Inflammatory response time course, HUVEC (Wada, 2009)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
PLAGL1
|
ENSG00000118495.20 | PLAGL1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| PLAGL1 | hg38_v1_chr6_-_144064511_144064608 | -0.26 | 2.0e-01 | Click! |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 3.1 | GO:2000752 | regulation of phospholipid scramblase activity(GO:1900161) positive regulation of phospholipid scramblase activity(GO:1900163) regulation of glucosylceramide catabolic process(GO:2000752) positive regulation of glucosylceramide catabolic process(GO:2000753) regulation of sphingomyelin catabolic process(GO:2000754) positive regulation of sphingomyelin catabolic process(GO:2000755) |
| 0.7 | 2.0 | GO:0009720 | detection of hormone stimulus(GO:0009720) |
| 0.6 | 1.9 | GO:0052250 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.6 | 2.6 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.6 | 2.6 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 0.6 | 2.3 | GO:0009443 | pyridoxal 5'-phosphate salvage(GO:0009443) |
| 0.6 | 2.8 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.6 | 1.7 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.5 | 1.6 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.5 | 1.4 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 0.5 | 1.4 | GO:0051040 | regulation of calcium-independent cell-cell adhesion(GO:0051040) |
| 0.4 | 1.3 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.4 | 2.0 | GO:0003068 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.3 | 1.0 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.3 | 1.4 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.3 | 1.4 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
| 0.3 | 0.9 | GO:0006117 | acetaldehyde metabolic process(GO:0006117) |
| 0.3 | 0.6 | GO:0002537 | nitric oxide production involved in inflammatory response(GO:0002537) |
| 0.3 | 3.6 | GO:0030578 | PML body organization(GO:0030578) |
| 0.3 | 1.8 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
| 0.3 | 0.9 | GO:0046521 | sphingoid catabolic process(GO:0046521) |
| 0.3 | 0.8 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.3 | 1.6 | GO:0070376 | regulation of ERK5 cascade(GO:0070376) |
| 0.3 | 0.8 | GO:0061182 | negative regulation of chondrocyte development(GO:0061182) |
| 0.3 | 1.3 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.3 | 1.3 | GO:0035935 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.3 | 1.3 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.3 | 0.8 | GO:0038156 | interleukin-3-mediated signaling pathway(GO:0038156) |
| 0.3 | 0.8 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
| 0.3 | 1.5 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.3 | 0.8 | GO:0034148 | regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) |
| 0.3 | 1.0 | GO:1904116 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 0.3 | 0.8 | GO:0070625 | zymogen granule exocytosis(GO:0070625) |
| 0.2 | 0.7 | GO:0046108 | uridine metabolic process(GO:0046108) |
| 0.2 | 1.5 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.2 | 4.4 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.2 | 0.2 | GO:1904782 | negative regulation of glutamate receptor signaling pathway(GO:1900450) negative regulation of NMDA glutamate receptor activity(GO:1904782) |
| 0.2 | 1.0 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
| 0.2 | 0.7 | GO:1904933 | regulation of cell proliferation in midbrain(GO:1904933) |
| 0.2 | 0.9 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.2 | 0.9 | GO:0036079 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.2 | 0.2 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
| 0.2 | 0.7 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.2 | 0.9 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.2 | 0.6 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 0.2 | 0.8 | GO:0003409 | optic cup structural organization(GO:0003409) |
| 0.2 | 0.8 | GO:0033590 | response to cobalamin(GO:0033590) |
| 0.2 | 0.4 | GO:1990834 | response to odorant(GO:1990834) |
| 0.2 | 0.8 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.2 | 1.4 | GO:0035655 | interleukin-18-mediated signaling pathway(GO:0035655) |
| 0.2 | 0.8 | GO:0021827 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) chemorepulsion involved in postnatal olfactory bulb interneuron migration(GO:0021836) |
| 0.2 | 1.0 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.2 | 0.6 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.2 | 1.0 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.2 | 2.6 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
| 0.2 | 1.0 | GO:0034344 | type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.2 | 0.4 | GO:0098712 | L-glutamate import across plasma membrane(GO:0098712) |
| 0.2 | 0.2 | GO:0035963 | cellular response to interleukin-13(GO:0035963) |
| 0.2 | 1.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.2 | 0.6 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.2 | 0.8 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.2 | 1.9 | GO:0021633 | optic nerve structural organization(GO:0021633) |
| 0.2 | 0.8 | GO:2001247 | positive regulation of phosphatidylcholine biosynthetic process(GO:2001247) |
| 0.2 | 6.9 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.2 | 0.7 | GO:0000706 | meiotic DNA double-strand break processing(GO:0000706) |
| 0.2 | 1.7 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.2 | 1.8 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.2 | 1.1 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.2 | 0.5 | GO:1902908 | regulation of melanosome transport(GO:1902908) |
| 0.2 | 0.9 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.2 | 0.5 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.2 | 0.5 | GO:0019364 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.2 | 0.5 | GO:1904328 | regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
| 0.2 | 0.5 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
| 0.2 | 0.7 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.2 | 1.6 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.2 | 0.7 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.2 | 0.7 | GO:1903438 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.2 | 2.4 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.2 | 0.5 | GO:2000182 | regulation of progesterone biosynthetic process(GO:2000182) |
| 0.2 | 0.2 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.2 | 0.3 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
| 0.2 | 0.7 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
| 0.2 | 1.2 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.2 | 0.5 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.2 | 0.5 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 0.2 | 5.2 | GO:0006972 | hyperosmotic response(GO:0006972) |
| 0.2 | 0.7 | GO:0021898 | commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.2 | 0.5 | GO:0002416 | IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
| 0.2 | 0.5 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
| 0.2 | 0.5 | GO:0014028 | notochord formation(GO:0014028) |
| 0.2 | 0.8 | GO:0043128 | regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.2 | 0.5 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
| 0.2 | 0.8 | GO:1903904 | negative regulation of establishment of T cell polarity(GO:1903904) negative regulation of T cell migration(GO:2000405) negative regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001107) |
| 0.2 | 1.3 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.2 | 0.3 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.2 | 0.6 | GO:1903182 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.2 | 2.7 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.2 | 0.9 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.2 | 0.6 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.2 | 0.5 | GO:0061027 | umbilical cord morphogenesis(GO:0036304) umbilical cord development(GO:0061027) |
| 0.2 | 1.1 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.2 | 1.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.2 | 0.6 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.2 | 0.3 | GO:0060434 | bronchus morphogenesis(GO:0060434) |
| 0.2 | 0.6 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.1 | 0.6 | GO:0006238 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.1 | 0.6 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.1 | 1.2 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 | 0.1 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.1 | 0.4 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.1 | 0.4 | GO:0003050 | regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.1 | 1.3 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.1 | 1.2 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.1 | 0.6 | GO:0042335 | cuticle development(GO:0042335) |
| 0.1 | 0.4 | GO:2000661 | positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.1 | 0.4 | GO:0034471 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.1 | 0.6 | GO:1904245 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 0.1 | 0.4 | GO:0072237 | metanephric proximal tubule development(GO:0072237) |
| 0.1 | 0.1 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
| 0.1 | 1.1 | GO:0014916 | regulation of lung blood pressure(GO:0014916) |
| 0.1 | 0.4 | GO:0097187 | dentinogenesis(GO:0097187) |
| 0.1 | 0.3 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.1 | 0.8 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 0.1 | 0.1 | GO:1903939 | regulation of TORC2 signaling(GO:1903939) |
| 0.1 | 0.5 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 0.1 | 0.5 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.1 | 1.6 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 | 0.5 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.1 | 1.9 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 0.3 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.1 | 0.1 | GO:0060031 | mediolateral intercalation(GO:0060031) planar cell polarity pathway involved in gastrula mediolateral intercalation(GO:0060775) |
| 0.1 | 0.7 | GO:0048371 | lateral mesodermal cell differentiation(GO:0048371) |
| 0.1 | 0.4 | GO:0035498 | carnosine metabolic process(GO:0035498) |
| 0.1 | 0.5 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.1 | 0.5 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.1 | 0.5 | GO:1905224 | clathrin-coated pit assembly(GO:1905224) |
| 0.1 | 0.5 | GO:0010138 | pyrimidine ribonucleotide salvage(GO:0010138) pyrimidine nucleotide salvage(GO:0032262) UMP salvage(GO:0044206) |
| 0.1 | 0.6 | GO:1904674 | positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.1 | 0.9 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.1 | 0.1 | GO:0060723 | spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.1 | 0.4 | GO:1902462 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.1 | 1.3 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.1 | 0.4 | GO:1904529 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.1 | 0.6 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 | 0.1 | GO:0045013 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.1 | 1.2 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.1 | 0.6 | GO:0002118 | aggressive behavior(GO:0002118) |
| 0.1 | 0.4 | GO:1904717 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.1 | 1.1 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.1 | 0.5 | GO:0072086 | specification of loop of Henle identity(GO:0072086) |
| 0.1 | 0.5 | GO:0009439 | cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.1 | 0.4 | GO:1990927 | calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.1 | 0.7 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.1 | 0.7 | GO:1903435 | positive regulation of constitutive secretory pathway(GO:1903435) |
| 0.1 | 0.5 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.1 | 0.6 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.1 | 0.7 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.1 | 0.7 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.1 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.1 | 0.6 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.1 | 0.6 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
| 0.1 | 0.1 | GO:0030952 | establishment or maintenance of cytoskeleton polarity(GO:0030952) |
| 0.1 | 0.6 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.1 | 0.3 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.1 | 0.5 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.1 | 0.6 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.1 | 0.7 | GO:0071105 | response to interleukin-11(GO:0071105) |
| 0.1 | 0.3 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.1 | 0.1 | GO:0060405 | regulation of penile erection(GO:0060405) |
| 0.1 | 3.1 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.6 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
| 0.1 | 0.4 | GO:0036229 | glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.1 | 0.1 | GO:0072014 | proximal tubule development(GO:0072014) |
| 0.1 | 0.3 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.1 | 0.3 | GO:0035377 | transepithelial water transport(GO:0035377) positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.1 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.1 | 0.4 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.1 | 0.3 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.1 | 0.7 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.1 | 0.2 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 0.7 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.1 | 0.7 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.1 | 0.1 | GO:1902725 | negative regulation of satellite cell differentiation(GO:1902725) |
| 0.1 | 0.6 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.1 | 0.5 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
| 0.1 | 1.2 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.1 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.1 | 0.2 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.1 | 0.2 | GO:0036018 | cellular response to erythropoietin(GO:0036018) |
| 0.1 | 0.6 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.1 | 0.3 | GO:1903949 | positive regulation of atrial cardiac muscle cell action potential(GO:1903949) |
| 0.1 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 0.3 | GO:1902524 | positive regulation of protein K48-linked ubiquitination(GO:1902524) |
| 0.1 | 1.3 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.1 | 0.4 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.1 | 0.5 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.1 | 0.6 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.1 | 0.5 | GO:0001575 | globoside metabolic process(GO:0001575) |
| 0.1 | 1.4 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 1.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 | 0.5 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.1 | 0.3 | GO:0061394 | regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.1 | 0.4 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.1 | 0.4 | GO:2000681 | negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.1 | 0.3 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.1 | 0.8 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 0.1 | GO:1903921 | protein processing in phagocytic vesicle(GO:1900756) regulation of protein processing in phagocytic vesicle(GO:1903921) positive regulation of protein processing in phagocytic vesicle(GO:1903923) |
| 0.1 | 0.6 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.1 | 0.3 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.1 | 0.3 | GO:0061386 | closure of optic fissure(GO:0061386) |
| 0.1 | 0.8 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.1 | 0.2 | GO:0071874 | response to norepinephrine(GO:0071873) cellular response to norepinephrine stimulus(GO:0071874) |
| 0.1 | 0.2 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
| 0.1 | 0.2 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.1 | 0.6 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.1 | 0.3 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.3 | GO:2000502 | negative regulation of natural killer cell chemotaxis(GO:2000502) |
| 0.1 | 0.2 | GO:0071224 | cellular response to peptidoglycan(GO:0071224) |
| 0.1 | 0.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.1 | 0.3 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.1 | 0.4 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
| 0.1 | 1.1 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.1 | 0.6 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 1.0 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.1 | 0.5 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.1 | 0.4 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.1 | 2.4 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.1 | 0.9 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.1 | 1.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.1 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 | 0.8 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.1 | 0.8 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.1 | 0.1 | GO:1901624 | negative regulation of lymphocyte chemotaxis(GO:1901624) |
| 0.1 | 0.8 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.1 | 0.7 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.1 | 0.9 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.1 | 2.5 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 0.1 | 0.3 | GO:0045645 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
| 0.1 | 0.3 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.1 | 0.3 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
| 0.1 | 0.4 | GO:0019082 | viral protein processing(GO:0019082) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 0.1 | 0.3 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
| 0.1 | 0.2 | GO:1904637 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.1 | 0.4 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.1 | 0.3 | GO:0006565 | L-serine catabolic process(GO:0006565) |
| 0.1 | 0.5 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 0.1 | 0.4 | GO:0019072 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.1 | 0.5 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.1 | 0.3 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.1 | 0.5 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.1 | 0.3 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.1 | 1.0 | GO:0035585 | calcium-mediated signaling using extracellular calcium source(GO:0035585) |
| 0.1 | 1.5 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.1 | 0.5 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 0.1 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.1 | 1.5 | GO:0072619 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 0.1 | 0.7 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 | 0.4 | GO:0032714 | negative regulation of interleukin-5 production(GO:0032714) |
| 0.1 | 0.4 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.1 | 0.5 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 | 0.8 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.1 | 0.3 | GO:1903381 | neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.1 | 0.4 | GO:0034959 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.1 | 0.3 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.1 | 0.8 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 | 0.2 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.1 | 0.3 | GO:0035915 | pore formation in membrane of other organism(GO:0035915) |
| 0.1 | 1.0 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.1 | 0.4 | GO:2001076 | regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 0.1 | 0.2 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.1 | 0.4 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
| 0.1 | 0.3 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.1 | 0.3 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.1 | 0.3 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 | 0.7 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.1 | 0.3 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.1 | 0.3 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.1 | 0.5 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 0.5 | GO:0086098 | angiotensin-activated signaling pathway involved in heart process(GO:0086098) |
| 0.1 | 0.3 | GO:0051595 | response to methylglyoxal(GO:0051595) negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.1 | 0.6 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) |
| 0.1 | 0.2 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.1 | 0.1 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.1 | 1.1 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.1 | 1.7 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.4 | GO:1904566 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.1 | 0.3 | GO:0035281 | pre-miRNA export from nucleus(GO:0035281) |
| 0.1 | 0.4 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.1 | 0.3 | GO:0000912 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.1 | 0.3 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.1 | 1.0 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.1 | 0.2 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.1 | 0.7 | GO:0015942 | formate metabolic process(GO:0015942) |
| 0.1 | 0.2 | GO:0070079 | peptidyl-lysine hydroxylation to 5-hydroxy-L-lysine(GO:0018395) histone arginine demethylation(GO:0070077) histone H3-R2 demethylation(GO:0070078) histone H4-R3 demethylation(GO:0070079) |
| 0.1 | 0.6 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.1 | 1.0 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.1 | 0.5 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.1 | 0.4 | GO:0090035 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.1 | 0.2 | GO:0036146 | cellular response to mycotoxin(GO:0036146) |
| 0.1 | 0.2 | GO:0019521 | aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.1 | 0.2 | GO:0051029 | rRNA transport(GO:0051029) |
| 0.1 | 0.2 | GO:1903576 | response to L-arginine(GO:1903576) |
| 0.1 | 0.3 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.1 | 1.1 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.1 | 0.2 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.1 | 0.4 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.1 | 0.3 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.1 | 0.2 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
| 0.1 | 0.1 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.1 | 0.2 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.1 | 0.6 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.1 | 0.9 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.1 | 0.3 | GO:2000984 | regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.1 | 0.7 | GO:0035986 | senescence-associated heterochromatin focus assembly(GO:0035986) |
| 0.1 | 3.1 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 | 0.4 | GO:0033512 | L-lysine catabolic process to acetyl-CoA via saccharopine(GO:0033512) |
| 0.1 | 0.5 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.1 | 0.6 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.1 | 0.1 | GO:0002583 | regulation of antigen processing and presentation of peptide antigen(GO:0002583) |
| 0.1 | 0.2 | GO:0035419 | detection of peptidoglycan(GO:0032499) activation of MAPK activity involved in innate immune response(GO:0035419) |
| 0.1 | 1.3 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.1 | 1.5 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
| 0.1 | 0.4 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.1 | 0.5 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.1 | 0.8 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.4 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.1 | 0.5 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 | 0.5 | GO:0035747 | natural killer cell chemotaxis(GO:0035747) |
| 0.1 | 1.6 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.1 | 0.2 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.1 | 1.1 | GO:0060180 | female mating behavior(GO:0060180) |
| 0.1 | 0.2 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.1 | 0.5 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.1 | 0.3 | GO:0071504 | cellular response to heparin(GO:0071504) |
| 0.1 | 0.3 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.1 | 0.1 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.1 | 0.2 | GO:0006579 | amino-acid betaine catabolic process(GO:0006579) |
| 0.1 | 0.5 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.1 | 0.2 | GO:0006045 | N-acetylglucosamine biosynthetic process(GO:0006045) glucosamine-containing compound biosynthetic process(GO:1901073) |
| 0.1 | 0.6 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.1 | 0.4 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.1 | 0.2 | GO:0036301 | macrophage colony-stimulating factor production(GO:0036301) regulation of macrophage colony-stimulating factor production(GO:1901256) |
| 0.1 | 0.3 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 | 0.3 | GO:0071418 | cellular response to amine stimulus(GO:0071418) |
| 0.1 | 0.3 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 | 0.1 | GO:1905033 | positive regulation of actin filament-based movement(GO:1903116) positive regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903762) positive regulation of ventricular cardiac muscle cell action potential(GO:1903947) positive regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905026) positive regulation of membrane repolarization during cardiac muscle cell action potential(GO:1905033) |
| 0.1 | 0.2 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
| 0.1 | 0.3 | GO:0061358 | negative regulation of Wnt protein secretion(GO:0061358) |
| 0.1 | 0.2 | GO:0021658 | rhombomere morphogenesis(GO:0021593) rhombomere 3 morphogenesis(GO:0021658) |
| 0.1 | 0.9 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.1 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.1 | 0.1 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.1 | 0.1 | GO:0060463 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
| 0.1 | 0.3 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.1 | 0.6 | GO:0031017 | exocrine pancreas development(GO:0031017) |
| 0.1 | 0.4 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.2 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.1 | 0.1 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.1 | 1.3 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.1 | 0.6 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.1 | 0.1 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.1 | 0.3 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 0.1 | 0.2 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.1 | 0.3 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.1 | 0.3 | GO:0015862 | uridine transport(GO:0015862) |
| 0.1 | 0.7 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 | 0.1 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.1 | 0.4 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.1 | 0.5 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
| 0.1 | 0.5 | GO:0030421 | defecation(GO:0030421) |
| 0.1 | 0.6 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.1 | GO:1902232 | regulation of positive thymic T cell selection(GO:1902232) |
| 0.1 | 0.4 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.1 | 0.4 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
| 0.1 | 0.9 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 1.7 | GO:0006206 | pyrimidine nucleobase metabolic process(GO:0006206) |
| 0.1 | 1.0 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.1 | 1.3 | GO:0048757 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.1 | 0.7 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.1 | 0.2 | GO:0006267 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.1 | 0.3 | GO:0070295 | renal water absorption(GO:0070295) |
| 0.1 | 0.1 | GO:0051414 | response to cortisol(GO:0051414) |
| 0.1 | 1.3 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 0.1 | 0.3 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
| 0.1 | 0.9 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.1 | 0.3 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
| 0.1 | 0.3 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
| 0.1 | 0.5 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
| 0.1 | 0.1 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.1 | 0.1 | GO:0021834 | chemorepulsion involved in embryonic olfactory bulb interneuron precursor migration(GO:0021834) |
| 0.1 | 0.3 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
| 0.1 | 0.5 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.1 | 0.2 | GO:0048867 | stem cell fate determination(GO:0048867) |
| 0.1 | 0.8 | GO:0015820 | leucine transport(GO:0015820) |
| 0.1 | 0.2 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 | 0.1 | GO:0031943 | regulation of glucocorticoid metabolic process(GO:0031943) |
| 0.1 | 0.4 | GO:0007185 | transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.1 | 0.1 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.1 | 0.1 | GO:0060309 | elastin catabolic process(GO:0060309) |
| 0.1 | 0.1 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.1 | 0.9 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.1 | 0.3 | GO:1904579 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.1 | 1.0 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.1 | 0.2 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.1 | 0.5 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 | 0.3 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.1 | 0.4 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.1 | 0.3 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) |
| 0.1 | 0.2 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.1 | 0.2 | GO:1903826 | arginine transmembrane transport(GO:1903826) |
| 0.1 | 2.7 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.1 | 0.2 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
| 0.1 | 0.1 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.1 | 0.5 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.1 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
| 0.1 | 0.2 | GO:0003383 | apical constriction(GO:0003383) |
| 0.1 | 0.2 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.1 | 0.6 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
| 0.1 | 0.1 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.1 | 0.2 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.1 | 1.2 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.1 | 0.8 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.1 | 0.1 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.1 | 0.3 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.1 | 0.7 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.1 | 0.5 | GO:0051177 | meiotic sister chromatid cohesion(GO:0051177) |
| 0.1 | 0.5 | GO:0002265 | astrocyte activation involved in immune response(GO:0002265) |
| 0.1 | 0.4 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.1 | 0.2 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.1 | 0.2 | GO:0090234 | regulation of kinetochore assembly(GO:0090234) |
| 0.1 | 0.3 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.1 | 0.2 | GO:0002774 | Fc receptor mediated inhibitory signaling pathway(GO:0002774) |
| 0.1 | 0.2 | GO:1904640 | response to methionine(GO:1904640) |
| 0.1 | 0.3 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.1 | 0.4 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.1 | 0.2 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.1 | 0.1 | GO:0044803 | multi-organism membrane organization(GO:0044803) |
| 0.1 | 0.5 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.1 | 0.2 | GO:1903525 | regulation of membrane tubulation(GO:1903525) negative regulation of membrane tubulation(GO:1903526) |
| 0.1 | 0.6 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.1 | 0.2 | GO:0009750 | response to fructose(GO:0009750) |
| 0.1 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.1 | 0.3 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.1 | 0.1 | GO:0014738 | regulation of muscle hyperplasia(GO:0014738) |
| 0.1 | 0.3 | GO:0046184 | aldehyde biosynthetic process(GO:0046184) |
| 0.1 | 0.9 | GO:0021681 | cerebellar granular layer development(GO:0021681) |
| 0.1 | 0.2 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.1 | 0.1 | GO:0043449 | cellular alkene metabolic process(GO:0043449) |
| 0.1 | 0.1 | GO:0060809 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 0.1 | 0.4 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.1 | 0.4 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.1 | 0.5 | GO:0040033 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.1 | 1.3 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.1 | 0.4 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.1 | 0.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.1 | 0.2 | GO:1903936 | cellular response to sodium arsenite(GO:1903936) |
| 0.1 | 0.3 | GO:0046137 | negative regulation of vitamin D biosynthetic process(GO:0010957) negative regulation of vitamin metabolic process(GO:0046137) |
| 0.1 | 0.7 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 | 0.1 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.1 | 0.1 | GO:0072244 | metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.1 | 0.2 | GO:0002881 | negative regulation of chronic inflammatory response to non-antigenic stimulus(GO:0002881) |
| 0.1 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) |
| 0.1 | 0.2 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.1 | 0.6 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.1 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) |
| 0.1 | 0.2 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.1 | 0.2 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.1 | 0.3 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.1 | 0.2 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.1 | 1.1 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.1 | 0.1 | GO:0002586 | regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
| 0.1 | 0.4 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.1 | 0.1 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 0.1 | 0.4 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
| 0.1 | 0.2 | GO:0035565 | regulation of pronephros size(GO:0035565) |
| 0.1 | 0.3 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.1 | 0.9 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.1 | 0.3 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.1 | 0.2 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.1 | 0.4 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.1 | 0.2 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.1 | 0.2 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.1 | 0.2 | GO:0070889 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) platelet alpha granule organization(GO:0070889) regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 0.1 | 0.2 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.1 | 0.1 | GO:0060558 | regulation of calcidiol 1-monooxygenase activity(GO:0060558) |
| 0.1 | 1.1 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.1 | 0.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.8 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.1 | 0.1 | GO:0031620 | regulation of fever generation(GO:0031620) positive regulation of fever generation(GO:0031622) |
| 0.1 | 0.4 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.1 | 1.0 | GO:0046697 | decidualization(GO:0046697) |
| 0.0 | 0.1 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.0 | 0.7 | GO:1901838 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.0 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.0 | 0.7 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.0 | 1.2 | GO:0032480 | negative regulation of type I interferon production(GO:0032480) |
| 0.0 | 1.4 | GO:0006700 | C21-steroid hormone biosynthetic process(GO:0006700) |
| 0.0 | 0.6 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 0.4 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.0 | 0.5 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.0 | 0.1 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.0 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.0 | 0.4 | GO:0097647 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.0 | 0.8 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.8 | GO:0042340 | keratan sulfate catabolic process(GO:0042340) |
| 0.0 | 0.8 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 | 0.4 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
| 0.0 | 0.8 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.4 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.0 | 0.3 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.0 | 0.1 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 0.0 | 0.2 | GO:0043335 | protein unfolding(GO:0043335) |
| 0.0 | 0.1 | GO:0019322 | xylulose biosynthetic process(GO:0005999) pentose biosynthetic process(GO:0019322) |
| 0.0 | 0.6 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.0 | 0.5 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.0 | 0.5 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.0 | 0.2 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.0 | 0.3 | GO:1901315 | negative regulation of histone ubiquitination(GO:0033183) negative regulation of protein K63-linked ubiquitination(GO:1900045) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.0 | 0.3 | GO:0045007 | depurination(GO:0045007) |
| 0.0 | 0.2 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.0 | 0.3 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.0 | 0.1 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
| 0.0 | 0.3 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.0 | 0.2 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.0 | 0.2 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.0 | 0.1 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.0 | 0.1 | GO:0002192 | IRES-dependent translational initiation(GO:0002192) |
| 0.0 | 0.6 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.0 | 0.2 | GO:1902564 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) negative regulation of neutrophil activation(GO:1902564) |
| 0.0 | 0.1 | GO:0018160 | peptidyl-pyrromethane cofactor linkage(GO:0018160) |
| 0.0 | 0.5 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.0 | 0.2 | GO:1901858 | regulation of mitochondrial DNA metabolic process(GO:1901858) |
| 0.0 | 0.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.6 | GO:0060581 | ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 0.0 | 0.1 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.0 | 0.7 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.0 | 0.9 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.0 | 0.9 | GO:0048311 | mitochondrion distribution(GO:0048311) |
| 0.0 | 0.3 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.0 | 1.2 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
| 0.0 | 0.5 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 1.2 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.0 | 0.3 | GO:0033489 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
| 0.0 | 0.2 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.0 | 0.3 | GO:0046618 | drug export(GO:0046618) |
| 0.0 | 0.1 | GO:0034201 | response to oleic acid(GO:0034201) |
| 0.0 | 0.1 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.0 | 0.1 | GO:1901993 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.0 | 0.4 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 | 0.3 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.5 | GO:1903543 | positive regulation of exosomal secretion(GO:1903543) |
| 0.0 | 0.1 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
| 0.0 | 0.6 | GO:0042354 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 | 0.3 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.0 | 0.5 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.0 | 0.1 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.0 | 0.3 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.0 | 0.3 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.0 | 0.2 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.0 | 0.3 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.0 | 0.4 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.0 | 0.5 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.0 | 0.1 | GO:0035570 | N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.0 | 0.9 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.0 | 0.1 | GO:2000569 | T-helper 2 cell activation(GO:0035712) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.0 | 0.3 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.0 | 0.2 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
| 0.0 | 0.3 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.0 | 0.2 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.0 | 1.6 | GO:1904659 | hexose transmembrane transport(GO:0035428) glucose transmembrane transport(GO:1904659) |
| 0.0 | 0.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.0 | 0.2 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.0 | 0.3 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.0 | 0.1 | GO:0036510 | trimming of terminal mannose on C branch(GO:0036510) |
| 0.0 | 0.1 | GO:0072310 | glomerular epithelial cell development(GO:0072310) |
| 0.0 | 0.3 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 | 0.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.1 | GO:0060535 | trachea cartilage morphogenesis(GO:0060535) |
| 0.0 | 0.2 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.0 | 0.5 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.0 | 0.5 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.4 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.0 | 0.1 | GO:0097360 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.0 | 0.4 | GO:0007207 | phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.0 | 2.5 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.0 | 0.2 | GO:0071404 | cellular response to lipoprotein particle stimulus(GO:0071402) cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
| 0.0 | 0.1 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
| 0.0 | 0.1 | GO:0097274 | urea homeostasis(GO:0097274) |
| 0.0 | 0.2 | GO:0001781 | neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) |
| 0.0 | 0.6 | GO:0002138 | retinoic acid biosynthetic process(GO:0002138) |
| 0.0 | 0.0 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
| 0.0 | 0.1 | GO:0007135 | meiosis II(GO:0007135) |
| 0.0 | 0.2 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 | 0.5 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.2 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.0 | 0.2 | GO:0072719 | cellular response to cisplatin(GO:0072719) |
| 0.0 | 0.2 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 | 0.2 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.0 | 0.2 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
| 0.0 | 0.1 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
| 0.0 | 0.3 | GO:0001712 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.0 | 0.7 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.0 | 0.1 | GO:0032627 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
| 0.0 | 0.4 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.0 | GO:0090164 | asymmetric Golgi ribbon formation(GO:0090164) |
| 0.0 | 0.2 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
| 0.0 | 0.2 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.0 | 0.4 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
| 0.0 | 0.0 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 0.2 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.0 | 0.4 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.0 | 0.5 | GO:0042993 | positive regulation of transcription factor import into nucleus(GO:0042993) |
| 0.0 | 0.2 | GO:0046885 | regulation of hormone biosynthetic process(GO:0046885) |
| 0.0 | 0.1 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
| 0.0 | 0.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.0 | 0.1 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.0 | 0.1 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.0 | 0.2 | GO:1904744 | regulation of telomeric DNA binding(GO:1904742) positive regulation of telomeric DNA binding(GO:1904744) |
| 0.0 | 2.3 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.0 | 0.2 | GO:0009838 | abscission(GO:0009838) |
| 0.0 | 0.2 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
| 0.0 | 0.0 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.0 | 0.1 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.0 | 0.1 | GO:0060013 | righting reflex(GO:0060013) |
| 0.0 | 0.5 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.0 | 0.4 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 | 0.1 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.0 | 0.4 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.0 | 1.1 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.0 | GO:0035801 | adrenal cortex development(GO:0035801) adrenal cortex formation(GO:0035802) |
| 0.0 | 0.1 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.0 | 0.2 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 | 0.3 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.0 | 0.2 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.0 | 0.2 | GO:0015840 | urea transport(GO:0015840) |
| 0.0 | 0.2 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.0 | 0.0 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.0 | 0.7 | GO:0070193 | synaptonemal complex organization(GO:0070193) |
| 0.0 | 0.1 | GO:0009822 | alkaloid catabolic process(GO:0009822) |
| 0.0 | 0.5 | GO:0008228 | opsonization(GO:0008228) |
| 0.0 | 0.2 | GO:0009213 | pyrimidine nucleoside triphosphate catabolic process(GO:0009149) pyrimidine deoxyribonucleoside triphosphate catabolic process(GO:0009213) |
| 0.0 | 0.1 | GO:1904350 | regulation of protein catabolic process in the vacuole(GO:1904350) |
| 0.0 | 0.6 | GO:1901748 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.0 | 0.5 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.3 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) |
| 0.0 | 0.0 | GO:0021897 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.0 | 0.1 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.0 | 0.5 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 | 0.1 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 | 0.4 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
| 0.0 | 0.2 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.0 | 0.1 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.0 | 0.1 | GO:1904504 | lipophagy(GO:0061724) regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.0 | 0.1 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.0 | 0.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 | 0.0 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
| 0.0 | 1.1 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 | 0.8 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.1 | GO:0006500 | N-terminal protein palmitoylation(GO:0006500) |
| 0.0 | 0.4 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.1 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
| 0.0 | 0.0 | GO:0060268 | respiratory burst involved in inflammatory response(GO:0002536) regulation of respiratory burst involved in inflammatory response(GO:0060264) negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
| 0.0 | 0.1 | GO:1903279 | regulation of the force of heart contraction by cardiac conduction(GO:0086092) regulation of calcium:sodium antiporter activity(GO:1903279) positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 0.0 | 0.1 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.0 | 0.3 | GO:0051195 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.0 | 0.3 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
| 0.0 | 0.0 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.0 | 0.4 | GO:0002070 | epithelial cell maturation(GO:0002070) |
| 0.0 | 0.1 | GO:1904799 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.0 | 0.1 | GO:2000909 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.0 | 0.5 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
| 0.0 | 0.2 | GO:0009886 | post-embryonic morphogenesis(GO:0009886) |
| 0.0 | 0.1 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
| 0.0 | 0.1 | GO:2000193 | positive regulation of fatty acid transport(GO:2000193) |
| 0.0 | 0.1 | GO:0071362 | cellular response to ether(GO:0071362) |
| 0.0 | 0.1 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.0 | 0.3 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.0 | 0.2 | GO:0051852 | disruption by host of symbiont cells(GO:0051852) killing by host of symbiont cells(GO:0051873) |
| 0.0 | 0.3 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.2 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
| 0.0 | 0.1 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.0 | 0.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 | 0.6 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 | 0.2 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 0.4 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.0 | 0.0 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.0 | 0.3 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 0.1 | GO:0003095 | pressure natriuresis(GO:0003095) |
| 0.0 | 0.3 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
| 0.0 | 0.2 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 | 0.5 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.2 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.0 | 0.3 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.1 | GO:0072334 | UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.0 | 0.1 | GO:0086021 | SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
| 0.0 | 0.1 | GO:0050651 | dermatan sulfate biosynthetic process(GO:0030208) dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.0 | 2.4 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.0 | GO:1990168 | protein K33-linked deubiquitination(GO:1990168) |
| 0.0 | 0.1 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) |
| 0.0 | 0.8 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.0 | 0.4 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.0 | 0.2 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.2 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
| 0.0 | 0.4 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.0 | 0.4 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 1.0 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.3 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.0 | 0.7 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.1 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.0 | 0.1 | GO:0060372 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
| 0.0 | 0.1 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
| 0.0 | 0.4 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
| 0.0 | 0.4 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.2 | GO:0035934 | corticosterone secretion(GO:0035934) |
| 0.0 | 0.1 | GO:0015993 | molecular hydrogen transport(GO:0015993) |
| 0.0 | 0.3 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.1 | GO:1902463 | protein localization to cell leading edge(GO:1902463) |
| 0.0 | 0.1 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.0 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 0.3 | GO:0048505 | regulation of development, heterochronic(GO:0040034) regulation of timing of cell differentiation(GO:0048505) |
| 0.0 | 0.4 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.0 | 0.5 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.1 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
| 0.0 | 0.1 | GO:0006258 | UDP-glucose catabolic process(GO:0006258) |
| 0.0 | 0.2 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
| 0.0 | 0.1 | GO:1904569 | regulation of selenocysteine incorporation(GO:1904569) |
| 0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.6 | GO:0042491 | auditory receptor cell differentiation(GO:0042491) |
| 0.0 | 0.1 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
| 0.0 | 0.2 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.0 | 0.3 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.0 | 0.3 | GO:0048569 | post-embryonic organ development(GO:0048569) |
| 0.0 | 0.3 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.0 | 0.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.0 | 0.1 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
| 0.0 | 0.2 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.0 | 0.1 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 | 0.4 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.0 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.0 | 0.2 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
| 0.0 | 0.1 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.2 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
| 0.0 | 0.2 | GO:0048339 | paraxial mesoderm development(GO:0048339) |
| 0.0 | 0.1 | GO:0060687 | prostate glandular acinus development(GO:0060525) prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
| 0.0 | 0.0 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.0 | 0.4 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.0 | 0.4 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.0 | 0.1 | GO:0030818 | negative regulation of cAMP biosynthetic process(GO:0030818) |
| 0.0 | 1.9 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.0 | 0.2 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 0.1 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
| 0.0 | 0.2 | GO:0071800 | podosome assembly(GO:0071800) |
| 0.0 | 0.1 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.0 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.1 | GO:1903288 | positive regulation of potassium ion import(GO:1903288) |
| 0.0 | 0.2 | GO:0099566 | regulation of postsynaptic cytosolic calcium ion concentration(GO:0099566) |
| 0.0 | 0.2 | GO:0097398 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.0 | 0.2 | GO:1902731 | negative regulation of chondrocyte proliferation(GO:1902731) |
| 0.0 | 0.4 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
| 0.0 | 0.1 | GO:0098971 | anterograde dendritic transport of neurotransmitter receptor complex(GO:0098971) |
| 0.0 | 0.5 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.0 | 0.0 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.0 | 0.0 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
| 0.0 | 0.0 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
| 0.0 | 0.1 | GO:0019303 | D-ribose catabolic process(GO:0019303) |
| 0.0 | 0.1 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.0 | 0.2 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.0 | 1.0 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.1 | GO:0098957 | anterograde axonal transport of mitochondrion(GO:0098957) |
| 0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.0 | GO:0035552 | oxidative single-stranded DNA demethylation(GO:0035552) |
| 0.0 | 0.0 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
| 0.0 | 0.1 | GO:0051255 | spindle midzone assembly(GO:0051255) |
| 0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.0 | GO:0044854 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) |
| 0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 0.2 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.0 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
| 0.0 | 2.3 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.6 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.0 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.0 | 0.1 | GO:1904220 | regulation of serine C-palmitoyltransferase activity(GO:1904220) |
| 0.0 | 0.1 | GO:0061107 | seminal vesicle development(GO:0061107) |
| 0.0 | 0.2 | GO:0051382 | kinetochore assembly(GO:0051382) |
| 0.0 | 0.1 | GO:0035524 | proline transmembrane transport(GO:0035524) |
| 0.0 | 0.2 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) leukocyte adhesion to vascular endothelial cell(GO:0061756) |
| 0.0 | 0.6 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
| 0.0 | 0.3 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.0 | 0.0 | GO:0034445 | regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 0.0 | 1.6 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
| 0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.1 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.0 | 0.0 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.0 | 0.7 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.0 | 0.1 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.0 | 0.2 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.2 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.0 | 0.1 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.0 | 0.8 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.1 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.0 | 0.2 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
| 0.0 | 0.2 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.0 | 0.1 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.0 | 0.0 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.0 | 0.3 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
| 0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.3 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.0 | 0.1 | GO:0002644 | negative regulation of tolerance induction(GO:0002644) |
| 0.0 | 0.3 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.0 | 0.2 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.0 | 0.1 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.0 | 0.1 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.0 | 0.1 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
| 0.0 | 0.2 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.0 | 0.1 | GO:0001865 | NK T cell differentiation(GO:0001865) |
| 0.0 | 0.0 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.0 | 0.0 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 | 0.2 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.1 | GO:0032223 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.0 | 0.1 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.0 | 0.4 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
| 0.0 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.6 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.0 | GO:0007494 | midgut development(GO:0007494) |
| 0.0 | 0.7 | GO:1902850 | microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.0 | 0.1 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 | 0.1 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.0 | 0.3 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.0 | 0.2 | GO:0048755 | branching morphogenesis of a nerve(GO:0048755) |
| 0.0 | 0.1 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.0 | 0.2 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.0 | 0.0 | GO:0010615 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.0 | 0.1 | GO:0006531 | aspartate metabolic process(GO:0006531) |
| 0.0 | 0.3 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.0 | 0.1 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.0 | 0.1 | GO:0019064 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.0 | 0.2 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.0 | 0.3 | GO:0045589 | regulatory T cell differentiation(GO:0045066) regulation of regulatory T cell differentiation(GO:0045589) |
| 0.0 | 0.1 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
| 0.0 | 0.1 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.0 | 0.1 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
| 0.0 | 0.2 | GO:0098582 | innate vocalization behavior(GO:0098582) |
| 0.0 | 0.1 | GO:0034721 | histone H3-K4 demethylation, trimethyl-H3-K4-specific(GO:0034721) |
| 0.0 | 0.6 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.0 | 0.2 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 | 0.1 | GO:1905232 | cellular response to L-glutamate(GO:1905232) |
| 0.0 | 0.1 | GO:0032962 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.0 | 0.1 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
| 0.0 | 0.1 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.0 | 0.1 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.0 | 0.0 | GO:0060061 | Spemann organizer formation(GO:0060061) |
| 0.0 | 0.1 | GO:0046968 | peptide antigen transport(GO:0046968) |
| 0.0 | 0.2 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.0 | 0.3 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 0.1 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 0.1 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.0 | 0.1 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.0 | 0.1 | GO:0051798 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
| 0.0 | 0.1 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.0 | 0.2 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.0 | 0.0 | GO:0071469 | cellular response to alkaline pH(GO:0071469) |
| 0.0 | 0.1 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 | 0.2 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 | 0.2 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.0 | 0.3 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.0 | 0.0 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.0 | 1.0 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.0 | 0.3 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.1 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.2 | GO:0051646 | mitochondrion localization(GO:0051646) |
| 0.0 | 0.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.0 | 0.0 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
| 0.0 | 0.1 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.0 | 0.1 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.0 | 0.2 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.0 | 0.3 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.0 | 0.2 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.0 | 0.2 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.3 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.0 | 0.7 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.3 | GO:1904851 | positive regulation of establishment of protein localization to telomere(GO:1904851) |
| 0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.9 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
| 0.0 | 0.7 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.0 | 3.0 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
| 0.0 | 0.1 | GO:0003373 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.0 | 0.1 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.0 | 0.0 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.0 | 0.4 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.0 | 0.1 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.0 | 0.0 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 | 0.4 | GO:0032608 | interferon-beta production(GO:0032608) |
| 0.0 | 1.7 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.0 | 0.1 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.0 | 0.0 | GO:1900114 | spermatid nucleus elongation(GO:0007290) positive regulation of histone H3-K9 trimethylation(GO:1900114) |
| 0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.0 | 0.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.0 | 0.4 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.2 | GO:0034375 | high-density lipoprotein particle remodeling(GO:0034375) |
| 0.0 | 0.3 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.0 | 0.1 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.0 | 0.0 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.0 | 0.0 | GO:0043012 | regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.0 | 0.2 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.0 | GO:0001188 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.0 | 0.0 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.0 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.0 | GO:0009608 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) positive regulation of fibril organization(GO:1902905) |
| 0.0 | 0.2 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
| 0.0 | 0.0 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.0 | 0.0 | GO:0031627 | telomeric loop formation(GO:0031627) |
| 0.0 | 0.4 | GO:0090128 | regulation of synapse maturation(GO:0090128) |
| 0.0 | 0.3 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
| 0.0 | 0.1 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
| 0.0 | 0.1 | GO:0051310 | metaphase plate congression(GO:0051310) |
| 0.0 | 0.0 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.0 | 0.4 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.3 | GO:0034142 | toll-like receptor 4 signaling pathway(GO:0034142) |
| 0.0 | 0.1 | GO:0097052 | L-kynurenine metabolic process(GO:0097052) |
| 0.0 | 0.3 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.0 | 0.2 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.0 | 0.0 | GO:0005997 | xylulose metabolic process(GO:0005997) |
| 0.0 | 0.0 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
| 0.0 | 0.1 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 0.1 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
| 0.0 | 0.0 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) positive regulation of phosphatidylinositol biosynthetic process(GO:0010513) |
| 0.0 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.0 | 0.0 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.0 | 0.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.0 | 0.1 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.0 | 0.2 | GO:0032570 | response to progesterone(GO:0032570) |
| 0.0 | 0.0 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.0 | 0.0 | GO:1902283 | negative regulation of primary amine oxidase activity(GO:1902283) |
| 0.0 | 0.0 | GO:0045472 | response to ether(GO:0045472) |
| 0.0 | 0.1 | GO:2001171 | positive regulation of ATP biosynthetic process(GO:2001171) |
| 0.0 | 0.1 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.0 | 0.3 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.0 | 0.3 | GO:0006636 | unsaturated fatty acid biosynthetic process(GO:0006636) |
| 0.0 | 1.4 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.0 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.0 | 0.0 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.0 | 0.1 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
| 0.0 | 0.0 | GO:0021978 | telencephalon regionalization(GO:0021978) |
| 0.0 | 0.1 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
| 0.0 | 0.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.0 | 0.2 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.0 | 0.1 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.0 | 0.2 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.0 | 0.1 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 | 0.1 | GO:0060638 | mesenchymal-epithelial cell signaling(GO:0060638) |
| 0.0 | 0.1 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 0.1 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.0 | 0.0 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.0 | 0.5 | GO:0046580 | negative regulation of Ras protein signal transduction(GO:0046580) |
| 0.0 | 0.0 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.0 | 0.4 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) |
| 0.0 | 0.0 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.0 | 0.0 | GO:0032928 | regulation of superoxide anion generation(GO:0032928) |
| 0.0 | 0.0 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.1 | GO:0007176 | regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
| 0.0 | 0.0 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.0 | 0.0 | GO:1902594 | viral penetration into host nucleus(GO:0075732) multi-organism nuclear import(GO:1902594) |
| 0.0 | 0.1 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.0 | 0.1 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.0 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.0 | 0.0 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.0 | 0.0 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.0 | 0.1 | GO:0051299 | centrosome separation(GO:0051299) |
| 0.0 | 0.1 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.0 | 0.1 | GO:0034465 | response to carbon monoxide(GO:0034465) |
| 0.0 | 0.0 | GO:0006864 | pyrimidine nucleotide transport(GO:0006864) mitochondrial pyrimidine nucleotide import(GO:1990519) |
| 0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.2 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.1 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.0 | 0.1 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
| 0.0 | 0.1 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 0.0 | GO:0045953 | negative regulation of natural killer cell mediated cytotoxicity(GO:0045953) |
| 0.0 | 0.0 | GO:0006617 | SRP-dependent cotranslational protein targeting to membrane, signal sequence recognition(GO:0006617) |
| 0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 | 0.1 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.0 | 0.2 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.0 | 0.2 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.1 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.0 | GO:1902775 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.3 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 6.0 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.6 | 2.6 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.5 | 2.0 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.4 | 1.3 | GO:0030689 | Noc complex(GO:0030689) |
| 0.3 | 1.0 | GO:1990723 | cytoplasmic periphery of the nuclear pore complex(GO:1990723) |
| 0.3 | 0.9 | GO:0035525 | NF-kappaB p50/p65 complex(GO:0035525) |
| 0.3 | 0.9 | GO:0044753 | amphisome(GO:0044753) |
| 0.3 | 1.1 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.3 | 1.0 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.2 | 1.2 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.2 | 1.6 | GO:0042825 | TAP complex(GO:0042825) |
| 0.2 | 1.7 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.2 | 1.2 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.2 | 1.0 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.2 | 1.8 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.2 | 0.2 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.2 | 0.9 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.2 | 1.8 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.2 | 0.8 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.2 | 0.6 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.2 | 0.3 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.2 | 1.4 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.1 | 0.7 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 0.4 | GO:0044609 | DBIRD complex(GO:0044609) |
| 0.1 | 0.8 | GO:0060171 | stereocilium membrane(GO:0060171) |
| 0.1 | 0.4 | GO:0001534 | radial spoke(GO:0001534) |
| 0.1 | 0.6 | GO:0060200 | clathrin-sculpted acetylcholine transport vesicle(GO:0060200) clathrin-sculpted acetylcholine transport vesicle membrane(GO:0060201) |
| 0.1 | 0.5 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.1 | 3.3 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.1 | 0.5 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 0.1 | 0.7 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.1 | 0.6 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 2.1 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 0.4 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 0.1 | 0.5 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.1 | 0.1 | GO:0019034 | viral replication complex(GO:0019034) |
| 0.1 | 0.9 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.1 | 0.5 | GO:0035517 | PR-DUB complex(GO:0035517) |
| 0.1 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.1 | 0.6 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.1 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.1 | 0.1 | GO:0036502 | Derlin-1-VIMP complex(GO:0036502) |
| 0.1 | 0.3 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.1 | 0.8 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.1 | 1.2 | GO:0000145 | exocyst(GO:0000145) |
| 0.1 | 0.4 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 0.3 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.1 | 0.3 | GO:0060987 | lipid tube(GO:0060987) |
| 0.1 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.1 | 1.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.1 | 0.3 | GO:0005606 | laminin-1 complex(GO:0005606) |
| 0.1 | 1.0 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.1 | 0.5 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.1 | 0.3 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) proton-transporting ATP synthase complex(GO:0045259) |
| 0.1 | 0.5 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 0.3 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
| 0.1 | 0.4 | GO:0031302 | intrinsic component of endosome membrane(GO:0031302) |
| 0.1 | 1.0 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.1 | 0.4 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.1 | 0.5 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 0.3 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.1 | 0.3 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 0.5 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 0.4 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.1 | 2.0 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.7 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 0.9 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 0.7 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 0.7 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 0.6 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.1 | 0.5 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.1 | 0.7 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.1 | 0.6 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.1 | 0.1 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.1 | 0.4 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 0.9 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 0.5 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 0.2 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.1 | 0.2 | GO:0060342 | photoreceptor inner segment membrane(GO:0060342) |
| 0.1 | 1.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 0.5 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.1 | 0.2 | GO:0030849 | autosome(GO:0030849) |
| 0.1 | 1.0 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.1 | 1.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 0.2 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.1 | 0.4 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.1 | 0.2 | GO:0000229 | cytoplasmic chromosome(GO:0000229) |
| 0.1 | 1.1 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 1.0 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 0.7 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.2 | GO:0036387 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.1 | 0.9 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.1 | 0.3 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 0.1 | 0.3 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.1 | 1.0 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.1 | 1.4 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.1 | 0.2 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
| 0.1 | 0.5 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 0.6 | GO:0010369 | chromocenter(GO:0010369) |
| 0.1 | 1.5 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.1 | 0.2 | GO:0016938 | kinesin I complex(GO:0016938) |
| 0.1 | 0.3 | GO:0070288 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.1 | 0.2 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.1 | 0.8 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.1 | 0.7 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.1 | 0.5 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.1 | 0.3 | GO:0001741 | XY body(GO:0001741) |
| 0.1 | 0.9 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.1 | 0.1 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 0.1 | 0.5 | GO:0034687 | integrin alphaL-beta2 complex(GO:0034687) |
| 0.1 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.1 | 0.5 | GO:0005587 | collagen type IV trimer(GO:0005587) |
| 0.1 | 0.4 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.1 | 0.2 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.1 | 0.3 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 0.3 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.1 | 4.5 | GO:0000792 | heterochromatin(GO:0000792) |
| 0.1 | 1.4 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 0.4 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.1 | 0.2 | GO:1990761 | growth cone lamellipodium(GO:1990761) growth cone filopodium(GO:1990812) |
| 0.1 | 0.4 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 0.1 | 3.1 | GO:0002102 | podosome(GO:0002102) |
| 0.1 | 0.2 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.0 | 0.3 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.4 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 0.2 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.0 | 1.2 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 1.2 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.1 | GO:0036338 | viral envelope(GO:0019031) viral membrane(GO:0036338) |
| 0.0 | 0.3 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.0 | 0.3 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.3 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.3 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.4 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.3 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.2 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.7 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.4 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.2 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
| 0.0 | 0.3 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.0 | 0.7 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.1 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
| 0.0 | 0.3 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.0 | 0.6 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 1.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.5 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.0 | 0.6 | GO:0032059 | bleb(GO:0032059) |
| 0.0 | 0.1 | GO:1990742 | microvesicle(GO:1990742) |
| 0.0 | 0.7 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.3 | GO:0043256 | laminin complex(GO:0043256) |
| 0.0 | 0.1 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.0 | 1.0 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.3 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.0 | 0.4 | GO:0043203 | axon hillock(GO:0043203) |
| 0.0 | 0.9 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.4 | GO:0070449 | elongin complex(GO:0070449) |
| 0.0 | 0.4 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.3 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 2.1 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 4.8 | GO:0035578 | azurophil granule lumen(GO:0035578) |
| 0.0 | 0.0 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.0 | 0.1 | GO:0097180 | protein C inhibitor-TMPRSS7 complex(GO:0036024) protein C inhibitor-TMPRSS11E complex(GO:0036025) protein C inhibitor-PLAT complex(GO:0036026) protein C inhibitor-PLAU complex(GO:0036027) protein C inhibitor-thrombin complex(GO:0036028) protein C inhibitor-KLK3 complex(GO:0036029) protein C inhibitor-plasma kallikrein complex(GO:0036030) serine protease inhibitor complex(GO:0097180) protein C inhibitor-coagulation factor V complex(GO:0097181) protein C inhibitor-coagulation factor Xa complex(GO:0097182) protein C inhibitor-coagulation factor XI complex(GO:0097183) |
| 0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.0 | 1.1 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 0.1 | GO:1990879 | CST complex(GO:1990879) |
| 0.0 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.0 | 0.8 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 0.2 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.8 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.3 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 1.7 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.0 | 0.3 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 0.5 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.5 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.2 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.0 | 0.2 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.0 | 1.2 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.1 | GO:0044754 | autolysosome(GO:0044754) |
| 0.0 | 0.2 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 0.5 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.1 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.0 | 0.3 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.8 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.4 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.0 | 0.2 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.0 | 0.1 | GO:0044453 | nuclear membrane part(GO:0044453) |
| 0.0 | 0.3 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.6 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.0 | 0.2 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.3 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.3 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.4 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.5 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.3 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.0 | 0.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.6 | GO:0005861 | troponin complex(GO:0005861) |
| 0.0 | 0.1 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.0 | 0.2 | GO:1990745 | EARP complex(GO:1990745) |
| 0.0 | 2.8 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 2.6 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.3 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.7 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.3 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.0 | 0.1 | GO:0042611 | MHC protein complex(GO:0042611) |
| 0.0 | 3.3 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.3 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 1.1 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 0.9 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.7 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.0 | 0.3 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 0.4 | GO:0031906 | late endosome lumen(GO:0031906) |
| 0.0 | 0.1 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.0 | 3.5 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.1 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
| 0.0 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.2 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.2 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.5 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.1 | GO:0035841 | new growing cell tip(GO:0035841) |
| 0.0 | 0.1 | GO:0071753 | IgM immunoglobulin complex(GO:0071753) IgM immunoglobulin complex, circulating(GO:0071754) pentameric IgM immunoglobulin complex(GO:0071756) |
| 0.0 | 0.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.4 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
| 0.0 | 0.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 1.5 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.0 | 0.1 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
| 0.0 | 0.4 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 1.2 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.4 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 0.2 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.3 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.5 | GO:0036038 | MKS complex(GO:0036038) |
| 0.0 | 1.3 | GO:0035580 | specific granule lumen(GO:0035580) |
| 0.0 | 0.1 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 1.6 | GO:0005776 | autophagosome(GO:0005776) |
| 0.0 | 0.1 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.0 | 2.5 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 0.5 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.3 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.2 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.0 | 1.3 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
| 0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.4 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 0.3 | GO:0038201 | TOR complex(GO:0038201) |
| 0.0 | 0.6 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 0.1 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.0 | 0.2 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
| 0.0 | 0.3 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.0 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.1 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.0 | 0.2 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 0.1 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 1.0 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
| 0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
| 0.0 | 0.0 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.0 | 0.0 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 0.4 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.0 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.0 | 0.1 | GO:0019774 | proteasome core complex, beta-subunit complex(GO:0019774) |
| 0.0 | 0.4 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.1 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.0 | 1.7 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 2.4 | GO:0030496 | midbody(GO:0030496) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.0 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.0 | 0.9 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.0 | 0.3 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.0 | 0.1 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.0 | 1.4 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 0.0 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.0 | 0.7 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.1 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.0 | 11.1 | GO:0000139 | Golgi membrane(GO:0000139) |
| 0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.6 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 0.1 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
| 0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.1 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 0.1 | GO:0072589 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.0 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.0 | 0.7 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.0 | 0.1 | GO:0042627 | chylomicron(GO:0042627) |
| 0.0 | 0.3 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.3 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
| 0.0 | 0.2 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.1 | GO:0033643 | host cell part(GO:0033643) |
| 0.0 | 0.0 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 2.5 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.0 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.0 | 0.2 | GO:0005685 | U1 snRNP(GO:0005685) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 2.3 | GO:0008478 | pyridoxal kinase activity(GO:0008478) |
| 0.6 | 1.7 | GO:0009032 | thymidine phosphorylase activity(GO:0009032) pyrimidine-nucleoside phosphorylase activity(GO:0016154) |
| 0.5 | 1.5 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 0.5 | 2.0 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
| 0.5 | 1.4 | GO:0042008 | interleukin-18 receptor activity(GO:0042008) |
| 0.4 | 1.3 | GO:0070362 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.4 | 2.0 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.4 | 2.3 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.3 | 3.8 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.3 | 1.0 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.3 | 0.9 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.3 | 1.8 | GO:0004122 | cystathionine beta-synthase activity(GO:0004122) |
| 0.3 | 1.2 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.3 | 0.9 | GO:0001002 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.3 | 0.8 | GO:0004912 | interleukin-3 receptor activity(GO:0004912) |
| 0.3 | 1.3 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.2 | 1.0 | GO:0004906 | interferon-gamma receptor activity(GO:0004906) |
| 0.2 | 0.7 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.2 | 2.0 | GO:0046979 | TAP2 binding(GO:0046979) |
| 0.2 | 0.7 | GO:0033842 | N-acetyl-beta-glucosaminyl-glycoprotein 4-beta-N-acetylgalactosaminyltransferase activity(GO:0033842) |
| 0.2 | 1.2 | GO:0004882 | androgen receptor activity(GO:0004882) |
| 0.2 | 0.2 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.2 | 0.7 | GO:0004056 | argininosuccinate lyase activity(GO:0004056) |
| 0.2 | 0.9 | GO:0036080 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.2 | 0.9 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.2 | 1.4 | GO:0042806 | fucose binding(GO:0042806) |
| 0.2 | 2.2 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.2 | 0.9 | GO:0046592 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.2 | 1.1 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.2 | 2.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.2 | 1.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.2 | 2.5 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
| 0.2 | 1.7 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.2 | 1.7 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.2 | 0.2 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.2 | 0.6 | GO:0005292 | high-affinity basic amino acid transmembrane transporter activity(GO:0005287) high-affinity arginine transmembrane transporter activity(GO:0005289) high-affinity lysine transmembrane transporter activity(GO:0005292) |
| 0.2 | 0.6 | GO:0050528 | acyloxyacyl hydrolase activity(GO:0050528) |
| 0.2 | 0.6 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
| 0.2 | 0.8 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.2 | 2.9 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.2 | 0.6 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.2 | 0.8 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
| 0.2 | 0.6 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 0.2 | 0.8 | GO:0004360 | glutamine-fructose-6-phosphate transaminase (isomerizing) activity(GO:0004360) |
| 0.2 | 0.8 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.2 | 3.9 | GO:0048185 | activin binding(GO:0048185) |
| 0.2 | 0.6 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.2 | 0.7 | GO:0033897 | ribonuclease T2 activity(GO:0033897) |
| 0.2 | 1.7 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.2 | 0.7 | GO:0032450 | maltose alpha-glucosidase activity(GO:0032450) |
| 0.2 | 0.5 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.2 | 1.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.2 | 0.5 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.2 | 2.8 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.2 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.2 | 1.6 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.2 | 0.5 | GO:0016419 | [acyl-carrier-protein] S-malonyltransferase activity(GO:0004314) S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
| 0.2 | 1.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.2 | 0.6 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
| 0.2 | 0.5 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.2 | 0.9 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.2 | 1.4 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.2 | 0.6 | GO:1901375 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.2 | 1.4 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.2 | 0.5 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.2 | 0.6 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.2 | 0.5 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 0.2 | 1.8 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.2 | 0.8 | GO:0030375 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.2 | 0.6 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.1 | 1.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.1 | 1.2 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.1 | 0.6 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.1 | 1.0 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.1 | 0.6 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.1 | 0.4 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.1 | 0.7 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 2.0 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.5 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.1 | 0.5 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.1 | 0.7 | GO:0004803 | transposase activity(GO:0004803) |
| 0.1 | 0.7 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.4 | GO:0004608 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.1 | 0.8 | GO:0031962 | mineralocorticoid receptor binding(GO:0031962) |
| 0.1 | 1.3 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.1 | 1.0 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 1.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 0.5 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.1 | 0.6 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.9 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.4 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 0.5 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.1 | 0.6 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 0.6 | GO:0005497 | androgen binding(GO:0005497) |
| 0.1 | 0.6 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.8 | GO:0015333 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.1 | 1.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 0.4 | GO:0050571 | 1,5-anhydro-D-fructose reductase activity(GO:0050571) |
| 0.1 | 0.6 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.1 | 0.5 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.1 | 0.7 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.1 | 0.9 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.1 | 0.3 | GO:0016497 | substance K receptor activity(GO:0016497) |
| 0.1 | 2.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.1 | 0.5 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.1 | 0.4 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.1 | 0.6 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
| 0.1 | 0.4 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.1 | 0.3 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.1 | 0.3 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.1 | 2.4 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
| 0.1 | 1.0 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 0.5 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.1 | 0.4 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 0.1 | 0.4 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.1 | 2.3 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.1 | 0.4 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.1 | 0.2 | GO:0031696 | alpha-2C adrenergic receptor binding(GO:0031696) |
| 0.1 | 0.3 | GO:0050509 | N-acetylglucosaminyl-proteoglycan 4-beta-glucuronosyltransferase activity(GO:0050509) |
| 0.1 | 1.6 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 0.3 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 0.1 | 0.3 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.1 | 0.2 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.1 | 0.4 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 0.6 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.1 | 2.3 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.1 | 0.7 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.1 | 1.4 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 1.4 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.1 | 0.8 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.1 | 0.2 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
| 0.1 | 1.1 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.1 | 0.8 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 0.3 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.1 | 0.6 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
| 0.1 | 0.8 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.1 | 0.5 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.1 | 0.6 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.1 | 0.4 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 1.4 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.1 | 0.9 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.1 | 0.3 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.1 | 0.7 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.1 | 0.4 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.1 | 0.7 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.1 | 0.3 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 0.8 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.3 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.1 | 1.0 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 0.3 | GO:0047783 | steroid 11-beta-monooxygenase activity(GO:0004507) corticosterone 18-monooxygenase activity(GO:0047783) |
| 0.1 | 0.2 | GO:0033749 | histone demethylase activity (H3-R2 specific)(GO:0033746) histone demethylase activity (H4-R3 specific)(GO:0033749) |
| 0.1 | 0.6 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.1 | 0.4 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.1 | 0.9 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.1 | 0.2 | GO:0098918 | structural constituent of synapse(GO:0098918) structural constituent of postsynaptic actin cytoskeleton(GO:0098973) |
| 0.1 | 0.2 | GO:0008903 | hydroxypyruvate isomerase activity(GO:0008903) |
| 0.1 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 0.2 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.1 | 2.1 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.1 | 0.5 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.1 | 2.5 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.1 | 0.4 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.1 | 0.4 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.1 | 0.2 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.1 | 0.5 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.1 | 1.6 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 0.2 | GO:0051120 | hepoxilin A3 synthase activity(GO:0051120) |
| 0.1 | 0.8 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 0.3 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.1 | 4.4 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.1 | 0.3 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.1 | 0.3 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.1 | 0.3 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.1 | 0.6 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.1 | 0.4 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.1 | 1.4 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.1 | 0.7 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.1 | 0.3 | GO:0032406 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.1 | 0.3 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.1 | 0.3 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.1 | 0.4 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.1 | 0.3 | GO:0004979 | beta-endorphin receptor activity(GO:0004979) morphine receptor activity(GO:0038047) |
| 0.1 | 0.8 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.1 | 0.4 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.1 | 0.9 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 0.4 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.1 | 0.4 | GO:0008969 | phosphohistidine phosphatase activity(GO:0008969) |
| 0.1 | 1.6 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.1 | 0.6 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.1 | 0.4 | GO:0005298 | proline:sodium symporter activity(GO:0005298) |
| 0.1 | 0.8 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.1 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.1 | 0.4 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.1 | 0.1 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
| 0.1 | 0.7 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.1 | 0.7 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.1 | 2.0 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.1 | 0.3 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.1 | 0.3 | GO:0034353 | RNA pyrophosphohydrolase activity(GO:0034353) |
| 0.1 | 0.3 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.1 | 0.3 | GO:0038049 | transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) |
| 0.1 | 0.4 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.1 | 0.7 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.1 | 0.8 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.1 | 0.4 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 0.4 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
| 0.1 | 0.1 | GO:0097604 | temperature-gated cation channel activity(GO:0097604) |
| 0.1 | 0.7 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.1 | 0.8 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 0.2 | GO:0035651 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
| 0.1 | 0.6 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.7 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 1.7 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.4 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.1 | 0.3 | GO:0046997 | oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
| 0.1 | 2.7 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.1 | 0.2 | GO:0031687 | A2A adenosine receptor binding(GO:0031687) |
| 0.1 | 1.0 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 0.4 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.1 | 0.3 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) |
| 0.1 | 0.3 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.1 | 0.6 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.1 | 1.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 1.3 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 1.4 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.1 | 0.1 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.1 | 0.8 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.1 | 0.4 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.1 | 0.2 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
| 0.1 | 0.2 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.1 | 1.3 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.1 | 0.3 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 0.1 | 0.4 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.1 | 0.2 | GO:0004796 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.1 | 0.3 | GO:0004515 | nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.1 | 0.3 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.1 | 0.2 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.1 | 0.7 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
| 0.1 | 0.2 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.1 | 0.3 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.1 | 0.2 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 0.3 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 0.1 | GO:0086059 | voltage-gated calcium channel activity involved SA node cell action potential(GO:0086059) |
| 0.1 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.1 | 0.3 | GO:0030298 | receptor signaling protein tyrosine kinase activator activity(GO:0030298) |
| 0.1 | 1.2 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.6 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 0.5 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 0.1 | 0.2 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.1 | 1.4 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.1 | 0.5 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.1 | 0.3 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 0.4 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.1 | 0.7 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 0.3 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.1 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 0.3 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.1 | 0.6 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.1 | 1.3 | GO:0015368 | calcium:cation antiporter activity(GO:0015368) |
| 0.1 | 0.2 | GO:0016495 | C-X3-C chemokine receptor activity(GO:0016495) |
| 0.1 | 0.3 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.1 | 0.1 | GO:0070404 | NADH binding(GO:0070404) |
| 0.1 | 0.5 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.1 | 0.2 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
| 0.1 | 0.6 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.1 | 1.0 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.1 | 0.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.1 | 0.2 | GO:0036505 | prosaposin receptor activity(GO:0036505) |
| 0.1 | 0.3 | GO:0015307 | drug:proton antiporter activity(GO:0015307) |
| 0.1 | 0.2 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.1 | 0.2 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 0.1 | 1.2 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.1 | 0.1 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.1 | 0.6 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.1 | 1.6 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.1 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 0.4 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.0 | 1.7 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.8 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.0 | 0.2 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.0 | 1.3 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.0 | 0.5 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.0 | 1.0 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.0 | 0.2 | GO:1904315 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.0 | 1.8 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 1.5 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.0 | 0.3 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.0 | 0.2 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.0 | 1.2 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.0 | 0.4 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 0.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.2 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.0 | 1.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.7 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.6 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.2 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.0 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.0 | 0.1 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
| 0.0 | 0.1 | GO:0004418 | hydroxymethylbilane synthase activity(GO:0004418) |
| 0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.0 | 0.5 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.2 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.0 | 0.3 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.0 | 0.3 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.1 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
| 0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.6 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.2 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.0 | 1.1 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 0.8 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.1 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.0 | 0.6 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.4 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.0 | 0.5 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 2.3 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
| 0.0 | 0.5 | GO:0043176 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.0 | 0.3 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.0 | 0.6 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.0 | 0.9 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 1.1 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.3 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.0 | 0.8 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.0 | 0.3 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.0 | 5.9 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.0 | 0.2 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 1.0 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.6 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.0 | 0.4 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 0.0 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.0 | 0.6 | GO:0043295 | glutathione binding(GO:0043295) |
| 0.0 | 0.4 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 0.3 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 1.0 | GO:0046961 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.0 | 0.4 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.2 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.0 | 0.3 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.0 | 0.1 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.0 | 0.2 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 0.7 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.0 | 0.2 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.0 | 0.5 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.0 | 0.3 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.4 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.0 | 1.1 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.5 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.0 | 0.1 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.0 | 1.2 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.3 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 0.5 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.0 | 0.4 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.0 | 0.3 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.0 | 1.1 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.3 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.0 | 0.5 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.0 | 0.5 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.0 | 0.4 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.0 | 0.9 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.0 | 2.5 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.0 | 0.9 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.4 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.0 | 0.2 | GO:0001595 | angiotensin receptor activity(GO:0001595) angiotensin type II receptor activity(GO:0004945) |
| 0.0 | 0.4 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.2 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
| 0.0 | 0.0 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.1 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 1.0 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.1 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
| 0.0 | 0.3 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.1 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 0.3 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.2 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 0.0 | 0.9 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.0 | 0.1 | GO:0090422 | thiamine pyrophosphate transporter activity(GO:0090422) |
| 0.0 | 0.3 | GO:0019863 | IgE binding(GO:0019863) |
| 0.0 | 0.1 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.0 | 0.1 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.0 | 0.1 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
| 0.0 | 0.1 | GO:0004051 | arachidonate 5-lipoxygenase activity(GO:0004051) |
| 0.0 | 0.4 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 0.2 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.0 | 0.4 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.1 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.0 | 0.3 | GO:0036122 | BMP binding(GO:0036122) |
| 0.0 | 1.0 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.1 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.0 | 0.2 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.0 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.0 | 0.8 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.9 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.3 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.0 | 0.2 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.0 | 0.6 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.4 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.0 | 0.1 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.0 | 1.6 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 1.2 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.5 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
| 0.0 | 0.2 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
| 0.0 | 0.1 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
| 0.0 | 0.5 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 0.1 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 0.0 | 0.2 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.0 | 0.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 1.9 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.1 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.0 | 0.1 | GO:0004629 | phospholipase C activity(GO:0004629) |
| 0.0 | 0.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.1 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 0.7 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.0 | 0.4 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.0 | 0.9 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
| 0.0 | 0.6 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 0.2 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.2 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.0 | 0.7 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.1 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.0 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.0 | 0.9 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.3 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.4 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 0.1 | GO:0031753 | endothelial differentiation G-protein coupled receptor binding(GO:0031753) Edg-2 lysophosphatidic acid receptor binding(GO:0031755) |
| 0.0 | 0.4 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.3 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.0 | 0.5 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.4 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.3 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.2 | GO:0008556 | potassium-transporting ATPase activity(GO:0008556) |
| 0.0 | 0.2 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.1 | GO:0030955 | potassium ion binding(GO:0030955) |
| 0.0 | 1.3 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.1 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
| 0.0 | 0.2 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.0 | 1.8 | GO:0008026 | ATP-dependent RNA helicase activity(GO:0004004) ATP-dependent helicase activity(GO:0008026) RNA-dependent ATPase activity(GO:0008186) purine NTP-dependent helicase activity(GO:0070035) |
| 0.0 | 0.6 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 1.2 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.2 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 0.1 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) hydrolase activity, acting on ether bonds(GO:0016801) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.4 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.0 | 0.3 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.0 | 0.4 | GO:0051184 | cofactor transporter activity(GO:0051184) |
| 0.0 | 0.9 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.6 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.0 | 0.1 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.0 | 0.3 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.0 | 0.2 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.0 | 0.3 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.0 | 0.1 | GO:0019798 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.0 | 0.1 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.0 | 0.0 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.0 | 0.0 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 0.0 | 0.1 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.0 | 0.1 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.0 | 0.1 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.0 | 0.2 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.0 | 2.7 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.2 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.0 | 0.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.0 | 0.5 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.8 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.9 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.0 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.0 | 8.7 | GO:0030695 | GTPase regulator activity(GO:0030695) |
| 0.0 | 0.1 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
| 0.0 | 0.2 | GO:0035240 | dopamine binding(GO:0035240) |
| 0.0 | 0.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.1 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.2 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.0 | 0.4 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 0.2 | GO:0010181 | FMN binding(GO:0010181) |
| 0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.0 | 0.2 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.0 | 0.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.2 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.0 | 0.2 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.0 | 0.1 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 0.0 | 0.1 | GO:1900750 | oligopeptide binding(GO:1900750) |
| 0.0 | 0.1 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.0 | 0.0 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.0 | 0.6 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 5.5 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 0.1 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
| 0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.3 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.1 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.0 | 0.1 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 0.0 | 0.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.1 | GO:1904929 | coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.0 | 0.0 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.0 | 0.1 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.0 | 0.1 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.0 | 0.1 | GO:0005163 | nerve growth factor receptor binding(GO:0005163) |
| 0.0 | 0.2 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.0 | 0.1 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.0 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 0.0 | 0.0 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 1.4 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.0 | 0.1 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.0 | 0.1 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.0 | 0.1 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.1 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.0 | 0.4 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 0.2 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.0 | GO:0004963 | follicle-stimulating hormone receptor activity(GO:0004963) |
| 0.0 | 0.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.1 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.0 | 0.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.0 | 0.5 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.0 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.1 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.0 | 0.1 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.0 | 0.1 | GO:0008967 | phosphoglycolate phosphatase activity(GO:0008967) |
| 0.0 | 0.0 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.0 | 0.2 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
| 0.0 | 0.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 0.1 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.0 | GO:0004992 | platelet activating factor receptor activity(GO:0004992) |
| 0.0 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.0 | 0.1 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.0 | 0.3 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.0 | 0.3 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.6 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.1 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) |
| 0.0 | 0.3 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.0 | 0.0 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.0 | 0.1 | GO:1902444 | riboflavin binding(GO:1902444) |
| 0.0 | 0.2 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.0 | 0.4 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.0 | 0.1 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.0 | 0.0 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.0 | 0.2 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.0 | 0.3 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
| 0.0 | 0.2 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.0 | 0.1 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.3 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 0.5 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.5 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.1 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.3 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.0 | 0.5 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.0 | 0.0 | GO:0070039 | rRNA (guanosine-2'-O-)-methyltransferase activity(GO:0070039) |
| 0.0 | 0.0 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.0 | 0.0 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.0 | 0.1 | GO:0004522 | ribonuclease A activity(GO:0004522) |
| 0.0 | 0.0 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.0 | 0.0 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.0 | 0.0 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.0 | 0.1 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.0 | 0.6 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.0 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.0 | 0.0 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 0.0 | 0.1 | GO:0016918 | retinal binding(GO:0016918) |
| 0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.0 | 0.1 | GO:0030197 | extracellular matrix constituent, lubricant activity(GO:0030197) |
| 0.0 | 0.4 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.1 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.0 | 0.1 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.0 | 0.1 | GO:0044213 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) intronic transcription regulatory region DNA binding(GO:0044213) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 4.1 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.1 | 0.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 7.3 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.1 | 1.7 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 5.0 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.1 | 4.8 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.1 | 4.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 2.8 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.1 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.1 | 3.1 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 0.5 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 3.1 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 1.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 0.3 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 2.6 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.1 | 4.6 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.1 | 3.1 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 1.1 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 2.9 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 1.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.1 | 1.2 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 1.8 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.1 | 1.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 3.5 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.1 | 1.7 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.9 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 2.7 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 1.7 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.7 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 3.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.8 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 1.6 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 1.1 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 1.8 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.0 | 1.5 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 1.0 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 3.5 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 2.0 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 1.2 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.6 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 2.6 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 3.4 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.6 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.0 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.7 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.0 | 0.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.0 | 0.7 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.3 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.7 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.4 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 1.3 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 1.9 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 0.5 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.4 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.0 | 0.3 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 0.1 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.0 | 2.9 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.0 | 0.3 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.5 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.8 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 2.1 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.0 | 0.4 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.8 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.9 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 0.6 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.5 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.5 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 11.3 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.6 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 1.1 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.0 | 1.6 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.1 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 1.6 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.0 | 0.7 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.0 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.4 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.3 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 0.1 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.3 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.2 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.9 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 1.1 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.8 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 0.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 1.4 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.5 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 2.1 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 0.3 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.3 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 0.2 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.4 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 3.0 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.3 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 0.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 3.6 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.2 | 2.5 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.2 | 0.5 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.1 | 4.1 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.1 | 6.2 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.1 | 0.8 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.1 | 3.1 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.1 | 0.4 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
| 0.1 | 0.1 | REACTOME INSULIN RECEPTOR SIGNALLING CASCADE | Genes involved in Insulin receptor signalling cascade |
| 0.1 | 2.6 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.1 | 0.7 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.1 | 2.8 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.1 | 1.8 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 2.0 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.1 | 0.1 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.1 | 0.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.1 | 1.8 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.1 | 1.5 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 0.3 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
| 0.1 | 1.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.1 | 4.0 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.1 | 0.6 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.1 | 1.3 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 1.3 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.1 | 5.3 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 2.3 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 2.8 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.1 | 0.7 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.1 | 1.2 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 0.1 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.1 | 0.3 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.1 | 0.3 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
| 0.1 | 0.1 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.1 | 1.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.1 | 1.9 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.1 | 1.4 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.1 | 1.6 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.1 | 5.9 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.1 | 4.4 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 0.8 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.1 | 1.6 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 1.3 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 0.2 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 0.4 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.1 | 1.3 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.1 | 0.7 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.1 | 0.9 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.1 | 0.8 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.1 | 1.2 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.1 | 0.7 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 2.2 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.1 | 4.1 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.1 | 1.8 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.1 | 0.4 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.1 | 1.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.1 | 1.1 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.1 | 2.2 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.1 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.1 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 1.6 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.9 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 4.0 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.7 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 1.0 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 1.7 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 1.5 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 1.4 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.6 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 1.0 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 1.0 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.3 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
| 0.0 | 1.3 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 2.4 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
| 0.0 | 0.8 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 3.8 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.0 | 1.2 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.0 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.0 | 1.0 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.2 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.0 | 1.0 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 3.1 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 1.1 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.0 | 0.4 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.4 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.0 | 0.8 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.0 | 1.1 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.5 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 2.3 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.9 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 1.3 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.5 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 1.0 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 1.0 | REACTOME BASE EXCISION REPAIR | Genes involved in Base Excision Repair |
| 0.0 | 1.6 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 1.2 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.6 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.5 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 2.6 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 1.3 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
| 0.0 | 0.5 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.5 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.3 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 1.9 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.3 | REACTOME ACTIVATED TLR4 SIGNALLING | Genes involved in Activated TLR4 signalling |
| 0.0 | 0.6 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.6 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.0 | 1.1 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.8 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
| 0.0 | 0.2 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
| 0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.0 | 0.4 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.5 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.0 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 1.5 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.0 | 2.1 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.0 | 2.1 | REACTOME MEIOSIS | Genes involved in Meiosis |
| 0.0 | 0.4 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.0 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 2.5 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.4 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.5 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.4 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.0 | 0.2 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 0.3 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.3 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 0.1 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.5 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.3 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 3.0 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.5 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.0 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.0 | 1.2 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 0.6 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 0.0 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 1.0 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.0 | 1.0 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.2 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.0 | 1.9 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
| 0.0 | 0.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.1 | REACTOME CELL CELL COMMUNICATION | Genes involved in Cell-Cell communication |
| 0.0 | 0.0 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
| 0.0 | 0.1 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |