Project
Illumina Body Map 2 (GSE30611)
Navigation
Downloads
Results for TAL1
Z-value: 2.95
Motif logo
Transcription factors associated with TAL1
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
TAL1
|
ENSG00000162367.11 | TAL bHLH transcription factor 1, erythroid differentiation factor |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| TAL1 | hg38_v1_chr1_-_47231715_47231786 | 0.52 | 2.5e-03 | Click! |
Activity profile of TAL1 motif
Sorted Z-values of TAL1 motif
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr22_+_22697789 | 13.87 |
ENST00000390306.2
|
IGLV2-23
|
immunoglobulin lambda variable 2-23 |
| chr14_-_106038355 | 13.77 |
ENST00000390597.3
|
IGHV2-5
|
immunoglobulin heavy variable 2-5 |
| chr14_-_106349792 | 13.64 |
ENST00000438142.3
|
IGHV4-31
|
immunoglobulin heavy variable 4-31 |
| chr14_-_106360320 | 12.01 |
ENST00000390615.2
|
IGHV3-33
|
immunoglobulin heavy variable 3-33 |
| chr14_-_106422175 | 11.54 |
ENST00000390619.2
|
IGHV4-39
|
immunoglobulin heavy variable 4-39 |
| chr2_-_89143133 | 11.21 |
ENST00000492167.1
|
IGKV3-20
|
immunoglobulin kappa variable 3-20 |
| chr14_-_105940235 | 11.04 |
ENST00000390593.2
|
IGHV6-1
|
immunoglobulin heavy variable 6-1 |
| chr14_-_106324743 | 10.97 |
ENST00000390612.3
|
IGHV4-28
|
immunoglobulin heavy variable 4-28 |
| chr14_-_106715166 | 10.75 |
ENST00000390633.2
|
IGHV1-69
|
immunoglobulin heavy variable 1-69 |
| chr14_-_106639589 | 10.73 |
ENST00000390630.3
|
IGHV4-61
|
immunoglobulin heavy variable 4-61 |
| chr2_-_88947820 | 10.63 |
ENST00000496168.1
|
IGKV1-5
|
immunoglobulin kappa variable 1-5 |
| chr14_-_106627685 | 10.62 |
ENST00000390629.3
|
IGHV4-59
|
immunoglobulin heavy variable 4-59 |
| chr22_+_22822658 | 10.51 |
ENST00000620395.2
|
IGLV2-8
|
immunoglobulin lambda variable 2-8 |
| chr22_+_22880706 | 10.38 |
ENST00000390319.2
|
IGLV3-1
|
immunoglobulin lambda variable 3-1 |
| chr14_-_94390614 | 9.32 |
ENST00000553327.5
ENST00000556955.5 ENST00000557118.5 ENST00000440909.5 |
SERPINA1
|
serpin family A member 1 |
| chr14_-_94390667 | 9.26 |
ENST00000557492.5
ENST00000355814.8 ENST00000437397.5 ENST00000448921.5 ENST00000393088.8 |
SERPINA1
|
serpin family A member 1 |
| chr22_+_22887780 | 9.08 |
ENST00000532223.2
ENST00000526893.6 ENST00000531372.1 |
IGLL5
|
immunoglobulin lambda like polypeptide 5 |
| chr14_-_105856183 | 8.50 |
ENST00000637539.2
ENST00000390559.6 |
IGHM
|
immunoglobulin heavy constant mu |
| chr14_-_94390650 | 8.37 |
ENST00000449399.7
ENST00000404814.8 |
SERPINA1
|
serpin family A member 1 |
| chr14_-_106511856 | 8.35 |
ENST00000390622.2
|
IGHV1-46
|
immunoglobulin heavy variable 1-46 |
| chr22_+_22098683 | 8.27 |
ENST00000390283.2
|
IGLV8-61
|
immunoglobulin lambda variable 8-61 |
| chr14_-_106062670 | 8.22 |
ENST00000390598.2
|
IGHV3-7
|
immunoglobulin heavy variable 3-7 |
| chr14_-_106235582 | 8.18 |
ENST00000390607.2
|
IGHV3-21
|
immunoglobulin heavy variable 3-21 |
| chr14_-_106771020 | 8.12 |
ENST00000617374.2
|
IGHV2-70
|
immunoglobulin heavy variable 2-70 |
| chr2_+_90114838 | 8.12 |
ENST00000417279.3
|
IGKV3D-15
|
immunoglobulin kappa variable 3D-15 |
| chr14_-_105987068 | 7.86 |
ENST00000390594.3
|
IGHV1-2
|
immunoglobulin heavy variable 1-2 |
| chr22_+_22734577 | 7.86 |
ENST00000390310.3
|
IGLV2-18
|
immunoglobulin lambda variable 2-18 |
| chr14_-_105845677 | 7.70 |
ENST00000390556.6
|
IGHD
|
immunoglobulin heavy constant delta |
| chr22_+_22792485 | 7.68 |
ENST00000390314.2
|
IGLV2-11
|
immunoglobulin lambda variable 2-11 |
| chr14_-_105626066 | 7.65 |
ENST00000641978.1
ENST00000390543.3 |
IGHG4
|
immunoglobulin heavy constant gamma 4 (G4m marker) |
| chr14_-_106811131 | 7.62 |
ENST00000424969.2
|
IGHV3-74
|
immunoglobulin heavy variable 3-74 |
| chr7_+_150800739 | 7.52 |
ENST00000004103.8
|
TMEM176A
|
transmembrane protein 176A |
| chr2_-_89213917 | 7.51 |
ENST00000498435.1
|
IGKV1-27
|
immunoglobulin kappa variable 1-27 |
| chr2_-_89117844 | 7.50 |
ENST00000490686.1
|
IGKV1-17
|
immunoglobulin kappa variable 1-17 |
| chr14_-_106762576 | 7.46 |
ENST00000624687.1
|
IGHV1-69D
|
immunoglobulin heavy variable 1-69D |
| chr4_-_73982019 | 7.34 |
ENST00000296029.4
|
PF4
|
platelet factor 4 |
| chr22_+_22811737 | 7.24 |
ENST00000390315.3
|
IGLV3-10
|
immunoglobulin lambda variable 3-10 |
| chr22_+_22758698 | 7.10 |
ENST00000390312.2
|
IGLV2-14
|
immunoglobulin lambda variable 2-14 |
| chr14_-_106301848 | 6.91 |
ENST00000390611.2
|
IGHV2-26
|
immunoglobulin heavy variable 2-26 |
| chr14_-_106374129 | 6.62 |
ENST00000390616.2
|
IGHV4-34
|
immunoglobulin heavy variable 4-34 |
| chr14_-_106335613 | 6.60 |
ENST00000603660.1
|
IGHV3-30
|
immunoglobulin heavy variable 3-30 |
| chr14_-_106005574 | 6.55 |
ENST00000390595.3
|
IGHV1-3
|
immunoglobulin heavy variable 1-3 |
| chr14_-_106269133 | 6.36 |
ENST00000390609.3
|
IGHV3-23
|
immunoglobulin heavy variable 3-23 |
| chr11_+_118304721 | 6.28 |
ENST00000361763.9
|
CD3E
|
CD3e molecule |
| chr22_+_22375984 | 6.21 |
ENST00000390296.2
|
IGLV5-45
|
immunoglobulin lambda variable 5-45 |
| chr22_+_22195753 | 6.19 |
ENST00000390285.4
|
IGLV6-57
|
immunoglobulin lambda variable 6-57 |
| chr14_-_106130061 | 6.16 |
ENST00000390602.3
|
IGHV3-13
|
immunoglobulin heavy variable 3-13 |
| chr2_+_90100235 | 6.09 |
ENST00000492446.1
|
IGKV1D-16
|
immunoglobulin kappa variable 1D-16 |
| chr7_-_38363476 | 6.03 |
ENST00000426402.2
|
TRGV2
|
T cell receptor gamma variable 2 |
| chr22_+_22922594 | 5.93 |
ENST00000390331.3
|
IGLC7
|
immunoglobulin lambda constant 7 |
| chr22_+_22686724 | 5.93 |
ENST00000390305.2
|
IGLV3-25
|
immunoglobulin lambda variable 3-25 |
| chr14_-_106791226 | 5.90 |
ENST00000433072.2
|
IGHV3-72
|
immunoglobulin heavy variable 3-72 |
| chr22_+_22327298 | 5.90 |
ENST00000390291.2
|
IGLV1-50
|
immunoglobulin lambda variable 1-50 (non-functional) |
| chr16_+_72054477 | 5.89 |
ENST00000355906.10
ENST00000570083.5 ENST00000228226.12 ENST00000398131.6 ENST00000569639.5 ENST00000564499.5 ENST00000357763.8 ENST00000613898.1 ENST00000562526.5 ENST00000565574.5 ENST00000568417.6 |
HP
|
haptoglobin |
| chr2_-_89027700 | 5.84 |
ENST00000483158.1
|
IGKV3-11
|
immunoglobulin kappa variable 3-11 |
| chr14_-_106154113 | 5.83 |
ENST00000390603.2
|
IGHV3-15
|
immunoglobulin heavy variable 3-15 |
| chr2_+_88885397 | 5.81 |
ENST00000390243.2
|
IGKV4-1
|
immunoglobulin kappa variable 4-1 |
| chr7_+_142320677 | 5.77 |
ENST00000390381.3
|
TRBV5-1
|
T cell receptor beta variable 5-1 |
| chr17_-_41102209 | 5.75 |
ENST00000440582.1
|
KRTAP4-16
|
keratin associated protein 4-16 |
| chrX_-_71111448 | 5.70 |
ENST00000456850.6
ENST00000473378.1 ENST00000374202.7 ENST00000374188.7 |
IL2RG
|
interleukin 2 receptor subunit gamma |
| chr21_-_44910630 | 5.65 |
ENST00000320216.10
ENST00000397852.5 |
ITGB2
|
integrin subunit beta 2 |
| chr14_-_106012390 | 5.60 |
ENST00000455737.2
|
IGHV4-4
|
immunoglobulin heavy variable 4-4 |
| chr6_+_6588082 | 5.50 |
ENST00000379953.6
|
LY86
|
lymphocyte antigen 86 |
| chr14_-_105743032 | 5.34 |
ENST00000390548.6
ENST00000390549.6 ENST00000390542.6 |
IGHG1
|
immunoglobulin heavy constant gamma 1 (G1m marker) |
| chr2_+_89959979 | 5.31 |
ENST00000453166.2
|
IGKV2D-28
|
immunoglobulin kappa variable 2D-28 |
| chr22_+_22369601 | 5.24 |
ENST00000390295.3
|
IGLV7-46
|
immunoglobulin lambda variable 7-46 |
| chr14_-_106470788 | 5.13 |
ENST00000434710.1
|
IGHV3-43
|
immunoglobulin heavy variable 3-43 |
| chr17_-_63932261 | 5.10 |
ENST00000349817.2
ENST00000006750.8 ENST00000392795.7 |
CD79B
|
CD79b molecule |
| chr7_+_142618821 | 5.09 |
ENST00000390393.3
|
TRBV19
|
T cell receptor beta variable 19 |
| chr2_-_86790825 | 5.09 |
ENST00000409781.1
ENST00000352580.7 |
CD8A
|
CD8a molecule |
| chr7_+_142391884 | 5.06 |
ENST00000390363.2
|
TRBV9
|
T cell receptor beta variable 9 |
| chr7_+_142300924 | 5.03 |
ENST00000455382.2
|
TRBV2
|
T cell receptor beta variable 2 |
| chr11_+_61102465 | 4.98 |
ENST00000347785.8
ENST00000544014.1 |
CD5
|
CD5 molecule |
| chr14_+_21846534 | 4.93 |
ENST00000390434.3
|
TRAV8-2
|
T cell receptor alpha variable 8-2 |
| chr16_+_33827140 | 4.88 |
ENST00000562905.2
|
IGHV3OR16-13
|
immunoglobulin heavy variable 3/OR16-13 (non-functional) |
| chr14_-_105644790 | 4.86 |
ENST00000641095.1
ENST00000390545.3 |
IGHG2
|
immunoglobulin heavy constant gamma 2 (G2m marker) |
| chr2_+_89913982 | 4.85 |
ENST00000390265.2
|
IGKV1D-33
|
immunoglobulin kappa variable 1D-33 |
| chr2_-_86790900 | 4.79 |
ENST00000283635.8
|
CD8A
|
CD8a molecule |
| chr4_+_73853290 | 4.71 |
ENST00000226524.4
|
PF4V1
|
platelet factor 4 variant 1 |
| chr2_-_89010515 | 4.60 |
ENST00000493819.1
|
IGKV1-9
|
immunoglobulin kappa variable 1-9 |
| chr17_-_81656532 | 4.60 |
ENST00000331056.10
|
PDE6G
|
phosphodiesterase 6G |
| chr22_-_50527689 | 4.58 |
ENST00000652401.1
|
TYMP
|
thymidine phosphorylase |
| chr12_+_6789508 | 4.47 |
ENST00000011653.9
ENST00000541982.5 ENST00000539492.1 |
CD4
|
CD4 molecule |
| chr22_+_35381086 | 4.46 |
ENST00000216117.9
ENST00000677931.1 ENST00000679074.1 |
HMOX1
|
heme oxygenase 1 |
| chr16_+_28931942 | 4.45 |
ENST00000324662.8
ENST00000538922.8 |
CD19
|
CD19 molecule |
| chr4_-_164383986 | 4.44 |
ENST00000507270.5
ENST00000514618.5 ENST00000503008.5 |
MARCHF1
|
membrane associated ring-CH-type finger 1 |
| chr1_-_169586539 | 4.40 |
ENST00000367796.3
|
F5
|
coagulation factor V |
| chr22_+_22668286 | 4.40 |
ENST00000390304.2
|
IGLV3-27
|
immunoglobulin lambda variable 3-27 |
| chr7_+_142560423 | 4.39 |
ENST00000620569.1
|
TRBV12-3
|
T cell receptor beta variable 12-3 |
| chr2_+_90220727 | 4.33 |
ENST00000471857.2
|
IGKV1D-8
|
immunoglobulin kappa variable 1D-8 |
| chr22_+_22357739 | 4.29 |
ENST00000390294.2
|
IGLV1-47
|
immunoglobulin lambda variable 1-47 |
| chr2_-_88857582 | 4.28 |
ENST00000390237.2
|
IGKC
|
immunoglobulin kappa constant |
| chr22_+_22395005 | 4.23 |
ENST00000390298.2
|
IGLV7-43
|
immunoglobulin lambda variable 7-43 |
| chr7_+_142328282 | 4.22 |
ENST00000390353.2
|
TRBV6-1
|
T cell receptor beta variable 6-1 |
| chr7_+_142720652 | 4.22 |
ENST00000390400.2
|
TRBV28
|
T cell receptor beta variable 28 |
| chr22_+_22409755 | 4.21 |
ENST00000390299.2
|
IGLV1-40
|
immunoglobulin lambda variable 1-40 |
| chr1_+_160739286 | 4.18 |
ENST00000359331.8
ENST00000495334.1 |
SLAMF7
|
SLAM family member 7 |
| chr2_-_157488829 | 4.18 |
ENST00000435117.1
ENST00000439355.5 |
CYTIP
|
cytohesin 1 interacting protein |
| chr5_+_169695135 | 4.17 |
ENST00000523684.5
ENST00000519734.5 |
DOCK2
|
dedicator of cytokinesis 2 |
| chr22_+_24432119 | 4.17 |
ENST00000472248.5
ENST00000610595.4 ENST00000618076.3 ENST00000436735.1 |
ADORA2A
|
adenosine A2a receptor |
| chr17_-_82317589 | 4.16 |
ENST00000312648.8
|
CD7
|
CD7 molecule |
| chr22_+_22747383 | 4.13 |
ENST00000390311.3
|
IGLV3-16
|
immunoglobulin lambda variable 3-16 |
| chr2_-_89268506 | 4.13 |
ENST00000473726.1
|
IGKV1-33
|
immunoglobulin kappa variable 1-33 |
| chr2_-_89085787 | 4.10 |
ENST00000390252.2
|
IGKV3-15
|
immunoglobulin kappa variable 3-15 |
| chr1_-_159714581 | 4.08 |
ENST00000255030.9
ENST00000437342.1 ENST00000368112.5 ENST00000368111.5 ENST00000368110.1 |
CRP
|
C-reactive protein |
| chr22_-_50526337 | 4.05 |
ENST00000651490.1
ENST00000543927.6 |
TYMP
SCO2
|
thymidine phosphorylase synthesis of cytochrome C oxidase 2 |
| chr19_+_54573781 | 4.03 |
ENST00000391738.8
ENST00000251376.7 ENST00000391737.3 ENST00000629481.1 |
LILRA2
|
leukocyte immunoglobulin like receptor A2 |
| chr1_+_207454230 | 4.01 |
ENST00000367058.7
ENST00000367059.3 ENST00000367057.8 |
CR2
|
complement C3d receptor 2 |
| chr16_+_32066065 | 4.01 |
ENST00000354689.6
|
IGHV3OR16-9
|
immunoglobulin heavy variable 3/OR16-9 (non-functional) |
| chr19_-_50365625 | 3.99 |
ENST00000598915.5
ENST00000253719.7 |
NAPSA
|
napsin A aspartic peptidase |
| chr20_-_36646146 | 3.98 |
ENST00000262866.9
|
SLA2
|
Src like adaptor 2 |
| chr14_-_106593319 | 3.97 |
ENST00000390627.3
|
IGHV3-53
|
immunoglobulin heavy variable 3-53 |
| chr22_+_22343185 | 3.97 |
ENST00000427632.2
|
IGLV9-49
|
immunoglobulin lambda variable 9-49 |
| chr15_-_21718245 | 3.94 |
ENST00000630556.1
|
ENSG00000281179.1
|
novel gene identicle to IGHV1OR15-1 |
| chr2_+_203867764 | 3.94 |
ENST00000648405.2
|
CTLA4
|
cytotoxic T-lymphocyte associated protein 4 |
| chr22_+_22030934 | 3.92 |
ENST00000390282.2
|
IGLV4-69
|
immunoglobulin lambda variable 4-69 |
| chr1_+_160739239 | 3.91 |
ENST00000368043.8
|
SLAMF7
|
SLAM family member 7 |
| chr2_+_90172802 | 3.90 |
ENST00000390277.3
|
IGKV3D-11
|
immunoglobulin kappa variable 3D-11 |
| chr7_+_142450941 | 3.90 |
ENST00000390368.2
|
TRBV6-5
|
T cell receptor beta variable 6-5 |
| chr11_-_67437670 | 3.89 |
ENST00000326294.4
|
PTPRCAP
|
protein tyrosine phosphatase receptor type C associated protein |
| chr4_+_155903688 | 3.87 |
ENST00000536354.3
|
TDO2
|
tryptophan 2,3-dioxygenase |
| chr15_+_81196871 | 3.86 |
ENST00000559383.5
ENST00000394660.6 ENST00000683961.1 |
IL16
|
interleukin 16 |
| chr19_-_4302380 | 3.86 |
ENST00000600114.5
ENST00000600349.1 ENST00000595645.5 ENST00000301272.6 |
TMIGD2
|
transmembrane and immunoglobulin domain containing 2 |
| chr1_-_169586471 | 3.83 |
ENST00000367797.9
|
F5
|
coagulation factor V |
| chr9_-_35650902 | 3.81 |
ENST00000259608.8
ENST00000618781.1 |
SIT1
|
signaling threshold regulating transmembrane adaptor 1 |
| chr2_-_89040745 | 3.81 |
ENST00000480492.1
|
IGKV1-12
|
immunoglobulin kappa variable 1-12 |
| chr14_-_106737547 | 3.80 |
ENST00000632209.1
|
IGHV1-69-2
|
immunoglobulin heavy variable 1-69-2 |
| chr7_-_38300288 | 3.79 |
ENST00000390341.2
|
TRGV10
|
T cell receptor gamma variable 10 (non-functional) |
| chr6_-_24911029 | 3.79 |
ENST00000259698.9
ENST00000644621.1 ENST00000644411.1 |
RIPOR2
|
RHO family interacting cell polarization regulator 2 |
| chr4_-_83109843 | 3.78 |
ENST00000411416.6
|
PLAC8
|
placenta associated 8 |
| chr12_+_47079586 | 3.75 |
ENST00000432328.2
ENST00000546455.6 |
PCED1B
|
PC-esterase domain containing 1B |
| chr14_-_105708627 | 3.72 |
ENST00000641837.1
ENST00000390547.3 |
IGHA1
|
immunoglobulin heavy constant alpha 1 |
| chr14_+_22281097 | 3.70 |
ENST00000390465.2
|
TRAV38-2DV8
|
T cell receptor alpha variable 38-2/delta variable 8 |
| chr16_+_32847692 | 3.70 |
ENST00000567458.2
|
IGHV2OR16-5
|
immunoglobulin heavy variable 2/OR16-5 (non-functional) |
| chr6_-_24910695 | 3.69 |
ENST00000643623.1
ENST00000538035.6 ENST00000647136.1 |
RIPOR2
|
RHO family interacting cell polarization regulator 2 |
| chr2_+_97713568 | 3.69 |
ENST00000264972.10
|
ZAP70
|
zeta chain of T cell receptor associated protein kinase 70 |
| chr9_-_137032081 | 3.68 |
ENST00000314412.7
|
FUT7
|
fucosyltransferase 7 |
| chr7_-_150800533 | 3.65 |
ENST00000434545.5
|
TMEM176B
|
transmembrane protein 176B |
| chr19_-_51630401 | 3.64 |
ENST00000683636.1
|
SIGLEC5
|
sialic acid binding Ig like lectin 5 |
| chr7_+_150801522 | 3.63 |
ENST00000461345.5
|
TMEM176A
|
transmembrane protein 176A |
| chr14_-_106538331 | 3.62 |
ENST00000390624.3
|
IGHV3-48
|
immunoglobulin heavy variable 3-48 |
| chr17_-_41140487 | 3.61 |
ENST00000345847.4
|
KRTAP4-6
|
keratin associated protein 4-6 |
| chr16_-_55833186 | 3.60 |
ENST00000361503.8
ENST00000422046.6 |
CES1
|
carboxylesterase 1 |
| chr14_-_106185387 | 3.60 |
ENST00000390605.2
|
IGHV1-18
|
immunoglobulin heavy variable 1-18 |
| chr14_-_106724093 | 3.59 |
ENST00000390634.3
|
IGHV2-70D
|
immunoglobulin heavy variable 2-70D |
| chr1_+_196774813 | 3.59 |
ENST00000471440.6
ENST00000391985.7 ENST00000617219.1 ENST00000367425.9 |
CFHR3
|
complement factor H related 3 |
| chr14_-_106211453 | 3.58 |
ENST00000390606.3
|
IGHV3-20
|
immunoglobulin heavy variable 3-20 |
| chr7_+_142544199 | 3.56 |
ENST00000611462.1
|
TRBV10-3
|
T cell receptor beta variable 10-3 |
| chr22_+_22818994 | 3.55 |
ENST00000390316.2
|
IGLV3-9
|
immunoglobulin lambda variable 3-9 |
| chr7_-_150801325 | 3.55 |
ENST00000447204.6
|
TMEM176B
|
transmembrane protein 176B |
| chr14_+_21894433 | 3.54 |
ENST00000390438.2
|
TRAV8-4
|
T cell receptor alpha variable 8-4 |
| chr6_-_30684744 | 3.54 |
ENST00000615892.4
|
PPP1R18
|
protein phosphatase 1 regulatory subunit 18 |
| chr14_+_21965451 | 3.52 |
ENST00000390442.3
|
TRAV12-3
|
T cell receptor alpha variable 12-3 |
| chr22_+_22322452 | 3.51 |
ENST00000390290.3
|
IGLV1-51
|
immunoglobulin lambda variable 1-51 |
| chr4_-_154612635 | 3.50 |
ENST00000407946.5
ENST00000405164.5 ENST00000336098.8 ENST00000393846.6 ENST00000404648.7 ENST00000443553.5 |
FGG
|
fibrinogen gamma chain |
| chr7_+_150800403 | 3.48 |
ENST00000484928.5
|
TMEM176A
|
transmembrane protein 176A |
| chr11_-_116792386 | 3.47 |
ENST00000433069.2
ENST00000542499.5 |
APOA5
|
apolipoprotein A5 |
| chr12_+_6444932 | 3.47 |
ENST00000266557.4
|
CD27
|
CD27 molecule |
| chr2_-_88966767 | 3.46 |
ENST00000464162.1
|
IGKV1-6
|
immunoglobulin kappa variable 1-6 |
| chr11_+_1870871 | 3.44 |
ENST00000417766.5
|
LSP1
|
lymphocyte specific protein 1 |
| chr14_-_106117159 | 3.44 |
ENST00000390601.3
|
IGHV3-11
|
immunoglobulin heavy variable 3-11 |
| chr7_-_150800320 | 3.44 |
ENST00000492607.5
ENST00000326442.10 ENST00000450753.2 |
TMEM176B
|
transmembrane protein 176B |
| chr17_+_7336502 | 3.44 |
ENST00000158762.8
|
ACAP1
|
ArfGAP with coiled-coil, ankyrin repeat and PH domains 1 |
| chr7_+_142352802 | 3.42 |
ENST00000634605.1
|
TRBV7-2
|
T cell receptor beta variable 7-2 |
| chr21_-_44914271 | 3.41 |
ENST00000522931.5
|
ITGB2
|
integrin subunit beta 2 |
| chr7_+_142462882 | 3.40 |
ENST00000454561.2
|
TRBV5-4
|
T cell receptor beta variable 5-4 |
| chr13_+_108269629 | 3.39 |
ENST00000430559.5
ENST00000375887.9 |
TNFSF13B
|
TNF superfamily member 13b |
| chr17_-_35880350 | 3.38 |
ENST00000605140.6
ENST00000651122.1 ENST00000603197.6 |
CCL5
|
C-C motif chemokine ligand 5 |
| chr22_+_22162155 | 3.38 |
ENST00000390284.2
|
IGLV4-60
|
immunoglobulin lambda variable 4-60 |
| chr1_+_161707244 | 3.34 |
ENST00000349527.8
ENST00000294796.8 ENST00000309691.10 ENST00000367953.7 ENST00000367950.2 |
FCRLA
|
Fc receptor like A |
| chr15_-_22160868 | 3.33 |
ENST00000604066.1
|
IGHV1OR15-1
|
immunoglobulin heavy variable 1/OR15-1 (non-functional) |
| chr2_+_88897230 | 3.32 |
ENST00000390244.2
|
IGKV5-2
|
immunoglobulin kappa variable 5-2 |
| chr7_+_142563730 | 3.32 |
ENST00000617347.1
|
TRBV12-4
|
T cell receptor beta variable 12-4 |
| chr22_+_22906342 | 3.29 |
ENST00000390325.2
|
IGLC3
|
immunoglobulin lambda constant 3 (Kern-Oz+ marker) |
| chr14_-_106108453 | 3.28 |
ENST00000632950.2
|
IGHV5-10-1
|
immunoglobulin heavy variable 5-10-1 |
| chr22_+_39960397 | 3.27 |
ENST00000424496.2
|
ENSG00000225528.3
|
novel protein similar to translation machinery associated 7 homolog (S. cerevisiae) TMA7 |
| chr16_-_31202733 | 3.27 |
ENST00000350605.4
ENST00000247470.10 |
PYCARD
|
PYD and CARD domain containing |
| chr1_-_157777124 | 3.24 |
ENST00000361516.8
ENST00000368181.4 |
FCRL2
|
Fc receptor like 2 |
| chr8_-_100706763 | 3.22 |
ENST00000517990.5
|
PABPC1
|
poly(A) binding protein cytoplasmic 1 |
| chr1_+_27342014 | 3.22 |
ENST00000618673.4
ENST00000318074.9 ENST00000616558.5 |
SYTL1
|
synaptotagmin like 1 |
| chr14_-_106411021 | 3.22 |
ENST00000390618.2
|
IGHV3-38
|
immunoglobulin heavy variable 3-38 (non-functional) |
| chr16_+_3065348 | 3.21 |
ENST00000529699.5
ENST00000526464.6 ENST00000440815.7 ENST00000529550.5 |
IL32
|
interleukin 32 |
| chr7_+_142345412 | 3.21 |
ENST00000390392.3
|
TRBV4-2
|
T cell receptor beta variable 4-2 |
| chr3_+_32391841 | 3.21 |
ENST00000334983.10
|
CMTM7
|
CKLF like MARVEL transmembrane domain containing 7 |
| chr11_-_2301859 | 3.19 |
ENST00000456145.2
ENST00000381153.8 |
C11orf21
|
chromosome 11 open reading frame 21 |
| chr2_-_89297785 | 3.18 |
ENST00000465170.1
|
IGKV1-37
|
immunoglobulin kappa variable 1-37 (non-functional) |
| chr9_+_114329869 | 3.17 |
ENST00000431067.4
|
ORM2
|
orosomucoid 2 |
| chr2_-_89100352 | 3.17 |
ENST00000479981.1
|
IGKV1-16
|
immunoglobulin kappa variable 1-16 |
| chr1_-_30757767 | 3.17 |
ENST00000294507.4
|
LAPTM5
|
lysosomal protein transmembrane 5 |
| chr22_+_22431949 | 3.17 |
ENST00000390301.3
|
IGLV1-36
|
immunoglobulin lambda variable 1-36 |
| chr11_-_105035113 | 3.16 |
ENST00000526568.5
ENST00000531166.5 ENST00000534497.5 ENST00000527979.5 ENST00000533400.6 ENST00000528974.1 ENST00000525825.5 ENST00000353247.9 ENST00000446369.5 ENST00000436863.7 |
CASP1
|
caspase 1 |
| chr14_-_94388589 | 3.16 |
ENST00000402629.1
ENST00000556091.1 ENST00000393087.9 ENST00000554720.1 |
SERPINA1
|
serpin family A member 1 |
| chr19_+_16143678 | 3.15 |
ENST00000613986.4
ENST00000593031.1 |
HSH2D
|
hematopoietic SH2 domain containing |
| chr7_-_87475647 | 3.14 |
ENST00000649586.2
ENST00000265723.8 |
ABCB4
|
ATP binding cassette subfamily B member 4 |
| chr14_-_22815421 | 3.13 |
ENST00000674313.1
ENST00000555959.1 |
SLC7A7
|
solute carrier family 7 member 7 |
| chr13_+_108269880 | 3.11 |
ENST00000542136.1
|
TNFSF13B
|
TNF superfamily member 13b |
| chr15_+_88635626 | 3.10 |
ENST00000379224.10
|
ISG20
|
interferon stimulated exonuclease gene 20 |
| chr14_-_50944428 | 3.10 |
ENST00000532462.5
|
PYGL
|
glycogen phosphorylase L |
| chr2_-_88992903 | 3.09 |
ENST00000495489.1
|
IGKV1-8
|
immunoglobulin kappa variable 1-8 |
| chr1_+_2555639 | 3.08 |
ENST00000426449.5
ENST00000434817.5 ENST00000435221.6 |
TNFRSF14
|
TNF receptor superfamily member 14 |
Network of associatons between targets according to the STRING database.
First level regulatory network of TAL1
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.1 | 533.1 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 2.7 | 2.7 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 2.5 | 7.6 | GO:2000296 | negative regulation of hydrogen peroxide catabolic process(GO:2000296) |
| 2.4 | 9.8 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 2.4 | 9.5 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
| 2.2 | 31.2 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 2.2 | 6.5 | GO:2000412 | positive regulation of thymocyte migration(GO:2000412) |
| 2.1 | 8.3 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 2.1 | 12.4 | GO:1903904 | negative regulation of establishment of T cell polarity(GO:1903904) negative regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001107) |
| 1.9 | 7.7 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 1.9 | 5.7 | GO:0002818 | intracellular defense response(GO:0002818) |
| 1.8 | 9.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 1.7 | 5.2 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 1.7 | 1.7 | GO:0002436 | immune complex clearance(GO:0002434) immune complex clearance by monocytes and macrophages(GO:0002436) regulation of immune complex clearance by monocytes and macrophages(GO:0090264) |
| 1.7 | 5.1 | GO:1905237 | response to cyclosporin A(GO:1905237) |
| 1.7 | 5.0 | GO:0035397 | helper T cell enhancement of adaptive immune response(GO:0035397) |
| 1.6 | 9.9 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 1.6 | 9.8 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
| 1.6 | 8.2 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 1.6 | 4.8 | GO:0002503 | peptide antigen assembly with MHC class II protein complex(GO:0002503) |
| 1.6 | 6.3 | GO:0090119 | vesicle-mediated cholesterol transport(GO:0090119) |
| 1.5 | 6.2 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 1.5 | 7.4 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 1.4 | 1.4 | GO:1904438 | positive regulation of iron ion transport(GO:0034758) positive regulation of iron ion transmembrane transport(GO:0034761) regulation of iron ion import(GO:1900390) regulation of ferrous iron import into cell(GO:1903989) positive regulation of ferrous iron import into cell(GO:1903991) regulation of ferrous iron binding(GO:1904432) positive regulation of ferrous iron binding(GO:1904434) regulation of transferrin receptor binding(GO:1904435) positive regulation of transferrin receptor binding(GO:1904437) regulation of ferrous iron import across plasma membrane(GO:1904438) positive regulation of ferrous iron import across plasma membrane(GO:1904440) |
| 1.3 | 6.6 | GO:0038156 | interleukin-3-mediated signaling pathway(GO:0038156) |
| 1.3 | 5.2 | GO:0003095 | pressure natriuresis(GO:0003095) |
| 1.3 | 3.9 | GO:0019442 | tryptophan catabolic process to acetyl-CoA(GO:0019442) |
| 1.3 | 3.8 | GO:0038193 | thromboxane A2 signaling pathway(GO:0038193) |
| 1.3 | 5.0 | GO:0010902 | positive regulation of very-low-density lipoprotein particle remodeling(GO:0010902) |
| 1.3 | 8.8 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 1.3 | 3.8 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 1.2 | 3.6 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
| 1.2 | 8.5 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 1.2 | 2.4 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 1.2 | 6.0 | GO:0009608 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) |
| 1.2 | 3.5 | GO:0002380 | immunoglobulin secretion involved in immune response(GO:0002380) |
| 1.2 | 1.2 | GO:0090212 | negative regulation of establishment of blood-brain barrier(GO:0090212) |
| 1.1 | 6.9 | GO:0032571 | response to vitamin K(GO:0032571) |
| 1.1 | 6.8 | GO:0046103 | adenosine catabolic process(GO:0006154) inosine biosynthetic process(GO:0046103) |
| 1.1 | 1.1 | GO:0002305 | gamma-delta intraepithelial T cell differentiation(GO:0002304) CD8-positive, gamma-delta intraepithelial T cell differentiation(GO:0002305) |
| 1.1 | 5.5 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 1.1 | 5.3 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
| 1.1 | 2.1 | GO:1901523 | leukotriene catabolic process(GO:0036100) leukotriene B4 catabolic process(GO:0036101) leukotriene B4 metabolic process(GO:0036102) icosanoid catabolic process(GO:1901523) fatty acid derivative catabolic process(GO:1901569) |
| 1.1 | 3.2 | GO:0006711 | estrogen catabolic process(GO:0006711) |
| 1.0 | 4.1 | GO:0002774 | Fc receptor mediated inhibitory signaling pathway(GO:0002774) |
| 1.0 | 8.1 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 1.0 | 3.0 | GO:1902227 | negative regulation of macrophage colony-stimulating factor signaling pathway(GO:1902227) negative regulation of response to macrophage colony-stimulating factor(GO:1903970) negative regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903973) |
| 1.0 | 3.0 | GO:0035915 | pore formation in membrane of other organism(GO:0035915) |
| 1.0 | 3.9 | GO:0044537 | regulation of circulating fibrinogen levels(GO:0044537) |
| 1.0 | 9.7 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 1.0 | 3.9 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 1.0 | 2.9 | GO:0038178 | complement component C5a signaling pathway(GO:0038178) |
| 1.0 | 7.6 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.9 | 2.8 | GO:0010931 | macrophage tolerance induction(GO:0010931) regulation of macrophage tolerance induction(GO:0010932) positive regulation of macrophage tolerance induction(GO:0010933) |
| 0.9 | 0.9 | GO:0002578 | negative regulation of antigen processing and presentation(GO:0002578) negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
| 0.9 | 1.8 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
| 0.9 | 3.6 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.9 | 0.9 | GO:0097501 | stress response to metal ion(GO:0097501) |
| 0.9 | 3.6 | GO:0034445 | regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 0.9 | 1.8 | GO:0002316 | follicular B cell differentiation(GO:0002316) |
| 0.9 | 7.9 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.9 | 5.2 | GO:0043366 | beta selection(GO:0043366) |
| 0.9 | 5.1 | GO:0001080 | nitrogen catabolite regulation of transcription from RNA polymerase II promoter(GO:0001079) nitrogen catabolite activation of transcription from RNA polymerase II promoter(GO:0001080) regulation of urea metabolic process(GO:0034255) intracellular bile acid receptor signaling pathway(GO:0038185) interleukin-17 secretion(GO:0072615) nitrogen catabolite regulation of transcription(GO:0090293) nitrogen catabolite activation of transcription(GO:0090294) regulation of nitrogen cycle metabolic process(GO:1903314) positive regulation of glutamate metabolic process(GO:2000213) regulation of ammonia assimilation cycle(GO:2001248) positive regulation of ammonia assimilation cycle(GO:2001250) |
| 0.9 | 0.9 | GO:0002501 | peptide antigen assembly with MHC protein complex(GO:0002501) |
| 0.8 | 8.5 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
| 0.8 | 5.1 | GO:0060370 | susceptibility to T cell mediated cytotoxicity(GO:0060370) |
| 0.8 | 4.2 | GO:0010193 | response to ozone(GO:0010193) |
| 0.8 | 18.6 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.8 | 5.6 | GO:0044800 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.8 | 4.8 | GO:0009804 | coumarin metabolic process(GO:0009804) |
| 0.8 | 3.2 | GO:0005986 | sucrose biosynthetic process(GO:0005986) |
| 0.8 | 66.9 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.8 | 4.7 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.8 | 3.9 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.8 | 7.0 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
| 0.8 | 2.3 | GO:1904784 | NLRP1 inflammasome complex assembly(GO:1904784) |
| 0.8 | 3.0 | GO:2000910 | negative regulation of cholesterol import(GO:0060621) negative regulation of sterol import(GO:2000910) |
| 0.7 | 5.9 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.7 | 153.6 | GO:0002377 | immunoglobulin production(GO:0002377) |
| 0.7 | 2.2 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.7 | 3.7 | GO:0003366 | cell-matrix adhesion involved in ameboidal cell migration(GO:0003366) |
| 0.7 | 5.8 | GO:1903433 | regulation of constitutive secretory pathway(GO:1903433) |
| 0.7 | 2.2 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 0.7 | 1.4 | GO:2000564 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) granzyme B production(GO:0071613) regulation of granzyme B production(GO:0071661) positive regulation of granzyme B production(GO:0071663) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) positive regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000566) |
| 0.7 | 1.4 | GO:0038043 | interleukin-5-mediated signaling pathway(GO:0038043) |
| 0.7 | 7.7 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.7 | 2.8 | GO:0019082 | viral protein processing(GO:0019082) regulation of nerve growth factor production(GO:0032903) negative regulation of nerve growth factor production(GO:0032904) dibasic protein processing(GO:0090472) |
| 0.7 | 0.7 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) regulation of respiratory burst involved in inflammatory response(GO:0060264) negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.7 | 0.7 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.7 | 0.7 | GO:2000182 | regulation of progesterone biosynthetic process(GO:2000182) |
| 0.7 | 2.0 | GO:0005999 | xylulose biosynthetic process(GO:0005999) |
| 0.7 | 2.7 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.7 | 1.3 | GO:0043309 | regulation of eosinophil degranulation(GO:0043309) positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
| 0.6 | 1.9 | GO:0032824 | negative regulation of natural killer cell differentiation(GO:0032824) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
| 0.6 | 2.5 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.6 | 2.5 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.6 | 7.0 | GO:0043129 | surfactant homeostasis(GO:0043129) |
| 0.6 | 2.5 | GO:0045425 | positive regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045425) |
| 0.6 | 5.7 | GO:0052696 | flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
| 0.6 | 8.8 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.6 | 3.1 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.6 | 3.7 | GO:0022614 | membrane to membrane docking(GO:0022614) |
| 0.6 | 1.2 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
| 0.6 | 0.6 | GO:0002339 | B cell selection(GO:0002339) |
| 0.6 | 1.8 | GO:0070105 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.6 | 1.8 | GO:0052314 | phytoalexin metabolic process(GO:0052314) |
| 0.6 | 1.2 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.6 | 1.8 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.6 | 1.8 | GO:1901291 | negative regulation of double-strand break repair via single-strand annealing(GO:1901291) |
| 0.6 | 0.6 | GO:1901623 | regulation of lymphocyte chemotaxis(GO:1901623) |
| 0.6 | 0.6 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 0.6 | 1.7 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.6 | 1.2 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.6 | 0.6 | GO:0035963 | cellular response to interleukin-13(GO:0035963) |
| 0.6 | 6.9 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) |
| 0.6 | 3.4 | GO:0071461 | cellular response to redox state(GO:0071461) |
| 0.6 | 2.8 | GO:0002357 | defense response to tumor cell(GO:0002357) |
| 0.6 | 1.1 | GO:1902994 | regulation of phospholipid efflux(GO:1902994) positive regulation of phospholipid efflux(GO:1902995) |
| 0.6 | 2.8 | GO:2000174 | regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.6 | 1.7 | GO:0006097 | glyoxylate cycle(GO:0006097) |
| 0.6 | 2.2 | GO:2001301 | lipoxin biosynthetic process(GO:2001301) lipoxin A4 metabolic process(GO:2001302) lipoxin A4 biosynthetic process(GO:2001303) |
| 0.6 | 2.8 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.5 | 2.2 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
| 0.5 | 1.6 | GO:1990922 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.5 | 6.5 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.5 | 0.5 | GO:1903519 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.5 | 1.6 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.5 | 1.6 | GO:0071449 | cellular response to lipid hydroperoxide(GO:0071449) |
| 0.5 | 1.1 | GO:0038162 | erythropoietin-mediated signaling pathway(GO:0038162) |
| 0.5 | 3.2 | GO:0002933 | lipid hydroxylation(GO:0002933) |
| 0.5 | 1.0 | GO:0002625 | regulation of T cell antigen processing and presentation(GO:0002625) |
| 0.5 | 1.6 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
| 0.5 | 2.6 | GO:0042369 | vitamin D catabolic process(GO:0042369) |
| 0.5 | 1.0 | GO:1903015 | regulation of exo-alpha-sialidase activity(GO:1903015) |
| 0.5 | 2.5 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.5 | 5.0 | GO:0002420 | natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002420) natural killer cell mediated immune response to tumor cell(GO:0002423) positive regulation of response to tumor cell(GO:0002836) positive regulation of immune response to tumor cell(GO:0002839) regulation of natural killer cell mediated immune response to tumor cell(GO:0002855) positive regulation of natural killer cell mediated immune response to tumor cell(GO:0002857) regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002858) positive regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002860) |
| 0.5 | 5.4 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
| 0.5 | 1.5 | GO:0014810 | positive regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014810) |
| 0.5 | 1.5 | GO:0034769 | basement membrane disassembly(GO:0034769) |
| 0.5 | 4.4 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
| 0.5 | 1.5 | GO:0016098 | monoterpenoid metabolic process(GO:0016098) |
| 0.5 | 1.9 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.5 | 1.9 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) |
| 0.5 | 4.3 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.5 | 1.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.5 | 1.9 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.5 | 4.7 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
| 0.5 | 2.3 | GO:0090156 | cellular sphingolipid homeostasis(GO:0090156) |
| 0.5 | 1.4 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.5 | 1.9 | GO:0032690 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.5 | 0.5 | GO:0097195 | pilomotor reflex(GO:0097195) |
| 0.5 | 1.4 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.5 | 7.4 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
| 0.5 | 11.9 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.5 | 2.7 | GO:0002923 | regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002923) |
| 0.5 | 0.5 | GO:0034756 | regulation of iron ion transport(GO:0034756) regulation of iron ion transmembrane transport(GO:0034759) |
| 0.5 | 10.5 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.5 | 2.7 | GO:0098758 | interleukin-8-mediated signaling pathway(GO:0038112) response to interleukin-8(GO:0098758) cellular response to interleukin-8(GO:0098759) |
| 0.5 | 0.9 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.5 | 1.4 | GO:0060739 | mesenchymal-epithelial cell signaling involved in prostate gland development(GO:0060739) |
| 0.4 | 1.3 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.4 | 1.3 | GO:0098976 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.4 | 1.8 | GO:0010900 | negative regulation of phosphatidylcholine catabolic process(GO:0010900) |
| 0.4 | 3.5 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.4 | 0.4 | GO:0002442 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
| 0.4 | 6.6 | GO:0018377 | protein myristoylation(GO:0018377) |
| 0.4 | 1.3 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
| 0.4 | 4.0 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.4 | 21.4 | GO:0050672 | negative regulation of mononuclear cell proliferation(GO:0032945) negative regulation of lymphocyte proliferation(GO:0050672) |
| 0.4 | 1.7 | GO:0048073 | regulation of eye pigmentation(GO:0048073) |
| 0.4 | 5.7 | GO:0019724 | B cell mediated immunity(GO:0019724) |
| 0.4 | 6.1 | GO:0010623 | programmed cell death involved in cell development(GO:0010623) |
| 0.4 | 3.5 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.4 | 1.7 | GO:0060368 | regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060368) |
| 0.4 | 1.7 | GO:1901162 | primary amino compound biosynthetic process(GO:1901162) |
| 0.4 | 0.4 | GO:1904106 | protein localization to microvillus(GO:1904106) |
| 0.4 | 1.7 | GO:0009624 | response to nematode(GO:0009624) |
| 0.4 | 2.1 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
| 0.4 | 4.7 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.4 | 3.0 | GO:0002480 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-independent(GO:0002480) |
| 0.4 | 1.3 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.4 | 34.8 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.4 | 3.4 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.4 | 1.3 | GO:0002769 | natural killer cell inhibitory signaling pathway(GO:0002769) |
| 0.4 | 2.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.4 | 6.7 | GO:0002313 | mature B cell differentiation involved in immune response(GO:0002313) |
| 0.4 | 0.8 | GO:0045355 | negative regulation of interferon-alpha biosynthetic process(GO:0045355) |
| 0.4 | 2.9 | GO:2000257 | regulation of complement activation(GO:0030449) regulation of protein activation cascade(GO:2000257) |
| 0.4 | 3.7 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.4 | 5.8 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.4 | 1.2 | GO:0090675 | intermicrovillar adhesion(GO:0090675) |
| 0.4 | 0.8 | GO:0072535 | tumor necrosis factor (ligand) superfamily member 11 production(GO:0072535) regulation of tumor necrosis factor (ligand) superfamily member 11 production(GO:2000307) |
| 0.4 | 1.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.4 | 1.2 | GO:0035565 | regulation of pronephros size(GO:0035565) |
| 0.4 | 2.4 | GO:0001507 | acetylcholine catabolic process in synaptic cleft(GO:0001507) acetylcholine catabolic process(GO:0006581) |
| 0.4 | 1.2 | GO:2000449 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) regulation of T cell extravasation(GO:2000407) regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) |
| 0.4 | 2.3 | GO:0009753 | response to jasmonic acid(GO:0009753) cellular response to jasmonic acid stimulus(GO:0071395) |
| 0.4 | 4.7 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.4 | 2.7 | GO:0030311 | poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.4 | 6.5 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.4 | 1.5 | GO:0002188 | translation reinitiation(GO:0002188) |
| 0.4 | 1.1 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.4 | 1.9 | GO:2000403 | positive regulation of lymphocyte migration(GO:2000403) |
| 0.4 | 2.6 | GO:0019557 | histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
| 0.4 | 1.9 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
| 0.4 | 1.8 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.4 | 1.1 | GO:1990654 | sebum secreting cell proliferation(GO:1990654) |
| 0.4 | 1.1 | GO:0048250 | mitochondrial iron ion transport(GO:0048250) |
| 0.4 | 2.2 | GO:0006050 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.4 | 8.8 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
| 0.4 | 0.7 | GO:0075528 | induction by symbiont of host defense response(GO:0044416) induction of host immune response by virus(GO:0046730) active induction of host immune response by virus(GO:0046732) modulation by symbiont of host defense response(GO:0052031) induction by organism of defense response of other organism involved in symbiotic interaction(GO:0052251) modulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052255) positive regulation by symbiont of host defense response(GO:0052509) positive regulation by organism of defense response of other organism involved in symbiotic interaction(GO:0052510) modulation by organism of immune response of other organism involved in symbiotic interaction(GO:0052552) modulation by symbiont of host immune response(GO:0052553) modulation by virus of host immune response(GO:0075528) |
| 0.4 | 6.1 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.4 | 5.4 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.4 | 4.6 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.4 | 3.2 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.4 | 1.4 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 0.4 | 3.2 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.4 | 1.4 | GO:0070295 | renal water absorption(GO:0070295) |
| 0.4 | 4.6 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.4 | 4.9 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.4 | 1.4 | GO:0036060 | filtration diaphragm assembly(GO:0036058) slit diaphragm assembly(GO:0036060) negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
| 0.4 | 6.3 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.4 | 0.7 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.4 | 1.4 | GO:0010607 | negative regulation of cytoplasmic mRNA processing body assembly(GO:0010607) |
| 0.3 | 1.0 | GO:0061402 | positive regulation of transcription from RNA polymerase II promoter in response to acidic pH(GO:0061402) |
| 0.3 | 1.0 | GO:1902523 | positive regulation of protein K63-linked ubiquitination(GO:1902523) |
| 0.3 | 3.8 | GO:0001562 | response to protozoan(GO:0001562) |
| 0.3 | 1.0 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.3 | 1.4 | GO:0033319 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.3 | 2.1 | GO:0071400 | cellular response to oleic acid(GO:0071400) |
| 0.3 | 0.7 | GO:1903978 | regulation of microglial cell activation(GO:1903978) |
| 0.3 | 1.0 | GO:0036290 | protein trans-autophosphorylation(GO:0036290) peptidyl-serine trans-autophosphorylation(GO:1990579) |
| 0.3 | 1.0 | GO:0071314 | cellular response to cocaine(GO:0071314) |
| 0.3 | 5.5 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.3 | 5.1 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.3 | 2.0 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.3 | 39.5 | GO:0031295 | T cell costimulation(GO:0031295) |
| 0.3 | 1.7 | GO:2000813 | negative regulation of barbed-end actin filament capping(GO:2000813) |
| 0.3 | 2.0 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.3 | 0.7 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.3 | 0.3 | GO:0071284 | cellular response to lead ion(GO:0071284) |
| 0.3 | 0.7 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.3 | 0.3 | GO:0072603 | interleukin-5 secretion(GO:0072603) regulation of interleukin-5 secretion(GO:2000662) positive regulation of interleukin-5 secretion(GO:2000664) |
| 0.3 | 3.7 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.3 | 3.0 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.3 | 3.3 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.3 | 0.3 | GO:0036115 | fatty-acyl-CoA catabolic process(GO:0036115) |
| 0.3 | 3.0 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.3 | 1.7 | GO:0035026 | leading edge cell differentiation(GO:0035026) |
| 0.3 | 1.7 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
| 0.3 | 2.0 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.3 | 6.2 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
| 0.3 | 3.6 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.3 | 1.0 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.3 | 0.7 | GO:0015911 | plasma membrane long-chain fatty acid transport(GO:0015911) |
| 0.3 | 1.6 | GO:0003245 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.3 | 2.3 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.3 | 1.0 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
| 0.3 | 0.6 | GO:0042322 | negative regulation of circadian sleep/wake cycle, REM sleep(GO:0042322) |
| 0.3 | 3.8 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.3 | 4.5 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.3 | 0.6 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.3 | 3.5 | GO:0002483 | antigen processing and presentation of endogenous peptide antigen(GO:0002483) antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
| 0.3 | 2.2 | GO:0071351 | interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
| 0.3 | 0.3 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
| 0.3 | 0.6 | GO:0019322 | pentose biosynthetic process(GO:0019322) |
| 0.3 | 0.6 | GO:2000276 | negative regulation of oxidative phosphorylation uncoupler activity(GO:2000276) |
| 0.3 | 0.9 | GO:0070943 | neutrophil mediated cytotoxicity(GO:0070942) neutrophil mediated killing of symbiont cell(GO:0070943) neutrophil mediated killing of bacterium(GO:0070944) |
| 0.3 | 92.4 | GO:0002250 | adaptive immune response(GO:0002250) |
| 0.3 | 4.3 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.3 | 1.2 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.3 | 1.5 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.3 | 0.3 | GO:0035962 | response to interleukin-13(GO:0035962) |
| 0.3 | 0.3 | GO:0046110 | xanthine metabolic process(GO:0046110) |
| 0.3 | 3.3 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.3 | 0.6 | GO:0009750 | response to fructose(GO:0009750) |
| 0.3 | 2.4 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.3 | 0.9 | GO:0060382 | regulation of DNA strand elongation(GO:0060382) |
| 0.3 | 11.3 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.3 | 0.9 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
| 0.3 | 0.9 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.3 | 1.8 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.3 | 8.5 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.3 | 0.9 | GO:0002415 | immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
| 0.3 | 1.2 | GO:0060734 | regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:0060734) |
| 0.3 | 0.9 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.3 | 2.3 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
| 0.3 | 0.3 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.3 | 0.9 | GO:0044725 | chromatin reprogramming in the zygote(GO:0044725) |
| 0.3 | 0.9 | GO:0032917 | polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.3 | 1.1 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
| 0.3 | 2.0 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) |
| 0.3 | 0.9 | GO:1903461 | Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 0.3 | 4.3 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
| 0.3 | 2.6 | GO:0002360 | T cell lineage commitment(GO:0002360) |
| 0.3 | 0.9 | GO:1990418 | response to insulin-like growth factor stimulus(GO:1990418) |
| 0.3 | 2.0 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
| 0.3 | 5.7 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.3 | 0.6 | GO:0036017 | response to erythropoietin(GO:0036017) |
| 0.3 | 0.6 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.3 | 4.3 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.3 | 1.1 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
| 0.3 | 0.3 | GO:0072387 | flavin adenine dinucleotide metabolic process(GO:0072387) |
| 0.3 | 1.1 | GO:0010430 | fatty acid omega-oxidation(GO:0010430) |
| 0.3 | 3.9 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.3 | 5.0 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.3 | 4.2 | GO:0019731 | antibacterial humoral response(GO:0019731) |
| 0.3 | 0.3 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
| 0.3 | 0.5 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.3 | 0.5 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.3 | 2.2 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine salvage(GO:0071267) |
| 0.3 | 0.8 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.3 | 1.3 | GO:0032252 | secretory granule localization(GO:0032252) |
| 0.3 | 2.4 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.3 | 2.4 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.3 | 0.5 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.3 | 1.9 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.3 | 0.5 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
| 0.3 | 1.1 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.3 | 2.1 | GO:0035696 | monocyte extravasation(GO:0035696) |
| 0.3 | 1.3 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.3 | 4.0 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.3 | 0.5 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.3 | 1.6 | GO:0097327 | response to antineoplastic agent(GO:0097327) |
| 0.3 | 2.1 | GO:0032431 | activation of phospholipase A2 activity(GO:0032431) |
| 0.3 | 0.5 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) biofilm formation(GO:0042710) single-species biofilm formation(GO:0044010) single-species biofilm formation in or on host organism(GO:0044407) regulation of single-species biofilm formation(GO:1900190) negative regulation of single-species biofilm formation(GO:1900191) regulation of single-species biofilm formation in or on host organism(GO:1900228) negative regulation of single-species biofilm formation in or on host organism(GO:1900229) |
| 0.3 | 1.0 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.3 | 1.5 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.3 | 0.8 | GO:0042488 | positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) positive regulation of enamel mineralization(GO:0070175) |
| 0.3 | 1.0 | GO:0006740 | NADPH regeneration(GO:0006740) |
| 0.3 | 2.0 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.3 | 1.5 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.3 | 0.5 | GO:0010713 | negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) |
| 0.3 | 1.5 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
| 0.2 | 2.0 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.2 | 1.2 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.2 | 2.7 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
| 0.2 | 1.0 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.2 | 2.6 | GO:0002675 | positive regulation of acute inflammatory response(GO:0002675) |
| 0.2 | 1.7 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.2 | 1.4 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.2 | 1.7 | GO:0070383 | DNA cytosine deamination(GO:0070383) |
| 0.2 | 4.8 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.2 | 0.7 | GO:0018160 | peptidyl-pyrromethane cofactor linkage(GO:0018160) |
| 0.2 | 0.5 | GO:0060620 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.2 | 1.7 | GO:0051510 | regulation of unidimensional cell growth(GO:0051510) negative regulation of unidimensional cell growth(GO:0051511) establishment of cell polarity regulating cell shape(GO:0071964) regulation of establishment or maintenance of cell polarity regulating cell shape(GO:2000769) positive regulation of establishment or maintenance of cell polarity regulating cell shape(GO:2000771) regulation of establishment of cell polarity regulating cell shape(GO:2000782) positive regulation of establishment of cell polarity regulating cell shape(GO:2000784) positive regulation of barbed-end actin filament capping(GO:2000814) |
| 0.2 | 14.7 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
| 0.2 | 0.7 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.2 | 1.2 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.2 | 3.3 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.2 | 0.7 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.2 | 0.5 | GO:0036369 | transcription factor catabolic process(GO:0036369) |
| 0.2 | 0.2 | GO:2000360 | negative regulation of binding of sperm to zona pellucida(GO:2000360) |
| 0.2 | 1.4 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.2 | 1.2 | GO:0061107 | seminal vesicle development(GO:0061107) |
| 0.2 | 10.1 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.2 | 4.8 | GO:1902222 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.2 | 0.7 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.2 | 0.2 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.2 | 1.1 | GO:0010266 | response to vitamin B1(GO:0010266) |
| 0.2 | 0.4 | GO:0030638 | polyketide metabolic process(GO:0030638) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.2 | 0.7 | GO:0042361 | menaquinone catabolic process(GO:0042361) vitamin K catabolic process(GO:0042377) |
| 0.2 | 0.7 | GO:1903674 | regulation of cap-dependent translational initiation(GO:1903674) positive regulation of cap-dependent translational initiation(GO:1903676) |
| 0.2 | 2.5 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.2 | 0.9 | GO:2000158 | positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.2 | 5.7 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.2 | 0.7 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.2 | 0.7 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.2 | 2.4 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.2 | 1.5 | GO:0001910 | regulation of leukocyte mediated cytotoxicity(GO:0001910) |
| 0.2 | 0.9 | GO:0001554 | luteolysis(GO:0001554) |
| 0.2 | 0.9 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
| 0.2 | 0.9 | GO:2001033 | negative regulation of double-strand break repair via nonhomologous end joining(GO:2001033) |
| 0.2 | 1.3 | GO:0070378 | positive regulation of ERK5 cascade(GO:0070378) |
| 0.2 | 1.1 | GO:0009174 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) pyrimidine nucleobase biosynthetic process(GO:0019856) UMP metabolic process(GO:0046049) |
| 0.2 | 0.8 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.2 | 0.8 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
| 0.2 | 0.2 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
| 0.2 | 1.3 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.2 | 0.8 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.2 | 0.6 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.2 | 2.1 | GO:0052695 | cellular glucuronidation(GO:0052695) |
| 0.2 | 1.5 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.2 | 0.2 | GO:0035106 | operant conditioning(GO:0035106) |
| 0.2 | 1.9 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.2 | 1.4 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.2 | 1.0 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.2 | 0.2 | GO:0035378 | carbon dioxide transmembrane transport(GO:0035378) |
| 0.2 | 0.6 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.2 | 1.2 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.2 | 0.2 | GO:1900369 | negative regulation of RNA interference(GO:1900369) |
| 0.2 | 6.3 | GO:0042100 | B cell proliferation(GO:0042100) |
| 0.2 | 2.2 | GO:0035965 | cardiolipin acyl-chain remodeling(GO:0035965) |
| 0.2 | 0.8 | GO:0050992 | dimethylallyl diphosphate biosynthetic process(GO:0050992) dimethylallyl diphosphate metabolic process(GO:0050993) |
| 0.2 | 5.4 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.2 | 1.0 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
| 0.2 | 0.6 | GO:1904729 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
| 0.2 | 0.8 | GO:0042357 | thiamine diphosphate metabolic process(GO:0042357) |
| 0.2 | 1.0 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.2 | 1.0 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.2 | 0.6 | GO:0042363 | fat-soluble vitamin catabolic process(GO:0042363) |
| 0.2 | 2.0 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.2 | 0.2 | GO:1903895 | negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
| 0.2 | 2.3 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.2 | 0.6 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.2 | 5.6 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.2 | 1.5 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.2 | 16.2 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.2 | 1.7 | GO:1902044 | regulation of Fas signaling pathway(GO:1902044) |
| 0.2 | 2.1 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
| 0.2 | 2.7 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.2 | 0.4 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
| 0.2 | 1.0 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.2 | 2.7 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.2 | 1.9 | GO:0034036 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.2 | 0.4 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.2 | 1.7 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.2 | 0.4 | GO:0036378 | calcitriol biosynthetic process from calciol(GO:0036378) |
| 0.2 | 1.5 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.2 | 1.1 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.2 | 2.2 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.2 | 0.5 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
| 0.2 | 1.1 | GO:0036079 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.2 | 0.5 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.2 | 5.8 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.2 | 0.2 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.2 | 0.7 | GO:0016062 | adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 0.2 | 1.6 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.2 | 4.2 | GO:0019835 | cytolysis(GO:0019835) |
| 0.2 | 4.4 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.2 | 0.7 | GO:0060922 | atrioventricular node development(GO:0003162) cardiac septum cell differentiation(GO:0003292) atrioventricular node cell differentiation(GO:0060922) atrioventricular node cell development(GO:0060928) |
| 0.2 | 0.9 | GO:0042094 | interleukin-2 biosynthetic process(GO:0042094) |
| 0.2 | 0.9 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.2 | 1.9 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.2 | 1.9 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) |
| 0.2 | 0.7 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
| 0.2 | 0.9 | GO:0030581 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.2 | 4.8 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.2 | 5.1 | GO:0006929 | substrate-dependent cell migration(GO:0006929) |
| 0.2 | 1.2 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.2 | 0.5 | GO:0036245 | cellular response to menadione(GO:0036245) |
| 0.2 | 0.7 | GO:0034552 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.2 | 0.7 | GO:0035482 | gastric motility(GO:0035482) gastric emptying(GO:0035483) musculoskeletal movement, spinal reflex action(GO:0050883) |
| 0.2 | 0.7 | GO:0009405 | pathogenesis(GO:0009405) proprioception(GO:0019230) |
| 0.2 | 1.7 | GO:0060261 | positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.2 | 0.5 | GO:0060152 | peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
| 0.2 | 0.8 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.2 | 0.7 | GO:0016333 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.2 | 1.6 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.2 | 0.6 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
| 0.2 | 0.8 | GO:1902267 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.2 | 0.5 | GO:0090410 | malonate catabolic process(GO:0090410) |
| 0.2 | 1.4 | GO:1903208 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 0.2 | 0.5 | GO:0035038 | female pronucleus assembly(GO:0035038) |
| 0.2 | 4.7 | GO:0033003 | regulation of mast cell activation(GO:0033003) |
| 0.2 | 0.5 | GO:0060789 | hair follicle placode formation(GO:0060789) |
| 0.2 | 0.5 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) positive regulation of high-density lipoprotein particle clearance(GO:0010983) |
| 0.2 | 0.9 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.2 | 0.6 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.2 | 1.8 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.2 | 6.6 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.2 | 24.3 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.2 | 0.5 | GO:0070902 | mitochondrial tRNA pseudouridine synthesis(GO:0070902) |
| 0.2 | 0.5 | GO:0071140 | resolution of recombination intermediates(GO:0071139) resolution of mitotic recombination intermediates(GO:0071140) |
| 0.2 | 2.4 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
| 0.1 | 0.7 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.1 | 1.0 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.1 | 0.7 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.1 | 5.6 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.1 | 2.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 5.3 | GO:0051084 | 'de novo' posttranslational protein folding(GO:0051084) |
| 0.1 | 1.8 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.1 | 0.9 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
| 0.1 | 0.4 | GO:0050955 | thermoception(GO:0050955) |
| 0.1 | 10.9 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.1 | 0.9 | GO:0071460 | cellular response to cell-matrix adhesion(GO:0071460) |
| 0.1 | 0.6 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.1 | 0.6 | GO:0000451 | rRNA 2'-O-methylation(GO:0000451) |
| 0.1 | 0.4 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
| 0.1 | 0.7 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.1 | 1.0 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.1 | 5.0 | GO:0022400 | regulation of rhodopsin mediated signaling pathway(GO:0022400) |
| 0.1 | 1.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.1 | 0.6 | GO:0072011 | diapedesis(GO:0050904) glomerular endothelium development(GO:0072011) |
| 0.1 | 1.9 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 0.1 | 1.1 | GO:0032905 | transforming growth factor beta1 production(GO:0032905) regulation of transforming growth factor beta1 production(GO:0032908) |
| 0.1 | 0.3 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) |
| 0.1 | 0.8 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.1 | 0.6 | GO:0033306 | phytol metabolic process(GO:0033306) fatty alcohol metabolic process(GO:1903173) |
| 0.1 | 1.8 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.1 | 1.1 | GO:0045047 | protein targeting to ER(GO:0045047) |
| 0.1 | 1.6 | GO:0034030 | nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.1 | 0.1 | GO:1990668 | vesicle fusion with endoplasmic reticulum-Golgi intermediate compartment (ERGIC) membrane(GO:1990668) |
| 0.1 | 1.1 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.1 | 0.4 | GO:1902616 | acyl carnitine transport(GO:0006844) acyl carnitine transmembrane transport(GO:1902616) |
| 0.1 | 2.1 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.1 | 0.5 | GO:1903936 | cellular response to sodium arsenite(GO:1903936) |
| 0.1 | 2.7 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.7 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.1 | 0.4 | GO:0006196 | AMP catabolic process(GO:0006196) |
| 0.1 | 0.7 | GO:0030573 | bile acid catabolic process(GO:0030573) |
| 0.1 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.1 | 3.4 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.1 | 0.4 | GO:0046886 | positive regulation of hormone biosynthetic process(GO:0046886) |
| 0.1 | 0.6 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.1 | 0.1 | GO:0051958 | methotrexate transport(GO:0051958) |
| 0.1 | 2.5 | GO:0001696 | gastric acid secretion(GO:0001696) |
| 0.1 | 1.0 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
| 0.1 | 0.5 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.1 | 1.8 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 1.0 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 0.1 | 2.3 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.1 | 0.7 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
| 0.1 | 0.5 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.1 | 1.2 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.1 | 0.5 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.1 | 1.0 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.1 | 0.4 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.1 | 0.4 | GO:0002468 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
| 0.1 | 0.4 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.1 | 3.0 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.1 | 1.2 | GO:2001300 | lipoxin metabolic process(GO:2001300) |
| 0.1 | 0.8 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.1 | 3.5 | GO:0030220 | platelet formation(GO:0030220) |
| 0.1 | 0.4 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
| 0.1 | 0.7 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 | 0.8 | GO:0003363 | lamellipodium assembly involved in ameboidal cell migration(GO:0003363) |
| 0.1 | 0.5 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.1 | 2.5 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.1 | 1.3 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.1 | 0.6 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.1 | 0.8 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 | 0.3 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.1 | 0.9 | GO:0060055 | angiogenesis involved in wound healing(GO:0060055) |
| 0.1 | 0.7 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
| 0.1 | 0.5 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.1 | 0.9 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 | 3.7 | GO:0045332 | phospholipid translocation(GO:0045332) |
| 0.1 | 2.0 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.1 | 1.2 | GO:0030149 | sphingolipid catabolic process(GO:0030149) |
| 0.1 | 0.3 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 0.1 | 0.8 | GO:0072733 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.1 | 0.2 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.1 | 1.9 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.1 | 1.0 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.1 | 0.5 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.1 | 0.9 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.1 | 0.8 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.1 | 0.9 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.1 | 1.7 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.1 | 1.2 | GO:0001845 | phagolysosome assembly(GO:0001845) phagosome-lysosome fusion(GO:0090385) |
| 0.1 | 66.1 | GO:0043312 | neutrophil activation involved in immune response(GO:0002283) neutrophil degranulation(GO:0043312) |
| 0.1 | 1.3 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.1 | 0.2 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.1 | 0.4 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.1 | 3.5 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 | 0.6 | GO:0042730 | fibrinolysis(GO:0042730) |
| 0.1 | 0.5 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.1 | 0.4 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.1 | 0.6 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 | 0.4 | GO:1902963 | regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902962) negative regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902963) |
| 0.1 | 0.1 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 | 0.2 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
| 0.1 | 0.5 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
| 0.1 | 1.7 | GO:0060732 | regulation of inositol phosphate biosynthetic process(GO:0010919) positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.1 | 0.3 | GO:0071344 | diphosphate metabolic process(GO:0071344) |
| 0.1 | 0.7 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.1 | 0.2 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.1 | 0.9 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 0.5 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.1 | 0.3 | GO:0006565 | L-serine catabolic process(GO:0006565) response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 0.1 | 1.1 | GO:1902991 | regulation of amyloid precursor protein catabolic process(GO:1902991) |
| 0.1 | 0.5 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 0.2 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.1 | 0.9 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.1 | 2.7 | GO:0001569 | patterning of blood vessels(GO:0001569) |
| 0.1 | 1.3 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.1 | 2.1 | GO:0070232 | regulation of T cell apoptotic process(GO:0070232) |
| 0.1 | 0.3 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.1 | 0.7 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 0.4 | GO:1903445 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 | 0.3 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
| 0.1 | 0.2 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.1 | 0.8 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.1 | 5.8 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 | 0.4 | GO:0009107 | lipoate biosynthetic process(GO:0009107) |
| 0.1 | 1.6 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 0.4 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.2 | GO:0032258 | CVT pathway(GO:0032258) |
| 0.1 | 0.8 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
| 0.1 | 0.3 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.1 | 0.7 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.1 | 0.9 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.1 | 0.8 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
| 0.1 | 0.7 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.1 | 0.8 | GO:0050868 | negative regulation of T cell activation(GO:0050868) |
| 0.1 | 0.1 | GO:1903949 | positive regulation of atrial cardiac muscle cell action potential(GO:1903949) |
| 0.1 | 1.7 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.1 | 4.2 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 0.5 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
| 0.1 | 1.4 | GO:0010592 | positive regulation of lamellipodium assembly(GO:0010592) |
| 0.1 | 0.7 | GO:0001865 | NK T cell differentiation(GO:0001865) |
| 0.1 | 7.4 | GO:0032481 | positive regulation of type I interferon production(GO:0032481) |
| 0.1 | 0.2 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.1 | 0.7 | GO:0061143 | nose morphogenesis(GO:0043585) alveolar primary septum development(GO:0061143) |
| 0.1 | 0.3 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
| 0.1 | 0.3 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.1 | 1.0 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
| 0.1 | 0.3 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 | 0.3 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 0.8 | GO:0097475 | motor neuron migration(GO:0097475) |
| 0.1 | 1.2 | GO:0044557 | relaxation of smooth muscle(GO:0044557) |
| 0.1 | 0.4 | GO:0048842 | positive regulation of axon extension involved in axon guidance(GO:0048842) |
| 0.1 | 3.3 | GO:0061157 | mRNA destabilization(GO:0061157) |
| 0.1 | 0.3 | GO:0000023 | maltose metabolic process(GO:0000023) |
| 0.1 | 0.3 | GO:0033168 | conversion of ds siRNA to ss siRNA involved in RNA interference(GO:0033168) conversion of ds siRNA to ss siRNA(GO:0036404) |
| 0.1 | 0.3 | GO:0042309 | homoiothermy(GO:0042309) |
| 0.1 | 1.6 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.1 | 1.3 | GO:0006069 | ethanol oxidation(GO:0006069) |
| 0.1 | 0.2 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.1 | 0.2 | GO:1904744 | regulation of telomeric DNA binding(GO:1904742) positive regulation of telomeric DNA binding(GO:1904744) |
| 0.1 | 0.2 | GO:0045905 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.1 | 0.3 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.1 | 0.4 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.1 | 0.2 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.1 | 0.2 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
| 0.1 | 0.4 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.1 | 0.4 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.1 | 0.4 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 2.7 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.1 | 0.5 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 | 0.2 | GO:0016476 | regulation of embryonic cell shape(GO:0016476) |
| 0.1 | 0.8 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.2 | GO:0036230 | granulocyte activation(GO:0036230) |
| 0.1 | 0.2 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.1 | 0.2 | GO:0000494 | box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
| 0.1 | 3.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.1 | 0.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 0.2 | GO:1903442 | response to methylamine(GO:0036255) response to lipoic acid(GO:1903442) |
| 0.1 | 0.4 | GO:0006233 | dUDP biosynthetic process(GO:0006227) dTDP biosynthetic process(GO:0006233) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dTDP metabolic process(GO:0046072) dUDP metabolic process(GO:0046077) |
| 0.1 | 0.9 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.1 | 0.1 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
| 0.1 | 1.6 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.1 | 0.1 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.1 | 1.4 | GO:0010043 | response to zinc ion(GO:0010043) |
| 0.1 | 0.2 | GO:0019417 | sulfur oxidation(GO:0019417) |
| 0.1 | 0.3 | GO:0061358 | negative regulation of Wnt protein secretion(GO:0061358) |
| 0.1 | 0.2 | GO:1901374 | acetate ester transport(GO:1901374) |
| 0.1 | 0.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.1 | 0.2 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.1 | 0.4 | GO:0090234 | regulation of centromere complex assembly(GO:0090230) regulation of kinetochore assembly(GO:0090234) |
| 0.1 | 0.4 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.1 | 0.4 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.1 | 0.9 | GO:0060338 | regulation of type I interferon-mediated signaling pathway(GO:0060338) |
| 0.1 | 0.4 | GO:0046066 | dGDP metabolic process(GO:0046066) |
| 0.1 | 0.3 | GO:0044209 | adenosine salvage(GO:0006169) dATP biosynthetic process(GO:0006175) purine deoxyribonucleoside triphosphate biosynthetic process(GO:0009216) AMP salvage(GO:0044209) |
| 0.1 | 0.4 | GO:0070829 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.1 | 0.4 | GO:2001106 | regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.1 | 1.5 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.1 | 0.9 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 | 0.6 | GO:0033197 | response to vitamin E(GO:0033197) |
| 0.1 | 0.2 | GO:1901994 | negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.1 | 1.4 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.1 | 0.4 | GO:0060312 | regulation of blood vessel remodeling(GO:0060312) |
| 0.1 | 1.7 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.1 | 0.2 | GO:0035646 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.1 | 0.5 | GO:0042113 | B cell activation(GO:0042113) |
| 0.1 | 0.2 | GO:1902766 | skeletal muscle satellite cell migration(GO:1902766) |
| 0.1 | 0.2 | GO:1903926 | signal transduction involved in intra-S DNA damage checkpoint(GO:0072428) negative regulation of mitotic cell cycle DNA replication(GO:1903464) response to bisphenol A(GO:1903925) cellular response to bisphenol A(GO:1903926) |
| 0.1 | 0.2 | GO:0061181 | regulation of chondrocyte development(GO:0061181) negative regulation of chondrocyte development(GO:0061182) regulation of bone mineralization involved in bone maturation(GO:1900157) negative regulation of bone mineralization involved in bone maturation(GO:1900158) |
| 0.1 | 0.2 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.1 | 0.2 | GO:1902173 | negative regulation of keratinocyte apoptotic process(GO:1902173) |
| 0.1 | 0.9 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.3 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.1 | 0.4 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 | 0.3 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.1 | 0.2 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.1 | 0.6 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.1 | 0.9 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 | 0.5 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
| 0.1 | 2.9 | GO:0015914 | phospholipid transport(GO:0015914) |
| 0.1 | 0.3 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 0.1 | 2.8 | GO:0007602 | phototransduction(GO:0007602) |
| 0.1 | 0.1 | GO:0045007 | depurination(GO:0045007) |
| 0.1 | 0.9 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.1 | 0.8 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.1 | 0.3 | GO:1904428 | negative regulation of tubulin deacetylation(GO:1904428) |
| 0.1 | 0.7 | GO:0031639 | plasminogen activation(GO:0031639) |
| 0.1 | 0.3 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) cerebral cortex GABAergic interneuron fate commitment(GO:0021893) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 0.1 | 0.3 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.1 | 0.3 | GO:0038170 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.1 | 0.2 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.1 | 1.4 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.1 | 0.6 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.1 | 4.1 | GO:0030217 | T cell differentiation(GO:0030217) |
| 0.1 | 1.3 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.1 | 2.1 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.1 | 0.7 | GO:0006555 | methionine metabolic process(GO:0006555) |
| 0.1 | 0.5 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 | 0.3 | GO:0060482 | lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
| 0.1 | 0.5 | GO:0090646 | mitochondrial tRNA processing(GO:0090646) |
| 0.1 | 0.2 | GO:0045780 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.1 | 0.6 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.1 | 0.3 | GO:1900220 | negative regulation of alkaline phosphatase activity(GO:0010693) semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 | 0.2 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 | 0.4 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.1 | 0.6 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.1 | 0.5 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.1 | 0.3 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.1 | 0.6 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.1 | 0.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 6.3 | GO:0051092 | positive regulation of NF-kappaB transcription factor activity(GO:0051092) |
| 0.1 | 0.9 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
| 0.1 | 0.2 | GO:0003408 | optic cup formation involved in camera-type eye development(GO:0003408) |
| 0.1 | 0.1 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.1 | 2.5 | GO:0001958 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.1 | 0.2 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.1 | 0.4 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 0.2 | GO:1903224 | regulation of endodermal cell differentiation(GO:1903224) negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.1 | 0.6 | GO:0007035 | vacuolar acidification(GO:0007035) |
| 0.1 | 0.6 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.1 | 0.2 | GO:0060796 | regulation of transcription involved in primary germ layer cell fate commitment(GO:0060796) |
| 0.1 | 0.2 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 | 0.4 | GO:0060613 | fat pad development(GO:0060613) |
| 0.1 | 1.2 | GO:0071357 | type I interferon signaling pathway(GO:0060337) cellular response to type I interferon(GO:0071357) |
| 0.1 | 0.7 | GO:0042267 | natural killer cell mediated cytotoxicity(GO:0042267) |
| 0.1 | 0.2 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.1 | 0.7 | GO:0043277 | apoptotic cell clearance(GO:0043277) |
| 0.1 | 0.6 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.1 | 0.9 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.1 | 0.2 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.1 | 0.2 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.1 | 0.4 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.2 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.1 | 0.4 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.1 | 0.5 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.0 | 0.6 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 2.1 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.0 | 0.3 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 | 0.3 | GO:0008614 | pyridoxine metabolic process(GO:0008614) pyridoxine biosynthetic process(GO:0008615) vitamin B6 biosynthetic process(GO:0042819) |
| 0.0 | 3.1 | GO:0030098 | lymphocyte differentiation(GO:0030098) |
| 0.0 | 0.4 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 | 0.7 | GO:0036499 | PERK-mediated unfolded protein response(GO:0036499) |
| 0.0 | 0.5 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
| 0.0 | 0.8 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.0 | 3.0 | GO:0001895 | retina homeostasis(GO:0001895) |
| 0.0 | 0.2 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.7 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.0 | 1.4 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.0 | 1.2 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.0 | 0.1 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 | 0.3 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.0 | 0.7 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.1 | GO:0097396 | response to interleukin-17(GO:0097396) cellular response to interleukin-17(GO:0097398) |
| 0.0 | 2.0 | GO:0045652 | regulation of megakaryocyte differentiation(GO:0045652) |
| 0.0 | 0.7 | GO:0048536 | spleen development(GO:0048536) |
| 0.0 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.0 | 0.6 | GO:2000620 | positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.0 | 0.5 | GO:0030851 | granulocyte differentiation(GO:0030851) |
| 0.0 | 0.3 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.0 | 0.3 | GO:0061743 | motor learning(GO:0061743) |
| 0.0 | 0.2 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.0 | 0.5 | GO:0015871 | choline transport(GO:0015871) |
| 0.0 | 0.5 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 1.9 | GO:0007040 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
| 0.0 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.0 | 0.5 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.0 | 0.2 | GO:1903351 | response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
| 0.0 | 0.2 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.0 | 0.4 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 2.5 | GO:0043507 | positive regulation of JUN kinase activity(GO:0043507) |
| 0.0 | 0.3 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
| 0.0 | 0.6 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.0 | 0.2 | GO:0033504 | floor plate development(GO:0033504) |
| 0.0 | 1.0 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.8 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.9 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.0 | 1.9 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.0 | 0.3 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.0 | 0.2 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
| 0.0 | 0.1 | GO:2000395 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.0 | 0.3 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) |
| 0.0 | 0.1 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.0 | 0.3 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.0 | 0.2 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.0 | 0.5 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 1.2 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.2 | GO:0019477 | L-lysine catabolic process to acetyl-CoA(GO:0019474) L-lysine catabolic process(GO:0019477) L-lysine metabolic process(GO:0046440) |
| 0.0 | 0.2 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.0 | 0.5 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.0 | 0.1 | GO:1902938 | regulation of intracellular calcium activated chloride channel activity(GO:1902938) |
| 0.0 | 0.2 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.0 | 0.1 | GO:1904885 | beta-catenin destruction complex assembly(GO:1904885) |
| 0.0 | 0.1 | GO:0070898 | RNA polymerase III transcriptional preinitiation complex assembly(GO:0070898) |
| 0.0 | 0.1 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
| 0.0 | 0.8 | GO:0006544 | glycine metabolic process(GO:0006544) |
| 0.0 | 0.6 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.2 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.0 | 0.4 | GO:0098779 | mitophagy in response to mitochondrial depolarization(GO:0098779) |
| 0.0 | 0.4 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.0 | 0.2 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.0 | 0.0 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.0 | 0.2 | GO:0019418 | sulfide oxidation(GO:0019418) sulfide oxidation, using sulfide:quinone oxidoreductase(GO:0070221) |
| 0.0 | 0.2 | GO:0045008 | depyrimidination(GO:0045008) |
| 0.0 | 0.4 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.1 | GO:0019062 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host(GO:0044406) adhesion of symbiont to host cell(GO:0044650) |
| 0.0 | 0.0 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.0 | 0.5 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
| 0.0 | 0.3 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.0 | 1.4 | GO:1901998 | toxin transport(GO:1901998) |
| 0.0 | 0.4 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.0 | 0.4 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.0 | 0.2 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.0 | 0.1 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.0 | 0.1 | GO:0006463 | steroid hormone receptor complex assembly(GO:0006463) |
| 0.0 | 0.4 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.4 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.0 | 0.3 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.0 | 0.1 | GO:1904760 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) negative regulation of myofibroblast differentiation(GO:1904761) |
| 0.0 | 0.2 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.3 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.0 | 0.1 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.0 | 0.4 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.5 | GO:0014911 | positive regulation of smooth muscle cell migration(GO:0014911) |
| 0.0 | 0.1 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.0 | 0.4 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 | 0.1 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
| 0.0 | 0.6 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.0 | 0.3 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.0 | 0.1 | GO:0044245 | polysaccharide digestion(GO:0044245) |
| 0.0 | 0.3 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.0 | 0.1 | GO:0036233 | glycine import(GO:0036233) |
| 0.0 | 0.7 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.0 | 0.8 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
| 0.0 | 0.3 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.0 | 0.5 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.0 | 0.7 | GO:1901661 | quinone metabolic process(GO:1901661) |
| 0.0 | 0.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.4 | GO:0042772 | DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.0 | 0.1 | GO:0036149 | phosphatidylinositol acyl-chain remodeling(GO:0036149) |
| 0.0 | 0.1 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.0 | 0.1 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.0 | 0.1 | GO:0048690 | regulation of sprouting of injured axon(GO:0048686) regulation of axon extension involved in regeneration(GO:0048690) |
| 0.0 | 0.3 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
| 0.0 | 0.2 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
| 0.0 | 0.3 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.0 | 0.2 | GO:0036508 | protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.0 | 0.1 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.0 | 0.2 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.0 | 0.5 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.0 | 0.1 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.0 | 0.1 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.0 | 0.1 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.0 | 0.5 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.0 | 0.0 | GO:0060032 | notochord regression(GO:0060032) |
| 0.0 | 0.6 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
| 0.0 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.0 | 0.1 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
| 0.0 | 0.4 | GO:0050994 | regulation of lipid catabolic process(GO:0050994) |
| 0.0 | 0.2 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.3 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
| 0.0 | 0.4 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.0 | 0.0 | GO:0016553 | base conversion or substitution editing(GO:0016553) |
| 0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.0 | 1.0 | GO:0002224 | toll-like receptor signaling pathway(GO:0002224) |
| 0.0 | 0.2 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.0 | 0.3 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.0 | 0.1 | GO:0033602 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) negative regulation of dopamine secretion(GO:0033602) aspartate secretion(GO:0061528) positive regulation of prolactin secretion(GO:1902722) regulation of aspartate secretion(GO:1904448) positive regulation of aspartate secretion(GO:1904450) |
| 0.0 | 0.3 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.0 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.0 | 0.2 | GO:0090009 | primitive streak formation(GO:0090009) |
| 0.0 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 0.4 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 0.0 | 0.3 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.0 | 0.4 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.1 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.0 | 0.5 | GO:0071349 | interleukin-12-mediated signaling pathway(GO:0035722) cellular response to interleukin-12(GO:0071349) |
| 0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.2 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.0 | 0.2 | GO:0090292 | nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.3 | GO:0006884 | cell volume homeostasis(GO:0006884) |
| 0.0 | 0.3 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.1 | GO:0071386 | cellular response to corticosterone stimulus(GO:0071386) |
| 0.0 | 0.3 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.2 | GO:0007379 | segment specification(GO:0007379) |
| 0.0 | 0.2 | GO:0070828 | heterochromatin organization(GO:0070828) |
| 0.0 | 0.2 | GO:0001825 | blastocyst formation(GO:0001825) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.9 | 19.7 | GO:0071756 | IgM immunoglobulin complex(GO:0071753) IgM immunoglobulin complex, circulating(GO:0071754) pentameric IgM immunoglobulin complex(GO:0071756) |
| 3.8 | 206.6 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
| 2.4 | 7.3 | GO:0097679 | other organism cytoplasm(GO:0097679) |
| 2.2 | 26.3 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 2.1 | 20.7 | GO:0034687 | integrin alphaL-beta2 complex(GO:0034687) |
| 2.0 | 8.1 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 1.9 | 5.7 | GO:0071065 | alpha9-beta1 integrin-vascular cell adhesion molecule-1 complex(GO:0071065) |
| 1.7 | 5.0 | GO:0030526 | granulocyte macrophage colony-stimulating factor receptor complex(GO:0030526) |
| 1.6 | 4.8 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
| 1.5 | 8.7 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 1.4 | 8.2 | GO:0097013 | phagocytic vesicle lumen(GO:0097013) |
| 1.3 | 6.7 | GO:0019814 | immunoglobulin complex(GO:0019814) |
| 1.3 | 11.4 | GO:0032010 | phagolysosome(GO:0032010) |
| 1.2 | 25.3 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 1.1 | 13.1 | GO:0060171 | stereocilium membrane(GO:0060171) |
| 1.0 | 19.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.9 | 2.6 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.8 | 2.4 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.7 | 3.7 | GO:0034669 | integrin alpha4-beta7 complex(GO:0034669) |
| 0.7 | 1.3 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 0.7 | 4.0 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.7 | 8.6 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.6 | 126.0 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.6 | 3.5 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.6 | 16.9 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.5 | 3.3 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.5 | 4.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.5 | 1.5 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 0.5 | 4.0 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.5 | 3.3 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.5 | 1.9 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.4 | 2.7 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.4 | 2.1 | GO:0031905 | early endosome lumen(GO:0031905) |
| 0.4 | 9.2 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.4 | 1.6 | GO:0070701 | mucus layer(GO:0070701) |
| 0.4 | 39.9 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.4 | 1.5 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.4 | 2.3 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.4 | 2.2 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.4 | 1.1 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.4 | 2.1 | GO:0071682 | endocytic vesicle lumen(GO:0071682) |
| 0.3 | 1.0 | GO:1990332 | Ire1 complex(GO:1990332) |
| 0.3 | 6.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.3 | 5.1 | GO:0097413 | Lewy body(GO:0097413) |
| 0.3 | 2.0 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.3 | 1.7 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.3 | 5.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.3 | 3.6 | GO:0098560 | cytoplasmic side of early endosome membrane(GO:0098559) cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.3 | 2.3 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.3 | 1.3 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.3 | 2.5 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.3 | 0.9 | GO:0042022 | interleukin-12 receptor complex(GO:0042022) |
| 0.3 | 36.2 | GO:0101003 | ficolin-1-rich granule membrane(GO:0101003) |
| 0.3 | 0.9 | GO:0090651 | apical cytoplasm(GO:0090651) |
| 0.3 | 25.3 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.3 | 2.1 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.3 | 1.7 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.3 | 2.6 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.3 | 1.2 | GO:0097179 | protease inhibitor complex(GO:0097179) |
| 0.3 | 24.5 | GO:0035580 | specific granule lumen(GO:0035580) |
| 0.3 | 1.9 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.3 | 1.3 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.3 | 1.8 | GO:0036021 | endolysosome lumen(GO:0036021) |
| 0.3 | 1.3 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.2 | 9.7 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.2 | 2.5 | GO:0042611 | MHC protein complex(GO:0042611) |
| 0.2 | 34.3 | GO:0035578 | azurophil granule lumen(GO:0035578) |
| 0.2 | 1.5 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.2 | 1.0 | GO:0035517 | PR-DUB complex(GO:0035517) |
| 0.2 | 0.2 | GO:0044279 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
| 0.2 | 3.8 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.2 | 87.3 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.2 | 3.0 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.2 | 0.7 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
| 0.2 | 0.9 | GO:0035525 | NF-kappaB p50/p65 complex(GO:0035525) |
| 0.2 | 1.1 | GO:0034753 | nuclear aryl hydrocarbon receptor complex(GO:0034753) |
| 0.2 | 16.8 | GO:0070821 | tertiary granule membrane(GO:0070821) |
| 0.2 | 1.9 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.2 | 0.6 | GO:0008043 | intracellular ferritin complex(GO:0008043) ferritin complex(GO:0070288) |
| 0.2 | 1.2 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.2 | 2.5 | GO:0016589 | NURF complex(GO:0016589) |
| 0.2 | 1.0 | GO:1990796 | photoreceptor cell terminal bouton(GO:1990796) |
| 0.2 | 3.6 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.2 | 11.1 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.2 | 0.6 | GO:0005760 | gamma DNA polymerase complex(GO:0005760) |
| 0.2 | 0.6 | GO:0030936 | collagen type XIII trimer(GO:0005600) transmembrane collagen trimer(GO:0030936) |
| 0.2 | 2.0 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 0.2 | 3.6 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.2 | 4.2 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.2 | 3.5 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.2 | 3.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.2 | 1.0 | GO:0043196 | varicosity(GO:0043196) |
| 0.2 | 1.9 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.2 | 0.2 | GO:0005592 | collagen type XI trimer(GO:0005592) |
| 0.2 | 0.7 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.2 | 1.5 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.2 | 3.8 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.2 | 0.5 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
| 0.2 | 0.8 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.2 | 1.4 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.2 | 0.5 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.2 | 3.7 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.2 | 2.4 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.2 | 0.8 | GO:0001652 | granular component(GO:0001652) |
| 0.2 | 0.6 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) proton-transporting ATP synthase complex(GO:0045259) |
| 0.2 | 4.2 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.2 | 5.9 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.2 | 5.5 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.2 | 0.8 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.2 | 6.8 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 4.2 | GO:1904724 | tertiary granule lumen(GO:1904724) |
| 0.1 | 2.8 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.4 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.1 | 11.1 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.1 | 1.7 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 1.4 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.1 | 1.0 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 1.8 | GO:0008305 | integrin complex(GO:0008305) |
| 0.1 | 1.0 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 0.3 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.1 | 1.8 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 1.4 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.1 | 0.5 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.1 | 0.8 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.1 | 18.5 | GO:1904813 | ficolin-1-rich granule(GO:0101002) ficolin-1-rich granule lumen(GO:1904813) |
| 0.1 | 0.3 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 1.4 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.1 | 0.8 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.1 | 3.6 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 1.6 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.1 | 0.1 | GO:0090543 | Flemming body(GO:0090543) |
| 0.1 | 0.7 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.1 | 0.5 | GO:0097545 | axonemal outer doublet(GO:0097545) |
| 0.1 | 7.3 | GO:0035579 | specific granule membrane(GO:0035579) |
| 0.1 | 2.0 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 2.6 | GO:0031091 | platelet alpha granule(GO:0031091) |
| 0.1 | 1.5 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.1 | 1.8 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.1 | 0.9 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 0.9 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.1 | 0.6 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.1 | 0.7 | GO:1990462 | omegasome(GO:1990462) |
| 0.1 | 0.4 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.1 | 1.1 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.1 | 0.9 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.1 | 0.5 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
| 0.1 | 0.4 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.1 | 0.2 | GO:0072536 | interleukin-23 receptor complex(GO:0072536) |
| 0.1 | 0.8 | GO:0032009 | early phagosome(GO:0032009) |
| 0.1 | 0.5 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.1 | 0.6 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.1 | 0.3 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.1 | 0.6 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.1 | 0.3 | GO:0033167 | ARC complex(GO:0033167) |
| 0.1 | 2.7 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.1 | 7.8 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.1 | 0.4 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.1 | 153.6 | GO:0005615 | extracellular space(GO:0005615) |
| 0.1 | 6.7 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 0.2 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.1 | 0.8 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.1 | 0.5 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.1 | 0.5 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.1 | 0.4 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.1 | 0.7 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.1 | 0.4 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.1 | 7.1 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.1 | 0.3 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 0.1 | 1.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.1 | 1.7 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.1 | 0.3 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.1 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 15.0 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.1 | 3.6 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.1 | 5.4 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
| 0.1 | 0.2 | GO:0071920 | cleavage body(GO:0071920) |
| 0.1 | 0.2 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 4.7 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 0.4 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.1 | 0.2 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.1 | 3.8 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.1 | 0.4 | GO:0044754 | autolysosome(GO:0044754) |
| 0.1 | 0.7 | GO:0098642 | network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.1 | 0.9 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 0.4 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.1 | 0.3 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 0.7 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.1 | 0.2 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.1 | 3.5 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.0 | 0.1 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.0 | 0.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.2 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.0 | 0.5 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.2 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.0 | 0.3 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.0 | 0.5 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.5 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.8 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.0 | 3.6 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 0.3 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.0 | 0.6 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 3.7 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.6 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 2.5 | GO:0005882 | intermediate filament(GO:0005882) |
| 0.0 | 0.9 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 6.2 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 2.0 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.4 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.0 | 0.6 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.4 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 0.3 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.0 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 4.8 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.5 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.5 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.2 | GO:1990745 | EARP complex(GO:1990745) |
| 0.0 | 0.9 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 1.9 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.4 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 4.2 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.1 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.0 | 0.3 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.1 | GO:1990879 | CST complex(GO:1990879) |
| 0.0 | 0.4 | GO:0019897 | extrinsic component of plasma membrane(GO:0019897) |
| 0.0 | 0.7 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.5 | GO:0036020 | endolysosome membrane(GO:0036020) |
| 0.0 | 1.7 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 1.1 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.1 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.0 | 0.2 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.2 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.0 | 82.4 | GO:0005576 | extracellular region(GO:0005576) |
| 0.0 | 1.2 | GO:0005903 | brush border(GO:0005903) |
| 0.0 | 1.3 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 1.4 | GO:0005776 | autophagosome(GO:0005776) |
| 0.0 | 0.1 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
| 0.0 | 0.1 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.3 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 0.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 1.6 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.1 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.0 | 1.5 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 2.4 | GO:0098852 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.1 | 221.0 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 2.9 | 8.6 | GO:0009032 | thymidine phosphorylase activity(GO:0009032) pyrimidine-nucleoside phosphorylase activity(GO:0016154) |
| 2.6 | 7.9 | GO:0004917 | interleukin-7 receptor activity(GO:0004917) |
| 2.6 | 7.8 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 2.2 | 10.8 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 2.2 | 466.8 | GO:0003823 | antigen binding(GO:0003823) |
| 2.1 | 20.7 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 1.7 | 5.1 | GO:0004877 | complement component C4b receptor activity(GO:0001861) complement component C3b receptor activity(GO:0004877) |
| 1.6 | 9.3 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 1.5 | 10.6 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 1.5 | 6.0 | GO:0017159 | pantetheine hydrolase activity(GO:0017159) |
| 1.4 | 7.0 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 1.3 | 6.6 | GO:0004912 | interleukin-3 receptor activity(GO:0004912) |
| 1.3 | 3.9 | GO:0050528 | acyloxyacyl hydrolase activity(GO:0050528) |
| 1.3 | 3.9 | GO:0003692 | left-handed Z-DNA binding(GO:0003692) |
| 1.3 | 5.1 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 1.3 | 1.3 | GO:1902271 | D3 vitamins binding(GO:1902271) |
| 1.3 | 3.8 | GO:0004961 | thromboxane receptor activity(GO:0004960) thromboxane A2 receptor activity(GO:0004961) |
| 1.2 | 7.3 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
| 1.2 | 19.1 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 1.1 | 5.7 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 1.1 | 4.4 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
| 1.1 | 17.4 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 1.1 | 3.2 | GO:0017129 | triglyceride binding(GO:0017129) |
| 1.0 | 3.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 1.0 | 2.9 | GO:0004878 | complement component C5a receptor activity(GO:0004878) |
| 0.9 | 2.8 | GO:0005139 | interleukin-7 receptor binding(GO:0005139) |
| 0.9 | 3.7 | GO:0030107 | HLA-A specific inhibitory MHC class I receptor activity(GO:0030107) |
| 0.9 | 4.5 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.9 | 3.5 | GO:0033265 | choline binding(GO:0033265) |
| 0.9 | 0.9 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.9 | 5.1 | GO:1902122 | chenodeoxycholic acid binding(GO:1902122) |
| 0.8 | 11.8 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.8 | 5.9 | GO:0090554 | phosphatidylcholine-translocating ATPase activity(GO:0090554) |
| 0.8 | 3.3 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.8 | 3.2 | GO:0005011 | macrophage colony-stimulating factor receptor activity(GO:0005011) |
| 0.8 | 3.2 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
| 0.8 | 6.3 | GO:0004873 | asialoglycoprotein receptor activity(GO:0004873) |
| 0.8 | 3.1 | GO:0016165 | linoleate 13S-lipoxygenase activity(GO:0016165) |
| 0.8 | 13.0 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.8 | 3.0 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.8 | 2.3 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) inositol-1,3,4,5-tetrakisphosphate 3-phosphatase activity(GO:0051717) |
| 0.8 | 3.0 | GO:0033897 | ribonuclease T2 activity(GO:0033897) |
| 0.7 | 7.3 | GO:0004875 | complement receptor activity(GO:0004875) |
| 0.7 | 2.9 | GO:0019862 | IgA binding(GO:0019862) |
| 0.7 | 0.7 | GO:0001855 | complement component C4b binding(GO:0001855) |
| 0.7 | 3.6 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.7 | 1.4 | GO:0004914 | interleukin-5 receptor activity(GO:0004914) |
| 0.7 | 1.4 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.7 | 7.6 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.7 | 2.1 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
| 0.7 | 3.4 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.7 | 15.6 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.7 | 3.4 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.7 | 4.6 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.7 | 0.7 | GO:0030109 | HLA-B specific inhibitory MHC class I receptor activity(GO:0030109) |
| 0.6 | 1.9 | GO:0005124 | scavenger receptor binding(GO:0005124) |
| 0.6 | 11.3 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.6 | 2.5 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.6 | 1.9 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.6 | 10.3 | GO:0008392 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.6 | 3.0 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.6 | 1.8 | GO:0034039 | 8-oxo-7,8-dihydroguanine DNA N-glycosylase activity(GO:0034039) |
| 0.6 | 3.5 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.6 | 2.9 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.6 | 3.5 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.6 | 3.5 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.6 | 4.0 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.6 | 2.3 | GO:0004335 | galactokinase activity(GO:0004335) |
| 0.6 | 20.7 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.6 | 1.7 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.6 | 1.7 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.6 | 1.7 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.5 | 2.2 | GO:0001632 | leukotriene B4 receptor activity(GO:0001632) |
| 0.5 | 1.6 | GO:0032395 | MHC class II receptor activity(GO:0032395) |
| 0.5 | 3.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.5 | 3.1 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.5 | 2.0 | GO:0019976 | interleukin-2 receptor activity(GO:0004911) interleukin-2 binding(GO:0019976) |
| 0.5 | 7.6 | GO:0019864 | IgG binding(GO:0019864) |
| 0.5 | 2.0 | GO:0070119 | ciliary neurotrophic factor binding(GO:0070119) |
| 0.5 | 2.0 | GO:0047685 | amine sulfotransferase activity(GO:0047685) |
| 0.5 | 1.5 | GO:0004326 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) dihydrofolate synthase activity(GO:0008841) |
| 0.5 | 1.0 | GO:0052815 | medium-chain acyl-CoA hydrolase activity(GO:0052815) long-chain acyl-CoA hydrolase activity(GO:0052816) |
| 0.5 | 2.9 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.5 | 1.9 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
| 0.5 | 4.8 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.5 | 1.4 | GO:0042008 | interleukin-18 receptor activity(GO:0042008) |
| 0.5 | 2.8 | GO:0047894 | flavonol 3-sulfotransferase activity(GO:0047894) |
| 0.5 | 1.4 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.5 | 3.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.5 | 3.7 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.5 | 9.3 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.5 | 1.4 | GO:0015322 | proton-dependent oligopeptide secondary active transmembrane transporter activity(GO:0005427) secondary active oligopeptide transmembrane transporter activity(GO:0015322) |
| 0.5 | 2.3 | GO:0070576 | vitamin D 24-hydroxylase activity(GO:0070576) |
| 0.5 | 24.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.4 | 1.8 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.4 | 1.8 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.4 | 5.8 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.4 | 2.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.4 | 3.5 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.4 | 1.3 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.4 | 1.7 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.4 | 2.1 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.4 | 2.9 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.4 | 1.2 | GO:0004411 | homogentisate 1,2-dioxygenase activity(GO:0004411) |
| 0.4 | 3.3 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.4 | 0.4 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.4 | 2.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.4 | 3.2 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.4 | 1.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.4 | 2.0 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
| 0.4 | 1.2 | GO:0052739 | phosphatidylserine 1-acylhydrolase activity(GO:0052739) |
| 0.4 | 5.9 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.4 | 1.6 | GO:0032440 | 2-alkenal reductase [NAD(P)] activity(GO:0032440) |
| 0.4 | 3.1 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.4 | 1.5 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.4 | 2.7 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.4 | 1.5 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.4 | 1.5 | GO:0003974 | UDP-N-acetylglucosamine 4-epimerase activity(GO:0003974) UDP-glucose 4-epimerase activity(GO:0003978) |
| 0.4 | 3.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.4 | 1.9 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.4 | 1.1 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.4 | 1.1 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.4 | 4.5 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 0.4 | 1.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.4 | 2.6 | GO:0015254 | glycerol channel activity(GO:0015254) |
| 0.4 | 1.8 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.4 | 1.8 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.4 | 3.2 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.4 | 3.6 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.4 | 1.4 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.4 | 2.8 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.4 | 2.5 | GO:0032393 | MHC class I receptor activity(GO:0032393) |
| 0.3 | 1.7 | GO:0042806 | fucose binding(GO:0042806) |
| 0.3 | 1.4 | GO:0048040 | UDP-glucuronate decarboxylase activity(GO:0048040) |
| 0.3 | 1.0 | GO:0008746 | NAD(P)+ transhydrogenase activity(GO:0008746) oxidoreductase activity, acting on NAD(P)H, NAD(P) as acceptor(GO:0016652) |
| 0.3 | 1.7 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.3 | 1.3 | GO:0016495 | C-X3-C chemokine receptor activity(GO:0016495) |
| 0.3 | 50.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.3 | 1.3 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.3 | 2.0 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.3 | 1.0 | GO:0097689 | iron channel activity(GO:0097689) |
| 0.3 | 1.0 | GO:0047750 | cholestenol delta-isomerase activity(GO:0047750) |
| 0.3 | 0.9 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.3 | 0.6 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.3 | 2.8 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.3 | 5.9 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.3 | 0.6 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.3 | 14.4 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.3 | 0.9 | GO:0016517 | interleukin-12 receptor activity(GO:0016517) |
| 0.3 | 0.9 | GO:0042007 | interleukin-18 binding(GO:0042007) |
| 0.3 | 2.1 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.3 | 1.5 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.3 | 1.2 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.3 | 2.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.3 | 2.7 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.3 | 3.6 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.3 | 0.3 | GO:0004031 | aldehyde oxidase activity(GO:0004031) |
| 0.3 | 15.5 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.3 | 5.6 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.3 | 5.6 | GO:0005537 | mannose binding(GO:0005537) |
| 0.3 | 2.6 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.3 | 0.9 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) |
| 0.3 | 3.8 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.3 | 0.9 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.3 | 1.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.3 | 0.9 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
| 0.3 | 1.1 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.3 | 1.1 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.3 | 3.6 | GO:0046625 | sphingolipid binding(GO:0046625) |
| 0.3 | 11.9 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.3 | 5.2 | GO:0001637 | G-protein coupled chemoattractant receptor activity(GO:0001637) chemokine receptor activity(GO:0004950) |
| 0.3 | 2.5 | GO:0046790 | virion binding(GO:0046790) |
| 0.3 | 1.1 | GO:0070259 | tyrosyl-DNA phosphodiesterase activity(GO:0070259) |
| 0.3 | 2.5 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.3 | 2.7 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.3 | 0.5 | GO:0031731 | CCR6 chemokine receptor binding(GO:0031731) |
| 0.3 | 9.4 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.3 | 1.3 | GO:0004910 | interleukin-1, Type II, blocking receptor activity(GO:0004910) |
| 0.3 | 1.1 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 0.3 | 2.1 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.3 | 0.3 | GO:0008798 | beta-aspartyl-peptidase activity(GO:0008798) |
| 0.3 | 1.0 | GO:0034736 | sterol O-acyltransferase activity(GO:0004772) cholesterol O-acyltransferase activity(GO:0034736) |
| 0.3 | 4.7 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.3 | 1.8 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.3 | 5.9 | GO:0005522 | profilin binding(GO:0005522) |
| 0.3 | 1.5 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.3 | 2.8 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.3 | 0.8 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
| 0.3 | 1.5 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
| 0.2 | 1.7 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.2 | 2.4 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.2 | 1.7 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.2 | 0.7 | GO:0004418 | hydroxymethylbilane synthase activity(GO:0004418) |
| 0.2 | 1.2 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
| 0.2 | 1.0 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.2 | 1.0 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.2 | 3.5 | GO:0004321 | fatty-acyl-CoA synthase activity(GO:0004321) |
| 0.2 | 0.7 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.2 | 3.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.2 | 0.7 | GO:0070123 | transforming growth factor beta receptor activity, type III(GO:0070123) |
| 0.2 | 3.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.2 | 7.2 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.2 | 1.2 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.2 | 1.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.2 | 3.8 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.2 | 4.3 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.2 | 0.9 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.2 | 0.9 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.2 | 1.3 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.2 | 0.7 | GO:0047787 | delta4-3-oxosteroid 5beta-reductase activity(GO:0047787) |
| 0.2 | 0.4 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.2 | 0.9 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.2 | 1.3 | GO:0030298 | receptor signaling protein tyrosine kinase activator activity(GO:0030298) |
| 0.2 | 1.9 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.2 | 1.3 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.2 | 0.4 | GO:0046915 | transition metal ion transmembrane transporter activity(GO:0046915) |
| 0.2 | 0.6 | GO:0016608 | growth hormone-releasing hormone activity(GO:0016608) |
| 0.2 | 6.6 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.2 | 6.8 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.2 | 1.5 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.2 | 2.5 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.2 | 1.5 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.2 | 0.8 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.2 | 1.5 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.2 | 0.8 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.2 | 1.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.2 | 2.7 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.2 | 0.8 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.2 | 0.4 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.2 | 1.4 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.2 | 0.8 | GO:0004452 | isopentenyl-diphosphate delta-isomerase activity(GO:0004452) |
| 0.2 | 0.6 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.2 | 1.0 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.2 | 2.0 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.2 | 9.3 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.2 | 32.6 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.2 | 3.3 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.2 | 0.6 | GO:0003878 | ATP citrate synthase activity(GO:0003878) |
| 0.2 | 2.0 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.2 | 1.4 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.2 | 1.2 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.2 | 0.8 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.2 | 1.0 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.2 | 6.3 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.2 | 0.4 | GO:0030343 | vitamin D3 25-hydroxylase activity(GO:0030343) vitamin D 25-hydroxylase activity(GO:0070643) |
| 0.2 | 0.6 | GO:0070039 | rRNA (guanosine-2'-O-)-methyltransferase activity(GO:0070039) |
| 0.2 | 2.3 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.2 | 0.8 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.2 | 3.6 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.2 | 2.3 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.2 | 5.6 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.2 | 1.1 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.2 | 2.2 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.2 | 0.9 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.2 | 0.9 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.2 | 1.1 | GO:0004530 | deoxyribonuclease I activity(GO:0004530) |
| 0.2 | 0.5 | GO:0004615 | phosphomannomutase activity(GO:0004615) |
| 0.2 | 3.8 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.2 | 0.7 | GO:0002046 | opsin binding(GO:0002046) |
| 0.2 | 0.8 | GO:0008263 | pyrimidine-specific mismatch base pair DNA N-glycosylase activity(GO:0008263) |
| 0.2 | 1.0 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.2 | 1.7 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.2 | 0.8 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.2 | 1.3 | GO:0052794 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.2 | 1.5 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.2 | 1.0 | GO:0004096 | catalase activity(GO:0004096) |
| 0.2 | 0.7 | GO:1901375 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.2 | 1.5 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.2 | 1.6 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.2 | 1.3 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.2 | 5.4 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.2 | 0.2 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.2 | 0.5 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
| 0.2 | 0.6 | GO:0001626 | nociceptin receptor activity(GO:0001626) |
| 0.2 | 0.6 | GO:0008832 | dGTPase activity(GO:0008832) triphosphoric monoester hydrolase activity(GO:0016793) guanyl deoxyribonucleotide binding(GO:0032560) dGTP binding(GO:0032567) |
| 0.2 | 0.8 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.2 | 0.5 | GO:0090409 | malonyl-CoA synthetase activity(GO:0090409) |
| 0.2 | 0.8 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 0.2 | 2.2 | GO:0031386 | protein tag(GO:0031386) |
| 0.2 | 3.3 | GO:0019841 | retinol binding(GO:0019841) |
| 0.2 | 0.6 | GO:0102344 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
| 0.2 | 1.3 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.2 | 0.5 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.2 | 9.8 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.2 | 0.8 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.2 | 3.1 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.2 | 0.5 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.2 | 0.5 | GO:0030549 | acetylcholine receptor activator activity(GO:0030549) |
| 0.2 | 0.6 | GO:0089720 | caspase binding(GO:0089720) |
| 0.2 | 3.5 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.2 | 1.8 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.2 | 5.2 | GO:0070001 | aspartic-type peptidase activity(GO:0070001) |
| 0.2 | 0.5 | GO:0004730 | pseudouridylate synthase activity(GO:0004730) |
| 0.2 | 3.6 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.2 | 0.6 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.2 | 0.8 | GO:0004666 | prostaglandin-endoperoxide synthase activity(GO:0004666) |
| 0.1 | 2.5 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.1 | 2.3 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
| 0.1 | 1.2 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.1 | 1.6 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 1.0 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.1 | 0.7 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.1 | GO:1904713 | beta-catenin destruction complex binding(GO:1904713) |
| 0.1 | 1.6 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.1 | 1.2 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
| 0.1 | 2.0 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.1 | 0.4 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
| 0.1 | 0.4 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.1 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.1 | 0.4 | GO:0036328 | VEGF-C-activated receptor activity(GO:0036328) |
| 0.1 | 1.8 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 1.6 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.1 | 0.5 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.1 | 0.5 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.1 | 4.1 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.1 | 1.3 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.1 | 1.0 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.1 | 0.6 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.1 | 0.5 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.1 | 1.3 | GO:0033857 | diphosphoinositol-pentakisphosphate kinase activity(GO:0033857) |
| 0.1 | 8.1 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.1 | 0.1 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
| 0.1 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.1 | 0.4 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.1 | 1.4 | GO:0008329 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
| 0.1 | 2.9 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.1 | 0.5 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.1 | 0.6 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 0.8 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.1 | 0.9 | GO:0002114 | interleukin-33 receptor activity(GO:0002114) |
| 0.1 | 2.6 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.1 | 1.4 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 0.4 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.1 | 0.4 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 0.7 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.7 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.1 | 1.6 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 2.4 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.1 | 0.6 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.1 | 1.2 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 0.5 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.1 | 0.6 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.1 | 1.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.1 | 0.2 | GO:0001156 | TFIIIC-class transcription factor binding(GO:0001156) |
| 0.1 | 3.6 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.1 | 0.6 | GO:0016890 | site-specific endodeoxyribonuclease activity, specific for altered base(GO:0016890) |
| 0.1 | 1.4 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 0.8 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.1 | 0.5 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.1 | 1.0 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.1 | 0.3 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.1 | 0.2 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.1 | 0.7 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.1 | 1.8 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) |
| 0.1 | 1.0 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 1.0 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 1.4 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.1 | 4.4 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.1 | 0.3 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.1 | 0.5 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.1 | 2.0 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.1 | 0.5 | GO:0004556 | alpha-amylase activity(GO:0004556) |
| 0.1 | 0.4 | GO:0047676 | arachidonate-CoA ligase activity(GO:0047676) |
| 0.1 | 1.0 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.1 | 0.3 | GO:0008988 | rRNA (adenine-N6-)-methyltransferase activity(GO:0008988) |
| 0.1 | 1.7 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 5.0 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.1 | 1.1 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.1 | 9.9 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.1 | 1.5 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.1 | 3.0 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.1 | 0.3 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.1 | 0.5 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.1 | 3.5 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.1 | 0.5 | GO:0036041 | long-chain fatty acid binding(GO:0036041) |
| 0.1 | 0.5 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.1 | 4.8 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.1 | 0.8 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.1 | 1.4 | GO:0050542 | icosanoid binding(GO:0050542) fatty acid derivative binding(GO:1901567) |
| 0.1 | 0.8 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 1.8 | GO:0055103 | ligase regulator activity(GO:0055103) ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.1 | 0.3 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.1 | 0.6 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.1 | 2.9 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.1 | 3.5 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.1 | 1.5 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.1 | 0.6 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.1 | 2.4 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.1 | 0.3 | GO:0072545 | tyrosine binding(GO:0072545) |
| 0.1 | 1.4 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.1 | 2.6 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.1 | 1.3 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 1.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.1 | 1.9 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.1 | 0.9 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.5 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
| 0.1 | 1.0 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.1 | 1.2 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 1.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 2.7 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.1 | 0.6 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.1 | 2.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 4.2 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.1 | 0.5 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 0.8 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 0.1 | 1.0 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.1 | 0.3 | GO:0016503 | pheromone receptor activity(GO:0016503) |
| 0.1 | 1.2 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.1 | 0.3 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.1 | 0.7 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.1 | 1.7 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 1.6 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.1 | 1.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 16.2 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.1 | 0.7 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.1 | 0.7 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 0.3 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.1 | 0.6 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.1 | 0.4 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 0.5 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.1 | 0.2 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.1 | 2.8 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.1 | 0.7 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 0.2 | GO:1990259 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.1 | 2.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.2 | GO:0016642 | glycine dehydrogenase (decarboxylating) activity(GO:0004375) oxidoreductase activity, acting on the CH-NH2 group of donors, disulfide as acceptor(GO:0016642) vitamin B6 binding(GO:0070279) pyridoxal binding(GO:0070280) |
| 0.1 | 0.4 | GO:0016524 | latrotoxin receptor activity(GO:0016524) |
| 0.1 | 0.7 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.1 | 0.5 | GO:0001132 | RNA polymerase II transcription factor activity, TBP-class protein binding, involved in preinitiation complex assembly(GO:0001129) RNA polymerase II transcription factor activity, TBP-class protein binding(GO:0001132) |
| 0.1 | 0.4 | GO:0039552 | RIG-I binding(GO:0039552) |
| 0.1 | 0.3 | GO:0004979 | beta-endorphin receptor activity(GO:0004979) morphine receptor activity(GO:0038047) |
| 0.1 | 3.6 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.1 | 1.7 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.1 | 0.7 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.1 | 3.4 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.1 | 0.7 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 0.4 | GO:0016316 | phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity(GO:0016316) inositol-1,3,4-trisphosphate 4-phosphatase activity(GO:0017161) phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) inositol-3,4-bisphosphate 4-phosphatase activity(GO:0052828) |
| 0.1 | 0.4 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.1 | 0.4 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.1 | 0.3 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.1 | 0.3 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.1 | 0.7 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 0.6 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 0.3 | GO:0004001 | adenosine kinase activity(GO:0004001) |
| 0.1 | 0.4 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.1 | 0.4 | GO:0004803 | transposase activity(GO:0004803) |
| 0.1 | 0.7 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 2.1 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.4 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.1 | 0.3 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.1 | 0.4 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.1 | 4.0 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.1 | 1.9 | GO:0019825 | oxygen binding(GO:0019825) |
| 0.1 | 1.3 | GO:0042923 | neuropeptide binding(GO:0042923) |
| 0.1 | 0.2 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
| 0.1 | 1.4 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.1 | 1.0 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.1 | 0.5 | GO:0004137 | deoxycytidine kinase activity(GO:0004137) |
| 0.1 | 0.2 | GO:0004638 | phosphoribosylaminoimidazole carboxylase activity(GO:0004638) phosphoribosylaminoimidazolesuccinocarboxamide synthase activity(GO:0004639) |
| 0.1 | 0.4 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.1 | 0.5 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.1 | 0.5 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.1 | 0.2 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.1 | 0.4 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.1 | 2.8 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.1 | 0.2 | GO:0016794 | guanosine-3',5'-bis(diphosphate) 3'-diphosphatase activity(GO:0008893) diphosphoric monoester hydrolase activity(GO:0016794) |
| 0.1 | 1.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.1 | 0.5 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 0.4 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 0.6 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.1 | 1.8 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 0.4 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.1 | 0.4 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.1 | 0.2 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.1 | 0.2 | GO:0033746 | histone demethylase activity (H3-R2 specific)(GO:0033746) histone demethylase activity (H4-R3 specific)(GO:0033749) |
| 0.1 | 2.6 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 1.1 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 0.1 | 1.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.1 | 0.4 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 1.2 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.1 | 1.0 | GO:0030955 | potassium ion binding(GO:0030955) |
| 0.1 | 0.4 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.1 | 0.5 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.1 | 2.1 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.1 | 15.6 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.1 | 0.2 | GO:0016672 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) |
| 0.1 | 0.7 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 0.2 | GO:0008106 | alcohol dehydrogenase (NADP+) activity(GO:0008106) |
| 0.1 | 4.2 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.1 | 0.3 | GO:0035500 | MH2 domain binding(GO:0035500) |
| 0.1 | 0.6 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 2.3 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.1 | 0.5 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.1 | 0.6 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 0.7 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 0.2 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.1 | 0.6 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.1 | 0.4 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 1.4 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.1 | 0.6 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.1 | 0.4 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.1 | 0.4 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.1 | 0.4 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.1 | 0.5 | GO:0005497 | androgen binding(GO:0005497) |
| 0.1 | 0.2 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.1 | 0.8 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.0 | 2.2 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.4 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.2 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.0 | 0.2 | GO:0004492 | methylmalonyl-CoA decarboxylase activity(GO:0004492) |
| 0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 1.0 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.5 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 1.8 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.0 | 0.9 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.0 | 0.6 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.1 | GO:0050146 | nucleoside phosphotransferase activity(GO:0050146) |
| 0.0 | 0.2 | GO:0004572 | mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase activity(GO:0004572) |
| 0.0 | 0.2 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.0 | 0.6 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.0 | 0.4 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.0 | 0.4 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.2 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.0 | 0.5 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.0 | 2.6 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 2.3 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.4 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.0 | 1.6 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.9 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.0 | 0.6 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.5 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.3 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.0 | 1.8 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.3 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 1.0 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.2 | GO:0004963 | follicle-stimulating hormone receptor activity(GO:0004963) |
| 0.0 | 1.1 | GO:0046961 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.2 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.0 | 0.4 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 0.1 | GO:0099530 | G-protein coupled receptor activity involved in regulation of postsynaptic membrane potential(GO:0099530) |
| 0.0 | 0.3 | GO:0016402 | pristanoyl-CoA oxidase activity(GO:0016402) |
| 0.0 | 0.5 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.0 | 0.3 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.0 | 0.5 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 1.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.0 | 0.2 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.0 | 0.3 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.0 | 0.4 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.0 | 0.2 | GO:0016725 | oxidoreductase activity, acting on CH or CH2 groups(GO:0016725) |
| 0.0 | 0.4 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.0 | 0.5 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) dopamine neurotransmitter receptor activity(GO:0004952) |
| 0.0 | 17.3 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.0 | 1.5 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.3 | GO:0004372 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.0 | 0.3 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.0 | 1.1 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.0 | 0.1 | GO:0031780 | corticotropin hormone receptor binding(GO:0031780) type 5 melanocortin receptor binding(GO:0031783) |
| 0.0 | 2.1 | GO:0051219 | phosphoprotein binding(GO:0051219) |
| 0.0 | 0.2 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 6.6 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.9 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.0 | 0.2 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.0 | 0.5 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.0 | 0.0 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.0 | 1.0 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.0 | 1.2 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.5 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 0.1 | GO:0008312 | 7S RNA binding(GO:0008312) |
| 0.0 | 0.3 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.0 | 2.7 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.5 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.7 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 3.6 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.0 | 0.1 | GO:0004167 | dopachrome isomerase activity(GO:0004167) |
| 0.0 | 0.9 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.0 | 1.1 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.0 | 0.7 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 1.2 | GO:1990782 | protein tyrosine kinase binding(GO:1990782) |
| 0.0 | 0.2 | GO:0016723 | oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
| 0.0 | 1.5 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 16.0 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
| 0.0 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 0.3 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.0 | 0.3 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
| 0.0 | 0.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.0 | 0.8 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.0 | 0.2 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 1.0 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.1 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 0.4 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.1 | GO:0004336 | galactosylceramidase activity(GO:0004336) |
| 0.0 | 0.0 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.0 | 0.4 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.0 | 0.3 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.0 | 0.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.1 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.8 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.0 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.0 | 0.1 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.6 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.0 | 0.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.1 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.0 | 0.8 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 0.8 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.0 | 0.1 | GO:0004733 | pyridoxamine-phosphate oxidase activity(GO:0004733) |
| 0.0 | 0.1 | GO:0032145 | 4-aminobutyrate transaminase activity(GO:0003867) succinate-semialdehyde dehydrogenase binding(GO:0032145) (S)-3-amino-2-methylpropionate transaminase activity(GO:0047298) |
| 0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.0 | 0.4 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.0 | 0.2 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
| 0.0 | 0.5 | GO:0022829 | wide pore channel activity(GO:0022829) |
| 0.0 | 0.1 | GO:0052654 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.0 | 0.2 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.0 | 0.1 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) |
| 0.0 | 0.0 | GO:0030366 | molybdopterin synthase activity(GO:0030366) |
| 0.0 | 3.5 | GO:0030246 | carbohydrate binding(GO:0030246) |
| 0.0 | 0.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.0 | 0.2 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 0.7 | GO:0043022 | ribosome binding(GO:0043022) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 88.4 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.7 | 6.5 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.7 | 42.8 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.6 | 1.2 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.5 | 3.8 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.5 | 21.1 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.4 | 0.4 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.4 | 4.1 | PID EPO PATHWAY | EPO signaling pathway |
| 0.4 | 14.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.4 | 38.4 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.3 | 9.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.3 | 3.4 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.3 | 35.9 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.3 | 2.3 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.3 | 21.8 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.3 | 9.6 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.3 | 0.6 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.3 | 19.5 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.3 | 4.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.3 | 3.8 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.3 | 10.1 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.3 | 0.9 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.3 | 12.5 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.3 | 12.9 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.3 | 12.8 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.2 | 0.9 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.2 | 7.3 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.2 | 3.7 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.2 | 2.8 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.2 | 9.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.2 | 3.7 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.2 | 6.8 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.2 | 5.2 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.2 | 5.7 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.2 | 8.0 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.2 | 2.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.2 | 2.5 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.2 | 11.9 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.2 | 0.4 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.2 | 4.9 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.2 | 9.5 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.2 | 1.0 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.2 | 1.0 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.2 | 1.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.2 | 10.0 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.1 | 0.9 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.1 | 3.8 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.1 | 1.7 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 3.9 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.1 | 3.4 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.1 | 4.2 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.1 | 0.8 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 4.6 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.1 | 6.9 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.1 | 3.5 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.1 | 2.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.1 | 4.7 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.1 | 2.3 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 4.6 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.1 | 2.7 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.1 | 3.9 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 0.2 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 1.2 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.1 | 2.0 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.1 | 1.9 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.1 | 2.3 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.1 | 4.3 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 3.2 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.1 | 1.3 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.1 | 5.2 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.1 | 0.5 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 2.0 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.1 | 2.8 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.1 | 6.1 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.1 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.1 | 0.6 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 0.5 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.1 | 1.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 4.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 3.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 1.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.7 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 3.6 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 1.7 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 7.8 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 0.8 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.8 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 1.3 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 2.5 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.0 | 2.3 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 4.3 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.5 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 11.7 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 1.9 | PID CMYB PATHWAY | C-MYB transcription factor network |
| 0.0 | 0.4 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 0.8 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 7.8 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 1.5 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 1.5 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 0.2 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 0.8 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 3.3 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.7 | 10.2 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 1.5 | 28.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 1.4 | 28.8 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 1.1 | 11.1 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.8 | 21.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.8 | 3.8 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.7 | 78.1 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.7 | 4.0 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.6 | 10.6 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.6 | 11.1 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.6 | 40.6 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.5 | 7.2 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.5 | 5.1 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.5 | 16.6 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.5 | 12.4 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.5 | 1.0 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.5 | 9.2 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.4 | 48.1 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.4 | 2.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.4 | 0.4 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.4 | 1.8 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.4 | 6.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.4 | 12.7 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.4 | 5.4 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.4 | 10.0 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.4 | 8.9 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.4 | 5.3 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.4 | 17.6 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.3 | 8.6 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.3 | 1.7 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
| 0.3 | 4.9 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.3 | 2.6 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.3 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.3 | 4.1 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.3 | 7.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.3 | 1.2 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.3 | 6.7 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.3 | 1.4 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.3 | 23.7 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.3 | 7.9 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.3 | 1.8 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.3 | 4.4 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.3 | 0.5 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.2 | 2.0 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.2 | 3.6 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.2 | 6.0 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.2 | 3.4 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.2 | 37.0 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.2 | 4.3 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.2 | 4.0 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.2 | 6.4 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.2 | 2.3 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.2 | 0.4 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.2 | 0.6 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
| 0.2 | 0.6 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.2 | 7.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.2 | 5.7 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.2 | 6.1 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.2 | 2.2 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.2 | 4.2 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.2 | 10.9 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.2 | 1.9 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.2 | 3.1 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.2 | 6.2 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.2 | 1.8 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.2 | 3.7 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.2 | 9.0 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.2 | 16.8 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.2 | 1.2 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.2 | 1.3 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.2 | 2.0 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.2 | 8.0 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.2 | 4.3 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.2 | 0.5 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
| 0.2 | 8.8 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.2 | 0.8 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.1 | 3.5 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
| 0.1 | 6.1 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.1 | 1.0 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.1 | 15.0 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.1 | 1.5 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.1 | 2.7 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.1 | 3.4 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.1 | 3.5 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 1.6 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.1 | 5.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.1 | 4.6 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.1 | 2.1 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.1 | 1.0 | REACTOME TCR SIGNALING | Genes involved in TCR signaling |
| 0.1 | 1.6 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.1 | 1.4 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.1 | 15.7 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.1 | 6.8 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 0.9 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.1 | 15.5 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.1 | 6.1 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.1 | 4.0 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.1 | 1.2 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.1 | 9.7 | REACTOME TOLL RECEPTOR CASCADES | Genes involved in Toll Receptor Cascades |
| 0.1 | 1.0 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.1 | 3.8 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.1 | 1.6 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.1 | 2.1 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 2.4 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.1 | 0.4 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.1 | 2.2 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 1.5 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
| 0.1 | 3.4 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.1 | 1.1 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 1.8 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 0.8 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 3.2 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.1 | 1.5 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 0.1 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
| 0.1 | 12.9 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.1 | 3.8 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.1 | 1.7 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.1 | 3.0 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.1 | 0.4 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.1 | 1.2 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.1 | 1.1 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.1 | 1.4 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 0.6 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.1 | 0.9 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.1 | 14.7 | REACTOME CLASS A1 RHODOPSIN LIKE RECEPTORS | Genes involved in Class A/1 (Rhodopsin-like receptors) |
| 0.1 | 1.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 4.0 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.1 | 1.7 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 2.4 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 1.4 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 2.8 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 1.3 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
| 0.0 | 1.4 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.0 | 0.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.0 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 1.4 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
| 0.0 | 1.2 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.8 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 4.0 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.2 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 0.9 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 1.6 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.0 | 3.9 | REACTOME GLYCOSAMINOGLYCAN METABOLISM | Genes involved in Glycosaminoglycan metabolism |
| 0.0 | 0.8 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.3 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.0 | 0.5 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.5 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.0 | 0.4 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 0.6 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.3 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.3 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.1 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.5 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 0.8 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.0 | 0.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.2 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
| 0.0 | 0.3 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
| 0.0 | 2.1 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 0.0 | 0.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.3 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.0 | 0.9 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.0 | 0.1 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.7 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |