Motif ID: Smad1
Z-value: 1.091

Transcription factors associated with Smad1:
Gene Symbol | Entrez ID | Gene Name |
---|---|---|
Smad1 | ENSMUSG00000031681.8 | Smad1 |
Activity-expression correlation:
Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Smad1 | mm10_v2_chr8_-_79399513_79399532 | -0.42 | 8.6e-02 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 2.5 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.4 | 1.3 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
0.4 | 1.1 | GO:0014738 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.4 | 1.1 | GO:0030421 | defecation(GO:0030421) |
0.3 | 1.3 | GO:0072236 | metanephric loop of Henle development(GO:0072236) |
0.3 | 0.9 | GO:0001803 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
0.3 | 0.8 | GO:0001869 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
0.3 | 0.8 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
0.3 | 0.3 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.3 | 0.8 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) |
0.3 | 1.8 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
0.3 | 1.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.2 | 1.0 | GO:1902340 | telomeric heterochromatin assembly(GO:0031509) negative regulation of chromosome condensation(GO:1902340) |
0.2 | 0.7 | GO:0002586 | positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
0.2 | 0.7 | GO:1905072 | cardiac jelly development(GO:1905072) |
0.2 | 1.2 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.2 | 0.7 | GO:0070625 | zymogen granule exocytosis(GO:0070625) |
0.2 | 0.7 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
0.2 | 3.0 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
0.2 | 0.9 | GO:0072272 | proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
0.2 | 0.7 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.2 | 0.7 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.2 | 0.7 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
0.2 | 0.6 | GO:0014877 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.2 | 0.8 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.2 | 0.6 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
0.2 | 0.8 | GO:0051794 | regulation of catagen(GO:0051794) |
0.2 | 0.2 | GO:0033122 | regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
0.2 | 0.6 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
0.2 | 0.2 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.2 | 0.6 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
0.2 | 0.7 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) negative regulation of protein homooligomerization(GO:0032463) |
0.2 | 0.2 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.2 | 0.7 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.2 | 0.7 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.2 | 1.0 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.2 | 0.5 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.2 | 0.7 | GO:1900145 | regulation of nodal signaling pathway involved in determination of left/right asymmetry(GO:1900145) regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900175) |
0.2 | 0.6 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
0.2 | 0.6 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.2 | 0.8 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.2 | 0.8 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.2 | 0.5 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.2 | 0.5 | GO:1901079 | positive regulation of relaxation of muscle(GO:1901079) |
0.2 | 0.6 | GO:1904565 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
0.2 | 1.2 | GO:0032725 | positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
0.2 | 0.6 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.4 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.1 | 0.6 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.1 | 0.9 | GO:0046070 | dGTP metabolic process(GO:0046070) |
0.1 | 0.1 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.1 | 0.4 | GO:0003360 | brainstem development(GO:0003360) |
0.1 | 0.4 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
0.1 | 0.6 | GO:0090282 | positive regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071931) positive regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0090282) |
0.1 | 0.4 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.1 | 0.7 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.1 | 0.4 | GO:0045819 | plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
0.1 | 0.5 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.1 | 0.4 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
0.1 | 0.9 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.1 | 0.4 | GO:0046022 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) axial mesoderm morphogenesis(GO:0048319) |
0.1 | 1.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.4 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.1 | 0.2 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
0.1 | 0.5 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
0.1 | 0.2 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.1 | 0.1 | GO:0014045 | establishment of endothelial blood-brain barrier(GO:0014045) central nervous system vasculogenesis(GO:0022009) |
0.1 | 0.1 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.1 | 0.1 | GO:0060423 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.1 | 0.3 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.1 | 0.3 | GO:0015938 | coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) acetyl-CoA catabolic process(GO:0046356) |
0.1 | 0.7 | GO:0046645 | positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
0.1 | 0.3 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.1 | 0.7 | GO:0001980 | regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
0.1 | 0.4 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.1 | 0.3 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.1 | 0.4 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.1 | 0.1 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.1 | 0.1 | GO:0052805 | imidazole-containing compound catabolic process(GO:0052805) |
0.1 | 0.9 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.1 | 0.1 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
0.1 | 0.6 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.1 | 0.3 | GO:0098928 | presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
0.1 | 0.2 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.1 | 0.3 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.1 | 0.3 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 1.3 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.1 | 0.5 | GO:0032901 | positive regulation of neurotrophin production(GO:0032901) |
0.1 | 0.7 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
0.1 | 0.3 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.1 | 0.4 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
0.1 | 0.4 | GO:0010040 | response to iron(II) ion(GO:0010040) positive regulation of hydrogen peroxide metabolic process(GO:0010726) negative regulation of synaptic transmission, dopaminergic(GO:0032227) regulation of peroxidase activity(GO:2000468) |
0.1 | 0.2 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
0.1 | 0.3 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
0.1 | 0.4 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.1 | 0.5 | GO:1903609 | negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
0.1 | 0.4 | GO:2000987 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
0.1 | 0.2 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.1 | 1.0 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
0.1 | 0.5 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.1 | 0.8 | GO:0071493 | cellular response to UV-B(GO:0071493) |
0.1 | 0.5 | GO:2000157 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
0.1 | 0.4 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
0.1 | 0.2 | GO:0034759 | regulation of iron ion transport(GO:0034756) regulation of iron ion transmembrane transport(GO:0034759) |
0.1 | 0.3 | GO:0060598 | dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
0.1 | 0.2 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
0.1 | 0.3 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.1 | 0.4 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
0.1 | 0.4 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.1 | 0.1 | GO:0050819 | negative regulation of coagulation(GO:0050819) |
0.1 | 0.2 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.1 | 0.7 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 0.6 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.1 | 0.2 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
0.1 | 0.2 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.1 | 0.3 | GO:0072103 | glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
0.1 | 0.2 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.1 | 0.2 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.1 | 0.4 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.1 | 0.1 | GO:0048389 | intermediate mesoderm development(GO:0048389) pattern specification involved in mesonephros development(GO:0061227) anterior/posterior pattern specification involved in kidney development(GO:0072098) |
0.1 | 0.2 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.1 | 0.2 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
0.1 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.2 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.1 | 1.7 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.1 | 0.2 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.1 | 0.2 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
0.1 | 0.4 | GO:0060290 | transdifferentiation(GO:0060290) |
0.1 | 0.2 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.1 | 0.5 | GO:0032782 | bile acid secretion(GO:0032782) |
0.1 | 0.2 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.6 | GO:0048023 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.1 | 0.1 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.1 | 0.2 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.1 | 0.2 | GO:0019659 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.1 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
0.1 | 0.2 | GO:0048289 | isotype switching to IgE isotypes(GO:0048289) regulation of isotype switching to IgE isotypes(GO:0048293) |
0.1 | 0.4 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
0.1 | 0.4 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
0.1 | 0.2 | GO:0046381 | CMP-N-acetylneuraminate metabolic process(GO:0046381) |
0.1 | 0.4 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.1 | 0.1 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
0.1 | 0.6 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.1 | 0.2 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.1 | 0.5 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.1 | 0.1 | GO:0097350 | neutrophil clearance(GO:0097350) |
0.1 | 0.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
0.1 | 0.2 | GO:0071707 | immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
0.1 | 0.3 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.1 | 0.2 | GO:0036233 | glycine import(GO:0036233) |
0.1 | 0.1 | GO:0052803 | imidazole-containing compound metabolic process(GO:0052803) |
0.1 | 0.2 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.1 | 0.1 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.1 | 0.3 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.1 | 0.3 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.1 | 0.2 | GO:0098886 | modification of dendritic spine(GO:0098886) |
0.1 | 0.3 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
0.1 | 0.3 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.1 | 0.1 | GO:1903598 | positive regulation of gap junction assembly(GO:1903598) |
0.1 | 1.7 | GO:0046596 | regulation of viral entry into host cell(GO:0046596) |
0.1 | 0.2 | GO:0051353 | positive regulation of oxidoreductase activity(GO:0051353) |
0.1 | 0.1 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.1 | 0.4 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
0.1 | 0.3 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.1 | 0.2 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.1 | 0.2 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.1 | 0.2 | GO:0071105 | response to interleukin-9(GO:0071104) response to interleukin-11(GO:0071105) |
0.1 | 0.2 | GO:0019441 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
0.1 | 0.4 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.1 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.1 | 0.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.1 | 0.2 | GO:1904451 | regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
0.1 | 0.3 | GO:0002339 | B cell selection(GO:0002339) |
0.1 | 0.2 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.1 | 0.2 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
0.1 | 0.3 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 0.2 | GO:0006780 | uroporphyrinogen III biosynthetic process(GO:0006780) |
0.1 | 0.5 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.1 | 0.3 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.1 | 0.3 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.1 | 0.5 | GO:0060613 | fat pad development(GO:0060613) |
0.1 | 0.1 | GO:0070942 | neutrophil mediated cytotoxicity(GO:0070942) neutrophil mediated killing of symbiont cell(GO:0070943) |
0.1 | 0.6 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.1 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.2 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
0.1 | 0.1 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
0.1 | 0.3 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
0.1 | 0.7 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.1 | 0.2 | GO:1904959 | regulation of electron carrier activity(GO:1904732) regulation of cytochrome-c oxidase activity(GO:1904959) |
0.1 | 0.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.1 | 0.4 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.1 | 0.3 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.1 | 0.2 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.1 | 0.2 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.1 | 1.8 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.1 | 0.2 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.1 | 0.3 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.1 | 0.2 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.1 | 0.3 | GO:0061074 | regulation of neural retina development(GO:0061074) |
0.1 | 0.2 | GO:0061744 | motor behavior(GO:0061744) |
0.1 | 0.2 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.1 | 0.4 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.1 | 0.4 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.1 | 0.2 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.1 | 0.2 | GO:0015786 | UDP-glucose transport(GO:0015786) protein O-linked fucosylation(GO:0036066) |
0.1 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.7 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.1 | 0.2 | GO:0046077 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate metabolic process(GO:0009138) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
0.1 | 0.3 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.1 | 0.3 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.1 | 0.2 | GO:0051798 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
0.1 | 0.3 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 0.4 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.1 | 0.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.4 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.1 | 0.4 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
0.1 | 0.2 | GO:0070543 | response to linoleic acid(GO:0070543) |
0.0 | 0.2 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.0 | 0.3 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.0 | 0.1 | GO:0002667 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
0.0 | 0.2 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.3 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
0.0 | 0.2 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
0.0 | 0.1 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.0 | 0.6 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.1 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.0 | 0.1 | GO:0045414 | regulation of interleukin-8 biosynthetic process(GO:0045414) |
0.0 | 0.3 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.0 | 0.2 | GO:0033580 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
0.0 | 0.5 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.9 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.0 | 0.3 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.0 | 0.1 | GO:0032627 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
0.0 | 0.2 | GO:0060261 | positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
0.0 | 0.7 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.2 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) |
0.0 | 3.1 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.0 | GO:0035482 | gastric motility(GO:0035482) gastric emptying(GO:0035483) |
0.0 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.2 | GO:0045187 | regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
0.0 | 0.3 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.7 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.0 | 0.3 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.4 | GO:0019400 | alditol metabolic process(GO:0019400) |
0.0 | 0.5 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.0 | 0.1 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
0.0 | 0.3 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.2 | GO:0030432 | peristalsis(GO:0030432) |
0.0 | 0.1 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.0 | 0.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.3 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.0 | 0.4 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.0 | 0.2 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.0 | 0.3 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.0 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.0 | 0.3 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.3 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.0 | 0.4 | GO:0006968 | cellular defense response(GO:0006968) |
0.0 | 0.1 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
0.0 | 0.2 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.0 | 0.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.1 | GO:1900060 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.0 | 0.3 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.0 | 0.7 | GO:0006465 | signal peptide processing(GO:0006465) |
0.0 | 0.2 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
0.0 | 0.1 | GO:0070166 | enamel mineralization(GO:0070166) |
0.0 | 0.1 | GO:0060785 | regulation of apoptosis involved in tissue homeostasis(GO:0060785) |
0.0 | 0.2 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
0.0 | 0.1 | GO:1903596 | regulation of gap junction assembly(GO:1903596) |
0.0 | 0.1 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
0.0 | 0.0 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) oxidative demethylation(GO:0070989) |
0.0 | 0.6 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.2 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.0 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.0 | 0.2 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.0 | 0.2 | GO:0050855 | regulation of B cell receptor signaling pathway(GO:0050855) positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.1 | GO:2000501 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) |
0.0 | 0.5 | GO:0001779 | natural killer cell differentiation(GO:0001779) |
0.0 | 0.2 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) |
0.0 | 0.4 | GO:0001977 | renal system process involved in regulation of blood volume(GO:0001977) |
0.0 | 0.1 | GO:0042662 | negative regulation of Wnt signaling pathway involved in heart development(GO:0003308) negative regulation of mesodermal cell fate specification(GO:0042662) |
0.0 | 0.4 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 0.1 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
0.0 | 0.2 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.6 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 0.1 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.0 | 0.4 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
0.0 | 0.5 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.0 | 0.1 | GO:0034334 | adherens junction maintenance(GO:0034334) |
0.0 | 1.3 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.1 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.0 | 0.4 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.1 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.0 | 0.3 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.9 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.3 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.3 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.3 | GO:0050857 | positive regulation of antigen receptor-mediated signaling pathway(GO:0050857) positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.0 | 0.1 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
0.0 | 0.1 | GO:2001160 | regulation of histone H3-K79 methylation(GO:2001160) |
0.0 | 0.6 | GO:0000338 | protein deneddylation(GO:0000338) |
0.0 | 0.1 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
0.0 | 0.3 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.0 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.1 | GO:0006788 | heme oxidation(GO:0006788) |
0.0 | 0.1 | GO:0060578 | extraocular skeletal muscle development(GO:0002074) subthalamic nucleus development(GO:0021763) left lung development(GO:0060459) left lung morphogenesis(GO:0060460) pulmonary vein morphogenesis(GO:0060577) superior vena cava morphogenesis(GO:0060578) |
0.0 | 0.0 | GO:1905216 | positive regulation of RNA binding(GO:1905216) |
0.0 | 0.2 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.0 | 0.6 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
0.0 | 0.7 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.0 | 0.1 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.0 | 0.6 | GO:0098869 | cellular oxidant detoxification(GO:0098869) cellular detoxification(GO:1990748) |
0.0 | 0.1 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
0.0 | 0.2 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.0 | 0.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.1 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.0 | 0.3 | GO:2001022 | positive regulation of response to DNA damage stimulus(GO:2001022) |
0.0 | 0.3 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.0 | 0.4 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.0 | 0.7 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.0 | 0.1 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
0.0 | 0.3 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
0.0 | 0.0 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
0.0 | 0.4 | GO:0002385 | organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
0.0 | 0.3 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.0 | 0.2 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.2 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.2 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.2 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.0 | 0.3 | GO:0009650 | UV protection(GO:0009650) |
0.0 | 0.1 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.0 | 0.5 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 0.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.0 | 0.2 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.0 | 0.0 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.0 | 0.3 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.1 | GO:0031938 | regulation of chromatin silencing at telomere(GO:0031938) |
0.0 | 0.2 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.7 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.3 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.0 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
0.0 | 0.6 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
0.0 | 0.1 | GO:0042713 | sperm ejaculation(GO:0042713) |
0.0 | 0.0 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.0 | 0.3 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.2 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.0 | 0.2 | GO:0002544 | chronic inflammatory response(GO:0002544) |
0.0 | 0.1 | GO:0040010 | positive regulation of growth rate(GO:0040010) |
0.0 | 0.4 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.0 | 0.2 | GO:0048105 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
0.0 | 0.1 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.0 | 0.1 | GO:0002302 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
0.0 | 0.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.0 | GO:0098712 | L-glutamate import across plasma membrane(GO:0098712) |
0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.0 | 0.3 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.0 | 0.3 | GO:1903963 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.0 | 0.2 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.0 | 0.2 | GO:0007440 | foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
0.0 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
0.0 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.0 | 0.1 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
0.0 | 0.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.0 | 0.1 | GO:0002423 | natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002420) natural killer cell mediated immune response to tumor cell(GO:0002423) regulation of natural killer cell mediated immune response to tumor cell(GO:0002855) regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002858) |
0.0 | 0.1 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.0 | 0.6 | GO:0002455 | humoral immune response mediated by circulating immunoglobulin(GO:0002455) |
0.0 | 0.3 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.0 | 0.4 | GO:0035115 | embryonic forelimb morphogenesis(GO:0035115) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.2 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.0 | 0.2 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.0 | 0.2 | GO:0060594 | mammary gland specification(GO:0060594) |
0.0 | 0.8 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.2 | GO:1901911 | diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
0.0 | 0.1 | GO:1904798 | positive regulation of core promoter binding(GO:1904798) |
0.0 | 1.0 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.6 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
0.0 | 0.2 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
0.0 | 0.2 | GO:0046415 | urate metabolic process(GO:0046415) |
0.0 | 0.7 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.2 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
0.0 | 0.1 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.0 | 0.3 | GO:0001765 | membrane raft assembly(GO:0001765) |
0.0 | 0.2 | GO:0048102 | autophagic cell death(GO:0048102) |
0.0 | 0.1 | GO:2000744 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
0.0 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.0 | 0.1 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.0 | 0.2 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.0 | 0.2 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.1 | GO:0036438 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) maintenance of lens transparency(GO:0036438) |
0.0 | 0.2 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.0 | 0.2 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.0 | 0.1 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
0.0 | 0.1 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
0.0 | 0.1 | GO:0035617 | stress granule disassembly(GO:0035617) |
0.0 | 0.2 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 1.4 | GO:0006754 | ATP biosynthetic process(GO:0006754) |
0.0 | 0.2 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 0.1 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
0.0 | 0.3 | GO:0061028 | establishment of endothelial barrier(GO:0061028) |
0.0 | 0.3 | GO:1990173 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
0.0 | 0.2 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.0 | 0.9 | GO:0006414 | translational elongation(GO:0006414) |
0.0 | 0.1 | GO:0046368 | GDP-L-fucose metabolic process(GO:0046368) |
0.0 | 0.4 | GO:0006662 | glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) |
0.0 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.1 | GO:1904407 | positive regulation of nitric oxide biosynthetic process(GO:0045429) positive regulation of reactive oxygen species biosynthetic process(GO:1903428) positive regulation of nitric oxide metabolic process(GO:1904407) |
0.0 | 0.5 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
0.0 | 0.2 | GO:0032693 | negative regulation of interleukin-10 production(GO:0032693) |
0.0 | 0.1 | GO:0015791 | polyol transport(GO:0015791) |
0.0 | 0.2 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
0.0 | 0.2 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.0 | 0.3 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.3 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
0.0 | 0.2 | GO:0001516 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.1 | GO:1903061 | regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
0.0 | 0.1 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
0.0 | 0.3 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.0 | 0.1 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.0 | 0.4 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
0.0 | 0.1 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.0 | 0.1 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.0 | 0.1 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.1 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.1 | GO:0051298 | centrosome duplication(GO:0051298) |
0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.1 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.0 | 0.0 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.0 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.0 | 0.2 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.0 | 0.1 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
0.0 | 0.3 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
0.0 | 0.1 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.0 | 0.6 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
0.0 | 0.1 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.5 | GO:0007617 | mating behavior(GO:0007617) multi-organism reproductive behavior(GO:0044705) |
0.0 | 0.2 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.0 | 0.4 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.0 | 0.3 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.0 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.0 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.0 | 0.7 | GO:0007566 | embryo implantation(GO:0007566) |
0.0 | 0.1 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
0.0 | 0.0 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.0 | 0.2 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.1 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.0 | 0.0 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
0.0 | 0.2 | GO:0019884 | antigen processing and presentation of exogenous antigen(GO:0019884) |
0.0 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.1 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
0.0 | 0.1 | GO:0051969 | regulation of transmission of nerve impulse(GO:0051969) |
0.0 | 0.2 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
0.0 | 0.3 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.2 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
0.0 | 0.0 | GO:0072610 | interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) positive regulation of interleukin-12 secretion(GO:2001184) |
0.0 | 0.3 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.2 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.0 | 0.2 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 0.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.0 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
0.0 | 0.3 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.0 | 0.1 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
0.0 | 0.4 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.2 | GO:0021854 | hypothalamus development(GO:0021854) |
0.0 | 0.7 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.2 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.4 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.0 | 0.2 | GO:0033108 | mitochondrial respiratory chain complex assembly(GO:0033108) |
0.0 | 0.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.0 | 0.1 | GO:0060539 | diaphragm development(GO:0060539) |
0.0 | 0.1 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.0 | 0.2 | GO:0002063 | chondrocyte development(GO:0002063) |
0.0 | 0.2 | GO:1901409 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.1 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
0.0 | 0.2 | GO:0034390 | smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
0.0 | 0.1 | GO:0010212 | response to ionizing radiation(GO:0010212) |
0.0 | 0.1 | GO:0042167 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.0 | 0.2 | GO:0000054 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
0.0 | 0.2 | GO:2001223 | negative regulation of neuron migration(GO:2001223) |
0.0 | 0.1 | GO:1903795 | regulation of inorganic anion transmembrane transport(GO:1903795) |
0.0 | 0.1 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.0 | 0.0 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
0.0 | 0.2 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.0 | 0.1 | GO:0098762 | meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
0.0 | 0.2 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.0 | 0.3 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.0 | 0.2 | GO:0010586 | miRNA metabolic process(GO:0010586) |
0.0 | 0.1 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
0.0 | 0.1 | GO:0090220 | meiotic telomere clustering(GO:0045141) chromosome localization to nuclear envelope involved in homologous chromosome segregation(GO:0090220) |
0.0 | 0.1 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.0 | 0.1 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.0 | 0.1 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.3 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.2 | GO:0046697 | decidualization(GO:0046697) |
0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 1.2 | GO:0006413 | translational initiation(GO:0006413) |
0.0 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.1 | GO:0010922 | positive regulation of phosphatase activity(GO:0010922) |
0.0 | 0.0 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.0 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.1 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.0 | 0.1 | GO:0001928 | regulation of exocyst assembly(GO:0001928) |
0.0 | 0.1 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.2 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
0.0 | 0.1 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.2 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
0.0 | 0.5 | GO:0051693 | actin filament capping(GO:0051693) |
0.0 | 0.0 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.1 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.0 | 0.1 | GO:0048008 | platelet-derived growth factor receptor signaling pathway(GO:0048008) |
0.0 | 0.0 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.0 | 0.2 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.0 | 0.1 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.0 | 0.1 | GO:0070986 | left/right axis specification(GO:0070986) |
0.0 | 0.1 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
0.0 | 0.0 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
0.0 | 0.0 | GO:0070344 | fat cell proliferation(GO:0070341) regulation of fat cell proliferation(GO:0070344) negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.3 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.2 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
0.0 | 0.1 | GO:0045862 | positive regulation of proteolysis(GO:0045862) |
0.0 | 0.1 | GO:0010884 | positive regulation of lipid storage(GO:0010884) |
0.0 | 0.2 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.2 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.6 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.2 | GO:0003417 | growth plate cartilage development(GO:0003417) |
0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.0 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.1 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.0 | 0.1 | GO:0015862 | uridine transport(GO:0015862) |
0.0 | 0.3 | GO:0007006 | mitochondrial membrane organization(GO:0007006) |
0.0 | 0.4 | GO:0050830 | defense response to Gram-positive bacterium(GO:0050830) |
0.0 | 0.0 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.0 | 0.1 | GO:0070294 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
0.0 | 0.1 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
0.0 | 0.1 | GO:0045776 | negative regulation of blood pressure(GO:0045776) |
0.0 | 0.1 | GO:0050909 | sensory perception of taste(GO:0050909) |
0.0 | 0.2 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
0.0 | 0.2 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.0 | 0.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 0.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.0 | 0.0 | GO:0042891 | antibiotic transport(GO:0042891) |
0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.1 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.0 | 0.2 | GO:0034502 | protein localization to chromosome(GO:0034502) |
0.0 | 0.1 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.0 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
0.0 | 0.4 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 0.1 | GO:0046512 | sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
0.0 | 0.1 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.1 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.1 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.0 | 0.1 | GO:0042982 | amyloid precursor protein metabolic process(GO:0042982) |
0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.1 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.0 | 0.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.1 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
0.0 | 0.0 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.1 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.0 | 0.1 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.0 | 0.3 | GO:0019915 | lipid storage(GO:0019915) |
0.0 | 0.1 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.1 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.0 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.1 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
0.0 | 0.3 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.0 | 0.1 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
0.0 | 0.0 | GO:0045987 | positive regulation of smooth muscle contraction(GO:0045987) |
0.0 | 0.0 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.0 | 0.2 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.0 | 0.1 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
0.0 | 0.0 | GO:0060857 | establishment of glial blood-brain barrier(GO:0060857) |
0.0 | 0.0 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.0 | GO:1900364 | regulation of mRNA polyadenylation(GO:1900363) negative regulation of mRNA polyadenylation(GO:1900364) |
0.0 | 0.0 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.0 | GO:0070202 | regulation of establishment of protein localization to chromosome(GO:0070202) |
0.0 | 0.0 | GO:1905075 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
0.0 | 0.0 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.0 | 0.1 | GO:0014046 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
0.0 | 0.2 | GO:0051894 | positive regulation of focal adhesion assembly(GO:0051894) positive regulation of adherens junction organization(GO:1903393) |
0.0 | 0.1 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.1 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.0 | 0.3 | GO:0051881 | regulation of mitochondrial membrane potential(GO:0051881) |
0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.1 | GO:0007140 | male meiosis(GO:0007140) |
0.0 | 0.1 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.0 | 0.0 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
0.0 | 0.3 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
0.0 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.0 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
0.0 | 0.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.0 | 0.4 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
0.0 | 0.1 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
0.0 | 0.1 | GO:0007098 | centrosome cycle(GO:0007098) |
0.0 | 0.0 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.0 | 0.2 | GO:0048701 | embryonic cranial skeleton morphogenesis(GO:0048701) |
0.0 | 0.0 | GO:1901838 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.0 | 0.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.0 | 0.1 | GO:0001893 | maternal placenta development(GO:0001893) |
0.0 | 0.1 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
0.0 | 0.1 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.0 | 0.0 | GO:1904245 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
0.0 | 0.2 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
0.0 | 0.1 | GO:0010669 | epithelial structure maintenance(GO:0010669) |
0.0 | 0.1 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
Gene overrepresentation in cellular_component category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.8 | GO:0000801 | central element(GO:0000801) |
0.2 | 0.6 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
0.2 | 1.4 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.2 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.2 | 0.7 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.2 | 0.5 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
0.2 | 0.5 | GO:0071953 | elastic fiber(GO:0071953) |
0.2 | 0.5 | GO:0005584 | collagen type I trimer(GO:0005584) |
0.1 | 0.4 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
0.1 | 1.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.1 | 0.9 | GO:0097452 | GAIT complex(GO:0097452) |
0.1 | 0.5 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 0.7 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 0.4 | GO:0043224 | nuclear SCF ubiquitin ligase complex(GO:0043224) |
0.1 | 0.4 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.4 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
0.1 | 0.8 | GO:0001740 | Barr body(GO:0001740) |
0.1 | 1.6 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.1 | 0.3 | GO:0044299 | C-fiber(GO:0044299) |
0.1 | 0.3 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 3.6 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 1.4 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.1 | 0.6 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 1.0 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.1 | 0.8 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.1 | 0.4 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
0.1 | 0.7 | GO:0005787 | signal peptidase complex(GO:0005787) |
0.1 | 0.3 | GO:0045283 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
0.1 | 0.8 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.1 | 5.7 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.1 | 0.3 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 0.5 | GO:0035976 | AP1 complex(GO:0035976) |
0.1 | 0.8 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
0.1 | 0.4 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.1 | 0.6 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.4 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 0.4 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.2 | GO:0036125 | mitochondrial fatty acid beta-oxidation multienzyme complex(GO:0016507) fatty acid beta-oxidation multienzyme complex(GO:0036125) |
0.1 | 0.4 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
0.1 | 0.9 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 1.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.1 | 0.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 0.3 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 0.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 0.8 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.1 | 0.2 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
0.1 | 0.4 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.1 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.1 | 0.3 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.6 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 0.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.1 | 0.1 | GO:0014704 | intercalated disc(GO:0014704) |
0.1 | 0.4 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 0.2 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
0.1 | 0.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 1.4 | GO:0005839 | proteasome core complex(GO:0005839) |
0.1 | 0.2 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.1 | 0.2 | GO:0097574 | lateral part of cell(GO:0097574) basolateral part of cell(GO:1990794) rod bipolar cell terminal bouton(GO:1990795) |
0.1 | 0.2 | GO:0033391 | chromatoid body(GO:0033391) |
0.1 | 0.2 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
0.1 | 2.9 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.1 | 0.6 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.1 | 0.2 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.1 | 0.2 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.1 | 0.4 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
0.1 | 0.4 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 0.2 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 0.2 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.1 | 0.4 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.2 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 0.3 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
0.1 | 0.6 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.1 | 1.2 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 0.5 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 0.2 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.1 | GO:0042827 | platelet dense granule(GO:0042827) |
0.0 | 0.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.0 | 0.2 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
0.0 | 0.5 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.0 | 0.1 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
0.0 | 0.2 | GO:0060187 | cell pole(GO:0060187) |
0.0 | 1.1 | GO:0097346 | INO80-type complex(GO:0097346) |
0.0 | 0.6 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.4 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
0.0 | 0.2 | GO:1903349 | omegasome membrane(GO:1903349) |
0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
0.0 | 0.1 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
0.0 | 0.2 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.0 | 2.0 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.5 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.4 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.5 | GO:0022626 | cytosolic ribosome(GO:0022626) |
0.0 | 0.6 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.5 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.7 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 0.3 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.7 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 0.3 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.2 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.4 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) |
0.0 | 0.2 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.0 | 0.2 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.2 | GO:0097444 | spine apparatus(GO:0097444) |
0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 0.2 | GO:0033010 | paranodal junction(GO:0033010) |
0.0 | 0.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.1 | GO:0008537 | proteasome activator complex(GO:0008537) |
0.0 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.4 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.2 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.0 | 0.2 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.5 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.1 | GO:0061702 | inflammasome complex(GO:0061702) |
0.0 | 0.3 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.0 | 0.5 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.0 | GO:1990415 | Pex17p-Pex14p docking complex(GO:1990415) peroxisomal importomer complex(GO:1990429) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.0 | 1.0 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.6 | GO:0030286 | dynein complex(GO:0030286) |
0.0 | 0.3 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.0 | 0.7 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.4 | GO:0044754 | secondary lysosome(GO:0005767) autolysosome(GO:0044754) |
0.0 | 0.3 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
0.0 | 0.5 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.3 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.6 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
0.0 | 0.2 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.3 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.2 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.2 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.1 | GO:0070985 | TFIIK complex(GO:0070985) |
0.0 | 0.4 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.1 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.2 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 0.1 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
0.0 | 0.7 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.0 | 0.1 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
0.0 | 1.8 | GO:0009897 | external side of plasma membrane(GO:0009897) |
0.0 | 0.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.4 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.1 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.2 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 0.3 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.6 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.2 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.5 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 1.3 | GO:0015934 | large ribosomal subunit(GO:0015934) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.1 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.0 | 0.1 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.0 | 0.2 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.6 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.3 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.2 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.1 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 1.1 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.7 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.2 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.4 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.2 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.9 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.1 | GO:0043235 | receptor complex(GO:0043235) |
0.0 | 0.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.1 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
0.0 | 0.0 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.0 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.2 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 1.5 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.6 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.1 | GO:0005883 | neurofilament(GO:0005883) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.2 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 0.0 | GO:0016460 | myosin II complex(GO:0016460) |
0.0 | 0.1 | GO:0098837 | postsynaptic recycling endosome(GO:0098837) |
0.0 | 0.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.0 | 0.1 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 1.2 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.0 | 0.1 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
0.0 | 0.1 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.4 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.2 | GO:0044217 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
0.0 | 0.2 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.7 | GO:0031970 | mitochondrial intermembrane space(GO:0005758) organelle envelope lumen(GO:0031970) |
0.0 | 0.2 | GO:0005902 | microvillus(GO:0005902) |
0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.1 | GO:0000974 | Prp19 complex(GO:0000974) |
0.0 | 4.4 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.1 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 0.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 1.4 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 2.8 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 0.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.2 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 0.1 | GO:0097610 | cell division site(GO:0032153) cleavage furrow(GO:0032154) cell division site part(GO:0032155) cell surface furrow(GO:0097610) |
0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.5 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.1 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.0 | 0.2 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.0 | 0.0 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.1 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
0.0 | 0.5 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.3 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.4 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.0 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) TAP complex(GO:0042825) |
0.0 | 0.2 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 0.6 | GO:0072562 | blood microparticle(GO:0072562) |
Gene overrepresentation in molecular_function category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 2.0 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
0.3 | 2.1 | GO:0019841 | retinol binding(GO:0019841) |
0.3 | 3.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.3 | 0.8 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.2 | 0.7 | GO:0051870 | methotrexate binding(GO:0051870) |
0.2 | 0.7 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.2 | 1.0 | GO:0005534 | galactose binding(GO:0005534) |
0.2 | 1.2 | GO:0019864 | immunoglobulin receptor activity(GO:0019763) IgG binding(GO:0019864) |
0.2 | 0.7 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.2 | 0.5 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.2 | 0.5 | GO:0016015 | morphogen activity(GO:0016015) |
0.2 | 0.8 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.2 | 0.5 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.2 | 0.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.2 | 0.8 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) glycerol transmembrane transporter activity(GO:0015168) |
0.2 | 0.8 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.2 | 0.8 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
0.1 | 0.6 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.1 | 0.4 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.1 | 0.6 | GO:1902379 | chemoattractant activity involved in axon guidance(GO:1902379) |
0.1 | 0.4 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 0.4 | GO:0000402 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
0.1 | 0.4 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
0.1 | 0.5 | GO:0004921 | interleukin-11 receptor activity(GO:0004921) interleukin-11 binding(GO:0019970) |
0.1 | 0.7 | GO:0042610 | CD8 receptor binding(GO:0042610) |
0.1 | 0.9 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.1 | 0.9 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 1.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.1 | 0.4 | GO:0030172 | troponin C binding(GO:0030172) |
0.1 | 0.4 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.1 | 0.5 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 0.5 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.8 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
0.1 | 0.3 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.1 | 0.5 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.1 | 0.4 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.1 | 0.5 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.1 | 0.3 | GO:0030519 | snoRNP binding(GO:0030519) |
0.1 | 0.3 | GO:0030249 | guanylate cyclase regulator activity(GO:0030249) |
0.1 | 0.3 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 1.3 | GO:0031386 | protein tag(GO:0031386) |
0.1 | 0.3 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.1 | 0.3 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.1 | 0.4 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.1 | 0.5 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.1 | 1.3 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.1 | 0.8 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.6 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 0.5 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
0.1 | 0.3 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.1 | 0.4 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.1 | 0.6 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.1 | 0.4 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 1.0 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.1 | 0.3 | GO:0015928 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
0.1 | 0.3 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.1 | 0.3 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.3 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.1 | 0.3 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.6 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 0.2 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.1 | 0.3 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.1 | 0.4 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
0.1 | 0.5 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 0.3 | GO:0001851 | complement component C3b binding(GO:0001851) |
0.1 | 0.2 | GO:0042562 | hormone binding(GO:0042562) |
0.1 | 0.5 | GO:1903136 | cuprous ion binding(GO:1903136) |
0.1 | 0.3 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.3 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.1 | 0.9 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.2 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.1 | 0.2 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
0.1 | 0.2 | GO:0018738 | S-formylglutathione hydrolase activity(GO:0018738) |
0.1 | 0.4 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.1 | 0.6 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.1 | 0.4 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 1.1 | GO:0001848 | complement binding(GO:0001848) |
0.1 | 0.6 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.3 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.1 | 0.2 | GO:0001047 | core promoter binding(GO:0001047) |
0.1 | 0.3 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 0.7 | GO:0015266 | protein channel activity(GO:0015266) |
0.1 | 0.4 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
0.1 | 1.3 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.1 | 0.3 | GO:0031687 | A2A adenosine receptor binding(GO:0031687) |
0.1 | 0.5 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.1 | 0.3 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.1 | 0.2 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.1 | 0.1 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
0.1 | 0.5 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 1.4 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.1 | 0.2 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.1 | 0.2 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 0.3 | GO:0042806 | fucose binding(GO:0042806) |
0.1 | 0.3 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.1 | 0.4 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 10.9 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 0.2 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.1 | 0.3 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.1 | 0.4 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
0.1 | 0.2 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.1 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.2 | GO:0004454 | ketohexokinase activity(GO:0004454) |
0.1 | 0.6 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.1 | 0.5 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 0.1 | GO:0004532 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity(GO:0004532) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.1 | 0.1 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
0.1 | 0.9 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.1 | 0.2 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.1 | 0.2 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.1 | 0.5 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 0.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.1 | 0.6 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.1 | 0.2 | GO:0071568 | UFM1 transferase activity(GO:0071568) |
0.1 | 0.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.1 | 0.4 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.1 | 0.4 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.1 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.1 | 0.2 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.1 | 0.4 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.6 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.1 | 0.3 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.1 | 0.4 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.1 | 0.4 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.9 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.1 | 0.3 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.1 | 0.5 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.1 | 0.4 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 0.3 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 1.8 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.1 | 0.5 | GO:0050733 | RS domain binding(GO:0050733) |
0.1 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) arginine binding(GO:0034618) |
0.1 | 0.2 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.1 | 0.2 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
0.1 | 0.6 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.0 | 0.2 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.2 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.8 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.0 | 0.2 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.0 | 0.5 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.2 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 0.4 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.2 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.2 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.0 | 1.0 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.4 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.4 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.0 | 0.2 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.0 | 0.2 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
0.0 | 1.3 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.3 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.0 | 0.5 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.0 | 0.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.2 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 1.0 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.1 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
0.0 | 0.3 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.0 | 1.1 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.1 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
0.0 | 0.5 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.3 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.3 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
0.0 | 0.4 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.0 | 0.2 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.0 | 0.2 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.7 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.2 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
0.0 | 2.0 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.4 | GO:0016840 | carbon-nitrogen lyase activity(GO:0016840) |
0.0 | 0.1 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
0.0 | 0.1 | GO:0035939 | microsatellite binding(GO:0035939) |
0.0 | 0.5 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.0 | 0.4 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.5 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.0 | 0.7 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.1 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.0 | 0.4 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.6 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.0 | 0.3 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.4 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.0 | 1.7 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.8 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.0 | 0.2 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.0 | 0.1 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.0 | 0.5 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.2 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.1 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
0.0 | 0.1 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 1.4 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.0 | 0.6 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.2 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.3 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 2.0 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.5 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.9 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.0 | 0.5 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.0 | 0.2 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.3 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.0 | 0.2 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 0.2 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.3 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.0 | 0.8 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.4 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.5 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.2 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.1 | GO:0004540 | ribonuclease activity(GO:0004540) |
0.0 | 0.2 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.0 | 0.2 | GO:0000298 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
0.0 | 1.0 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.2 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.0 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.2 | GO:0048101 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.0 | 1.0 | GO:0005179 | hormone activity(GO:0005179) |
0.0 | 1.2 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.0 | 0.2 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.5 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.0 | 0.2 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.2 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.2 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.0 | 0.1 | GO:0003883 | CTP synthase activity(GO:0003883) |
0.0 | 0.1 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.2 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.3 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.0 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
0.0 | 0.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 1.1 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.3 | GO:0008227 | G-protein coupled amine receptor activity(GO:0008227) |
0.0 | 0.3 | GO:0019199 | transmembrane receptor protein kinase activity(GO:0019199) |
0.0 | 0.3 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.1 | GO:0003692 | left-handed Z-DNA binding(GO:0003692) |
0.0 | 0.1 | GO:0004321 | fatty-acyl-CoA synthase activity(GO:0004321) |
0.0 | 0.1 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
0.0 | 0.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 2.2 | GO:0008201 | heparin binding(GO:0008201) |
0.0 | 0.1 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.0 | 0.0 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.1 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.3 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.1 | GO:0086038 | calcium:sodium antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086038) |
0.0 | 0.1 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) |
0.0 | 0.1 | GO:0032554 | deoxyribonucleotide binding(GO:0032552) purine deoxyribonucleotide binding(GO:0032554) |
0.0 | 0.1 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.0 | 0.3 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.0 | 0.1 | GO:0046969 | histone deacetylase activity (H3-K9 specific)(GO:0032129) NAD-dependent histone deacetylase activity (H3-K9 specific)(GO:0046969) |
0.0 | 0.0 | GO:0046977 | TAP binding(GO:0046977) |
0.0 | 0.2 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.2 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.7 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.0 | 0.8 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.1 | GO:0070140 | isopeptidase activity(GO:0070122) ubiquitin-like protein-specific isopeptidase activity(GO:0070138) SUMO-specific isopeptidase activity(GO:0070140) |
0.0 | 0.2 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.0 | 0.2 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.2 | GO:0005537 | mannose binding(GO:0005537) |
0.0 | 0.3 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.1 | GO:0004673 | phosphorelay sensor kinase activity(GO:0000155) protein histidine kinase activity(GO:0004673) |
0.0 | 0.2 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.0 | 0.2 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.6 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.1 | GO:0004104 | cholinesterase activity(GO:0004104) choline binding(GO:0033265) |
0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.0 | 0.2 | GO:0048185 | activin binding(GO:0048185) |
0.0 | 0.1 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.0 | 0.1 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.0 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.4 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.1 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
0.0 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.3 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.1 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.1 | GO:0097003 | adiponectin binding(GO:0055100) adipokinetic hormone receptor activity(GO:0097003) |
0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.1 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
0.0 | 0.2 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
0.0 | 0.6 | GO:0016776 | phosphotransferase activity, phosphate group as acceptor(GO:0016776) |
0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.1 | GO:0019779 | Atg12 activating enzyme activity(GO:0019778) Atg8 activating enzyme activity(GO:0019779) |
0.0 | 0.2 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.1 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.0 | 0.0 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.9 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.0 | 0.1 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.1 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
0.0 | 0.2 | GO:0035173 | histone kinase activity(GO:0035173) |
0.0 | 0.0 | GO:0004866 | endopeptidase inhibitor activity(GO:0004866) endopeptidase regulator activity(GO:0061135) |
0.0 | 0.0 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.1 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.5 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.0 | 0.3 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.2 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
0.0 | 0.1 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.0 | 0.0 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.1 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.0 | 0.1 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.0 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.0 | 0.3 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.0 | GO:0008392 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
0.0 | 0.3 | GO:0008143 | poly(A) binding(GO:0008143) |
0.0 | 0.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.1 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.0 | GO:0045127 | N-acylmannosamine kinase activity(GO:0009384) N-acetylglucosamine kinase activity(GO:0045127) |
0.0 | 0.2 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.0 | 0.3 | GO:0051287 | NAD binding(GO:0051287) |
0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.0 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
0.0 | 0.3 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.1 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 0.1 | GO:0052654 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
0.0 | 0.0 | GO:0033883 | pyridoxal phosphatase activity(GO:0033883) |
0.0 | 0.1 | GO:0070403 | NAD+ binding(GO:0070403) |
0.0 | 0.0 | GO:0005118 | sevenless binding(GO:0005118) |
0.0 | 0.5 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.1 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.1 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
0.0 | 0.0 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.0 | 0.3 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 0.3 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.2 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
0.0 | 0.1 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
0.0 | 0.3 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.6 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.0 | 0.1 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.0 | 0.3 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.2 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
0.0 | 0.0 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.0 | 0.1 | GO:0097643 | amylin receptor activity(GO:0097643) |
0.0 | 0.0 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.0 | GO:0019213 | deacetylase activity(GO:0019213) |
0.0 | 0.0 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.2 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.0 | 0.0 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
0.0 | 0.1 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.1 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.2 | GO:0016859 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) cis-trans isomerase activity(GO:0016859) |
0.0 | 0.2 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.0 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.0 | 0.0 | GO:0015250 | water channel activity(GO:0015250) |
Gene overrepresentation in C2:CP category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.2 | PID_TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.1 | 3.9 | PID_HNF3B_PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 0.9 | PID_ALK2_PATHWAY | ALK2 signaling events |
0.1 | 1.1 | SA_G1_AND_S_PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.1 | 0.4 | PID_NFAT_3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.1 | 1.8 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
0.1 | 1.8 | NABA_PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 1.4 | PID_FRA_PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.2 | SA_REG_CASCADE_OF_CYCLIN_EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 1.2 | PID_SYNDECAN_4_PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.2 | PID_EPO_PATHWAY | EPO signaling pathway |
0.0 | 0.3 | PID_HES_HEY_PATHWAY | Notch-mediated HES/HEY network |
0.0 | 1.5 | PID_IL12_2PATHWAY | IL12-mediated signaling events |
0.0 | 1.2 | PID_P38_MK2_PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 3.3 | WNT_SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.6 | PID_P38_GAMMA_DELTA_PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.6 | PID_BMP_PATHWAY | BMP receptor signaling |
0.0 | 0.7 | PID_TCR_CALCIUM_PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.2 | PID_S1P_S1P2_PATHWAY | S1P2 pathway |
0.0 | 0.6 | PID_ALK1_PATHWAY | ALK1 signaling events |
0.0 | 0.4 | PID_RANBP2_PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 1.6 | PID_E2F_PATHWAY | E2F transcription factor network |
0.0 | 0.2 | PID_CERAMIDE_PATHWAY | Ceramide signaling pathway |
0.0 | 0.1 | PID_IL23_PATHWAY | IL23-mediated signaling events |
0.0 | 0.6 | SA_TRKA_RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.9 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.3 | PID_PRL_SIGNALING_EVENTS_PATHWAY | Signaling events mediated by PRL |
0.0 | 0.6 | PID_TRAIL_PATHWAY | TRAIL signaling pathway |
0.0 | 0.1 | PID_IL27_PATHWAY | IL27-mediated signaling events |
0.0 | 0.8 | ST_T_CELL_SIGNAL_TRANSDUCTION | T Cell Signal Transduction |
0.0 | 0.6 | PID_NECTIN_PATHWAY | Nectin adhesion pathway |
0.0 | 0.2 | PID_INTEGRIN2_PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.1 | NABA_BASEMENT_MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 3.0 | NABA_SECRETED_FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.9 | PID_SYNDECAN_1_PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.4 | PID_RB_1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.1 | PID_IL12_STAT4_PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 0.8 | PID_HEDGEHOG_GLI_PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.1 | PID_TCPTP_PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.1 | PID_TCR_RAS_PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.1 | PID_IL3_PATHWAY | IL3-mediated signaling events |
0.0 | 0.3 | PID_HIF1A_PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 1.9 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.2 | PID_SMAD2_3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.1 | SA_MMP_CYTOKINE_CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.3 | PID_AURORA_A_PATHWAY | Aurora A signaling |
0.0 | 0.3 | PID_RETINOIC_ACID_PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.3 | PID_ALPHA_SYNUCLEIN_PATHWAY | Alpha-synuclein signaling |
0.0 | 0.2 | PID_INTEGRIN3_PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.1 | PID_IFNG_PATHWAY | IFN-gamma pathway |
0.0 | 1.0 | PID_MYC_ACTIV_PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.4 | PID_RAC1_PATHWAY | RAC1 signaling pathway |
0.0 | 0.2 | PID_AJDISS_2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.2 | PID_MAPK_TRK_PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.2 | PID_TGFBR_PATHWAY | TGF-beta receptor signaling |
0.0 | 0.7 | PID_AR_PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.1 | PID_AMB2_NEUTROPHILS_PATHWAY | amb2 Integrin signaling |
Gene overrepresentation in C2:CP:REACTOME category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.2 | REACTOME_INTERACTIONS_OF_VPR_WITH_HOST_CELLULAR_PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.2 | 0.2 | REACTOME_PROSTACYCLIN_SIGNALLING_THROUGH_PROSTACYCLIN_RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 0.8 | REACTOME_TRANSLOCATION_OF_ZAP_70_TO_IMMUNOLOGICAL_SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.1 | 0.8 | REACTOME_PASSIVE_TRANSPORT_BY_AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.1 | 0.3 | REACTOME_PD1_SIGNALING | Genes involved in PD-1 signaling |
0.1 | 5.4 | REACTOME_AMYLOIDS | Genes involved in Amyloids |
0.1 | 1.7 | REACTOME_FORMATION_OF_ATP_BY_CHEMIOSMOTIC_COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 1.0 | REACTOME_PURINE_CATABOLISM | Genes involved in Purine catabolism |
0.1 | 0.1 | REACTOME_PI3K_CASCADE | Genes involved in PI3K Cascade |
0.1 | 0.8 | REACTOME_INTRINSIC_PATHWAY | Genes involved in Intrinsic Pathway |
0.1 | 0.3 | REACTOME_CELL_DEATH_SIGNALLING_VIA_NRAGE_NRIF_AND_NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.1 | 8.9 | REACTOME_PEPTIDE_CHAIN_ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 0.8 | REACTOME_KERATAN_SULFATE_DEGRADATION | Genes involved in Keratan sulfate degradation |
0.1 | 0.3 | REACTOME_G_ALPHA_Q_SIGNALLING_EVENTS | Genes involved in G alpha (q) signalling events |
0.1 | 0.7 | REACTOME_PLATELET_ADHESION_TO_EXPOSED_COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.1 | 0.9 | REACTOME_CS_DS_DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 0.7 | REACTOME_TRYPTOPHAN_CATABOLISM | Genes involved in Tryptophan catabolism |
0.1 | 0.2 | REACTOME_SEMA3A_PAK_DEPENDENT_AXON_REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.1 | 3.9 | REACTOME_P53_DEPENDENT_G1_DNA_DAMAGE_RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.1 | 1.0 | REACTOME_UNWINDING_OF_DNA | Genes involved in Unwinding of DNA |
0.1 | 0.3 | REACTOME_REGULATION_OF_COMPLEMENT_CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 1.0 | REACTOME_P38MAPK_EVENTS | Genes involved in p38MAPK events |
0.1 | 0.2 | REACTOME_ETHANOL_OXIDATION | Genes involved in Ethanol oxidation |
0.1 | 0.6 | REACTOME_RECEPTOR_LIGAND_BINDING_INITIATES_THE_SECOND_PROTEOLYTIC_CLEAVAGE_OF_NOTCH_RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.1 | 2.7 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.9 | REACTOME_APOPTOSIS_INDUCED_DNA_FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.1 | 0.5 | REACTOME_BILE_SALT_AND_ORGANIC_ANION_SLC_TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.1 | 0.6 | REACTOME_VEGF_LIGAND_RECEPTOR_INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 0.6 | REACTOME_REGULATED_PROTEOLYSIS_OF_P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.1 | 0.5 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 0.5 | REACTOME_REMOVAL_OF_THE_FLAP_INTERMEDIATE_FROM_THE_C_STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.8 | REACTOME_SYNTHESIS_SECRETION_AND_DEACYLATION_OF_GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.8 | REACTOME_MRNA_DECAY_BY_5_TO_3_EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.4 | REACTOME_INHIBITION_OF_INSULIN_SECRETION_BY_ADRENALINE_NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.2 | REACTOME_COMMON_PATHWAY | Genes involved in Common Pathway |
0.0 | 0.7 | REACTOME_REGULATION_OF_INSULIN_LIKE_GROWTH_FACTOR_IGF_ACTIVITY_BY_INSULIN_LIKE_GROWTH_FACTOR_BINDING_PROTEINS_IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 1.0 | REACTOME_CHOLESTEROL_BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 1.1 | REACTOME_BASIGIN_INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.3 | REACTOME_THE_ACTIVATION_OF_ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.5 | REACTOME_GAP_JUNCTION_ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.2 | REACTOME_PROCESSIVE_SYNTHESIS_ON_THE_LAGGING_STRAND | Genes involved in Processive synthesis on the lagging strand |
0.0 | 0.9 | REACTOME_MITOCHONDRIAL_TRNA_AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 2.8 | REACTOME_RESPIRATORY_ELECTRON_TRANSPORT_ATP_SYNTHESIS_BY_CHEMIOSMOTIC_COUPLING_AND_HEAT_PRODUCTION_BY_UNCOUPLING_PROTEINS_ | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.0 | 1.1 | REACTOME_RAP1_SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 3.1 | REACTOME_CLASS_B_2_SECRETIN_FAMILY_RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.5 | REACTOME_G1_S_SPECIFIC_TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.0 | 1.5 | REACTOME_GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.1 | REACTOME_VIF_MEDIATED_DEGRADATION_OF_APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.8 | REACTOME_INHIBITION_OF_THE_PROTEOLYTIC_ACTIVITY_OF_APC_C_REQUIRED_FOR_THE_ONSET_OF_ANAPHASE_BY_MITOTIC_SPINDLE_CHECKPOINT_COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.0 | 1.3 | REACTOME_LIPID_DIGESTION_MOBILIZATION_AND_TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
0.0 | 0.4 | REACTOME_CDT1_ASSOCIATION_WITH_THE_CDC6_ORC_ORIGIN_COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
0.0 | 0.6 | REACTOME_IMMUNOREGULATORY_INTERACTIONS_BETWEEN_A_LYMPHOID_AND_A_NON_LYMPHOID_CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.1 | REACTOME_NRIF_SIGNALS_CELL_DEATH_FROM_THE_NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.0 | 2.5 | REACTOME_TRANSLATION | Genes involved in Translation |
0.0 | 0.2 | REACTOME_HYALURONAN_UPTAKE_AND_DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.5 | REACTOME_ACTIVATED_NOTCH1_TRANSMITS_SIGNAL_TO_THE_NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 1.0 | REACTOME_RNA_POL_II_TRANSCRIPTION_PRE_INITIATION_AND_PROMOTER_OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.0 | 2.5 | REACTOME_PEPTIDE_LIGAND_BINDING_RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.6 | REACTOME_ABORTIVE_ELONGATION_OF_HIV1_TRANSCRIPT_IN_THE_ABSENCE_OF_TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.0 | 0.2 | REACTOME_SIGNAL_REGULATORY_PROTEIN_SIRP_FAMILY_INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.3 | REACTOME_GRB2_SOS_PROVIDES_LINKAGE_TO_MAPK_SIGNALING_FOR_INTERGRINS_ | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.0 | 0.6 | REACTOME_ACTIVATION_OF_BH3_ONLY_PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.7 | REACTOME_SYNTHESIS_AND_INTERCONVERSION_OF_NUCLEOTIDE_DI_AND_TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.3 | REACTOME_G0_AND_EARLY_G1 | Genes involved in G0 and Early G1 |
0.0 | 0.7 | REACTOME_ANTIVIRAL_MECHANISM_BY_IFN_STIMULATED_GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 0.6 | REACTOME_METABOLISM_OF_PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 1.0 | REACTOME_LYSOSOME_VESICLE_BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 0.2 | REACTOME_AKT_PHOSPHORYLATES_TARGETS_IN_THE_CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.0 | 0.7 | REACTOME_KINESINS | Genes involved in Kinesins |
0.0 | 0.2 | REACTOME_CD28_DEPENDENT_VAV1_PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.0 | 0.3 | REACTOME_PTM_GAMMA_CARBOXYLATION_HYPUSINE_FORMATION_AND_ARYLSULFATASE_ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.0 | 0.2 | REACTOME_INFLUENZA_VIRAL_RNA_TRANSCRIPTION_AND_REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.6 | REACTOME_SIGNALING_BY_BMP | Genes involved in Signaling by BMP |
0.0 | 0.6 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.7 | REACTOME_PREFOLDIN_MEDIATED_TRANSFER_OF_SUBSTRATE_TO_CCT_TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.7 | REACTOME_TIGHT_JUNCTION_INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.8 | REACTOME_SMAD2_SMAD3_SMAD4_HETEROTRIMER_REGULATES_TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.0 | 0.6 | REACTOME_REGULATION_OF_BETA_CELL_DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.4 | REACTOME_PRE_NOTCH_TRANSCRIPTION_AND_TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.0 | 0.2 | REACTOME_CYTOCHROME_P450_ARRANGED_BY_SUBSTRATE_TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.2 | REACTOME_FGFR4_LIGAND_BINDING_AND_ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.0 | 0.1 | REACTOME_THE_NLRP3_INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.0 | 0.5 | REACTOME_MRNA_SPLICING_MINOR_PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.1 | REACTOME_PECAM1_INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 1.0 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
0.0 | 0.4 | REACTOME_TRNA_AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.0 | 0.2 | REACTOME_FORMATION_OF_INCISION_COMPLEX_IN_GG_NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.3 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.4 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.2 | REACTOME_AMINE_LIGAND_BINDING_RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.2 | REACTOME_ACTIVATION_OF_IRF3_IRF7_MEDIATED_BY_TBK1_IKK_EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.0 | 0.4 | REACTOME_NEGATIVE_REGULATORS_OF_RIG_I_MDA5_SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 0.1 | REACTOME_REGULATION_OF_ORNITHINE_DECARBOXYLASE_ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.1 | REACTOME_METAL_ION_SLC_TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.1 | REACTOME_PHASE1_FUNCTIONALIZATION_OF_COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.0 | 0.3 | REACTOME_AMINO_ACID_SYNTHESIS_AND_INTERCONVERSION_TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.1 | REACTOME_DOWNREGULATION_OF_SMAD2_3_SMAD4_TRANSCRIPTIONAL_ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.0 | REACTOME_APC_C_CDH1_MEDIATED_DEGRADATION_OF_CDC20_AND_OTHER_APC_C_CDH1_TARGETED_PROTEINS_IN_LATE_MITOSIS_EARLY_G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.0 | 0.3 | REACTOME_CASPASE_MEDIATED_CLEAVAGE_OF_CYTOSKELETAL_PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.2 | REACTOME_MITOCHONDRIAL_FATTY_ACID_BETA_OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.2 | REACTOME_RNA_POL_I_TRANSCRIPTION_TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.0 | 0.1 | REACTOME_SIGNALING_BY_NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.1 | REACTOME_EXTRINSIC_PATHWAY_FOR_APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.3 | REACTOME_INSULIN_RECEPTOR_RECYCLING | Genes involved in Insulin receptor recycling |
0.0 | 0.1 | REACTOME_GENERATION_OF_SECOND_MESSENGER_MOLECULES | Genes involved in Generation of second messenger molecules |
0.0 | 0.2 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.2 | REACTOME_EFFECTS_OF_PIP2_HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.1 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PS | Genes involved in Acyl chain remodelling of PS |
0.0 | 0.1 | REACTOME_CYCLIN_E_ASSOCIATED_EVENTS_DURING_G1_S_TRANSITION_ | Genes involved in Cyclin E associated events during G1/S transition |
0.0 | 0.1 | REACTOME_RECRUITMENT_OF_NUMA_TO_MITOTIC_CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.3 | REACTOME_CELL_SURFACE_INTERACTIONS_AT_THE_VASCULAR_WALL | Genes involved in Cell surface interactions at the vascular wall |
0.0 | 0.1 | REACTOME_MEMBRANE_BINDING_AND_TARGETTING_OF_GAG_PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.1 | REACTOME_METABOLISM_OF_POLYAMINES | Genes involved in Metabolism of polyamines |