Motif ID: Hnf4g
Z-value: 1.174

Transcription factors associated with Hnf4g:
Gene Symbol | Entrez ID | Gene Name |
---|---|---|
Hnf4g | ENSMUSG00000017688.8 | Hnf4g |
Top targets:
Gene overrepresentation in biological_process category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.1 | GO:0060489 | orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
0.3 | 1.0 | GO:0019343 | cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
0.3 | 0.9 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
0.3 | 0.8 | GO:0016095 | polyprenol catabolic process(GO:0016095) terpenoid catabolic process(GO:0016115) |
0.2 | 0.2 | GO:0036482 | neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
0.2 | 0.9 | GO:0045608 | inhibition of neuroepithelial cell differentiation(GO:0002085) negative regulation of auditory receptor cell differentiation(GO:0045608) |
0.2 | 0.6 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.2 | 0.6 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.2 | 0.6 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.2 | 1.5 | GO:0061687 | detoxification of inorganic compound(GO:0061687) |
0.2 | 0.4 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
0.2 | 0.5 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.2 | 0.7 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
0.2 | 0.7 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.2 | 0.8 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.2 | 1.0 | GO:0032196 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) transposition(GO:0032196) |
0.2 | 0.2 | GO:2000981 | negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
0.2 | 0.5 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
0.1 | 0.6 | GO:1904565 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
0.1 | 0.7 | GO:0021905 | pancreatic A cell development(GO:0003322) forebrain-midbrain boundary formation(GO:0021905) somatic motor neuron fate commitment(GO:0021917) regulation of transcription from RNA polymerase II promoter involved in somatic motor neuron fate commitment(GO:0021918) sensory neuron migration(GO:1904937) |
0.1 | 0.4 | GO:0021972 | corticospinal neuron axon guidance through spinal cord(GO:0021972) positive regulation of negative chemotaxis(GO:0050924) induction of negative chemotaxis(GO:0050929) negative regulation of mononuclear cell migration(GO:0071676) negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
0.1 | 0.3 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.1 | 0.4 | GO:0060598 | dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
0.1 | 0.4 | GO:0002447 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) regulation of eosinophil activation(GO:1902566) |
0.1 | 0.4 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
0.1 | 0.4 | GO:0071649 | regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
0.1 | 0.5 | GO:0051316 | attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
0.1 | 0.7 | GO:0032901 | positive regulation of neurotrophin production(GO:0032901) |
0.1 | 0.4 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.1 | 0.5 | GO:2001045 | closure of optic fissure(GO:0061386) negative regulation of integrin-mediated signaling pathway(GO:2001045) |
0.1 | 0.4 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.3 | GO:0071579 | regulation of zinc ion transport(GO:0071579) |
0.1 | 0.2 | GO:0031016 | pancreas development(GO:0031016) |
0.1 | 0.6 | GO:1900170 | negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
0.1 | 0.6 | GO:0032902 | nerve growth factor production(GO:0032902) |
0.1 | 0.1 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
0.1 | 0.2 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.1 | 0.4 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
0.1 | 0.1 | GO:0010039 | response to iron ion(GO:0010039) |
0.1 | 0.4 | GO:0060217 | hemangioblast cell differentiation(GO:0060217) |
0.1 | 0.6 | GO:1904684 | negative regulation of metalloendopeptidase activity(GO:1904684) |
0.1 | 0.3 | GO:0002489 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway(GO:0002488) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway, TAP-dependent(GO:0002489) |
0.1 | 0.3 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.1 | 0.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.4 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
0.1 | 0.3 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.1 | 0.4 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.1 | 0.4 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.3 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.1 | 0.5 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.1 | 0.3 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.1 | 0.4 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.1 | 0.6 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.1 | 0.5 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.5 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
0.1 | 0.9 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.1 | 0.6 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.1 | 1.7 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.1 | 0.3 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.1 | 0.4 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.1 | 0.5 | GO:0019659 | fermentation(GO:0006113) lactate biosynthetic process from pyruvate(GO:0019244) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.1 | 0.4 | GO:0006203 | dGTP catabolic process(GO:0006203) dATP catabolic process(GO:0046061) |
0.1 | 0.2 | GO:0060769 | positive regulation of epithelial cell proliferation involved in prostate gland development(GO:0060769) |
0.1 | 0.4 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 0.4 | GO:2000256 | positive regulation of male germ cell proliferation(GO:2000256) |
0.1 | 0.4 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.3 | GO:1901250 | regulation of lung goblet cell differentiation(GO:1901249) negative regulation of lung goblet cell differentiation(GO:1901250) |
0.1 | 0.3 | GO:0042823 | pyridoxal phosphate biosynthetic process(GO:0042823) |
0.1 | 0.3 | GO:0051933 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
0.1 | 0.5 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.1 | 0.2 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.1 | 0.7 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.1 | 0.3 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.1 | 0.3 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.1 | 0.3 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.7 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.1 | 0.7 | GO:0046459 | short-chain fatty acid metabolic process(GO:0046459) |
0.1 | 0.3 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.1 | 0.5 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.1 | 0.2 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.1 | 0.6 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.5 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.1 | 0.5 | GO:0007144 | female meiosis I(GO:0007144) |
0.1 | 0.1 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.1 | 0.1 | GO:0090559 | regulation of membrane permeability(GO:0090559) |
0.1 | 0.7 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.1 | 0.3 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.2 | GO:0060821 | inactivation of X chromosome by DNA methylation(GO:0060821) |
0.1 | 0.4 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.7 | GO:0006560 | proline metabolic process(GO:0006560) |
0.1 | 0.9 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 0.2 | GO:0035604 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) coronal suture morphogenesis(GO:0060365) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) |
0.1 | 0.6 | GO:0072615 | interleukin-17 secretion(GO:0072615) |
0.1 | 0.4 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.1 | 0.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.1 | 0.2 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
0.1 | 0.2 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.1 | 0.2 | GO:0014891 | striated muscle atrophy(GO:0014891) |
0.1 | 0.2 | GO:0048698 | negative regulation of collateral sprouting in absence of injury(GO:0048698) |
0.1 | 0.3 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.1 | 0.7 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.1 | 0.4 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.1 | 0.7 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.1 | 0.3 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
0.1 | 0.2 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 0.2 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
0.1 | 0.1 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
0.1 | 0.3 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.1 | 0.6 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.1 | 1.0 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 0.3 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.3 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.1 | 0.4 | GO:0046490 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
0.1 | 0.2 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
0.1 | 0.2 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
0.1 | 0.4 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 0.2 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.1 | 0.1 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.1 | 0.5 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.1 | 0.5 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.1 | 0.2 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.1 | 0.3 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.1 | 0.7 | GO:0009437 | amino-acid betaine metabolic process(GO:0006577) carnitine metabolic process(GO:0009437) |
0.1 | 0.3 | GO:0015692 | vanadium ion transport(GO:0015676) lead ion transport(GO:0015692) |
0.1 | 0.3 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
0.1 | 1.0 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.1 | 0.5 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.1 | 0.3 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
0.1 | 0.3 | GO:0015788 | UDP-N-acetylglucosamine transport(GO:0015788) |
0.1 | 0.4 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
0.1 | 0.2 | GO:1902743 | regulation of lamellipodium organization(GO:1902743) |
0.1 | 0.2 | GO:0032053 | ciliary basal body organization(GO:0032053) |
0.1 | 0.2 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.1 | 0.3 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.1 | 0.4 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.1 | 0.2 | GO:1901072 | fructose biosynthetic process(GO:0046370) glucosamine-containing compound catabolic process(GO:1901072) |
0.1 | 0.3 | GO:0070989 | oxidative demethylation(GO:0070989) |
0.1 | 0.4 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.1 | 0.2 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
0.1 | 0.2 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.1 | 0.3 | GO:0032298 | positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
0.1 | 0.2 | GO:0009174 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.1 | 0.3 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.1 | 0.3 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
0.1 | 0.2 | GO:0045819 | plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
0.1 | 0.2 | GO:0021998 | neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) positive regulation of cardiac ventricle development(GO:1904414) |
0.1 | 0.3 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.1 | 0.2 | GO:0019389 | glucuronoside metabolic process(GO:0019389) |
0.1 | 0.2 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.0 | 0.3 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.3 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.0 | 0.3 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.1 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
0.0 | 0.1 | GO:0045004 | DNA replication proofreading(GO:0045004) |
0.0 | 0.1 | GO:0036166 | phenotypic switching(GO:0036166) |
0.0 | 0.1 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
0.0 | 0.2 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.0 | 0.4 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.0 | 0.1 | GO:0045006 | DNA deamination(GO:0045006) |
0.0 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 0.6 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.3 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.1 | GO:0070560 | protein secretion by platelet(GO:0070560) |
0.0 | 0.1 | GO:0001978 | regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
0.0 | 0.1 | GO:0060282 | positive regulation of chronic inflammatory response(GO:0002678) positive regulation of oocyte development(GO:0060282) |
0.0 | 0.3 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.0 | 0.3 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.2 | GO:0072683 | T cell extravasation(GO:0072683) |
0.0 | 0.4 | GO:0042167 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.0 | 0.4 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.0 | 0.2 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.0 | 0.2 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.0 | 0.2 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
0.0 | 0.4 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.0 | 0.3 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.2 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.0 | 0.3 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.2 | GO:0089700 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) protein kinase D signaling(GO:0089700) |
0.0 | 0.6 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.6 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.0 | 0.2 | GO:0032776 | DNA methylation on cytosine(GO:0032776) |
0.0 | 0.2 | GO:0045963 | dopamine catabolic process(GO:0042420) negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.0 | 0.2 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.0 | 0.5 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.0 | 0.1 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
0.0 | 0.3 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.0 | 0.3 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.0 | 0.6 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.0 | 0.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.0 | 0.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.1 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
0.0 | 0.5 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.1 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
0.0 | 0.3 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.1 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
0.0 | 0.1 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
0.0 | 0.1 | GO:0060126 | hypophysis morphogenesis(GO:0048850) somatotropin secreting cell differentiation(GO:0060126) |
0.0 | 0.2 | GO:0001936 | regulation of endothelial cell proliferation(GO:0001936) |
0.0 | 0.1 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.0 | 0.2 | GO:0003383 | apical constriction(GO:0003383) |
0.0 | 0.2 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.0 | 0.2 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.5 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.0 | 0.1 | GO:0010958 | regulation of amino acid import(GO:0010958) |
0.0 | 0.0 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.0 | 0.2 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.2 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.0 | 0.2 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
0.0 | 0.8 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
0.0 | 1.1 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
0.0 | 0.2 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.0 | 0.1 | GO:0043686 | co-translational protein modification(GO:0043686) |
0.0 | 0.1 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.0 | 0.1 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
0.0 | 0.2 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.0 | 0.2 | GO:0051897 | positive regulation of protein kinase B signaling(GO:0051897) |
0.0 | 0.1 | GO:0030070 | insulin processing(GO:0030070) |
0.0 | 0.3 | GO:0021940 | positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
0.0 | 0.4 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.1 | GO:0000448 | cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
0.0 | 0.2 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.0 | 0.9 | GO:0003416 | endochondral bone growth(GO:0003416) |
0.0 | 0.3 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.0 | 0.2 | GO:0015862 | uridine transport(GO:0015862) |
0.0 | 0.2 | GO:0015677 | copper ion import(GO:0015677) |
0.0 | 1.4 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
0.0 | 0.2 | GO:0032725 | positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
0.0 | 0.6 | GO:0060261 | positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
0.0 | 0.1 | GO:0002865 | negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.2 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.0 | 0.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.3 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.2 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.0 | 0.2 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.3 | GO:0050858 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.0 | 0.9 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
0.0 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.0 | 0.1 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.1 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.3 | GO:0060539 | diaphragm development(GO:0060539) |
0.0 | 0.1 | GO:0015867 | ATP transport(GO:0015867) |
0.0 | 0.3 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.1 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
0.0 | 0.1 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
0.0 | 0.2 | GO:0051958 | methotrexate transport(GO:0051958) |
0.0 | 0.1 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.1 | GO:0019046 | viral latency(GO:0019042) release from viral latency(GO:0019046) regulation of DNA strand elongation(GO:0060382) |
0.0 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.0 | 0.2 | GO:0060768 | regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.0 | 0.2 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.0 | 0.1 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
0.0 | 0.2 | GO:0035411 | catenin import into nucleus(GO:0035411) |
0.0 | 0.3 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.1 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
0.0 | 0.2 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 0.1 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
0.0 | 0.2 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.1 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.1 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.4 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.0 | 0.2 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
0.0 | 0.4 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
0.0 | 0.2 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.1 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.3 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) negative regulation of protein homooligomerization(GO:0032463) |
0.0 | 0.1 | GO:0046415 | urate metabolic process(GO:0046415) |
0.0 | 0.1 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
0.0 | 0.0 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.0 | 0.2 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
0.0 | 0.1 | GO:0097501 | stress response to metal ion(GO:0097501) |
0.0 | 0.1 | GO:0050855 | regulation of B cell receptor signaling pathway(GO:0050855) positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.8 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.3 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.0 | 0.2 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.0 | 0.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.1 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.0 | GO:1904959 | regulation of electron carrier activity(GO:1904732) regulation of cytochrome-c oxidase activity(GO:1904959) |
0.0 | 0.1 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.0 | 0.3 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.0 | 0.3 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.0 | 0.1 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.2 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.0 | GO:0060453 | regulation of gastric acid secretion(GO:0060453) |
0.0 | 0.0 | GO:0015675 | nickel cation transport(GO:0015675) |
0.0 | 0.6 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.1 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.0 | 0.1 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
0.0 | 0.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.0 | 0.1 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.4 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.0 | 0.1 | GO:1990859 | cellular response to endothelin(GO:1990859) |
0.0 | 0.1 | GO:0034214 | protein hexamerization(GO:0034214) |
0.0 | 0.2 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.0 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.1 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.8 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
0.0 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.2 | GO:0030220 | platelet formation(GO:0030220) |
0.0 | 0.2 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.0 | 0.4 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.0 | 0.3 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.1 | GO:1990379 | lipid transport across blood brain barrier(GO:1990379) |
0.0 | 0.1 | GO:1905245 | regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902959) positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) regulation of aspartic-type peptidase activity(GO:1905245) positive regulation of aspartic-type peptidase activity(GO:1905247) regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.4 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.1 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
0.0 | 1.0 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
0.0 | 0.2 | GO:0051608 | histamine transport(GO:0051608) |
0.0 | 0.3 | GO:0060055 | angiogenesis involved in wound healing(GO:0060055) |
0.0 | 0.0 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
0.0 | 0.4 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.0 | 0.3 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.0 | 0.1 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.0 | 0.1 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
0.0 | 0.1 | GO:0090383 | phagosome acidification(GO:0090383) |
0.0 | 0.2 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.1 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
0.0 | 0.3 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.0 | 0.1 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
0.0 | 0.1 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.0 | 0.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.2 | GO:0050957 | equilibrioception(GO:0050957) |
0.0 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) endoplasmic reticulum tubular network assembly(GO:0071787) |
0.0 | 0.1 | GO:0090070 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
0.0 | 0.2 | GO:0097186 | amelogenesis(GO:0097186) |
0.0 | 0.1 | GO:0032782 | bile acid secretion(GO:0032782) |
0.0 | 0.0 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
0.0 | 0.4 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.1 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.0 | 0.2 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.0 | 0.2 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
0.0 | 0.1 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.1 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.3 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
0.0 | 0.0 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.0 | 0.1 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) negative regulation of dendritic cell differentiation(GO:2001199) |
0.0 | 0.1 | GO:0002339 | B cell selection(GO:0002339) |
0.0 | 0.0 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.0 | 0.1 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.0 | 0.0 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
0.0 | 0.1 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
0.0 | 0.1 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.0 | 0.0 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.0 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.2 | GO:2001273 | regulation of glucose import in response to insulin stimulus(GO:2001273) |
0.0 | 0.4 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
0.0 | 0.1 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
0.0 | 0.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.0 | 0.2 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.0 | 0.6 | GO:0010390 | histone monoubiquitination(GO:0010390) |
0.0 | 0.0 | GO:0010752 | regulation of cGMP-mediated signaling(GO:0010752) |
0.0 | 0.3 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.3 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.1 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
0.0 | 0.1 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
0.0 | 0.1 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.0 | 0.2 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.0 | 0.1 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.1 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.4 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.0 | GO:0080144 | amino acid homeostasis(GO:0080144) |
0.0 | 0.4 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.2 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.1 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.0 | 0.0 | GO:0034035 | sulfate assimilation(GO:0000103) purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.0 | 0.1 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.2 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.0 | 0.1 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.0 | 0.1 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
0.0 | 0.3 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.1 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
0.0 | 0.2 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.0 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.0 | 0.2 | GO:0014898 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle hypertrophy in response to stress(GO:0014898) |
0.0 | 0.1 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
0.0 | 0.0 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.1 | GO:0010592 | positive regulation of lamellipodium assembly(GO:0010592) |
0.0 | 0.0 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.0 | 0.1 | GO:1903028 | regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
0.0 | 0.2 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.0 | 0.2 | GO:0003170 | heart valve development(GO:0003170) |
0.0 | 0.1 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.0 | 0.0 | GO:0032960 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) |
0.0 | 0.8 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.0 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
0.0 | 0.1 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
0.0 | 0.3 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.0 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.0 | 0.0 | GO:0014877 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.0 | 0.2 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.1 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.0 | 0.1 | GO:0031639 | plasminogen activation(GO:0031639) |
0.0 | 0.2 | GO:0002063 | chondrocyte development(GO:0002063) |
0.0 | 0.3 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.0 | 0.0 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.2 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
0.0 | 0.2 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.0 | 0.1 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.0 | 0.0 | GO:0032493 | response to bacterial lipoprotein(GO:0032493) |
0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.0 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.1 | GO:0000422 | mitophagy(GO:0000422) mitochondrion disassembly(GO:0061726) |
0.0 | 0.1 | GO:1904152 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.0 | 0.4 | GO:0002066 | columnar/cuboidal epithelial cell development(GO:0002066) |
0.0 | 0.1 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.0 | 0.1 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
0.0 | 0.1 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.0 | 0.3 | GO:0035136 | forelimb morphogenesis(GO:0035136) |
0.0 | 0.0 | GO:0046110 | xanthine metabolic process(GO:0046110) |
0.0 | 0.1 | GO:0007398 | ectoderm development(GO:0007398) |
0.0 | 0.1 | GO:0001996 | regulation of systemic arterial blood pressure by norepinephrine-epinephrine(GO:0001993) positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) positive regulation of blood pressure by epinephrine-norepinephrine(GO:0003321) |
0.0 | 0.0 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.0 | 0.0 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.0 | 0.1 | GO:1901911 | diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
0.0 | 0.1 | GO:0097435 | fibril organization(GO:0097435) |
0.0 | 0.0 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.0 | 0.1 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.0 | 0.0 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.0 | 0.3 | GO:0006284 | base-excision repair(GO:0006284) |
0.0 | 0.2 | GO:0021854 | hypothalamus development(GO:0021854) |
0.0 | 0.1 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
0.0 | 0.0 | GO:0043129 | surfactant homeostasis(GO:0043129) |
0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.1 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.0 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.2 | GO:0006801 | superoxide metabolic process(GO:0006801) |
0.0 | 0.1 | GO:0048793 | pronephros development(GO:0048793) |
Gene overrepresentation in cellular_component category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.7 | GO:0036125 | mitochondrial fatty acid beta-oxidation multienzyme complex(GO:0016507) fatty acid beta-oxidation multienzyme complex(GO:0036125) |
0.2 | 1.0 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.2 | 0.5 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
0.1 | 0.9 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 0.5 | GO:0000939 | nuclear MIS12/MIND complex(GO:0000818) condensed chromosome inner kinetochore(GO:0000939) |
0.1 | 0.9 | GO:0001940 | male pronucleus(GO:0001940) |
0.1 | 0.7 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.1 | 0.4 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
0.1 | 0.2 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.1 | 0.6 | GO:0043218 | compact myelin(GO:0043218) |
0.1 | 0.4 | GO:0060187 | cell pole(GO:0060187) |
0.1 | 0.6 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.4 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.3 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.1 | 0.3 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
0.1 | 0.3 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.1 | 0.5 | GO:0043256 | laminin complex(GO:0043256) |
0.1 | 0.1 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.4 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
0.1 | 0.9 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.1 | 0.2 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.1 | 0.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 0.4 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.1 | 0.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.3 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.1 | 0.2 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.4 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 0.2 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 0.4 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 0.4 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.1 | 0.5 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.1 | 0.3 | GO:0070826 | paraferritin complex(GO:0070826) |
0.1 | 0.2 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 0.6 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.1 | 0.4 | GO:0042825 | TAP complex(GO:0042825) |
0.1 | 0.8 | GO:0005605 | basal lamina(GO:0005605) |
0.1 | 0.2 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
0.0 | 0.4 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.5 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 0.2 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
0.0 | 0.2 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.2 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.6 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.7 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.0 | 0.3 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.0 | 0.3 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.1 | GO:0031251 | PAN complex(GO:0031251) |
0.0 | 0.3 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.2 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.5 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.9 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.4 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.3 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.6 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.1 | GO:0005652 | nuclear lamina(GO:0005652) |
0.0 | 0.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 0.7 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.0 | 0.9 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.1 | GO:0034272 | phosphatidylinositol 3-kinase complex, class III, type I(GO:0034271) phosphatidylinositol 3-kinase complex, class III, type II(GO:0034272) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.3 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.5 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 0.1 | GO:0000799 | nuclear condensin complex(GO:0000799) germinal vesicle(GO:0042585) |
0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.4 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 1.8 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.3 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.5 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.2 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
0.0 | 0.9 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.1 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
0.0 | 0.1 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.0 | 0.1 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
0.0 | 0.1 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.4 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.0 | 0.1 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 0.2 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 0.3 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 1.7 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.9 | GO:0002102 | podosome(GO:0002102) |
0.0 | 1.6 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.0 | 0.1 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.0 | 1.9 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.3 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.3 | GO:0032156 | septin cytoskeleton(GO:0032156) |
0.0 | 0.1 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) neurofibrillary tangle(GO:0097418) |
0.0 | 0.2 | GO:0030139 | endocytic vesicle(GO:0030139) |
0.0 | 0.1 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.3 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.2 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.9 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.2 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.0 | 0.2 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.1 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.3 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.0 | 0.3 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.6 | GO:0031901 | early endosome membrane(GO:0031901) |
0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
0.0 | 0.2 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.1 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.0 | 0.2 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.2 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.2 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.0 | 0.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.0 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.1 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
0.0 | 0.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.0 | 0.0 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.0 | 0.1 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) |
0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.1 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.0 | 0.8 | GO:0022626 | cytosolic ribosome(GO:0022626) |
0.0 | 0.5 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.3 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 0.0 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.1 | GO:0032587 | ruffle membrane(GO:0032587) |
0.0 | 0.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 2.2 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.2 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.1 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.3 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.2 | GO:0009986 | cell surface(GO:0009986) |
0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.2 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.9 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.0 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 0.1 | GO:0072562 | blood microparticle(GO:0072562) |
0.0 | 0.7 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 0.4 | GO:0031514 | motile cilium(GO:0031514) |
0.0 | 0.0 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.2 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.0 | 0.3 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.2 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 0.1 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.2 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 0.1 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.0 | 0.8 | GO:0016234 | inclusion body(GO:0016234) |
0.0 | 0.7 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.2 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
Gene overrepresentation in molecular_function category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 0.6 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.4 | 1.1 | GO:0005118 | sevenless binding(GO:0005118) |
0.3 | 0.8 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
0.2 | 1.0 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
0.2 | 1.3 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.2 | 0.6 | GO:0004568 | chitinase activity(GO:0004568) |
0.2 | 0.5 | GO:0098809 | nitrite reductase activity(GO:0098809) |
0.2 | 0.7 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.2 | 0.9 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.2 | 0.7 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.2 | 0.7 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.2 | 0.8 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.2 | 0.5 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.2 | 0.6 | GO:0038049 | glucocorticoid receptor activity(GO:0004883) transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
0.2 | 0.2 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.2 | 0.8 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
0.1 | 0.6 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.1 | 0.6 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.1 | 0.4 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.1 | 0.7 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.1 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) cytosine C-5 DNA demethylase activity(GO:0051747) |
0.1 | 0.5 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.1 | 0.2 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
0.1 | 0.5 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 0.5 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 0.6 | GO:1990188 | euchromatin binding(GO:1990188) |
0.1 | 0.5 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.1 | 0.8 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.1 | 0.3 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.1 | 0.8 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.6 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.1 | 0.4 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
0.1 | 0.7 | GO:0000150 | recombinase activity(GO:0000150) |
0.1 | 0.4 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.1 | 0.5 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.1 | 1.1 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.1 | 0.9 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.6 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.1 | 0.7 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 0.4 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.1 | 0.5 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.1 | 0.4 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
0.1 | 0.5 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.1 | 0.3 | GO:0031403 | lithium ion binding(GO:0031403) |
0.1 | 0.6 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) lysophosphatidic acid receptor activity(GO:0070915) |
0.1 | 0.4 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.6 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 0.4 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 0.6 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.1 | 0.6 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.3 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.3 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.1 | 0.6 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
0.1 | 0.3 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.1 | 1.3 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.1 | 0.3 | GO:0042806 | fucose binding(GO:0042806) |
0.1 | 0.4 | GO:0097643 | amylin receptor activity(GO:0097643) |
0.1 | 0.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.1 | 1.0 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
0.1 | 0.4 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.1 | 0.3 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
0.1 | 0.4 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.1 | 0.3 | GO:0043515 | kinetochore binding(GO:0043515) |
0.1 | 0.3 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 0.2 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.1 | 0.3 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.1 | 1.0 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.5 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) inositol trisphosphate phosphatase activity(GO:0046030) |
0.1 | 0.3 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.1 | 0.3 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.1 | 0.4 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.1 | 0.2 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) tapasin binding(GO:0046980) |
0.1 | 0.4 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.1 | 0.6 | GO:0043121 | neurotrophin binding(GO:0043121) |
0.1 | 0.7 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 0.4 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 0.4 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.3 | GO:0015086 | cadmium ion transmembrane transporter activity(GO:0015086) lead ion transmembrane transporter activity(GO:0015094) vanadium ion transmembrane transporter activity(GO:0015100) ferrous iron uptake transmembrane transporter activity(GO:0015639) |
0.1 | 0.3 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 0.2 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
0.1 | 0.2 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 0.8 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
0.1 | 0.2 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.1 | 0.2 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.1 | 0.4 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.1 | 0.2 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
0.1 | 0.2 | GO:0032052 | bile acid binding(GO:0032052) |
0.1 | 0.7 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.1 | 0.2 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.1 | 0.2 | GO:0000402 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
0.1 | 0.6 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 0.2 | GO:0004921 | interleukin-11 receptor activity(GO:0004921) interleukin-11 binding(GO:0019970) |
0.0 | 0.5 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.1 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
0.0 | 0.3 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.2 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.0 | 0.2 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.0 | 0.2 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.1 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
0.0 | 0.1 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.0 | 0.5 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.0 | 0.3 | GO:0009374 | biotin binding(GO:0009374) |
0.0 | 0.7 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 0.1 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
0.0 | 0.1 | GO:0035605 | peptidyl-cysteine S-nitrosylase activity(GO:0035605) |
0.0 | 0.4 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
0.0 | 0.2 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
0.0 | 0.4 | GO:0019956 | chemokine binding(GO:0019956) |
0.0 | 0.3 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.0 | 0.7 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.3 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.3 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.1 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.0 | 0.5 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.2 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.4 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.2 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.2 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.0 | 0.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.1 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
0.0 | 0.1 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
0.0 | 0.1 | GO:0046997 | sarcosine dehydrogenase activity(GO:0008480) oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
0.0 | 0.2 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.5 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
0.0 | 0.3 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.4 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.2 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.4 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.0 | 0.1 | GO:0097677 | STAT family protein binding(GO:0097677) |
0.0 | 0.6 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.1 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.0 | 0.3 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.4 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.2 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.1 | GO:0050436 | microfibril binding(GO:0050436) |
0.0 | 0.2 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.0 | 0.2 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.2 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.0 | 0.2 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.1 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.0 | 0.1 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.6 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.1 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.1 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.0 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.4 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.2 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
0.0 | 0.8 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.1 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.0 | 0.3 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.2 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.2 | GO:0015925 | galactosidase activity(GO:0015925) |
0.0 | 1.0 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.2 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.0 | 0.1 | GO:0070140 | isopeptidase activity(GO:0070122) ubiquitin-like protein-specific isopeptidase activity(GO:0070138) SUMO-specific isopeptidase activity(GO:0070140) |
0.0 | 0.3 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.2 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
0.0 | 0.2 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.1 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.0 | 0.1 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.0 | 0.1 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) |
0.0 | 0.1 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) |
0.0 | 0.4 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.2 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.2 | GO:0015616 | DNA translocase activity(GO:0015616) |
0.0 | 0.1 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.0 | 0.2 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.5 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.1 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.0 | 0.2 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.0 | 0.0 | GO:0015099 | nickel cation transmembrane transporter activity(GO:0015099) |
0.0 | 0.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.0 | 0.1 | GO:0036468 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
0.0 | 0.1 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.0 | 0.1 | GO:0004637 | phosphoribosylamine-glycine ligase activity(GO:0004637) |
0.0 | 0.3 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.6 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.6 | GO:0016667 | oxidoreductase activity, acting on a sulfur group of donors(GO:0016667) |
0.0 | 0.6 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.6 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.0 | 0.1 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
0.0 | 0.6 | GO:0008146 | sulfotransferase activity(GO:0008146) |
0.0 | 0.3 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.0 | 0.1 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
0.0 | 0.4 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.1 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
0.0 | 0.1 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
0.0 | 0.2 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.1 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 0.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.1 | GO:0050347 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 1.0 | GO:0019213 | deacetylase activity(GO:0019213) |
0.0 | 0.1 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
0.0 | 0.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) phospholipase C activity(GO:0004629) |
0.0 | 0.1 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.1 | GO:0015254 | glycerol channel activity(GO:0015254) |
0.0 | 0.2 | GO:0019534 | toxin transporter activity(GO:0019534) |
0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.4 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.6 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.0 | 0.1 | GO:0004984 | olfactory receptor activity(GO:0004984) |
0.0 | 0.3 | GO:0015464 | acetylcholine receptor activity(GO:0015464) |
0.0 | 0.2 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.0 | 0.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.1 | GO:0005124 | scavenger receptor binding(GO:0005124) |
0.0 | 0.2 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.1 | GO:0016004 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.0 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
0.0 | 0.1 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.0 | 0.5 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.1 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 2.8 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.0 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.0 | 0.1 | GO:0003883 | CTP synthase activity(GO:0003883) |
0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.0 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
0.0 | 0.2 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 0.7 | GO:0019955 | cytokine binding(GO:0019955) |
0.0 | 0.2 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.0 | 0.1 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.0 | 0.6 | GO:0008528 | G-protein coupled peptide receptor activity(GO:0008528) |
0.0 | 0.1 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
0.0 | 0.1 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.0 | 0.3 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.0 | 0.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.5 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
0.0 | 0.0 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.0 | 0.2 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) hedgehog receptor activity(GO:0008158) |
0.0 | 0.0 | GO:0015928 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
0.0 | 0.2 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.0 | GO:0030519 | snoRNP binding(GO:0030519) |
0.0 | 0.0 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.0 | 0.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.2 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.2 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.0 | 0.1 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.0 | 0.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.2 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 2.1 | GO:0051015 | actin filament binding(GO:0051015) |
0.0 | 1.0 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
0.0 | 0.7 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 0.5 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.2 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.0 | 0.0 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 0.3 | GO:0043394 | proteoglycan binding(GO:0043394) |
0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.0 | GO:0070905 | serine binding(GO:0070905) |
0.0 | 0.0 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.7 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.0 | GO:0016725 | oxidoreductase activity, acting on CH or CH2 groups(GO:0016725) |
0.0 | 0.0 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.0 | GO:0097617 | annealing activity(GO:0097617) |
0.0 | 0.1 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
0.0 | 0.0 | GO:0016722 | oxidoreductase activity, oxidizing metal ions(GO:0016722) |
0.0 | 0.1 | GO:0005165 | neurotrophin receptor binding(GO:0005165) |
0.0 | 0.1 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.1 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.1 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.0 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.0 | GO:0003977 | UDP-N-acetylglucosamine diphosphorylase activity(GO:0003977) |
0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.1 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.1 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
Gene overrepresentation in C2:CP category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.3 | ST_INTERFERON_GAMMA_PATHWAY | Interferon gamma pathway. |
0.1 | 0.5 | PID_INTEGRIN4_PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 0.5 | SA_FAS_SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 0.7 | PID_INTEGRIN2_PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.3 | ST_PAC1_RECEPTOR_PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.6 | SA_REG_CASCADE_OF_CYCLIN_EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.3 | SIG_PIP3_SIGNALING_IN_CARDIAC_MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 0.2 | PID_EPHA2_FWD_PATHWAY | EPHA2 forward signaling |
0.0 | 1.6 | PID_ATR_PATHWAY | ATR signaling pathway |
0.0 | 0.3 | SA_G2_AND_M_PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 1.2 | PID_FANCONI_PATHWAY | Fanconi anemia pathway |
0.0 | 0.8 | PID_S1P_META_PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.6 | PID_BARD1_PATHWAY | BARD1 signaling events |
0.0 | 0.3 | SA_MMP_CYTOKINE_CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.4 | PID_INSULIN_GLUCOSE_PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.2 | PID_TCR_JNK_PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.7 | NABA_BASEMENT_MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 3.5 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.6 | NABA_COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.1 | SA_CASPASE_CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.7 | ST_WNT_BETA_CATENIN_PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.3 | PID_INTEGRIN_A9B1_PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 1.0 | PID_FAK_PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.3 | PID_ANTHRAX_PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.8 | ST_GAQ_PATHWAY | G alpha q Pathway |
0.0 | 0.1 | PID_PTP1B_PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.1 | PID_VEGF_VEGFR_PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.4 | PID_SMAD2_3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.8 | PID_HNF3B_PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.3 | ST_T_CELL_SIGNAL_TRANSDUCTION | T Cell Signal Transduction |
0.0 | 0.3 | PID_NFKAPPAB_ATYPICAL_PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.2 | PID_ERBB_NETWORK_PATHWAY | ErbB receptor signaling network |
0.0 | 0.6 | PID_NETRIN_PATHWAY | Netrin-mediated signaling events |
0.0 | 0.2 | PID_GLYPICAN_1PATHWAY | Glypican 1 network |
0.0 | 0.7 | PID_PLK1_PATHWAY | PLK1 signaling events |
0.0 | 0.8 | PID_LYSOPHOSPHOLIPID_PATHWAY | LPA receptor mediated events |
0.0 | 0.1 | PID_HDAC_CLASSII_PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.3 | PID_P38_MK2_PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.8 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.9 | PID_E2F_PATHWAY | E2F transcription factor network |
0.0 | 0.2 | PID_PRL_SIGNALING_EVENTS_PATHWAY | Signaling events mediated by PRL |
0.0 | 0.2 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
0.0 | 0.7 | ST_INTEGRIN_SIGNALING_PATHWAY | Integrin Signaling Pathway |
0.0 | 0.3 | PID_ARF_3PATHWAY | Arf1 pathway |
0.0 | 0.3 | PID_A6B1_A6B4_INTEGRIN_PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.2 | PID_GMCSF_PATHWAY | GMCSF-mediated signaling events |
0.0 | 0.3 | PID_BMP_PATHWAY | BMP receptor signaling |
Gene overrepresentation in C2:CP:REACTOME category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.7 | REACTOME_MITOCHONDRIAL_FATTY_ACID_BETA_OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 1.2 | REACTOME_SEMA3A_PLEXIN_REPULSION_SIGNALING_BY_INHIBITING_INTEGRIN_ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 0.6 | REACTOME_THE_ACTIVATION_OF_ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.1 | 0.2 | REACTOME_FGFR2C_LIGAND_BINDING_AND_ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.1 | 1.1 | REACTOME_NFKB_ACTIVATION_THROUGH_FADD_RIP1_PATHWAY_MEDIATED_BY_CASPASE_8_AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.1 | 0.5 | REACTOME_BILE_SALT_AND_ORGANIC_ANION_SLC_TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.1 | 0.8 | REACTOME_SYNTHESIS_SECRETION_AND_INACTIVATION_OF_GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 1.0 | REACTOME_NOTCH_HLH_TRANSCRIPTION_PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.1 | 0.9 | REACTOME_ASSOCIATION_OF_LICENSING_FACTORS_WITH_THE_PRE_REPLICATIVE_COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.1 | 0.2 | REACTOME_HORMONE_LIGAND_BINDING_RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.1 | 0.5 | REACTOME_SIGNALING_BY_FGFR3_MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 1.2 | REACTOME_SULFUR_AMINO_ACID_METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.6 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.3 | REACTOME_COMMON_PATHWAY | Genes involved in Common Pathway |
0.0 | 1.0 | REACTOME_HS_GAG_DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.4 | REACTOME_EXTRINSIC_PATHWAY_FOR_APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.9 | REACTOME_CASPASE_MEDIATED_CLEAVAGE_OF_CYTOSKELETAL_PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 1.1 | REACTOME_PHASE1_FUNCTIONALIZATION_OF_COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.0 | 0.6 | REACTOME_APOPTOSIS_INDUCED_DNA_FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.8 | REACTOME_CHONDROITIN_SULFATE_BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.2 | REACTOME_ELEVATION_OF_CYTOSOLIC_CA2_LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.3 | REACTOME_REGULATION_OF_ORNITHINE_DECARBOXYLASE_ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.6 | REACTOME_MRNA_DECAY_BY_5_TO_3_EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.4 | REACTOME_NA_CL_DEPENDENT_NEUROTRANSMITTER_TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.2 | REACTOME_DOWNREGULATION_OF_ERBB2_ERBB3_SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.6 | REACTOME_HOMOLOGOUS_RECOMBINATION_REPAIR_OF_REPLICATION_INDEPENDENT_DOUBLE_STRAND_BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 0.6 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.8 | REACTOME_G0_AND_EARLY_G1 | Genes involved in G0 and Early G1 |
0.0 | 0.5 | REACTOME_GLYCOGEN_BREAKDOWN_GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.8 | REACTOME_ACTIVATED_AMPK_STIMULATES_FATTY_ACID_OXIDATION_IN_MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 0.3 | REACTOME_KERATAN_SULFATE_DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.4 | REACTOME_ER_PHAGOSOME_PATHWAY | Genes involved in ER-Phagosome pathway |
0.0 | 0.6 | REACTOME_PYRUVATE_METABOLISM | Genes involved in Pyruvate metabolism |
0.0 | 0.5 | REACTOME_DESTABILIZATION_OF_MRNA_BY_TRISTETRAPROLIN_TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 0.2 | REACTOME_APOPTOTIC_CLEAVAGE_OF_CELL_ADHESION_PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 1.6 | REACTOME_DEPOSITION_OF_NEW_CENPA_CONTAINING_NUCLEOSOMES_AT_THE_CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.4 | REACTOME_METABOLISM_OF_STEROID_HORMONES_AND_VITAMINS_A_AND_D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 0.0 | REACTOME_ADP_SIGNALLING_THROUGH_P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.0 | 0.6 | REACTOME_REGULATION_OF_BETA_CELL_DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.2 | REACTOME_REGULATION_OF_INSULIN_SECRETION_BY_ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.2 | REACTOME_CYCLIN_A_B1_ASSOCIATED_EVENTS_DURING_G2_M_TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.5 | REACTOME_TETRAHYDROBIOPTERIN_BH4_SYNTHESIS_RECYCLING_SALVAGE_AND_REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 0.6 | REACTOME_SIGNALING_BY_HIPPO | Genes involved in Signaling by Hippo |
0.0 | 1.3 | REACTOME_CROSS_PRESENTATION_OF_SOLUBLE_EXOGENOUS_ANTIGENS_ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.1 | REACTOME_REMOVAL_OF_THE_FLAP_INTERMEDIATE_FROM_THE_C_STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 1.9 | REACTOME_INTEGRIN_CELL_SURFACE_INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.5 | REACTOME_SIGNALING_BY_NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.3 | REACTOME_ADENYLATE_CYCLASE_INHIBITORY_PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.0 | 0.1 | REACTOME_DESTABILIZATION_OF_MRNA_BY_KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.0 | 2.5 | REACTOME_INFLUENZA_VIRAL_RNA_TRANSCRIPTION_AND_REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.5 | REACTOME_CHOLESTEROL_BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.5 | REACTOME_KINESINS | Genes involved in Kinesins |
0.0 | 0.1 | REACTOME_ORGANIC_CATION_ANION_ZWITTERION_TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.2 | REACTOME_CHEMOKINE_RECEPTORS_BIND_CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.6 | REACTOME_MRNA_SPLICING_MINOR_PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.1 | REACTOME_RECEPTOR_LIGAND_BINDING_INITIATES_THE_SECOND_PROTEOLYTIC_CLEAVAGE_OF_NOTCH_RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.0 | 0.1 | REACTOME_PROCESSIVE_SYNTHESIS_ON_THE_LAGGING_STRAND | Genes involved in Processive synthesis on the lagging strand |
0.0 | 1.0 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
0.0 | 0.1 | REACTOME_CREATION_OF_C4_AND_C2_ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.4 | REACTOME_GLYCOSPHINGOLIPID_METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.3 | REACTOME_ERKS_ARE_INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.4 | REACTOME_APC_C_CDH1_MEDIATED_DEGRADATION_OF_CDC20_AND_OTHER_APC_C_CDH1_TARGETED_PROTEINS_IN_LATE_MITOSIS_EARLY_G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.0 | 0.1 | REACTOME_HYALURONAN_UPTAKE_AND_DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.1 | REACTOME_GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.3 | REACTOME_FORMATION_OF_INCISION_COMPLEX_IN_GG_NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.4 | REACTOME_CELL_EXTRACELLULAR_MATRIX_INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.8 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 1.0 | REACTOME_NUCLEAR_RECEPTOR_TRANSCRIPTION_PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.4 | REACTOME_INTERFERON_ALPHA_BETA_SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.3 | REACTOME_HS_GAG_BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.2 | REACTOME_GABA_B_RECEPTOR_ACTIVATION | Genes involved in GABA B receptor activation |
0.0 | 0.2 | REACTOME_MTORC1_MEDIATED_SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.3 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.1 | REACTOME_CHYLOMICRON_MEDIATED_LIPID_TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.1 | REACTOME_VEGF_LIGAND_RECEPTOR_INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.3 | REACTOME_METABOLISM_OF_PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.1 | REACTOME_BASE_FREE_SUGAR_PHOSPHATE_REMOVAL_VIA_THE_SINGLE_NUCLEOTIDE_REPLACEMENT_PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.0 | 0.6 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.1 | REACTOME_AMINE_LIGAND_BINDING_RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.1 | REACTOME_TANDEM_PORE_DOMAIN_POTASSIUM_CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.3 | REACTOME_TRANSPORT_OF_RIBONUCLEOPROTEINS_INTO_THE_HOST_NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.0 | 0.3 | REACTOME_ENDOSOMAL_SORTING_COMPLEX_REQUIRED_FOR_TRANSPORT_ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.3 | REACTOME_PYRIMIDINE_METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.2 | REACTOME_FANCONI_ANEMIA_PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.1 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_GOLGI_MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.3 | REACTOME_AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.1 | REACTOME_ALPHA_LINOLENIC_ACID_ALA_METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.2 | REACTOME_APOPTOTIC_CLEAVAGE_OF_CELLULAR_PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |