Motif ID: Dmc1
Z-value: 1.985
Transcription factors associated with Dmc1:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Dmc1 | ENSMUSG00000022429.10 | Dmc1 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Dmc1 | mm10_v2_chr15_-_79605084_79605114 | 0.05 | 8.6e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.7 | 6.9 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 1.0 | 3.1 | GO:0051464 | positive regulation of cortisol secretion(GO:0051464) |
| 0.9 | 2.8 | GO:0008228 | opsonization(GO:0008228) modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.6 | 1.9 | GO:1903795 | regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.6 | 3.4 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.5 | 1.6 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
| 0.5 | 2.0 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.5 | 2.9 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.5 | 1.9 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.5 | 2.3 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
| 0.4 | 1.3 | GO:0032632 | interleukin-3 production(GO:0032632) |
| 0.4 | 2.1 | GO:0072683 | T cell extravasation(GO:0072683) |
| 0.4 | 1.6 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.4 | 1.2 | GO:0042196 | dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
| 0.4 | 2.0 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.3 | 4.4 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.3 | 3.4 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.3 | 9.3 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.3 | 1.5 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.3 | 2.3 | GO:0000050 | urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 0.3 | 0.8 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.3 | 3.8 | GO:0010447 | response to acidic pH(GO:0010447) |
| 0.3 | 3.3 | GO:0097067 | negative regulation of erythrocyte differentiation(GO:0045647) cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.2 | 0.9 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.2 | 0.7 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.2 | 4.1 | GO:0002495 | antigen processing and presentation of peptide antigen via MHC class II(GO:0002495) |
| 0.2 | 2.5 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.2 | 1.8 | GO:0021984 | adenohypophysis development(GO:0021984) |
| 0.2 | 1.0 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.2 | 0.4 | GO:0002371 | dendritic cell cytokine production(GO:0002371) regulation of dendritic cell cytokine production(GO:0002730) |
| 0.2 | 0.9 | GO:0031033 | myosin filament organization(GO:0031033) |
| 0.2 | 0.7 | GO:0018343 | protein farnesylation(GO:0018343) negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.2 | 0.7 | GO:0046655 | glycine biosynthetic process(GO:0006545) folic acid metabolic process(GO:0046655) |
| 0.2 | 3.6 | GO:0019835 | cytolysis(GO:0019835) |
| 0.2 | 1.1 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.2 | 1.2 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.2 | 1.6 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.2 | 0.8 | GO:0019230 | proprioception(GO:0019230) |
| 0.2 | 0.6 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.2 | 0.5 | GO:0050748 | negative regulation of receptor biosynthetic process(GO:0010871) negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.2 | 0.6 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 0.1 | 4.2 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.1 | 3.3 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.1 | 0.6 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.1 | 0.7 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.1 | 0.4 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.1 | 0.7 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.4 | GO:0006011 | UDP-glucose metabolic process(GO:0006011) |
| 0.1 | 1.0 | GO:0019673 | dolichol metabolic process(GO:0019348) GDP-mannose metabolic process(GO:0019673) |
| 0.1 | 1.7 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.1 | 0.1 | GO:0048793 | pronephros development(GO:0048793) |
| 0.1 | 0.8 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 0.1 | 0.6 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 | 1.7 | GO:0018126 | protein hydroxylation(GO:0018126) |
| 0.1 | 0.5 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.1 | 1.6 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.1 | 1.0 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 | 0.9 | GO:0043206 | extracellular fibril organization(GO:0043206) |
| 0.1 | 0.5 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.1 | 1.4 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.1 | 0.5 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.1 | 0.5 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 | 0.3 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.1 | 0.8 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 | 2.5 | GO:0001706 | endoderm formation(GO:0001706) |
| 0.1 | 0.3 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.1 | 0.7 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.1 | 0.2 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.1 | 1.3 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.1 | 0.4 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.1 | 0.2 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.1 | 0.4 | GO:0071467 | cellular response to pH(GO:0071467) |
| 0.1 | 1.1 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 0.5 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 | 0.2 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
| 0.1 | 0.5 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.1 | 0.6 | GO:0031424 | keratinization(GO:0031424) |
| 0.1 | 4.9 | GO:0001578 | microtubule bundle formation(GO:0001578) |
| 0.1 | 0.4 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 | 0.7 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.1 | 1.6 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.1 | 0.5 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.1 | 1.4 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 | 1.8 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.1 | 2.9 | GO:0048678 | response to axon injury(GO:0048678) |
| 0.1 | 0.6 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.1 | 0.6 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.1 | 0.3 | GO:0006544 | glycine metabolic process(GO:0006544) |
| 0.0 | 0.2 | GO:0070228 | regulation of lymphocyte apoptotic process(GO:0070228) T cell apoptotic process(GO:0070231) regulation of T cell apoptotic process(GO:0070232) |
| 0.0 | 0.1 | GO:2000152 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) regulation of ubiquitin-specific protease activity(GO:2000152) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.0 | 0.5 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.0 | 1.1 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.0 | 3.5 | GO:0007601 | visual perception(GO:0007601) |
| 0.0 | 0.2 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.1 | GO:0046077 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.0 | 0.1 | GO:0030167 | proteoglycan catabolic process(GO:0030167) regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 0.0 | 0.2 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.0 | 0.2 | GO:0043247 | protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
| 0.0 | 0.2 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.2 | GO:0061436 | establishment of skin barrier(GO:0061436) |
| 0.0 | 0.1 | GO:1900365 | positive regulation of mRNA polyadenylation(GO:1900365) |
| 0.0 | 0.1 | GO:0060558 | regulation of calcidiol 1-monooxygenase activity(GO:0060558) |
| 0.0 | 0.5 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.0 | 0.1 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.0 | 1.6 | GO:0080171 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
| 0.0 | 1.1 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.6 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.0 | 2.0 | GO:0019882 | antigen processing and presentation(GO:0019882) |
| 0.0 | 0.4 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.0 | 0.0 | GO:0042633 | molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.0 | 0.6 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.2 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.0 | 0.2 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.0 | 0.0 | GO:0000019 | regulation of mitotic recombination(GO:0000019) |
| 0.0 | 0.4 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.2 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.0 | 0.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.3 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
| 0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 | 0.3 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.0 | 0.2 | GO:2000650 | negative regulation of sodium ion transmembrane transporter activity(GO:2000650) |
| 0.0 | 1.4 | GO:0043525 | positive regulation of neuron apoptotic process(GO:0043525) |
| 0.0 | 0.3 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 0.6 | GO:1902652 | cholesterol metabolic process(GO:0008203) secondary alcohol metabolic process(GO:1902652) |
| 0.0 | 0.4 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.0 | 0.9 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.0 | 0.1 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.0 | 0.3 | GO:1904816 | negative regulation of protein sumoylation(GO:0033234) positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.0 | 0.6 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 0.2 | GO:0021554 | optic nerve development(GO:0021554) |
| 0.0 | 0.3 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.0 | 0.4 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.2 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.0 | 0.2 | GO:0036010 | protein localization to endosome(GO:0036010) retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.1 | GO:0034308 | primary alcohol metabolic process(GO:0034308) |
| 0.0 | 0.3 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 0.2 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.0 | 0.3 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
| 0.0 | 1.0 | GO:0051492 | regulation of stress fiber assembly(GO:0051492) |
| 0.0 | 0.1 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
| 0.0 | 0.5 | GO:0030514 | negative regulation of BMP signaling pathway(GO:0030514) |
| 0.0 | 0.0 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.0 | 0.8 | GO:0030183 | B cell differentiation(GO:0030183) |
| 0.0 | 0.6 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
| 0.0 | 0.4 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 | 0.1 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
| 0.0 | 0.8 | GO:0042098 | T cell proliferation(GO:0042098) |
| 0.0 | 0.0 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.0 | 0.2 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.3 | 6.9 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.8 | 2.3 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.7 | 2.2 | GO:0044299 | C-fiber(GO:0044299) |
| 0.7 | 3.3 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.4 | 1.9 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.3 | 1.3 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.3 | 2.5 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.2 | 0.7 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.2 | 1.0 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.2 | 2.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 0.5 | GO:1903095 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
| 0.2 | 1.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.2 | 0.5 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 0.2 | 2.3 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.1 | 0.9 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.1 | 0.7 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.1 | 1.5 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 4.1 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 2.0 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.1 | 0.5 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.1 | 1.6 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.1 | 2.0 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.1 | 1.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.1 | 0.5 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.1 | 0.7 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 0.7 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 1.0 | GO:0070938 | contractile ring(GO:0070938) |
| 0.1 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 0.2 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.1 | 0.2 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.1 | 1.0 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.1 | 0.5 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 1.1 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.1 | 2.0 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.1 | 0.6 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 0.5 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 8.7 | GO:0010008 | endosome membrane(GO:0010008) |
| 0.0 | 1.2 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.7 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.5 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 0.0 | 1.9 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.4 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.0 | 0.6 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 0.2 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.9 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 1.1 | GO:0032590 | dendrite membrane(GO:0032590) |
| 0.0 | 0.4 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 2.7 | GO:0005604 | basement membrane(GO:0005604) |
| 0.0 | 0.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.0 | 0.3 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 2.5 | GO:0097060 | synaptic membrane(GO:0097060) |
| 0.0 | 0.4 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.0 | 1.0 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 0.7 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.0 | 1.6 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.4 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.0 | 0.6 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 3.8 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.2 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
| 0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 3.7 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 0.2 | GO:0005675 | DNA replication factor A complex(GO:0005662) holo TFIIH complex(GO:0005675) |
| 0.0 | 0.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 1.4 | GO:0005901 | caveola(GO:0005901) |
| 0.0 | 1.1 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
| 0.0 | 2.0 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.0 | 0.4 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.3 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 4.5 | GO:0005925 | focal adhesion(GO:0005925) |
| 0.0 | 0.7 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 3.6 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 1.0 | 3.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.9 | 3.4 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.7 | 10.2 | GO:0005537 | mannose binding(GO:0005537) |
| 0.6 | 1.9 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.6 | 2.4 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.6 | 2.8 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.4 | 1.7 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.4 | 3.5 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.4 | 1.2 | GO:0019120 | hydrolase activity, acting on acid halide bonds(GO:0016824) hydrolase activity, acting on acid halide bonds, in C-halide compounds(GO:0019120) alkylhalidase activity(GO:0047651) |
| 0.3 | 0.9 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.3 | 1.2 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.3 | 1.7 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.3 | 1.6 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.3 | 2.3 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.3 | 1.8 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.2 | 0.7 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.2 | 0.7 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.2 | 1.2 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.2 | 1.0 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.2 | 0.9 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.2 | 0.5 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.2 | 3.6 | GO:0031005 | filamin binding(GO:0031005) |
| 0.2 | 4.1 | GO:0042287 | MHC protein binding(GO:0042287) |
| 0.2 | 0.6 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.2 | 1.1 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.2 | 4.2 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
| 0.2 | 0.5 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.2 | 1.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.2 | 0.6 | GO:0004104 | cholinesterase activity(GO:0004104) choline binding(GO:0033265) |
| 0.2 | 0.6 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.1 | 2.3 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
| 0.1 | 1.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.1 | 0.8 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.1 | 0.7 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.1 | 0.7 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.1 | 0.5 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 0.8 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.1 | 2.0 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.1 | 3.3 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.1 | 0.4 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.1 | 1.3 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
| 0.1 | 0.4 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.1 | 0.8 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.1 | 0.3 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
| 0.1 | 0.9 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.1 | 8.1 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.1 | 1.0 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.7 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.1 | 0.5 | GO:0018121 | imidazoleglycerol-phosphate synthase activity(GO:0000107) NAD(P)-cysteine ADP-ribosyltransferase activity(GO:0018071) NAD(P)-asparagine ADP-ribosyltransferase activity(GO:0018121) NAD(P)-serine ADP-ribosyltransferase activity(GO:0018127) 7-cyano-7-deazaguanine tRNA-ribosyltransferase activity(GO:0043867) purine deoxyribosyltransferase activity(GO:0044102) |
| 0.1 | 0.3 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
| 0.1 | 1.6 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.2 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
| 0.1 | 0.3 | GO:0050347 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
| 0.1 | 2.0 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.1 | 2.5 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 0.2 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.1 | 0.5 | GO:0016918 | retinal binding(GO:0016918) |
| 0.1 | 0.5 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.1 | 5.9 | GO:0043851 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) rRNA (uridine-2'-O-)-methyltransferase activity(GO:0008650) rRNA (adenine-N6-)-methyltransferase activity(GO:0008988) rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) selenocysteine methyltransferase activity(GO:0016205) rRNA (adenine) methyltransferase activity(GO:0016433) rRNA (cytosine) methyltransferase activity(GO:0016434) rRNA (guanine) methyltransferase activity(GO:0016435) 1-phenanthrol methyltransferase activity(GO:0018707) protein-arginine N5-methyltransferase activity(GO:0019702) dimethylarsinite methyltransferase activity(GO:0034541) 4,5-dihydroxybenzo(a)pyrene methyltransferase activity(GO:0034807) 1-hydroxypyrene methyltransferase activity(GO:0034931) 1-hydroxy-6-methoxypyrene methyltransferase activity(GO:0034933) demethylmenaquinone methyltransferase activity(GO:0043770) cobalt-precorrin-6B C5-methyltransferase activity(GO:0043776) cobalt-precorrin-7 C15-methyltransferase activity(GO:0043777) cobalt-precorrin-5B C1-methyltransferase activity(GO:0043780) cobalt-precorrin-3 C17-methyltransferase activity(GO:0043782) dimethylamine methyltransferase activity(GO:0043791) hydroxyneurosporene-O-methyltransferase activity(GO:0043803) tRNA (adenine-57, 58-N(1)-) methyltransferase activity(GO:0043827) methylamine-specific methylcobalamin:coenzyme M methyltransferase activity(GO:0043833) trimethylamine methyltransferase activity(GO:0043834) methanol-specific methylcobalamin:coenzyme M methyltransferase activity(GO:0043851) monomethylamine methyltransferase activity(GO:0043852) P-methyltransferase activity(GO:0051994) Se-methyltransferase activity(GO:0051995) 2-phytyl-1,4-naphthoquinone methyltransferase activity(GO:0052624) tRNA (uracil-2'-O-)-methyltransferase activity(GO:0052665) tRNA (cytosine-2'-O-)-methyltransferase activity(GO:0052666) phosphomethylethanolamine N-methyltransferase activity(GO:0052667) tRNA (cytosine-3-)-methyltransferase activity(GO:0052735) rRNA (cytosine-2'-O-)-methyltransferase activity(GO:0070677) rRNA (cytosine-N4-)-methyltransferase activity(GO:0071424) trihydroxyferuloyl spermidine O-methyltransferase activity(GO:0080012) |
| 0.1 | 1.6 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.1 | 2.9 | GO:0070888 | E-box binding(GO:0070888) |
| 0.1 | 0.6 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.1 | 0.2 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.1 | 0.5 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.1 | 0.5 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.1 | 1.1 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.1 | 2.0 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.1 | 0.5 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.1 | 0.2 | GO:0004954 | icosanoid receptor activity(GO:0004953) prostanoid receptor activity(GO:0004954) prostaglandin receptor activity(GO:0004955) |
| 0.1 | 0.8 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.7 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.2 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.0 | 1.9 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 1.2 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
| 0.0 | 0.2 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.4 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 1.9 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.2 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.2 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.0 | 1.3 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.1 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.0 | 1.9 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.0 | 0.3 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.7 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 1.0 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.4 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 3.8 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 2.9 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.0 | 0.7 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 0.1 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.0 | 0.2 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.3 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.0 | 0.8 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.0 | 3.6 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.0 | 2.5 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 1.9 | GO:0008201 | heparin binding(GO:0008201) |
| 0.0 | 0.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 1.2 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.9 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.1 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.0 | 1.6 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.0 | 0.5 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
| 0.0 | 0.6 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.0 | 0.6 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 0.1 | GO:0019956 | chemokine binding(GO:0019956) |
| 0.0 | 0.1 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.0 | 0.3 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.6 | GO:0051018 | protein kinase A binding(GO:0051018) |
| 0.0 | 0.5 | GO:0043774 | UDP-N-acetylmuramoylalanyl-D-glutamyl-2,6-diaminopimelate-D-alanyl-D-alanine ligase activity(GO:0008766) ribosomal S6-glutamic acid ligase activity(GO:0018169) coenzyme F420-0 gamma-glutamyl ligase activity(GO:0043773) coenzyme F420-2 alpha-glutamyl ligase activity(GO:0043774) protein-glycine ligase activity(GO:0070735) protein-glycine ligase activity, initiating(GO:0070736) protein-glycine ligase activity, elongating(GO:0070737) tubulin-glycine ligase activity(GO:0070738) |
| 0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 0.7 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 1.1 | GO:0001948 | glycoprotein binding(GO:0001948) |
| 0.0 | 2.2 | GO:0016829 | lyase activity(GO:0016829) |
| 0.0 | 1.8 | GO:0004553 | hydrolase activity, hydrolyzing O-glycosyl compounds(GO:0004553) |