Motif ID: Rad21_Smc3
Z-value: 0.820


Transcription factors associated with Rad21_Smc3:
Gene Symbol | Entrez ID | Gene Name |
---|---|---|
Rad21 | ENSMUSG00000022314.9 | Rad21 |
Smc3 | ENSMUSG00000024974.10 | Smc3 |
Activity-expression correlation:
Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Rad21 | mm10_v2_chr15_-_51991679_51991760 | -0.37 | 1.3e-01 | Click! |
Smc3 | mm10_v2_chr19_+_53600377_53600435 | -0.06 | 8.2e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 3.9 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
1.1 | 3.2 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.8 | 2.5 | GO:0060598 | dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
0.7 | 2.1 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
0.7 | 4.0 | GO:0032439 | endosome localization(GO:0032439) |
0.7 | 3.3 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.7 | 2.0 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) regulation of G-protein coupled receptor internalization(GO:1904020) |
0.6 | 2.5 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
0.6 | 2.4 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.6 | 1.7 | GO:0098706 | ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
0.6 | 1.1 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.6 | 1.7 | GO:0009814 | defense response, incompatible interaction(GO:0009814) |
0.5 | 1.6 | GO:1902071 | positive regulation of cellular response to hypoxia(GO:1900039) regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.5 | 2.4 | GO:0019236 | response to pheromone(GO:0019236) |
0.4 | 1.3 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.4 | 1.3 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.4 | 1.2 | GO:0072382 | minus-end-directed vesicle transport along microtubule(GO:0072382) |
0.4 | 1.2 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) |
0.4 | 1.2 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.4 | 2.2 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.4 | 1.4 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.4 | 1.4 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
0.3 | 1.0 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
0.3 | 1.7 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.3 | 1.0 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.3 | 1.3 | GO:0009204 | pyrimidine nucleotide catabolic process(GO:0006244) deoxyribonucleoside triphosphate catabolic process(GO:0009204) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.3 | 1.0 | GO:2000314 | negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
0.3 | 0.9 | GO:2000510 | regulation of MDA-5 signaling pathway(GO:0039533) positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.3 | 2.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.3 | 0.9 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.3 | 1.1 | GO:0002188 | translation reinitiation(GO:0002188) |
0.3 | 0.8 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
0.3 | 0.8 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.3 | 2.4 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) positive regulation of interferon-gamma secretion(GO:1902715) |
0.3 | 0.8 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) vein smooth muscle contraction(GO:0014826) |
0.3 | 0.8 | GO:0035799 | ureter maturation(GO:0035799) |
0.2 | 1.5 | GO:0046645 | positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
0.2 | 1.0 | GO:0010957 | negative regulation of vitamin D biosynthetic process(GO:0010957) negative regulation of vitamin metabolic process(GO:0046137) |
0.2 | 0.7 | GO:0032240 | RNA import into nucleus(GO:0006404) mRNA export from nucleus in response to heat stress(GO:0031990) negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
0.2 | 0.5 | GO:0042097 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
0.2 | 1.1 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
0.2 | 1.3 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.2 | 1.0 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) positive regulation of NAD(P)H oxidase activity(GO:0033864) positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.2 | 1.1 | GO:0032202 | telomere assembly(GO:0032202) |
0.2 | 1.1 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.2 | 1.3 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.2 | 0.5 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.2 | 0.5 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
0.1 | 0.4 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.7 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.1 | 0.6 | GO:0060709 | glycogen cell differentiation involved in embryonic placenta development(GO:0060709) |
0.1 | 1.0 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 0.7 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.7 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
0.1 | 1.7 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
0.1 | 1.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.1 | 0.7 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.1 | 0.5 | GO:1904729 | regulation of intestinal lipid absorption(GO:1904729) |
0.1 | 0.4 | GO:0021759 | globus pallidus development(GO:0021759) |
0.1 | 0.5 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.1 | 0.4 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 0.8 | GO:0000050 | urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
0.1 | 1.5 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.1 | 0.8 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.1 | 0.7 | GO:0001980 | regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
0.1 | 0.4 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.1 | 1.1 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.1 | 0.6 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.1 | 0.6 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.1 | 0.4 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.1 | 1.3 | GO:0001779 | natural killer cell differentiation(GO:0001779) |
0.1 | 1.4 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 0.6 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 1.1 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.1 | 0.8 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.1 | 0.4 | GO:0060431 | primary lung bud formation(GO:0060431) |
0.1 | 0.3 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.1 | 0.5 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
0.1 | 0.3 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.1 | 0.4 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.1 | 0.3 | GO:0006011 | UDP-glucose metabolic process(GO:0006011) |
0.1 | 0.4 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.1 | 1.5 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.1 | 0.2 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
0.1 | 0.4 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.1 | 0.4 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
0.1 | 0.4 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.1 | 0.6 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.1 | 0.9 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.1 | 0.5 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
0.1 | 0.2 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.1 | 0.9 | GO:0001711 | endodermal cell fate commitment(GO:0001711) |
0.1 | 2.4 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
0.1 | 0.3 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
0.1 | 0.5 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.1 | 3.2 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.1 | 0.9 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.1 | 0.4 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) regulation of interleukin-6 biosynthetic process(GO:0045408) |
0.1 | 0.6 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.1 | 0.2 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.1 | 0.2 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.1 | 0.7 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
0.0 | 0.2 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.0 | 0.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.1 | GO:0048069 | eye pigmentation(GO:0048069) |
0.0 | 0.6 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.2 | GO:0002667 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) negative regulation of protein kinase C signaling(GO:0090038) |
0.0 | 0.6 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.2 | GO:0031161 | phosphatidylinositol catabolic process(GO:0031161) |
0.0 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.0 | 0.4 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.5 | GO:0019985 | translesion synthesis(GO:0019985) |
0.0 | 0.6 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.0 | 0.6 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
0.0 | 1.6 | GO:0014009 | glial cell proliferation(GO:0014009) |
0.0 | 1.3 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.6 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.5 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.2 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.3 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 1.1 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.0 | 0.7 | GO:0033273 | response to vitamin(GO:0033273) |
0.0 | 0.2 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.0 | 0.1 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 1.7 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
0.0 | 0.1 | GO:0098543 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
0.0 | 1.2 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.2 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 1.1 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
0.0 | 0.8 | GO:0014002 | astrocyte development(GO:0014002) |
0.0 | 0.2 | GO:0072086 | specification of loop of Henle identity(GO:0072086) |
0.0 | 0.7 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.0 | 0.2 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 1.6 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.1 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
0.0 | 0.1 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
0.0 | 1.1 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.0 | 0.2 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.4 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 1.0 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
0.0 | 0.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.5 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
0.0 | 0.2 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.0 | 0.3 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.0 | 1.4 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.0 | 0.5 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
0.0 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.6 | GO:1903846 | positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
0.0 | 0.2 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.0 | 0.5 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.0 | 1.2 | GO:0034394 | protein localization to cell surface(GO:0034394) |
0.0 | 0.1 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 0.5 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.2 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.0 | 0.1 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
0.0 | 0.2 | GO:0060416 | response to growth hormone(GO:0060416) |
0.0 | 0.1 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.0 | 0.1 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.0 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.0 | 0.2 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
0.0 | 0.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.0 | 0.6 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
0.0 | 0.1 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.0 | 0.2 | GO:0043252 | prostaglandin transport(GO:0015732) sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.0 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
0.0 | 0.2 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
0.0 | 0.6 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
0.0 | 0.0 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.1 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.0 | 0.2 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
0.0 | 0.1 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.2 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.0 | 0.4 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
0.0 | 0.1 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
Gene overrepresentation in cellular_component category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 4.9 | GO:0045179 | apical cortex(GO:0045179) |
0.5 | 1.4 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.4 | 1.2 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.4 | 1.1 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
0.2 | 1.0 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.2 | 1.3 | GO:0097452 | GAIT complex(GO:0097452) |
0.2 | 1.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.2 | 1.9 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.2 | 2.2 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.2 | 0.7 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
0.2 | 1.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.2 | 4.0 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.2 | 0.8 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 1.3 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.1 | 2.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 0.9 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.5 | GO:0030677 | ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.1 | 0.3 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
0.1 | 0.7 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 1.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.9 | GO:0005687 | U4 snRNP(GO:0005687) |
0.1 | 0.7 | GO:0002177 | manchette(GO:0002177) |
0.1 | 0.7 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 0.3 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 5.0 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.1 | 1.7 | GO:0000242 | pericentriolar material(GO:0000242) |
0.1 | 3.8 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.1 | 0.7 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 1.0 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 1.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.3 | GO:1990131 | Iml1 complex(GO:1990130) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.1 | 0.7 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 0.8 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.1 | 1.2 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.1 | 0.2 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.1 | 0.4 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.1 | 1.4 | GO:0005921 | gap junction(GO:0005921) |
0.1 | 0.3 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 0.3 | GO:0070847 | core mediator complex(GO:0070847) |
0.1 | 0.9 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.1 | 0.4 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 0.5 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.1 | 0.5 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 3.4 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.0 | 3.2 | GO:0005844 | polysome(GO:0005844) |
0.0 | 0.6 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 1.1 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.3 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.4 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.7 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
0.0 | 0.4 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.2 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 1.7 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.5 | GO:0005652 | nuclear lamina(GO:0005652) |
0.0 | 0.2 | GO:0097361 | CIA complex(GO:0097361) |
0.0 | 2.3 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 2.2 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 0.2 | GO:0070187 | telosome(GO:0070187) |
0.0 | 0.6 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.3 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.7 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 1.2 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 2.0 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 0.4 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.9 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.3 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 4.6 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 1.8 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
0.0 | 0.6 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 2.0 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.6 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.4 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.5 | GO:0045178 | basal part of cell(GO:0045178) |
0.0 | 0.6 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.1 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
0.0 | 0.0 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.7 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.2 | GO:1990635 | proximal dendrite(GO:1990635) |
0.0 | 0.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.3 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.4 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.1 | GO:0005883 | neurofilament(GO:0005883) |
0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
Gene overrepresentation in molecular_function category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 3.9 | GO:0004454 | ketohexokinase activity(GO:0004454) |
0.6 | 1.7 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.5 | 2.5 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.5 | 2.0 | GO:0031687 | A2A adenosine receptor binding(GO:0031687) |
0.4 | 2.4 | GO:0043199 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) sulfate binding(GO:0043199) |
0.3 | 1.3 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.3 | 2.5 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.3 | 1.3 | GO:0004921 | interleukin-11 receptor activity(GO:0004921) interleukin-11 binding(GO:0019970) |
0.3 | 1.5 | GO:0042610 | CD8 receptor binding(GO:0042610) |
0.3 | 2.1 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
0.3 | 1.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.3 | 0.8 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.3 | 2.8 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.2 | 1.0 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.2 | 0.7 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.2 | 0.7 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
0.2 | 0.9 | GO:0030984 | kininogen binding(GO:0030984) |
0.2 | 0.7 | GO:0030172 | troponin C binding(GO:0030172) |
0.2 | 0.6 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.2 | 0.8 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.2 | 6.2 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.2 | 1.4 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.2 | 3.2 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.2 | 0.7 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.2 | 0.7 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.2 | 0.5 | GO:0098973 | structural constituent of synapse(GO:0098918) structural constituent of postsynaptic actin cytoskeleton(GO:0098973) |
0.2 | 0.8 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.2 | 0.8 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.2 | 1.7 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.1 | 0.9 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.1 | 0.9 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
0.1 | 0.6 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.7 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 1.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 0.5 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.1 | 0.4 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
0.1 | 0.6 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.1 | 0.3 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
0.1 | 0.6 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.1 | 2.5 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.1 | 0.6 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 2.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.1 | 0.9 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.1 | 0.4 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.1 | 1.2 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.1 | 1.2 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
0.1 | 1.4 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.1 | 1.0 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 0.4 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.5 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.1 | 1.1 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.1 | 0.5 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.6 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 10.6 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 0.4 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.1 | 2.2 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.1 | 0.5 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.9 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.1 | 0.3 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.2 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
0.1 | 0.4 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.8 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.0 | 1.5 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.0 | 0.6 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.0 | 0.1 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 0.7 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.3 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.8 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.2 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.0 | 0.7 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.9 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.8 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 0.4 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 4.1 | GO:0003774 | motor activity(GO:0003774) |
0.0 | 0.1 | GO:0004492 | methylmalonyl-CoA decarboxylase activity(GO:0004492) |
0.0 | 0.4 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.0 | 0.2 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 1.0 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.7 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 2.1 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.0 | 0.2 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 5.8 | GO:0001047 | core promoter binding(GO:0001047) |
0.0 | 0.4 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.2 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 0.5 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.0 | 0.2 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.0 | 0.1 | GO:0008607 | cAMP-dependent protein kinase regulator activity(GO:0008603) phosphorylase kinase regulator activity(GO:0008607) |
0.0 | 0.3 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.0 | 0.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 1.6 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.3 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 1.1 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.0 | 0.9 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 2.4 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.1 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
0.0 | 0.1 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.0 | 0.5 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 1.6 | GO:0019888 | protein phosphatase regulator activity(GO:0019888) |
0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.5 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
0.0 | 0.6 | GO:0004407 | histone deacetylase activity(GO:0004407) |
0.0 | 0.2 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
0.0 | 0.4 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.6 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 0.0 | GO:0035651 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
0.0 | 1.4 | GO:0016616 | oxidoreductase activity, acting on the CH-OH group of donors, NAD or NADP as acceptor(GO:0016616) |
0.0 | 0.4 | GO:0098631 | protein binding involved in cell adhesion(GO:0098631) protein binding involved in cell-cell adhesion(GO:0098632) |
0.0 | 0.9 | GO:0008186 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 0.6 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.6 | GO:0016876 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.0 | 0.8 | GO:0016835 | carbon-oxygen lyase activity(GO:0016835) |
0.0 | 0.1 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.0 | 0.4 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.5 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.3 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.0 | GO:0070573 | tripeptidyl-peptidase activity(GO:0008240) metallodipeptidase activity(GO:0070573) |
Gene overrepresentation in C2:CP category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 5.2 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
0.2 | 1.4 | ST_TYPE_I_INTERFERON_PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.1 | 0.7 | SA_MMP_CYTOKINE_CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.1 | 1.3 | PID_INTEGRIN_CS_PATHWAY | Integrin family cell surface interactions |
0.1 | 3.1 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.1 | 1.4 | PID_PRL_SIGNALING_EVENTS_PATHWAY | Signaling events mediated by PRL |
0.1 | 1.5 | PID_NFKAPPAB_ATYPICAL_PATHWAY | Atypical NF-kappaB pathway |
0.1 | 2.4 | NABA_COLLAGENS | Genes encoding collagen proteins |
0.0 | 2.2 | SIG_REGULATION_OF_THE_ACTIN_CYTOSKELETON_BY_RHO_GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 2.1 | PID_RAS_PATHWAY | Regulation of Ras family activation |
0.0 | 0.8 | PID_INTEGRIN_A9B1_PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 1.4 | PID_HNF3B_PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.8 | PID_PDGFRA_PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.4 | PID_ANTHRAX_PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 1.8 | PID_ILK_PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.8 | SIG_IL4RECEPTOR_IN_B_LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 1.3 | PID_NFAT_TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 2.1 | PID_P53_REGULATION_PATHWAY | p53 pathway |
0.0 | 0.5 | PID_INSULIN_GLUCOSE_PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.8 | PID_ENDOTHELIN_PATHWAY | Endothelins |
0.0 | 0.8 | PID_FAK_PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.2 | PID_IL5_PATHWAY | IL5-mediated signaling events |
0.0 | 0.4 | ST_B_CELL_ANTIGEN_RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.6 | PID_AURORA_A_PATHWAY | Aurora A signaling |
0.0 | 1.1 | PID_PLK1_PATHWAY | PLK1 signaling events |
0.0 | 0.8 | PID_E2F_PATHWAY | E2F transcription factor network |
0.0 | 0.5 | PID_DELTA_NP63_PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 1.4 | WNT_SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.9 | PID_MYC_REPRESS_PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.3 | SIG_CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.1 | PID_SYNDECAN_1_PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.5 | PID_FANCONI_PATHWAY | Fanconi anemia pathway |
0.0 | 0.5 | PID_RAC1_PATHWAY | RAC1 signaling pathway |
Gene overrepresentation in C2:CP:REACTOME category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.5 | REACTOME_TRANSLOCATION_OF_ZAP_70_TO_IMMUNOLOGICAL_SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.2 | 3.2 | REACTOME_AMINE_COMPOUND_SLC_TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.1 | 2.7 | REACTOME_TETRAHYDROBIOPTERIN_BH4_SYNTHESIS_RECYCLING_SALVAGE_AND_REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 0.3 | REACTOME_PHOSPHORYLATION_OF_CD3_AND_TCR_ZETA_CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.1 | 6.4 | REACTOME_REGULATION_OF_WATER_BALANCE_BY_RENAL_AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.1 | 0.9 | REACTOME_INTRINSIC_PATHWAY | Genes involved in Intrinsic Pathway |
0.1 | 9.8 | REACTOME_PEPTIDE_CHAIN_ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 0.2 | REACTOME_G_BETA_GAMMA_SIGNALLING_THROUGH_PLC_BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.1 | 0.8 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PS | Genes involved in Acyl chain remodelling of PS |
0.1 | 0.8 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 4.1 | REACTOME_VIF_MEDIATED_DEGRADATION_OF_APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.1 | 1.0 | REACTOME_ROLE_OF_DCC_IN_REGULATING_APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 1.8 | REACTOME_ENDOSOMAL_SORTING_COMPLEX_REQUIRED_FOR_TRANSPORT_ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.1 | 1.8 | REACTOME_RAP1_SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 1.8 | REACTOME_EXTENSION_OF_TELOMERES | Genes involved in Extension of Telomeres |
0.1 | 0.3 | REACTOME_INHIBITION_OF_REPLICATION_INITIATION_OF_DAMAGED_DNA_BY_RB1_E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 1.5 | REACTOME_SEMA4D_INDUCED_CELL_MIGRATION_AND_GROWTH_CONE_COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 2.4 | REACTOME_HOST_INTERACTIONS_OF_HIV_FACTORS | Genes involved in Host Interactions of HIV factors |
0.0 | 0.8 | REACTOME_G1_S_SPECIFIC_TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.0 | 0.2 | REACTOME_TELOMERE_MAINTENANCE | Genes involved in Telomere Maintenance |
0.0 | 1.1 | REACTOME_LATENT_INFECTION_OF_HOMO_SAPIENS_WITH_MYCOBACTERIUM_TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 2.3 | REACTOME_METABOLISM_OF_NON_CODING_RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.4 | REACTOME_TRANSCRIPTIONAL_REGULATION_OF_WHITE_ADIPOCYTE_DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 2.0 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 2.3 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
0.0 | 0.7 | REACTOME_TGF_BETA_RECEPTOR_SIGNALING_IN_EMT_EPITHELIAL_TO_MESENCHYMAL_TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.5 | REACTOME_FORMATION_OF_THE_TERNARY_COMPLEX_AND_SUBSEQUENTLY_THE_43S_COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.6 | REACTOME_MITOCHONDRIAL_TRNA_AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 1.2 | REACTOME_VOLTAGE_GATED_POTASSIUM_CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 1.9 | REACTOME_MEIOTIC_RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 1.9 | REACTOME_RESPIRATORY_ELECTRON_TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.2 | REACTOME_TRANSPORT_OF_ORGANIC_ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.9 | REACTOME_PREFOLDIN_MEDIATED_TRANSFER_OF_SUBSTRATE_TO_CCT_TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.4 | REACTOME_ACTIVATION_OF_BH3_ONLY_PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.7 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.3 | REACTOME_IMMUNOREGULATORY_INTERACTIONS_BETWEEN_A_LYMPHOID_AND_A_NON_LYMPHOID_CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 1.4 | REACTOME_INTEGRIN_CELL_SURFACE_INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.1 | REACTOME_P53_DEPENDENT_G1_DNA_DAMAGE_RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.0 | 0.2 | REACTOME_NEGATIVE_REGULATION_OF_THE_PI3K_AKT_NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.4 | REACTOME_CHONDROITIN_SULFATE_BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.3 | REACTOME_SULFUR_AMINO_ACID_METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.4 | REACTOME_G1_PHASE | Genes involved in G1 Phase |
0.0 | 0.1 | REACTOME_ETHANOL_OXIDATION | Genes involved in Ethanol oxidation |
0.0 | 0.1 | REACTOME_SYNTHESIS_OF_BILE_ACIDS_AND_BILE_SALTS_VIA_24_HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 1.3 | REACTOME_MRNA_SPLICING | Genes involved in mRNA Splicing |