avrg: young vs old, Illumina Body Map 2 (GSE30611)
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
TFDP1
|
ENSG00000198176.13 | TFDP1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| TFDP1 | hg38_v1_chr13_+_113584683_113584762 | 0.12 | 5.2e-01 | Click! |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 4.8 | GO:0071962 | mitotic sister chromatid cohesion, centromeric(GO:0071962) |
| 1.6 | 1.6 | GO:0035574 | histone H4-K20 demethylation(GO:0035574) |
| 1.5 | 4.5 | GO:1904772 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 1.4 | 7.1 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
| 1.3 | 4.0 | GO:0002380 | immunoglobulin secretion involved in immune response(GO:0002380) |
| 1.3 | 5.3 | GO:1990108 | protein linear deubiquitination(GO:1990108) |
| 1.2 | 4.9 | GO:0006117 | acetaldehyde metabolic process(GO:0006117) |
| 1.2 | 9.6 | GO:0048619 | embryonic genitalia morphogenesis(GO:0030538) embryonic hindgut morphogenesis(GO:0048619) |
| 1.2 | 2.4 | GO:0021861 | forebrain radial glial cell differentiation(GO:0021861) |
| 1.1 | 5.7 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 1.1 | 4.3 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 1.0 | 3.0 | GO:1990922 | regulation of hepatic stellate cell proliferation(GO:1904897) positive regulation of hepatic stellate cell proliferation(GO:1904899) hepatic stellate cell proliferation(GO:1990922) |
| 0.9 | 2.8 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.9 | 2.8 | GO:0061485 | memory T cell proliferation(GO:0061485) |
| 0.9 | 4.5 | GO:2000174 | regulation of pro-T cell differentiation(GO:2000174) positive regulation of pro-T cell differentiation(GO:2000176) |
| 0.9 | 2.7 | GO:1904828 | regulation of phenotypic switching by transcription from RNA polymerase II promoter(GO:0100057) regulation of hydrogen sulfide biosynthetic process(GO:1904826) positive regulation of hydrogen sulfide biosynthetic process(GO:1904828) |
| 0.9 | 9.8 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.9 | 5.3 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.9 | 3.5 | GO:0097534 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
| 0.8 | 2.5 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.8 | 2.5 | GO:1902594 | viral penetration into host nucleus(GO:0075732) multi-organism nuclear import(GO:1902594) |
| 0.8 | 2.5 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
| 0.8 | 2.4 | GO:0021718 | superior olivary nucleus development(GO:0021718) superior olivary nucleus maturation(GO:0021722) |
| 0.8 | 2.4 | GO:1903452 | regulation of G1 to G0 transition(GO:1903450) positive regulation of G1 to G0 transition(GO:1903452) |
| 0.8 | 4.6 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
| 0.8 | 3.0 | GO:0051228 | mitotic spindle disassembly(GO:0051228) spindle disassembly(GO:0051230) |
| 0.8 | 3.0 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.7 | 2.2 | GO:0003192 | mitral valve formation(GO:0003192) |
| 0.7 | 1.5 | GO:0060066 | oviduct development(GO:0060066) |
| 0.7 | 1.4 | GO:2001038 | regulation of cellular response to drug(GO:2001038) |
| 0.7 | 2.1 | GO:0044725 | chromatin reprogramming in the zygote(GO:0044725) |
| 0.7 | 10.8 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.7 | 2.0 | GO:1905006 | negative regulation of cytokine activity(GO:0060302) negative regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905006) |
| 0.7 | 2.0 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.7 | 4.6 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.7 | 2.6 | GO:0033037 | polysaccharide localization(GO:0033037) |
| 0.6 | 3.2 | GO:0090402 | oncogene-induced cell senescence(GO:0090402) |
| 0.6 | 3.7 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.6 | 3.7 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.6 | 1.8 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.6 | 4.2 | GO:0031291 | Ran protein signal transduction(GO:0031291) |
| 0.6 | 2.4 | GO:1903182 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.6 | 3.5 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.6 | 1.7 | GO:2000798 | amniotic stem cell differentiation(GO:0097086) negative regulation of dense core granule biogenesis(GO:2000706) negative regulation of mesenchymal stem cell differentiation(GO:2000740) regulation of amniotic stem cell differentiation(GO:2000797) negative regulation of amniotic stem cell differentiation(GO:2000798) |
| 0.6 | 4.0 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.6 | 6.8 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.6 | 2.8 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.6 | 0.6 | GO:0050653 | chondroitin sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0050653) |
| 0.6 | 1.7 | GO:1905073 | occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 0.6 | 3.9 | GO:0071477 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.6 | 2.8 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.5 | 1.6 | GO:0010932 | macrophage tolerance induction(GO:0010931) regulation of macrophage tolerance induction(GO:0010932) positive regulation of macrophage tolerance induction(GO:0010933) |
| 0.5 | 1.6 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.5 | 1.6 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.5 | 1.6 | GO:0007057 | spindle assembly involved in female meiosis I(GO:0007057) |
| 0.5 | 2.6 | GO:0002513 | tolerance induction to self antigen(GO:0002513) |
| 0.5 | 5.2 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.5 | 3.1 | GO:1904800 | regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.5 | 2.6 | GO:0032796 | uropod organization(GO:0032796) |
| 0.5 | 5.7 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.5 | 3.1 | GO:0061187 | regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.5 | 1.5 | GO:0045994 | positive regulation of translational initiation by iron(GO:0045994) |
| 0.5 | 2.5 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.5 | 1.5 | GO:0048320 | axial mesoderm formation(GO:0048320) |
| 0.5 | 1.5 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.5 | 4.0 | GO:0090625 | mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.5 | 5.4 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.5 | 3.4 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.5 | 2.4 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
| 0.5 | 13.9 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.5 | 1.4 | GO:1903461 | Okazaki fragment processing involved in mitotic DNA replication(GO:1903461) |
| 0.5 | 1.9 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.5 | 1.4 | GO:2001037 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
| 0.5 | 1.4 | GO:0070105 | positive regulation of interleukin-6-mediated signaling pathway(GO:0070105) |
| 0.5 | 6.5 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.5 | 2.7 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.5 | 1.4 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.4 | 1.8 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.4 | 3.1 | GO:0060374 | mast cell differentiation(GO:0060374) |
| 0.4 | 0.9 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.4 | 1.3 | GO:0070377 | negative regulation of ERK5 cascade(GO:0070377) |
| 0.4 | 1.3 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
| 0.4 | 2.2 | GO:0034721 | histone H3-K4 demethylation, trimethyl-H3-K4-specific(GO:0034721) |
| 0.4 | 3.9 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.4 | 4.3 | GO:0060136 | enucleate erythrocyte differentiation(GO:0043353) embryonic process involved in female pregnancy(GO:0060136) |
| 0.4 | 1.3 | GO:0005999 | xylulose biosynthetic process(GO:0005999) |
| 0.4 | 1.3 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.4 | 5.9 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.4 | 1.7 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.4 | 0.8 | GO:1990164 | histone H2A phosphorylation(GO:1990164) |
| 0.4 | 2.9 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
| 0.4 | 2.9 | GO:0022614 | membrane to membrane docking(GO:0022614) |
| 0.4 | 0.4 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.4 | 2.0 | GO:1902339 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.4 | 0.4 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.4 | 6.8 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.4 | 7.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.4 | 2.4 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.4 | 7.0 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.4 | 1.5 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.4 | 3.1 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.4 | 5.3 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.4 | 4.2 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.4 | 6.8 | GO:0032625 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 0.4 | 10.2 | GO:0006337 | nucleosome disassembly(GO:0006337) |
| 0.4 | 1.5 | GO:0070429 | regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) |
| 0.4 | 1.1 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 0.4 | 4.8 | GO:1902748 | melanocyte migration(GO:0097324) positive regulation of lens fiber cell differentiation(GO:1902748) |
| 0.4 | 0.4 | GO:0006679 | glucosylceramide biosynthetic process(GO:0006679) |
| 0.4 | 1.9 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.4 | 1.8 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.4 | 1.5 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.4 | 2.9 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.4 | 3.7 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.4 | 2.2 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.4 | 2.9 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.4 | 4.3 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.4 | 0.4 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
| 0.4 | 0.7 | GO:0060032 | notochord regression(GO:0060032) |
| 0.4 | 2.1 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.3 | 3.4 | GO:0060992 | response to fungicide(GO:0060992) |
| 0.3 | 1.4 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.3 | 0.7 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
| 0.3 | 6.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.3 | 4.9 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
| 0.3 | 5.3 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.3 | 1.0 | GO:2000656 | regulation of apolipoprotein binding(GO:2000656) negative regulation of apolipoprotein binding(GO:2000657) |
| 0.3 | 1.6 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.3 | 0.3 | GO:0072199 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.3 | 3.5 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.3 | 0.3 | GO:1990785 | response to water-immersion restraint stress(GO:1990785) |
| 0.3 | 0.9 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.3 | 5.7 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 0.3 | 0.9 | GO:0098507 | polynucleotide 5' dephosphorylation(GO:0098507) |
| 0.3 | 0.3 | GO:1902823 | negative regulation of late endosome to lysosome transport(GO:1902823) |
| 0.3 | 0.3 | GO:0032986 | protein-DNA complex disassembly(GO:0032986) |
| 0.3 | 0.6 | GO:0002876 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) positive regulation of chronic inflammatory response to antigenic stimulus(GO:0002876) |
| 0.3 | 2.8 | GO:0033183 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.3 | 2.1 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.3 | 2.1 | GO:0040030 | regulation of molecular function, epigenetic(GO:0040030) |
| 0.3 | 0.6 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) regulation of positive thymic T cell selection(GO:1902232) |
| 0.3 | 1.5 | GO:1904868 | signal transduction involved in G2 DNA damage checkpoint(GO:0072425) signal transduction involved in mitotic G2 DNA damage checkpoint(GO:0072434) positive regulation of DNA catabolic process(GO:1903626) telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.3 | 0.9 | GO:0034471 | endonucleolytic cleavage to generate mature 5'-end of SSU-rRNA from (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000472) rRNA 5'-end processing(GO:0000967) ncRNA 5'-end processing(GO:0034471) |
| 0.3 | 1.8 | GO:0071386 | cellular response to corticosterone stimulus(GO:0071386) |
| 0.3 | 1.8 | GO:1904550 | chemotaxis to arachidonic acid(GO:0034670) response to arachidonic acid(GO:1904550) |
| 0.3 | 2.9 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.3 | 1.2 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.3 | 0.3 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.3 | 1.8 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.3 | 1.7 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.3 | 1.2 | GO:0061184 | positive regulation of dermatome development(GO:0061184) |
| 0.3 | 6.3 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.3 | 1.2 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.3 | 4.3 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.3 | 1.4 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.3 | 0.9 | GO:1901874 | negative regulation of post-translational protein modification(GO:1901874) |
| 0.3 | 19.0 | GO:1904837 | beta-catenin-TCF complex assembly(GO:1904837) |
| 0.3 | 0.3 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.3 | 0.8 | GO:0017186 | peptidyl-pyroglutamic acid biosynthetic process, using glutaminyl-peptide cyclotransferase(GO:0017186) |
| 0.3 | 1.6 | GO:0009957 | epidermal cell fate specification(GO:0009957) response to chlorate(GO:0010157) |
| 0.3 | 2.2 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.3 | 1.3 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.3 | 0.5 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.3 | 1.6 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.3 | 1.3 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.3 | 1.3 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.3 | 1.1 | GO:0019072 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.3 | 0.5 | GO:1904017 | cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.3 | 1.6 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
| 0.3 | 1.3 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
| 0.3 | 1.0 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.3 | 3.1 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
| 0.3 | 3.9 | GO:0021702 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.3 | 3.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.3 | 0.3 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.3 | 1.5 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.3 | 0.8 | GO:0071810 | regulation of fever generation by regulation of prostaglandin secretion(GO:0071810) positive regulation of fever generation by positive regulation of prostaglandin secretion(GO:0071812) positive regulation of ERK1 and ERK2 cascade via TNFSF11-mediated signaling(GO:0071848) regulation of fever generation by prostaglandin secretion(GO:0100009) |
| 0.3 | 0.8 | GO:1902769 | regulation of choline O-acetyltransferase activity(GO:1902769) positive regulation of choline O-acetyltransferase activity(GO:1902771) negative regulation of tau-protein kinase activity(GO:1902948) positive regulation of early endosome to recycling endosome transport(GO:1902955) negative regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902960) negative regulation of neurofibrillary tangle assembly(GO:1902997) negative regulation of aspartic-type peptidase activity(GO:1905246) |
| 0.2 | 1.7 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.2 | 3.0 | GO:0070734 | histone H3-K27 methylation(GO:0070734) |
| 0.2 | 0.2 | GO:0015847 | putrescine transport(GO:0015847) |
| 0.2 | 1.0 | GO:1904504 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
| 0.2 | 3.7 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
| 0.2 | 1.0 | GO:0043988 | histone H3-S10 phosphorylation(GO:0043987) histone H3-S28 phosphorylation(GO:0043988) |
| 0.2 | 2.2 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.2 | 1.7 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.2 | 6.0 | GO:0034356 | NAD biosynthesis via nicotinamide riboside salvage pathway(GO:0034356) |
| 0.2 | 1.9 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.2 | 1.7 | GO:0048549 | positive regulation of sodium:proton antiporter activity(GO:0032417) positive regulation of pinocytosis(GO:0048549) |
| 0.2 | 2.4 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.2 | 0.7 | GO:0072387 | flavin adenine dinucleotide metabolic process(GO:0072387) regulation of protein K63-linked deubiquitination(GO:1903004) positive regulation of protein K63-linked deubiquitination(GO:1903006) |
| 0.2 | 2.1 | GO:0035583 | sequestering of TGFbeta in extracellular matrix(GO:0035583) |
| 0.2 | 0.7 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 0.2 | 0.7 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.2 | 3.7 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
| 0.2 | 0.7 | GO:0035048 | splicing factor protein import into nucleus(GO:0035048) |
| 0.2 | 6.0 | GO:0031061 | negative regulation of histone methylation(GO:0031061) |
| 0.2 | 1.6 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.2 | 3.9 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.2 | 3.9 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.2 | 0.2 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 0.2 | 0.9 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.2 | 2.7 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.2 | 0.9 | GO:0002268 | follicular dendritic cell differentiation(GO:0002268) |
| 0.2 | 5.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.2 | 1.3 | GO:0033080 | immature T cell proliferation in thymus(GO:0033080) regulation of immature T cell proliferation in thymus(GO:0033084) negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.2 | 0.4 | GO:2000742 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.2 | 1.3 | GO:0035947 | regulation of gluconeogenesis by regulation of transcription from RNA polymerase II promoter(GO:0035947) |
| 0.2 | 0.7 | GO:0019230 | proprioception(GO:0019230) |
| 0.2 | 5.5 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
| 0.2 | 5.0 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.2 | 0.6 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.2 | 2.1 | GO:0060613 | fat pad development(GO:0060613) |
| 0.2 | 1.9 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.2 | 3.6 | GO:0060242 | contact inhibition(GO:0060242) |
| 0.2 | 1.7 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.2 | 0.8 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.2 | 0.6 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.2 | 0.2 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
| 0.2 | 0.2 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.2 | 0.4 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.2 | 2.3 | GO:0060295 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.2 | 0.6 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.2 | 6.3 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.2 | 5.5 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.2 | 0.8 | GO:0035853 | chromosome passenger complex localization to spindle midzone(GO:0035853) |
| 0.2 | 0.6 | GO:0036292 | DNA rewinding(GO:0036292) |
| 0.2 | 1.6 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.2 | 0.2 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.2 | 3.2 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.2 | 1.6 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.2 | 1.2 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.2 | 1.6 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.2 | 3.0 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.2 | 1.8 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.2 | 0.6 | GO:0044205 | 'de novo' UMP biosynthetic process(GO:0044205) |
| 0.2 | 0.8 | GO:0006272 | leading strand elongation(GO:0006272) |
| 0.2 | 0.2 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.2 | 0.6 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
| 0.2 | 2.5 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.2 | 0.8 | GO:0003290 | atrial septum secundum morphogenesis(GO:0003290) |
| 0.2 | 4.7 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.2 | 0.9 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.2 | 4.1 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.2 | 1.1 | GO:1903516 | regulation of single strand break repair(GO:1903516) |
| 0.2 | 1.3 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.2 | 0.4 | GO:0080120 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.2 | 1.8 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.2 | 0.9 | GO:1903028 | positive regulation of opsonization(GO:1903028) |
| 0.2 | 2.2 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.2 | 0.7 | GO:0015917 | aminophospholipid transport(GO:0015917) |
| 0.2 | 0.2 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.2 | 0.4 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.2 | 0.5 | GO:0042144 | vacuole fusion, non-autophagic(GO:0042144) |
| 0.2 | 2.8 | GO:0045408 | regulation of interleukin-6 biosynthetic process(GO:0045408) |
| 0.2 | 0.5 | GO:0036245 | cellular response to menadione(GO:0036245) |
| 0.2 | 0.5 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.2 | 2.1 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.2 | 0.3 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.2 | 0.7 | GO:0014040 | positive regulation of Schwann cell differentiation(GO:0014040) |
| 0.2 | 16.7 | GO:1902850 | microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.2 | 0.5 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.2 | 0.7 | GO:1902962 | regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902962) negative regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902963) |
| 0.2 | 3.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.2 | 1.0 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.2 | 0.7 | GO:2000687 | negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.2 | 1.9 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.2 | 3.5 | GO:0035066 | positive regulation of histone acetylation(GO:0035066) |
| 0.2 | 0.7 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.2 | 0.8 | GO:1904744 | regulation of telomeric DNA binding(GO:1904742) positive regulation of telomeric DNA binding(GO:1904744) |
| 0.2 | 0.7 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.2 | 1.2 | GO:0021747 | cochlear nucleus development(GO:0021747) |
| 0.2 | 2.8 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.2 | 4.6 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
| 0.2 | 0.8 | GO:1902499 | positive regulation of protein autoubiquitination(GO:1902499) |
| 0.2 | 1.6 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.2 | 6.1 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.2 | 0.6 | GO:0030047 | actin modification(GO:0030047) |
| 0.2 | 0.6 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.2 | 0.9 | GO:2000343 | regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
| 0.2 | 1.4 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.2 | 0.8 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.2 | 0.6 | GO:1904925 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.2 | 3.2 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.2 | 1.5 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.2 | 0.6 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.1 | 1.2 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 2.4 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.1 | 4.6 | GO:0043555 | regulation of translation in response to stress(GO:0043555) |
| 0.1 | 2.8 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.1 | 0.6 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 | 0.4 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
| 0.1 | 0.7 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.1 | 2.6 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.1 | 1.0 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.1 | 0.4 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.1 | 0.4 | GO:0031627 | telomeric loop formation(GO:0031627) |
| 0.1 | 1.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.1 | 0.6 | GO:0006238 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) CMP metabolic process(GO:0046035) |
| 0.1 | 2.9 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.1 | 1.0 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 | 1.3 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.1 | 1.7 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 0.7 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.1 | 0.7 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.1 | 0.8 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 | 0.5 | GO:1904782 | negative regulation of glutamate receptor signaling pathway(GO:1900450) negative regulation of NMDA glutamate receptor activity(GO:1904782) positive regulation of NMDA glutamate receptor activity(GO:1904783) |
| 0.1 | 1.6 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.1 | 1.9 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.1 | 1.2 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.1 | 0.8 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.1 | 0.4 | GO:0051389 | inactivation of MAPKK activity(GO:0051389) |
| 0.1 | 0.8 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.1 | 0.5 | GO:1903936 | cellular response to sodium arsenite(GO:1903936) |
| 0.1 | 3.5 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 0.7 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 | 0.5 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
| 0.1 | 0.4 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.1 | 0.5 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.1 | 1.9 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
| 0.1 | 0.8 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 | 0.5 | GO:0046833 | positive regulation of nucleobase-containing compound transport(GO:0032241) positive regulation of RNA export from nucleus(GO:0046833) |
| 0.1 | 0.5 | GO:0042247 | morphogenesis of follicular epithelium(GO:0016333) establishment or maintenance of polarity of follicular epithelium(GO:0016334) establishment of planar polarity of follicular epithelium(GO:0042247) |
| 0.1 | 0.6 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.1 | 1.4 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.1 | 1.2 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.1 | 0.4 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
| 0.1 | 0.4 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.1 | 2.0 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.1 | 0.5 | GO:1901836 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.1 | 2.7 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.1 | 2.4 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 | 0.7 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.1 | 0.7 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.1 | 1.0 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.1 | 0.1 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.1 | 0.6 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 3.7 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
| 0.1 | 1.4 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.1 | 0.7 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.1 | 1.4 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.1 | 1.2 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.1 | 2.3 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.1 | 2.0 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.1 | 2.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 0.7 | GO:1904674 | positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.1 | 1.0 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.1 | 0.6 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 1.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 | 0.5 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.1 | 3.6 | GO:0030220 | platelet formation(GO:0030220) |
| 0.1 | 1.6 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 | 0.7 | GO:0072423 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) |
| 0.1 | 5.8 | GO:0070911 | global genome nucleotide-excision repair(GO:0070911) |
| 0.1 | 0.2 | GO:0097198 | histone H3-K36 trimethylation(GO:0097198) |
| 0.1 | 1.4 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.1 | 0.6 | GO:0046778 | modification by virus of host mRNA processing(GO:0046778) |
| 0.1 | 1.9 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.1 | 0.2 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.1 | 0.3 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.1 | 3.0 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.1 | 0.2 | GO:0032258 | CVT pathway(GO:0032258) |
| 0.1 | 2.0 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.1 | 0.5 | GO:1905167 | positive regulation of lysosomal protein catabolic process(GO:1905167) |
| 0.1 | 0.7 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.5 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 2.9 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.1 | 2.2 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.1 | 0.8 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.1 | 1.1 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.1 | 3.1 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.1 | 7.2 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.1 | 0.5 | GO:0035803 | egg coat formation(GO:0035803) |
| 0.1 | 1.8 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.1 | 0.6 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.1 | 1.9 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.1 | 2.2 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.1 | 0.4 | GO:0000961 | negative regulation of mitochondrial RNA catabolic process(GO:0000961) |
| 0.1 | 1.3 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.5 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.1 | 1.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.1 | 0.6 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.1 | 1.0 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.1 | 0.2 | GO:0060424 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.1 | 0.6 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.1 | 0.8 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.1 | 0.8 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 0.8 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.1 | 0.2 | GO:0007518 | myoblast fate determination(GO:0007518) |
| 0.1 | 1.1 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 | 4.3 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.1 | 0.1 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
| 0.1 | 0.5 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.1 | 1.8 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.1 | 0.3 | GO:0060459 | subthalamic nucleus development(GO:0021763) prolactin secreting cell differentiation(GO:0060127) left lung development(GO:0060459) left lung morphogenesis(GO:0060460) pulmonary vein morphogenesis(GO:0060577) superior vena cava morphogenesis(GO:0060578) |
| 0.1 | 0.4 | GO:0090116 | C-5 methylation of cytosine(GO:0090116) |
| 0.1 | 0.8 | GO:0006297 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.1 | 0.5 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.1 | 0.3 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.1 | 0.4 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
| 0.1 | 0.1 | GO:0098917 | retrograde trans-synaptic signaling(GO:0098917) |
| 0.1 | 1.1 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.1 | 1.0 | GO:0036337 | Fas signaling pathway(GO:0036337) |
| 0.1 | 0.3 | GO:0014034 | neural crest cell fate commitment(GO:0014034) |
| 0.1 | 0.6 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.1 | 0.2 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 | 0.5 | GO:0072752 | cellular response to rapamycin(GO:0072752) |
| 0.1 | 1.0 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.1 | 0.4 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 0.8 | GO:0045136 | development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
| 0.1 | 1.3 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.1 | 0.3 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) positive regulation of mast cell cytokine production(GO:0032765) |
| 0.1 | 0.4 | GO:1904566 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.1 | 2.9 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
| 0.1 | 0.6 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.1 | 9.2 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 | 0.9 | GO:0090205 | positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.1 | 0.7 | GO:0071168 | protein localization to chromatin(GO:0071168) |
| 0.1 | 0.2 | GO:0035668 | TRAM-dependent toll-like receptor signaling pathway(GO:0035668) TRAM-dependent toll-like receptor 4 signaling pathway(GO:0035669) |
| 0.1 | 0.2 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.1 | 1.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.1 | 0.3 | GO:2000158 | regulation of ubiquitin-specific protease activity(GO:2000152) positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.1 | 3.1 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.1 | 1.3 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.1 | 0.5 | GO:1904896 | ESCRT complex disassembly(GO:1904896) ESCRT III complex disassembly(GO:1904903) |
| 0.1 | 0.5 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.1 | 1.3 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.1 | 0.2 | GO:1905051 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.1 | 1.1 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.1 | 0.3 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.1 | 0.2 | GO:0001839 | neural plate morphogenesis(GO:0001839) |
| 0.1 | 0.1 | GO:0001743 | optic placode formation(GO:0001743) |
| 0.1 | 2.2 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.1 | 2.5 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.1 | 4.0 | GO:0016573 | histone acetylation(GO:0016573) |
| 0.1 | 0.7 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
| 0.1 | 1.1 | GO:0060965 | negative regulation of gene silencing by miRNA(GO:0060965) |
| 0.1 | 0.1 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.1 | 1.3 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.1 | 0.8 | GO:1903358 | regulation of Golgi organization(GO:1903358) |
| 0.1 | 0.4 | GO:0075713 | establishment of integrated proviral latency(GO:0075713) |
| 0.1 | 1.7 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.1 | 1.4 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.1 | 0.3 | GO:0048617 | foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
| 0.1 | 2.6 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.1 | 0.1 | GO:0060268 | negative regulation of respiratory burst(GO:0060268) |
| 0.1 | 0.2 | GO:0003274 | endocardial cushion fusion(GO:0003274) endocardial cell fate commitment(GO:0060957) endocardial cushion cell fate commitment(GO:0061445) |
| 0.1 | 1.3 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.1 | 0.1 | GO:0002357 | defense response to tumor cell(GO:0002357) |
| 0.1 | 0.8 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.1 | 3.5 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.1 | 5.0 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
| 0.1 | 0.9 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.1 | 0.8 | GO:0043576 | regulation of respiratory gaseous exchange(GO:0043576) |
| 0.1 | 1.2 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.1 | 0.6 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.1 | 0.9 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 | 0.3 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.1 | 0.1 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 | 1.4 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
| 0.1 | 0.6 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
| 0.1 | 1.6 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.1 | 0.4 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.1 | 2.2 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.1 | 0.3 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.1 | 2.5 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.1 | 0.7 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.1 | 0.7 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.1 | 0.4 | GO:0019075 | virus maturation(GO:0019075) |
| 0.1 | 0.3 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.1 | 1.3 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 | 0.1 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) |
| 0.1 | 4.2 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
| 0.1 | 0.2 | GO:0070431 | nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.1 | 0.6 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 0.4 | GO:0021626 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
| 0.1 | 1.0 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 1.0 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.1 | 0.2 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.1 | 0.3 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.1 | 1.6 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.1 | 1.7 | GO:0051923 | sulfation(GO:0051923) |
| 0.1 | 0.1 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.1 | 0.4 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.1 | 0.7 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.1 | 0.2 | GO:0048200 | COPI-coated vesicle budding(GO:0035964) Golgi transport vesicle coating(GO:0048200) COPI coating of Golgi vesicle(GO:0048205) |
| 0.1 | 0.7 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
| 0.1 | 0.2 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
| 0.1 | 2.0 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.1 | 0.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.1 | 0.3 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 | 5.2 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.1 | 0.2 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.1 | 1.4 | GO:0006359 | regulation of transcription from RNA polymerase III promoter(GO:0006359) |
| 0.1 | 0.9 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) endocardial cell differentiation(GO:0060956) |
| 0.1 | 0.5 | GO:0045002 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) double-strand break repair via single-strand annealing(GO:0045002) |
| 0.1 | 0.2 | GO:0040040 | thermosensory behavior(GO:0040040) |
| 0.1 | 0.2 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.1 | 0.5 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
| 0.1 | 2.4 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 | 0.6 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.1 | 0.2 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.1 | 0.6 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.1 | 0.5 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.1 | 1.8 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.1 | 0.7 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 1.2 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.1 | 0.2 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.1 | 1.0 | GO:0032329 | serine transport(GO:0032329) |
| 0.1 | 2.4 | GO:0034728 | nucleosome organization(GO:0034728) |
| 0.1 | 0.4 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
| 0.1 | 0.3 | GO:0035865 | cellular response to potassium ion(GO:0035865) |
| 0.1 | 0.9 | GO:0007077 | mitotic nuclear envelope disassembly(GO:0007077) |
| 0.1 | 1.2 | GO:0007143 | female meiotic division(GO:0007143) |
| 0.1 | 3.6 | GO:0044364 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| 0.1 | 1.6 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 | 1.5 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
| 0.0 | 2.8 | GO:0051646 | mitochondrion localization(GO:0051646) |
| 0.0 | 5.1 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) |
| 0.0 | 1.0 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.0 | 1.0 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.0 | 0.7 | GO:0007130 | synaptonemal complex assembly(GO:0007130) synaptonemal complex organization(GO:0070193) |
| 0.0 | 0.3 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.0 | 0.8 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
| 0.0 | 0.1 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 0.0 | 0.5 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.1 | GO:0016267 | O-glycan processing, core 1(GO:0016267) |
| 0.0 | 0.8 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 2.4 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 1.6 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.0 | 0.2 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.0 | 1.2 | GO:0045814 | negative regulation of gene expression, epigenetic(GO:0045814) |
| 0.0 | 0.5 | GO:0034465 | response to carbon monoxide(GO:0034465) |
| 0.0 | 1.1 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.0 | 0.6 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.0 | 0.1 | GO:1902741 | type I interferon secretion(GO:0072641) interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.0 | 1.6 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 1.4 | GO:0009311 | oligosaccharide metabolic process(GO:0009311) |
| 0.0 | 1.5 | GO:0007140 | male meiosis(GO:0007140) |
| 0.0 | 0.3 | GO:0060174 | limb bud formation(GO:0060174) |
| 0.0 | 0.3 | GO:0036093 | male germ cell proliferation(GO:0002176) germ cell proliferation(GO:0036093) |
| 0.0 | 0.5 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.0 | 0.4 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
| 0.0 | 0.6 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.0 | 0.2 | GO:0000451 | rRNA 2'-O-methylation(GO:0000451) |
| 0.0 | 6.1 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 | 0.5 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.5 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.0 | 1.1 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.0 | 0.8 | GO:0031958 | corticosteroid receptor signaling pathway(GO:0031958) glucocorticoid receptor signaling pathway(GO:0042921) |
| 0.0 | 1.4 | GO:0032508 | DNA duplex unwinding(GO:0032508) |
| 0.0 | 1.0 | GO:0046463 | neutral lipid biosynthetic process(GO:0046460) acylglycerol biosynthetic process(GO:0046463) |
| 0.0 | 0.7 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.0 | 0.2 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.0 | 0.2 | GO:1902430 | negative regulation of beta-amyloid formation(GO:1902430) |
| 0.0 | 0.3 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.2 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.0 | 0.9 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.0 | 1.2 | GO:0045987 | positive regulation of smooth muscle contraction(GO:0045987) |
| 0.0 | 0.1 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 0.0 | 0.8 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 | 0.2 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.0 | 0.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 | 0.4 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.0 | 0.7 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.0 | 0.5 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.0 | 1.2 | GO:0036150 | phosphatidylserine acyl-chain remodeling(GO:0036150) |
| 0.0 | 0.3 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.0 | 0.6 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.0 | 1.1 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.0 | 0.5 | GO:1990776 | response to angiotensin(GO:1990776) |
| 0.0 | 0.3 | GO:0046078 | dUMP metabolic process(GO:0046078) |
| 0.0 | 1.4 | GO:0071158 | positive regulation of cell cycle arrest(GO:0071158) |
| 0.0 | 0.4 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
| 0.0 | 0.6 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.1 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.0 | 0.8 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.6 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.8 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 0.5 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.0 | 0.8 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 1.4 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
| 0.0 | 0.6 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
| 0.0 | 1.3 | GO:0033173 | calcineurin-NFAT signaling cascade(GO:0033173) |
| 0.0 | 0.2 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.0 | 0.2 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.0 | 0.1 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.0 | 0.2 | GO:2000047 | regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
| 0.0 | 2.3 | GO:0016925 | protein sumoylation(GO:0016925) |
| 0.0 | 0.3 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.3 | GO:0006658 | phosphatidylserine metabolic process(GO:0006658) |
| 0.0 | 0.4 | GO:0000732 | strand displacement(GO:0000732) |
| 0.0 | 0.4 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 | 1.4 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 3.1 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 1.1 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.0 | 0.2 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.0 | 1.0 | GO:0042795 | snRNA transcription(GO:0009301) snRNA metabolic process(GO:0016073) snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.6 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.0 | 0.7 | GO:0098877 | neurotransmitter receptor transport to plasma membrane(GO:0098877) neurotransmitter receptor transport to postsynaptic membrane(GO:0098969) establishment of protein localization to postsynaptic membrane(GO:1903540) |
| 0.0 | 1.8 | GO:0035914 | skeletal muscle cell differentiation(GO:0035914) |
| 0.0 | 0.2 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
| 0.0 | 1.0 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
| 0.0 | 0.1 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 0.0 | 0.1 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.0 | 0.5 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
| 0.0 | 0.2 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.0 | 0.4 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.4 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.2 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.0 | 0.3 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.0 | 0.3 | GO:0032506 | cytokinetic process(GO:0032506) |
| 0.0 | 0.3 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.3 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.0 | 0.8 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.0 | 0.9 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.0 | 0.2 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 | 0.1 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
| 0.0 | 0.3 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.0 | 0.1 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.0 | 0.6 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 1.4 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.3 | GO:0021769 | orbitofrontal cortex development(GO:0021769) |
| 0.0 | 0.1 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.0 | 0.1 | GO:0009386 | translational attenuation(GO:0009386) |
| 0.0 | 0.3 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.3 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.0 | 0.3 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.1 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.0 | 1.1 | GO:0032011 | ARF protein signal transduction(GO:0032011) |
| 0.0 | 0.5 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.0 | 3.6 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.0 | 0.1 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.0 | 0.1 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.0 | 0.4 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 2.1 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
| 0.0 | 0.8 | GO:0006998 | nuclear envelope organization(GO:0006998) |
| 0.0 | 0.8 | GO:0060612 | adipose tissue development(GO:0060612) |
| 0.0 | 0.3 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.0 | 0.0 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.0 | 0.4 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.2 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.0 | 0.1 | GO:0061182 | negative regulation of chondrocyte development(GO:0061182) |
| 0.0 | 0.2 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.0 | 0.2 | GO:1903826 | arginine transmembrane transport(GO:1903826) |
| 0.0 | 0.1 | GO:1904397 | negative regulation of neuromuscular junction development(GO:1904397) |
| 0.0 | 1.8 | GO:0001578 | microtubule bundle formation(GO:0001578) |
| 0.0 | 0.1 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.0 | 0.1 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) small RNA loading onto RISC(GO:0070922) |
| 0.0 | 0.1 | GO:1902462 | transforming growth factor beta activation(GO:0036363) mesenchymal stem cell proliferation(GO:0097168) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.0 | 0.4 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.0 | 0.2 | GO:0061157 | mRNA destabilization(GO:0061157) |
| 0.0 | 0.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 | 0.1 | GO:0002606 | dendritic cell antigen processing and presentation(GO:0002468) positive regulation of antigen processing and presentation(GO:0002579) regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
| 0.0 | 0.2 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.0 | 0.3 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.0 | 0.1 | GO:1903309 | negative regulation of chromatin modification(GO:1903309) |
| 0.0 | 2.0 | GO:0006338 | chromatin remodeling(GO:0006338) |
| 0.0 | 0.3 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.2 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 | 0.9 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
| 0.0 | 0.3 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.0 | 1.1 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
| 0.0 | 0.5 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.0 | 0.2 | GO:0015801 | aromatic amino acid transport(GO:0015801) thyroid hormone transport(GO:0070327) |
| 0.0 | 0.8 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.0 | 0.4 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
| 0.0 | 0.1 | GO:0007314 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) P granule organization(GO:0030719) |
| 0.0 | 0.2 | GO:0044597 | polyketide metabolic process(GO:0030638) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.4 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 | 0.0 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
| 0.0 | 0.2 | GO:0035872 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) |
| 0.0 | 0.1 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
| 0.0 | 0.1 | GO:0036508 | protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.0 | 0.3 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.0 | 0.0 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.0 | 0.9 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.0 | 1.5 | GO:0060337 | type I interferon signaling pathway(GO:0060337) cellular response to type I interferon(GO:0071357) |
| 0.0 | 0.6 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 | 0.1 | GO:1902884 | positive regulation of response to oxidative stress(GO:1902884) |
| 0.0 | 0.1 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) |
| 0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.3 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.0 | 0.4 | GO:0072698 | protein localization to microtubule cytoskeleton(GO:0072698) |
| 0.0 | 0.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.2 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.5 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
| 0.0 | 0.2 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.0 | 0.0 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.0 | 2.6 | GO:0016579 | protein deubiquitination(GO:0016579) |
| 0.0 | 0.2 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.3 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
| 0.0 | 0.1 | GO:0097338 | response to clozapine(GO:0097338) |
| 0.0 | 0.2 | GO:0019054 | modulation by virus of host process(GO:0019054) |
| 0.0 | 0.1 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 | 0.0 | GO:0001555 | oocyte growth(GO:0001555) |
| 0.0 | 0.1 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 | 0.1 | GO:0061074 | regulation of neural retina development(GO:0061074) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 4.9 | GO:0035525 | NF-kappaB p50/p65 complex(GO:0035525) |
| 0.8 | 4.2 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.8 | 5.6 | GO:0031523 | Myb complex(GO:0031523) |
| 0.7 | 4.1 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.7 | 5.4 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.7 | 5.4 | GO:0031415 | NatA complex(GO:0031415) |
| 0.6 | 1.9 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.6 | 7.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.6 | 2.4 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.6 | 1.8 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.6 | 0.6 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.5 | 1.6 | GO:0075341 | host cell PML body(GO:0075341) |
| 0.5 | 4.5 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.5 | 2.4 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.4 | 1.7 | GO:0035517 | PR-DUB complex(GO:0035517) |
| 0.4 | 6.9 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.4 | 6.9 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.4 | 2.4 | GO:0032449 | CBM complex(GO:0032449) |
| 0.4 | 9.1 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.4 | 0.4 | GO:0043614 | multi-eIF complex(GO:0043614) |
| 0.4 | 4.9 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.4 | 2.3 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.4 | 1.1 | GO:0060987 | lipid tube(GO:0060987) |
| 0.4 | 0.4 | GO:0016589 | NURF complex(GO:0016589) |
| 0.4 | 2.6 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.4 | 5.6 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.4 | 3.7 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.4 | 2.2 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.4 | 3.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.4 | 1.1 | GO:0032116 | SMC loading complex(GO:0032116) |
| 0.3 | 16.0 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.3 | 15.2 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.3 | 2.6 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.3 | 3.0 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.3 | 5.5 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.3 | 20.4 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.3 | 3.8 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.3 | 4.7 | GO:0032059 | bleb(GO:0032059) |
| 0.3 | 4.0 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.3 | 2.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.3 | 0.6 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.3 | 3.9 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.3 | 3.0 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.3 | 0.9 | GO:0000805 | X chromosome(GO:0000805) |
| 0.3 | 0.6 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 0.3 | 2.0 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.3 | 0.9 | GO:0071062 | alphav-beta3 integrin-vitronectin complex(GO:0071062) |
| 0.3 | 0.6 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.3 | 5.7 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.3 | 5.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.3 | 3.3 | GO:0072487 | MSL complex(GO:0072487) |
| 0.3 | 0.8 | GO:0031251 | PAN complex(GO:0031251) |
| 0.3 | 0.3 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.3 | 4.3 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.3 | 4.0 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.3 | 2.6 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.3 | 0.5 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.2 | 1.7 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.2 | 3.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.2 | 1.7 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.2 | 3.8 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.2 | 2.3 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.2 | 1.4 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.2 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
| 0.2 | 3.7 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.2 | 1.5 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.2 | 5.5 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.2 | 3.7 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.2 | 3.2 | GO:0060091 | kinocilium(GO:0060091) |
| 0.2 | 4.9 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.2 | 0.2 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.2 | 1.7 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.2 | 1.0 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.2 | 2.2 | GO:0045120 | pronucleus(GO:0045120) |
| 0.2 | 7.2 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.2 | 34.2 | GO:0016605 | PML body(GO:0016605) |
| 0.2 | 0.6 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.2 | 3.1 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.2 | 1.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.2 | 2.3 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 0.2 | 0.7 | GO:0043293 | apoptosome(GO:0043293) |
| 0.2 | 0.4 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.2 | 1.4 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.2 | 4.3 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.2 | 3.2 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
| 0.2 | 0.7 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.2 | 2.5 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.2 | 1.8 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.2 | 0.9 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.2 | 1.0 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.2 | 0.7 | GO:0033167 | ARC complex(GO:0033167) |
| 0.2 | 1.2 | GO:0001652 | granular component(GO:0001652) |
| 0.2 | 0.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.2 | 0.7 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
| 0.2 | 1.5 | GO:0090543 | Flemming body(GO:0090543) |
| 0.2 | 4.7 | GO:0070822 | Sin3-type complex(GO:0070822) |
| 0.2 | 1.3 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
| 0.2 | 0.5 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.2 | 1.6 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.2 | 0.3 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
| 0.2 | 7.4 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.2 | 57.0 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.2 | 1.6 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.2 | 1.8 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.2 | 15.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 0.4 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 1.6 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.1 | 0.4 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 0.1 | 1.8 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 0.8 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.1 | 2.2 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.1 | 0.8 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.1 | 4.2 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.1 | 2.9 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.1 | 3.5 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 3.1 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 1.0 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
| 0.1 | 3.8 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.1 | 1.1 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 0.6 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.1 | 0.5 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.1 | 1.0 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.1 | 1.7 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.1 | 9.4 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.1 | 7.1 | GO:0016592 | mediator complex(GO:0016592) |
| 0.1 | 0.6 | GO:0000126 | transcription factor TFIIIB complex(GO:0000126) |
| 0.1 | 1.3 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 0.1 | 0.4 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.1 | 2.9 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 2.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.1 | 1.3 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 0.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.1 | 0.5 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.1 | 0.5 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.1 | 3.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 2.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 2.9 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.1 | 1.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.1 | 1.4 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 4.5 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.1 | 0.3 | GO:0000333 | telomerase catalytic core complex(GO:0000333) |
| 0.1 | 1.8 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.1 | 1.8 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.1 | 1.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.1 | 5.7 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.1 | 0.5 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
| 0.1 | 5.9 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.1 | 0.5 | GO:0034753 | nuclear aryl hydrocarbon receptor complex(GO:0034753) |
| 0.1 | 0.9 | GO:0010369 | chromocenter(GO:0010369) |
| 0.1 | 0.8 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.1 | 1.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 0.4 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) |
| 0.1 | 1.5 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 0.5 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.1 | 0.6 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.1 | 0.5 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.1 | 1.0 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 5.7 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
| 0.1 | 0.4 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 0.6 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.1 | 0.5 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.1 | 1.0 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 0.9 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.1 | 0.6 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 0.7 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.1 | 9.3 | GO:0035577 | azurophil granule membrane(GO:0035577) |
| 0.1 | 0.3 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.1 | 0.6 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 1.4 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 0.9 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 0.7 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 0.2 | GO:0035101 | FACT complex(GO:0035101) |
| 0.1 | 0.3 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.1 | 2.2 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.1 | 8.1 | GO:0000785 | chromatin(GO:0000785) |
| 0.1 | 0.2 | GO:0097409 | glial cytoplasmic inclusion(GO:0097409) classical Lewy body(GO:0097414) Lewy neurite(GO:0097462) Lewy body corona(GO:1990038) |
| 0.1 | 1.9 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 0.2 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 7.0 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.1 | 3.1 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 0.3 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 0.6 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.1 | 0.5 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.1 | 1.6 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.1 | 5.5 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.1 | 0.5 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.1 | 0.5 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.1 | 0.3 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.1 | 0.3 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.1 | 4.2 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.1 | 0.6 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 0.7 | GO:0098560 | cytoplasmic side of early endosome membrane(GO:0098559) cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.1 | 10.4 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.1 | 0.7 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.1 | 1.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 4.8 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 0.4 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 1.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 1.1 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 0.8 | GO:0097433 | dense body(GO:0097433) |
| 0.1 | 0.6 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.1 | 2.1 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.1 | 0.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 1.3 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.1 | 0.7 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.1 | 7.8 | GO:0000922 | spindle pole(GO:0000922) |
| 0.1 | 0.8 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 7.1 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.1 | 4.8 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.1 | 0.9 | GO:0005845 | mRNA cap binding complex(GO:0005845) |
| 0.1 | 0.5 | GO:0097413 | Lewy body(GO:0097413) |
| 0.1 | 3.2 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.1 | 43.7 | GO:0016604 | nuclear body(GO:0016604) |
| 0.1 | 6.8 | GO:0005819 | spindle(GO:0005819) |
| 0.1 | 0.3 | GO:0001741 | XY body(GO:0001741) |
| 0.1 | 0.5 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.1 | 1.3 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.1 | 1.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 5.3 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 4.4 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.2 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 0.5 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.0 | 2.0 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.3 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 0.5 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.0 | 5.5 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.4 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.0 | 2.3 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.5 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
| 0.0 | 1.2 | GO:0034399 | nuclear periphery(GO:0034399) |
| 0.0 | 0.1 | GO:0034657 | GID complex(GO:0034657) |
| 0.0 | 1.3 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.4 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 2.6 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 1.1 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.5 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.3 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.0 | 0.4 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.2 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.0 | 0.7 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 1.7 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 1.7 | GO:0035770 | ribonucleoprotein granule(GO:0035770) |
| 0.0 | 0.0 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.0 | 0.4 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 100.6 | GO:0005654 | nucleoplasm(GO:0005654) |
| 0.0 | 0.1 | GO:0002133 | polycystin complex(GO:0002133) |
| 0.0 | 0.5 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.0 | 0.2 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
| 0.0 | 0.4 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 0.4 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.0 | 0.8 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 3.7 | GO:1904813 | ficolin-1-rich granule(GO:0101002) ficolin-1-rich granule lumen(GO:1904813) |
| 0.0 | 0.4 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 4.9 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 2.3 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 0.9 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.0 | 0.6 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.0 | 0.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.5 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.3 | GO:0036020 | endolysosome membrane(GO:0036020) |
| 0.0 | 0.0 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 1.4 | GO:0035578 | azurophil granule lumen(GO:0035578) |
| 0.0 | 0.0 | GO:0042025 | host cell nucleus(GO:0042025) |
| 0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.4 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
| 0.0 | 1.2 | GO:0070821 | tertiary granule membrane(GO:0070821) |
| 0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.0 | 11.8 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 1.6 | 4.8 | GO:0052858 | peptidyl-lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0052858) |
| 1.2 | 6.0 | GO:0047280 | nicotinamide phosphoribosyltransferase activity(GO:0047280) |
| 1.0 | 3.9 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 0.9 | 2.7 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.8 | 2.4 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.8 | 4.6 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
| 0.8 | 2.3 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.7 | 9.7 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.7 | 2.2 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.7 | 2.8 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.7 | 3.4 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.7 | 5.3 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.6 | 1.8 | GO:0070123 | transforming growth factor beta receptor activity, type III(GO:0070123) |
| 0.6 | 4.8 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 0.6 | 2.4 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
| 0.6 | 5.3 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.6 | 1.8 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.6 | 2.8 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.6 | 2.2 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.5 | 1.6 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.5 | 1.0 | GO:1904455 | ubiquitin-specific protease activity involved in negative regulation of ERAD pathway(GO:1904455) |
| 0.5 | 7.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.5 | 6.6 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.5 | 2.0 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.5 | 3.0 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
| 0.5 | 2.0 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.5 | 1.4 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.5 | 4.8 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.5 | 12.0 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.4 | 6.7 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.4 | 4.9 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.4 | 1.3 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.4 | 1.8 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.4 | 2.6 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.4 | 2.1 | GO:0043035 | chromatin insulator sequence binding(GO:0043035) |
| 0.4 | 4.7 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.4 | 1.3 | GO:0036134 | thromboxane-A synthase activity(GO:0004796) 12-hydroxyheptadecatrienoic acid synthase activity(GO:0036134) |
| 0.4 | 2.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.4 | 2.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.4 | 2.1 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.4 | 1.6 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.4 | 1.2 | GO:0038186 | calcitriol receptor activity(GO:0008434) lithocholic acid receptor activity(GO:0038186) calcitriol binding(GO:1902098) lithocholic acid binding(GO:1902121) |
| 0.4 | 1.5 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.4 | 1.1 | GO:0004119 | cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) |
| 0.4 | 3.6 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.3 | 2.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.3 | 8.3 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.3 | 4.1 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 0.3 | 3.3 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.3 | 6.8 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.3 | 4.5 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.3 | 1.0 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.3 | 2.2 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.3 | 2.2 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.3 | 6.7 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.3 | 7.5 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.3 | 1.6 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.3 | 1.6 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
| 0.3 | 0.9 | GO:0004651 | polynucleotide 5'-phosphatase activity(GO:0004651) |
| 0.3 | 2.8 | GO:0004727 | prenylated protein tyrosine phosphatase activity(GO:0004727) |
| 0.3 | 2.8 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.3 | 9.4 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.3 | 1.8 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.3 | 6.8 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.3 | 1.5 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.3 | 3.8 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.3 | 1.4 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.3 | 4.8 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.3 | 6.5 | GO:0005522 | profilin binding(GO:0005522) |
| 0.3 | 2.5 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.3 | 13.2 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.3 | 1.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.3 | 0.8 | GO:0016603 | glutaminyl-peptide cyclotransferase activity(GO:0016603) |
| 0.3 | 1.6 | GO:0016316 | phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity(GO:0016316) inositol-1,3,4-trisphosphate 4-phosphatase activity(GO:0017161) phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) inositol-3,4-bisphosphate 4-phosphatase activity(GO:0052828) |
| 0.3 | 7.3 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.3 | 1.1 | GO:0047291 | neolactotetraosylceramide alpha-2,3-sialyltransferase activity(GO:0004513) lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
| 0.3 | 4.5 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.3 | 3.7 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.3 | 14.0 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.3 | 6.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.3 | 1.3 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.3 | 1.5 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.3 | 2.3 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.2 | 0.2 | GO:0015203 | polyamine transmembrane transporter activity(GO:0015203) putrescine transmembrane transporter activity(GO:0015489) |
| 0.2 | 0.7 | GO:0051717 | inositol-1,3,4,5-tetrakisphosphate 3-phosphatase activity(GO:0051717) |
| 0.2 | 7.2 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.2 | 3.0 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.2 | 6.8 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.2 | 0.7 | GO:0034057 | RNA strand-exchange activity(GO:0034057) |
| 0.2 | 1.6 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.2 | 1.1 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.2 | 1.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.2 | 2.3 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.2 | 19.6 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.2 | 1.5 | GO:0050119 | N-acetylglucosamine deacetylase activity(GO:0050119) |
| 0.2 | 26.8 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.2 | 4.7 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.2 | 14.8 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.2 | 1.5 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.2 | 0.4 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.2 | 16.8 | GO:0035326 | enhancer binding(GO:0035326) |
| 0.2 | 4.8 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.2 | 0.6 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.2 | 8.2 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.2 | 6.0 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.2 | 0.8 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.2 | 1.0 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.2 | 2.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.2 | 1.5 | GO:0038051 | glucocorticoid receptor activity(GO:0004883) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.2 | 1.0 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.2 | 1.9 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.2 | 1.5 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.2 | 0.7 | GO:0030395 | lactose binding(GO:0030395) |
| 0.2 | 0.2 | GO:0070363 | mitochondrial light strand promoter sense binding(GO:0070363) |
| 0.2 | 0.5 | GO:0016964 | alpha-2 macroglobulin receptor activity(GO:0016964) |
| 0.2 | 2.7 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.2 | 0.5 | GO:0004874 | aryl hydrocarbon receptor activity(GO:0004874) |
| 0.2 | 3.5 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.2 | 0.5 | GO:0061752 | telomeric repeat-containing RNA binding(GO:0061752) |
| 0.2 | 0.3 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.2 | 1.0 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.2 | 4.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.2 | 42.4 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.2 | 7.0 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.2 | 1.5 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.2 | 2.6 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.2 | 5.9 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.2 | 0.6 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.2 | 32.4 | GO:0042393 | histone binding(GO:0042393) |
| 0.2 | 1.7 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.2 | 1.4 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.2 | 1.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.2 | 4.9 | GO:0043495 | protein anchor(GO:0043495) |
| 0.2 | 1.4 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.2 | 0.9 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.2 | 4.9 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.2 | 6.2 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.2 | 1.8 | GO:0003909 | DNA ligase activity(GO:0003909) |
| 0.2 | 2.7 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.2 | 0.5 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.2 | 1.7 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.1 | 0.3 | GO:0005330 | dopamine:sodium symporter activity(GO:0005330) |
| 0.1 | 1.8 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.1 | 0.1 | GO:0000992 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
| 0.1 | 0.6 | GO:0004088 | carbamoyl-phosphate synthase (ammonia) activity(GO:0004087) carbamoyl-phosphate synthase (glutamine-hydrolyzing) activity(GO:0004088) |
| 0.1 | 0.9 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.1 | 4.0 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 1.6 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.1 | 0.6 | GO:0001026 | TFIIIB-type transcription factor activity(GO:0001026) |
| 0.1 | 2.4 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.1 | 2.2 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 1.1 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 0.7 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.1 | 1.4 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 8.4 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 4.2 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.1 | 0.4 | GO:0005093 | Rab GDP-dissociation inhibitor activity(GO:0005093) |
| 0.1 | 2.4 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 13.3 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.1 | 3.3 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.1 | 1.2 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.1 | 0.6 | GO:0055077 | gap junction hemi-channel activity(GO:0055077) |
| 0.1 | 1.9 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.1 | 1.1 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.1 | 1.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 0.4 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
| 0.1 | 0.5 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.1 | 4.6 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.1 | 0.6 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 0.1 | 0.8 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 0.5 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 6.9 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.1 | 0.8 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.1 | 1.5 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 4.8 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.1 | 1.4 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 3.7 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.1 | 0.6 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.1 | 0.6 | GO:0052839 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.1 | 1.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.3 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.1 | 0.6 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 0.1 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 1.6 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.1 | 1.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.1 | 0.8 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.1 | 1.3 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.1 | 0.9 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 0.9 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 0.8 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.1 | 2.6 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.1 | 3.4 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.1 | 2.9 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.1 | 1.4 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.1 | 15.5 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.1 | 2.3 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.1 | 1.4 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 0.5 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.7 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.1 | 0.9 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 0.5 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.1 | 1.0 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 0.4 | GO:0008665 | 2'-phosphotransferase activity(GO:0008665) |
| 0.1 | 0.9 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 5.6 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.1 | 0.8 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.1 | 4.6 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.1 | 1.8 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.1 | 1.8 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 0.4 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.1 | 5.2 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.1 | 0.1 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 2.6 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.1 | 0.3 | GO:0050146 | nucleoside phosphotransferase activity(GO:0050146) |
| 0.1 | 3.8 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.1 | 0.4 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.1 | 0.7 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 3.9 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.1 | 1.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.1 | 0.6 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.1 | 1.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.1 | 0.7 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.1 | 2.6 | GO:0005521 | lamin binding(GO:0005521) |
| 0.1 | 1.6 | GO:0031701 | angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
| 0.1 | 1.6 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.1 | 0.6 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 7.5 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.1 | 0.1 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
| 0.1 | 1.4 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.1 | 0.9 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 1.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.1 | 1.8 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.1 | 2.4 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.1 | 0.8 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 0.4 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.1 | 1.1 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.1 | 34.5 | GO:0000987 | core promoter proximal region sequence-specific DNA binding(GO:0000987) |
| 0.1 | 0.2 | GO:0019777 | Atg12 transferase activity(GO:0019777) |
| 0.1 | 0.1 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
| 0.1 | 0.1 | GO:0070717 | poly-purine tract binding(GO:0070717) |
| 0.1 | 2.0 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.1 | 0.5 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.1 | 1.2 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.1 | 1.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 2.7 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 0.4 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.1 | 0.6 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.1 | 2.1 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.1 | 0.6 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.1 | 1.2 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.1 | 0.2 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.1 | 0.3 | GO:0016404 | 15-hydroxyprostaglandin dehydrogenase (NAD+) activity(GO:0016404) |
| 0.1 | 1.0 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.1 | 1.7 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.1 | 0.4 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.3 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.1 | 1.5 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.1 | 8.0 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.1 | 0.2 | GO:0070039 | rRNA (guanosine-2'-O-)-methyltransferase activity(GO:0070039) |
| 0.1 | 0.9 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.1 | 5.8 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.1 | 0.6 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.1 | 0.6 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 0.6 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.1 | 1.5 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.1 | 0.6 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.1 | 0.4 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.1 | 1.7 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 0.3 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.1 | 0.9 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
| 0.1 | 0.3 | GO:0005110 | frizzled-2 binding(GO:0005110) |
| 0.1 | 0.7 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.1 | 0.2 | GO:0033842 | N-acetyl-beta-glucosaminyl-glycoprotein 4-beta-N-acetylgalactosaminyltransferase activity(GO:0033842) |
| 0.1 | 0.4 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 1.2 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.1 | 0.6 | GO:0047144 | 2-acylglycerol-3-phosphate O-acyltransferase activity(GO:0047144) |
| 0.1 | 0.6 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.1 | 0.6 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.1 | 1.3 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 1.2 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.1 | 1.7 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 2.4 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.1 | 0.5 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 0.5 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.2 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
| 0.0 | 4.2 | GO:0001076 | transcription factor activity, RNA polymerase II transcription factor binding(GO:0001076) |
| 0.0 | 0.4 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.0 | 0.7 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 6.5 | GO:0001012 | RNA polymerase II regulatory region DNA binding(GO:0001012) |
| 0.0 | 0.3 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.5 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.0 | 0.1 | GO:0016263 | glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase activity(GO:0016263) |
| 0.0 | 0.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.5 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.6 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.0 | 2.6 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 0.4 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.0 | 0.4 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 0.7 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.0 | 1.2 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.6 | GO:0050694 | galactosylceramide sulfotransferase activity(GO:0001733) galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.0 | 3.0 | GO:0070035 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
| 0.0 | 1.7 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 1.0 | GO:0004532 | exoribonuclease activity(GO:0004532) |
| 0.0 | 0.9 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.4 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 2.1 | GO:0043531 | ADP binding(GO:0043531) |
| 0.0 | 3.8 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.0 | 0.5 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 3.5 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.7 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.0 | 3.3 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
| 0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 2.5 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.0 | 0.8 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.0 | 1.5 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 4.5 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 1.2 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.7 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.3 | GO:0010465 | nerve growth factor receptor activity(GO:0010465) |
| 0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.0 | 1.3 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.1 | GO:0005277 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.0 | 0.4 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.0 | 0.4 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 1.0 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.0 | 0.3 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.5 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.5 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 0.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.0 | 0.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.5 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.7 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.4 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.2 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.2 | GO:0004905 | type I interferon receptor activity(GO:0004905) |
| 0.0 | 1.2 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.4 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.3 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.0 | 0.3 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.4 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.0 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 1.1 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.5 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 1.3 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.0 | 0.5 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 6.6 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.0 | 0.3 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 1.0 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.4 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 1.5 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.3 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.0 | 0.9 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.3 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.0 | 0.1 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.0 | 2.0 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
| 0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.0 | 0.7 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.0 | 1.1 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 39.1 | GO:0003677 | DNA binding(GO:0003677) |
| 0.0 | 2.1 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
| 0.0 | 1.1 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.2 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.3 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.0 | 0.6 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 1.1 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 1.8 | GO:0003712 | transcription cofactor activity(GO:0003712) |
| 0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.0 | 3.7 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.2 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.2 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
| 0.0 | 0.0 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
| 0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.3 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 0.1 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) |
| 0.0 | 1.5 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.0 | 0.0 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.0 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.0 | 2.9 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
| 0.0 | 0.2 | GO:0016875 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
| 0.0 | 0.2 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.0 | 0.2 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.0 | 0.2 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
| 0.0 | 0.3 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.0 | 0.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 6.7 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.3 | 18.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.3 | 0.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.3 | 34.7 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.3 | 17.9 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.3 | 4.0 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.3 | 6.9 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.2 | 2.5 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.2 | 24.9 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.2 | 39.1 | PID CMYB PATHWAY | C-MYB transcription factor network |
| 0.2 | 4.8 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.2 | 1.6 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.2 | 14.6 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.2 | 9.8 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.2 | 9.4 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.2 | 23.7 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.2 | 10.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.2 | 12.4 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.2 | 5.0 | PID MYC PATHWAY | C-MYC pathway |
| 0.2 | 10.8 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.2 | 1.8 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 5.7 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.1 | 5.1 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 20.5 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.1 | 6.4 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.1 | 5.7 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.1 | 5.2 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.1 | 9.8 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.1 | 6.6 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.1 | 3.3 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.1 | 5.1 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.1 | 11.7 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.1 | 1.7 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.1 | 1.4 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.1 | 5.5 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 5.5 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.1 | 4.9 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.1 | 5.4 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.1 | 2.9 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 3.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.1 | 0.8 | PID EPO PATHWAY | EPO signaling pathway |
| 0.1 | 3.3 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 1.3 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 3.5 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.1 | 1.9 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.1 | 3.9 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.1 | 1.8 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.1 | 5.0 | PID E2F PATHWAY | E2F transcription factor network |
| 0.1 | 1.5 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.1 | 3.3 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.1 | 0.6 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.1 | 5.1 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.1 | 1.6 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.1 | 0.7 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.1 | 1.2 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 1.7 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.0 | 0.9 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 0.3 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.0 | 2.9 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.5 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 1.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.5 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 1.0 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 1.4 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 1.3 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 4.1 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.0 | 0.8 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 2.4 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 1.7 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.2 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.0 | 1.2 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 0.6 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 1.0 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.4 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 1.7 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.2 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.1 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.3 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 1.3 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 1.2 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.5 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.4 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.3 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.5 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.2 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.3 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.6 | PID ARF6 PATHWAY | Arf6 signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 6.6 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.6 | 9.6 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.5 | 5.3 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.4 | 5.6 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.4 | 16.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.4 | 4.2 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.3 | 7.9 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.3 | 4.6 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.3 | 0.8 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.3 | 15.0 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.3 | 5.9 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.2 | 0.7 | REACTOME MITOTIC G1 G1 S PHASES | Genes involved in Mitotic G1-G1/S phases |
| 0.2 | 2.7 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.2 | 28.2 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.2 | 6.9 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.2 | 7.9 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.2 | 4.3 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
| 0.2 | 10.7 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.2 | 8.8 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 0.2 | 4.9 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.2 | 4.0 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.2 | 10.5 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.2 | 5.2 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.2 | 8.7 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.2 | 8.7 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.2 | 8.0 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.2 | 2.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.2 | 1.5 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.2 | 8.3 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.2 | 3.5 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
| 0.1 | 0.9 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.1 | 2.4 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.1 | 3.1 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 4.0 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 2.0 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.1 | 4.1 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.1 | 3.6 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.1 | 6.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 2.5 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.1 | 3.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.1 | 1.7 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.1 | 3.7 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.1 | 1.0 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.1 | 4.0 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.1 | 0.9 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.1 | 2.9 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 1.5 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.1 | 1.4 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 4.0 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 0.2 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
| 0.1 | 1.6 | REACTOME E2F MEDIATED REGULATION OF DNA REPLICATION | Genes involved in E2F mediated regulation of DNA replication |
| 0.1 | 6.0 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.1 | 0.7 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.1 | 0.6 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.1 | 1.8 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.1 | 3.5 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 1.6 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.1 | 0.9 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.1 | 4.5 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.1 | 1.8 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.1 | 3.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 13.6 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.1 | 2.5 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 1.6 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.1 | 3.8 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.1 | 11.0 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.1 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 0.7 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 1.4 | REACTOME TCR SIGNALING | Genes involved in TCR signaling |
| 0.1 | 3.8 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.1 | 0.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 3.1 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.1 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.1 | 5.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 4.9 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.1 | 11.6 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.1 | 1.3 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.1 | 2.0 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.1 | 0.9 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.1 | 1.2 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.1 | 0.7 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.1 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.1 | 1.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 5.3 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.1 | 5.5 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.1 | 1.0 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.1 | 0.7 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.1 | 1.3 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.1 | 0.7 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.1 | 2.5 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.1 | 0.7 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.1 | 5.0 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.1 | 1.2 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 0.6 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.1 | 0.6 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.1 | 0.1 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.1 | 0.9 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
| 0.0 | 1.9 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 4.2 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.8 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.5 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 2.0 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.0 | 1.0 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.8 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.0 | 1.7 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.2 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.4 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.6 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.7 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.0 | 1.0 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.7 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 1.0 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 1.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 2.1 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 0.6 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
| 0.0 | 0.5 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.0 | 0.6 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.5 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.2 | REACTOME RNA POL II PRE TRANSCRIPTION EVENTS | Genes involved in RNA Polymerase II Pre-transcription Events |
| 0.0 | 0.5 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.4 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.9 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.5 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.2 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 5.0 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.1 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.0 | 0.2 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
| 0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 0.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.7 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.6 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 0.0 | 0.1 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.0 | 0.3 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.0 | 0.1 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.0 | 0.3 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |