| 2.7 |
13.7 |
GO:0003070 |
age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 2.7 |
8.2 |
GO:1900163 |
regulation of phospholipid scramblase activity(GO:1900161) positive regulation of phospholipid scramblase activity(GO:1900163) regulation of glucosylceramide catabolic process(GO:2000752) positive regulation of glucosylceramide catabolic process(GO:2000753) regulation of sphingomyelin catabolic process(GO:2000754) positive regulation of sphingomyelin catabolic process(GO:2000755) |
| 2.0 |
5.9 |
GO:0045062 |
extrathymic T cell selection(GO:0045062) |
| 1.9 |
5.7 |
GO:0009720 |
detection of hormone stimulus(GO:0009720) |
| 1.8 |
5.4 |
GO:0046967 |
cytosol to ER transport(GO:0046967) |
| 1.7 |
5.2 |
GO:1903400 |
L-arginine transmembrane transport(GO:1903400) |
| 1.5 |
6.0 |
GO:1990108 |
protein linear deubiquitination(GO:1990108) |
| 1.4 |
4.3 |
GO:0048250 |
mitochondrial iron ion transport(GO:0048250) |
| 1.4 |
4.3 |
GO:0061182 |
negative regulation of chondrocyte development(GO:0061182) |
| 1.4 |
4.1 |
GO:0043006 |
activation of phospholipase A2 activity by calcium-mediated signaling(GO:0043006) |
| 1.3 |
4.0 |
GO:0061027 |
umbilical cord morphogenesis(GO:0036304) umbilical cord development(GO:0061027) |
| 1.3 |
3.9 |
GO:0070902 |
mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 1.2 |
5.8 |
GO:0033159 |
negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 1.1 |
3.3 |
GO:0051040 |
regulation of calcium-independent cell-cell adhesion(GO:0051040) |
| 1.1 |
8.4 |
GO:0007506 |
gonadal mesoderm development(GO:0007506) |
| 1.0 |
3.1 |
GO:0061394 |
regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 1.0 |
3.1 |
GO:0046521 |
sphingoid catabolic process(GO:0046521) |
| 1.0 |
4.2 |
GO:0002268 |
follicular dendritic cell differentiation(GO:0002268) |
| 1.0 |
3.1 |
GO:0052250 |
modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.9 |
7.5 |
GO:0090625 |
mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.9 |
4.5 |
GO:1900127 |
positive regulation of hyaluronan biosynthetic process(GO:1900127) |
| 0.9 |
3.5 |
GO:2001247 |
positive regulation of phosphatidylcholine biosynthetic process(GO:2001247) |
| 0.9 |
2.6 |
GO:1901492 |
positive regulation of lymphangiogenesis(GO:1901492) |
| 0.9 |
10.5 |
GO:0030578 |
PML body organization(GO:0030578) |
| 0.9 |
2.6 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.8 |
2.4 |
GO:0052151 |
positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.8 |
3.9 |
GO:0001575 |
globoside metabolic process(GO:0001575) |
| 0.8 |
2.3 |
GO:1900194 |
negative regulation of oocyte maturation(GO:1900194) |
| 0.8 |
3.0 |
GO:0035740 |
CD8-positive, alpha-beta T cell proliferation(GO:0035740) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
| 0.7 |
0.7 |
GO:0009233 |
menaquinone metabolic process(GO:0009233) |
| 0.7 |
2.9 |
GO:0002296 |
T-helper 1 cell lineage commitment(GO:0002296) |
| 0.7 |
2.1 |
GO:0038156 |
interleukin-3-mediated signaling pathway(GO:0038156) |
| 0.7 |
2.1 |
GO:1901899 |
positive regulation of relaxation of cardiac muscle(GO:1901899) |
| 0.7 |
2.8 |
GO:1902568 |
positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
| 0.7 |
2.1 |
GO:0006117 |
acetaldehyde metabolic process(GO:0006117) |
| 0.7 |
2.8 |
GO:0009447 |
putrescine catabolic process(GO:0009447) |
| 0.7 |
2.1 |
GO:0046108 |
uridine metabolic process(GO:0046108) |
| 0.7 |
3.4 |
GO:0043974 |
histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.7 |
4.1 |
GO:0035617 |
stress granule disassembly(GO:0035617) |
| 0.7 |
4.8 |
GO:2000860 |
positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.6 |
1.3 |
GO:1902226 |
regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
| 0.6 |
1.3 |
GO:0033590 |
response to cobalamin(GO:0033590) |
| 0.6 |
1.9 |
GO:0061573 |
endoplasmic reticulum polarization(GO:0061163) actin filament bundle retrograde transport(GO:0061573) actin filament bundle distribution(GO:0070650) |
| 0.6 |
3.2 |
GO:2000836 |
androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.6 |
8.2 |
GO:0036155 |
acylglycerol acyl-chain remodeling(GO:0036155) |
| 0.6 |
5.0 |
GO:0034773 |
histone H4-K20 trimethylation(GO:0034773) |
| 0.6 |
2.5 |
GO:1904141 |
positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.6 |
1.9 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.6 |
1.8 |
GO:2000276 |
negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.6 |
5.5 |
GO:0070212 |
protein poly-ADP-ribosylation(GO:0070212) |
| 0.6 |
3.1 |
GO:0002357 |
defense response to tumor cell(GO:0002357) |
| 0.6 |
3.6 |
GO:0061767 |
negative regulation of lung blood pressure(GO:0061767) |
| 0.6 |
3.6 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.6 |
2.4 |
GO:0070378 |
positive regulation of ERK5 cascade(GO:0070378) |
| 0.6 |
1.7 |
GO:0018395 |
peptidyl-lysine hydroxylation to 5-hydroxy-L-lysine(GO:0018395) histone arginine demethylation(GO:0070077) histone H3-R2 demethylation(GO:0070078) histone H4-R3 demethylation(GO:0070079) |
| 0.6 |
2.3 |
GO:2001226 |
negative regulation of chloride transport(GO:2001226) |
| 0.6 |
1.7 |
GO:0090222 |
centrosome-templated microtubule nucleation(GO:0090222) |
| 0.6 |
1.7 |
GO:0001560 |
regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.6 |
6.8 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.6 |
0.6 |
GO:0060738 |
epithelial-mesenchymal signaling involved in prostate gland development(GO:0060738) |
| 0.6 |
1.1 |
GO:1903826 |
arginine transmembrane transport(GO:1903826) |
| 0.6 |
0.6 |
GO:0061346 |
non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
| 0.6 |
2.2 |
GO:0000738 |
DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.5 |
1.6 |
GO:0071224 |
cellular response to peptidoglycan(GO:0071224) |
| 0.5 |
3.2 |
GO:0061762 |
CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.5 |
2.1 |
GO:0002541 |
activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.5 |
2.1 |
GO:0003409 |
optic cup structural organization(GO:0003409) |
| 0.5 |
1.6 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.5 |
1.6 |
GO:1903721 |
regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.5 |
3.1 |
GO:0006041 |
glucosamine metabolic process(GO:0006041) |
| 0.5 |
1.6 |
GO:0046005 |
positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 0.5 |
2.1 |
GO:2000687 |
negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.5 |
2.0 |
GO:0009224 |
CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.5 |
2.0 |
GO:0070981 |
L-asparagine biosynthetic process(GO:0070981) L-asparagine metabolic process(GO:0070982) |
| 0.5 |
2.0 |
GO:0035544 |
negative regulation of SNARE complex assembly(GO:0035544) |
| 0.5 |
2.5 |
GO:0030538 |
embryonic genitalia morphogenesis(GO:0030538) |
| 0.5 |
1.5 |
GO:0032289 |
central nervous system myelin formation(GO:0032289) |
| 0.5 |
2.9 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.5 |
6.3 |
GO:0046940 |
nucleoside monophosphate phosphorylation(GO:0046940) |
| 0.5 |
0.5 |
GO:0005985 |
sucrose metabolic process(GO:0005985) |
| 0.5 |
4.2 |
GO:0032713 |
negative regulation of interleukin-4 production(GO:0032713) |
| 0.5 |
1.4 |
GO:1903281 |
positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 0.5 |
0.9 |
GO:0070384 |
Harderian gland development(GO:0070384) |
| 0.5 |
2.7 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 0.5 |
9.1 |
GO:0046069 |
cGMP catabolic process(GO:0046069) |
| 0.4 |
2.2 |
GO:1904398 |
positive regulation of neuromuscular junction development(GO:1904398) |
| 0.4 |
0.4 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.4 |
4.0 |
GO:0002480 |
antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.4 |
8.9 |
GO:0003374 |
dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.4 |
3.1 |
GO:0001705 |
ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.4 |
2.1 |
GO:0033387 |
putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.4 |
2.6 |
GO:0035655 |
interleukin-18-mediated signaling pathway(GO:0035655) |
| 0.4 |
1.7 |
GO:0042450 |
arginine biosynthetic process via ornithine(GO:0042450) |
| 0.4 |
1.7 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.4 |
0.4 |
GO:0032707 |
negative regulation of interleukin-23 production(GO:0032707) |
| 0.4 |
2.9 |
GO:0035522 |
monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.4 |
1.7 |
GO:1904117 |
response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 0.4 |
1.2 |
GO:0050717 |
positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.4 |
1.2 |
GO:0060723 |
spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.4 |
1.7 |
GO:0060061 |
Spemann organizer formation(GO:0060061) |
| 0.4 |
4.9 |
GO:2001288 |
positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.4 |
3.3 |
GO:0031444 |
slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.4 |
1.6 |
GO:0072674 |
multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.4 |
1.2 |
GO:1904862 |
inhibitory synapse assembly(GO:1904862) |
| 0.4 |
3.2 |
GO:1902748 |
positive regulation of lens fiber cell differentiation(GO:1902748) |
| 0.4 |
4.8 |
GO:0061734 |
parkin-mediated mitophagy in response to mitochondrial depolarization(GO:0061734) |
| 0.4 |
2.0 |
GO:0034343 |
type III interferon production(GO:0034343) regulation of type III interferon production(GO:0034344) |
| 0.4 |
0.8 |
GO:0032499 |
detection of peptidoglycan(GO:0032499) |
| 0.4 |
0.8 |
GO:0090031 |
positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.4 |
1.6 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 0.4 |
1.2 |
GO:0071676 |
negative regulation of mononuclear cell migration(GO:0071676) |
| 0.4 |
1.5 |
GO:0043314 |
negative regulation of neutrophil degranulation(GO:0043314) |
| 0.4 |
1.9 |
GO:1901662 |
phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.4 |
0.4 |
GO:0097212 |
lysosomal membrane organization(GO:0097212) |
| 0.4 |
2.2 |
GO:0038110 |
interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.4 |
1.5 |
GO:1905224 |
clathrin-coated pit assembly(GO:1905224) |
| 0.4 |
1.1 |
GO:1990481 |
mRNA pseudouridine synthesis(GO:1990481) |
| 0.4 |
0.4 |
GO:1903630 |
regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.4 |
0.7 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.4 |
0.7 |
GO:2000630 |
positive regulation of miRNA metabolic process(GO:2000630) |
| 0.4 |
2.6 |
GO:1903433 |
regulation of constitutive secretory pathway(GO:1903433) |
| 0.4 |
1.8 |
GO:2000327 |
regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.4 |
4.8 |
GO:0038129 |
ERBB3 signaling pathway(GO:0038129) |
| 0.4 |
1.5 |
GO:0035771 |
interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.4 |
2.2 |
GO:2000382 |
positive regulation of mesoderm development(GO:2000382) |
| 0.4 |
2.5 |
GO:0033504 |
floor plate development(GO:0033504) |
| 0.4 |
0.4 |
GO:0032747 |
positive regulation of interleukin-23 production(GO:0032747) |
| 0.4 |
2.9 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.4 |
1.4 |
GO:0009443 |
pyridoxal 5'-phosphate salvage(GO:0009443) |
| 0.4 |
2.9 |
GO:0032218 |
riboflavin transport(GO:0032218) |
| 0.4 |
1.4 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.4 |
2.8 |
GO:0070164 |
negative regulation of adiponectin secretion(GO:0070164) |
| 0.4 |
0.4 |
GO:1902218 |
regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.4 |
1.8 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.3 |
0.3 |
GO:0050653 |
chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.3 |
1.0 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.3 |
0.3 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.3 |
2.1 |
GO:0003383 |
apical constriction(GO:0003383) |
| 0.3 |
3.4 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.3 |
1.4 |
GO:0034239 |
macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
| 0.3 |
1.4 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.3 |
1.0 |
GO:0001544 |
initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.3 |
0.3 |
GO:0036466 |
synaptic vesicle recycling via endosome(GO:0036466) |
| 0.3 |
1.7 |
GO:0010816 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.3 |
1.0 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 0.3 |
1.0 |
GO:2000097 |
regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.3 |
4.3 |
GO:0045162 |
clustering of voltage-gated sodium channels(GO:0045162) |
| 0.3 |
0.7 |
GO:0060434 |
bronchus morphogenesis(GO:0060434) |
| 0.3 |
1.0 |
GO:0042946 |
glucoside transport(GO:0042946) |
| 0.3 |
4.2 |
GO:2001199 |
negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.3 |
1.0 |
GO:0035425 |
autocrine signaling(GO:0035425) |
| 0.3 |
5.5 |
GO:0032625 |
interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 0.3 |
2.6 |
GO:0045636 |
positive regulation of melanocyte differentiation(GO:0045636) |
| 0.3 |
1.3 |
GO:2000110 |
negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.3 |
0.6 |
GO:0021747 |
cochlear nucleus development(GO:0021747) |
| 0.3 |
0.3 |
GO:0016199 |
axon midline choice point recognition(GO:0016199) |
| 0.3 |
0.6 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.3 |
0.6 |
GO:0086098 |
angiotensin-activated signaling pathway involved in heart process(GO:0086098) |
| 0.3 |
1.0 |
GO:0034471 |
endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.3 |
0.9 |
GO:0097680 |
double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.3 |
3.2 |
GO:0043951 |
negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.3 |
2.5 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.3 |
1.2 |
GO:0032954 |
regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.3 |
0.9 |
GO:0051795 |
positive regulation of catagen(GO:0051795) |
| 0.3 |
0.6 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 0.3 |
1.2 |
GO:0006049 |
UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.3 |
1.2 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.3 |
0.9 |
GO:0045212 |
negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.3 |
1.2 |
GO:0050925 |
negative regulation of negative chemotaxis(GO:0050925) |
| 0.3 |
0.6 |
GO:0089709 |
histidine transport(GO:0015817) L-histidine transmembrane transport(GO:0089709) L-histidine transport(GO:1902024) |
| 0.3 |
2.5 |
GO:0032962 |
positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.3 |
1.2 |
GO:1905073 |
occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.3 |
0.3 |
GO:0021898 |
commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.3 |
0.9 |
GO:0060458 |
right lung development(GO:0060458) |
| 0.3 |
2.7 |
GO:2001206 |
positive regulation of osteoclast development(GO:2001206) |
| 0.3 |
0.9 |
GO:1903949 |
positive regulation of atrial cardiac muscle cell action potential(GO:1903949) |
| 0.3 |
1.8 |
GO:1902715 |
positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.3 |
0.9 |
GO:1903347 |
negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.3 |
2.1 |
GO:0006003 |
fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.3 |
3.9 |
GO:0032782 |
bile acid secretion(GO:0032782) |
| 0.3 |
2.4 |
GO:0072733 |
response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.3 |
0.9 |
GO:0050760 |
negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.3 |
1.5 |
GO:0008295 |
spermidine biosynthetic process(GO:0008295) |
| 0.3 |
1.2 |
GO:0090086 |
negative regulation of protein deubiquitination(GO:0090086) |
| 0.3 |
10.1 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.3 |
0.6 |
GO:0032304 |
negative regulation of icosanoid secretion(GO:0032304) |
| 0.3 |
0.9 |
GO:0071962 |
mitotic sister chromatid cohesion, centromeric(GO:0071962) |
| 0.3 |
8.0 |
GO:0006972 |
hyperosmotic response(GO:0006972) |
| 0.3 |
2.0 |
GO:2000035 |
regulation of stem cell division(GO:2000035) |
| 0.3 |
0.6 |
GO:0071898 |
regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.3 |
1.7 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 0.3 |
1.7 |
GO:0034201 |
response to oleic acid(GO:0034201) |
| 0.3 |
5.0 |
GO:0032926 |
negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.3 |
1.7 |
GO:0032468 |
Golgi calcium ion homeostasis(GO:0032468) |
| 0.3 |
0.8 |
GO:0006478 |
peptidyl-tyrosine sulfation(GO:0006478) |
| 0.3 |
2.5 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.3 |
5.2 |
GO:0006878 |
cellular copper ion homeostasis(GO:0006878) |
| 0.3 |
8.5 |
GO:0043011 |
myeloid dendritic cell differentiation(GO:0043011) |
| 0.3 |
3.3 |
GO:0060546 |
negative regulation of necroptotic process(GO:0060546) |
| 0.3 |
0.8 |
GO:0070407 |
oxidation-dependent protein catabolic process(GO:0070407) |
| 0.3 |
1.4 |
GO:0043932 |
ossification involved in bone remodeling(GO:0043932) |
| 0.3 |
2.2 |
GO:0043402 |
glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.3 |
1.3 |
GO:0003065 |
positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.3 |
0.3 |
GO:0010847 |
regulation of chromatin assembly(GO:0010847) |
| 0.3 |
1.1 |
GO:0072086 |
specification of loop of Henle identity(GO:0072086) |
| 0.3 |
0.5 |
GO:0042939 |
glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 0.3 |
0.3 |
GO:0061443 |
endocardial cushion cell differentiation(GO:0061443) |
| 0.3 |
0.8 |
GO:0060279 |
positive regulation of ovulation(GO:0060279) |
| 0.3 |
2.9 |
GO:0023035 |
CD40 signaling pathway(GO:0023035) |
| 0.3 |
0.8 |
GO:0002416 |
IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
| 0.3 |
2.1 |
GO:0010886 |
positive regulation of cholesterol storage(GO:0010886) |
| 0.3 |
2.1 |
GO:1990822 |
basic amino acid transmembrane transport(GO:1990822) |
| 0.3 |
0.8 |
GO:0006045 |
N-acetylglucosamine biosynthetic process(GO:0006045) glucosamine-containing compound biosynthetic process(GO:1901073) |
| 0.3 |
1.6 |
GO:0060988 |
lipid tube assembly(GO:0060988) |
| 0.3 |
1.3 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.3 |
1.3 |
GO:0001866 |
NK T cell proliferation(GO:0001866) |
| 0.3 |
3.4 |
GO:0010918 |
positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.3 |
1.3 |
GO:1903527 |
positive regulation of membrane tubulation(GO:1903527) |
| 0.3 |
0.5 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.3 |
0.8 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.3 |
1.3 |
GO:0043126 |
regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043126) positive regulation of 1-phosphatidylinositol 4-kinase activity(GO:0043128) |
| 0.3 |
0.8 |
GO:0032912 |
negative regulation of transforming growth factor beta2 production(GO:0032912) |
| 0.3 |
2.0 |
GO:0006880 |
intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.3 |
0.8 |
GO:1904933 |
regulation of cell proliferation in midbrain(GO:1904933) |
| 0.3 |
0.5 |
GO:0060697 |
positive regulation of phospholipid catabolic process(GO:0060697) |
| 0.3 |
0.8 |
GO:2000661 |
positive regulation of interleukin-1-mediated signaling pathway(GO:2000661) |
| 0.3 |
0.8 |
GO:0002071 |
glandular epithelial cell maturation(GO:0002071) |
| 0.3 |
1.3 |
GO:2000286 |
receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.2 |
1.2 |
GO:0006788 |
heme oxidation(GO:0006788) |
| 0.2 |
4.2 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.2 |
1.2 |
GO:0033031 |
positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.2 |
1.0 |
GO:1903182 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.2 |
0.7 |
GO:0071550 |
death-inducing signaling complex assembly(GO:0071550) |
| 0.2 |
0.7 |
GO:1903911 |
excitatory chemical synaptic transmission(GO:0098976) positive regulation of receptor clustering(GO:1903911) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.2 |
0.5 |
GO:0098712 |
L-glutamate import across plasma membrane(GO:0098712) |
| 0.2 |
1.2 |
GO:0022614 |
membrane to membrane docking(GO:0022614) |
| 0.2 |
1.2 |
GO:0015692 |
lead ion transport(GO:0015692) |
| 0.2 |
1.2 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.2 |
1.7 |
GO:1902856 |
negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 0.2 |
0.7 |
GO:0071321 |
cellular response to cGMP(GO:0071321) |
| 0.2 |
1.9 |
GO:0097052 |
L-kynurenine metabolic process(GO:0097052) |
| 0.2 |
4.1 |
GO:0042940 |
D-amino acid transport(GO:0042940) |
| 0.2 |
0.5 |
GO:0060313 |
negative regulation of blood vessel remodeling(GO:0060313) |
| 0.2 |
0.2 |
GO:0002589 |
regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) negative regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002590) |
| 0.2 |
0.2 |
GO:0009146 |
purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.2 |
1.2 |
GO:0003431 |
growth plate cartilage chondrocyte development(GO:0003431) |
| 0.2 |
0.9 |
GO:0090107 |
regulation of high-density lipoprotein particle assembly(GO:0090107) |
| 0.2 |
0.7 |
GO:0044828 |
negative regulation by host of viral genome replication(GO:0044828) |
| 0.2 |
0.5 |
GO:1904924 |
negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 0.2 |
2.8 |
GO:0051964 |
negative regulation of synapse assembly(GO:0051964) |
| 0.2 |
0.7 |
GO:1900186 |
negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.2 |
0.7 |
GO:1902595 |
regulation of DNA replication origin binding(GO:1902595) |
| 0.2 |
0.5 |
GO:0086021 |
SA node cell to atrial cardiac muscle cell communication by electrical coupling(GO:0086021) |
| 0.2 |
1.2 |
GO:0010836 |
negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.2 |
0.9 |
GO:0009436 |
glyoxylate catabolic process(GO:0009436) |
| 0.2 |
0.7 |
GO:0035915 |
pore formation in membrane of other organism(GO:0035915) |
| 0.2 |
1.4 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.2 |
0.5 |
GO:0071442 |
regulation of histone H3-K14 acetylation(GO:0071440) positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.2 |
0.9 |
GO:1903070 |
negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.2 |
0.7 |
GO:0007518 |
myoblast fate determination(GO:0007518) |
| 0.2 |
0.5 |
GO:0090135 |
actin filament branching(GO:0090135) protein localization to cell leading edge(GO:1902463) |
| 0.2 |
0.7 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.2 |
0.7 |
GO:0042776 |
mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.2 |
0.5 |
GO:0006258 |
UDP-glucose catabolic process(GO:0006258) |
| 0.2 |
2.0 |
GO:1901552 |
positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.2 |
1.8 |
GO:0042699 |
follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.2 |
2.0 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.2 |
1.1 |
GO:0019322 |
pentose biosynthetic process(GO:0019322) |
| 0.2 |
2.5 |
GO:1902661 |
positive regulation of glucose mediated signaling pathway(GO:1902661) |
| 0.2 |
1.6 |
GO:0010481 |
epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.2 |
1.6 |
GO:1903237 |
negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.2 |
0.7 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.2 |
0.2 |
GO:2000275 |
regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.2 |
0.4 |
GO:0070376 |
regulation of ERK5 cascade(GO:0070376) |
| 0.2 |
1.3 |
GO:0015811 |
L-cystine transport(GO:0015811) |
| 0.2 |
0.4 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.2 |
1.7 |
GO:2000074 |
regulation of type B pancreatic cell development(GO:2000074) |
| 0.2 |
0.6 |
GO:1903422 |
negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.2 |
0.6 |
GO:0045643 |
regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
| 0.2 |
0.6 |
GO:0061026 |
cardiac muscle tissue regeneration(GO:0061026) |
| 0.2 |
0.9 |
GO:1902544 |
regulation of DNA N-glycosylase activity(GO:1902544) |
| 0.2 |
2.3 |
GO:0043985 |
histone H4-R3 methylation(GO:0043985) |
| 0.2 |
0.8 |
GO:0098957 |
anterograde axonal transport of mitochondrion(GO:0098957) |
| 0.2 |
0.2 |
GO:0097051 |
establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.2 |
5.3 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.2 |
1.9 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.2 |
0.8 |
GO:0090156 |
negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.2 |
2.3 |
GO:0009155 |
purine deoxyribonucleotide catabolic process(GO:0009155) |
| 0.2 |
1.0 |
GO:0045204 |
MAPK export from nucleus(GO:0045204) |
| 0.2 |
0.6 |
GO:0003050 |
regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.2 |
0.8 |
GO:1902869 |
regulation of amacrine cell differentiation(GO:1902869) |
| 0.2 |
0.4 |
GO:0015870 |
acetylcholine transport(GO:0015870) |
| 0.2 |
0.2 |
GO:0071499 |
cellular response to laminar fluid shear stress(GO:0071499) |
| 0.2 |
1.2 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.2 |
4.1 |
GO:1903830 |
magnesium ion transmembrane transport(GO:1903830) |
| 0.2 |
0.4 |
GO:0010840 |
regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) circadian sleep/wake cycle, wakefulness(GO:0042746) |
| 0.2 |
1.2 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.2 |
1.2 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.2 |
2.6 |
GO:1902237 |
positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.2 |
0.4 |
GO:0070426 |
positive regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070426) positive regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070434) |
| 0.2 |
1.6 |
GO:0036337 |
Fas signaling pathway(GO:0036337) |
| 0.2 |
0.4 |
GO:0009111 |
vitamin catabolic process(GO:0009111) |
| 0.2 |
0.4 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.2 |
1.4 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.2 |
1.0 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.2 |
3.4 |
GO:0006002 |
fructose 6-phosphate metabolic process(GO:0006002) |
| 0.2 |
2.6 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.2 |
3.0 |
GO:1902004 |
positive regulation of beta-amyloid formation(GO:1902004) |
| 0.2 |
0.6 |
GO:0070625 |
zymogen granule exocytosis(GO:0070625) |
| 0.2 |
1.0 |
GO:0034141 |
positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.2 |
0.6 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.2 |
0.4 |
GO:0070093 |
negative regulation of glucagon secretion(GO:0070093) |
| 0.2 |
0.2 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.2 |
1.8 |
GO:0035897 |
proteolysis in other organism(GO:0035897) |
| 0.2 |
2.6 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.2 |
0.2 |
GO:0089718 |
amino acid import across plasma membrane(GO:0089718) |
| 0.2 |
0.4 |
GO:0044854 |
plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) |
| 0.2 |
0.6 |
GO:1904578 |
response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.2 |
0.4 |
GO:0010813 |
neuropeptide catabolic process(GO:0010813) |
| 0.2 |
0.8 |
GO:0060339 |
negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.2 |
1.4 |
GO:0035934 |
corticosterone secretion(GO:0035934) |
| 0.2 |
1.9 |
GO:0061732 |
mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.2 |
0.8 |
GO:2000158 |
positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.2 |
0.8 |
GO:0038060 |
nitric oxide-cGMP-mediated signaling pathway(GO:0038060) |
| 0.2 |
0.8 |
GO:0036229 |
glutamine secretion(GO:0010585) L-glutamine import(GO:0036229) L-glutamine import into cell(GO:1903803) |
| 0.2 |
0.8 |
GO:1904742 |
regulation of telomeric DNA binding(GO:1904742) positive regulation of telomeric DNA binding(GO:1904744) |
| 0.2 |
0.2 |
GO:0098905 |
regulation of bundle of His cell action potential(GO:0098905) |
| 0.2 |
1.1 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.2 |
1.1 |
GO:0038172 |
interleukin-33-mediated signaling pathway(GO:0038172) |
| 0.2 |
0.2 |
GO:0001743 |
optic placode formation(GO:0001743) optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.2 |
0.4 |
GO:0000479 |
endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.2 |
2.8 |
GO:2001223 |
negative regulation of neuron migration(GO:2001223) |
| 0.2 |
2.0 |
GO:1903944 |
regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.2 |
0.9 |
GO:0060028 |
convergent extension involved in axis elongation(GO:0060028) |
| 0.2 |
0.4 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) |
| 0.2 |
0.9 |
GO:0061107 |
seminal vesicle development(GO:0061107) |
| 0.2 |
2.0 |
GO:0043152 |
induction of bacterial agglutination(GO:0043152) |
| 0.2 |
0.4 |
GO:2000118 |
regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.2 |
0.2 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.2 |
0.6 |
GO:0075732 |
viral penetration into host nucleus(GO:0075732) multi-organism nuclear import(GO:1902594) |
| 0.2 |
1.1 |
GO:0070375 |
ERK5 cascade(GO:0070375) |
| 0.2 |
2.6 |
GO:0098914 |
membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.2 |
0.4 |
GO:2000374 |
regulation of oxygen metabolic process(GO:2000374) |
| 0.2 |
0.2 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.2 |
2.5 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.2 |
0.2 |
GO:0035359 |
negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.2 |
0.5 |
GO:0035281 |
pre-miRNA export from nucleus(GO:0035281) |
| 0.2 |
0.7 |
GO:0044805 |
late nucleophagy(GO:0044805) |
| 0.2 |
1.6 |
GO:0042904 |
9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.2 |
0.9 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.2 |
0.4 |
GO:0048073 |
regulation of eye pigmentation(GO:0048073) |
| 0.2 |
2.5 |
GO:0033327 |
Leydig cell differentiation(GO:0033327) |
| 0.2 |
1.2 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.2 |
0.5 |
GO:0019364 |
NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.2 |
0.2 |
GO:0021937 |
cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.2 |
0.3 |
GO:0099543 |
retrograde trans-synaptic signaling by soluble gas(GO:0098923) trans-synaptic signaling by soluble gas(GO:0099543) |
| 0.2 |
0.3 |
GO:0090234 |
regulation of kinetochore assembly(GO:0090234) |
| 0.2 |
0.5 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.2 |
2.8 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.2 |
2.8 |
GO:0006054 |
N-acetylneuraminate metabolic process(GO:0006054) |
| 0.2 |
0.5 |
GO:0009386 |
translational attenuation(GO:0009386) |
| 0.2 |
2.1 |
GO:0043117 |
positive regulation of vascular permeability(GO:0043117) |
| 0.2 |
1.4 |
GO:0015014 |
heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.2 |
0.7 |
GO:1901842 |
negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.2 |
1.7 |
GO:1903071 |
positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.2 |
1.2 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.2 |
0.3 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.2 |
0.3 |
GO:0033029 |
regulation of neutrophil apoptotic process(GO:0033029) |
| 0.2 |
0.2 |
GO:0090085 |
regulation of protein deubiquitination(GO:0090085) |
| 0.2 |
1.4 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.2 |
0.2 |
GO:0044333 |
Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.2 |
1.0 |
GO:0060370 |
susceptibility to T cell mediated cytotoxicity(GO:0060370) |
| 0.2 |
0.5 |
GO:0015920 |
lipopolysaccharide transport(GO:0015920) |
| 0.2 |
0.5 |
GO:0035574 |
histone H4-K20 demethylation(GO:0035574) |
| 0.2 |
0.3 |
GO:0014916 |
regulation of lung blood pressure(GO:0014916) |
| 0.2 |
0.5 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 0.2 |
0.8 |
GO:2001076 |
regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 0.2 |
1.0 |
GO:0006642 |
triglyceride mobilization(GO:0006642) |
| 0.2 |
0.3 |
GO:1902953 |
positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.2 |
1.5 |
GO:0032776 |
DNA methylation on cytosine(GO:0032776) |
| 0.2 |
0.8 |
GO:0010745 |
negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.2 |
0.3 |
GO:0051596 |
methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.2 |
2.0 |
GO:0043497 |
regulation of protein heterodimerization activity(GO:0043497) |
| 0.2 |
3.0 |
GO:0034356 |
NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.2 |
0.8 |
GO:0034334 |
adherens junction maintenance(GO:0034334) |
| 0.2 |
0.7 |
GO:0070889 |
platelet alpha granule organization(GO:0070889) |
| 0.2 |
0.3 |
GO:0046066 |
dGDP metabolic process(GO:0046066) |
| 0.2 |
0.8 |
GO:2001034 |
positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
| 0.2 |
1.6 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.2 |
3.3 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.2 |
0.8 |
GO:0036506 |
maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.2 |
0.2 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.2 |
2.1 |
GO:0098780 |
response to mitochondrial depolarisation(GO:0098780) |
| 0.2 |
0.3 |
GO:0033025 |
mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
| 0.2 |
0.8 |
GO:0061052 |
negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.2 |
0.6 |
GO:0000492 |
box C/D snoRNP assembly(GO:0000492) |
| 0.2 |
1.3 |
GO:0043696 |
dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.2 |
0.5 |
GO:1904640 |
response to methionine(GO:1904640) |
| 0.2 |
2.3 |
GO:0045078 |
positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.2 |
0.5 |
GO:0046338 |
phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.2 |
0.2 |
GO:0035166 |
post-embryonic hemopoiesis(GO:0035166) |
| 0.2 |
0.3 |
GO:0090034 |
regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.2 |
0.6 |
GO:1900454 |
positive regulation of long term synaptic depression(GO:1900454) |
| 0.2 |
0.8 |
GO:0071421 |
manganese ion transmembrane transport(GO:0071421) |
| 0.2 |
0.2 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.2 |
0.6 |
GO:1900450 |
negative regulation of glutamate receptor signaling pathway(GO:1900450) negative regulation of NMDA glutamate receptor activity(GO:1904782) |
| 0.2 |
0.5 |
GO:0001579 |
medium-chain fatty acid transport(GO:0001579) |
| 0.2 |
1.0 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.2 |
3.2 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.2 |
1.1 |
GO:0032417 |
positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.2 |
0.5 |
GO:0018013 |
N-terminal protein amino acid methylation(GO:0006480) N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.2 |
14.5 |
GO:0042590 |
antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.2 |
0.5 |
GO:0045013 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.2 |
1.1 |
GO:0032306 |
regulation of prostaglandin secretion(GO:0032306) positive regulation of prostaglandin secretion(GO:0032308) |
| 0.2 |
2.0 |
GO:0060013 |
righting reflex(GO:0060013) |
| 0.2 |
0.3 |
GO:0051036 |
regulation of multivesicular body size(GO:0010796) regulation of endosome size(GO:0051036) |
| 0.2 |
0.8 |
GO:0006620 |
posttranslational protein targeting to membrane(GO:0006620) |
| 0.2 |
0.5 |
GO:0045897 |
positive regulation of transcription during mitosis(GO:0045897) |
| 0.2 |
0.2 |
GO:0070425 |
negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 0.2 |
1.2 |
GO:0045351 |
type I interferon biosynthetic process(GO:0045351) |
| 0.2 |
1.2 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.2 |
0.2 |
GO:0002892 |
type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) |
| 0.2 |
0.8 |
GO:0060770 |
negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.2 |
0.5 |
GO:0001831 |
trophectodermal cellular morphogenesis(GO:0001831) |
| 0.2 |
0.5 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.2 |
0.6 |
GO:0016334 |
morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.2 |
0.2 |
GO:1902728 |
positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 0.2 |
0.5 |
GO:0033037 |
polysaccharide localization(GO:0033037) |
| 0.2 |
0.8 |
GO:0086103 |
G-protein coupled receptor signaling pathway involved in heart process(GO:0086103) |
| 0.2 |
2.3 |
GO:0006995 |
cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.2 |
0.5 |
GO:1901857 |
positive regulation of cellular respiration(GO:1901857) |
| 0.2 |
0.3 |
GO:0031133 |
regulation of axon diameter(GO:0031133) |
| 0.2 |
1.2 |
GO:0097296 |
activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
| 0.2 |
0.9 |
GO:0006535 |
cysteine biosynthetic process from serine(GO:0006535) |
| 0.2 |
0.2 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.2 |
0.6 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.1 |
0.4 |
GO:1902905 |
positive regulation of fibril organization(GO:1902905) |
| 0.1 |
1.6 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.1 |
1.2 |
GO:0051024 |
positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.1 |
0.7 |
GO:0002678 |
positive regulation of chronic inflammatory response(GO:0002678) |
| 0.1 |
0.6 |
GO:0045084 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.1 |
1.0 |
GO:0006990 |
positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.1 |
1.6 |
GO:2001241 |
positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.1 |
0.4 |
GO:0039534 |
negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.1 |
3.4 |
GO:0051292 |
nuclear pore complex assembly(GO:0051292) |
| 0.1 |
0.4 |
GO:1903976 |
negative regulation of glial cell migration(GO:1903976) |
| 0.1 |
0.7 |
GO:1903333 |
negative regulation of protein folding(GO:1903333) |
| 0.1 |
4.4 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.1 |
1.0 |
GO:0050689 |
negative regulation of defense response to virus by host(GO:0050689) |
| 0.1 |
0.1 |
GO:0043652 |
engulfment of apoptotic cell(GO:0043652) |
| 0.1 |
0.3 |
GO:0045542 |
positive regulation of cholesterol biosynthetic process(GO:0045542) |
| 0.1 |
0.1 |
GO:2000793 |
cell proliferation involved in heart valve development(GO:2000793) |
| 0.1 |
0.4 |
GO:0042414 |
epinephrine metabolic process(GO:0042414) epinephrine biosynthetic process(GO:0042418) |
| 0.1 |
0.7 |
GO:1902613 |
regulation of anti-Mullerian hormone signaling pathway(GO:1902612) negative regulation of anti-Mullerian hormone signaling pathway(GO:1902613) anti-Mullerian hormone signaling pathway(GO:1990262) |
| 0.1 |
0.1 |
GO:0048388 |
endosomal lumen acidification(GO:0048388) |
| 0.1 |
0.1 |
GO:0003218 |
cardiac left ventricle formation(GO:0003218) |
| 0.1 |
0.6 |
GO:1903936 |
cellular response to sodium arsenite(GO:1903936) |
| 0.1 |
0.3 |
GO:0035054 |
embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.1 |
1.7 |
GO:0045161 |
neuronal ion channel clustering(GO:0045161) |
| 0.1 |
5.2 |
GO:0018146 |
keratan sulfate biosynthetic process(GO:0018146) |
| 0.1 |
0.8 |
GO:0051182 |
coenzyme transport(GO:0051182) |
| 0.1 |
0.3 |
GO:0030974 |
thiamine pyrophosphate transport(GO:0030974) |
| 0.1 |
0.4 |
GO:1903259 |
exon-exon junction complex disassembly(GO:1903259) |
| 0.1 |
0.4 |
GO:0042532 |
negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.1 |
0.4 |
GO:1903774 |
positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.1 |
3.8 |
GO:0039702 |
viral budding via host ESCRT complex(GO:0039702) |
| 0.1 |
1.0 |
GO:0072592 |
oxygen metabolic process(GO:0072592) |
| 0.1 |
0.6 |
GO:0035750 |
protein localization to myelin sheath abaxonal region(GO:0035750) |
| 0.1 |
0.1 |
GO:0045053 |
protein retention in Golgi apparatus(GO:0045053) |
| 0.1 |
1.8 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.1 |
0.4 |
GO:1903576 |
response to L-arginine(GO:1903576) |
| 0.1 |
3.2 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.1 |
0.7 |
GO:0061743 |
motor learning(GO:0061743) |
| 0.1 |
0.4 |
GO:2000510 |
positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.1 |
1.2 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) |
| 0.1 |
0.1 |
GO:0043376 |
regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.1 |
0.7 |
GO:0050747 |
positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.1 |
0.7 |
GO:0001555 |
oocyte growth(GO:0001555) |
| 0.1 |
2.3 |
GO:0060334 |
regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.1 |
0.5 |
GO:0044210 |
'de novo' CTP biosynthetic process(GO:0044210) |
| 0.1 |
2.0 |
GO:0034497 |
protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 |
0.8 |
GO:0046015 |
regulation of transcription by glucose(GO:0046015) |
| 0.1 |
0.5 |
GO:1901096 |
regulation of autophagosome maturation(GO:1901096) |
| 0.1 |
1.7 |
GO:0046449 |
creatinine metabolic process(GO:0046449) |
| 0.1 |
0.4 |
GO:0030579 |
ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.1 |
0.9 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.1 |
0.5 |
GO:0007206 |
phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.1 |
1.2 |
GO:0007042 |
lysosomal lumen acidification(GO:0007042) |
| 0.1 |
0.3 |
GO:0015680 |
intracellular copper ion transport(GO:0015680) |
| 0.1 |
1.1 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 |
0.8 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 0.1 |
0.3 |
GO:2000668 |
dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
| 0.1 |
0.3 |
GO:0071638 |
negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
| 0.1 |
0.3 |
GO:1903521 |
apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.1 |
0.1 |
GO:0002188 |
translation reinitiation(GO:0002188) |
| 0.1 |
0.1 |
GO:0010940 |
positive regulation of necrotic cell death(GO:0010940) |
| 0.1 |
0.4 |
GO:0006579 |
amino-acid betaine catabolic process(GO:0006579) |
| 0.1 |
0.9 |
GO:0045079 |
negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.1 |
2.1 |
GO:0035330 |
regulation of hippo signaling(GO:0035330) |
| 0.1 |
0.5 |
GO:0019074 |
viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.1 |
0.6 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.1 |
1.0 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.1 |
0.4 |
GO:0019089 |
negative regulation of transcription from RNA polymerase II promoter in response to UV-induced DNA damage(GO:0010768) transmission of virus(GO:0019089) dissemination or transmission of symbiont from host(GO:0044007) dissemination or transmission of organism from other organism involved in symbiotic interaction(GO:0051821) |
| 0.1 |
0.4 |
GO:0072344 |
rescue of stalled ribosome(GO:0072344) |
| 0.1 |
0.9 |
GO:0016344 |
meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.1 |
0.3 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.1 |
1.8 |
GO:0000244 |
spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 |
0.5 |
GO:0010701 |
positive regulation of norepinephrine secretion(GO:0010701) |
| 0.1 |
0.5 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 0.1 |
1.5 |
GO:0000055 |
ribosomal large subunit export from nucleus(GO:0000055) |
| 0.1 |
0.4 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 0.1 |
1.0 |
GO:0072553 |
terminal button organization(GO:0072553) |
| 0.1 |
3.3 |
GO:0090023 |
positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.1 |
0.4 |
GO:1900109 |
regulation of histone H3-K9 dimethylation(GO:1900109) positive regulation of histone H3-K9 dimethylation(GO:1900111) |
| 0.1 |
0.5 |
GO:0002543 |
activation of blood coagulation via clotting cascade(GO:0002543) |
| 0.1 |
6.2 |
GO:0007214 |
gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 |
1.2 |
GO:0021633 |
optic nerve structural organization(GO:0021633) |
| 0.1 |
0.6 |
GO:0035633 |
maintenance of blood-brain barrier(GO:0035633) |
| 0.1 |
0.6 |
GO:0046504 |
ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.1 |
0.4 |
GO:0035048 |
splicing factor protein import into nucleus(GO:0035048) |
| 0.1 |
1.0 |
GO:0070586 |
cell-cell adhesion involved in gastrulation(GO:0070586) |
| 0.1 |
0.9 |
GO:0060373 |
regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.1 |
0.2 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.1 |
0.6 |
GO:0098912 |
membrane depolarization during atrial cardiac muscle cell action potential(GO:0098912) |
| 0.1 |
1.1 |
GO:0034465 |
response to carbon monoxide(GO:0034465) |
| 0.1 |
0.4 |
GO:0071393 |
cellular response to progesterone stimulus(GO:0071393) |
| 0.1 |
0.8 |
GO:2001033 |
negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
| 0.1 |
4.8 |
GO:0032456 |
endocytic recycling(GO:0032456) |
| 0.1 |
0.5 |
GO:0051029 |
rRNA transport(GO:0051029) |
| 0.1 |
1.5 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 |
0.7 |
GO:0060356 |
leucine import(GO:0060356) |
| 0.1 |
0.9 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 |
0.1 |
GO:0034444 |
negative regulation of lipoprotein oxidation(GO:0034443) regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 0.1 |
0.2 |
GO:0097252 |
oligodendrocyte apoptotic process(GO:0097252) negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.1 |
0.6 |
GO:0002457 |
T cell antigen processing and presentation(GO:0002457) |
| 0.1 |
0.1 |
GO:0021897 |
forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.1 |
0.5 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 |
0.8 |
GO:0097500 |
receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.1 |
2.4 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.1 |
0.8 |
GO:0048743 |
positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.1 |
1.0 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.1 |
2.8 |
GO:0019511 |
peptidyl-proline hydroxylation(GO:0019511) |
| 0.1 |
0.6 |
GO:0071494 |
cellular response to UV-C(GO:0071494) |
| 0.1 |
0.2 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 0.1 |
0.6 |
GO:0060478 |
acrosomal vesicle exocytosis(GO:0060478) |
| 0.1 |
0.2 |
GO:1903348 |
positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.1 |
0.8 |
GO:0002175 |
protein localization to paranode region of axon(GO:0002175) |
| 0.1 |
0.1 |
GO:0061153 |
trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 |
0.1 |
GO:1900222 |
negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.1 |
0.2 |
GO:1990737 |
response to manganese-induced endoplasmic reticulum stress(GO:1990737) |
| 0.1 |
3.6 |
GO:0070423 |
nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) |
| 0.1 |
0.2 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.1 |
0.8 |
GO:0052405 |
negative regulation by host of symbiont molecular function(GO:0052405) |
| 0.1 |
0.8 |
GO:0046598 |
positive regulation of viral entry into host cell(GO:0046598) |
| 0.1 |
1.0 |
GO:0000012 |
single strand break repair(GO:0000012) |
| 0.1 |
0.7 |
GO:0002353 |
kinin cascade(GO:0002254) plasma kallikrein-kinin cascade(GO:0002353) |
| 0.1 |
0.1 |
GO:0072641 |
type I interferon secretion(GO:0072641) |
| 0.1 |
0.1 |
GO:0097676 |
histone H3-K36 dimethylation(GO:0097676) |
| 0.1 |
0.7 |
GO:0035585 |
calcium-mediated signaling using extracellular calcium source(GO:0035585) |
| 0.1 |
0.4 |
GO:0009236 |
cobalamin biosynthetic process(GO:0009236) |
| 0.1 |
2.2 |
GO:1904251 |
regulation of bile acid metabolic process(GO:1904251) |
| 0.1 |
0.4 |
GO:1900535 |
medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.1 |
0.3 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.1 |
1.6 |
GO:0097300 |
programmed necrotic cell death(GO:0097300) |
| 0.1 |
0.5 |
GO:0071043 |
CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.1 |
0.2 |
GO:1990535 |
neuron projection maintenance(GO:1990535) |
| 0.1 |
0.9 |
GO:1904706 |
negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.1 |
0.3 |
GO:0046931 |
pore complex assembly(GO:0046931) |
| 0.1 |
0.2 |
GO:0014034 |
neural crest cell fate commitment(GO:0014034) |
| 0.1 |
0.1 |
GO:0002351 |
serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
| 0.1 |
0.3 |
GO:0035279 |
mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 |
0.4 |
GO:1904100 |
regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 0.1 |
0.8 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.1 |
2.4 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.1 |
1.1 |
GO:0002934 |
desmosome organization(GO:0002934) |
| 0.1 |
0.2 |
GO:0071072 |
negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.1 |
1.3 |
GO:0010878 |
cholesterol storage(GO:0010878) |
| 0.1 |
1.3 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 0.1 |
1.2 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 |
0.4 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 |
1.7 |
GO:0034501 |
protein localization to kinetochore(GO:0034501) |
| 0.1 |
0.6 |
GO:0048227 |
plasma membrane to endosome transport(GO:0048227) |
| 0.1 |
0.4 |
GO:0052651 |
monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.1 |
9.6 |
GO:0006890 |
retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.1 |
0.8 |
GO:0045838 |
positive regulation of membrane potential(GO:0045838) |
| 0.1 |
1.0 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.1 |
0.5 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 |
0.5 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.1 |
0.2 |
GO:0033160 |
positive regulation of protein import into nucleus, translocation(GO:0033160) |
| 0.1 |
0.7 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.1 |
0.7 |
GO:0032515 |
negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.1 |
1.8 |
GO:0006895 |
Golgi to endosome transport(GO:0006895) |
| 0.1 |
0.9 |
GO:0070544 |
histone H3-K36 demethylation(GO:0070544) |
| 0.1 |
0.3 |
GO:0008078 |
mesodermal cell migration(GO:0008078) |
| 0.1 |
0.2 |
GO:1903059 |
regulation of protein lipidation(GO:1903059) |
| 0.1 |
2.0 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.1 |
1.7 |
GO:0030949 |
positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
| 0.1 |
0.4 |
GO:0051534 |
negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.1 |
0.2 |
GO:0009631 |
cold acclimation(GO:0009631) |
| 0.1 |
3.9 |
GO:0000462 |
maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.1 |
0.3 |
GO:0001207 |
histone displacement(GO:0001207) positive regulation of transcription involved in meiotic cell cycle(GO:0051039) |
| 0.1 |
0.3 |
GO:1990180 |
mitochondrial tRNA 3'-end processing(GO:1990180) |
| 0.1 |
0.5 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.1 |
0.3 |
GO:0002866 |
positive regulation of acute inflammatory response to antigenic stimulus(GO:0002866) |
| 0.1 |
0.2 |
GO:1901668 |
regulation of superoxide dismutase activity(GO:1901668) |
| 0.1 |
1.0 |
GO:0006307 |
DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 |
0.8 |
GO:0010571 |
positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.1 |
0.5 |
GO:0033490 |
cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
| 0.1 |
0.2 |
GO:0036269 |
swimming behavior(GO:0036269) |
| 0.1 |
0.2 |
GO:1904327 |
protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.1 |
0.4 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.1 |
0.1 |
GO:0038183 |
bile acid signaling pathway(GO:0038183) |
| 0.1 |
0.3 |
GO:0016094 |
polyprenol biosynthetic process(GO:0016094) |
| 0.1 |
1.1 |
GO:0010248 |
establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 |
0.3 |
GO:0045957 |
regulation of complement activation, alternative pathway(GO:0030451) negative regulation of complement activation, alternative pathway(GO:0045957) |
| 0.1 |
0.2 |
GO:0006651 |
diacylglycerol biosynthetic process(GO:0006651) |
| 0.1 |
0.1 |
GO:0060157 |
urinary bladder development(GO:0060157) |
| 0.1 |
1.0 |
GO:0060052 |
neurofilament cytoskeleton organization(GO:0060052) |
| 0.1 |
0.8 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.1 |
1.7 |
GO:0032786 |
positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.1 |
0.9 |
GO:1990573 |
potassium ion import across plasma membrane(GO:1990573) |
| 0.1 |
0.3 |
GO:1902460 |
transforming growth factor beta activation(GO:0036363) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.1 |
0.3 |
GO:2000622 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 |
0.3 |
GO:0061536 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.1 |
0.7 |
GO:0090074 |
negative regulation of protein homodimerization activity(GO:0090074) |
| 0.1 |
0.3 |
GO:0043308 |
eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
| 0.1 |
0.2 |
GO:0023019 |
signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.1 |
0.3 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.1 |
0.6 |
GO:1900119 |
positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.1 |
0.3 |
GO:0044126 |
regulation of growth of symbiont in host(GO:0044126) |
| 0.1 |
0.3 |
GO:0036333 |
hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.1 |
0.4 |
GO:0021914 |
negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.1 |
0.6 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.1 |
1.9 |
GO:0042753 |
positive regulation of circadian rhythm(GO:0042753) |
| 0.1 |
0.4 |
GO:0032581 |
ER-dependent peroxisome organization(GO:0032581) |
| 0.1 |
0.8 |
GO:0042167 |
porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.1 |
0.3 |
GO:1904732 |
regulation of electron carrier activity(GO:1904732) |
| 0.1 |
0.4 |
GO:0032287 |
peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 |
0.5 |
GO:0034499 |
late endosome to Golgi transport(GO:0034499) |
| 0.1 |
2.4 |
GO:0031954 |
positive regulation of protein autophosphorylation(GO:0031954) |
| 0.1 |
1.6 |
GO:2000052 |
positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.1 |
0.6 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 |
1.7 |
GO:0071850 |
mitotic cell cycle arrest(GO:0071850) |
| 0.1 |
0.3 |
GO:2001268 |
negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.1 |
1.7 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.1 |
0.5 |
GO:1900121 |
negative regulation of receptor binding(GO:1900121) |
| 0.1 |
0.1 |
GO:1903939 |
regulation of TORC2 signaling(GO:1903939) |
| 0.1 |
0.6 |
GO:0035610 |
protein side chain deglutamylation(GO:0035610) |
| 0.1 |
0.6 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.1 |
0.3 |
GO:2000234 |
positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.1 |
0.2 |
GO:0045213 |
neurotransmitter receptor metabolic process(GO:0045213) |
| 0.1 |
0.3 |
GO:0006391 |
transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.1 |
0.7 |
GO:0055129 |
L-proline biosynthetic process(GO:0055129) |
| 0.1 |
1.0 |
GO:0060155 |
platelet dense granule organization(GO:0060155) |
| 0.1 |
2.1 |
GO:0006183 |
GTP biosynthetic process(GO:0006183) |
| 0.1 |
0.4 |
GO:0035627 |
ceramide transport(GO:0035627) |
| 0.1 |
0.1 |
GO:0070885 |
regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.1 |
0.5 |
GO:0051708 |
intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.1 |
0.4 |
GO:0007008 |
outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 |
0.8 |
GO:0071712 |
ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.1 |
0.7 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) |
| 0.1 |
3.0 |
GO:0034067 |
protein localization to Golgi apparatus(GO:0034067) |
| 0.1 |
0.7 |
GO:2000484 |
positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.1 |
1.6 |
GO:0042136 |
neurotransmitter biosynthetic process(GO:0042136) |
| 0.1 |
0.4 |
GO:0042262 |
DNA protection(GO:0042262) |
| 0.1 |
0.7 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.1 |
0.3 |
GO:0035803 |
egg coat formation(GO:0035803) |
| 0.1 |
0.4 |
GO:0061668 |
mitochondrial ribosome assembly(GO:0061668) |
| 0.1 |
0.4 |
GO:0010820 |
positive regulation of T cell chemotaxis(GO:0010820) |
| 0.1 |
1.1 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.1 |
0.1 |
GO:1901419 |
regulation of response to alcohol(GO:1901419) |
| 0.1 |
0.3 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.1 |
0.3 |
GO:2000193 |
positive regulation of fatty acid transport(GO:2000193) |
| 0.1 |
0.1 |
GO:0070525 |
tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.1 |
0.1 |
GO:0034128 |
negative regulation of MyD88-independent toll-like receptor signaling pathway(GO:0034128) |
| 0.1 |
0.1 |
GO:2000729 |
positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.1 |
0.3 |
GO:0060748 |
tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.1 |
0.3 |
GO:0000103 |
sulfate assimilation(GO:0000103) |
| 0.1 |
0.3 |
GO:0042357 |
thiamine diphosphate metabolic process(GO:0042357) |
| 0.1 |
2.3 |
GO:0070286 |
axonemal dynein complex assembly(GO:0070286) |
| 0.1 |
0.7 |
GO:0048149 |
behavioral response to ethanol(GO:0048149) |
| 0.1 |
0.3 |
GO:2001023 |
regulation of response to drug(GO:2001023) |
| 0.1 |
0.7 |
GO:0051121 |
hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.1 |
0.7 |
GO:0010792 |
DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.1 |
0.2 |
GO:0031296 |
B cell costimulation(GO:0031296) |
| 0.1 |
0.2 |
GO:0072334 |
UDP-galactose transport(GO:0015785) UDP-galactose transmembrane transport(GO:0072334) |
| 0.1 |
1.4 |
GO:0034116 |
positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.1 |
0.2 |
GO:0032717 |
negative regulation of interleukin-8 production(GO:0032717) |
| 0.1 |
0.4 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 |
0.2 |
GO:0030718 |
germ-line stem cell population maintenance(GO:0030718) |
| 0.1 |
0.3 |
GO:0070922 |
small RNA loading onto RISC(GO:0070922) |
| 0.1 |
0.2 |
GO:0007341 |
penetration of zona pellucida(GO:0007341) |
| 0.1 |
0.3 |
GO:0051138 |
positive regulation of NK T cell differentiation(GO:0051138) |
| 0.1 |
0.4 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.1 |
0.1 |
GO:0006408 |
snRNA export from nucleus(GO:0006408) |
| 0.1 |
0.6 |
GO:1901409 |
positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.1 |
0.7 |
GO:0000710 |
meiotic mismatch repair(GO:0000710) |
| 0.1 |
0.2 |
GO:1903677 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 |
0.3 |
GO:0007252 |
I-kappaB phosphorylation(GO:0007252) |
| 0.1 |
0.5 |
GO:0071218 |
cellular response to misfolded protein(GO:0071218) |
| 0.1 |
0.2 |
GO:0098886 |
modification of dendritic spine(GO:0098886) |
| 0.1 |
0.2 |
GO:0015808 |
L-alanine transport(GO:0015808) |
| 0.1 |
0.2 |
GO:0090598 |
male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.1 |
0.1 |
GO:0000706 |
meiotic DNA double-strand break processing(GO:0000706) |
| 0.1 |
0.2 |
GO:0060012 |
synaptic transmission, glycinergic(GO:0060012) |
| 0.1 |
0.2 |
GO:0071344 |
diphosphate metabolic process(GO:0071344) |
| 0.1 |
0.5 |
GO:0018916 |
nitrobenzene metabolic process(GO:0018916) |
| 0.1 |
0.2 |
GO:0052026 |
modulation by virus of host transcription(GO:0019056) positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) modulation by symbiont of host transcription(GO:0052026) |
| 0.1 |
0.2 |
GO:0045347 |
negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.1 |
0.6 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.1 |
0.1 |
GO:0044154 |
histone H3-K14 acetylation(GO:0044154) |
| 0.1 |
0.5 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 |
1.6 |
GO:0070129 |
regulation of mitochondrial translation(GO:0070129) |
| 0.1 |
1.2 |
GO:0006378 |
mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
| 0.1 |
0.2 |
GO:0055118 |
negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.1 |
2.7 |
GO:0010803 |
regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.1 |
0.6 |
GO:0002943 |
tRNA dihydrouridine synthesis(GO:0002943) |
| 0.1 |
0.3 |
GO:2000628 |
regulation of miRNA metabolic process(GO:2000628) |
| 0.1 |
0.8 |
GO:0071963 |
establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.1 |
1.4 |
GO:2000674 |
regulation of type B pancreatic cell apoptotic process(GO:2000674) |
| 0.1 |
6.2 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 0.1 |
0.2 |
GO:0035377 |
transepithelial water transport(GO:0035377) positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.1 |
0.1 |
GO:0034427 |
nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.1 |
0.7 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 |
0.9 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 |
0.2 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 |
1.8 |
GO:0003351 |
epithelial cilium movement(GO:0003351) |
| 0.1 |
0.8 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 0.1 |
0.2 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.1 |
0.2 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 0.1 |
1.0 |
GO:1900364 |
negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.1 |
0.8 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.1 |
0.1 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) |
| 0.1 |
0.1 |
GO:0048682 |
axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
| 0.1 |
0.3 |
GO:1901838 |
regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.1 |
0.5 |
GO:0072520 |
seminiferous tubule development(GO:0072520) |
| 0.1 |
0.1 |
GO:0002025 |
vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.1 |
1.5 |
GO:0051923 |
sulfation(GO:0051923) |
| 0.1 |
0.2 |
GO:2000197 |
regulation of ribonucleoprotein complex localization(GO:2000197) |
| 0.1 |
0.8 |
GO:1904871 |
regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) |
| 0.1 |
0.1 |
GO:0097360 |
chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.1 |
0.1 |
GO:1904294 |
positive regulation of ERAD pathway(GO:1904294) |
| 0.1 |
0.2 |
GO:2000616 |
negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.1 |
2.2 |
GO:0006198 |
cAMP catabolic process(GO:0006198) |
| 0.1 |
0.4 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.1 |
0.4 |
GO:1902731 |
negative regulation of chondrocyte proliferation(GO:1902731) |
| 0.1 |
0.2 |
GO:0039692 |
single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.1 |
0.3 |
GO:0071027 |
nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.1 |
0.1 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.1 |
0.5 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
1.1 |
GO:0032464 |
positive regulation of protein homooligomerization(GO:0032464) |
| 0.1 |
0.6 |
GO:1903543 |
positive regulation of exosomal secretion(GO:1903543) |
| 0.1 |
0.9 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.1 |
3.0 |
GO:0050832 |
defense response to fungus(GO:0050832) |
| 0.1 |
0.4 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.1 |
0.3 |
GO:0031443 |
fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.1 |
2.4 |
GO:0043252 |
sodium-independent organic anion transport(GO:0043252) |
| 0.1 |
1.1 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.1 |
0.2 |
GO:0010042 |
response to manganese ion(GO:0010042) |
| 0.1 |
0.1 |
GO:0006679 |
glucosylceramide biosynthetic process(GO:0006679) |
| 0.1 |
0.2 |
GO:0071409 |
cellular response to cycloheximide(GO:0071409) |
| 0.1 |
0.4 |
GO:0003025 |
regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.1 |
0.6 |
GO:2000270 |
negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.1 |
1.1 |
GO:0090361 |
platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 |
1.4 |
GO:0019054 |
modulation by virus of host process(GO:0019054) |
| 0.1 |
0.3 |
GO:0090063 |
positive regulation of microtubule nucleation(GO:0090063) |
| 0.1 |
0.5 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 |
0.2 |
GO:1901252 |
regulation of intracellular transport of viral material(GO:1901252) negative regulation of intracellular transport of viral material(GO:1901253) |
| 0.1 |
1.0 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.1 |
1.0 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.1 |
0.2 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.1 |
0.1 |
GO:1903056 |
regulation of melanosome organization(GO:1903056) |
| 0.1 |
0.3 |
GO:0060700 |
regulation of ribonuclease activity(GO:0060700) |
| 0.1 |
0.1 |
GO:0033133 |
positive regulation of glucokinase activity(GO:0033133) |
| 0.1 |
0.2 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.1 |
0.1 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.1 |
0.3 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.1 |
0.3 |
GO:0009257 |
10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.1 |
0.8 |
GO:0090344 |
negative regulation of cell aging(GO:0090344) |
| 0.1 |
0.5 |
GO:0005984 |
disaccharide metabolic process(GO:0005984) |
| 0.1 |
0.3 |
GO:0000451 |
rRNA 2'-O-methylation(GO:0000451) |
| 0.1 |
0.2 |
GO:0036215 |
response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.1 |
1.1 |
GO:0051601 |
exocyst localization(GO:0051601) |
| 0.1 |
2.5 |
GO:0007205 |
protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.1 |
0.2 |
GO:0018101 |
protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.1 |
0.7 |
GO:0060413 |
atrial septum morphogenesis(GO:0060413) |
| 0.1 |
0.1 |
GO:0090521 |
glomerular visceral epithelial cell migration(GO:0090521) |
| 0.1 |
0.1 |
GO:0002277 |
myeloid dendritic cell activation involved in immune response(GO:0002277) |
| 0.1 |
0.3 |
GO:2000406 |
positive regulation of T cell migration(GO:2000406) |
| 0.1 |
0.3 |
GO:0042631 |
cellular response to water deprivation(GO:0042631) |
| 0.1 |
0.3 |
GO:0051177 |
meiotic sister chromatid cohesion(GO:0051177) |
| 0.1 |
0.3 |
GO:0034154 |
toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.1 |
0.1 |
GO:0090526 |
regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.1 |
0.1 |
GO:0034441 |
plasma lipoprotein particle oxidation(GO:0034441) |
| 0.1 |
1.4 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 |
0.3 |
GO:0016256 |
N-glycan processing to lysosome(GO:0016256) |
| 0.1 |
1.3 |
GO:0034380 |
high-density lipoprotein particle assembly(GO:0034380) |
| 0.1 |
0.1 |
GO:0002215 |
defense response to nematode(GO:0002215) |
| 0.1 |
0.6 |
GO:0042759 |
long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.1 |
0.3 |
GO:0019471 |
4-hydroxyproline metabolic process(GO:0019471) |
| 0.1 |
0.5 |
GO:1903748 |
negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.1 |
0.5 |
GO:0010818 |
T cell chemotaxis(GO:0010818) |
| 0.1 |
0.2 |
GO:0060298 |
positive regulation of sarcomere organization(GO:0060298) |
| 0.1 |
0.6 |
GO:2001204 |
regulation of osteoclast development(GO:2001204) |
| 0.1 |
1.2 |
GO:0035641 |
locomotory exploration behavior(GO:0035641) |
| 0.1 |
0.4 |
GO:0045836 |
positive regulation of meiotic nuclear division(GO:0045836) |
| 0.1 |
0.4 |
GO:0030643 |
cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.1 |
0.1 |
GO:0006987 |
activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 |
0.3 |
GO:0001915 |
negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.1 |
0.3 |
GO:0048539 |
bone marrow development(GO:0048539) |
| 0.1 |
0.3 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.1 |
0.3 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.1 |
0.2 |
GO:1901859 |
regulation of mitochondrial DNA replication(GO:0090296) negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.1 |
0.3 |
GO:2000173 |
negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.1 |
1.0 |
GO:0042987 |
amyloid precursor protein catabolic process(GO:0042987) |
| 0.1 |
2.3 |
GO:0019835 |
cytolysis(GO:0019835) |
| 0.1 |
0.1 |
GO:0006227 |
dUDP biosynthetic process(GO:0006227) dTDP biosynthetic process(GO:0006233) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dTDP metabolic process(GO:0046072) dUDP metabolic process(GO:0046077) |
| 0.1 |
0.2 |
GO:0046322 |
negative regulation of fatty acid oxidation(GO:0046322) |
| 0.1 |
0.5 |
GO:0042533 |
tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
| 0.1 |
0.6 |
GO:0099638 |
endosome to plasma membrane protein transport(GO:0099638) |
| 0.1 |
0.2 |
GO:0002118 |
aggressive behavior(GO:0002118) |
| 0.1 |
1.0 |
GO:0040032 |
post-embryonic body morphogenesis(GO:0040032) |
| 0.1 |
0.2 |
GO:1990926 |
short-term synaptic potentiation(GO:1990926) |
| 0.1 |
0.1 |
GO:0045110 |
intermediate filament bundle assembly(GO:0045110) |
| 0.1 |
0.2 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 0.1 |
3.4 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.1 |
0.6 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.1 |
0.5 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.1 |
0.2 |
GO:0008355 |
olfactory learning(GO:0008355) |
| 0.1 |
0.4 |
GO:0055059 |
asymmetric neuroblast division(GO:0055059) |
| 0.1 |
0.1 |
GO:0035106 |
operant conditioning(GO:0035106) |
| 0.1 |
0.7 |
GO:0010839 |
negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.1 |
0.1 |
GO:0002439 |
chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.1 |
1.2 |
GO:0018023 |
peptidyl-lysine trimethylation(GO:0018023) |
| 0.1 |
6.7 |
GO:0090630 |
activation of GTPase activity(GO:0090630) |
| 0.1 |
0.1 |
GO:1990253 |
cellular response to leucine starvation(GO:1990253) |
| 0.1 |
0.6 |
GO:0014041 |
regulation of neuron maturation(GO:0014041) |
| 0.1 |
1.9 |
GO:1900740 |
regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.1 |
0.8 |
GO:0030828 |
positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.1 |
1.0 |
GO:0010763 |
positive regulation of fibroblast migration(GO:0010763) |
| 0.1 |
0.2 |
GO:1904806 |
regulation of protein oxidation(GO:1904806) positive regulation of protein oxidation(GO:1904808) |
| 0.1 |
0.1 |
GO:0060137 |
maternal process involved in parturition(GO:0060137) |
| 0.1 |
0.9 |
GO:0008228 |
opsonization(GO:0008228) |
| 0.1 |
0.1 |
GO:0018963 |
phthalate metabolic process(GO:0018963) |
| 0.1 |
0.3 |
GO:0071105 |
response to interleukin-11(GO:0071105) |
| 0.1 |
0.6 |
GO:0017183 |
peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 |
0.2 |
GO:0007343 |
egg activation(GO:0007343) |
| 0.1 |
0.9 |
GO:0009303 |
rRNA transcription(GO:0009303) |
| 0.1 |
0.8 |
GO:0010954 |
positive regulation of protein processing(GO:0010954) |
| 0.1 |
0.2 |
GO:0036483 |
neuron intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0036483) regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903381) negative regulation of endoplasmic reticulum stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903382) |
| 0.1 |
1.4 |
GO:0060117 |
auditory receptor cell development(GO:0060117) |
| 0.1 |
0.3 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.1 |
1.0 |
GO:1902083 |
negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 |
0.1 |
GO:0001878 |
response to yeast(GO:0001878) |
| 0.1 |
0.1 |
GO:1904616 |
regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.1 |
0.2 |
GO:1903897 |
regulation of PERK-mediated unfolded protein response(GO:1903897) |
| 0.1 |
0.4 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.1 |
0.2 |
GO:0098902 |
regulation of membrane depolarization during action potential(GO:0098902) |
| 0.1 |
0.2 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.1 |
0.5 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.1 |
0.4 |
GO:0061737 |
leukotriene signaling pathway(GO:0061737) |
| 0.1 |
1.3 |
GO:0048009 |
insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 0.1 |
0.2 |
GO:0045875 |
negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 |
0.1 |
GO:0006772 |
thiamine metabolic process(GO:0006772) |
| 0.1 |
0.3 |
GO:1901509 |
regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.1 |
0.9 |
GO:0043485 |
endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.1 |
0.9 |
GO:0034656 |
nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.1 |
0.2 |
GO:1904588 |
cellular response to glycoprotein(GO:1904588) cellular response to thyrotropin-releasing hormone(GO:1905229) |
| 0.1 |
0.8 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.1 |
1.8 |
GO:0032008 |
positive regulation of TOR signaling(GO:0032008) |
| 0.1 |
0.2 |
GO:2000297 |
negative regulation of synapse maturation(GO:2000297) |
| 0.1 |
0.1 |
GO:0097168 |
mesenchymal stem cell proliferation(GO:0097168) |
| 0.1 |
0.2 |
GO:0035565 |
regulation of pronephros size(GO:0035565) |
| 0.1 |
0.1 |
GO:1902080 |
regulation of calcium ion import into sarcoplasmic reticulum(GO:1902080) negative regulation of calcium ion import into sarcoplasmic reticulum(GO:1902081) |
| 0.1 |
0.3 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.1 |
1.1 |
GO:0035455 |
response to interferon-alpha(GO:0035455) |
| 0.1 |
0.1 |
GO:0042090 |
interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.1 |
0.5 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.1 |
0.4 |
GO:1904380 |
endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.1 |
0.3 |
GO:1900425 |
negative regulation of defense response to bacterium(GO:1900425) |
| 0.1 |
0.4 |
GO:0070995 |
NADPH oxidation(GO:0070995) |
| 0.1 |
0.2 |
GO:0071896 |
protein localization to adherens junction(GO:0071896) |
| 0.1 |
0.3 |
GO:0006896 |
Golgi to vacuole transport(GO:0006896) |
| 0.1 |
0.1 |
GO:2001189 |
negative regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001189) |
| 0.1 |
0.6 |
GO:0043578 |
nuclear matrix organization(GO:0043578) |
| 0.1 |
0.3 |
GO:0035385 |
Roundabout signaling pathway(GO:0035385) |
| 0.1 |
0.2 |
GO:1990167 |
protein K27-linked deubiquitination(GO:1990167) |
| 0.1 |
0.1 |
GO:0090309 |
positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.1 |
0.1 |
GO:0010730 |
negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.0 |
0.1 |
GO:0003366 |
cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.0 |
0.4 |
GO:0061051 |
positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.0 |
0.8 |
GO:0032211 |
negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.0 |
0.1 |
GO:0021943 |
formation of radial glial scaffolds(GO:0021943) |
| 0.0 |
0.4 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 |
0.1 |
GO:0046166 |
glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.0 |
1.1 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.0 |
0.4 |
GO:0002691 |
regulation of cellular extravasation(GO:0002691) |
| 0.0 |
0.1 |
GO:0001546 |
preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.0 |
0.0 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.0 |
0.1 |
GO:0071922 |
establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.0 |
0.5 |
GO:0006559 |
L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.0 |
0.4 |
GO:0007263 |
nitric oxide mediated signal transduction(GO:0007263) |
| 0.0 |
0.3 |
GO:0021523 |
somatic motor neuron differentiation(GO:0021523) |
| 0.0 |
0.0 |
GO:0036090 |
cleavage furrow ingression(GO:0036090) |
| 0.0 |
0.1 |
GO:0043313 |
regulation of neutrophil degranulation(GO:0043313) |
| 0.0 |
0.0 |
GO:0090481 |
pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
| 0.0 |
0.1 |
GO:1904816 |
positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.0 |
0.2 |
GO:0007185 |
transmembrane receptor protein tyrosine phosphatase signaling pathway(GO:0007185) |
| 0.0 |
0.4 |
GO:0048387 |
negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 |
0.3 |
GO:0006828 |
manganese ion transport(GO:0006828) |
| 0.0 |
0.0 |
GO:0050757 |
thymidylate synthase biosynthetic process(GO:0050757) regulation of thymidylate synthase biosynthetic process(GO:0050758) |
| 0.0 |
0.0 |
GO:0061622 |
glycolytic process through glucose-1-phosphate(GO:0061622) |
| 0.0 |
0.1 |
GO:0000469 |
cleavage involved in rRNA processing(GO:0000469) |
| 0.0 |
0.0 |
GO:0048627 |
myoblast development(GO:0048627) |
| 0.0 |
0.2 |
GO:0075522 |
IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 |
0.6 |
GO:0033622 |
integrin activation(GO:0033622) |
| 0.0 |
0.5 |
GO:0051307 |
meiotic chromosome separation(GO:0051307) |
| 0.0 |
0.4 |
GO:0014912 |
negative regulation of smooth muscle cell migration(GO:0014912) |
| 0.0 |
0.0 |
GO:0051771 |
negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.0 |
0.0 |
GO:0072695 |
negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.0 |
0.0 |
GO:0002378 |
immunoglobulin biosynthetic process(GO:0002378) |
| 0.0 |
0.1 |
GO:0051256 |
mitotic spindle midzone assembly(GO:0051256) |
| 0.0 |
0.3 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.0 |
0.1 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 |
0.4 |
GO:1902187 |
negative regulation of viral release from host cell(GO:1902187) |
| 0.0 |
0.0 |
GO:1901858 |
regulation of mitochondrial DNA metabolic process(GO:1901858) |
| 0.0 |
0.3 |
GO:1902916 |
positive regulation of protein polyubiquitination(GO:1902916) |
| 0.0 |
0.6 |
GO:0090200 |
positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 |
0.1 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.0 |
0.2 |
GO:0071436 |
sodium ion export(GO:0071436) |
| 0.0 |
0.1 |
GO:0016999 |
antibiotic metabolic process(GO:0016999) |
| 0.0 |
0.9 |
GO:0007141 |
male meiosis I(GO:0007141) |
| 0.0 |
0.7 |
GO:0030205 |
dermatan sulfate metabolic process(GO:0030205) dermatan sulfate biosynthetic process(GO:0030208) |
| 0.0 |
0.2 |
GO:0097498 |
endothelial tube lumen extension(GO:0097498) |
| 0.0 |
0.1 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 |
0.1 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.0 |
1.1 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 |
0.2 |
GO:0002911 |
lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.0 |
0.1 |
GO:0060020 |
Bergmann glial cell differentiation(GO:0060020) |
| 0.0 |
0.4 |
GO:0010224 |
response to UV-B(GO:0010224) |
| 0.0 |
0.3 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.0 |
0.2 |
GO:2000721 |
positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.0 |
0.3 |
GO:0097033 |
mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 |
0.2 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 |
0.0 |
GO:2000848 |
positive regulation of corticosteroid hormone secretion(GO:2000848) |
| 0.0 |
0.2 |
GO:1902101 |
positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.0 |
0.2 |
GO:0006999 |
nuclear pore organization(GO:0006999) |
| 0.0 |
0.4 |
GO:0000052 |
citrulline metabolic process(GO:0000052) |
| 0.0 |
3.4 |
GO:0000380 |
alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.0 |
0.2 |
GO:0042340 |
keratan sulfate catabolic process(GO:0042340) |
| 0.0 |
0.1 |
GO:0050655 |
dermatan sulfate proteoglycan biosynthetic process(GO:0050651) dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.0 |
0.2 |
GO:0071420 |
cellular response to histamine(GO:0071420) |
| 0.0 |
0.0 |
GO:0044026 |
DNA hypermethylation(GO:0044026) |
| 0.0 |
0.1 |
GO:1901355 |
response to rapamycin(GO:1901355) |
| 0.0 |
2.4 |
GO:0036498 |
IRE1-mediated unfolded protein response(GO:0036498) |
| 0.0 |
0.0 |
GO:1902037 |
negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.0 |
0.1 |
GO:0000454 |
snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.0 |
0.7 |
GO:0009225 |
nucleotide-sugar metabolic process(GO:0009225) |
| 0.0 |
0.0 |
GO:0043553 |
negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.0 |
0.2 |
GO:0019418 |
sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.0 |
0.1 |
GO:0045472 |
response to ether(GO:0045472) |
| 0.0 |
0.3 |
GO:0006616 |
SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.0 |
1.9 |
GO:0006400 |
tRNA modification(GO:0006400) |
| 0.0 |
0.1 |
GO:0009439 |
cyanate metabolic process(GO:0009439) cyanate catabolic process(GO:0009440) |
| 0.0 |
0.1 |
GO:0006114 |
glycerol biosynthetic process(GO:0006114) |
| 0.0 |
0.3 |
GO:0042483 |
negative regulation of odontogenesis(GO:0042483) |
| 0.0 |
0.2 |
GO:0032911 |
negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.0 |
0.2 |
GO:0048296 |
isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 |
0.1 |
GO:0086045 |
membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.0 |
0.2 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 |
0.1 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 |
0.4 |
GO:1902259 |
regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.0 |
0.3 |
GO:0019367 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 |
0.3 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.0 |
0.1 |
GO:0044146 |
negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.0 |
0.1 |
GO:0021650 |
vestibulocochlear nerve formation(GO:0021650) |
| 0.0 |
0.2 |
GO:0060482 |
lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
| 0.0 |
0.6 |
GO:0038003 |
opioid receptor signaling pathway(GO:0038003) |
| 0.0 |
0.2 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.0 |
0.1 |
GO:0072023 |
thick ascending limb development(GO:0072023) metanephric thick ascending limb development(GO:0072233) |
| 0.0 |
0.6 |
GO:0060670 |
branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 |
0.9 |
GO:0071431 |
tRNA export from nucleus(GO:0006409) tRNA transport(GO:0051031) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.0 |
0.3 |
GO:0090315 |
negative regulation of protein targeting to membrane(GO:0090315) |
| 0.0 |
0.4 |
GO:0048025 |
negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.0 |
0.5 |
GO:0070444 |
oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.0 |
0.0 |
GO:0042823 |
pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.0 |
15.5 |
GO:0008380 |
RNA splicing(GO:0008380) |
| 0.0 |
0.1 |
GO:1900227 |
positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
| 0.0 |
0.6 |
GO:0019852 |
L-ascorbic acid metabolic process(GO:0019852) |
| 0.0 |
0.2 |
GO:0071880 |
adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
| 0.0 |
0.0 |
GO:1905150 |
regulation of voltage-gated sodium channel activity(GO:1905150) |
| 0.0 |
0.0 |
GO:0072034 |
retinal rod cell differentiation(GO:0060221) renal vesicle induction(GO:0072034) |
| 0.0 |
0.0 |
GO:0045113 |
regulation of integrin biosynthetic process(GO:0045113) |
| 0.0 |
0.2 |
GO:0032536 |
regulation of cell projection size(GO:0032536) |
| 0.0 |
0.3 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.0 |
0.5 |
GO:0045724 |
positive regulation of cilium assembly(GO:0045724) |
| 0.0 |
0.1 |
GO:0045651 |
positive regulation of macrophage differentiation(GO:0045651) |
| 0.0 |
0.1 |
GO:0014878 |
response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.0 |
0.3 |
GO:0051006 |
positive regulation of lipoprotein lipase activity(GO:0051006) |
| 0.0 |
0.1 |
GO:1900041 |
negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.0 |
0.2 |
GO:1902412 |
regulation of mitotic cytokinesis(GO:1902412) |
| 0.0 |
0.1 |
GO:0048818 |
positive regulation of hair follicle maturation(GO:0048818) |
| 0.0 |
0.1 |
GO:0071930 |
negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.0 |
1.8 |
GO:0051058 |
negative regulation of Ras protein signal transduction(GO:0046580) negative regulation of small GTPase mediated signal transduction(GO:0051058) |
| 0.0 |
0.1 |
GO:1904749 |
regulation of protein localization to nucleolus(GO:1904749) |
| 0.0 |
0.8 |
GO:0050710 |
negative regulation of cytokine secretion(GO:0050710) |
| 0.0 |
0.4 |
GO:0051014 |
actin filament severing(GO:0051014) |
| 0.0 |
0.2 |
GO:0044752 |
response to human chorionic gonadotropin(GO:0044752) |
| 0.0 |
0.2 |
GO:0051694 |
pointed-end actin filament capping(GO:0051694) |
| 0.0 |
0.1 |
GO:0035630 |
bone mineralization involved in bone maturation(GO:0035630) |
| 0.0 |
0.7 |
GO:0043982 |
histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.0 |
0.1 |
GO:0036079 |
GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.0 |
0.0 |
GO:0018879 |
biphenyl metabolic process(GO:0018879) |
| 0.0 |
0.4 |
GO:2001222 |
regulation of neuron migration(GO:2001222) |
| 0.0 |
0.1 |
GO:0060743 |
epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 |
0.2 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.0 |
0.4 |
GO:0051654 |
establishment of mitochondrion localization(GO:0051654) |
| 0.0 |
0.4 |
GO:0036109 |
alpha-linolenic acid metabolic process(GO:0036109) |
| 0.0 |
0.2 |
GO:0036296 |
response to increased oxygen levels(GO:0036296) |
| 0.0 |
0.0 |
GO:0009624 |
response to nematode(GO:0009624) |
| 0.0 |
0.1 |
GO:0010626 |
regulation of Schwann cell proliferation(GO:0010624) negative regulation of Schwann cell proliferation(GO:0010626) Schwann cell proliferation(GO:0014010) |
| 0.0 |
0.1 |
GO:1903012 |
positive regulation of bone development(GO:1903012) |
| 0.0 |
0.0 |
GO:1902913 |
positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.0 |
0.2 |
GO:0032971 |
regulation of muscle filament sliding(GO:0032971) |
| 0.0 |
0.0 |
GO:0042346 |
positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.0 |
0.3 |
GO:0030277 |
maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.0 |
0.2 |
GO:0002933 |
lipid hydroxylation(GO:0002933) |
| 0.0 |
0.3 |
GO:0019388 |
galactose catabolic process(GO:0019388) |
| 0.0 |
0.1 |
GO:0016556 |
mRNA modification(GO:0016556) |
| 0.0 |
0.1 |
GO:0001827 |
inner cell mass cell fate commitment(GO:0001827) inner cell mass cellular morphogenesis(GO:0001828) |
| 0.0 |
0.3 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 |
0.1 |
GO:0002023 |
reduction of food intake in response to dietary excess(GO:0002023) |
| 0.0 |
0.3 |
GO:1902035 |
regulation of hematopoietic stem cell proliferation(GO:1902033) positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 |
0.1 |
GO:0032455 |
nerve growth factor processing(GO:0032455) |
| 0.0 |
0.1 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.0 |
0.1 |
GO:2000587 |
negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.0 |
0.1 |
GO:0071073 |
positive regulation of phospholipid biosynthetic process(GO:0071073) |
| 0.0 |
0.3 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.0 |
0.4 |
GO:0006884 |
cell volume homeostasis(GO:0006884) |
| 0.0 |
0.0 |
GO:0045900 |
negative regulation of translational elongation(GO:0045900) |
| 0.0 |
0.1 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 |
0.2 |
GO:0003298 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 |
0.0 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.0 |
0.2 |
GO:0038165 |
oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.0 |
0.1 |
GO:0003350 |
pulmonary myocardium development(GO:0003350) |
| 0.0 |
0.0 |
GO:0031118 |
rRNA pseudouridine synthesis(GO:0031118) |
| 0.0 |
0.1 |
GO:0006147 |
guanine catabolic process(GO:0006147) |
| 0.0 |
0.3 |
GO:0051457 |
maintenance of protein location in nucleus(GO:0051457) |
| 0.0 |
0.1 |
GO:0019885 |
antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
| 0.0 |
0.1 |
GO:0080154 |
regulation of fertilization(GO:0080154) |
| 0.0 |
0.1 |
GO:0030210 |
heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.0 |
0.8 |
GO:0071577 |
zinc II ion transmembrane transport(GO:0071577) |
| 0.0 |
0.1 |
GO:1904692 |
positive regulation of type B pancreatic cell proliferation(GO:1904692) |
| 0.0 |
0.0 |
GO:0071907 |
determination of digestive tract left/right asymmetry(GO:0071907) |
| 0.0 |
0.2 |
GO:0090151 |
establishment of protein localization to mitochondrial membrane(GO:0090151) |
| 0.0 |
0.8 |
GO:0030815 |
negative regulation of cAMP metabolic process(GO:0030815) |
| 0.0 |
0.1 |
GO:0042754 |
negative regulation of circadian rhythm(GO:0042754) |
| 0.0 |
0.2 |
GO:0000338 |
protein deneddylation(GO:0000338) |
| 0.0 |
0.1 |
GO:0072093 |
ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
| 0.0 |
0.0 |
GO:0010193 |
response to ozone(GO:0010193) |
| 0.0 |
0.3 |
GO:0097107 |
postsynaptic density assembly(GO:0097107) gephyrin clustering involved in postsynaptic density assembly(GO:0097116) |
| 0.0 |
0.0 |
GO:0048619 |
embryonic hindgut morphogenesis(GO:0048619) |
| 0.0 |
0.8 |
GO:0008542 |
visual learning(GO:0008542) |
| 0.0 |
1.0 |
GO:0018208 |
peptidyl-proline modification(GO:0018208) |
| 0.0 |
0.1 |
GO:0002769 |
natural killer cell inhibitory signaling pathway(GO:0002769) |
| 0.0 |
0.8 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.0 |
0.4 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 |
2.3 |
GO:0070126 |
mitochondrial translational termination(GO:0070126) |
| 0.0 |
0.1 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 |
0.0 |
GO:1990036 |
calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.0 |
0.4 |
GO:0030252 |
growth hormone secretion(GO:0030252) |
| 0.0 |
0.0 |
GO:0072716 |
response to actinomycin D(GO:0072716) cellular response to actinomycin D(GO:0072717) |
| 0.0 |
0.2 |
GO:0015816 |
glycine transport(GO:0015816) |
| 0.0 |
0.0 |
GO:0002638 |
negative regulation of immunoglobulin production(GO:0002638) |
| 0.0 |
0.1 |
GO:0014707 |
branchiomeric skeletal muscle development(GO:0014707) |
| 0.0 |
0.0 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 0.0 |
0.1 |
GO:0090131 |
mesenchyme migration(GO:0090131) |
| 0.0 |
0.1 |
GO:0035674 |
tricarboxylic acid transmembrane transport(GO:0035674) |
| 0.0 |
0.1 |
GO:0046102 |
inosine metabolic process(GO:0046102) |
| 0.0 |
0.3 |
GO:0046039 |
GTP metabolic process(GO:0046039) |
| 0.0 |
0.1 |
GO:0032074 |
negative regulation of nuclease activity(GO:0032074) |
| 0.0 |
0.0 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 0.0 |
0.0 |
GO:0030300 |
regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
| 0.0 |
0.1 |
GO:0099566 |
regulation of postsynaptic cytosolic calcium ion concentration(GO:0099566) |
| 0.0 |
0.3 |
GO:0021692 |
cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
| 0.0 |
0.1 |
GO:0031125 |
rRNA 3'-end processing(GO:0031125) |
| 0.0 |
0.1 |
GO:2000490 |
negative regulation of hepatic stellate cell activation(GO:2000490) |
| 0.0 |
0.2 |
GO:0035860 |
glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.0 |
0.1 |
GO:0097068 |
response to thyroxine(GO:0097068) response to L-phenylalanine derivative(GO:1904386) |
| 0.0 |
0.1 |
GO:0043476 |
pigment accumulation(GO:0043476) cellular pigment accumulation(GO:0043482) |
| 0.0 |
0.1 |
GO:0019919 |
peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.0 |
0.1 |
GO:0042412 |
taurine biosynthetic process(GO:0042412) |
| 0.0 |
0.0 |
GO:1903413 |
cellular response to bile acid(GO:1903413) |
| 0.0 |
0.1 |
GO:1902283 |
negative regulation of primary amine oxidase activity(GO:1902283) |
| 0.0 |
0.1 |
GO:1904970 |
brush border assembly(GO:1904970) |
| 0.0 |
0.1 |
GO:1901660 |
calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
| 0.0 |
0.1 |
GO:0086073 |
bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.0 |
0.1 |
GO:0008218 |
bioluminescence(GO:0008218) |
| 0.0 |
0.1 |
GO:0071918 |
urea transmembrane transport(GO:0071918) |
| 0.0 |
0.1 |
GO:0070893 |
transposon integration(GO:0070893) regulation of transposon integration(GO:0070894) negative regulation of transposon integration(GO:0070895) |
| 0.0 |
2.3 |
GO:0038096 |
immune response-regulating cell surface receptor signaling pathway involved in phagocytosis(GO:0002433) Fc-gamma receptor signaling pathway involved in phagocytosis(GO:0038096) |
| 0.0 |
0.5 |
GO:0018345 |
protein palmitoylation(GO:0018345) |
| 0.0 |
0.0 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.0 |
0.1 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 |
0.1 |
GO:0030916 |
otic vesicle formation(GO:0030916) |
| 0.0 |
0.8 |
GO:0071166 |
ribonucleoprotein complex localization(GO:0071166) |
| 0.0 |
0.0 |
GO:0046968 |
peptide antigen transport(GO:0046968) |
| 0.0 |
0.0 |
GO:0042421 |
norepinephrine biosynthetic process(GO:0042421) |
| 0.0 |
0.3 |
GO:0090083 |
regulation of inclusion body assembly(GO:0090083) |
| 0.0 |
0.1 |
GO:0007468 |
regulation of rhodopsin gene expression(GO:0007468) |
| 0.0 |
0.0 |
GO:0021764 |
amygdala development(GO:0021764) |
| 0.0 |
0.0 |
GO:0016198 |
axon choice point recognition(GO:0016198) |
| 0.0 |
0.0 |
GO:1900154 |
regulation of bone trabecula formation(GO:1900154) negative regulation of bone trabecula formation(GO:1900155) |
| 0.0 |
0.0 |
GO:0099538 |
synaptic signaling via neuropeptide(GO:0099538) trans-synaptic signaling by neuropeptide(GO:0099540) trans-synaptic signaling by neuropeptide, modulating synaptic transmission(GO:0099551) |
| 0.0 |
0.0 |
GO:0042095 |
interferon-gamma biosynthetic process(GO:0042095) regulation of interferon-gamma biosynthetic process(GO:0045072) |
| 0.0 |
0.1 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.0 |
0.0 |
GO:0032957 |
inositol trisphosphate metabolic process(GO:0032957) |
| 0.0 |
0.0 |
GO:0061589 |
calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 |
0.0 |
GO:0090290 |
positive regulation of osteoclast proliferation(GO:0090290) |
| 0.0 |
0.0 |
GO:0002525 |
acute inflammatory response to non-antigenic stimulus(GO:0002525) regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
| 0.0 |
0.1 |
GO:0035970 |
peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 |
0.3 |
GO:0006750 |
glutathione biosynthetic process(GO:0006750) |
| 0.0 |
0.0 |
GO:1903599 |
positive regulation of mitophagy(GO:1903599) |
| 0.0 |
0.1 |
GO:0035995 |
detection of muscle stretch(GO:0035995) |
| 0.0 |
0.0 |
GO:0071670 |
smooth muscle cell chemotaxis(GO:0071670) |
| 0.0 |
0.1 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.0 |
0.1 |
GO:0045007 |
depurination(GO:0045007) |
| 0.0 |
0.1 |
GO:0071569 |
protein ufmylation(GO:0071569) |
| 0.0 |
0.1 |
GO:0090197 |
regulation of chemokine secretion(GO:0090196) positive regulation of chemokine secretion(GO:0090197) |
| 0.0 |
0.2 |
GO:0046348 |
amino sugar catabolic process(GO:0046348) |
| 0.0 |
0.6 |
GO:0050913 |
sensory perception of bitter taste(GO:0050913) |
| 0.0 |
0.1 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 |
0.1 |
GO:0032264 |
IMP salvage(GO:0032264) |
| 0.0 |
0.0 |
GO:2000535 |
regulation of entry of bacterium into host cell(GO:2000535) |
| 0.0 |
0.1 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.0 |
0.2 |
GO:0015871 |
choline transport(GO:0015871) |
| 0.0 |
0.0 |
GO:0002423 |
natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002420) natural killer cell mediated immune response to tumor cell(GO:0002423) regulation of natural killer cell mediated immune response to tumor cell(GO:0002855) regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002858) |
| 0.0 |
0.0 |
GO:0015847 |
putrescine transport(GO:0015847) |
| 0.0 |
0.0 |
GO:0042780 |
tRNA 3'-end processing(GO:0042780) |
| 0.0 |
0.1 |
GO:0097398 |
response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.0 |
0.1 |
GO:0007168 |
receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 |
0.0 |
GO:2001269 |
positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.0 |
0.0 |
GO:0009730 |
detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.0 |
0.1 |
GO:0032196 |
transposition(GO:0032196) |
| 0.0 |
0.0 |
GO:0072656 |
maintenance of protein location in mitochondrion(GO:0072656) |
| 0.0 |
0.2 |
GO:0035338 |
long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.0 |
0.0 |
GO:1903031 |
regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) positive regulation of microtubule binding(GO:1904528) |
| 0.0 |
0.6 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.0 |
0.7 |
GO:0031295 |
T cell costimulation(GO:0031295) |
| 0.0 |
0.0 |
GO:0048749 |
compound eye development(GO:0048749) |
| 0.0 |
0.2 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.0 |
0.0 |
GO:0006829 |
zinc II ion transport(GO:0006829) |
| 0.0 |
0.2 |
GO:0008272 |
sulfate transport(GO:0008272) |
| 0.0 |
0.1 |
GO:0051013 |
microtubule severing(GO:0051013) |
