6.4 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.8 | 0.8 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.8 | 7.1 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.8 | 4.7 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.8 | 10.9 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.8 | 10.1 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.8 | 0.8 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.8 | 5.4 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.8 | 10.8 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) potassium-transporting ATPase activity(GO:0008556) |
| 0.8 | 10.7 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.8 | 3.8 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.8 | 3.1 | GO:0004882 | androgen receptor activity(GO:0004882) |
| 0.8 | 2.3 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.8 | 1.5 | GO:0002113 | interleukin-33 binding(GO:0002113) |
| 0.8 | 2.3 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
| 0.7 | 3.7 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.7 | 4.5 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.7 | 19.2 | GO:0022842 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
| 0.7 | 1.5 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.7 | 2.9 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.7 | 5.8 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.7 | 8.7 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.7 | 0.7 | GO:0086059 | voltage-gated calcium channel activity involved SA node cell action potential(GO:0086059) |
| 0.7 | 7.9 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.7 | 0.7 | GO:0003909 | DNA ligase activity(GO:0003909) |
| 0.7 | 11.4 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.7 | 2.1 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.7 | 21.8 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.7 | 2.8 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
| 0.7 | 2.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.7 | 4.9 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.7 | 12.5 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.7 | 4.8 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.7 | 5.5 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.7 | 3.4 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.7 | 0.7 | GO:0008513 | secondary active organic cation transmembrane transporter activity(GO:0008513) |
| 0.7 | 2.7 | GO:0008478 | pyridoxal kinase activity(GO:0008478) |
| 0.7 | 3.4 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.7 | 12.0 | GO:0005536 | glucose binding(GO:0005536) |
| 0.7 | 3.3 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.7 | 3.3 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.7 | 3.3 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.7 | 1.3 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.6 | 2.6 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.6 | 5.8 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.6 | 1.9 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.6 | 3.9 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.6 | 5.2 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.6 | 2.6 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.6 | 3.9 | GO:0005330 | dopamine:sodium symporter activity(GO:0005330) |
| 0.6 | 3.8 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.6 | 1.3 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.6 | 1.9 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.6 | 6.2 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.6 | 2.5 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
| 0.6 | 3.1 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.6 | 2.4 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 0.6 | 3.0 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 0.6 | 11.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.6 | 2.9 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.6 | 2.3 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.6 | 5.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.6 | 5.7 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.6 | 9.0 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.6 | 2.8 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.6 | 3.9 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.6 | 0.6 | GO:0015368 | calcium:cation antiporter activity(GO:0015368) |
| 0.6 | 3.9 | GO:0001595 | angiotensin receptor activity(GO:0001595) angiotensin type II receptor activity(GO:0004945) |
| 0.6 | 2.2 | GO:0036080 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.6 | 1.7 | GO:0004608 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.6 | 1.7 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.5 | 35.7 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.5 | 15.6 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.5 | 1.6 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.5 | 1.6 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.5 | 1.6 | GO:0070362 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.5 | 7.8 | GO:0046790 | virion binding(GO:0046790) |
| 0.5 | 1.0 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.5 | 3.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.5 | 4.7 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.5 | 1.5 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.5 | 21.0 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.5 | 5.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.5 | 1.5 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
| 0.5 | 0.5 | GO:0031403 | lithium ion binding(GO:0031403) |
| 0.5 | 1.5 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.5 | 1.5 | GO:0031755 | endothelial differentiation G-protein coupled receptor binding(GO:0031753) Edg-2 lysophosphatidic acid receptor binding(GO:0031755) |
| 0.5 | 4.0 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.5 | 3.4 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.5 | 2.4 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.5 | 4.4 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.5 | 2.9 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.5 | 2.4 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.5 | 1.0 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.5 | 8.6 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.5 | 1.9 | GO:0002114 | interleukin-33 receptor activity(GO:0002114) |
| 0.5 | 0.9 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.5 | 8.5 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.5 | 5.2 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.5 | 0.9 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.5 | 1.9 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.5 | 3.7 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.5 | 2.3 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
| 0.5 | 1.4 | GO:0005137 | interleukin-5 receptor binding(GO:0005137) |
| 0.5 | 4.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.5 | 2.3 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.5 | 0.5 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.5 | 2.3 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.5 | 3.2 | GO:0034618 | arginine binding(GO:0034618) |
| 0.5 | 4.5 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.5 | 4.1 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.5 | 17.2 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.5 | 3.6 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.5 | 5.4 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.4 | 1.3 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.4 | 3.6 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.4 | 1.3 | GO:0042007 | interleukin-18 binding(GO:0042007) |
| 0.4 | 0.4 | GO:0097604 | temperature-gated cation channel activity(GO:0097604) |
| 0.4 | 6.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.4 | 2.2 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.4 | 4.4 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 0.4 | 5.2 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.4 | 1.3 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.4 | 2.6 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.4 | 2.2 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.4 | 2.6 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.4 | 5.6 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.4 | 1.3 | GO:0034736 | sterol O-acyltransferase activity(GO:0004772) cholesterol O-acyltransferase activity(GO:0034736) |
| 0.4 | 9.4 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
| 0.4 | 8.1 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.4 | 15.3 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.4 | 1.3 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.4 | 4.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.4 | 36.8 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.4 | 9.7 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.4 | 0.4 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
| 0.4 | 8.8 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.4 | 4.6 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.4 | 1.7 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.4 | 1.7 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.4 | 0.4 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
| 0.4 | 3.3 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.4 | 1.2 | GO:0060001 | minus-end directed microfilament motor activity(GO:0060001) |
| 0.4 | 0.8 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) |
| 0.4 | 4.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.4 | 2.9 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.4 | 0.4 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.4 | 4.9 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.4 | 0.8 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.4 | 5.7 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.4 | 1.2 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.4 | 2.0 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.4 | 2.0 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.4 | 6.0 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.4 | 2.8 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.4 | 18.4 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.4 | 7.6 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
| 0.4 | 4.0 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.4 | 2.8 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.4 | 4.0 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
| 0.4 | 1.2 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.4 | 1.6 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.4 | 4.7 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.4 | 10.9 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.4 | 21.8 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.4 | 8.9 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.4 | 1.2 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.4 | 1.6 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.4 | 3.8 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.4 | 1.5 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.4 | 2.3 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.4 | 1.5 | GO:0015198 | oligopeptide transporter activity(GO:0015198) oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.4 | 14.9 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.4 | 1.1 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
| 0.4 | 2.6 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.4 | 2.6 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.4 | 1.5 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.4 | 7.8 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.4 | 1.5 | GO:0045569 | TRAIL binding(GO:0045569) |
| 0.4 | 1.5 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.4 | 5.5 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.4 | 2.6 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.4 | 1.5 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.4 | 7.6 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.4 | 4.0 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.4 | 0.4 | GO:0035240 | dopamine binding(GO:0035240) |
| 0.4 | 3.2 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.4 | 11.4 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.4 | 17.8 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.4 | 2.5 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.4 | 1.8 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.4 | 1.8 | GO:0016429 | tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
| 0.4 | 6.7 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.4 | 1.1 | GO:0000994 | RNA polymerase III core binding(GO:0000994) |
| 0.3 | 1.4 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.3 | 9.7 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.3 | 1.0 | GO:0010348 | lithium:proton antiporter activity(GO:0010348) |
| 0.3 | 2.4 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.3 | 5.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.3 | 3.4 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.3 | 2.4 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.3 | 1.7 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.3 | 1.0 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.3 | 1.7 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.3 | 0.3 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.3 | 17.4 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.3 | 1.3 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.3 | 1.0 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.3 | 4.7 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.3 | 14.7 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.3 | 0.7 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 0.3 | 2.6 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.3 | 12.5 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.3 | 1.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.3 | 3.9 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.3 | 2.3 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.3 | 1.6 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.3 | 18.4 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.3 | 13.6 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.3 | 1.0 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.3 | 8.4 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.3 | 3.2 | GO:0015288 | porin activity(GO:0015288) |
| 0.3 | 3.2 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.3 | 2.9 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.3 | 20.3 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.3 | 8.2 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.3 | 0.6 | GO:0030305 | heparanase activity(GO:0030305) |
| 0.3 | 2.2 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.3 | 1.9 | GO:0042835 | BRE binding(GO:0042835) |
| 0.3 | 14.7 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.3 | 0.3 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.3 | 6.8 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.3 | 0.6 | GO:0033823 | procollagen-lysine 5-dioxygenase activity(GO:0008475) procollagen glucosyltransferase activity(GO:0033823) |
| 0.3 | 7.1 | GO:0001164 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.3 | 0.9 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.3 | 1.5 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.3 | 2.7 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.3 | 1.8 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.3 | 0.6 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.3 | 8.7 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.3 | 6.3 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.3 | 3.0 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.3 | 4.8 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.3 | 1.5 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
| 0.3 | 0.9 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.3 | 1.2 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.3 | 3.3 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.3 | 0.6 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
| 0.3 | 6.2 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.3 | 1.8 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.3 | 2.9 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.3 | 3.2 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.3 | 0.3 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
| 0.3 | 1.2 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.3 | 1.7 | GO:0019003 | GDP binding(GO:0019003) |
| 0.3 | 1.1 | GO:0032408 | purine-specific mismatch base pair DNA N-glycosylase activity(GO:0000701) MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.3 | 3.1 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.3 | 2.0 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
| 0.3 | 0.6 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.3 | 4.8 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.3 | 4.8 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.3 | 2.2 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.3 | 3.1 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.3 | 2.8 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.3 | 42.8 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.3 | 1.9 | GO:0035473 | lipase binding(GO:0035473) |
| 0.3 | 3.6 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.3 | 2.7 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.3 | 2.7 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
| 0.3 | 2.7 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.3 | 3.5 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.3 | 0.8 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.3 | 1.1 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
| 0.3 | 0.8 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.3 | 7.0 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.3 | 1.9 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.3 | 6.9 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.3 | 1.6 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.3 | 0.8 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.3 | 4.5 | GO:0070513 | death domain binding(GO:0070513) |
| 0.3 | 5.0 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.3 | 4.2 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.3 | 1.1 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.3 | 5.8 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.3 | 3.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.3 | 6.8 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.3 | 103.5 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.3 | 1.3 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.3 | 16.0 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.3 | 1.3 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.3 | 0.5 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.3 | 1.0 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.3 | 1.5 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.3 | 2.5 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.3 | 5.0 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.2 | 0.7 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.2 | 3.2 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.2 | 2.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.2 | 1.7 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.2 | 3.6 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.2 | 1.9 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.2 | 0.2 | GO:0005017 | platelet-derived growth factor-activated receptor activity(GO:0005017) |
| 0.2 | 0.5 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.2 | 8.0 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
| 0.2 | 1.9 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.2 | 4.1 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.2 | 1.4 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.2 | 5.8 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
| 0.2 | 1.0 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.2 | 0.7 | GO:0008457 | beta-galactosyl-N-acetylglucosaminylgalactosylglucosyl-ceramide beta-1,3-acetylglucosaminyltransferase activity(GO:0008457) lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase activity(GO:0047256) |
| 0.2 | 0.7 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.2 | 4.0 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.2 | 0.2 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
| 0.2 | 12.0 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.2 | 2.6 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.2 | 2.6 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.2 | 45.1 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.2 | 0.9 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.2 | 1.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.2 | 11.0 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.2 | 2.1 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.2 | 0.7 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.2 | 4.8 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.2 | 0.2 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.2 | 0.9 | GO:0002046 | opsin binding(GO:0002046) |
| 0.2 | 0.7 | GO:0047783 | steroid 11-beta-monooxygenase activity(GO:0004507) corticosterone 18-monooxygenase activity(GO:0047783) |
| 0.2 | 5.0 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.2 | 1.4 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.2 | 0.9 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.2 | 0.2 | GO:0008426 | protein kinase C inhibitor activity(GO:0008426) |
| 0.2 | 0.7 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.2 | 0.4 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.2 | 5.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.2 | 19.0 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.2 | 0.2 | GO:0050473 | arachidonate 15-lipoxygenase activity(GO:0050473) |
| 0.2 | 12.7 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.2 | 0.4 | GO:0015925 | galactosidase activity(GO:0015925) |
| 0.2 | 85.4 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.2 | 10.9 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.2 | 2.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.2 | 1.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.2 | 0.6 | GO:0008336 | gamma-butyrobetaine dioxygenase activity(GO:0008336) |
| 0.2 | 2.3 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.2 | 1.5 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.2 | 5.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.2 | 0.2 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.2 | 0.8 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.2 | 6.6 | GO:0030695 | GTPase regulator activity(GO:0030695) |
| 0.2 | 2.5 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) |
| 0.2 | 3.3 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.2 | 3.9 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.2 | 1.6 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 0.2 | 1.0 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.2 | 0.8 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.2 | 0.6 | GO:0008892 | guanine deaminase activity(GO:0008892) |
| 0.2 | 1.8 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.2 | 2.4 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.2 | 2.8 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.2 | 9.8 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.2 | 0.6 | GO:0098973 | structural constituent of synapse(GO:0098918) structural constituent of postsynaptic actin cytoskeleton(GO:0098973) |
| 0.2 | 11.8 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.2 | 1.0 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.2 | 3.0 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.2 | 1.4 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.2 | 1.9 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.2 | 0.4 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.2 | 1.5 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.2 | 1.7 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.2 | 1.5 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.2 | 0.8 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.2 | 2.5 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.2 | 0.9 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.2 | 0.9 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.2 | 0.7 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.2 | 0.6 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.2 | 0.9 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
| 0.2 | 2.7 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.2 | 1.1 | GO:0017136 | NAD-dependent histone deacetylase activity(GO:0017136) |
| 0.2 | 0.7 | GO:0016531 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) |
| 0.2 | 0.5 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.2 | 1.6 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.2 | 2.0 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.2 | 0.9 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.2 | 0.7 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
| 0.2 | 0.9 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.2 | 1.4 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.2 | 14.5 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
| 0.2 | 3.7 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
| 0.2 | 1.1 | GO:0030955 | potassium ion binding(GO:0030955) |
| 0.2 | 0.9 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.2 | 1.2 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.2 | 3.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.2 | 1.7 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.2 | 1.0 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.2 | 46.9 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.2 | 0.7 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.2 | 13.0 | GO:0008026 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
| 0.2 | 1.7 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.2 | 0.8 | GO:1904315 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.2 | 15.5 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.2 | 1.0 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.2 | 6.0 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.2 | 3.7 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.2 | 4.5 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.2 | 1.7 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.2 | 0.5 | GO:0004132 | dCMP deaminase activity(GO:0004132) |
| 0.2 | 0.8 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.2 | 3.3 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.2 | 0.7 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
| 0.2 | 0.2 | GO:0001034 | RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.2 | 0.2 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.2 | 3.0 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.2 | 4.6 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.2 | 2.2 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.2 | 20.2 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.2 | 0.6 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.2 | 2.7 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.2 | 0.5 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.2 | 3.3 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.2 | 0.9 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.2 | 0.2 | GO:0008967 | phosphoglycolate phosphatase activity(GO:0008967) |
| 0.2 | 0.3 | GO:0070039 | rRNA (guanosine-2'-O-)-methyltransferase activity(GO:0070039) |
| 0.2 | 0.2 | GO:0016419 | [acyl-carrier-protein] S-malonyltransferase activity(GO:0004314) S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
| 0.2 | 0.9 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.2 | 11.2 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.2 | 0.6 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 0.2 | 1.7 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.2 | 0.8 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.2 | 0.6 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.2 | 3.5 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.2 | 0.9 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.2 | 0.5 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.2 | 1.7 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 2.1 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.1 | 0.1 | GO:0032396 | inhibitory MHC class I receptor activity(GO:0032396) |
| 0.1 | 4.1 | GO:0004114 | 3',5'-cyclic-nucleotide phosphodiesterase activity(GO:0004114) |
| 0.1 | 0.3 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.1 | 0.6 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.1 | 1.2 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.1 | 0.7 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.1 | 2.3 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.1 | 0.4 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.1 | 3.9 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.1 | 1.0 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.1 | 2.6 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.1 | 4.4 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.1 | 1.1 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) acidic amino acid transmembrane transporter activity(GO:0015172) |
| 0.1 | 1.6 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.1 | 2.1 | GO:0042834 | peptidoglycan binding(GO:0042834) |
| 0.1 | 0.8 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 1.1 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.1 | 0.3 | GO:0005462 | UDP-N-acetylglucosamine transmembrane transporter activity(GO:0005462) |
| 0.1 | 0.4 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.1 | 0.7 | GO:0008948 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) oxaloacetate decarboxylase activity(GO:0008948) |
| 0.1 | 0.4 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.1 | 4.4 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.1 | 1.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 2.8 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.1 | 1.1 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.1 | 0.4 | GO:0016497 | substance K receptor activity(GO:0016497) |
| 0.1 | 0.1 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) |
| 0.1 | 1.1 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
| 0.1 | 0.5 | GO:0004992 | platelet activating factor receptor activity(GO:0004992) |
| 0.1 | 0.8 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.1 | 0.4 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.1 | 0.1 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
| 0.1 | 0.9 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 1.5 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.1 | 0.4 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.1 | 0.7 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.1 | 5.8 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.1 | 1.4 | GO:0001851 | complement component C3b binding(GO:0001851) |
| 0.1 | 0.9 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.1 | 14.6 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.1 | 0.4 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.1 | 1.0 | GO:0019239 | deaminase activity(GO:0019239) |
| 0.1 | 1.3 | GO:0010181 | FMN binding(GO:0010181) |
| 0.1 | 1.4 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.1 | 0.4 | GO:0036505 | prosaposin receptor activity(GO:0036505) |
| 0.1 | 0.5 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.1 | 2.4 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.1 | 3.6 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.1 | 7.4 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.1 | 5.6 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 0.6 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.1 | 7.4 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.1 | 0.7 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
| 0.1 | 1.2 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.1 | 0.4 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.1 | 0.5 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.1 | 0.4 | GO:0034189 | very-low-density lipoprotein particle binding(GO:0034189) |
| 0.1 | 3.3 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.1 | 1.0 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.1 | 0.5 | GO:0046997 | oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
| 0.1 | 1.8 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.1 | 3.5 | GO:0004629 | phospholipase C activity(GO:0004629) |
| 0.1 | 2.0 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
| 0.1 | 0.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 2.8 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.1 | 5.4 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.1 | 0.4 | GO:0090422 | thiamine pyrophosphate transporter activity(GO:0090422) |
| 0.1 | 3.3 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.1 | 0.3 | GO:0005011 | macrophage colony-stimulating factor receptor activity(GO:0005011) |
| 0.1 | 0.7 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 0.2 | GO:0004112 | cyclic-nucleotide phosphodiesterase activity(GO:0004112) |
| 0.1 | 4.9 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.1 | 0.7 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.1 | 1.7 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.1 | 3.9 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.1 | 1.4 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.1 | 3.4 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.1 | 0.4 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.1 | 0.3 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.1 | 1.3 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.1 | 0.3 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.1 | 19.3 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.1 | 1.6 | GO:0008061 | chitin binding(GO:0008061) |
| 0.1 | 0.4 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.1 | 0.3 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.1 | 0.1 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.1 | 2.6 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.1 | 2.7 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.1 | 1.3 | GO:0043295 | glutathione binding(GO:0043295) |
| 0.1 | 1.2 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 3.3 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.1 | 0.2 | GO:0070404 | NADH binding(GO:0070404) |
| 0.1 | 1.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 0.3 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 25.4 | GO:0044822 | mRNA binding(GO:0003729) poly(A) RNA binding(GO:0044822) |
| 0.1 | 1.2 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.1 | 1.0 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.1 | 5.4 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
| 0.1 | 4.6 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.1 | 0.5 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.1 | 0.9 | GO:0043176 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.1 | 0.3 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.1 | 1.0 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.1 | 1.6 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.1 | 0.9 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 1.0 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 0.1 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
| 0.1 | 0.9 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.1 | 0.3 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.1 | 0.2 | GO:0051120 | hepoxilin A3 synthase activity(GO:0051120) |
| 0.1 | 1.1 | GO:0001614 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
| 0.1 | 0.8 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.1 | 0.3 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.1 | 0.2 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.1 | 0.2 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.1 | 0.3 | GO:0086020 | gap junction channel activity involved in SA node cell-atrial cardiac muscle cell electrical coupling(GO:0086020) |
| 0.1 | 0.2 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
| 0.1 | 3.7 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
| 0.1 | 0.1 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
| 0.1 | 0.3 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.1 | 2.0 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
| 0.1 | 1.0 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 0.2 | GO:0033981 | D-dopachrome decarboxylase activity(GO:0033981) |
| 0.1 | 0.3 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.1 | 0.6 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.1 | 0.2 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.1 | 0.2 | GO:0050528 | acyloxyacyl hydrolase activity(GO:0050528) |
| 0.1 | 0.3 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.1 | 5.9 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.1 | 1.6 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.1 | 0.3 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 0.2 | GO:0060175 | brain-derived neurotrophic factor-activated receptor activity(GO:0060175) |
| 0.1 | 0.9 | GO:0019864 | IgG binding(GO:0019864) |
| 0.1 | 0.2 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.1 | 0.6 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.1 | 0.5 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.1 | 1.0 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.1 | 0.2 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.1 | 0.2 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.1 | 0.2 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.1 | 1.3 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
| 0.1 | 0.4 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.1 | 17.3 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.1 | 5.3 | GO:0019783 | ubiquitin-like protein-specific protease activity(GO:0019783) |
| 0.1 | 0.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.1 | 0.9 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.1 | 0.3 | GO:1902444 | riboflavin binding(GO:1902444) |
| 0.1 | 0.2 | GO:0033897 | ribonuclease T2 activity(GO:0033897) |
| 0.1 | 0.2 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.1 | 0.4 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.1 | 0.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.3 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.1 | 0.4 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.1 | 1.2 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.0 | 0.1 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
| 0.0 | 0.4 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 1.5 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.0 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.0 | 0.1 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
| 0.0 | 0.6 | GO:0008066 | glutamate receptor activity(GO:0008066) |
| 0.0 | 8.3 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.7 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.2 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.0 | 5.2 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.1 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.2 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 0.6 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.0 | 0.3 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.2 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.0 | 0.0 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.0 | 1.6 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.0 | 0.3 | GO:0004935 | adrenergic receptor activity(GO:0004935) |
| 0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.0 | 0.3 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.2 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.0 | 0.1 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
| 0.0 | 0.2 | GO:0048256 | flap endonuclease activity(GO:0048256) |
| 0.0 | 0.3 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.3 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.0 | 0.0 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.0 | 0.1 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.0 | 0.6 | GO:0070008 | serine-type carboxypeptidase activity(GO:0004185) serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.2 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.2 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.0 | 0.9 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.7 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 0.1 | GO:0019863 | IgE binding(GO:0019863) |
| 0.0 | 0.0 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.0 | 4.0 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.0 | 0.1 | GO:0015205 | nucleobase transmembrane transporter activity(GO:0015205) |
| 0.0 | 0.8 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.2 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.0 | 0.7 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.1 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.0 | 0.1 | GO:0070259 | tyrosyl-DNA phosphodiesterase activity(GO:0070259) |
| 0.0 | 0.1 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
| 0.0 | 0.3 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.2 | GO:0030884 | lipid antigen binding(GO:0030882) endogenous lipid antigen binding(GO:0030883) exogenous lipid antigen binding(GO:0030884) |
| 0.0 | 0.0 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.1 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
| 0.0 | 0.2 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 0.1 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
| 0.0 | 0.1 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 0.0 | 0.1 | GO:0019150 | D-ribulokinase activity(GO:0019150) |
| 0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.2 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.0 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.0 | 1.3 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 0.1 | GO:0004321 | fatty-acyl-CoA synthase activity(GO:0004321) |
| 0.0 | 10.5 | GO:0003723 | RNA binding(GO:0003723) |
| 0.0 | 0.2 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.0 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.8 | 11.4 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 1.3 | 2.6 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 1.2 | 4.8 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 1.2 | 14.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 1.2 | 9.3 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 1.1 | 58.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 1.0 | 1.0 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 1.0 | 2.0 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.9 | 21.8 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.8 | 29.9 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.8 | 3.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.7 | 12.6 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.7 | 27.8 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.7 | 64.1 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.7 | 21.2 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.7 | 2.7 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.7 | 32.4 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.6 | 12.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.6 | 7.3 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.6 | 1.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.6 | 14.2 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.6 | 15.4 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.6 | 60.6 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.6 | 9.2 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.5 | 24.0 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.5 | 16.0 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.5 | 28.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.5 | 2.5 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.5 | 3.9 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.5 | 10.7 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.5 | 15.0 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.5 | 22.6 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.5 | 17.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.5 | 7.6 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.5 | 30.5 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.5 | 6.0 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.4 | 12.9 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.4 | 25.2 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.4 | 9.1 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.4 | 27.0 | PID FOXO PATHWAY | FoxO family signaling |
| 0.4 | 6.6 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.4 | 30.5 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.4 | 14.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.4 | 6.7 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.4 | 7.3 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.4 | 7.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.4 | 3.6 | PID MYC PATHWAY | C-MYC pathway |
| 0.4 | 22.1 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.3 | 48.4 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.3 | 1.7 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.3 | 5.7 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.3 | 16.2 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.3 | 4.5 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.3 | 5.0 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.3 | 12.1 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.3 | 31.1 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.3 | 4.5 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.3 | 1.8 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.3 | 0.3 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.3 | 26.5 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.3 | 5.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.3 | 0.6 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.3 | 1.1 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.3 | 2.8 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.3 | 6.7 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.3 | 11.7 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.3 | 10.3 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.3 | 8.0 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.3 | 7.6 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.3 | 4.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.3 | 11.1 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.3 | 3.9 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.3 | 5.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.2 | 1.0 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.2 | 1.9 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.2 | 92.8 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.2 | 2.3 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.2 | 8.6 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.2 | 1.6 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.2 | 6.9 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.2 | 4.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.2 | 4.5 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.2 | 11.2 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.2 | 0.2 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.2 | 2.6 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.2 | 1.9 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.2 | 2.8 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.2 | 2.8 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.2 | 7.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.2 | 15.0 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.2 | 10.2 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.2 | 11.5 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.2 | 5.0 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.2 | 2.9 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.2 | 1.8 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.2 | 8.3 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.2 | 2.6 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.2 | 4.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.2 | 5.8 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.2 | 10.0 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.2 | 8.0 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.2 | 2.7 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.2 | 7.6 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.1 | 2.8 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 3.5 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.1 | 5.2 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 0.7 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.1 | 0.4 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.1 | 28.9 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.1 | 0.8 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 3.6 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.1 | 3.7 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.1 | 3.6 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.1 | 1.0 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 0.5 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.1 | 0.8 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.1 | 0.7 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.1 | 0.3 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.1 | 0.4 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 1.6 | PID FGF PATHWAY | FGF signaling pathway |
| 0.1 | 0.8 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.1 | 0.1 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.1 | 3.1 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.1 | 1.1 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.1 | 0.4 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 14.4 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 1.8 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.0 | 1.1 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.0 | 0.4 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 0.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.0 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.3 | PID ENDOTHELIN PATHWAY | Endothelins |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 11.3 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 1.7 | 3.4 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
| 1.6 | 23.3 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 1.5 | 1.5 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
| 1.5 | 55.1 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 1.4 | 64.7 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 1.3 | 21.3 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 1.3 | 14.5 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 1.1 | 1.1 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 1.1 | 1.1 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
| 1.0 | 1.0 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 1.0 | 2.9 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 1.0 | 46.0 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 1.0 | 1.0 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 1.0 | 24.9 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.9 | 11.0 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.9 | 21.6 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.9 | 41.5 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
| 0.9 | 2.6 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.8 | 90.7 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.8 | 18.8 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.8 | 8.7 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.8 | 46.8 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.8 | 21.8 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.7 | 12.3 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.7 | 15.5 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.7 | 4.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.7 | 1.3 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.6 | 10.4 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.6 | 0.6 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
| 0.6 | 11.4 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.6 | 0.6 | REACTOME SIGNALING BY TGF BETA RECEPTOR COMPLEX | Genes involved in Signaling by TGF-beta Receptor Complex |
| 0.6 | 13.2 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.6 | 5.5 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.6 | 0.6 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.6 | 21.3 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.6 | 1.2 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.6 | 21.2 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.6 | 22.9 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.6 | 10.0 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.5 | 4.8 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.5 | 13.1 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.5 | 1.0 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.5 | 19.7 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.5 | 10.0 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.5 | 10.8 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.5 | 15.6 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.5 | 22.8 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.5 | 1.9 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.5 | 4.7 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.5 | 20.0 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.5 | 28.9 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.4 | 42.9 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.4 | 8.4 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
| 0.4 | 8.8 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.4 | 7.3 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.4 | 3.8 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.4 | 20.6 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.4 | 19.2 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.4 | 4.6 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.4 | 3.7 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.4 | 4.0 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.4 | 29.0 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.4 | 17.3 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.4 | 11.6 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.4 | 5.4 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.4 | 5.4 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.4 | 11.2 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.4 | 20.5 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.4 | 25.2 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.4 | 5.6 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.4 | 12.8 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.4 | 2.9 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.4 | 9.6 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.4 | 4.6 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.4 | 3.2 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.3 | 2.4 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.3 | 1.3 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
| 0.3 | 1.3 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.3 | 11.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.3 | 20.7 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.3 | 0.3 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
| 0.3 | 0.9 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.3 | 9.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.3 | 3.9 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.3 | 2.7 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.3 | 2.7 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.3 | 3.8 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.3 | 0.6 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.3 | 4.7 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.3 | 4.2 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.3 | 23.8 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.3 | 0.3 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.3 | 12.3 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.3 | 6.0 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.3 | 13.2 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.3 | 25.0 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.3 | 1.6 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.3 | 14.4 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.3 | 6.5 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.3 | 4.5 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
| 0.3 | 39.3 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
| 0.2 | 8.9 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.2 | 4.0 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.2 | 6.6 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.2 | 5.3 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.2 | 9.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.2 | 5.8 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.2 | 7.3 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.2 | 1.3 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.2 | 0.7 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.2 | 3.7 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.2 | 5.9 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.2 | 10.2 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.2 | 3.9 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.2 | 2.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.2 | 0.8 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.2 | 2.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.2 | 10.6 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.2 | 2.9 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.2 | 3.9 | REACTOME EARLY PHASE OF HIV LIFE CYCLE | Genes involved in Early Phase of HIV Life Cycle |
| 0.2 | 2.0 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.2 | 13.7 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.2 | 6.1 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.2 | 40.8 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.2 | 4.2 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.2 | 1.5 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.2 | 2.7 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.2 | 4.5 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.2 | 2.5 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.2 | 3.0 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.2 | 3.5 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.2 | 0.5 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.2 | 1.5 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.2 | 2.5 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.2 | 0.3 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.2 | 2.1 | REACTOME OPSINS | Genes involved in Opsins |
| 0.2 | 2.4 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.2 | 11.6 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.2 | 3.4 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.2 | 0.8 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.2 | 1.1 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
| 0.2 | 10.5 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.1 | 5.1 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 2.9 | REACTOME ORC1 REMOVAL FROM CHROMATIN | Genes involved in Orc1 removal from chromatin |
| 0.1 | 15.7 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.1 | 25.2 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
| 0.1 | 0.5 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.1 | 0.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.1 | 0.1 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
| 0.1 | 2.1 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 1.2 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.1 | 3.6 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.1 | 1.8 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.1 | 1.9 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.1 | 2.8 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 1.7 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 0.4 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.1 | 0.4 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.1 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.1 | 1.5 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.1 | 2.2 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.1 | 2.0 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.1 | 2.6 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.1 | 7.2 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.1 | 5.6 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.1 | 2.1 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.1 | 1.8 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 0.9 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.1 | 0.3 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
| 0.1 | 1.2 | REACTOME RNA POL II PRE TRANSCRIPTION EVENTS | Genes involved in RNA Polymerase II Pre-transcription Events |
| 0.1 | 1.4 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 6.4 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.1 | 1.4 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.1 | 2.3 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
| 0.1 | 0.2 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.1 | 1.7 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.1 | 15.4 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.1 | 0.1 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.1 | 0.6 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 0.2 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.1 | 1.8 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.1 | 4.3 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.1 | 0.7 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
| 0.1 | 0.4 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.1 | 1.0 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.1 | 0.7 | REACTOME MYD88 MAL CASCADE INITIATED ON PLASMA MEMBRANE | Genes involved in MyD88:Mal cascade initiated on plasma membrane |
| 0.1 | 2.3 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
| 0.1 | 0.3 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.1 | 0.6 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 2.2 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.0 | 1.4 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
| 0.0 | 0.8 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.7 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 1.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 2.0 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
| 0.0 | 1.7 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.4 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 2.0 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.8 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 0.5 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 2.2 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.4 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.0 | 0.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.3 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.0 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.0 | 0.6 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.3 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
| 0.0 | 0.3 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.0 | 0.0 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.0 | 0.0 | REACTOME E2F MEDIATED REGULATION OF DNA REPLICATION | Genes involved in E2F mediated regulation of DNA replication |
| 0.0 | 0.0 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.1 | REACTOME PLATELET HOMEOSTASIS | Genes involved in Platelet homeostasis |
| 0.0 | 0.1 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |