Project
Illumina Body Map 2 (GSE30611)
Navigation
Downloads
Results for TCF3_MYOG
Z-value: 2.17
Motif logo
Transcription factors associated with TCF3_MYOG
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
TCF3
|
ENSG00000071564.17 | transcription factor 3 |
|
MYOG
|
ENSG00000122180.5 | myogenin |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| MYOG | hg38_v1_chr1_-_203086001_203086019 | 0.36 | 4.2e-02 | Click! |
| TCF3 | hg38_v1_chr19_-_1650667_1650745 | -0.09 | 6.4e-01 | Click! |
Activity profile of TCF3_MYOG motif
Sorted Z-values of TCF3_MYOG motif
Network of associatons between targets according to the STRING database.
First level regulatory network of TCF3_MYOG
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 5.0 | 15.0 | GO:1901899 | positive regulation of relaxation of cardiac muscle(GO:1901899) |
| 1.9 | 7.8 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 1.6 | 15.9 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 1.6 | 9.4 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 1.5 | 4.5 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
| 1.5 | 6.0 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 1.4 | 24.2 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 1.4 | 8.4 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 1.4 | 15.1 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 1.3 | 4.0 | GO:0018963 | phthalate metabolic process(GO:0018963) |
| 1.3 | 5.3 | GO:1900085 | negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
| 1.3 | 20.9 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 1.3 | 3.9 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
| 1.3 | 5.2 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
| 1.3 | 5.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 1.3 | 11.3 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 1.3 | 8.8 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
| 1.2 | 2.5 | GO:0072190 | ureter urothelium development(GO:0072190) |
| 1.2 | 11.0 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 1.2 | 3.5 | GO:0043397 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) |
| 1.2 | 3.5 | GO:1904397 | negative regulation of neuromuscular junction development(GO:1904397) |
| 1.1 | 3.4 | GO:0006113 | fermentation(GO:0006113) regulation of fermentation(GO:0043465) |
| 1.1 | 3.2 | GO:0014876 | response to injury involved in regulation of muscle adaptation(GO:0014876) |
| 1.0 | 81.2 | GO:0030049 | muscle filament sliding(GO:0030049) actin-myosin filament sliding(GO:0033275) |
| 1.0 | 3.9 | GO:0046882 | negative regulation of B cell differentiation(GO:0045578) negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 1.0 | 2.9 | GO:1904328 | regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
| 1.0 | 2.9 | GO:2000439 | positive regulation of monocyte extravasation(GO:2000439) |
| 0.9 | 3.8 | GO:1903410 | nitric oxide production involved in inflammatory response(GO:0002537) lysine import(GO:0034226) L-arginine import(GO:0043091) L-lysine import(GO:0061461) arginine import(GO:0090467) L-arginine transmembrane transport(GO:1903400) L-lysine import into cell(GO:1903410) |
| 0.9 | 12.0 | GO:0036309 | protein localization to M-band(GO:0036309) |
| 0.9 | 2.7 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.9 | 2.6 | GO:0051821 | negative regulation of transcription from RNA polymerase II promoter in response to UV-induced DNA damage(GO:0010768) transmission of virus(GO:0019089) dissemination or transmission of symbiont from host(GO:0044007) dissemination or transmission of organism from other organism involved in symbiotic interaction(GO:0051821) |
| 0.9 | 1.7 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
| 0.8 | 4.9 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.8 | 9.7 | GO:0021678 | third ventricle development(GO:0021678) |
| 0.8 | 5.3 | GO:0018032 | protein amidation(GO:0018032) |
| 0.7 | 3.7 | GO:0032765 | positive regulation of mast cell cytokine production(GO:0032765) |
| 0.7 | 2.2 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.7 | 2.9 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.7 | 1.4 | GO:0072034 | renal vesicle induction(GO:0072034) |
| 0.7 | 2.8 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.6 | 2.5 | GO:0003051 | angiotensin-mediated drinking behavior(GO:0003051) |
| 0.6 | 3.0 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.6 | 4.8 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.6 | 1.8 | GO:1902303 | regulation of heart rate by hormone(GO:0003064) negative regulation of potassium ion export(GO:1902303) |
| 0.6 | 1.8 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.6 | 3.6 | GO:0001757 | somite specification(GO:0001757) |
| 0.6 | 4.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.6 | 6.4 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.6 | 2.3 | GO:0003165 | Purkinje myocyte development(GO:0003165) |
| 0.6 | 2.8 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.5 | 3.3 | GO:0035900 | response to isolation stress(GO:0035900) |
| 0.5 | 3.7 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.5 | 4.6 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.5 | 1.0 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.5 | 11.6 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.5 | 2.5 | GO:0097403 | cellular response to raffinose(GO:0097403) response to raffinose(GO:1901545) |
| 0.5 | 3.0 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
| 0.5 | 1.5 | GO:0060723 | spongiotrophoblast cell proliferation(GO:0060720) regulation of spongiotrophoblast cell proliferation(GO:0060721) cell proliferation involved in embryonic placenta development(GO:0060722) regulation of cell proliferation involved in embryonic placenta development(GO:0060723) |
| 0.5 | 3.4 | GO:0030311 | poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.5 | 4.4 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
| 0.5 | 6.3 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.5 | 2.9 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.5 | 1.4 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.5 | 6.4 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.5 | 2.3 | GO:0030047 | actin modification(GO:0030047) |
| 0.5 | 5.0 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.4 | 1.3 | GO:1901383 | negative regulation of chorionic trophoblast cell proliferation(GO:1901383) |
| 0.4 | 10.3 | GO:0045199 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.4 | 8.9 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.4 | 3.5 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.4 | 6.9 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.4 | 1.3 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.4 | 1.7 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
| 0.4 | 2.5 | GO:0015862 | uridine transport(GO:0015862) |
| 0.4 | 2.9 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.4 | 1.7 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.4 | 1.2 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.4 | 1.2 | GO:0021793 | vagus nerve morphogenesis(GO:0021644) chemorepulsion of branchiomotor axon(GO:0021793) |
| 0.4 | 1.6 | GO:1990926 | short-term synaptic potentiation(GO:1990926) |
| 0.4 | 1.5 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
| 0.4 | 6.4 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
| 0.4 | 1.9 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 0.4 | 3.4 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) |
| 0.4 | 3.4 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.4 | 1.8 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.4 | 2.5 | GO:1903294 | regulation of glutamate secretion, neurotransmission(GO:1903294) positive regulation of glutamate secretion, neurotransmission(GO:1903296) |
| 0.4 | 1.4 | GO:0007538 | primary sex determination(GO:0007538) |
| 0.4 | 3.2 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.4 | 4.2 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.4 | 5.6 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.3 | 1.0 | GO:1904908 | negative regulation of maintenance of sister chromatid cohesion(GO:0034092) negative regulation of maintenance of mitotic sister chromatid cohesion(GO:0034183) maintenance of mitotic sister chromatid cohesion, telomeric(GO:0099403) mitotic sister chromatid cohesion, telomeric(GO:0099404) regulation of maintenance of mitotic sister chromatid cohesion, telomeric(GO:1904907) negative regulation of maintenance of mitotic sister chromatid cohesion, telomeric(GO:1904908) |
| 0.3 | 6.2 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
| 0.3 | 1.0 | GO:0061033 | secretion by lung epithelial cell involved in lung growth(GO:0061033) |
| 0.3 | 3.1 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.3 | 1.3 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.3 | 3.7 | GO:0086024 | adrenergic receptor signaling pathway involved in positive regulation of heart rate(GO:0086024) |
| 0.3 | 1.0 | GO:0008358 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) P granule organization(GO:0030719) |
| 0.3 | 3.6 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.3 | 5.2 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.3 | 3.2 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.3 | 0.9 | GO:1903413 | cellular response to bile acid(GO:1903413) |
| 0.3 | 0.9 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.3 | 1.2 | GO:0097350 | neutrophil clearance(GO:0097350) |
| 0.3 | 6.0 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
| 0.3 | 1.8 | GO:0008354 | germ cell migration(GO:0008354) |
| 0.3 | 3.8 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.3 | 1.4 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.3 | 4.3 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.3 | 2.3 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.3 | 3.9 | GO:0071316 | cellular response to nicotine(GO:0071316) |
| 0.3 | 1.1 | GO:0035853 | chromosome passenger complex localization to spindle midzone(GO:0035853) |
| 0.3 | 0.3 | GO:0032425 | regulation of mismatch repair(GO:0032423) positive regulation of mismatch repair(GO:0032425) |
| 0.3 | 1.9 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.3 | 1.6 | GO:0098704 | fructose import(GO:0032445) carbohydrate import into cell(GO:0097319) carbohydrate import across plasma membrane(GO:0098704) fructose import across plasma membrane(GO:1990539) |
| 0.3 | 3.5 | GO:0072564 | response to linoleic acid(GO:0070543) blood microparticle formation(GO:0072564) regulation of blood microparticle formation(GO:2000332) positive regulation of blood microparticle formation(GO:2000334) |
| 0.3 | 0.8 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.3 | 2.7 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.3 | 0.8 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.3 | 1.1 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.3 | 0.8 | GO:0070079 | peptidyl-lysine hydroxylation to 5-hydroxy-L-lysine(GO:0018395) histone arginine demethylation(GO:0070077) histone H3-R2 demethylation(GO:0070078) histone H4-R3 demethylation(GO:0070079) |
| 0.3 | 0.8 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.3 | 0.5 | GO:1904616 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.3 | 5.7 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.3 | 1.0 | GO:0033591 | response to L-ascorbic acid(GO:0033591) |
| 0.3 | 7.2 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.2 | 6.9 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.2 | 0.5 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
| 0.2 | 1.0 | GO:0098957 | anterograde axonal transport of mitochondrion(GO:0098957) |
| 0.2 | 1.5 | GO:1902723 | negative regulation of skeletal muscle cell proliferation(GO:0014859) negative regulation of skeletal muscle satellite cell proliferation(GO:1902723) |
| 0.2 | 0.5 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.2 | 7.2 | GO:0070296 | sarcoplasmic reticulum calcium ion transport(GO:0070296) |
| 0.2 | 1.4 | GO:0006127 | glycerophosphate shuttle(GO:0006127) |
| 0.2 | 2.5 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.2 | 1.1 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.2 | 3.4 | GO:0071313 | cellular response to caffeine(GO:0071313) |
| 0.2 | 14.3 | GO:0030239 | myofibril assembly(GO:0030239) |
| 0.2 | 0.7 | GO:0043449 | olfactory learning(GO:0008355) cellular alkene metabolic process(GO:0043449) |
| 0.2 | 2.2 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.2 | 1.5 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.2 | 8.1 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.2 | 2.1 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.2 | 0.6 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.2 | 0.6 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.2 | 2.9 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.2 | 2.7 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.2 | 2.3 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.2 | 2.9 | GO:2000680 | rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.2 | 1.0 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.2 | 1.2 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.2 | 1.9 | GO:1904261 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.2 | 0.6 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.2 | 3.2 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.2 | 2.2 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.2 | 7.8 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.2 | 0.6 | GO:0015938 | coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.2 | 0.7 | GO:2000639 | regulation of SREBP signaling pathway(GO:2000638) negative regulation of SREBP signaling pathway(GO:2000639) |
| 0.2 | 2.2 | GO:0046959 | habituation(GO:0046959) |
| 0.2 | 1.6 | GO:0090063 | regulation of microtubule nucleation(GO:0010968) positive regulation of microtubule nucleation(GO:0090063) |
| 0.2 | 0.5 | GO:1901143 | insulin catabolic process(GO:1901143) |
| 0.2 | 4.3 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.2 | 0.9 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.2 | 4.6 | GO:1901687 | glutathione derivative metabolic process(GO:1901685) glutathione derivative biosynthetic process(GO:1901687) |
| 0.2 | 2.5 | GO:1905024 | regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) regulation of potassium ion export across plasma membrane(GO:1903764) regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905024) |
| 0.2 | 0.5 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.2 | 0.5 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.2 | 1.0 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.2 | 0.8 | GO:0035801 | adrenal cortex development(GO:0035801) adrenal cortex formation(GO:0035802) |
| 0.2 | 0.8 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.2 | 3.3 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.2 | 5.7 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.2 | 1.2 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 0.2 | 0.2 | GO:1990927 | calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.2 | 2.1 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.2 | 1.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.2 | 2.1 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.1 | 6.9 | GO:0031111 | negative regulation of microtubule polymerization or depolymerization(GO:0031111) |
| 0.1 | 0.7 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.1 | 0.7 | GO:0038098 | sequestering of BMP from receptor via BMP binding(GO:0038098) |
| 0.1 | 0.7 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.1 | 2.3 | GO:0046716 | muscle cell cellular homeostasis(GO:0046716) |
| 0.1 | 0.9 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.1 | 2.7 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
| 0.1 | 1.9 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.7 | GO:1902228 | mammary gland fat development(GO:0060611) positive regulation of macrophage colony-stimulating factor signaling pathway(GO:1902228) positive regulation of response to macrophage colony-stimulating factor(GO:1903971) positive regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903974) positive regulation of microglial cell migration(GO:1904141) |
| 0.1 | 1.0 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.1 | 1.5 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.1 | 6.2 | GO:0005980 | glycogen catabolic process(GO:0005980) |
| 0.1 | 0.5 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.1 | 1.8 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.1 | 1.0 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.1 | 0.6 | GO:0018352 | protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.1 | 1.0 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
| 0.1 | 1.7 | GO:0060992 | response to fungicide(GO:0060992) |
| 0.1 | 0.8 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
| 0.1 | 1.1 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.1 | 0.5 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.1 | 0.4 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
| 0.1 | 0.5 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.1 | 9.1 | GO:0030318 | melanocyte differentiation(GO:0030318) |
| 0.1 | 1.7 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.1 | 2.3 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.1 | 3.1 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.1 | 1.1 | GO:1901098 | positive regulation of autophagosome maturation(GO:1901098) |
| 0.1 | 0.6 | GO:0006233 | dUDP biosynthetic process(GO:0006227) dTDP biosynthetic process(GO:0006233) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dTDP metabolic process(GO:0046072) dUDP metabolic process(GO:0046077) |
| 0.1 | 0.6 | GO:0035803 | egg coat formation(GO:0035803) |
| 0.1 | 0.2 | GO:0021622 | oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
| 0.1 | 1.0 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 3.1 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 | 1.0 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
| 0.1 | 0.4 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
| 0.1 | 0.3 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.1 | 0.6 | GO:0070370 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.1 | 1.2 | GO:0001766 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.1 | 2.0 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.1 | 3.1 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.1 | 1.2 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.1 | 0.3 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 1.8 | GO:0021702 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.1 | 0.6 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 | 9.8 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.3 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.1 | 1.4 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.1 | 9.2 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.1 | 0.6 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.1 | 6.6 | GO:0045103 | intermediate filament-based process(GO:0045103) |
| 0.1 | 0.4 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.1 | 4.8 | GO:0032292 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
| 0.1 | 3.0 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.1 | 0.6 | GO:0072752 | cellular response to rapamycin(GO:0072752) |
| 0.1 | 0.5 | GO:0090076 | relaxation of skeletal muscle(GO:0090076) |
| 0.1 | 0.6 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.1 | 3.9 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.1 | 0.3 | GO:0036049 | protein demalonylation(GO:0036046) peptidyl-lysine demalonylation(GO:0036047) protein desuccinylation(GO:0036048) peptidyl-lysine desuccinylation(GO:0036049) protein deglutarylation(GO:0061698) peptidyl-lysine deglutarylation(GO:0061699) |
| 0.1 | 1.3 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.1 | 0.9 | GO:0097491 | sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
| 0.1 | 0.8 | GO:0010649 | regulation of cell communication by electrical coupling(GO:0010649) |
| 0.1 | 1.4 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.1 | 1.2 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 0.1 | 5.0 | GO:0021955 | central nervous system neuron axonogenesis(GO:0021955) |
| 0.1 | 0.9 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.1 | 2.9 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.1 | 0.5 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
| 0.1 | 0.3 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
| 0.1 | 0.7 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.1 | 1.1 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.1 | 1.8 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.1 | 1.6 | GO:0002138 | retinoic acid biosynthetic process(GO:0002138) |
| 0.1 | 0.7 | GO:1904936 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.1 | 0.4 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) positive regulation of cellular pH reduction(GO:0032849) |
| 0.1 | 16.8 | GO:0031424 | keratinization(GO:0031424) |
| 0.1 | 0.3 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 | 0.3 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.1 | 1.9 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.1 | 1.0 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.1 | 1.0 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 | 1.4 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
| 0.1 | 3.8 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.1 | 0.9 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.1 | 1.7 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 | 0.5 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.1 | 0.7 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.1 | 2.0 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
| 0.1 | 0.4 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) |
| 0.1 | 0.4 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.1 | 0.2 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.1 | 0.9 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) neural plate regionalization(GO:0060897) |
| 0.1 | 3.9 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 | 0.7 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.1 | 1.0 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.1 | 0.6 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.1 | 0.3 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 1.0 | GO:0010644 | cell communication by electrical coupling(GO:0010644) |
| 0.1 | 1.2 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
| 0.1 | 0.9 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
| 0.1 | 1.2 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 | 3.6 | GO:0030199 | collagen fibril organization(GO:0030199) |
| 0.1 | 1.3 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.1 | 1.1 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.1 | 1.7 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
| 0.1 | 0.4 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
| 0.1 | 4.0 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
| 0.1 | 0.5 | GO:0072663 | protein targeting to peroxisome(GO:0006625) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.1 | 2.6 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.1 | 1.0 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 0.5 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 1.9 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.1 | 0.3 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.1 | 0.9 | GO:0015747 | urate transport(GO:0015747) |
| 0.1 | 1.9 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.1 | 0.5 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.1 | 1.4 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.1 | 1.5 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.1 | 0.2 | GO:1903679 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 | 1.0 | GO:0015074 | DNA integration(GO:0015074) |
| 0.1 | 1.1 | GO:0035729 | cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.1 | 0.6 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.1 | 0.7 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 2.3 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 | 0.3 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.1 | 0.9 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.1 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) organ senescence(GO:0010260) |
| 0.1 | 0.7 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 | 0.6 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.1 | 0.6 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.1 | 0.5 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) |
| 0.1 | 0.9 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.1 | 1.0 | GO:0007172 | signal complex assembly(GO:0007172) |
| 0.1 | 0.5 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 | 0.8 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.1 | 2.5 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.0 | 0.3 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.0 | 0.3 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.0 | 1.0 | GO:0040018 | positive regulation of multicellular organism growth(GO:0040018) |
| 0.0 | 0.4 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.0 | 1.2 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 | 0.3 | GO:0043584 | nose development(GO:0043584) |
| 0.0 | 0.4 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.0 | 3.1 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.0 | 3.5 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 1.9 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.0 | 0.5 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.0 | 0.1 | GO:0010159 | specification of organ position(GO:0010159) |
| 0.0 | 0.8 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 0.9 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 2.7 | GO:0032091 | negative regulation of protein binding(GO:0032091) |
| 0.0 | 0.3 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.0 | 2.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 0.8 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 0.9 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.3 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 4.6 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.0 | 1.3 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.0 | 0.4 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.0 | 1.0 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.0 | 0.6 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 1.4 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.0 | 1.3 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.0 | 0.4 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.8 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.0 | 0.4 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 | 3.2 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| 0.0 | 0.5 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.4 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.0 | 0.2 | GO:0009624 | response to nematode(GO:0009624) |
| 0.0 | 0.8 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 1.1 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.0 | 2.1 | GO:0051703 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.0 | 1.2 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
| 0.0 | 0.1 | GO:1903521 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.0 | 0.3 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.0 | 0.4 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.0 | 2.6 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.0 | 9.8 | GO:0006936 | muscle contraction(GO:0006936) |
| 0.0 | 0.2 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.0 | 1.4 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.7 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.0 | 2.0 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
| 0.0 | 2.4 | GO:1901379 | regulation of potassium ion transmembrane transport(GO:1901379) |
| 0.0 | 0.2 | GO:0001315 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.0 | 0.2 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.0 | 1.0 | GO:1904776 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.0 | 0.7 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.0 | 1.4 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.0 | 5.2 | GO:0030509 | BMP signaling pathway(GO:0030509) |
| 0.0 | 0.5 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.0 | 0.5 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 1.1 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.0 | 0.9 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.0 | 1.4 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 0.1 | GO:0097106 | retrograde axonal transport(GO:0008090) postsynaptic density organization(GO:0097106) |
| 0.0 | 0.3 | GO:0007530 | sex determination(GO:0007530) |
| 0.0 | 0.4 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.0 | 1.2 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.0 | 0.2 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 | 0.6 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
| 0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 0.5 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 | 0.5 | GO:0097369 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.5 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 | 0.9 | GO:0060074 | synapse maturation(GO:0060074) |
| 0.0 | 0.5 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.0 | 0.9 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
| 0.0 | 0.3 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.2 | GO:2000768 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.0 | 2.3 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.0 | 0.6 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
| 0.0 | 0.2 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.0 | 0.2 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.0 | 0.5 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
| 0.0 | 0.3 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.0 | 0.5 | GO:0010765 | positive regulation of sodium ion transport(GO:0010765) |
| 0.0 | 1.6 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
| 0.0 | 0.1 | GO:0018874 | benzoate metabolic process(GO:0018874) |
| 0.0 | 2.8 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
| 0.0 | 1.3 | GO:0043271 | negative regulation of ion transport(GO:0043271) |
| 0.0 | 0.1 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.0 | 2.3 | GO:0030330 | DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
| 0.0 | 0.2 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.0 | 0.2 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.0 | 0.6 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.0 | 0.6 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 | 0.5 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 1.0 | GO:1903959 | regulation of anion transmembrane transport(GO:1903959) |
| 0.0 | 0.8 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
| 0.0 | 1.4 | GO:0006378 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
| 0.0 | 0.7 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.0 | 0.9 | GO:0014003 | oligodendrocyte development(GO:0014003) |
| 0.0 | 1.1 | GO:0000288 | nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:0000288) |
| 0.0 | 5.3 | GO:0007050 | cell cycle arrest(GO:0007050) |
| 0.0 | 0.1 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
| 0.0 | 2.3 | GO:0007368 | determination of left/right symmetry(GO:0007368) |
| 0.0 | 0.1 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
| 0.0 | 0.7 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.0 | 0.5 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.0 | 0.6 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.0 | 2.6 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.0 | 0.3 | GO:0032802 | low-density lipoprotein particle receptor catabolic process(GO:0032802) |
| 0.0 | 1.1 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.0 | 0.4 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.0 | 1.4 | GO:0065002 | intracellular protein transmembrane transport(GO:0065002) |
| 0.0 | 1.1 | GO:0097192 | signal transduction in absence of ligand(GO:0038034) extrinsic apoptotic signaling pathway in absence of ligand(GO:0097192) |
| 0.0 | 1.3 | GO:0008306 | associative learning(GO:0008306) |
| 0.0 | 2.7 | GO:0008277 | regulation of G-protein coupled receptor protein signaling pathway(GO:0008277) |
| 0.0 | 0.5 | GO:0051588 | regulation of neurotransmitter transport(GO:0051588) |
| 0.0 | 0.7 | GO:0006626 | protein targeting to mitochondrion(GO:0006626) |
| 0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.2 | GO:0061088 | regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 | 0.4 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
| 0.0 | 0.1 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.0 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.0 | 0.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.3 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 0.0 | 3.1 | GO:0006986 | response to unfolded protein(GO:0006986) |
| 0.0 | 0.8 | GO:0043001 | Golgi to plasma membrane protein transport(GO:0043001) |
| 0.0 | 0.5 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.0 | 2.2 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.0 | 1.5 | GO:0060071 | Wnt signaling pathway, planar cell polarity pathway(GO:0060071) regulation of establishment of planar polarity(GO:0090175) |
| 0.0 | 8.0 | GO:0043687 | post-translational protein modification(GO:0043687) |
| 0.0 | 0.2 | GO:2000828 | post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.0 | 0.1 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.0 | 0.5 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.5 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.0 | 0.2 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.1 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.0 | 0.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.0 | 0.1 | GO:0042182 | ketone catabolic process(GO:0042182) |
| 0.0 | 0.1 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
| 0.0 | 0.5 | GO:0002548 | monocyte chemotaxis(GO:0002548) |
| 0.0 | 0.1 | GO:0032485 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.8 | GO:0033138 | positive regulation of peptidyl-serine phosphorylation(GO:0033138) |
| 0.0 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 | 0.2 | GO:0090266 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.0 | 0.4 | GO:0010761 | fibroblast migration(GO:0010761) |
| 0.0 | 0.4 | GO:0014047 | glutamate secretion(GO:0014047) |
| 0.0 | 0.1 | GO:0060356 | leucine import(GO:0060356) |
| 0.0 | 0.1 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 3.0 | GO:0000398 | RNA splicing, via transesterification reactions with bulged adenosine as nucleophile(GO:0000377) mRNA splicing, via spliceosome(GO:0000398) |
| 0.0 | 0.1 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.2 | 15.1 | GO:1990393 | 3M complex(GO:1990393) |
| 1.6 | 26.6 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 1.5 | 24.7 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 1.4 | 2.8 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 1.4 | 39.0 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 1.3 | 3.9 | GO:0043512 | inhibin complex(GO:0043511) inhibin A complex(GO:0043512) |
| 1.2 | 11.8 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 1.1 | 15.0 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.8 | 1.7 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.7 | 2.1 | GO:0071665 | gamma-catenin-TCF7L2 complex(GO:0071665) |
| 0.7 | 3.5 | GO:0005595 | collagen type XII trimer(GO:0005595) |
| 0.7 | 3.3 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.6 | 5.6 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.6 | 3.1 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.6 | 37.8 | GO:0031430 | M band(GO:0031430) |
| 0.5 | 6.4 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.5 | 6.9 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.5 | 2.6 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.5 | 2.0 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
| 0.5 | 13.9 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.5 | 12.3 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.5 | 1.4 | GO:0005914 | spot adherens junction(GO:0005914) |
| 0.5 | 2.8 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.5 | 10.2 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.5 | 1.4 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
| 0.4 | 3.4 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.4 | 1.3 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 0.4 | 4.6 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.4 | 13.9 | GO:0031672 | A band(GO:0031672) |
| 0.4 | 2.7 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.4 | 1.8 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.4 | 3.9 | GO:0016011 | dystroglycan complex(GO:0016011) |
| 0.3 | 4.0 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.3 | 87.6 | GO:0030017 | sarcomere(GO:0030017) |
| 0.3 | 6.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.3 | 2.7 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.3 | 2.9 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.3 | 9.7 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.3 | 1.6 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.2 | 7.9 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.2 | 20.9 | GO:0045095 | keratin filament(GO:0045095) |
| 0.2 | 8.7 | GO:0030057 | desmosome(GO:0030057) |
| 0.2 | 1.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.2 | 1.3 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.2 | 4.5 | GO:0099634 | postsynaptic specialization membrane(GO:0099634) |
| 0.2 | 1.3 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.2 | 1.7 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.2 | 0.8 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.2 | 2.0 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.2 | 8.9 | GO:0005605 | basal lamina(GO:0005605) |
| 0.2 | 0.8 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.2 | 2.8 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.2 | 2.9 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.2 | 2.7 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.2 | 0.9 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.2 | 1.4 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.2 | 2.7 | GO:0008091 | spectrin(GO:0008091) |
| 0.2 | 6.2 | GO:0043218 | compact myelin(GO:0043218) |
| 0.2 | 2.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.2 | 1.0 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.2 | 2.2 | GO:0030016 | myofibril(GO:0030016) |
| 0.2 | 4.2 | GO:0043034 | costamere(GO:0043034) |
| 0.2 | 9.0 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.2 | 4.9 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.2 | 0.9 | GO:0002081 | inner acrosomal membrane(GO:0002079) outer acrosomal membrane(GO:0002081) |
| 0.1 | 1.2 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 0.7 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 1.6 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.1 | 16.1 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.1 | 0.8 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.1 | 4.7 | GO:0030904 | retromer complex(GO:0030904) |
| 0.1 | 1.8 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.1 | 1.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.1 | 11.7 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.1 | 1.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 3.3 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.1 | 1.5 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.1 | 4.3 | GO:0034704 | calcium channel complex(GO:0034704) |
| 0.1 | 1.1 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 2.1 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.6 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.1 | 1.5 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.1 | 0.7 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.1 | 0.4 | GO:0070993 | translation preinitiation complex(GO:0070993) |
| 0.1 | 3.3 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.1 | 0.7 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.1 | 1.8 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.1 | 0.3 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.1 | 0.5 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.1 | 0.3 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.1 | 2.1 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.1 | 1.0 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 7.7 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.1 | 1.2 | GO:0033643 | host cell part(GO:0033643) |
| 0.1 | 9.7 | GO:0005901 | caveola(GO:0005901) |
| 0.1 | 3.6 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.1 | 0.6 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.1 | 2.3 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.1 | 0.5 | GO:0031417 | NatC complex(GO:0031417) |
| 0.1 | 3.3 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.1 | 0.9 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 13.5 | GO:0043204 | perikaryon(GO:0043204) |
| 0.1 | 1.1 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 5.4 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.1 | 0.8 | GO:0042587 | glycogen granule(GO:0042587) PTW/PP1 phosphatase complex(GO:0072357) |
| 0.1 | 1.8 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.1 | 1.0 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.1 | 0.9 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 1.0 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.1 | 3.2 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.1 | 3.1 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.1 | 1.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.1 | 2.3 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 6.5 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 6.9 | GO:0005884 | actin filament(GO:0005884) |
| 0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 1.6 | GO:0098827 | endoplasmic reticulum tubular network(GO:0071782) endoplasmic reticulum subcompartment(GO:0098827) |
| 0.0 | 4.8 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.0 | 0.9 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.0 | 0.1 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.0 | 0.7 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.0 | 2.1 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.0 | 0.9 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 1.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.3 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.0 | 0.5 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 8.7 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 1.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 0.6 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 0.3 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.2 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.0 | 0.6 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 1.4 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.2 | GO:0045293 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.0 | 0.2 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.2 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 6.1 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 2.2 | GO:0034358 | plasma lipoprotein particle(GO:0034358) lipoprotein particle(GO:1990777) |
| 0.0 | 0.6 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 3.8 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 3.2 | GO:0005882 | intermediate filament(GO:0005882) |
| 0.0 | 0.9 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 1.1 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.0 | 0.4 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 1.9 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 2.3 | GO:0036126 | sperm flagellum(GO:0036126) |
| 0.0 | 5.8 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.5 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 2.2 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.5 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 4.1 | GO:0022626 | cytosolic ribosome(GO:0022626) |
| 0.0 | 0.5 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 2.6 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 1.6 | GO:0042383 | sarcolemma(GO:0042383) |
| 0.0 | 0.5 | GO:0097546 | ciliary base(GO:0097546) |
| 0.0 | 1.0 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 5.2 | GO:0014069 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
| 0.0 | 1.7 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 1.3 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.0 | 0.2 | GO:0005845 | mRNA cap binding complex(GO:0005845) |
| 0.0 | 1.1 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 2.6 | GO:0030426 | growth cone(GO:0030426) |
| 0.0 | 0.1 | GO:0005846 | nuclear cap binding complex(GO:0005846) |
| 0.0 | 1.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 1.4 | GO:0044306 | neuron projection terminus(GO:0044306) |
| 0.0 | 7.3 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.2 | GO:0097433 | dense body(GO:0097433) |
| 0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 1.8 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.0 | 0.3 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 4.8 | GO:0044297 | cell body(GO:0044297) |
| 0.0 | 0.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.5 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.3 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 1.7 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 2.9 | GO:0005770 | late endosome(GO:0005770) |
| 0.0 | 0.4 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 1.1 | GO:0005875 | microtubule associated complex(GO:0005875) |
| 0.0 | 0.3 | GO:0036019 | endolysosome(GO:0036019) endolysosome membrane(GO:0036020) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.9 | 23.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 1.7 | 8.6 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 1.7 | 8.4 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 1.4 | 4.2 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 1.4 | 19.5 | GO:0031014 | troponin T binding(GO:0031014) |
| 1.3 | 5.3 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 1.1 | 3.2 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 1.0 | 6.0 | GO:0051373 | FATZ binding(GO:0051373) |
| 1.0 | 6.0 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 1.0 | 5.9 | GO:0032038 | myosin II heavy chain binding(GO:0032038) |
| 1.0 | 3.8 | GO:0061769 | ribosylnicotinamide kinase activity(GO:0050262) ribosylnicotinate kinase activity(GO:0061769) |
| 0.9 | 3.8 | GO:0005292 | high-affinity basic amino acid transmembrane transporter activity(GO:0005287) high-affinity arginine transmembrane transporter activity(GO:0005289) high-affinity lysine transmembrane transporter activity(GO:0005292) |
| 0.9 | 4.3 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.8 | 18.3 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.8 | 7.9 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.8 | 110.1 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.8 | 5.3 | GO:0004504 | peptidylglycine monooxygenase activity(GO:0004504) peptidylamidoglycolate lyase activity(GO:0004598) |
| 0.7 | 2.9 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) |
| 0.7 | 2.1 | GO:0005199 | structural constituent of cell wall(GO:0005199) |
| 0.7 | 3.4 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.6 | 3.0 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.6 | 3.5 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.6 | 5.1 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.5 | 3.8 | GO:0004471 | malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.5 | 5.3 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
| 0.5 | 2.1 | GO:0030395 | lactose binding(GO:0030395) |
| 0.5 | 2.5 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.5 | 5.0 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.5 | 3.4 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.5 | 4.4 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.5 | 4.3 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.5 | 0.9 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.4 | 1.3 | GO:0038100 | nodal binding(GO:0038100) |
| 0.4 | 2.2 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.4 | 1.8 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.4 | 8.8 | GO:0043295 | glutathione binding(GO:0043295) |
| 0.4 | 10.1 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.4 | 3.4 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.4 | 10.3 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.4 | 7.3 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.4 | 3.3 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.4 | 2.8 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.4 | 7.4 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.4 | 3.8 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.4 | 1.5 | GO:0016880 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.4 | 12.1 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.4 | 3.4 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.4 | 1.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.4 | 6.2 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.4 | 2.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.4 | 3.3 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.4 | 1.8 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.3 | 1.3 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.3 | 2.3 | GO:0086083 | cell adhesive protein binding involved in bundle of His cell-Purkinje myocyte communication(GO:0086083) |
| 0.3 | 3.2 | GO:0089720 | caspase binding(GO:0089720) |
| 0.3 | 1.2 | GO:0047708 | biotinidase activity(GO:0047708) |
| 0.3 | 5.5 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.3 | 3.7 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.3 | 0.9 | GO:0033265 | choline binding(GO:0033265) |
| 0.3 | 1.2 | GO:0060001 | minus-end directed microfilament motor activity(GO:0060001) |
| 0.3 | 0.9 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
| 0.3 | 3.5 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
| 0.3 | 1.8 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.3 | 1.2 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.3 | 1.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.3 | 0.8 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.3 | 3.1 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.3 | 1.6 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
| 0.3 | 1.4 | GO:0090079 | translation activator activity(GO:0008494) translation regulator activity, nucleic acid binding(GO:0090079) |
| 0.3 | 2.7 | GO:0031432 | titin binding(GO:0031432) |
| 0.3 | 0.8 | GO:0033749 | histone demethylase activity (H3-R2 specific)(GO:0033746) histone demethylase activity (H4-R3 specific)(GO:0033749) |
| 0.2 | 1.2 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.2 | 0.7 | GO:0033842 | N-acetyl-beta-glucosaminyl-glycoprotein 4-beta-N-acetylgalactosaminyltransferase activity(GO:0033842) |
| 0.2 | 2.7 | GO:0071253 | connexin binding(GO:0071253) |
| 0.2 | 1.4 | GO:0004368 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.2 | 6.2 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
| 0.2 | 10.2 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.2 | 9.1 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.2 | 2.3 | GO:0045159 | myosin II binding(GO:0045159) |
| 0.2 | 1.2 | GO:0051748 | UTP:glucose-1-phosphate uridylyltransferase activity(GO:0003983) UTP-monosaccharide-1-phosphate uridylyltransferase activity(GO:0051748) |
| 0.2 | 3.3 | GO:0030020 | extracellular matrix structural constituent conferring tensile strength(GO:0030020) |
| 0.2 | 0.6 | GO:0033862 | UMP kinase activity(GO:0033862) |
| 0.2 | 0.8 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.2 | 1.1 | GO:0070004 | cysteine-type carboxypeptidase activity(GO:0016807) cysteine-type exopeptidase activity(GO:0070004) |
| 0.2 | 3.8 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.2 | 3.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.2 | 2.3 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.2 | 2.4 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.2 | 4.4 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.2 | 2.9 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.2 | 1.8 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.2 | 1.8 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.2 | 0.5 | GO:0031626 | beta-endorphin binding(GO:0031626) |
| 0.2 | 2.3 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.2 | 0.9 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.2 | 0.9 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.2 | 1.4 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.2 | 0.9 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.2 | 1.4 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.2 | 0.5 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.2 | 0.9 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
| 0.2 | 0.8 | GO:0045182 | translation regulator activity(GO:0045182) |
| 0.2 | 1.0 | GO:1903763 | gap junction channel activity involved in cell communication by electrical coupling(GO:1903763) |
| 0.2 | 1.4 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.2 | 35.3 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.2 | 1.7 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.2 | 4.9 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.2 | 3.9 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.2 | 1.5 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.2 | 3.1 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.2 | 6.9 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.2 | 0.8 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 0.2 | 0.5 | GO:0070984 | SET domain binding(GO:0070984) |
| 0.2 | 4.6 | GO:0043495 | protein anchor(GO:0043495) |
| 0.2 | 1.9 | GO:0015248 | sterol transporter activity(GO:0015248) |
| 0.2 | 2.4 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.2 | 6.1 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.2 | 0.8 | GO:0050115 | myosin phosphatase activity(GO:0017018) myosin-light-chain-phosphatase activity(GO:0050115) |
| 0.1 | 0.7 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.1 | 3.9 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.1 | 1.9 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.1 | 5.0 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.1 | 1.6 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.1 | 1.4 | GO:0031811 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 0.1 | 3.9 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.1 | 7.6 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.1 | 3.3 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.1 | 1.3 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.1 | 2.8 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.1 | 0.5 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.1 | 2.5 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.1 | 0.8 | GO:0030197 | extracellular matrix constituent, lubricant activity(GO:0030197) |
| 0.1 | 0.6 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.1 | 1.0 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.1 | 0.4 | GO:0099530 | G-protein coupled receptor activity involved in regulation of postsynaptic membrane potential(GO:0099530) |
| 0.1 | 0.5 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.1 | 3.8 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.1 | 5.2 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.1 | 0.3 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 0.1 | 1.5 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 1.7 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.1 | 1.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.1 | 2.0 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 0.5 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
| 0.1 | 1.4 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.1 | 0.7 | GO:0099529 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.1 | 1.4 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 2.7 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.1 | 8.1 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.1 | 3.4 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.1 | 2.3 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.1 | 4.2 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.1 | 0.4 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
| 0.1 | 0.3 | GO:0036055 | protein-malonyllysine demalonylase activity(GO:0036054) protein-succinyllysine desuccinylase activity(GO:0036055) protein-glutaryllysine deglutarylase activity(GO:0061697) |
| 0.1 | 3.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.1 | 2.0 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.1 | 5.6 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.1 | 1.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.1 | 0.8 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.1 | 0.2 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.1 | 1.8 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
| 0.1 | 1.3 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.1 | 0.6 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.1 | 0.2 | GO:0004515 | nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.1 | 2.3 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.1 | 0.9 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.1 | 0.8 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 1.2 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.1 | 2.5 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.1 | 0.4 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.1 | 1.0 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 0.7 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.1 | 1.5 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 0.2 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.1 | 0.9 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.1 | 3.4 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.1 | 3.5 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.1 | 0.2 | GO:0005046 | KDEL sequence binding(GO:0005046) |
| 0.1 | 0.6 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.1 | 0.3 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
| 0.1 | 0.8 | GO:0034618 | arginine binding(GO:0034618) |
| 0.1 | 1.0 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.1 | 0.5 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.1 | 0.9 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.1 | 0.5 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 1.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.1 | 1.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 1.4 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.1 | 0.8 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.1 | 1.3 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.1 | 0.2 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.1 | 13.1 | GO:0044325 | ion channel binding(GO:0044325) |
| 0.1 | 0.5 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.1 | 3.2 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.1 | 3.6 | GO:0017022 | myosin binding(GO:0017022) |
| 0.1 | 1.5 | GO:0016918 | retinal binding(GO:0016918) |
| 0.1 | 0.7 | GO:0036122 | BMP binding(GO:0036122) |
| 0.1 | 0.2 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
| 0.1 | 1.3 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.1 | 0.9 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.1 | 2.3 | GO:0051018 | protein kinase A binding(GO:0051018) |
| 0.1 | 0.6 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 19.4 | GO:0003729 | mRNA binding(GO:0003729) poly(A) RNA binding(GO:0044822) |
| 0.1 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 2.8 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.1 | 2.0 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 0.6 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.1 | 0.3 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.1 | 4.1 | GO:0019003 | GDP binding(GO:0019003) |
| 0.1 | 2.6 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 3.0 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 0.8 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.0 | 0.1 | GO:0008434 | calcitriol receptor activity(GO:0008434) lithocholic acid receptor activity(GO:0038186) calcitriol binding(GO:1902098) lithocholic acid binding(GO:1902121) |
| 0.0 | 33.1 | GO:0003779 | actin binding(GO:0003779) |
| 0.0 | 1.0 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 1.3 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 2.4 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 2.1 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 0.3 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 9.8 | GO:0005516 | calmodulin binding(GO:0005516) |
| 0.0 | 0.3 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
| 0.0 | 0.4 | GO:0098988 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.0 | 0.9 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 1.6 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.0 | 1.0 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 0.3 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.5 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.0 | 0.5 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.0 | 0.5 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
| 0.0 | 0.4 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.0 | 2.9 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.3 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.0 | 1.6 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 1.1 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 1.2 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 0.2 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.0 | 1.7 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
| 0.0 | 0.5 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 1.5 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.5 | GO:0008160 | protein tyrosine phosphatase activator activity(GO:0008160) |
| 0.0 | 1.2 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.7 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.7 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 1.3 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
| 0.0 | 0.6 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.3 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.0 | 0.5 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 0.7 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.0 | 0.3 | GO:0016595 | glutamate binding(GO:0016595) |
| 0.0 | 0.5 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 0.4 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.4 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.4 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.2 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.0 | 0.1 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 1.4 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.0 | 0.4 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.0 | 2.7 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 1.1 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.3 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.5 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 2.9 | GO:0019888 | protein phosphatase regulator activity(GO:0019888) |
| 0.0 | 0.4 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.8 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.0 | 0.6 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 4.3 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.0 | 0.2 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.2 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.0 | 4.5 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.1 | GO:0030305 | heparanase activity(GO:0030305) |
| 0.0 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.0 | 0.2 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.2 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 0.5 | GO:0016875 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
| 0.0 | 0.6 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.2 | GO:0015186 | L-cystine transmembrane transporter activity(GO:0015184) L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.0 | 0.4 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
| 0.0 | 0.7 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.0 | 0.6 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.0 | 0.6 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.0 | 1.8 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.6 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 0.2 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
| 0.0 | 0.3 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.0 | 0.2 | GO:0030548 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 10.7 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
| 0.0 | 0.3 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 1.5 | GO:0005254 | chloride channel activity(GO:0005254) |
| 0.0 | 0.5 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.2 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.6 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
| 0.0 | 0.7 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.1 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.0 | 0.9 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.0 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.0 | 0.7 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.0 | 0.2 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 0.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 9.3 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.3 | 3.7 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.3 | 3.9 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.2 | 2.1 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.2 | 5.8 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.2 | 16.1 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.2 | 5.9 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.2 | 4.4 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.2 | 12.1 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 1.8 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.1 | 7.6 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.1 | 5.2 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 7.0 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 19.0 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.1 | 4.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.1 | 4.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 3.9 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.1 | 2.7 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.1 | 12.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 3.1 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 2.7 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 11.1 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.1 | 2.0 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 4.6 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.1 | 23.4 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.1 | 1.2 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.1 | 1.3 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.1 | 1.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 2.1 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.1 | 2.5 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 1.8 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 2.5 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 1.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 4.2 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.7 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.7 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 2.8 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 1.6 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 2.1 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.5 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 1.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 1.3 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 2.3 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.5 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.0 | 1.6 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 0.7 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.5 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.6 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.6 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.3 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.5 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 69.0 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.4 | 26.2 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.3 | 9.8 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.3 | 13.8 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.2 | 4.9 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.2 | 3.8 | REACTOME REVERSIBLE HYDRATION OF CARBON DIOXIDE | Genes involved in Reversible Hydration of Carbon Dioxide |
| 0.2 | 8.8 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.2 | 8.0 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.2 | 5.4 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.2 | 2.5 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.2 | 5.9 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
| 0.1 | 4.6 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 4.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.1 | 4.3 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.1 | 2.3 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.1 | 1.8 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 4.9 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 5.6 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.1 | 4.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.1 | 1.5 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.1 | 4.4 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 1.3 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 2.5 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.1 | 2.8 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 0.2 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
| 0.1 | 3.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 0.6 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 4.2 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.1 | 1.5 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.1 | 3.1 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.1 | 6.1 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.1 | 4.0 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.1 | 9.1 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 2.2 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.1 | 1.2 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 2.7 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.1 | 0.9 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.1 | 2.1 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.1 | 1.6 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 0.8 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 1.6 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.1 | 1.4 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.1 | 0.9 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.1 | 0.7 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.1 | 2.9 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
| 0.0 | 0.8 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.9 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 1.0 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 2.3 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 3.9 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 1.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 5.0 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 9.7 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.9 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 2.3 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 5.0 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 0.7 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.0 | 1.3 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 2.5 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 1.4 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.6 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.9 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 1.0 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
| 0.0 | 3.8 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.0 | 0.8 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 8.9 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 2.0 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.8 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.0 | 1.2 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 3.4 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.0 | 2.6 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.7 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.0 | 1.4 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.5 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.6 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.9 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.7 | REACTOME DEFENSINS | Genes involved in Defensins |
| 0.0 | 1.1 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.3 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.9 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.5 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 0.2 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |