Motif ID: Tcf4_Mesp1
Z-value: 1.357
Transcription factors associated with Tcf4_Mesp1:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Mesp1 | ENSMUSG00000030544.5 | Mesp1 |
| Tcf4 | ENSMUSG00000053477.9 | Tcf4 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Tcf4 | mm10_v2_chr18_+_69344503_69344530 | -0.66 | 9.6e-03 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 3.9 | GO:0051866 | general adaptation syndrome(GO:0051866) |
| 0.9 | 2.6 | GO:0001830 | trophectodermal cell fate commitment(GO:0001830) |
| 0.8 | 2.4 | GO:1901731 | calcium-mediated signaling using extracellular calcium source(GO:0035585) positive regulation of platelet aggregation(GO:1901731) |
| 0.8 | 1.6 | GO:0007521 | muscle cell fate determination(GO:0007521) |
| 0.8 | 2.3 | GO:0072070 | loop of Henle development(GO:0072070) metanephric loop of Henle development(GO:0072236) |
| 0.7 | 3.0 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.7 | 2.2 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.7 | 2.2 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.6 | 1.9 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.6 | 1.9 | GO:1900369 | negative regulation of RNA interference(GO:1900369) |
| 0.6 | 1.9 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) phosphate ion transmembrane transport(GO:0035435) |
| 0.6 | 1.8 | GO:0060596 | mammary placode formation(GO:0060596) |
| 0.6 | 3.9 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.6 | 1.7 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) regulation of nucleoside transport(GO:0032242) negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
| 0.5 | 3.8 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.5 | 2.7 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.5 | 2.6 | GO:0060279 | progesterone secretion(GO:0042701) positive regulation of ovulation(GO:0060279) |
| 0.5 | 0.5 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.5 | 1.4 | GO:0051892 | negative regulation of cardioblast differentiation(GO:0051892) |
| 0.5 | 1.4 | GO:0019085 | early viral transcription(GO:0019085) |
| 0.5 | 1.9 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.4 | 2.7 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.4 | 3.8 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.4 | 2.1 | GO:0075136 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 0.4 | 1.7 | GO:0032439 | endosome localization(GO:0032439) |
| 0.4 | 3.3 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.4 | 2.0 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.4 | 1.5 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.4 | 1.8 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.4 | 1.4 | GO:0045188 | regulation of circadian sleep/wake cycle, non-REM sleep(GO:0045188) |
| 0.3 | 1.7 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.3 | 1.0 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.3 | 1.0 | GO:0003096 | renal sodium ion transport(GO:0003096) |
| 0.3 | 0.9 | GO:0048211 | Golgi vesicle docking(GO:0048211) |
| 0.3 | 0.9 | GO:0010752 | signal complex assembly(GO:0007172) regulation of cGMP-mediated signaling(GO:0010752) |
| 0.3 | 4.0 | GO:1901898 | negative regulation of relaxation of muscle(GO:1901078) negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 0.3 | 0.9 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.3 | 1.2 | GO:0006867 | asparagine transport(GO:0006867) glutamine transport(GO:0006868) |
| 0.3 | 2.0 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.3 | 0.9 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.3 | 1.7 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) |
| 0.3 | 4.1 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.3 | 1.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.3 | 0.8 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.3 | 2.5 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.2 | 1.0 | GO:0021564 | glossopharyngeal nerve development(GO:0021563) vagus nerve development(GO:0021564) |
| 0.2 | 1.0 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.2 | 1.7 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.2 | 5.0 | GO:0035036 | binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.2 | 4.3 | GO:0046855 | phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
| 0.2 | 0.7 | GO:0015882 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.2 | 0.8 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.2 | 0.8 | GO:2000347 | positive regulation of hepatocyte proliferation(GO:2000347) |
| 0.2 | 0.6 | GO:0032278 | positive regulation of gonadotropin secretion(GO:0032278) |
| 0.2 | 0.6 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.2 | 0.8 | GO:1904529 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.2 | 2.6 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.2 | 1.4 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.2 | 0.8 | GO:0046898 | response to cycloheximide(GO:0046898) |
| 0.2 | 0.6 | GO:0060912 | cardiac cell fate specification(GO:0060912) |
| 0.2 | 1.3 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.2 | 0.6 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
| 0.2 | 0.6 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
| 0.2 | 0.7 | GO:0051311 | spindle assembly involved in female meiosis(GO:0007056) meiotic metaphase plate congression(GO:0051311) |
| 0.2 | 0.5 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.2 | 1.8 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.2 | 0.5 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.2 | 0.9 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.2 | 0.7 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.2 | 0.5 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.2 | 1.4 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.2 | 0.5 | GO:2000501 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) |
| 0.2 | 0.5 | GO:0036118 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.2 | 0.5 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.2 | 1.0 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.2 | 0.8 | GO:0014832 | urinary bladder smooth muscle contraction(GO:0014832) |
| 0.2 | 1.0 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.2 | 0.2 | GO:0036115 | fatty-acyl-CoA catabolic process(GO:0036115) |
| 0.2 | 0.6 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.2 | 0.5 | GO:2000620 | positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.2 | 0.6 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.1 | 0.6 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.1 | 0.6 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.1 | 1.6 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.1 | 1.3 | GO:0036371 | protein localization to M-band(GO:0036309) protein localization to T-tubule(GO:0036371) |
| 0.1 | 0.6 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.1 | 0.6 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.1 | 0.9 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.1 | 0.3 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 | 0.3 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.1 | 1.0 | GO:0051792 | medium-chain fatty acid biosynthetic process(GO:0051792) |
| 0.1 | 0.4 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.1 | 1.1 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.1 | 1.1 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.1 | 0.8 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.1 | 0.1 | GO:1903061 | regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.1 | 0.4 | GO:0046381 | CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.1 | 0.5 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.1 | 0.3 | GO:0048686 | regulation of sprouting of injured axon(GO:0048686) regulation of axon extension involved in regeneration(GO:0048690) |
| 0.1 | 0.1 | GO:0003011 | diaphragm contraction(GO:0002086) involuntary skeletal muscle contraction(GO:0003011) |
| 0.1 | 0.4 | GO:0043379 | memory T cell differentiation(GO:0043379) |
| 0.1 | 1.5 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.1 | 0.4 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
| 0.1 | 0.4 | GO:0006065 | UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.1 | 0.5 | GO:0001705 | ectoderm formation(GO:0001705) |
| 0.1 | 3.2 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.1 | 1.1 | GO:0014820 | tonic smooth muscle contraction(GO:0014820) artery smooth muscle contraction(GO:0014824) |
| 0.1 | 0.5 | GO:0071476 | cellular hypotonic response(GO:0071476) |
| 0.1 | 0.2 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.1 | 2.3 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.1 | 0.4 | GO:0002302 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
| 0.1 | 1.5 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.4 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
| 0.1 | 0.4 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.1 | 0.1 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
| 0.1 | 0.8 | GO:0099612 | protein localization to axon(GO:0099612) |
| 0.1 | 0.5 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 1.9 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
| 0.1 | 0.4 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 | 0.3 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.1 | 0.5 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.1 | 0.8 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.1 | 0.1 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.1 | 0.5 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.1 | 0.7 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.1 | 0.6 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.1 | 0.3 | GO:0090298 | negative regulation of mitochondrial DNA replication(GO:0090298) |
| 0.1 | 1.7 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.1 | 0.4 | GO:0071404 | cellular response to lipoprotein particle stimulus(GO:0071402) cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
| 0.1 | 0.7 | GO:0098828 | modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.1 | 0.5 | GO:0040038 | polar body extrusion after meiotic divisions(GO:0040038) |
| 0.1 | 1.4 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.1 | 1.7 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.1 | 0.3 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.1 | 0.1 | GO:0045763 | negative regulation of cellular amino acid metabolic process(GO:0045763) |
| 0.1 | 1.2 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.1 | 0.3 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.1 | 0.6 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
| 0.1 | 0.3 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.1 | 0.3 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) |
| 0.1 | 0.2 | GO:0033206 | meiotic cytokinesis(GO:0033206) |
| 0.1 | 0.3 | GO:0006404 | RNA import into nucleus(GO:0006404) snRNA transport(GO:0051030) |
| 0.1 | 2.0 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.1 | 1.2 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
| 0.1 | 0.3 | GO:0046959 | habituation(GO:0046959) |
| 0.1 | 0.8 | GO:0086018 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) SA node cell to atrial cardiac muscle cell communication(GO:0086070) |
| 0.1 | 0.5 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.1 | 0.4 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
| 0.1 | 0.8 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.1 | 1.2 | GO:0031000 | response to caffeine(GO:0031000) |
| 0.1 | 1.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.1 | 0.6 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.1 | 0.5 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.1 | 0.6 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.1 | 0.4 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 | 0.5 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.4 | GO:0007113 | endomitotic cell cycle(GO:0007113) positive regulation of male germ cell proliferation(GO:2000256) |
| 0.1 | 0.5 | GO:0019732 | antifungal humoral response(GO:0019732) |
| 0.1 | 4.9 | GO:0010812 | negative regulation of cell-substrate adhesion(GO:0010812) |
| 0.1 | 0.9 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
| 0.1 | 0.9 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
| 0.1 | 0.6 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.1 | 0.2 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.1 | 0.8 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.1 | 0.5 | GO:2000252 | imidazole-containing compound metabolic process(GO:0052803) negative regulation of feeding behavior(GO:2000252) |
| 0.1 | 0.8 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.1 | 0.8 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.1 | 0.3 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.1 | 0.3 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.1 | 0.8 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 0.5 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.3 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 0.3 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.1 | 0.4 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.1 | 0.6 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.1 | 0.3 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 | 0.7 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.1 | 0.4 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
| 0.1 | 0.3 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.1 | 0.9 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 0.3 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.1 | 5.1 | GO:0019933 | cAMP-mediated signaling(GO:0019933) |
| 0.1 | 0.5 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
| 0.1 | 0.3 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.1 | 0.6 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.1 | 0.6 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 0.2 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.1 | 1.4 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.1 | 0.5 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
| 0.1 | 0.9 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 0.3 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.1 | 0.2 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
| 0.1 | 0.3 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.1 | 0.4 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.1 | 0.9 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.1 | 0.4 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.1 | 0.5 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
| 0.1 | 0.6 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
| 0.1 | 0.1 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.1 | 0.5 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 | 0.3 | GO:1990743 | protein sialylation(GO:1990743) |
| 0.1 | 0.3 | GO:2000795 | negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.1 | 0.6 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.1 | 0.6 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.2 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 0.1 | 0.4 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.1 | 0.3 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 | 0.3 | GO:0034238 | macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) |
| 0.1 | 0.8 | GO:0033008 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.1 | 0.3 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 2.3 | GO:0001782 | B cell homeostasis(GO:0001782) |
| 0.1 | 0.3 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
| 0.1 | 0.2 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.1 | 0.2 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
| 0.1 | 2.0 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.1 | 0.3 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.1 | 0.5 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 0.3 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.1 | 0.2 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
| 0.1 | 0.5 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.1 | 1.2 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 0.5 | GO:0045056 | transcytosis(GO:0045056) |
| 0.1 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.1 | GO:0071649 | chemokine (C-C motif) ligand 5 production(GO:0071609) regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.1 | 0.4 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 | 0.2 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
| 0.1 | 1.4 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.1 | 0.3 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.1 | 0.7 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 | 0.2 | GO:0001821 | histamine secretion(GO:0001821) histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.1 | 0.8 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.1 | 0.3 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
| 0.1 | 0.3 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 | 0.8 | GO:0017014 | protein nitrosylation(GO:0017014) |
| 0.1 | 0.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 0.1 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.1 | 0.4 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.1 | 0.6 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 0.2 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.1 | 0.1 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.1 | 0.3 | GO:0032298 | positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.1 | 0.2 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.3 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.1 | 1.9 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.1 | 0.2 | GO:0000087 | mitotic M phase(GO:0000087) mitotic cell cycle phase(GO:0098763) |
| 0.1 | 0.5 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
| 0.1 | 0.3 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.1 | 0.5 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.1 | 0.2 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
| 0.1 | 0.5 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.1 | 0.3 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) convergent extension involved in axis elongation(GO:0060028) |
| 0.1 | 0.2 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.1 | 0.4 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 | 0.1 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.1 | 1.2 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.1 | 0.4 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 | 0.2 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.1 | 1.2 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.1 | 0.6 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
| 0.1 | 0.2 | GO:0060217 | positive regulation of chromatin assembly or disassembly(GO:0045799) hemangioblast cell differentiation(GO:0060217) |
| 0.1 | 0.1 | GO:0030969 | mRNA splicing via endonucleolytic cleavage and ligation involved in unfolded protein response(GO:0030969) mRNA splicing, via endonucleolytic cleavage and ligation(GO:0070054) mRNA endonucleolytic cleavage involved in unfolded protein response(GO:0070055) |
| 0.1 | 0.6 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.1 | 0.2 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.1 | 0.2 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.1 | 0.5 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.0 | 0.2 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.0 | 0.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.7 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.0 | 0.2 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 | 0.2 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.0 | 0.2 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.6 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.1 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.0 | 0.4 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.5 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.0 | 0.8 | GO:0045760 | positive regulation of action potential(GO:0045760) |
| 0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 | 1.1 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.0 | 0.2 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.0 | 0.6 | GO:0030953 | astral microtubule organization(GO:0030953) |
| 0.0 | 0.2 | GO:1905049 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
| 0.0 | 0.5 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.0 | 3.9 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.0 | 0.5 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 0.0 | 0.2 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 0.0 | 0.3 | GO:0051036 | regulation of endosome size(GO:0051036) |
| 0.0 | 0.6 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.0 | 0.2 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.0 | 0.6 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
| 0.0 | 0.1 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.0 | 1.2 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
| 0.0 | 0.1 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
| 0.0 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 1.7 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.0 | 0.2 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.0 | 0.0 | GO:2000852 | regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.0 | 0.1 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.0 | 0.2 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.0 | 0.7 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.0 | 0.2 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.2 | GO:0021678 | third ventricle development(GO:0021678) |
| 0.0 | 0.5 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 | 0.3 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 | 0.2 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.1 | GO:0042275 | error-free postreplication DNA repair(GO:0042275) |
| 0.0 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.0 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.0 | 0.3 | GO:0001773 | myeloid dendritic cell activation(GO:0001773) myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 | 0.2 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 | 0.3 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.0 | 0.4 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.1 | GO:0031622 | positive regulation of fever generation(GO:0031622) |
| 0.0 | 0.1 | GO:0009182 | purine deoxyribonucleotide biosynthetic process(GO:0009153) purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) GDP metabolic process(GO:0046710) |
| 0.0 | 0.2 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.0 | 0.5 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.0 | 0.7 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.0 | 0.2 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.0 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 | 0.3 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.0 | 0.4 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.6 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.0 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.4 | GO:0015677 | copper ion import(GO:0015677) |
| 0.0 | 0.4 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.0 | 0.4 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.0 | 0.2 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.0 | 0.1 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 | 0.4 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 | 0.0 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.0 | 0.1 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.0 | 1.1 | GO:0006101 | citrate metabolic process(GO:0006101) |
| 0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.2 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.0 | 2.0 | GO:0031638 | zymogen activation(GO:0031638) |
| 0.0 | 0.4 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.0 | 1.0 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
| 0.0 | 0.1 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.0 | 0.4 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.3 | GO:0009650 | UV protection(GO:0009650) |
| 0.0 | 0.2 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.2 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
| 0.0 | 0.9 | GO:1900077 | negative regulation of cellular response to insulin stimulus(GO:1900077) |
| 0.0 | 0.2 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.0 | 0.4 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
| 0.0 | 0.1 | GO:0003417 | growth plate cartilage development(GO:0003417) |
| 0.0 | 0.6 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
| 0.0 | 4.5 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.0 | 0.2 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.0 | 0.4 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.0 | 0.5 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 | 3.3 | GO:0016579 | protein deubiquitination(GO:0016579) |
| 0.0 | 0.2 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.0 | 0.9 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.0 | 0.3 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.0 | 0.5 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.0 | 5.3 | GO:0048193 | Golgi vesicle transport(GO:0048193) |
| 0.0 | 0.1 | GO:0010985 | negative regulation of lipoprotein particle clearance(GO:0010985) |
| 0.0 | 0.2 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
| 0.0 | 1.2 | GO:0014003 | oligodendrocyte development(GO:0014003) |
| 0.0 | 0.3 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.0 | 0.3 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.1 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.3 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
| 0.0 | 0.6 | GO:0005980 | polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 | 0.2 | GO:0042297 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
| 0.0 | 0.3 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
| 0.0 | 0.5 | GO:2000036 | regulation of stem cell population maintenance(GO:2000036) |
| 0.0 | 0.7 | GO:0007099 | centriole replication(GO:0007099) |
| 0.0 | 0.6 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.1 | GO:0033561 | regulation of water loss via skin(GO:0033561) establishment of skin barrier(GO:0061436) |
| 0.0 | 0.3 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.1 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) spinal cord ventral commissure morphogenesis(GO:0021965) |
| 0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.0 | 0.0 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.0 | 0.3 | GO:0019835 | cytolysis(GO:0019835) |
| 0.0 | 0.3 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 0.0 | 0.4 | GO:0006884 | cell volume homeostasis(GO:0006884) |
| 0.0 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.2 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 1.2 | GO:0006446 | regulation of translational initiation(GO:0006446) |
| 0.0 | 0.1 | GO:0016068 | antibody-dependent cellular cytotoxicity(GO:0001788) regulation of type I hypersensitivity(GO:0001810) positive regulation of type I hypersensitivity(GO:0001812) type I hypersensitivity(GO:0016068) |
| 0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.5 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.3 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 0.4 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 | 0.2 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
| 0.0 | 0.1 | GO:1902219 | regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.0 | 0.0 | GO:0042447 | hormone catabolic process(GO:0042447) |
| 0.0 | 0.5 | GO:0002053 | positive regulation of mesenchymal cell proliferation(GO:0002053) |
| 0.0 | 0.2 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 | 0.1 | GO:0015840 | urea transport(GO:0015840) urea transmembrane transport(GO:0071918) |
| 0.0 | 0.1 | GO:0035115 | embryonic forelimb morphogenesis(GO:0035115) |
| 0.0 | 0.4 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.0 | 0.1 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.0 | 1.5 | GO:0007405 | neuroblast proliferation(GO:0007405) |
| 0.0 | 0.4 | GO:0046854 | lipid phosphorylation(GO:0046834) phosphatidylinositol phosphorylation(GO:0046854) |
| 0.0 | 0.6 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
| 0.0 | 0.0 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.0 | 0.3 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 0.2 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.6 | GO:0006040 | amino sugar metabolic process(GO:0006040) |
| 0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.5 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.0 | 0.2 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.1 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
| 0.0 | 0.4 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
| 0.0 | 0.1 | GO:0040031 | snRNA pseudouridine synthesis(GO:0031120) snRNA modification(GO:0040031) |
| 0.0 | 0.2 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
| 0.0 | 0.3 | GO:0048636 | positive regulation of striated muscle tissue development(GO:0045844) positive regulation of muscle organ development(GO:0048636) |
| 0.0 | 0.5 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
| 0.0 | 0.3 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
| 0.0 | 0.1 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.1 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 | 0.2 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.0 | 1.0 | GO:0043488 | regulation of mRNA stability(GO:0043488) |
| 0.0 | 0.1 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.0 | 0.4 | GO:0032410 | negative regulation of transporter activity(GO:0032410) |
| 0.0 | 0.2 | GO:0061084 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) regulation of protein folding(GO:1903332) negative regulation of protein folding(GO:1903333) |
| 0.0 | 0.3 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.0 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.2 | GO:0034390 | smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
| 0.0 | 0.2 | GO:0007602 | phototransduction(GO:0007602) |
| 0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.1 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.0 | 0.3 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.0 | 0.2 | GO:0070266 | necroptotic process(GO:0070266) |
| 0.0 | 0.1 | GO:0050926 | tolerance induction(GO:0002507) regulation of positive chemotaxis(GO:0050926) positive regulation of positive chemotaxis(GO:0050927) |
| 0.0 | 0.6 | GO:0061178 | regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061178) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.0 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.4 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
| 0.0 | 0.2 | GO:0051497 | negative regulation of actin filament bundle assembly(GO:0032232) negative regulation of stress fiber assembly(GO:0051497) |
| 0.0 | 0.6 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
| 0.0 | 0.2 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.3 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.0 | 0.9 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
| 0.0 | 0.2 | GO:0001656 | metanephros development(GO:0001656) |
| 0.0 | 0.4 | GO:0007200 | phospholipase C-activating G-protein coupled receptor signaling pathway(GO:0007200) |
| 0.0 | 0.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.0 | 0.1 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
| 0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.0 | 0.2 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
| 0.0 | 0.3 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.0 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.0 | 0.2 | GO:0010955 | negative regulation of protein processing(GO:0010955) negative regulation of protein maturation(GO:1903318) |
| 0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.0 | 0.0 | GO:0072429 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) regulation of peroxisome size(GO:0044375) |
| 0.0 | 0.3 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
| 0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 0.0 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 0.1 | GO:0015786 | UDP-glucose transport(GO:0015786) |
| 0.0 | 0.5 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.0 | 0.4 | GO:0018107 | peptidyl-threonine phosphorylation(GO:0018107) |
| 0.0 | 0.0 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.2 | GO:0045921 | positive regulation of exocytosis(GO:0045921) |
| 0.0 | 0.1 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.0 | 0.0 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.0 | 0.0 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.1 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 | 0.4 | GO:0042168 | heme metabolic process(GO:0042168) |
| 0.0 | 0.1 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
| 0.0 | 0.1 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 0.0 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 | 0.1 | GO:0097369 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.0 | GO:0072539 | T-helper 17 type immune response(GO:0072538) T-helper 17 cell differentiation(GO:0072539) |
| 0.0 | 0.2 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
| 0.0 | 0.0 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.2 | GO:0031952 | regulation of protein autophosphorylation(GO:0031952) |
| 0.0 | 0.0 | GO:0010958 | regulation of amino acid import(GO:0010958) regulation of L-arginine import(GO:0010963) |
| 0.0 | 0.1 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
| 0.0 | 0.1 | GO:0046460 | triglyceride biosynthetic process(GO:0019432) neutral lipid biosynthetic process(GO:0046460) acylglycerol biosynthetic process(GO:0046463) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 2.4 | GO:0043512 | inhibin A complex(GO:0043512) |
| 0.8 | 3.1 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.7 | 2.2 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.7 | 2.7 | GO:1990032 | parallel fiber(GO:1990032) |
| 0.6 | 2.4 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
| 0.3 | 2.9 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.3 | 1.9 | GO:0045179 | apical cortex(GO:0045179) |
| 0.3 | 2.9 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.3 | 1.4 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.2 | 3.9 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.2 | 2.1 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.2 | 0.6 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.2 | 0.6 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.2 | 3.7 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.2 | 4.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.2 | 1.8 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.2 | 0.5 | GO:0071914 | prominosome(GO:0071914) |
| 0.2 | 0.7 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.2 | 0.5 | GO:0097233 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.2 | 2.0 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.2 | 1.2 | GO:0097433 | dense body(GO:0097433) |
| 0.2 | 4.8 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.1 | 0.9 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.1 | 2.2 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.1 | 0.7 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 0.4 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 4.8 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.1 | 0.7 | GO:0005861 | troponin complex(GO:0005861) |
| 0.1 | 0.4 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.1 | 0.8 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.1 | 0.4 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.1 | 1.2 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 1.0 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 0.4 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.1 | 0.8 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 0.6 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 0.5 | GO:0043259 | laminin-1 complex(GO:0005606) laminin-10 complex(GO:0043259) |
| 0.1 | 0.6 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.3 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.1 | 0.3 | GO:0005940 | septin ring(GO:0005940) |
| 0.1 | 1.4 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 0.3 | GO:0097447 | dendritic tree(GO:0097447) |
| 0.1 | 0.4 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 0.6 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.1 | 0.4 | GO:0090537 | CERF complex(GO:0090537) |
| 0.1 | 0.4 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.1 | 0.3 | GO:0070449 | elongin complex(GO:0070449) |
| 0.1 | 0.3 | GO:0044299 | C-fiber(GO:0044299) |
| 0.1 | 0.2 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 1.4 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 0.5 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.1 | 1.0 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.1 | 0.3 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.1 | 0.6 | GO:0070695 | FHF complex(GO:0070695) |
| 0.1 | 0.8 | GO:0034706 | voltage-gated sodium channel complex(GO:0001518) sodium channel complex(GO:0034706) |
| 0.1 | 0.2 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.1 | 0.3 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.1 | 0.5 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.1 | 0.3 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.1 | 0.2 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.1 | 0.3 | GO:0071942 | XPC complex(GO:0071942) |
| 0.1 | 1.1 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.1 | 0.2 | GO:0030057 | desmosome(GO:0030057) |
| 0.1 | 1.6 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.1 | 0.3 | GO:1990204 | oxidoreductase complex(GO:1990204) |
| 0.1 | 0.5 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.1 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.1 | 1.0 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 0.5 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.8 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
| 0.1 | 0.4 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 0.2 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.1 | 2.6 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.1 | 0.4 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.1 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 3.7 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.1 | 0.4 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.1 | 0.4 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 0.7 | GO:0048188 | MLL3/4 complex(GO:0044666) Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 1.1 | GO:0000145 | exocyst(GO:0000145) |
| 0.1 | 0.3 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.1 | 0.6 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.1 | 0.5 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 0.6 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.1 | 0.2 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
| 0.1 | 1.3 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 0.4 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 0.5 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 0.8 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.1 | 0.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 0.7 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.1 | 1.1 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.4 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.6 | GO:0060076 | excitatory synapse(GO:0060076) |
| 0.0 | 0.5 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.5 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 4.7 | GO:0043195 | terminal bouton(GO:0043195) |
| 0.0 | 0.1 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 12.2 | GO:0014069 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
| 0.0 | 0.2 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 0.4 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 0.2 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.0 | GO:0030135 | coated vesicle(GO:0030135) |
| 0.0 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) ERCC4-ERCC1 complex(GO:0070522) |
| 0.0 | 0.6 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 4.1 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.7 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.6 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.4 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.0 | 0.4 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.3 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.0 | 0.5 | GO:0016234 | inclusion body(GO:0016234) |
| 0.0 | 0.3 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.8 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 0.2 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
| 0.0 | 0.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.3 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.0 | 0.6 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.0 | 0.6 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.1 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 2.4 | GO:0043197 | dendritic spine(GO:0043197) |
| 0.0 | 0.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.3 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.1 | GO:0070826 | paraferritin complex(GO:0070826) |
| 0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 1.2 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 2.9 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.2 | GO:0031105 | septin complex(GO:0031105) |
| 0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 2.4 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.0 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.4 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.5 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.5 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.3 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.1 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.6 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 3.4 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 0.2 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.0 | 0.1 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) clathrin-coated endocytic vesicle membrane(GO:0030669) |
| 0.0 | 0.5 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.3 | GO:0005776 | autophagosome(GO:0005776) |
| 0.0 | 0.7 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.0 | 0.2 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 0.8 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 6.2 | GO:0005635 | nuclear envelope(GO:0005635) |
| 0.0 | 0.7 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.2 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.2 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.0 | 0.1 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.1 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.0 | 0.2 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.3 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.2 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.3 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 0.8 | GO:0030426 | growth cone(GO:0030426) |
| 0.0 | 0.3 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.0 | 0.5 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.0 | 0.4 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.0 | 0.1 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.4 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.0 | 0.5 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.1 | GO:0097361 | CIA complex(GO:0097361) |
| 0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.5 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.0 | 0.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.4 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.0 | 1.7 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
| 0.0 | 0.3 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.0 | 0.1 | GO:0032433 | filopodium tip(GO:0032433) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 3.8 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.7 | 2.2 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.6 | 2.3 | GO:1902379 | chemoattractant activity involved in axon guidance(GO:1902379) |
| 0.6 | 2.2 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.5 | 1.6 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.5 | 2.5 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.5 | 3.9 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.5 | 5.6 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.5 | 2.8 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.4 | 2.7 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.4 | 1.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.4 | 6.7 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.4 | 1.2 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
| 0.4 | 2.7 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.3 | 2.7 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.3 | 1.0 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.3 | 1.0 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.3 | 0.9 | GO:0047598 | 7-dehydrocholesterol reductase activity(GO:0047598) |
| 0.3 | 0.9 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
| 0.3 | 0.9 | GO:0001565 | phorbol ester receptor activity(GO:0001565) non-kinase phorbol ester receptor activity(GO:0001566) |
| 0.3 | 3.2 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.3 | 2.5 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.3 | 1.9 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
| 0.3 | 3.8 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.3 | 7.1 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.3 | 1.8 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.3 | 1.0 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.3 | 0.8 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.2 | 0.7 | GO:0031403 | lithium ion binding(GO:0031403) |
| 0.2 | 1.2 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.2 | 0.7 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.2 | 4.2 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.2 | 0.7 | GO:0070890 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 0.2 | 1.3 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.2 | 0.8 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.2 | 5.5 | GO:0034930 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) heparan sulfate 2-O-sulfotransferase activity(GO:0004394) HNK-1 sulfotransferase activity(GO:0016232) heparan sulfate 6-O-sulfotransferase activity(GO:0017095) trans-9R,10R-dihydrodiolphenanthrene sulfotransferase activity(GO:0018721) 1-phenanthrol sulfotransferase activity(GO:0018722) 3-phenanthrol sulfotransferase activity(GO:0018723) 4-phenanthrol sulfotransferase activity(GO:0018724) trans-3,4-dihydrodiolphenanthrene sulfotransferase activity(GO:0018725) 9-phenanthrol sulfotransferase activity(GO:0018726) 2-phenanthrol sulfotransferase activity(GO:0018727) phenanthrol sulfotransferase activity(GO:0019111) 1-hydroxypyrene sulfotransferase activity(GO:0034930) proteoglycan sulfotransferase activity(GO:0050698) cholesterol sulfotransferase activity(GO:0051922) hydroxyjasmonate sulfotransferase activity(GO:0080131) |
| 0.2 | 0.8 | GO:0070976 | calcium-independent protein kinase C activity(GO:0004699) TIR domain binding(GO:0070976) |
| 0.2 | 0.8 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.2 | 0.6 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.2 | 1.0 | GO:0086080 | connexin binding(GO:0071253) protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.2 | 0.6 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.2 | 0.6 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.2 | 3.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.2 | 0.9 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.2 | 0.5 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.2 | 0.5 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
| 0.2 | 0.5 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) apolipoprotein A-I receptor activity(GO:0034188) |
| 0.2 | 5.6 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.2 | 0.2 | GO:0070012 | oligopeptidase activity(GO:0070012) |
| 0.2 | 0.7 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.2 | 1.1 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.2 | 1.6 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.2 | 2.7 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.2 | 0.5 | GO:0003692 | left-handed Z-DNA binding(GO:0003692) |
| 0.2 | 1.3 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.2 | 0.5 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
| 0.1 | 0.9 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 0.6 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.1 | 1.6 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 3.1 | GO:0017161 | JUN kinase phosphatase activity(GO:0008579) phosphohistidine phosphatase activity(GO:0008969) inositol-1,3,4-trisphosphate 4-phosphatase activity(GO:0017161) NADP phosphatase activity(GO:0019178) 5-amino-6-(5-phosphoribitylamino)uracil phosphatase activity(GO:0043726) phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-3,4-bisphosphate 4-phosphatase activity(GO:0052828) inositol-1,3,4-trisphosphate 1-phosphatase activity(GO:0052829) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) phosphatidylinositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052867) IDP phosphatase activity(GO:1990003) |
| 0.1 | 0.6 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 0.9 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.1 | 0.9 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 4.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.1 | 1.1 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
| 0.1 | 0.5 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 0.4 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.1 | 0.8 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 0.4 | GO:0003979 | UDP-glucose 6-dehydrogenase activity(GO:0003979) |
| 0.1 | 0.5 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.1 | 0.6 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.1 | 3.0 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.1 | 0.7 | GO:0045340 | mercury ion binding(GO:0045340) |
| 0.1 | 2.6 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.1 | 0.6 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.1 | 0.4 | GO:0033883 | pyridoxal phosphatase activity(GO:0033883) |
| 0.1 | 2.2 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.1 | 0.4 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.1 | 0.6 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.1 | 0.7 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.4 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.1 | 0.9 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.1 | 0.6 | GO:0008761 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) |
| 0.1 | 1.0 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.1 | 0.2 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.1 | 0.8 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.1 | 0.3 | GO:0004686 | elongation factor-2 kinase activity(GO:0004686) |
| 0.1 | 2.8 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.1 | 0.8 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.1 | 1.0 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 0.6 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.1 | 1.5 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.1 | 0.6 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.1 | 0.7 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 0.7 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 0.8 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.1 | 0.3 | GO:0004008 | copper-exporting ATPase activity(GO:0004008) copper-transporting ATPase activity(GO:0043682) |
| 0.1 | 0.4 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.1 | 0.8 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.1 | 0.4 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.1 | 0.3 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.1 | 4.3 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.1 | 2.4 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.1 | 1.0 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 1.0 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.1 | 1.0 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 0.1 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
| 0.1 | 1.6 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 2.1 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.1 | 0.3 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.1 | 0.9 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.1 | 0.3 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.1 | 0.3 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.1 | 0.4 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.1 | 0.3 | GO:0018121 | imidazoleglycerol-phosphate synthase activity(GO:0000107) NAD(P)-cysteine ADP-ribosyltransferase activity(GO:0018071) NAD(P)-asparagine ADP-ribosyltransferase activity(GO:0018121) NAD(P)-serine ADP-ribosyltransferase activity(GO:0018127) 7-cyano-7-deazaguanine tRNA-ribosyltransferase activity(GO:0043867) purine deoxyribosyltransferase activity(GO:0044102) |
| 0.1 | 0.8 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.1 | 0.2 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.1 | 0.6 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.1 | 0.4 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 0.8 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 0.2 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.1 | 2.1 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.1 | 1.2 | GO:0042556 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) phosphatidylinositol bisphosphate kinase activity(GO:0052813) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.1 | 0.4 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.1 | 0.2 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
| 0.1 | 0.3 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.1 | 0.4 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 0.6 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.1 | 0.6 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.1 | 0.6 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 0.8 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.1 | 1.3 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.1 | 0.3 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.1 | 3.8 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.1 | 3.0 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.1 | 0.3 | GO:0004096 | aminoacylase activity(GO:0004046) catalase activity(GO:0004096) |
| 0.1 | 0.3 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
| 0.1 | 0.3 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.1 | 1.8 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.6 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 3.1 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.1 | 0.8 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.1 | 0.2 | GO:0035651 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
| 0.1 | 0.6 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.1 | 0.2 | GO:0004637 | phosphoribosylamine-glycine ligase activity(GO:0004637) |
| 0.1 | 0.2 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.1 | 2.4 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 0.2 | GO:0070404 | NADH binding(GO:0070404) |
| 0.1 | 0.7 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.8 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.1 | 0.8 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.1 | 1.1 | GO:0008146 | sulfotransferase activity(GO:0008146) |
| 0.1 | 0.4 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.1 | 0.3 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.1 | 0.5 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.1 | 0.3 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.1 | 1.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.1 | 2.0 | GO:0034945 | dihydrolipoamide branched chain acyltransferase activity(GO:0004147) palmitoleoyl [acyl-carrier-protein]-dependent acyltransferase activity(GO:0008951) serine O-acyltransferase activity(GO:0016412) O-succinyltransferase activity(GO:0016750) sinapoyltransferase activity(GO:0016752) O-sinapoyltransferase activity(GO:0016753) peptidyl-lysine N6-myristoyltransferase activity(GO:0018030) peptidyl-lysine N6-palmitoyltransferase activity(GO:0018031) benzoyl acetate-CoA thiolase activity(GO:0018711) 3-hydroxybutyryl-CoA thiolase activity(GO:0018712) 3-ketopimelyl-CoA thiolase activity(GO:0018713) N-palmitoyltransferase activity(GO:0019105) acyl-CoA N-acyltransferase activity(GO:0019186) protein-cysteine S-myristoyltransferase activity(GO:0019705) glucosaminyl-phosphotidylinositol O-acyltransferase activity(GO:0032216) ergosterol O-acyltransferase activity(GO:0034737) lanosterol O-acyltransferase activity(GO:0034738) naphthyl-2-oxomethyl-succinyl-CoA succinyl transferase activity(GO:0034848) 2,4,4-trimethyl-3-oxopentanoyl-CoA 2-C-propanoyl transferase activity(GO:0034851) 2-methylhexanoyl-CoA C-acetyltransferase activity(GO:0034915) butyryl-CoA 2-C-propionyltransferase activity(GO:0034919) 2,6-dimethyl-5-methylene-3-oxo-heptanoyl-CoA C-acetyltransferase activity(GO:0034945) L-2-aminoadipate N-acetyltransferase activity(GO:0043741) keto acid formate lyase activity(GO:0043806) azetidine-2-carboxylic acid acetyltransferase activity(GO:0046941) peptidyl-lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0052858) acetyl-CoA:L-lysine N6-acetyltransferase(GO:0090595) |
| 0.1 | 0.2 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.1 | 0.7 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.1 | 0.5 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.1 | 0.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.1 | 1.0 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 0.2 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.1 | 1.2 | GO:0005521 | lamin binding(GO:0005521) |
| 0.1 | 0.2 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.1 | 0.7 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.1 | 0.5 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.1 | 1.2 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 1.0 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.1 | 0.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 0.2 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.1 | 0.2 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
| 0.1 | 0.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.1 | 0.3 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 0.2 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.1 | 1.1 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.1 | 2.3 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.1 | 0.5 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) collagen receptor activity(GO:0038064) |
| 0.0 | 0.4 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 2.8 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.0 | 0.2 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.0 | 0.2 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.3 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.0 | 1.2 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 0.9 | GO:0051723 | protein methylesterase activity(GO:0051723) |
| 0.0 | 0.3 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.0 | 4.7 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.0 | 0.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 0.4 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.3 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 0.5 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.6 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 0.3 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.3 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.1 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.6 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.0 | 1.6 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.1 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.2 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.0 | 0.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 1.1 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
| 0.0 | 0.4 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.0 | 0.2 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.0 | 1.0 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.0 | 0.5 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.0 | 0.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.0 | 0.3 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.1 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
| 0.0 | 0.4 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.0 | 0.5 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.1 | GO:0048019 | receptor antagonist activity(GO:0048019) |
| 0.0 | 0.1 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.5 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.5 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
| 0.0 | 0.3 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 0.5 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.5 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.3 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.0 | 12.0 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
| 0.0 | 1.3 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.0 | 0.8 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.4 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.0 | 0.1 | GO:0015086 | cadmium ion transmembrane transporter activity(GO:0015086) cobalt ion transmembrane transporter activity(GO:0015087) lead ion transmembrane transporter activity(GO:0015094) nickel cation transmembrane transporter activity(GO:0015099) vanadium ion transmembrane transporter activity(GO:0015100) ferrous iron uptake transmembrane transporter activity(GO:0015639) |
| 0.0 | 0.5 | GO:0046332 | SMAD binding(GO:0046332) |
| 0.0 | 1.0 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 0.5 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 0.2 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.0 | 0.7 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.0 | 0.5 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.1 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.0 | 0.6 | GO:0005548 | phospholipid transporter activity(GO:0005548) |
| 0.0 | 0.3 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.3 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.0 | 0.2 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 0.0 | 0.2 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.3 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.0 | 0.2 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.2 | GO:0046030 | inositol trisphosphate phosphatase activity(GO:0046030) |
| 0.0 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.1 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.0 | 0.4 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 1.4 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.0 | 0.1 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
| 0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 0.2 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
| 0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 0.3 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 0.1 | GO:0050062 | long-chain-fatty-acyl-CoA reductase activity(GO:0050062) fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.1 | GO:0070330 | aromatase activity(GO:0070330) |
| 0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.1 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.1 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.0 | 0.0 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.0 | 0.1 | GO:0050347 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.0 | 0.8 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 0.2 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.1 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 0.0 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 1.4 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.0 | 0.1 | GO:0034943 | acyl-CoA ligase activity(GO:0003996) 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.0 | 0.4 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.0 | 0.1 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.0 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.4 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.3 | GO:0004532 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity(GO:0004532) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
| 0.0 | 0.5 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.0 | GO:0016428 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.0 | 0.2 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.3 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.0 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.2 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
| 0.0 | 0.1 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.0 | 0.1 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.0 | 0.1 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.0 | 0.4 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 0.3 | GO:0051018 | protein kinase A binding(GO:0051018) |
| 0.0 | 0.7 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
| 0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 0.0 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.0 | GO:0035591 | signaling adaptor activity(GO:0035591) |
| 0.0 | 0.3 | GO:0016814 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amidines(GO:0016814) |
| 0.0 | 0.2 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.1 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |