Motif ID: Figla
Z-value: 0.674

Transcription factors associated with Figla:
Gene Symbol | Entrez ID | Gene Name |
---|---|---|
Figla | ENSMUSG00000030001.3 | Figla |
Top targets:
Gene overrepresentation in biological_process category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.3 | GO:0036292 | DNA rewinding(GO:0036292) |
0.4 | 1.3 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
0.4 | 1.5 | GO:0051311 | spindle assembly involved in female meiosis(GO:0007056) meiotic metaphase plate congression(GO:0051311) |
0.3 | 1.0 | GO:0016332 | establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
0.3 | 0.9 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
0.2 | 1.1 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.2 | 0.9 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.2 | 0.7 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
0.2 | 0.6 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
0.2 | 0.5 | GO:0031660 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
0.2 | 0.6 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.2 | 0.8 | GO:0035063 | nuclear speck organization(GO:0035063) |
0.2 | 0.5 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
0.2 | 0.8 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.1 | 0.4 | GO:2000314 | negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
0.1 | 0.7 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
0.1 | 1.0 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.1 | 0.4 | GO:0060023 | soft palate development(GO:0060023) |
0.1 | 1.9 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.1 | 0.4 | GO:2000564 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) negative regulation of regulatory T cell differentiation(GO:0045590) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
0.1 | 1.7 | GO:0014842 | regulation of skeletal muscle satellite cell proliferation(GO:0014842) |
0.1 | 0.4 | GO:0060032 | notochord regression(GO:0060032) |
0.1 | 0.6 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.5 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.1 | GO:1901630 | negative regulation of presynaptic membrane organization(GO:1901630) |
0.1 | 0.4 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.1 | 0.3 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.1 | GO:0015938 | coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
0.1 | 0.9 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.1 | 0.3 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.1 | 0.2 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
0.1 | 0.8 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.5 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.3 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
0.1 | 0.3 | GO:1990379 | lipid transport across blood brain barrier(GO:1990379) |
0.1 | 0.6 | GO:0030035 | microspike assembly(GO:0030035) |
0.1 | 0.3 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.7 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.1 | 0.6 | GO:0036159 | outer dynein arm assembly(GO:0036158) inner dynein arm assembly(GO:0036159) |
0.1 | 0.3 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.1 | 0.6 | GO:0060539 | diaphragm development(GO:0060539) |
0.1 | 0.5 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.1 | 0.2 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.1 | 0.3 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.3 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.1 | 0.7 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
0.0 | 0.5 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.8 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.7 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.0 | 0.2 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
0.0 | 0.3 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.0 | 0.4 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.0 | 1.5 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.0 | 0.2 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) positive regulation of blood vessel remodeling(GO:2000504) |
0.0 | 0.4 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.3 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.0 | 0.8 | GO:0045780 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
0.0 | 0.3 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.4 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.0 | 0.2 | GO:0070886 | positive regulation of NFAT protein import into nucleus(GO:0051533) positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.1 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
0.0 | 0.3 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.1 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) cellular response to actinomycin D(GO:0072717) |
0.0 | 0.3 | GO:0031639 | plasminogen activation(GO:0031639) |
0.0 | 0.2 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.0 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.0 | 0.3 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.5 | GO:0034142 | toll-like receptor 4 signaling pathway(GO:0034142) |
0.0 | 0.2 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.2 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.0 | 0.2 | GO:0019433 | triglyceride catabolic process(GO:0019433) |
0.0 | 0.1 | GO:0035574 | histone H4-K20 demethylation(GO:0035574) |
0.0 | 0.2 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.4 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.0 | 0.0 | GO:0006116 | NADH oxidation(GO:0006116) glycerol-3-phosphate catabolic process(GO:0046168) |
0.0 | 2.2 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
0.0 | 0.5 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
0.0 | 0.1 | GO:0072235 | distal convoluted tubule development(GO:0072025) metanephric collecting duct development(GO:0072205) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) |
0.0 | 0.8 | GO:0048747 | muscle fiber development(GO:0048747) |
0.0 | 0.4 | GO:0046677 | response to antibiotic(GO:0046677) |
0.0 | 0.0 | GO:0036337 | Fas signaling pathway(GO:0036337) |
0.0 | 0.4 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.2 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.2 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
0.0 | 0.9 | GO:0007043 | cell-cell junction assembly(GO:0007043) |
0.0 | 0.7 | GO:0051489 | regulation of filopodium assembly(GO:0051489) |
0.0 | 0.2 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.0 | 0.3 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.0 | 0.0 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) |
0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.0 | 0.4 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.1 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.0 | 0.0 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
Gene overrepresentation in cellular_component category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.7 | GO:1990423 | RZZ complex(GO:1990423) |
0.2 | 0.8 | GO:0008537 | proteasome activator complex(GO:0008537) |
0.2 | 1.3 | GO:0042627 | chylomicron(GO:0042627) |
0.2 | 1.5 | GO:0072687 | meiotic spindle(GO:0072687) |
0.2 | 0.5 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.2 | 1.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.2 | 0.6 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.1 | 0.5 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.1 | 0.6 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.5 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.3 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
0.1 | 0.3 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.1 | 0.6 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 0.5 | GO:0045179 | apical cortex(GO:0045179) |
0.1 | 1.5 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 0.2 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
0.1 | 0.4 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.2 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.0 | 0.3 | GO:0044305 | calyx of Held(GO:0044305) |
0.0 | 0.3 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.6 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
0.0 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
0.0 | 0.4 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.4 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.1 | GO:0031251 | PAN complex(GO:0031251) |
0.0 | 1.3 | GO:0043596 | nuclear replication fork(GO:0043596) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.8 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.4 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.1 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.0 | 2.0 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 0.6 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.8 | GO:0030673 | axolemma(GO:0030673) |
0.0 | 0.3 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.9 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 1.0 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.3 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.7 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.8 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
Gene overrepresentation in molecular_function category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.9 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.3 | 0.9 | GO:0070052 | collagen V binding(GO:0070052) |
0.2 | 0.6 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.5 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
0.1 | 0.5 | GO:0050436 | microfibril binding(GO:0050436) |
0.1 | 0.7 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
0.1 | 0.6 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.1 | 1.3 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.1 | 0.8 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.1 | 0.3 | GO:0001565 | phorbol ester receptor activity(GO:0001565) non-kinase phorbol ester receptor activity(GO:0001566) |
0.1 | 1.4 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.1 | 0.3 | GO:0004473 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
0.1 | 0.3 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.1 | 0.8 | GO:0016004 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
0.1 | 0.8 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.2 | GO:0005171 | hepatocyte growth factor receptor binding(GO:0005171) |
0.1 | 0.1 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
0.1 | 0.3 | GO:0070404 | NADH binding(GO:0070404) |
0.1 | 0.3 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.1 | 0.5 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.2 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
0.1 | 0.2 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.0 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.4 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.0 | 0.6 | GO:0015197 | peptide transporter activity(GO:0015197) |
0.0 | 0.4 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
0.0 | 1.1 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.9 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.5 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.1 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
0.0 | 0.2 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.7 | GO:0030506 | ankyrin binding(GO:0030506) |
0.0 | 0.3 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.0 | 0.7 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
0.0 | 1.1 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 0.5 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.0 | 0.3 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 1.2 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.6 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.0 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.1 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
0.0 | 0.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.3 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.2 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.0 | 0.0 | GO:0016901 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.0 | 0.3 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.2 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.0 | 0.2 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.1 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
0.0 | 0.3 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.7 | GO:0008146 | sulfotransferase activity(GO:0008146) |
0.0 | 0.4 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.7 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 0.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.6 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.4 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
0.0 | 0.3 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.7 | GO:0020037 | heme binding(GO:0020037) |
0.0 | 0.7 | GO:0004879 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
0.0 | 0.5 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.4 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
Gene overrepresentation in C2:CP category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.3 | SA_REG_CASCADE_OF_CYCLIN_EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 1.7 | PID_AURORA_B_PATHWAY | Aurora B signaling |
0.0 | 0.6 | PID_RANBP2_PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 1.3 | PID_HNF3B_PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.9 | PID_GLYPICAN_1PATHWAY | Glypican 1 network |
0.0 | 1.0 | NABA_COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.5 | PID_FOXM1_PATHWAY | FOXM1 transcription factor network |
0.0 | 0.4 | PID_IL12_STAT4_PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 0.4 | PID_HEDGEHOG_2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.5 | PID_MYC_PATHWAY | C-MYC pathway |
0.0 | 0.2 | PID_P38_ALPHA_BETA_DOWNSTREAM_PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.1 | PID_RHODOPSIN_PATHWAY | Visual signal transduction: Rods |
0.0 | 0.6 | SIG_INSULIN_RECEPTOR_PATHWAY_IN_CARDIAC_MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 1.2 | PID_P53_DOWNSTREAM_PATHWAY | Direct p53 effectors |
Gene overrepresentation in C2:CP:REACTOME category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 2.0 | REACTOME_PHOSPHORYLATION_OF_THE_APC_C | Genes involved in Phosphorylation of the APC/C |
0.1 | 1.6 | REACTOME_TIGHT_JUNCTION_INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.8 | REACTOME_PRE_NOTCH_PROCESSING_IN_GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.5 | REACTOME_DEGRADATION_OF_THE_EXTRACELLULAR_MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 1.3 | REACTOME_PRE_NOTCH_TRANSCRIPTION_AND_TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.0 | 0.9 | REACTOME_HS_GAG_DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.7 | REACTOME_METABOLISM_OF_PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 1.1 | REACTOME_ACTIVATED_NOTCH1_TRANSMITS_SIGNAL_TO_THE_NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 0.7 | REACTOME_CELL_EXTRACELLULAR_MATRIX_INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.4 | REACTOME_UNWINDING_OF_DNA | Genes involved in Unwinding of DNA |
0.0 | 0.1 | REACTOME_OLFACTORY_SIGNALING_PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.0 | 0.3 | REACTOME_GAP_JUNCTION_ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.4 | REACTOME_TRAF6_MEDIATED_IRF7_ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.0 | 0.1 | REACTOME_PRESYNAPTIC_NICOTINIC_ACETYLCHOLINE_RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.0 | 0.1 | REACTOME_INHIBITION_OF_INSULIN_SECRETION_BY_ADRENALINE_NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 1.0 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
0.0 | 0.6 | REACTOME_SMOOTH_MUSCLE_CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.5 | REACTOME_REGULATION_OF_WATER_BALANCE_BY_RENAL_AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 1.1 | REACTOME_CLASS_B_2_SECRETIN_FAMILY_RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.3 | REACTOME_RNA_POL_III_CHAIN_ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.0 | 0.3 | REACTOME_CHOLESTEROL_BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.6 | REACTOME_TRANSCRIPTIONAL_ACTIVITY_OF_SMAD2_SMAD3_SMAD4_HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.0 | 1.2 | REACTOME_MITOTIC_PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.0 | 0.7 | REACTOME_NUCLEAR_RECEPTOR_TRANSCRIPTION_PATHWAY | Genes involved in Nuclear Receptor transcription pathway |