Project
avrg: Illumina Body Map 2 (GSE30611)
Navigation
Downloads
Results for MXI1_MYC_MYCN
Z-value: 3.69
Motif logo
Transcription factors associated with MXI1_MYC_MYCN
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
MXI1
|
ENSG00000119950.21 | MXI1 |
|
MYC
|
ENSG00000136997.21 | MYC |
|
MYCN
|
ENSG00000134323.12 | MYCN |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| MXI1 | hg38_v1_chr10_+_110207587_110207684 | -0.59 | 4.0e-04 | Click! |
| MYC | hg38_v1_chr8_+_127735597_127735659 | 0.41 | 2.1e-02 | Click! |
| MYCN | hg38_v1_chr2_+_15940537_15940566 | -0.28 | 1.2e-01 | Click! |
Activity profile of MXI1_MYC_MYCN motif
Sorted Z-values of MXI1_MYC_MYCN motif
Network of associatons between targets according to the STRING database.
First level regulatory network of MXI1_MYC_MYCN
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.9 | 11.5 | GO:0061461 | lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 2.8 | 8.5 | GO:1904482 | response to tetrahydrofolate(GO:1904481) cellular response to tetrahydrofolate(GO:1904482) |
| 2.4 | 14.2 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
| 2.0 | 5.9 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 1.9 | 7.6 | GO:0072302 | negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) |
| 1.7 | 6.8 | GO:0018106 | peptidyl-histidine phosphorylation(GO:0018106) |
| 1.7 | 5.0 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
| 1.6 | 6.5 | GO:0033306 | phytol metabolic process(GO:0033306) fatty alcohol metabolic process(GO:1903173) |
| 1.5 | 1.5 | GO:0035802 | adrenal cortex development(GO:0035801) adrenal cortex formation(GO:0035802) |
| 1.5 | 6.0 | GO:0010902 | positive regulation of very-low-density lipoprotein particle remodeling(GO:0010902) |
| 1.5 | 8.8 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 1.4 | 4.2 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 1.4 | 5.4 | GO:0048627 | myoblast development(GO:0048627) |
| 1.3 | 4.0 | GO:0034970 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) histone H3-R2 methylation(GO:0034970) |
| 1.3 | 3.9 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 1.3 | 3.9 | GO:0009386 | translational attenuation(GO:0009386) |
| 1.3 | 7.8 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 1.2 | 1.2 | GO:0044381 | glucose import in response to insulin stimulus(GO:0044381) |
| 1.2 | 17.7 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
| 1.1 | 3.4 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 1.1 | 1.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 1.1 | 3.4 | GO:0007518 | myoblast fate determination(GO:0007518) |
| 1.1 | 3.3 | GO:0051695 | actin filament uncapping(GO:0051695) |
| 1.1 | 3.2 | GO:0071400 | cellular response to oleic acid(GO:0071400) |
| 1.0 | 10.3 | GO:1904637 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 1.0 | 4.0 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 1.0 | 4.0 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
| 1.0 | 4.8 | GO:0030961 | peptidyl-arginine hydroxylation(GO:0030961) |
| 0.9 | 6.3 | GO:0098706 | ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.9 | 2.7 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.9 | 2.6 | GO:1902490 | regulation of sperm capacitation(GO:1902490) |
| 0.9 | 0.9 | GO:0036466 | synaptic vesicle recycling via endosome(GO:0036466) |
| 0.9 | 3.4 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.9 | 2.6 | GO:0018012 | N-terminal peptidyl-alanine methylation(GO:0018011) N-terminal peptidyl-alanine trimethylation(GO:0018012) N-terminal peptidyl-glycine methylation(GO:0018013) N-terminal peptidyl-proline dimethylation(GO:0018016) peptidyl-alanine modification(GO:0018194) N-terminal peptidyl-proline methylation(GO:0035568) N-terminal peptidyl-serine methylation(GO:0035570) N-terminal peptidyl-serine dimethylation(GO:0035572) N-terminal peptidyl-serine trimethylation(GO:0035573) |
| 0.8 | 3.3 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.8 | 2.4 | GO:0046452 | dihydrofolate metabolic process(GO:0046452) |
| 0.8 | 5.7 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.8 | 1.6 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.8 | 3.2 | GO:0045212 | negative regulation of synaptic transmission, cholinergic(GO:0032223) neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.8 | 2.4 | GO:0045554 | TRAIL biosynthetic process(GO:0045553) regulation of TRAIL biosynthetic process(GO:0045554) positive regulation of TRAIL biosynthetic process(GO:0045556) |
| 0.8 | 12.5 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.8 | 2.3 | GO:0060139 | positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.8 | 3.1 | GO:0003290 | atrial septum secundum morphogenesis(GO:0003290) |
| 0.8 | 6.9 | GO:0045905 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.8 | 1.5 | GO:0015917 | aminophospholipid transport(GO:0015917) |
| 0.8 | 2.3 | GO:0044533 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
| 0.7 | 3.0 | GO:1901895 | negative regulation of calcium-transporting ATPase activity(GO:1901895) |
| 0.7 | 2.2 | GO:0071962 | mitotic sister chromatid cohesion, centromeric(GO:0071962) |
| 0.7 | 3.7 | GO:0009236 | cobalamin biosynthetic process(GO:0009236) |
| 0.7 | 2.2 | GO:0097698 | telomere maintenance via base-excision repair(GO:0097698) |
| 0.7 | 2.9 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.7 | 2.1 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.7 | 0.7 | GO:1990641 | response to iron ion starvation(GO:1990641) |
| 0.7 | 4.1 | GO:0042819 | pyridoxine metabolic process(GO:0008614) pyridoxine biosynthetic process(GO:0008615) vitamin B6 biosynthetic process(GO:0042819) |
| 0.7 | 3.4 | GO:0032764 | negative regulation of mast cell cytokine production(GO:0032764) |
| 0.7 | 4.8 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.7 | 2.0 | GO:0070625 | zymogen granule exocytosis(GO:0070625) |
| 0.7 | 1.3 | GO:1901877 | regulation of calcium ion binding(GO:1901876) negative regulation of calcium ion binding(GO:1901877) |
| 0.7 | 2.7 | GO:0009258 | 10-formyltetrahydrofolate catabolic process(GO:0009258) |
| 0.7 | 4.0 | GO:0006127 | glycerophosphate shuttle(GO:0006127) |
| 0.7 | 2.7 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.7 | 3.3 | GO:0018352 | protein-pyridoxal-5-phosphate linkage(GO:0018352) |
| 0.7 | 9.2 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.7 | 2.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
| 0.6 | 1.9 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
| 0.6 | 6.8 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.6 | 5.6 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.6 | 10.5 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.6 | 3.0 | GO:1904933 | regulation of cell proliferation in midbrain(GO:1904933) |
| 0.6 | 3.6 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.6 | 1.8 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 0.6 | 3.6 | GO:0032954 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.6 | 3.0 | GO:0044209 | AMP salvage(GO:0044209) |
| 0.6 | 3.0 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
| 0.6 | 2.4 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
| 0.6 | 11.6 | GO:0006069 | ethanol oxidation(GO:0006069) |
| 0.6 | 1.7 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.6 | 1.7 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.6 | 2.9 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.6 | 6.9 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.6 | 1.7 | GO:0019836 | hemolysis by symbiont of host erythrocytes(GO:0019836) hemolysis in other organism(GO:0044179) hemolysis in other organism involved in symbiotic interaction(GO:0052331) |
| 0.6 | 2.8 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.6 | 0.6 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.6 | 5.0 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.5 | 6.0 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.5 | 5.5 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.5 | 3.3 | GO:0051167 | glucuronate catabolic process(GO:0006064) glucuronate catabolic process to xylulose 5-phosphate(GO:0019640) xylulose 5-phosphate metabolic process(GO:0051167) xylulose 5-phosphate biosynthetic process(GO:1901159) |
| 0.5 | 1.6 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.5 | 4.8 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.5 | 4.2 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.5 | 2.1 | GO:0009956 | radial pattern formation(GO:0009956) |
| 0.5 | 2.6 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.5 | 4.5 | GO:0007506 | gonadal mesoderm development(GO:0007506) |
| 0.5 | 3.0 | GO:0010157 | response to chlorate(GO:0010157) |
| 0.5 | 1.5 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 0.5 | 5.5 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
| 0.5 | 2.9 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.5 | 7.6 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.5 | 0.5 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.5 | 1.9 | GO:0010983 | positive regulation of high-density lipoprotein particle clearance(GO:0010983) |
| 0.5 | 3.8 | GO:0044211 | CTP salvage(GO:0044211) |
| 0.5 | 4.7 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.5 | 2.8 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
| 0.5 | 1.4 | GO:0072684 | mitochondrial tRNA 3'-trailer cleavage, endonucleolytic(GO:0072684) |
| 0.5 | 2.8 | GO:0033490 | cholesterol biosynthetic process via desmosterol(GO:0033489) cholesterol biosynthetic process via lathosterol(GO:0033490) |
| 0.5 | 6.0 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.5 | 1.4 | GO:0035281 | pre-miRNA export from nucleus(GO:0035281) |
| 0.5 | 5.0 | GO:0097647 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.5 | 1.4 | GO:0097187 | dentinogenesis(GO:0097187) |
| 0.5 | 1.8 | GO:0071110 | protein biotinylation(GO:0009305) response to biotin(GO:0070781) histone biotinylation(GO:0071110) |
| 0.5 | 2.7 | GO:0006850 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.5 | 1.4 | GO:0003050 | regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.5 | 6.8 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.4 | 0.4 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
| 0.4 | 4.0 | GO:0006489 | dolichyl diphosphate biosynthetic process(GO:0006489) dolichyl diphosphate metabolic process(GO:0046465) |
| 0.4 | 1.3 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.4 | 1.3 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.4 | 4.8 | GO:0017062 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) |
| 0.4 | 8.3 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.4 | 2.2 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.4 | 3.0 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.4 | 1.3 | GO:0099557 | trans-synaptic signaling by trans-synaptic complex, modulating synaptic transmission(GO:0099557) |
| 0.4 | 14.0 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.4 | 2.5 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.4 | 0.8 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.4 | 1.6 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.4 | 1.2 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.4 | 0.8 | GO:0003095 | pressure natriuresis(GO:0003095) |
| 0.4 | 4.0 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.4 | 1.2 | GO:0019483 | beta-alanine biosynthetic process(GO:0019483) |
| 0.4 | 1.6 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.4 | 1.6 | GO:0070429 | regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) |
| 0.4 | 13.4 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.4 | 2.0 | GO:0090070 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.4 | 2.0 | GO:0006288 | base-excision repair, DNA ligation(GO:0006288) |
| 0.4 | 3.5 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.4 | 0.8 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.4 | 2.7 | GO:0000050 | urea cycle(GO:0000050) |
| 0.4 | 0.8 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.4 | 2.2 | GO:0006772 | thiamine metabolic process(GO:0006772) |
| 0.4 | 1.1 | GO:1902905 | positive regulation of fibril organization(GO:1902905) |
| 0.4 | 1.9 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.4 | 5.5 | GO:0035826 | rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.4 | 2.2 | GO:0015862 | uridine transport(GO:0015862) |
| 0.4 | 6.2 | GO:0015886 | heme transport(GO:0015886) |
| 0.4 | 1.5 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.4 | 1.5 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.4 | 1.1 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 0.4 | 0.7 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
| 0.4 | 1.1 | GO:1901899 | positive regulation of relaxation of cardiac muscle(GO:1901899) |
| 0.4 | 1.8 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.4 | 1.1 | GO:0002101 | tRNA wobble cytosine modification(GO:0002101) |
| 0.4 | 1.1 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) flavin adenine dinucleotide metabolic process(GO:0072387) |
| 0.4 | 6.7 | GO:1902222 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.4 | 2.1 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.4 | 0.7 | GO:0044691 | tooth eruption(GO:0044691) |
| 0.3 | 1.0 | GO:1903515 | calcium ion transport from cytosol to endoplasmic reticulum(GO:1903515) |
| 0.3 | 1.4 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.3 | 1.4 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.3 | 1.4 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.3 | 5.8 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.3 | 1.0 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
| 0.3 | 6.7 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.3 | 6.7 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.3 | 7.4 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.3 | 2.0 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.3 | 1.7 | GO:0061034 | olfactory bulb mitral cell layer development(GO:0061034) |
| 0.3 | 1.0 | GO:0001189 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.3 | 3.9 | GO:0034465 | response to carbon monoxide(GO:0034465) |
| 0.3 | 1.6 | GO:0015878 | biotin transport(GO:0015878) pantothenate transmembrane transport(GO:0015887) |
| 0.3 | 3.9 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.3 | 2.6 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.3 | 0.6 | GO:0042309 | homoiothermy(GO:0042309) |
| 0.3 | 1.3 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.3 | 1.3 | GO:0006740 | NADPH regeneration(GO:0006740) |
| 0.3 | 8.6 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.3 | 2.2 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.3 | 2.5 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.3 | 0.3 | GO:0042560 | folic acid-containing compound catabolic process(GO:0009397) pteridine-containing compound catabolic process(GO:0042560) |
| 0.3 | 7.6 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.3 | 1.3 | GO:0035498 | carnosine metabolic process(GO:0035498) |
| 0.3 | 1.3 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.3 | 2.2 | GO:0048241 | epinephrine transport(GO:0048241) |
| 0.3 | 1.5 | GO:0010731 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.3 | 0.9 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.3 | 0.9 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.3 | 13.2 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.3 | 4.9 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.3 | 3.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.3 | 0.6 | GO:0060435 | bronchiole development(GO:0060435) |
| 0.3 | 2.4 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
| 0.3 | 3.3 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
| 0.3 | 1.2 | GO:0072237 | metanephric proximal tubule development(GO:0072237) |
| 0.3 | 1.5 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.3 | 0.9 | GO:0032053 | ciliary basal body organization(GO:0032053) |
| 0.3 | 3.8 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.3 | 0.3 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.3 | 1.5 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 0.3 | 0.9 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.3 | 2.9 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.3 | 0.9 | GO:1903570 | coronary vein morphogenesis(GO:0003169) regulation of protein kinase D signaling(GO:1903570) positive regulation of protein kinase D signaling(GO:1903572) |
| 0.3 | 2.3 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.3 | 1.4 | GO:0010193 | response to ozone(GO:0010193) |
| 0.3 | 0.6 | GO:2000232 | regulation of rRNA processing(GO:2000232) |
| 0.3 | 0.6 | GO:1905237 | response to cyclosporin A(GO:1905237) |
| 0.3 | 2.0 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
| 0.3 | 1.4 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.3 | 0.8 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.3 | 2.5 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.3 | 1.9 | GO:0002005 | angiotensin catabolic process in blood(GO:0002005) |
| 0.3 | 1.1 | GO:0000451 | rRNA 2'-O-methylation(GO:0000451) |
| 0.3 | 3.3 | GO:0046498 | S-adenosylhomocysteine metabolic process(GO:0046498) |
| 0.3 | 0.3 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
| 0.3 | 1.4 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.3 | 2.7 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.3 | 5.7 | GO:0019321 | pentose metabolic process(GO:0019321) |
| 0.3 | 0.8 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.3 | 2.4 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.3 | 1.1 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) positive regulation of histone H3-K9 dimethylation(GO:1900111) |
| 0.3 | 0.3 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.3 | 1.6 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.3 | 1.6 | GO:0090131 | mesenchyme migration(GO:0090131) |
| 0.3 | 1.3 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.3 | 1.3 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.3 | 0.8 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.3 | 2.3 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.3 | 1.5 | GO:0005985 | sucrose metabolic process(GO:0005985) |
| 0.3 | 1.0 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.3 | 3.8 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.3 | 0.8 | GO:0050976 | detection of mechanical stimulus involved in sensory perception of touch(GO:0050976) cellular response to alkaline pH(GO:0071469) |
| 0.3 | 4.0 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.2 | 0.7 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.2 | 3.7 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.2 | 1.2 | GO:0046963 | 3'-phosphoadenosine 5'-phosphosulfate transport(GO:0046963) 3'-phospho-5'-adenylyl sulfate transmembrane transport(GO:1902559) |
| 0.2 | 0.5 | GO:0042779 | tRNA 3'-trailer cleavage, endonucleolytic(GO:0034414) tRNA 3'-trailer cleavage(GO:0042779) |
| 0.2 | 0.7 | GO:0000412 | histone peptidyl-prolyl isomerization(GO:0000412) |
| 0.2 | 1.5 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.2 | 2.4 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.2 | 0.5 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.2 | 2.2 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.2 | 1.0 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.2 | 11.1 | GO:0005980 | glycogen catabolic process(GO:0005980) |
| 0.2 | 4.2 | GO:0015684 | ferrous iron transport(GO:0015684) ferrous iron transmembrane transport(GO:1903874) |
| 0.2 | 1.2 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
| 0.2 | 0.5 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
| 0.2 | 2.3 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.2 | 2.1 | GO:0071233 | cellular response to leucine(GO:0071233) |
| 0.2 | 2.8 | GO:0015705 | iodide transport(GO:0015705) |
| 0.2 | 0.9 | GO:0002501 | peptide antigen assembly with MHC protein complex(GO:0002501) |
| 0.2 | 3.0 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.2 | 3.2 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
| 0.2 | 0.7 | GO:0032773 | regulation of monophenol monooxygenase activity(GO:0032771) positive regulation of monophenol monooxygenase activity(GO:0032773) negative regulation of catagen(GO:0051796) regulation of hair cycle by canonical Wnt signaling pathway(GO:0060901) positive regulation of melanosome transport(GO:1902910) |
| 0.2 | 0.5 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.2 | 0.9 | GO:0006311 | meiotic gene conversion(GO:0006311) |
| 0.2 | 1.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.2 | 1.4 | GO:0034201 | response to oleic acid(GO:0034201) |
| 0.2 | 1.1 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
| 0.2 | 0.9 | GO:0019285 | glycine betaine biosynthetic process from choline(GO:0019285) glycine betaine metabolic process(GO:0031455) glycine betaine biosynthetic process(GO:0031456) |
| 0.2 | 0.7 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) |
| 0.2 | 2.9 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.2 | 4.0 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.2 | 0.7 | GO:0061011 | hepatic duct development(GO:0061011) |
| 0.2 | 0.9 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.2 | 1.1 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.2 | 2.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.2 | 0.7 | GO:0071422 | succinate transport(GO:0015744) succinate transmembrane transport(GO:0071422) |
| 0.2 | 10.4 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.2 | 1.3 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.2 | 1.1 | GO:1901094 | regulation of protein tetramerization(GO:1901090) negative regulation of protein tetramerization(GO:1901091) regulation of protein homotetramerization(GO:1901093) negative regulation of protein homotetramerization(GO:1901094) |
| 0.2 | 1.5 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.2 | 0.8 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.2 | 2.3 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.2 | 0.6 | GO:0035674 | tricarboxylic acid transmembrane transport(GO:0035674) |
| 0.2 | 2.5 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.2 | 3.3 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.2 | 3.3 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 0.2 | 1.2 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.2 | 1.6 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.2 | 1.2 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.2 | 0.4 | GO:2000722 | regulation of cardiac vascular smooth muscle cell differentiation(GO:2000722) positive regulation of cardiac vascular smooth muscle cell differentiation(GO:2000724) |
| 0.2 | 0.6 | GO:0003273 | chronological cell aging(GO:0001300) cell migration involved in endocardial cushion formation(GO:0003273) |
| 0.2 | 3.0 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.2 | 2.0 | GO:1904749 | regulation of protein localization to nucleolus(GO:1904749) |
| 0.2 | 1.6 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.2 | 0.8 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.2 | 2.2 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.2 | 0.8 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.2 | 1.4 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.2 | 0.6 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.2 | 0.6 | GO:0018160 | peptidyl-pyrromethane cofactor linkage(GO:0018160) |
| 0.2 | 2.7 | GO:0032930 | positive regulation of superoxide anion generation(GO:0032930) |
| 0.2 | 0.4 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
| 0.2 | 0.6 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.2 | 0.8 | GO:0000912 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.2 | 0.6 | GO:0060876 | semicircular canal formation(GO:0060876) |
| 0.2 | 0.6 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
| 0.2 | 1.2 | GO:0070378 | positive regulation of ERK5 cascade(GO:0070378) |
| 0.2 | 2.1 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.2 | 5.0 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.2 | 1.9 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.2 | 2.7 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.2 | 1.3 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.2 | 2.5 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.2 | 0.8 | GO:2000685 | mesodermal-endodermal cell signaling(GO:0003131) programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) histone H2A-S139 phosphorylation(GO:0035978) positive regulation of cellular response to X-ray(GO:2000685) |
| 0.2 | 1.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.2 | 0.8 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 | 5.6 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.2 | 0.9 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.2 | 0.8 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.2 | 3.0 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.2 | 1.7 | GO:0002084 | protein depalmitoylation(GO:0002084) |
| 0.2 | 0.9 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.2 | 0.7 | GO:0002879 | positive regulation of acute inflammatory response to non-antigenic stimulus(GO:0002879) |
| 0.2 | 1.3 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.2 | 0.6 | GO:0035445 | borate transmembrane transport(GO:0035445) borate transport(GO:0046713) |
| 0.2 | 2.8 | GO:1904352 | positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.2 | 0.7 | GO:0044376 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.2 | 0.6 | GO:1902594 | viral penetration into host nucleus(GO:0075732) multi-organism nuclear import(GO:1902594) |
| 0.2 | 1.7 | GO:0001705 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.2 | 0.7 | GO:0048205 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.2 | 3.1 | GO:0042407 | cristae formation(GO:0042407) |
| 0.2 | 0.5 | GO:1901053 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.2 | 0.5 | GO:0086097 | phospholipase C-activating angiotensin-activated signaling pathway(GO:0086097) |
| 0.2 | 0.4 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.2 | 1.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.2 | 0.9 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
| 0.2 | 0.5 | GO:0035989 | tendon development(GO:0035989) |
| 0.2 | 0.5 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.2 | 0.3 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) positive regulation of cytoplasmic translation(GO:2000767) |
| 0.2 | 0.9 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.2 | 0.9 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
| 0.2 | 7.3 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.2 | 0.3 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.2 | 0.3 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.2 | 1.4 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.2 | 0.3 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.2 | 0.5 | GO:0033082 | regulation of extrathymic T cell differentiation(GO:0033082) |
| 0.2 | 1.0 | GO:0097384 | ergosterol biosynthetic process(GO:0006696) ergosterol metabolic process(GO:0008204) cellular lipid biosynthetic process(GO:0097384) |
| 0.2 | 0.7 | GO:1902161 | transepithelial water transport(GO:0035377) positive regulation of cyclic nucleotide-gated ion channel activity(GO:1902161) |
| 0.2 | 2.2 | GO:0036155 | acylglycerol acyl-chain remodeling(GO:0036155) |
| 0.2 | 0.5 | GO:0060057 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.2 | 2.7 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.2 | 2.7 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.2 | 1.0 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.2 | 2.8 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.2 | 4.5 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.2 | 1.3 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
| 0.2 | 1.3 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) activation of phospholipase A2 activity(GO:0032431) |
| 0.2 | 1.3 | GO:0045007 | depurination(GO:0045007) |
| 0.2 | 3.4 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.2 | 0.3 | GO:0030974 | thiamine pyrophosphate transport(GO:0030974) |
| 0.2 | 1.5 | GO:0035494 | SNARE complex disassembly(GO:0035494) |
| 0.2 | 1.4 | GO:0006065 | UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.2 | 0.8 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.2 | 0.5 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
| 0.2 | 7.0 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.2 | 1.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.2 | 3.0 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.2 | 0.5 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.2 | 1.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.2 | 1.7 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.2 | 1.1 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.2 | 1.7 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.2 | 1.1 | GO:0071896 | synaptic vesicle targeting(GO:0016080) protein localization to adherens junction(GO:0071896) |
| 0.2 | 2.0 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
| 0.2 | 1.9 | GO:0015939 | pantothenate metabolic process(GO:0015939) |
| 0.2 | 0.6 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.2 | 1.1 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.2 | 0.9 | GO:0033274 | response to vitamin B2(GO:0033274) heterochromatin maintenance(GO:0070829) |
| 0.2 | 0.8 | GO:0036233 | glycine import(GO:0036233) |
| 0.2 | 1.2 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
| 0.2 | 2.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.2 | 1.5 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.2 | 0.9 | GO:0019075 | virus maturation(GO:0019075) |
| 0.1 | 0.4 | GO:0031126 | snoRNA 3'-end processing(GO:0031126) |
| 0.1 | 0.4 | GO:2000798 | amniotic stem cell differentiation(GO:0097086) negative regulation of dense core granule biogenesis(GO:2000706) negative regulation of mesenchymal stem cell differentiation(GO:2000740) regulation of amniotic stem cell differentiation(GO:2000797) negative regulation of amniotic stem cell differentiation(GO:2000798) |
| 0.1 | 2.4 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 0.3 | GO:0016476 | regulation of embryonic cell shape(GO:0016476) |
| 0.1 | 1.5 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.1 | 0.9 | GO:0001757 | somite specification(GO:0001757) floor plate development(GO:0033504) |
| 0.1 | 6.8 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.1 | 0.9 | GO:0019060 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.1 | 0.7 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.1 | 5.4 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.3 | GO:0031393 | negative regulation of prostaglandin biosynthetic process(GO:0031393) |
| 0.1 | 1.3 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.1 | 0.7 | GO:0097374 | proprioception(GO:0019230) sensory neuron axon guidance(GO:0097374) |
| 0.1 | 1.4 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
| 0.1 | 31.6 | GO:0042254 | ribosome biogenesis(GO:0042254) |
| 0.1 | 1.0 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.1 | 0.6 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 | 0.4 | GO:2000845 | testosterone secretion(GO:0035936) regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) regulation of testosterone secretion(GO:2000843) positive regulation of testosterone secretion(GO:2000845) |
| 0.1 | 0.9 | GO:0060370 | susceptibility to T cell mediated cytotoxicity(GO:0060370) |
| 0.1 | 3.5 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.1 | 0.3 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.1 | 0.6 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 0.1 | 1.3 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 | 1.5 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
| 0.1 | 1.2 | GO:0060768 | regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 | 0.7 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 0.1 | 1.4 | GO:0016072 | rRNA metabolic process(GO:0016072) |
| 0.1 | 1.1 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.1 | 0.3 | GO:1902822 | regulation of late endosome to lysosome transport(GO:1902822) positive regulation of late endosome to lysosome transport(GO:1902824) |
| 0.1 | 1.6 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
| 0.1 | 2.2 | GO:0010510 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.1 | 0.5 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.1 | 0.5 | GO:0008354 | germ cell migration(GO:0008354) |
| 0.1 | 1.9 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 | 0.8 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.1 | 2.5 | GO:0097369 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 | 0.3 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.1 | 0.7 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.1 | 2.2 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.1 | 2.1 | GO:0014877 | response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.1 | 0.8 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.1 | 1.8 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.1 | 1.3 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.1 | 0.3 | GO:0035947 | regulation of gluconeogenesis by regulation of transcription from RNA polymerase II promoter(GO:0035947) |
| 0.1 | 0.4 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.1 | 0.1 | GO:0021559 | trigeminal nerve development(GO:0021559) |
| 0.1 | 1.2 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.1 | 0.4 | GO:0070377 | negative regulation of ERK5 cascade(GO:0070377) |
| 0.1 | 1.8 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 | 0.1 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.1 | 0.4 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.1 | 0.1 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.1 | 0.6 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 0.1 | 1.0 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.1 | 1.7 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.1 | GO:0097676 | histone H3-K36 dimethylation(GO:0097676) |
| 0.1 | 0.5 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) regulation of transcription from RNA polymerase II promoter in response to arsenic-containing substance(GO:0061394) |
| 0.1 | 1.6 | GO:0098582 | innate vocalization behavior(GO:0098582) |
| 0.1 | 0.4 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.1 | 0.4 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.1 | 0.5 | GO:1990918 | double-strand break repair involved in meiotic recombination(GO:1990918) |
| 0.1 | 0.2 | GO:1904640 | response to methionine(GO:1904640) |
| 0.1 | 0.7 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 | 2.0 | GO:1903760 | regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) |
| 0.1 | 0.8 | GO:0036018 | cellular response to erythropoietin(GO:0036018) |
| 0.1 | 0.7 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.1 | 0.8 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) |
| 0.1 | 2.0 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.1 | 2.6 | GO:0009083 | branched-chain amino acid metabolic process(GO:0009081) branched-chain amino acid catabolic process(GO:0009083) |
| 0.1 | 1.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.1 | 1.2 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.1 | 0.3 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.1 | 3.4 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.1 | 12.4 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.2 | GO:0019343 | cysteine biosynthetic process from serine(GO:0006535) cysteine biosynthetic process via cystathionine(GO:0019343) |
| 0.1 | 0.8 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 | 0.1 | GO:0042144 | vacuole fusion, non-autophagic(GO:0042144) |
| 0.1 | 4.6 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
| 0.1 | 0.9 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.1 | 0.3 | GO:0090410 | malonate catabolic process(GO:0090410) |
| 0.1 | 0.3 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.1 | 0.3 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.1 | 1.0 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.1 | 0.9 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.1 | 1.0 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.1 | 0.9 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.1 | 0.8 | GO:0019556 | histidine catabolic process to glutamate and formamide(GO:0019556) histidine catabolic process to glutamate and formate(GO:0019557) formamide metabolic process(GO:0043606) |
| 0.1 | 0.6 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.1 | 3.2 | GO:1904776 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.1 | 1.6 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.1 | 0.5 | GO:0034334 | adherens junction maintenance(GO:0034334) maintenance of organ identity(GO:0048496) |
| 0.1 | 6.2 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.1 | 0.7 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.1 | 1.9 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.1 | 0.5 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
| 0.1 | 1.6 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 0.1 | 1.4 | GO:0035036 | sperm-egg recognition(GO:0035036) |
| 0.1 | 5.5 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
| 0.1 | 1.7 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 0.4 | GO:0009107 | lipoate metabolic process(GO:0009106) lipoate biosynthetic process(GO:0009107) |
| 0.1 | 0.3 | GO:0033594 | response to hydroxyisoflavone(GO:0033594) |
| 0.1 | 0.2 | GO:1902256 | apoptotic process involved in outflow tract morphogenesis(GO:0003275) regulation of apoptotic process involved in outflow tract morphogenesis(GO:1902256) |
| 0.1 | 5.9 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 0.1 | 0.9 | GO:0021800 | cerebral cortex tangential migration(GO:0021800) |
| 0.1 | 0.5 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.1 | 0.7 | GO:0006196 | AMP catabolic process(GO:0006196) |
| 0.1 | 3.6 | GO:0046716 | muscle cell cellular homeostasis(GO:0046716) |
| 0.1 | 1.5 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 | 2.5 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.1 | 2.7 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.1 | 1.1 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.1 | 0.3 | GO:0007231 | osmosensory signaling pathway(GO:0007231) |
| 0.1 | 3.2 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.1 | 1.4 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.1 | 0.7 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.1 | 0.5 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.1 | 0.5 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.1 | 0.4 | GO:0090135 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) actin filament branching(GO:0090135) protein localization to cell leading edge(GO:1902463) |
| 0.1 | 3.6 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.1 | 0.8 | GO:0046549 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.1 | 0.3 | GO:0032470 | positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) |
| 0.1 | 0.3 | GO:0060279 | negative regulation of B cell differentiation(GO:0045578) positive regulation of ovulation(GO:0060279) |
| 0.1 | 1.7 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.1 | 0.3 | GO:0002416 | IgG immunoglobulin transcytosis in epithelial cells mediated by FcRn immunoglobulin receptor(GO:0002416) |
| 0.1 | 1.2 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.1 | 0.6 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 0.1 | 0.9 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 | 1.0 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.1 | 1.0 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 0.3 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.1 | 0.4 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.1 | 1.6 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 0.4 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.1 | 0.3 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.1 | 1.1 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.1 | 1.2 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 | 1.3 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.1 | 0.6 | GO:0008218 | bioluminescence(GO:0008218) |
| 0.1 | 1.0 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.1 | 5.3 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.1 | 1.1 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.1 | 1.9 | GO:0007140 | male meiosis(GO:0007140) |
| 0.1 | 0.8 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 | 1.1 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.1 | 0.3 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.1 | 0.8 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.1 | 1.2 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.1 | 1.4 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.1 | 0.4 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.1 | 0.6 | GO:0003360 | brainstem development(GO:0003360) |
| 0.1 | 0.1 | GO:0097501 | stress response to metal ion(GO:0097501) |
| 0.1 | 2.8 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
| 0.1 | 4.8 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.1 | 0.4 | GO:2000197 | regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
| 0.1 | 0.4 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
| 0.1 | 2.4 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.1 | 1.9 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.1 | 1.0 | GO:0051873 | killing by host of symbiont cells(GO:0051873) |
| 0.1 | 0.1 | GO:0048541 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 0.1 | 0.3 | GO:0021558 | noradrenergic neuron differentiation(GO:0003357) trochlear nerve development(GO:0021558) |
| 0.1 | 0.3 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.1 | 0.9 | GO:0060707 | trophoblast giant cell differentiation(GO:0060707) |
| 0.1 | 0.6 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.1 | 2.3 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.1 | 1.9 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.1 | 1.9 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.1 | 0.1 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.1 | 0.8 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.1 | 0.8 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) |
| 0.1 | 1.4 | GO:0042737 | drug catabolic process(GO:0042737) |
| 0.1 | 0.2 | GO:0090149 | mitochondrial membrane fission(GO:0090149) |
| 0.1 | 0.4 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.1 | 0.2 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.1 | 2.0 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.1 | 0.5 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 0.1 | 0.7 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.1 | 0.2 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.1 | 0.3 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.1 | 2.0 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 | 1.8 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.1 | 4.4 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.1 | 1.6 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 | 0.7 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.1 | 0.2 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.1 | 0.8 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.1 | 0.4 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.1 | 1.7 | GO:0000737 | DNA catabolic process, endonucleolytic(GO:0000737) apoptotic DNA fragmentation(GO:0006309) |
| 0.1 | 0.5 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.1 | 0.2 | GO:0032258 | CVT pathway(GO:0032258) |
| 0.1 | 0.4 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.1 | 1.7 | GO:0071467 | cellular response to pH(GO:0071467) |
| 0.1 | 3.0 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
| 0.1 | 0.2 | GO:0046051 | UTP metabolic process(GO:0046051) |
| 0.1 | 0.8 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 | 3.6 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.1 | 0.2 | GO:2001311 | lysobisphosphatidic acid metabolic process(GO:2001311) |
| 0.1 | 5.8 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
| 0.1 | 0.4 | GO:0060011 | sperm ejaculation(GO:0042713) Sertoli cell proliferation(GO:0060011) |
| 0.1 | 0.4 | GO:0098838 | methotrexate transport(GO:0051958) reduced folate transmembrane transport(GO:0098838) |
| 0.1 | 0.1 | GO:0044725 | chromatin reprogramming in the zygote(GO:0044725) |
| 0.1 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.1 | 1.2 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.1 | 1.3 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.1 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.1 | 0.7 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.1 | 0.1 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.1 | 4.9 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.1 | 1.0 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.1 | 2.2 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.1 | 1.5 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
| 0.1 | 5.8 | GO:0048207 | vesicle coating(GO:0006901) vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.1 | 0.6 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.1 | 1.3 | GO:0048569 | post-embryonic organ development(GO:0048569) |
| 0.1 | 0.6 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 | 0.1 | GO:0051414 | response to cortisol(GO:0051414) |
| 0.1 | 0.3 | GO:1902287 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.1 | 1.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.1 | 0.3 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.1 | 5.4 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
| 0.1 | 1.1 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.1 | 0.1 | GO:0060161 | receptor-mediated endocytosis of virus by host cell(GO:0019065) positive regulation of dopamine receptor signaling pathway(GO:0060161) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.1 | 0.3 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
| 0.1 | 2.9 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 | 1.1 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.1 | 1.1 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.1 | 0.8 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 1.1 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 | 0.4 | GO:0021930 | cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
| 0.1 | 0.2 | GO:0038086 | VEGF-activated platelet-derived growth factor receptor signaling pathway(GO:0038086) positive regulation of cell proliferation by VEGF-activated platelet derived growth factor receptor signaling pathway(GO:0038091) angiogenesis involved in coronary vascular morphogenesis(GO:0060978) cell migration involved in coronary angiogenesis(GO:0060981) metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
| 0.1 | 0.3 | GO:1904761 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) negative regulation of myofibroblast differentiation(GO:1904761) |
| 0.1 | 0.3 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.1 | 0.1 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) negative regulation of mRNA catabolic process(GO:1902373) |
| 0.1 | 0.1 | GO:0043932 | ossification involved in bone remodeling(GO:0043932) |
| 0.1 | 0.3 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.1 | 2.3 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.1 | 1.4 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
| 0.1 | 1.4 | GO:0060412 | ventricular septum morphogenesis(GO:0060412) |
| 0.1 | 0.1 | GO:1903033 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) positive regulation of microtubule binding(GO:1904528) |
| 0.1 | 0.5 | GO:0060026 | convergent extension(GO:0060026) |
| 0.1 | 2.8 | GO:0045672 | positive regulation of osteoclast differentiation(GO:0045672) |
| 0.1 | 0.7 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 | 0.8 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.1 | 0.6 | GO:0072161 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
| 0.1 | 5.2 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.7 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
| 0.1 | 0.4 | GO:0097068 | response to thyroxine(GO:0097068) response to L-phenylalanine derivative(GO:1904386) |
| 0.1 | 0.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.1 | 0.9 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) |
| 0.1 | 0.6 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.1 | 0.7 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.1 | 0.2 | GO:2001200 | positive regulation of dendritic cell differentiation(GO:2001200) |
| 0.1 | 0.9 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
| 0.1 | 2.9 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) |
| 0.1 | 4.9 | GO:0055072 | iron ion homeostasis(GO:0055072) |
| 0.1 | 0.2 | GO:0060965 | negative regulation of gene silencing by miRNA(GO:0060965) |
| 0.1 | 0.6 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 | 0.5 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 | 2.3 | GO:0097341 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) |
| 0.1 | 0.4 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.1 | 0.5 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 1.5 | GO:0000717 | nucleotide-excision repair, DNA duplex unwinding(GO:0000717) |
| 0.1 | 0.1 | GO:0035038 | female pronucleus assembly(GO:0035038) |
| 0.1 | 0.4 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 0.2 | GO:0061580 | colon epithelial cell migration(GO:0061580) |
| 0.1 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 0.2 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.1 | 0.3 | GO:0055014 | atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
| 0.1 | 0.3 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.1 | 0.4 | GO:0030421 | defecation(GO:0030421) |
| 0.1 | 0.5 | GO:0031017 | exocrine pancreas development(GO:0031017) |
| 0.1 | 1.1 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.1 | 0.4 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
| 0.1 | 0.6 | GO:0045132 | meiotic chromosome segregation(GO:0045132) |
| 0.1 | 1.1 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.1 | 0.4 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.1 | 0.6 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.1 | 0.2 | GO:0045643 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
| 0.1 | 0.6 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
| 0.1 | 0.2 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
| 0.1 | 0.5 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 0.1 | 1.3 | GO:0036003 | positive regulation of transcription from RNA polymerase II promoter in response to stress(GO:0036003) |
| 0.1 | 0.8 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.1 | 0.1 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.1 | 0.2 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.1 | 0.2 | GO:2000563 | positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.1 | 2.3 | GO:0043277 | apoptotic cell clearance(GO:0043277) |
| 0.1 | 0.9 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.1 | 0.2 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.1 | 12.3 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
| 0.1 | 0.2 | GO:0003139 | heart field specification(GO:0003128) secondary heart field specification(GO:0003139) |
| 0.1 | 1.7 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.1 | 0.2 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.1 | 4.7 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.1 | 0.7 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.1 | 0.4 | GO:0044375 | peroxisome membrane biogenesis(GO:0016557) regulation of peroxisome size(GO:0044375) |
| 0.1 | 0.8 | GO:0045005 | replication fork processing(GO:0031297) DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.1 | 0.5 | GO:1901314 | negative regulation of histone ubiquitination(GO:0033183) negative regulation of protein K63-linked ubiquitination(GO:1900045) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.1 | 0.7 | GO:0001759 | organ induction(GO:0001759) |
| 0.1 | 1.6 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.1 | 1.7 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.1 | 0.1 | GO:0070193 | synaptonemal complex organization(GO:0070193) |
| 0.1 | 0.9 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
| 0.1 | 0.8 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
| 0.1 | 0.8 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.1 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.1 | 0.4 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 1.1 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
| 0.1 | 2.1 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.0 | 0.3 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 | 0.4 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.0 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.0 | 1.6 | GO:0014898 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
| 0.0 | 2.3 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.0 | 0.2 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
| 0.0 | 3.3 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 2.3 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
| 0.0 | 0.8 | GO:0042832 | defense response to protozoan(GO:0042832) |
| 0.0 | 0.8 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.0 | 0.1 | GO:0035624 | receptor transactivation(GO:0035624) |
| 0.0 | 0.5 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.0 | 1.3 | GO:0006625 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.0 | 0.4 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.0 | 0.6 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.0 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.5 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
| 0.0 | 1.6 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.0 | 0.2 | GO:0070836 | caveola assembly(GO:0070836) |
| 0.0 | 0.4 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 1.3 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.0 | 0.9 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.0 | 0.3 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.0 | 0.1 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
| 0.0 | 0.3 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.0 | 0.3 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.0 | 1.0 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.0 | 0.5 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.0 | 0.2 | GO:0002572 | pro-T cell differentiation(GO:0002572) regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.0 | 0.5 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
| 0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 | 0.6 | GO:0001510 | RNA methylation(GO:0001510) |
| 0.0 | 1.1 | GO:0016073 | snRNA metabolic process(GO:0016073) |
| 0.0 | 0.3 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.0 | 0.8 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.0 | 0.5 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 3.8 | GO:0002088 | lens development in camera-type eye(GO:0002088) |
| 0.0 | 0.3 | GO:0050879 | multicellular organismal movement(GO:0050879) musculoskeletal movement(GO:0050881) |
| 0.0 | 1.9 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 | 0.5 | GO:0035729 | cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.0 | 4.1 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
| 0.0 | 4.6 | GO:0006413 | translational initiation(GO:0006413) |
| 0.0 | 0.5 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.0 | 2.4 | GO:0048477 | oogenesis(GO:0048477) |
| 0.0 | 0.1 | GO:0045918 | positive regulation of interleukin-23 production(GO:0032747) negative regulation of cytolysis(GO:0045918) |
| 0.0 | 0.2 | GO:1905123 | regulation of glucosylceramidase activity(GO:1905123) |
| 0.0 | 0.5 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.0 | 0.3 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 1.2 | GO:0009880 | embryonic pattern specification(GO:0009880) |
| 0.0 | 0.3 | GO:0051382 | kinetochore assembly(GO:0051382) |
| 0.0 | 0.4 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.0 | 0.7 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.0 | 0.4 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.2 | GO:0009648 | photoperiodism(GO:0009648) |
| 0.0 | 0.4 | GO:0001502 | cartilage condensation(GO:0001502) |
| 0.0 | 0.2 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
| 0.0 | 0.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.0 | 0.2 | GO:0097045 | phosphatidylserine exposure on blood platelet(GO:0097045) |
| 0.0 | 0.3 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 0.0 | 0.2 | GO:0035549 | positive regulation of interferon-beta secretion(GO:0035549) |
| 0.0 | 0.3 | GO:0060318 | regulation of definitive erythrocyte differentiation(GO:0010724) definitive erythrocyte differentiation(GO:0060318) |
| 0.0 | 0.2 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.5 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 | 0.5 | GO:0007379 | segment specification(GO:0007379) |
| 0.0 | 0.8 | GO:0002693 | positive regulation of cellular extravasation(GO:0002693) |
| 0.0 | 0.2 | GO:0019605 | benzoate metabolic process(GO:0018874) butyrate metabolic process(GO:0019605) |
| 0.0 | 0.1 | GO:0060525 | prostate glandular acinus development(GO:0060525) |
| 0.0 | 0.4 | GO:0098779 | mitophagy in response to mitochondrial depolarization(GO:0098779) |
| 0.0 | 0.3 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
| 0.0 | 2.6 | GO:0046324 | regulation of glucose import(GO:0046324) |
| 0.0 | 0.3 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.0 | 0.3 | GO:0042262 | DNA protection(GO:0042262) |
| 0.0 | 0.1 | GO:0035853 | chromosome passenger complex localization to spindle midzone(GO:0035853) |
| 0.0 | 0.5 | GO:0061088 | regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 | 0.4 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.6 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.0 | 0.4 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.0 | 2.1 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.0 | 5.6 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.0 | 0.9 | GO:0007292 | female gamete generation(GO:0007292) |
| 0.0 | 0.6 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
| 0.0 | 0.4 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.0 | 0.2 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.0 | 1.8 | GO:0048247 | lymphocyte chemotaxis(GO:0048247) |
| 0.0 | 2.5 | GO:0042267 | natural killer cell mediated cytotoxicity(GO:0042267) |
| 0.0 | 0.8 | GO:0001709 | cell fate determination(GO:0001709) |
| 0.0 | 0.4 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.4 | GO:0048311 | mitochondrion distribution(GO:0048311) |
| 0.0 | 0.6 | GO:1901750 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
| 0.0 | 0.4 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.0 | 0.4 | GO:0050746 | regulation of lipoprotein metabolic process(GO:0050746) |
| 0.0 | 0.4 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.0 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 | 0.1 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.0 | 1.2 | GO:0031663 | lipopolysaccharide-mediated signaling pathway(GO:0031663) |
| 0.0 | 0.6 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.0 | 0.6 | GO:0048286 | lung alveolus development(GO:0048286) |
| 0.0 | 0.2 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.0 | 0.1 | GO:0090204 | protein localization to nuclear pore(GO:0090204) |
| 0.0 | 0.5 | GO:0009948 | anterior/posterior axis specification(GO:0009948) |
| 0.0 | 0.8 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.0 | 0.2 | GO:0046092 | deoxycytidine metabolic process(GO:0046092) |
| 0.0 | 0.4 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.0 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.0 | 0.2 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.3 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.5 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.7 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.3 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.5 | GO:0070571 | negative regulation of axon regeneration(GO:0048681) negative regulation of neuron projection regeneration(GO:0070571) |
| 0.0 | 0.1 | GO:0035407 | histone H3-T11 phosphorylation(GO:0035407) |
| 0.0 | 0.2 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.0 | 0.5 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.0 | 1.9 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 0.4 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.8 | GO:0034644 | cellular response to UV(GO:0034644) |
| 0.0 | 0.5 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.2 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) |
| 0.0 | 0.2 | GO:0032196 | transposition(GO:0032196) |
| 0.0 | 0.1 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 0.0 | 0.7 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.1 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
| 0.0 | 0.8 | GO:0048565 | digestive tract development(GO:0048565) |
| 0.0 | 0.1 | GO:0046368 | GDP-L-fucose metabolic process(GO:0046368) |
| 0.0 | 0.1 | GO:1901202 | negative regulation of extracellular matrix assembly(GO:1901202) |
| 0.0 | 0.7 | GO:0033173 | calcineurin-NFAT signaling cascade(GO:0033173) |
| 0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.1 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.0 | 0.4 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.0 | 0.1 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.0 | 0.4 | GO:0001893 | maternal placenta development(GO:0001893) |
| 0.0 | 2.0 | GO:0006338 | chromatin remodeling(GO:0006338) |
| 0.0 | 0.1 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.0 | 0.3 | GO:0040023 | establishment of nucleus localization(GO:0040023) |
| 0.0 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 1.4 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) |
| 0.0 | 0.1 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.0 | 0.2 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.3 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.0 | 0.2 | GO:1903543 | positive regulation of exosomal secretion(GO:1903543) |
| 0.0 | 0.6 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.0 | 0.3 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.0 | 1.0 | GO:0046849 | bone remodeling(GO:0046849) |
| 0.0 | 0.0 | GO:0086100 | endothelin receptor signaling pathway(GO:0086100) |
| 0.0 | 1.0 | GO:0051149 | positive regulation of muscle cell differentiation(GO:0051149) |
| 0.0 | 1.9 | GO:0090305 | nucleic acid phosphodiester bond hydrolysis(GO:0090305) |
| 0.0 | 0.2 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
| 0.0 | 0.2 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.4 | GO:0007127 | meiosis I(GO:0007127) |
| 0.0 | 0.1 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.0 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
| 0.0 | 0.1 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
| 0.0 | 0.1 | GO:0016036 | cellular response to phosphate starvation(GO:0016036) positive regulation of sulfur amino acid metabolic process(GO:0031337) positive regulation of homocysteine metabolic process(GO:0050668) |
| 0.0 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.1 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.0 | 0.5 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.0 | 0.1 | GO:0033028 | myeloid cell apoptotic process(GO:0033028) |
| 0.0 | 0.2 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.0 | 0.4 | GO:0045604 | regulation of epidermal cell differentiation(GO:0045604) |
| 0.0 | 0.4 | GO:1901998 | toxin transport(GO:1901998) |
| 0.0 | 0.3 | GO:0040019 | positive regulation of embryonic development(GO:0040019) |
| 0.0 | 0.3 | GO:0010880 | regulation of release of sequestered calcium ion into cytosol by sarcoplasmic reticulum(GO:0010880) |
| 0.0 | 0.2 | GO:0070166 | enamel mineralization(GO:0070166) |
| 0.0 | 0.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.3 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.0 | 0.4 | GO:0031640 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| 0.0 | 0.3 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
| 0.0 | 0.6 | GO:0042035 | regulation of cytokine biosynthetic process(GO:0042035) |
| 0.0 | 0.3 | GO:0050850 | positive regulation of calcium-mediated signaling(GO:0050850) |
| 0.0 | 0.2 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.0 | 0.0 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.0 | 0.1 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.0 | 0.0 | GO:0018008 | N-terminal protein myristoylation(GO:0006499) N-terminal peptidyl-glycine N-myristoylation(GO:0018008) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 6.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 1.2 | 4.8 | GO:0034455 | t-UTP complex(GO:0034455) |
| 1.2 | 3.6 | GO:1990923 | PET complex(GO:1990923) |
| 1.1 | 14.3 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.9 | 7.3 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.9 | 0.9 | GO:0030689 | Noc complex(GO:0030689) |
| 0.9 | 2.6 | GO:0005606 | laminin-1 complex(GO:0005606) |
| 0.9 | 20.6 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.8 | 9.9 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.8 | 4.9 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.8 | 6.4 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.7 | 3.0 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.7 | 7.4 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.7 | 13.2 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.7 | 3.3 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.6 | 5.2 | GO:0031415 | NatA complex(GO:0031415) |
| 0.6 | 5.0 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.6 | 6.8 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.6 | 4.9 | GO:0071546 | pi-body(GO:0071546) |
| 0.6 | 1.7 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.6 | 1.7 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 0.6 | 3.3 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.5 | 2.1 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.5 | 16.8 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.4 | 6.2 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.4 | 1.7 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.4 | 7.3 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.4 | 0.9 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.4 | 2.0 | GO:0071149 | TEAD-1-YAP complex(GO:0071148) TEAD-2-YAP complex(GO:0071149) |
| 0.4 | 3.6 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.4 | 1.6 | GO:0098575 | lumenal side of lysosomal membrane(GO:0098575) |
| 0.4 | 1.6 | GO:0035517 | PR-DUB complex(GO:0035517) |
| 0.4 | 1.5 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.4 | 2.5 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.4 | 1.8 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.4 | 3.2 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.3 | 1.7 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.3 | 5.5 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.3 | 3.3 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.3 | 1.6 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.3 | 20.1 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.3 | 1.3 | GO:0043614 | multi-eIF complex(GO:0043614) |
| 0.3 | 3.4 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.3 | 1.2 | GO:0002133 | polycystin complex(GO:0002133) |
| 0.3 | 15.4 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.3 | 0.9 | GO:0005584 | collagen type I trimer(GO:0005584) |
| 0.3 | 4.7 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.3 | 1.5 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.3 | 3.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.3 | 1.6 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.3 | 2.9 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.3 | 2.3 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.3 | 3.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.3 | 2.8 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.3 | 5.5 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.3 | 2.0 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.2 | 3.0 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.2 | 1.2 | GO:0035841 | new growing cell tip(GO:0035841) |
| 0.2 | 6.7 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.2 | 1.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.2 | 1.6 | GO:0072589 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.2 | 3.7 | GO:0034709 | methylosome(GO:0034709) |
| 0.2 | 2.1 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.2 | 0.9 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 0.2 | 2.9 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.2 | 1.6 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.2 | 6.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.2 | 1.5 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.2 | 1.1 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.2 | 3.2 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.2 | 4.0 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.2 | 0.4 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.2 | 1.2 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.2 | 0.6 | GO:0072563 | endothelial microparticle(GO:0072563) |
| 0.2 | 1.0 | GO:0005960 | glycine cleavage complex(GO:0005960) |
| 0.2 | 9.3 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.2 | 2.6 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.2 | 1.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.2 | 1.3 | GO:0000801 | central element(GO:0000801) |
| 0.2 | 1.0 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.2 | 3.8 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.2 | 1.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.2 | 0.7 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.2 | 0.9 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.2 | 3.0 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.2 | 2.6 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.2 | 2.4 | GO:0098647 | collagen type VI trimer(GO:0005589) collagen beaded filament(GO:0098647) |
| 0.2 | 0.5 | GO:0005592 | collagen type XI trimer(GO:0005592) |
| 0.2 | 1.0 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.2 | 17.9 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.2 | 4.8 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.2 | 2.7 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.2 | 0.8 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.2 | 0.5 | GO:1990617 | CHOP-ATF4 complex(GO:1990617) |
| 0.2 | 1.7 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.2 | 0.8 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.2 | 1.2 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.2 | 1.5 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.2 | 18.6 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.1 | 3.1 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 1.5 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 3.4 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.1 | 1.3 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 0.6 | GO:0097123 | cyclin A1-CDK2 complex(GO:0097123) |
| 0.1 | 10.3 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 1.1 | GO:0002169 | 3-methylcrotonyl-CoA carboxylase complex, mitochondrial(GO:0002169) methylcrotonoyl-CoA carboxylase complex(GO:1905202) |
| 0.1 | 11.0 | GO:0005844 | polysome(GO:0005844) |
| 0.1 | 1.1 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.1 | 0.7 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.1 | 1.7 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.1 | 4.0 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.1 | 5.0 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 1.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.1 | 1.3 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 0.1 | 1.9 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.1 | 1.6 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 3.7 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 2.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 0.9 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 3.5 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.1 | 0.5 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.1 | 0.6 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.1 | 2.7 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.1 | 1.2 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 2.1 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.1 | 0.6 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.1 | 3.9 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.1 | 0.9 | GO:0071942 | XPC complex(GO:0071942) |
| 0.1 | 0.5 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.1 | 2.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.1 | 1.5 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.1 | 0.2 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.1 | 1.5 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 2.2 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 1.0 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 1.5 | GO:0000791 | euchromatin(GO:0000791) |
| 0.1 | 0.8 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 2.8 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.1 | 0.9 | GO:0070695 | FHF complex(GO:0070695) |
| 0.1 | 2.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.1 | 0.4 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.1 | 3.7 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.1 | 7.7 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.1 | 0.6 | GO:0005713 | recombination nodule(GO:0005713) |
| 0.1 | 0.6 | GO:0034753 | nuclear aryl hydrocarbon receptor complex(GO:0034753) |
| 0.1 | 0.7 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.1 | 2.1 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 1.8 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 1.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.1 | 0.3 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 1.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.1 | 4.7 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.1 | 11.9 | GO:0005811 | lipid particle(GO:0005811) |
| 0.1 | 0.4 | GO:0097545 | axonemal outer doublet(GO:0097545) |
| 0.1 | 2.1 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.1 | 0.9 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.1 | 8.4 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.1 | 10.2 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.1 | 0.6 | GO:0032449 | CBM complex(GO:0032449) |
| 0.1 | 1.0 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.1 | 0.3 | GO:0043511 | inhibin complex(GO:0043511) inhibin A complex(GO:0043512) |
| 0.1 | 1.2 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 4.0 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.1 | 4.9 | GO:0005605 | basal lamina(GO:0005605) |
| 0.1 | 0.7 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.1 | 2.1 | GO:0010369 | chromocenter(GO:0010369) |
| 0.1 | 4.5 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.1 | 1.0 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.1 | 0.8 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.1 | 3.8 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 1.8 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 4.8 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 0.9 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.1 | 0.6 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.1 | 0.2 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.1 | GO:0036502 | Derlin-1-VIMP complex(GO:0036502) |
| 0.1 | 0.3 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.1 | 11.0 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.1 | 0.3 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.1 | 2.1 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.1 | 1.9 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.1 | 2.8 | GO:0070069 | cytochrome complex(GO:0070069) |
| 0.1 | 1.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 0.6 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.1 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
| 0.1 | 0.2 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.1 | 0.2 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.1 | 4.6 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
| 0.1 | 0.3 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.1 | 0.7 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 7.2 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.1 | 0.7 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.1 | 0.8 | GO:0097413 | Lewy body(GO:0097413) |
| 0.1 | 0.2 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
| 0.1 | 0.4 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.4 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.1 | 2.7 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.1 | 0.2 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.1 | 0.4 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.1 | 8.6 | GO:0031093 | platelet alpha granule lumen(GO:0031093) |
| 0.1 | 1.1 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.1 | 0.6 | GO:0032009 | early phagosome(GO:0032009) |
| 0.1 | 1.0 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 2.5 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.1 | 0.6 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.1 | 0.6 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 1.4 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.1 | 1.0 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.1 | 52.6 | GO:0031966 | mitochondrial membrane(GO:0031966) |
| 0.1 | 1.7 | GO:0044438 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
| 0.1 | 14.1 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.1 | 6.2 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.1 | 0.9 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.1 | 3.7 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.1 | 1.6 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 0.3 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.1 | 1.1 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 1.1 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 1.0 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 2.0 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 0.7 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 6.0 | GO:0005840 | ribosome(GO:0005840) |
| 0.1 | 0.4 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.1 | 2.1 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.1 | 0.3 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.1 | 5.5 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.1 | 0.7 | GO:0001741 | XY body(GO:0001741) |
| 0.1 | 0.3 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.1 | 0.6 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 0.6 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.1 | 1.6 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 0.7 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.1 | 0.3 | GO:0035363 | histone locus body(GO:0035363) |
| 0.1 | 27.0 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.1 | 0.6 | GO:0070449 | elongin complex(GO:0070449) |
| 0.1 | 4.4 | GO:0031672 | A band(GO:0031672) |
| 0.1 | 3.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 1.9 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.1 | 0.6 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 0.5 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.1 | 1.0 | GO:0031089 | platelet dense granule lumen(GO:0031089) |
| 0.0 | 0.1 | GO:0030681 | multimeric ribonuclease P complex(GO:0030681) |
| 0.0 | 0.3 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 1.0 | GO:0045179 | apical cortex(GO:0045179) |
| 0.0 | 0.6 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 0.4 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 6.2 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.7 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 1.3 | GO:0097526 | spliceosomal tri-snRNP complex(GO:0097526) |
| 0.0 | 0.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 2.3 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.6 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 1.0 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.3 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.0 | 3.1 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 3.7 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.0 | 0.9 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 60.2 | GO:0005739 | mitochondrion(GO:0005739) |
| 0.0 | 0.8 | GO:0044453 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
| 0.0 | 0.3 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.0 | 0.4 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 0.0 | GO:0071547 | piP-body(GO:0071547) |
| 0.0 | 0.3 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 5.7 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 3.7 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 6.7 | GO:0030018 | Z disc(GO:0030018) |
| 0.0 | 4.1 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 29.4 | GO:0005730 | nucleolus(GO:0005730) |
| 0.0 | 1.7 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 5.3 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.0 | 0.1 | GO:0033011 | perinuclear theca(GO:0033011) |
| 0.0 | 0.3 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.0 | 0.4 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.0 | 0.4 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 1.6 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.1 | GO:0097196 | Shu complex(GO:0097196) |
| 0.0 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.3 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.0 | 0.8 | GO:0005657 | replication fork(GO:0005657) |
| 0.0 | 0.2 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.1 | GO:0072536 | interleukin-23 receptor complex(GO:0072536) |
| 0.0 | 0.4 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.3 | GO:0044447 | axoneme part(GO:0044447) |
| 0.0 | 0.6 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.6 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.2 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
| 0.0 | 0.7 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.4 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.6 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.0 | 0.4 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.0 | 0.1 | GO:0060171 | stereocilium membrane(GO:0060171) |
| 0.0 | 0.1 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 1.0 | GO:0005901 | caveola(GO:0005901) |
| 0.0 | 8.9 | GO:0016604 | nuclear body(GO:0016604) |
| 0.0 | 0.4 | GO:0014704 | intercalated disc(GO:0014704) |
| 0.0 | 0.3 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.0 | 0.1 | GO:0031674 | I band(GO:0031674) |
| 0.0 | 1.4 | GO:0005903 | brush border(GO:0005903) |
| 0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.7 | 10.7 | GO:0005287 | high-affinity basic amino acid transmembrane transporter activity(GO:0005287) high-affinity arginine transmembrane transporter activity(GO:0005289) high-affinity lysine transmembrane transporter activity(GO:0005292) |
| 2.5 | 22.7 | GO:0008732 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 2.2 | 6.5 | GO:0046577 | long-chain-alcohol oxidase activity(GO:0046577) |
| 2.0 | 5.9 | GO:0070362 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 1.7 | 5.0 | GO:0004326 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) dihydrofolate synthase activity(GO:0008841) |
| 1.5 | 5.9 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 1.3 | 5.2 | GO:0019150 | D-ribulokinase activity(GO:0019150) |
| 1.3 | 3.8 | GO:0004766 | spermidine synthase activity(GO:0004766) |
| 1.2 | 11.2 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 1.2 | 4.8 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
| 1.2 | 7.2 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 1.2 | 5.8 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 1.0 | 6.3 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 1.0 | 4.1 | GO:0004733 | pyridoxamine-phosphate oxidase activity(GO:0004733) |
| 1.0 | 3.0 | GO:0004639 | phosphoribosylaminoimidazole carboxylase activity(GO:0004638) phosphoribosylaminoimidazolesuccinocarboxamide synthase activity(GO:0004639) |
| 1.0 | 7.0 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 1.0 | 5.8 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.9 | 5.7 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.9 | 3.7 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.9 | 2.7 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.9 | 2.7 | GO:0080101 | phosphatidyl-N-methylethanolamine N-methyltransferase activity(GO:0000773) phosphatidylethanolamine N-methyltransferase activity(GO:0004608) phosphatidyl-N-dimethylethanolamine N-methyltransferase activity(GO:0080101) |
| 0.9 | 2.7 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.9 | 3.4 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.8 | 3.4 | GO:0033265 | choline binding(GO:0033265) |
| 0.8 | 6.6 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.8 | 3.2 | GO:0004104 | acetylcholinesterase activity(GO:0003990) cholinesterase activity(GO:0004104) |
| 0.8 | 0.8 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.8 | 2.3 | GO:0035605 | peptidyl-cysteine S-nitrosylase activity(GO:0035605) |
| 0.8 | 2.3 | GO:0003826 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.7 | 2.2 | GO:0052858 | peptidyl-lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0052858) |
| 0.7 | 2.9 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.7 | 22.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.7 | 3.5 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
| 0.7 | 2.1 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.7 | 4.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.7 | 7.4 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.7 | 3.4 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 0.7 | 2.7 | GO:0016155 | formyltetrahydrofolate dehydrogenase activity(GO:0016155) |
| 0.7 | 4.0 | GO:0004368 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.7 | 6.0 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.6 | 2.6 | GO:0071885 | N-terminal protein N-methyltransferase activity(GO:0071885) |
| 0.6 | 5.0 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.6 | 4.4 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.6 | 1.9 | GO:0019166 | 2,4-dienoyl-CoA reductase (NADPH) activity(GO:0008670) trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.6 | 3.0 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.6 | 1.8 | GO:1904928 | coreceptor activity involved in canonical Wnt signaling pathway(GO:1904928) |
| 0.6 | 5.3 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.6 | 3.4 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.5 | 2.2 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.5 | 3.2 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.5 | 11.5 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.5 | 4.7 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.5 | 3.5 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
| 0.5 | 2.5 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.5 | 3.0 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
| 0.5 | 6.6 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.5 | 1.0 | GO:0070039 | rRNA (guanosine-2'-O-)-methyltransferase activity(GO:0070039) |
| 0.5 | 1.9 | GO:0005277 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.5 | 2.8 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.5 | 9.6 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.5 | 1.4 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 0.5 | 1.8 | GO:0004077 | biotin-[acetyl-CoA-carboxylase] ligase activity(GO:0004077) biotin-[methylcrotonoyl-CoA-carboxylase] ligase activity(GO:0004078) biotin-[methylmalonyl-CoA-carboxytransferase] ligase activity(GO:0004079) biotin-[propionyl-CoA-carboxylase (ATP-hydrolyzing)] ligase activity(GO:0004080) biotin-protein ligase activity(GO:0018271) |
| 0.4 | 2.2 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.4 | 4.5 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.4 | 1.8 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.4 | 3.5 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.4 | 3.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.4 | 2.6 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.4 | 1.3 | GO:0016652 | NAD(P)+ transhydrogenase activity(GO:0008746) oxidoreductase activity, acting on NAD(P)H, NAD(P) as acceptor(GO:0016652) |
| 0.4 | 1.3 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.4 | 2.0 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.4 | 0.4 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
| 0.4 | 1.2 | GO:0034057 | RNA strand-exchange activity(GO:0034057) |
| 0.4 | 6.0 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.4 | 2.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.4 | 3.5 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.4 | 7.8 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.4 | 3.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.4 | 3.1 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.4 | 1.9 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.4 | 1.9 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.4 | 1.9 | GO:0042781 | 3'-tRNA processing endoribonuclease activity(GO:0042781) |
| 0.4 | 1.9 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.4 | 3.0 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.4 | 1.5 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.4 | 0.7 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.4 | 2.9 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.4 | 11.8 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.4 | 4.2 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.3 | 3.5 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.3 | 1.0 | GO:0086039 | lutropin-choriogonadotropic hormone receptor binding(GO:0031775) calcium-transporting ATPase activity involved in regulation of cardiac muscle cell membrane potential(GO:0086039) |
| 0.3 | 6.8 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.3 | 1.4 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.3 | 1.0 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.3 | 1.4 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.3 | 1.4 | GO:0004001 | adenosine kinase activity(GO:0004001) |
| 0.3 | 1.3 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) |
| 0.3 | 2.0 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.3 | 2.7 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.3 | 1.0 | GO:0004047 | aminomethyltransferase activity(GO:0004047) |
| 0.3 | 5.6 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.3 | 5.2 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.3 | 3.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.3 | 2.2 | GO:0097108 | smoothened binding(GO:0005119) hedgehog family protein binding(GO:0097108) |
| 0.3 | 3.1 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.3 | 3.4 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.3 | 0.9 | GO:0015322 | proton-dependent oligopeptide secondary active transmembrane transporter activity(GO:0005427) secondary active oligopeptide transmembrane transporter activity(GO:0015322) |
| 0.3 | 0.9 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.3 | 0.9 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.3 | 2.7 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.3 | 3.2 | GO:0009374 | biotin binding(GO:0009374) |
| 0.3 | 1.5 | GO:0005334 | norepinephrine:sodium symporter activity(GO:0005334) |
| 0.3 | 10.4 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.3 | 3.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.3 | 2.3 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.3 | 3.4 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.3 | 1.6 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.3 | 0.8 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.3 | 8.1 | GO:0043495 | protein anchor(GO:0043495) |
| 0.3 | 1.0 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
| 0.3 | 1.3 | GO:0035473 | lipase binding(GO:0035473) |
| 0.3 | 7.9 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.3 | 1.0 | GO:0032406 | MutLbeta complex binding(GO:0032406) MutSbeta complex binding(GO:0032408) |
| 0.3 | 1.0 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.3 | 0.8 | GO:0015218 | pyrimidine nucleotide transmembrane transporter activity(GO:0015218) |
| 0.2 | 5.7 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.2 | 1.2 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.2 | 1.4 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.2 | 2.6 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.2 | 13.1 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.2 | 0.7 | GO:0097604 | temperature-gated cation channel activity(GO:0097604) |
| 0.2 | 3.5 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.2 | 2.1 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.2 | 2.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.2 | 0.7 | GO:0004584 | dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase activity(GO:0004584) |
| 0.2 | 0.9 | GO:0004485 | methylcrotonoyl-CoA carboxylase activity(GO:0004485) |
| 0.2 | 2.3 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.2 | 0.9 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.2 | 4.1 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.2 | 1.1 | GO:0004803 | transposase activity(GO:0004803) |
| 0.2 | 1.1 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 0.2 | 1.5 | GO:0008523 | sodium-dependent multivitamin transmembrane transporter activity(GO:0008523) |
| 0.2 | 2.4 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.2 | 1.3 | GO:0070888 | E-box binding(GO:0070888) |
| 0.2 | 5.7 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.2 | 0.6 | GO:0004500 | dopamine beta-monooxygenase activity(GO:0004500) |
| 0.2 | 2.6 | GO:0004465 | lipoprotein lipase activity(GO:0004465) |
| 0.2 | 1.5 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.2 | 4.1 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.2 | 3.0 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.2 | 4.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.2 | 0.8 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.2 | 0.6 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
| 0.2 | 1.5 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.2 | 1.7 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.2 | 1.2 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.2 | 1.6 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.2 | 1.9 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.2 | 2.2 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 0.2 | 4.2 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.2 | 1.2 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.2 | 4.0 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.2 | 3.7 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.2 | 0.6 | GO:0004418 | hydroxymethylbilane synthase activity(GO:0004418) |
| 0.2 | 5.4 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
| 0.2 | 1.2 | GO:0030298 | receptor signaling protein tyrosine kinase activator activity(GO:0030298) |
| 0.2 | 1.2 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.2 | 2.1 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) coreceptor activity involved in Wnt signaling pathway, planar cell polarity pathway(GO:1904929) |
| 0.2 | 0.6 | GO:0034602 | oxoglutarate dehydrogenase (NAD+) activity(GO:0034602) |
| 0.2 | 1.3 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.2 | 1.5 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.2 | 1.7 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.2 | 0.4 | GO:0016453 | C-acetyltransferase activity(GO:0016453) |
| 0.2 | 2.6 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.2 | 0.8 | GO:0035501 | MH1 domain binding(GO:0035501) |
| 0.2 | 0.9 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.2 | 1.9 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.2 | 0.6 | GO:0046715 | borate transmembrane transporter activity(GO:0046715) |
| 0.2 | 0.6 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.2 | 0.7 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.2 | 1.3 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.2 | 1.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.2 | 1.4 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.2 | 0.5 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) |
| 0.2 | 0.5 | GO:0001596 | angiotensin type I receptor activity(GO:0001596) |
| 0.2 | 0.7 | GO:0004087 | carbamoyl-phosphate synthase (ammonia) activity(GO:0004087) carbamoyl-phosphate synthase (glutamine-hydrolyzing) activity(GO:0004088) |
| 0.2 | 0.9 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.2 | 0.2 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.2 | 10.3 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.2 | 1.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.2 | 4.1 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.2 | 0.9 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.2 | 0.9 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.2 | 0.9 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.2 | 0.9 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.2 | 0.7 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.2 | 0.8 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.2 | 1.3 | GO:0043426 | MRF binding(GO:0043426) |
| 0.2 | 1.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.2 | 0.8 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.2 | 1.3 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.2 | 6.9 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.2 | 0.5 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.2 | 1.1 | GO:0038052 | RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
| 0.2 | 0.5 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
| 0.2 | 1.3 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.2 | 3.8 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.2 | 2.5 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.2 | 1.3 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.2 | 0.9 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.2 | 2.2 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.2 | 0.6 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.2 | 1.4 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.2 | 0.9 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.2 | 1.2 | GO:1901567 | icosanoid binding(GO:0050542) fatty acid derivative binding(GO:1901567) |
| 0.1 | 0.4 | GO:1990259 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.1 | 4.3 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.1 | 3.1 | GO:0008392 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.1 | 1.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 3.4 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.1 | 0.3 | GO:0004530 | deoxyribonuclease I activity(GO:0004530) |
| 0.1 | 0.6 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 0.3 | GO:0080130 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.1 | 3.6 | GO:0005536 | glucose binding(GO:0005536) |
| 0.1 | 1.0 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.1 | 1.7 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
| 0.1 | 0.6 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.1 | 3.3 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.1 | 0.4 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.1 | 4.7 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 0.7 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.1 | 0.6 | GO:1904713 | beta-catenin destruction complex binding(GO:1904713) |
| 0.1 | 0.7 | GO:0030621 | U4 snRNA binding(GO:0030621) U4atac snRNA binding(GO:0030622) |
| 0.1 | 1.7 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.1 | 1.5 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.1 | 0.5 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.1 | 0.8 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.1 | 0.4 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.1 | 2.6 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.1 | 2.4 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.1 | 25.5 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.1 | 0.4 | GO:0004507 | steroid 11-beta-monooxygenase activity(GO:0004507) corticosterone 18-monooxygenase activity(GO:0047783) |
| 0.1 | 0.7 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.1 | 1.7 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.1 | 0.5 | GO:0042132 | fructose 1,6-bisphosphate 1-phosphatase activity(GO:0042132) |
| 0.1 | 1.0 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.1 | 3.7 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.1 | 0.1 | GO:0001042 | RNA polymerase I core binding(GO:0001042) |
| 0.1 | 2.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 1.6 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 0.1 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.1 | 1.9 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.1 | 1.9 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 4.2 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.1 | 10.5 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) |
| 0.1 | 0.9 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 0.4 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.1 | 13.7 | GO:0098531 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
| 0.1 | 1.3 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.1 | 0.8 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.1 | 1.1 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.1 | 1.0 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.1 | 0.4 | GO:0000247 | C-8 sterol isomerase activity(GO:0000247) cholestenol delta-isomerase activity(GO:0047750) |
| 0.1 | 1.4 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.1 | 1.1 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.1 | 1.4 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.1 | 0.2 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.1 | 1.0 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 2.3 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.1 | 0.9 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.1 | 0.3 | GO:0005139 | interleukin-7 receptor binding(GO:0005139) |
| 0.1 | 0.7 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.1 | 5.3 | GO:0016896 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
| 0.1 | 1.0 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 0.9 | GO:0005534 | galactose binding(GO:0005534) |
| 0.1 | 0.4 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) |
| 0.1 | 2.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.1 | 3.5 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 1.8 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.1 | 9.4 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.1 | 1.4 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
| 0.1 | 0.3 | GO:0090409 | malonyl-CoA synthetase activity(GO:0090409) |
| 0.1 | 3.3 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.1 | 0.3 | GO:0036328 | VEGF-C-activated receptor activity(GO:0036328) |
| 0.1 | 0.8 | GO:0004122 | cystathionine beta-synthase activity(GO:0004122) |
| 0.1 | 1.1 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.1 | 0.3 | GO:0090422 | thiamine pyrophosphate transporter activity(GO:0090422) |
| 0.1 | 0.3 | GO:0004108 | citrate (Si)-synthase activity(GO:0004108) citrate synthase activity(GO:0036440) |
| 0.1 | 0.5 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.1 | 2.0 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.1 | 1.3 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.1 | 0.3 | GO:0016882 | cyclo-ligase activity(GO:0016882) 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.1 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.1 | 1.2 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.1 | 6.6 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.1 | 3.7 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.1 | 1.0 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.1 | 1.7 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.1 | 1.6 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) |
| 0.1 | 0.3 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.1 | 1.7 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.1 | 0.3 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.1 | 0.4 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
| 0.1 | 2.9 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.1 | 1.3 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.1 | 0.5 | GO:0052655 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.1 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.1 | 1.3 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.1 | 0.4 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.1 | 3.0 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 1.3 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.1 | 0.8 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 2.9 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.1 | 0.3 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.1 | 5.6 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.1 | 2.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.5 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.1 | 0.2 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.1 | 1.4 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 0.8 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.1 | 1.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.8 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.1 | 0.3 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.1 | 11.0 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.1 | 0.1 | GO:0016436 | rRNA (uridine-2'-O-)-methyltransferase activity(GO:0008650) rRNA (uridine) methyltransferase activity(GO:0016436) |
| 0.1 | 3.5 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.1 | 0.5 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.1 | 0.9 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 1.5 | GO:0015250 | water channel activity(GO:0015250) |
| 0.1 | 0.6 | GO:0016900 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.1 | 0.8 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.1 | 3.7 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.1 | 0.2 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.1 | 0.2 | GO:0005137 | interleukin-5 receptor binding(GO:0005137) |
| 0.1 | 0.4 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.9 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 2.6 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.1 | 0.5 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.1 | 1.6 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.1 | 2.0 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.1 | 2.5 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.1 | 0.6 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.1 | 0.6 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 0.2 | GO:0004615 | phosphomannomutase activity(GO:0004615) |
| 0.1 | 1.0 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.1 | 1.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.1 | 0.5 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.1 | 0.5 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
| 0.1 | 0.2 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.1 | 0.3 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 0.1 | 0.5 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.1 | 1.6 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.1 | 1.5 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.1 | 3.5 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.1 | 0.8 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.1 | 0.5 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.1 | 0.2 | GO:0052642 | lysophosphatidic acid phosphatase activity(GO:0052642) |
| 0.1 | 0.5 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.3 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.1 | 0.7 | GO:0055103 | ligase regulator activity(GO:0055103) |
| 0.1 | 0.3 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
| 0.1 | 0.4 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.1 | 1.1 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 12.6 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
| 0.1 | 0.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 0.7 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.1 | 1.7 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.1 | 1.2 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.1 | 5.6 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.1 | 1.8 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 4.3 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.1 | 0.4 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
| 0.1 | 5.3 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.1 | 1.2 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.1 | 2.0 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.1 | 2.0 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.1 | 0.3 | GO:0047374 | methylumbelliferyl-acetate deacetylase activity(GO:0047374) |
| 0.1 | 1.4 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.1 | 0.3 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.1 | 1.2 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 1.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.1 | 2.5 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.1 | 1.2 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.1 | 0.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.1 | 1.9 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 3.4 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 0.6 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.1 | 3.0 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.1 | 0.4 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.1 | 0.2 | GO:0004360 | glutamine-fructose-6-phosphate transaminase (isomerizing) activity(GO:0004360) L-glutamine aminotransferase activity(GO:0070548) |
| 0.1 | 0.6 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.1 | 1.8 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.1 | 0.2 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.1 | 5.4 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.1 | 6.9 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
| 0.1 | 0.3 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.1 | 0.8 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) RNA polymerase activity(GO:0034062) |
| 0.1 | 1.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 1.4 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.1 | 0.3 | GO:0097617 | annealing activity(GO:0097617) |
| 0.1 | 1.4 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.1 | 0.2 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.1 | 0.6 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.1 | 1.0 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.1 | 0.6 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 2.0 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.1 | 1.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.1 | 0.3 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.1 | 0.7 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.1 | 1.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 0.1 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.1 | 1.5 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.1 | 0.4 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.1 | 0.2 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.1 | 2.7 | GO:0016279 | protein-lysine N-methyltransferase activity(GO:0016279) |
| 0.1 | 0.2 | GO:0033754 | indoleamine 2,3-dioxygenase activity(GO:0033754) |
| 0.1 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 1.2 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 0.8 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.1 | 0.9 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.1 | 0.7 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
| 0.1 | 0.9 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.1 | 1.6 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.1 | 33.3 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.1 | 1.2 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.1 | 0.3 | GO:0050254 | rhodopsin kinase activity(GO:0050254) |
| 0.1 | 0.9 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.1 | 3.8 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.1 | 0.2 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.1 | 2.1 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 0.8 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.1 | 0.5 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.1 | 0.3 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.1 | 1.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.7 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.0 | 1.2 | GO:0004527 | exonuclease activity(GO:0004527) |
| 0.0 | 1.2 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 1.3 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.0 | 0.1 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.0 | 0.5 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.0 | 29.8 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
| 0.0 | 0.2 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.0 | 0.5 | GO:0089720 | caspase binding(GO:0089720) |
| 0.0 | 7.4 | GO:0019888 | protein phosphatase regulator activity(GO:0019888) |
| 0.0 | 0.3 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.0 | 87.9 | GO:0003723 | RNA binding(GO:0003723) |
| 0.0 | 0.2 | GO:0052810 | 1-phosphatidylinositol-5-kinase activity(GO:0052810) |
| 0.0 | 0.5 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.0 | 0.5 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.3 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.0 | 0.7 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.2 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.0 | 0.2 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.0 | 0.5 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.0 | 0.3 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 1.1 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) |
| 0.0 | 0.2 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.5 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 1.4 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 2.2 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.0 | 0.5 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 1.2 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.5 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.0 | 3.1 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 5.8 | GO:0000981 | RNA polymerase II transcription factor activity, sequence-specific DNA binding(GO:0000981) |
| 0.0 | 0.2 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.0 | 2.1 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.4 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.0 | 1.1 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.9 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.0 | 0.3 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.0 | 0.8 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.8 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.1 | GO:0060422 | peptidyl-dipeptidase inhibitor activity(GO:0060422) |
| 0.0 | 0.6 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.2 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.0 | 3.2 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 0.3 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.3 | GO:0003910 | DNA ligase (ATP) activity(GO:0003910) |
| 0.0 | 0.4 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
| 0.0 | 2.2 | GO:0008168 | methyltransferase activity(GO:0008168) |
| 0.0 | 0.3 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.0 | 0.9 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.4 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.0 | 0.7 | GO:0008026 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
| 0.0 | 0.4 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
| 0.0 | 0.3 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
| 0.0 | 0.8 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.0 | 0.6 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.1 | GO:0019781 | NEDD8 activating enzyme activity(GO:0019781) |
| 0.0 | 0.3 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.0 | 0.5 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 9.9 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 4.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.3 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.0 | 0.3 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.8 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.0 | 2.0 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.3 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.0 | 0.1 | GO:0004925 | prolactin receptor activity(GO:0004925) |
| 0.0 | 0.3 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.1 | GO:0034437 | glycoprotein transporter activity(GO:0034437) |
| 0.0 | 0.4 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.1 | GO:0052856 | NADHX epimerase activity(GO:0052856) NADPHX epimerase activity(GO:0052857) |
| 0.0 | 0.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.4 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.5 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.0 | 0.6 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.1 | GO:0097493 | extracellular matrix constituent conferring elasticity(GO:0030023) structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.3 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.4 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 1.1 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.1 | GO:0042020 | interleukin-23 binding(GO:0042019) interleukin-23 receptor activity(GO:0042020) |
| 0.0 | 1.3 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
| 0.0 | 0.6 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.2 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.0 | 0.9 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.0 | 0.8 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.0 | 0.3 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.1 | GO:0016497 | substance K receptor activity(GO:0016497) |
| 0.0 | 0.3 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.3 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.0 | 0.2 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.0 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.0 | 0.4 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.0 | 0.1 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.0 | 0.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 0.4 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.0 | 1.5 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.1 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.0 | 0.1 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.0 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097199) |
| 0.0 | 0.2 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.0 | 0.0 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 0.1 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.0 | 6.3 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
| 0.0 | 0.1 | GO:0018812 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) |
| 0.0 | 0.0 | GO:0004379 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
| 0.0 | 0.2 | GO:1901612 | cardiolipin binding(GO:1901612) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 1.4 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.5 | 10.9 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.4 | 62.2 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.3 | 10.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.2 | 6.4 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.2 | 4.9 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.2 | 8.5 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.2 | 21.4 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.2 | 14.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.1 | 3.0 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 1.0 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.1 | 4.8 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 8.7 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 5.0 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 17.0 | PID P73PATHWAY | p73 transcription factor network |
| 0.1 | 5.9 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.1 | 0.3 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.1 | 0.7 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 10.3 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 2.9 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.1 | 6.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 4.6 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 2.6 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 3.8 | PID FOXO PATHWAY | FoxO family signaling |
| 0.1 | 7.0 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.1 | 2.7 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.1 | 6.5 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.1 | 0.5 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.1 | 1.1 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 0.3 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 2.8 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.1 | 4.4 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 0.6 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.1 | 0.8 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.1 | 2.7 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.1 | 1.3 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.1 | 1.4 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.1 | 3.5 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.1 | 1.5 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 3.0 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.1 | 0.5 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 2.4 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 4.0 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.1 | 3.8 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.1 | 7.0 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 1.9 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 2.5 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 0.7 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 1.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 2.2 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.6 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.0 | 1.1 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.0 | 1.7 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 0.9 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 1.7 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 1.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 1.1 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.6 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.7 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.5 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 1.0 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.6 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.3 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.9 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.4 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.4 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.8 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.7 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.4 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.3 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.6 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.1 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 5.4 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.5 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.8 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.1 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 19.2 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.6 | 10.7 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.5 | 13.2 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.5 | 2.1 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.5 | 11.4 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.4 | 0.8 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.4 | 7.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.3 | 6.7 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.3 | 8.7 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.3 | 5.6 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.3 | 7.7 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.3 | 3.5 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.2 | 8.7 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.2 | 2.9 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.2 | 24.3 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.2 | 14.2 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.2 | 3.5 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.2 | 5.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.2 | 6.2 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.2 | 5.7 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.2 | 5.2 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.2 | 10.2 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.2 | 7.6 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.2 | 5.2 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.2 | 4.6 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.2 | 3.5 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.2 | 13.6 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.2 | 3.9 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.2 | 8.2 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.2 | 7.9 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.2 | 20.1 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 2.6 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.1 | 4.8 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.1 | 10.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 4.3 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.1 | 0.7 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.1 | 4.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.1 | 4.2 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.1 | 14.5 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.1 | 0.4 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.1 | 4.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 3.7 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 2.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.1 | 9.3 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.1 | 23.5 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.1 | 4.0 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.1 | 3.7 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.1 | 1.3 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.1 | 1.0 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.1 | 4.9 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 3.8 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.1 | 5.4 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.1 | 6.3 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.1 | 2.5 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 3.2 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 0.8 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.1 | 1.7 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.1 | 7.9 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.1 | 1.7 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 3.3 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.1 | 1.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 2.0 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.1 | 2.9 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 3.0 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 1.2 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.1 | 2.6 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 1.7 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.1 | 2.4 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 3.0 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.1 | 17.4 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.1 | 1.5 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.1 | 3.5 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.1 | 0.7 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.1 | 2.2 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.1 | 1.7 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 3.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 1.6 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 2.4 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.1 | 0.7 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.1 | 0.3 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.1 | 1.1 | REACTOME RNA POL II PRE TRANSCRIPTION EVENTS | Genes involved in RNA Polymerase II Pre-transcription Events |
| 0.1 | 1.9 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 2.6 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 1.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 0.7 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.1 | 3.6 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.1 | 3.4 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 1.1 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 2.1 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.1 | 1.1 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.1 | 1.0 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 2.2 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.1 | 1.2 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.1 | 1.4 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.1 | 0.7 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.1 | 0.3 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.1 | 0.4 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.4 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.0 | 3.7 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 1.4 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.8 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 2.1 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 1.0 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 1.2 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.8 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 0.9 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 1.4 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.3 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.0 | 0.9 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 4.8 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.8 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 5.4 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.5 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.9 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.2 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
| 0.0 | 0.9 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 0.8 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 3.3 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.9 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 1.0 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.2 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
| 0.0 | 0.4 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.3 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
| 0.0 | 6.9 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 1.1 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.0 | 0.4 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.0 | 0.3 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.6 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.9 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 0.8 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 0.8 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 0.6 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.0 | 0.6 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.4 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.0 | 0.5 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.2 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 0.6 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 1.6 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.0 | 0.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.0 | 0.2 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.0 | 0.6 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.2 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.0 | 0.6 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.5 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 1.2 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.1 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.0 | 0.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |