Motif ID: Hnf4g
Z-value: 1.326

Transcription factors associated with Hnf4g:
Gene Symbol | Entrez ID | Gene Name |
---|---|---|
Hnf4g | ENSMUSG00000017688.8 | Hnf4g |
Top targets:
Gene overrepresentation in biological_process category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.6 | 10.6 | GO:2000974 | negative regulation of pro-B cell differentiation(GO:2000974) |
1.5 | 7.4 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
1.5 | 4.4 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
1.4 | 4.3 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
1.3 | 6.5 | GO:2000065 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
1.3 | 8.9 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
1.2 | 3.7 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
1.2 | 3.6 | GO:0019343 | cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
1.1 | 3.3 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
1.1 | 3.2 | GO:0002447 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) regulation of eosinophil activation(GO:1902566) |
1.1 | 3.2 | GO:0006553 | lysine metabolic process(GO:0006553) |
1.0 | 3.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
1.0 | 3.9 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
0.9 | 3.6 | GO:0051933 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
0.9 | 2.6 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
0.8 | 5.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.8 | 0.8 | GO:0036482 | neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
0.8 | 3.0 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.7 | 3.0 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.7 | 2.1 | GO:0071649 | regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
0.7 | 3.5 | GO:0021905 | pancreatic A cell development(GO:0003322) forebrain-midbrain boundary formation(GO:0021905) somatic motor neuron fate commitment(GO:0021917) regulation of transcription from RNA polymerase II promoter involved in somatic motor neuron fate commitment(GO:0021918) sensory neuron migration(GO:1904937) |
0.7 | 2.1 | GO:1904139 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.7 | 3.5 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.7 | 0.7 | GO:1990379 | lipid transport across blood brain barrier(GO:1990379) |
0.7 | 4.1 | GO:0032196 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) transposition(GO:0032196) |
0.7 | 2.1 | GO:0042196 | dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
0.6 | 0.6 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.6 | 1.9 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.6 | 6.9 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.6 | 2.5 | GO:1904565 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
0.6 | 2.4 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.6 | 2.4 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
0.6 | 2.9 | GO:0032902 | nerve growth factor production(GO:0032902) |
0.6 | 2.9 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.5 | 2.7 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.5 | 1.6 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
0.5 | 2.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.5 | 2.6 | GO:1900170 | negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
0.5 | 1.5 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.5 | 1.5 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.5 | 5.6 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.5 | 1.5 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.5 | 1.4 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.5 | 1.4 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.5 | 4.7 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.5 | 2.8 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.5 | 1.8 | GO:0051316 | attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
0.4 | 1.8 | GO:2000256 | positive regulation of male germ cell proliferation(GO:2000256) |
0.4 | 0.9 | GO:0014891 | striated muscle atrophy(GO:0014891) |
0.4 | 2.2 | GO:0019659 | fermentation(GO:0006113) lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.4 | 1.7 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.4 | 1.3 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.4 | 3.9 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.4 | 2.1 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
0.4 | 1.2 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.4 | 3.3 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.4 | 2.0 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
0.4 | 4.1 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.4 | 0.8 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.4 | 2.4 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.4 | 2.3 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.4 | 6.5 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.4 | 1.1 | GO:0042823 | pyridoxal phosphate biosynthetic process(GO:0042823) |
0.4 | 1.1 | GO:0045006 | DNA deamination(GO:0045006) |
0.4 | 2.2 | GO:0097646 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
0.4 | 2.2 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.4 | 1.4 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.4 | 1.4 | GO:0015744 | succinate transport(GO:0015744) |
0.3 | 1.7 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.3 | 2.0 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.3 | 1.6 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.3 | 3.8 | GO:0009437 | amino-acid betaine metabolic process(GO:0006577) carnitine metabolic process(GO:0009437) |
0.3 | 1.2 | GO:0030091 | protein repair(GO:0030091) |
0.3 | 0.9 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
0.3 | 0.9 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
0.3 | 2.4 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.3 | 4.1 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.3 | 0.9 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
0.3 | 2.0 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
0.3 | 1.4 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.3 | 0.9 | GO:0009174 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.3 | 0.3 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) |
0.3 | 3.4 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.3 | 0.8 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
0.3 | 1.7 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.3 | 0.3 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.3 | 0.8 | GO:0045004 | DNA replication proofreading(GO:0045004) |
0.3 | 0.5 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.3 | 1.3 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.3 | 0.5 | GO:0006108 | malate metabolic process(GO:0006108) |
0.3 | 2.9 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.3 | 0.8 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.3 | 1.5 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.2 | 1.2 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.2 | 1.5 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
0.2 | 1.5 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.2 | 0.7 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.2 | 0.7 | GO:0060217 | hemangioblast cell differentiation(GO:0060217) |
0.2 | 0.7 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
0.2 | 1.0 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.2 | 0.7 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
0.2 | 3.5 | GO:0032060 | bleb assembly(GO:0032060) |
0.2 | 0.2 | GO:0060854 | patterning of lymph vessels(GO:0060854) |
0.2 | 0.7 | GO:0060489 | orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
0.2 | 0.7 | GO:0002489 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway(GO:0002488) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway, TAP-dependent(GO:0002489) |
0.2 | 0.7 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
0.2 | 7.9 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
0.2 | 4.1 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.2 | 2.0 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.2 | 5.3 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.2 | 2.7 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.2 | 1.8 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.2 | 1.9 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.2 | 0.4 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
0.2 | 0.4 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.2 | 0.6 | GO:0021998 | neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) positive regulation of cardiac ventricle development(GO:1904414) |
0.2 | 1.1 | GO:0032298 | positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
0.2 | 1.1 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.2 | 0.8 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.2 | 0.6 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.2 | 0.4 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.2 | 0.8 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.2 | 1.2 | GO:1901550 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.2 | 0.6 | GO:0021546 | rhombomere development(GO:0021546) |
0.2 | 0.6 | GO:0007521 | regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003256) muscle cell fate determination(GO:0007521) mammary placode formation(GO:0060596) |
0.2 | 1.8 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.2 | 1.2 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.2 | 1.2 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.2 | 1.4 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.2 | 0.6 | GO:0048698 | negative regulation of collateral sprouting in absence of injury(GO:0048698) |
0.2 | 1.0 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.2 | 1.3 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.2 | 1.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.2 | 0.7 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
0.2 | 0.2 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.2 | 1.3 | GO:0015862 | uridine transport(GO:0015862) |
0.2 | 0.9 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
0.2 | 0.5 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
0.2 | 0.5 | GO:0070602 | regulation of chondrocyte development(GO:0061181) regulation of centromeric sister chromatid cohesion(GO:0070602) |
0.2 | 0.9 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.2 | 0.5 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
0.2 | 0.9 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.2 | 1.7 | GO:0032776 | DNA methylation on cytosine(GO:0032776) |
0.2 | 0.5 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
0.2 | 0.5 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.2 | 1.0 | GO:0070989 | oxidative demethylation(GO:0070989) |
0.2 | 1.9 | GO:0060539 | diaphragm development(GO:0060539) |
0.2 | 0.7 | GO:0015825 | L-serine transport(GO:0015825) |
0.2 | 1.2 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.2 | 0.7 | GO:0030252 | growth hormone secretion(GO:0030252) |
0.2 | 0.5 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.2 | 0.5 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
0.2 | 1.1 | GO:0051958 | methotrexate transport(GO:0051958) |
0.2 | 0.5 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
0.2 | 0.5 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.2 | 0.6 | GO:0019530 | taurine metabolic process(GO:0019530) |
0.2 | 1.7 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.2 | 0.2 | GO:0008272 | sulfate transport(GO:0008272) |
0.2 | 1.5 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.1 | 0.4 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
0.1 | 0.6 | GO:1900864 | positive regulation of translational fidelity(GO:0045903) mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.1 | 0.4 | GO:0035604 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) coronal suture morphogenesis(GO:0060365) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) |
0.1 | 0.3 | GO:0072683 | T cell extravasation(GO:0072683) |
0.1 | 3.0 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
0.1 | 1.0 | GO:0007144 | female meiosis I(GO:0007144) |
0.1 | 0.6 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
0.1 | 0.4 | GO:0099548 | drug catabolic process(GO:0042737) exogenous drug catabolic process(GO:0042738) retrograde trans-synaptic signaling by soluble gas(GO:0098923) trans-synaptic signaling by nitric oxide(GO:0099548) |
0.1 | 3.9 | GO:0003416 | endochondral bone growth(GO:0003416) |
0.1 | 1.1 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.1 | 0.7 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.8 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.4 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
0.1 | 0.4 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.1 | 0.8 | GO:1901911 | diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
0.1 | 0.5 | GO:0032053 | ciliary basal body organization(GO:0032053) |
0.1 | 0.4 | GO:0015938 | coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
0.1 | 0.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.1 | 0.4 | GO:0007619 | courtship behavior(GO:0007619) |
0.1 | 0.1 | GO:2000977 | regulation of forebrain neuron differentiation(GO:2000977) |
0.1 | 2.1 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
0.1 | 1.6 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.1 | 0.3 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.1 | 0.4 | GO:0010814 | neuropeptide catabolic process(GO:0010813) substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
0.1 | 0.8 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.1 | 1.5 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.1 | 3.2 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
0.1 | 1.0 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.1 | 0.5 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.1 | 1.1 | GO:0006560 | proline metabolic process(GO:0006560) |
0.1 | 0.5 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
0.1 | 0.6 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
0.1 | 2.6 | GO:0014898 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle hypertrophy in response to stress(GO:0014898) |
0.1 | 1.0 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
0.1 | 1.0 | GO:0042167 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 0.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.1 | 0.4 | GO:0046544 | positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) development of secondary male sexual characteristics(GO:0046544) |
0.1 | 0.5 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.1 | 0.8 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.1 | 0.5 | GO:0002086 | diaphragm contraction(GO:0002086) |
0.1 | 3.1 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.1 | 0.4 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.1 | 0.2 | GO:0000448 | cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
0.1 | 0.5 | GO:1900364 | negative regulation of mRNA 3'-end processing(GO:0031441) regulation of mRNA polyadenylation(GO:1900363) negative regulation of mRNA polyadenylation(GO:1900364) |
0.1 | 0.6 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 0.3 | GO:0060821 | inactivation of X chromosome by DNA methylation(GO:0060821) |
0.1 | 0.3 | GO:0035624 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
0.1 | 0.4 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.1 | 0.7 | GO:0043921 | modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
0.1 | 0.5 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
0.1 | 1.0 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.1 | 1.7 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
0.1 | 0.4 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) |
0.1 | 0.6 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.1 | 0.8 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.1 | 0.8 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.1 | 0.7 | GO:0034214 | protein hexamerization(GO:0034214) |
0.1 | 1.0 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 2.8 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
0.1 | 0.4 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.1 | 1.3 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
0.1 | 0.4 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.1 | 1.0 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.1 | 0.3 | GO:0019236 | response to pheromone(GO:0019236) |
0.1 | 0.9 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.1 | 0.5 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.1 | 0.6 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 1.4 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.1 | 0.3 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.1 | 0.7 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
0.1 | 0.9 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.1 | 0.3 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.1 | 0.3 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.1 | 0.5 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.1 | 5.4 | GO:0048663 | neuron fate commitment(GO:0048663) |
0.1 | 1.1 | GO:0060033 | anatomical structure regression(GO:0060033) |
0.1 | 0.3 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
0.1 | 2.7 | GO:0001964 | startle response(GO:0001964) |
0.1 | 0.9 | GO:0015677 | copper ion import(GO:0015677) |
0.1 | 0.7 | GO:2000191 | regulation of fatty acid transport(GO:2000191) |
0.1 | 0.4 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
0.1 | 0.3 | GO:0043686 | co-translational protein modification(GO:0043686) |
0.1 | 0.1 | GO:0051798 | positive regulation of hair cycle(GO:0042635) positive regulation of epidermis development(GO:0045684) positive regulation of hair follicle development(GO:0051798) |
0.1 | 0.4 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.5 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
0.1 | 0.3 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
0.1 | 0.3 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.1 | 0.4 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.1 | 0.4 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.1 | 0.5 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.1 | 0.5 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
0.1 | 0.4 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.1 | 0.2 | GO:0039533 | regulation of MDA-5 signaling pathway(GO:0039533) |
0.1 | 0.3 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.1 | 2.1 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.1 | 1.4 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.1 | 1.3 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.5 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
0.1 | 0.2 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.1 | 1.6 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.1 | 0.2 | GO:0046370 | fructose biosynthetic process(GO:0046370) |
0.1 | 0.4 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.1 | 1.5 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.1 | 0.2 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.1 | 0.4 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.1 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.1 | 0.7 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.1 | 0.2 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
0.1 | 0.2 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
0.1 | 0.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 0.2 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.1 | 2.2 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
0.1 | 0.5 | GO:0014819 | regulation of skeletal muscle contraction(GO:0014819) |
0.1 | 0.3 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.1 | 0.4 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.1 | 1.0 | GO:0050858 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.1 | 0.5 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.1 | 0.3 | GO:0046112 | nucleobase biosynthetic process(GO:0046112) |
0.1 | 1.1 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) branched-chain amino acid catabolic process(GO:0009083) |
0.1 | 1.8 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.1 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.4 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.1 | 1.6 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.1 | 0.8 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.1 | 0.5 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.1 | 0.6 | GO:0006026 | aminoglycan catabolic process(GO:0006026) |
0.1 | 0.4 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.1 | 0.1 | GO:1904504 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.1 | 0.1 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.1 | 0.2 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.5 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.1 | 0.8 | GO:0032735 | positive regulation of interleukin-12 production(GO:0032735) |
0.1 | 0.3 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.1 | 0.6 | GO:0045019 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
0.1 | 2.6 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
0.1 | 0.2 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.1 | 0.2 | GO:0033762 | response to glucagon(GO:0033762) |
0.1 | 0.4 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
0.1 | 0.5 | GO:0051608 | histamine transport(GO:0051608) |
0.1 | 0.7 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
0.1 | 0.5 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
0.1 | 2.6 | GO:0060325 | face morphogenesis(GO:0060325) |
0.1 | 0.6 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.1 | 2.0 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.1 | 0.3 | GO:0009227 | UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
0.1 | 0.6 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.1 | 1.4 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.1 | 1.7 | GO:0015909 | long-chain fatty acid transport(GO:0015909) |
0.1 | 0.7 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.1 | 0.4 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
0.1 | 0.5 | GO:0051354 | negative regulation of oxidoreductase activity(GO:0051354) |
0.1 | 0.3 | GO:0015788 | UDP-N-acetylglucosamine transport(GO:0015788) |
0.1 | 0.9 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.1 | 1.1 | GO:0006801 | superoxide metabolic process(GO:0006801) |
0.1 | 0.4 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 0.6 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.1 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
0.1 | 0.4 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
0.1 | 0.2 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
0.1 | 1.3 | GO:0097435 | fibril organization(GO:0097435) |
0.1 | 0.8 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
0.1 | 1.0 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.1 | 0.7 | GO:0015914 | phospholipid transport(GO:0015914) |
0.1 | 0.7 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.1 | 0.4 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
0.1 | 1.4 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
0.1 | 0.5 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.2 | GO:0000054 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
0.1 | 0.2 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.1 | 0.3 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.1 | 0.6 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.1 | 0.2 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
0.1 | 0.7 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.1 | 0.3 | GO:0071715 | icosanoid transport(GO:0071715) fatty acid derivative transport(GO:1901571) |
0.1 | 0.4 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.1 | 2.1 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.1 | 1.7 | GO:0046677 | response to antibiotic(GO:0046677) |
0.1 | 0.9 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
0.1 | 0.2 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
0.1 | 0.3 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.1 | 0.6 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.1 | 0.3 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 0.3 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.1 | 0.5 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.1 | 0.5 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.1 | 1.5 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.1 | 0.4 | GO:0035411 | catenin import into nucleus(GO:0035411) |
0.1 | 1.7 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.1 | 0.3 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.1 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.8 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.1 | 0.5 | GO:0060999 | positive regulation of dendritic spine development(GO:0060999) |
0.1 | 0.1 | GO:0060282 | positive regulation of chronic inflammatory response(GO:0002678) positive regulation of oocyte development(GO:0060282) |
0.1 | 0.8 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.1 | 0.1 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.1 | 0.2 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
0.1 | 1.4 | GO:0030488 | tRNA methylation(GO:0030488) |
0.1 | 0.2 | GO:0090032 | negative regulation of steroid hormone biosynthetic process(GO:0090032) |
0.0 | 0.1 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
0.0 | 0.5 | GO:0051923 | sulfation(GO:0051923) |
0.0 | 0.7 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.0 | 0.1 | GO:0034035 | sulfate assimilation(GO:0000103) purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.0 | 0.7 | GO:0010592 | positive regulation of lamellipodium assembly(GO:0010592) |
0.0 | 0.2 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
0.0 | 0.8 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.0 | 0.4 | GO:1903020 | positive regulation of glycoprotein metabolic process(GO:1903020) |
0.0 | 0.3 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.0 | 1.9 | GO:0010390 | histone monoubiquitination(GO:0010390) |
0.0 | 0.6 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.0 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.0 | 0.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 1.2 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.0 | 0.2 | GO:0038032 | termination of G-protein coupled receptor signaling pathway(GO:0038032) |
0.0 | 0.3 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.2 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.0 | 0.3 | GO:0098743 | cartilage condensation(GO:0001502) cell aggregation(GO:0098743) |
0.0 | 1.2 | GO:0042168 | heme metabolic process(GO:0042168) |
0.0 | 1.8 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
0.0 | 0.6 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.0 | 1.1 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
0.0 | 0.2 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.0 | 0.2 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.0 | 0.3 | GO:1903624 | regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
0.0 | 0.3 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.0 | 2.0 | GO:0010389 | regulation of G2/M transition of mitotic cell cycle(GO:0010389) |
0.0 | 0.1 | GO:0001516 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
0.0 | 1.3 | GO:0042733 | embryonic digit morphogenesis(GO:0042733) |
0.0 | 0.5 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.0 | 0.3 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.0 | 0.5 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) negative regulation of sprouting angiogenesis(GO:1903671) |
0.0 | 0.2 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
0.0 | 0.3 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.0 | 0.2 | GO:0051897 | positive regulation of protein kinase B signaling(GO:0051897) |
0.0 | 0.3 | GO:0030578 | PML body organization(GO:0030578) |
0.0 | 0.2 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.2 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.2 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.6 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
0.0 | 0.4 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.9 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 1.5 | GO:0060021 | palate development(GO:0060021) |
0.0 | 0.4 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
0.0 | 0.3 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.1 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
0.0 | 0.4 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.0 | 0.3 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.3 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.3 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.2 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
0.0 | 2.1 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.2 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
0.0 | 2.1 | GO:0046847 | filopodium assembly(GO:0046847) |
0.0 | 0.5 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.2 | GO:0048260 | positive regulation of receptor-mediated endocytosis(GO:0048260) |
0.0 | 0.2 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.2 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.3 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 1.2 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.0 | 0.5 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
0.0 | 0.0 | GO:0046078 | pyrimidine nucleoside monophosphate metabolic process(GO:0009129) pyrimidine deoxyribonucleoside monophosphate metabolic process(GO:0009176) dUMP metabolic process(GO:0046078) |
0.0 | 0.3 | GO:1901998 | toxin transport(GO:1901998) |
0.0 | 0.3 | GO:0060235 | embryonic retina morphogenesis in camera-type eye(GO:0060059) lens induction in camera-type eye(GO:0060235) |
0.0 | 0.1 | GO:0046689 | response to mercury ion(GO:0046689) |
0.0 | 0.2 | GO:0042993 | positive regulation of transcription factor import into nucleus(GO:0042993) |
0.0 | 0.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.0 | 0.3 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 0.8 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
0.0 | 0.3 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
0.0 | 0.2 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.0 | 0.2 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.1 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.0 | 0.8 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.0 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.0 | 0.1 | GO:0046825 | regulation of protein export from nucleus(GO:0046825) |
0.0 | 1.1 | GO:0034394 | protein localization to cell surface(GO:0034394) |
0.0 | 0.1 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.0 | 0.1 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.0 | 0.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.0 | 0.5 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.0 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.0 | 0.5 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
0.0 | 0.3 | GO:0006766 | vitamin metabolic process(GO:0006766) |
0.0 | 1.6 | GO:0001570 | vasculogenesis(GO:0001570) |
0.0 | 0.2 | GO:0050691 | regulation of defense response to virus by host(GO:0050691) |
0.0 | 0.1 | GO:0030279 | negative regulation of ossification(GO:0030279) |
0.0 | 0.6 | GO:0042632 | cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
0.0 | 0.2 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.0 | 0.2 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.7 | GO:0016575 | histone deacetylation(GO:0016575) |
0.0 | 1.2 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.0 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.0 | 0.2 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.0 | 0.1 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.0 | 0.2 | GO:0061084 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.3 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.0 | 0.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.0 | 0.1 | GO:0036303 | lymph vessel morphogenesis(GO:0036303) |
0.0 | 0.7 | GO:0035914 | skeletal muscle cell differentiation(GO:0035914) |
0.0 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.1 | GO:1902083 | cellular response to hydroperoxide(GO:0071447) negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
0.0 | 0.5 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.0 | 0.5 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
0.0 | 0.0 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
0.0 | 0.1 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.1 | GO:1904355 | regulation of telomere capping(GO:1904353) positive regulation of telomere capping(GO:1904355) |
0.0 | 0.1 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.0 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.0 | 0.0 | GO:0046490 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
0.0 | 0.1 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.0 | 0.0 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.0 | 0.0 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
0.0 | 0.9 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.0 | 0.1 | GO:0046549 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
0.0 | 0.0 | GO:2000416 | regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
0.0 | 0.6 | GO:0051289 | protein homotetramerization(GO:0051289) |
0.0 | 0.2 | GO:1901071 | N-acetylglucosamine metabolic process(GO:0006044) glucosamine-containing compound metabolic process(GO:1901071) |
0.0 | 0.1 | GO:0090003 | regulation of Golgi to plasma membrane protein transport(GO:0042996) regulation of establishment of protein localization to plasma membrane(GO:0090003) |
0.0 | 0.5 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 0.3 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.0 | GO:0006116 | NADH oxidation(GO:0006116) |
0.0 | 0.1 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.5 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.0 | 0.3 | GO:0042990 | regulation of transcription factor import into nucleus(GO:0042990) |
0.0 | 0.1 | GO:0030851 | granulocyte differentiation(GO:0030851) |
0.0 | 0.1 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.0 | 0.0 | GO:1903204 | neuron death in response to oxidative stress(GO:0036475) regulation of oxidative stress-induced neuron death(GO:1903203) negative regulation of oxidative stress-induced neuron death(GO:1903204) |
0.0 | 0.3 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.8 | GO:0010811 | positive regulation of cell-substrate adhesion(GO:0010811) |
0.0 | 0.1 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) positive regulation of signal transduction by p53 class mediator(GO:1901798) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
0.0 | 0.2 | GO:0032438 | melanosome organization(GO:0032438) pigment granule organization(GO:0048753) |
0.0 | 0.1 | GO:0009268 | response to pH(GO:0009268) |
0.0 | 0.1 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.0 | 0.2 | GO:0048240 | sperm capacitation(GO:0048240) |
Gene overrepresentation in cellular_component category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 3.2 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.8 | 2.4 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.6 | 4.3 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.5 | 3.3 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.5 | 6.3 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.5 | 2.9 | GO:0043256 | laminin complex(GO:0043256) |
0.5 | 2.8 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.5 | 1.8 | GO:0000939 | nuclear MIS12/MIND complex(GO:0000818) condensed chromosome inner kinetochore(GO:0000939) |
0.5 | 3.2 | GO:0000322 | storage vacuole(GO:0000322) |
0.5 | 1.4 | GO:0036125 | mitochondrial fatty acid beta-oxidation multienzyme complex(GO:0016507) fatty acid beta-oxidation multienzyme complex(GO:0036125) |
0.5 | 0.9 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.5 | 1.8 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.4 | 2.2 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
0.4 | 0.9 | GO:0098855 | HCN channel complex(GO:0098855) |
0.4 | 3.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.4 | 1.1 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
0.3 | 1.3 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.3 | 7.6 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.3 | 0.9 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.3 | 1.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.3 | 1.7 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.3 | 0.8 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.3 | 4.3 | GO:0005605 | basal lamina(GO:0005605) |
0.2 | 0.7 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
0.2 | 1.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.2 | 3.4 | GO:0097449 | astrocyte projection(GO:0097449) |
0.2 | 5.3 | GO:0043218 | compact myelin(GO:0043218) |
0.2 | 1.3 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.2 | 0.4 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.2 | 1.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.2 | 1.8 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.2 | 4.6 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.2 | 1.0 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.2 | 0.9 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.2 | 0.8 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
0.2 | 2.0 | GO:0005915 | zonula adherens(GO:0005915) |
0.2 | 0.5 | GO:0031251 | PAN complex(GO:0031251) |
0.2 | 1.3 | GO:0001940 | male pronucleus(GO:0001940) |
0.2 | 1.3 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.2 | 1.2 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.2 | 2.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.2 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.2 | 0.5 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
0.2 | 0.2 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.2 | 0.8 | GO:0030056 | hemidesmosome(GO:0030056) |
0.2 | 0.5 | GO:0031012 | extracellular matrix(GO:0031012) |
0.2 | 0.5 | GO:0000799 | nuclear condensin complex(GO:0000799) germinal vesicle(GO:0042585) |
0.2 | 0.3 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.2 | 0.8 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
0.1 | 2.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.1 | 0.4 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
0.1 | 0.4 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.1 | 1.6 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.4 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 1.1 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 0.7 | GO:0005688 | U6 snRNP(GO:0005688) |
0.1 | 0.7 | GO:0031528 | microvillus membrane(GO:0031528) |
0.1 | 1.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.6 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.1 | 0.9 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.1 | 1.2 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 0.5 | GO:0032021 | NELF complex(GO:0032021) |
0.1 | 1.2 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 2.9 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.1 | 0.2 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 1.9 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.1 | 0.5 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 0.3 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 1.6 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.1 | 0.5 | GO:0031523 | Myb complex(GO:0031523) |
0.1 | 1.1 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.1 | 0.3 | GO:1903095 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
0.1 | 2.5 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.1 | 0.3 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
0.1 | 0.5 | GO:1990246 | uniplex complex(GO:1990246) |
0.1 | 0.3 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
0.1 | 1.5 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.1 | 1.5 | GO:0036038 | MKS complex(GO:0036038) |
0.1 | 9.9 | GO:0030175 | filopodium(GO:0030175) |
0.1 | 0.4 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.1 | 0.5 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 15.3 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.1 | 0.4 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.1 | 6.1 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.1 | 0.6 | GO:0016459 | myosin complex(GO:0016459) |
0.1 | 0.4 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.1 | 1.2 | GO:0000800 | lateral element(GO:0000800) |
0.1 | 0.9 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 0.7 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 5.0 | GO:0005604 | basement membrane(GO:0005604) |
0.1 | 0.6 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 1.2 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.1 | 0.2 | GO:0031983 | vesicle lumen(GO:0031983) |
0.1 | 0.5 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.1 | 0.5 | GO:0005638 | lamin filament(GO:0005638) |
0.1 | 0.2 | GO:0044299 | C-fiber(GO:0044299) |
0.1 | 0.3 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.1 | 0.6 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.1 | 6.4 | GO:0016363 | nuclear matrix(GO:0016363) |
0.1 | 3.6 | GO:0022626 | cytosolic ribosome(GO:0022626) |
0.1 | 1.2 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.2 | GO:0033391 | chromatoid body(GO:0033391) |
0.1 | 0.6 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.3 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) cytoplasmic side of lysosomal membrane(GO:0098574) |
0.1 | 0.3 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.1 | 0.9 | GO:0000922 | spindle pole(GO:0000922) |
0.1 | 0.4 | GO:0042825 | TAP complex(GO:0042825) |
0.1 | 0.7 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.1 | 2.3 | GO:0032420 | stereocilium(GO:0032420) |
0.1 | 0.5 | GO:0061617 | MICOS complex(GO:0061617) |
0.1 | 0.3 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.7 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.1 | 0.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.1 | 0.2 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 0.5 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.1 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
0.0 | 0.5 | GO:0001739 | sex chromatin(GO:0001739) |
0.0 | 0.2 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
0.0 | 3.1 | GO:0031526 | brush border membrane(GO:0031526) |
0.0 | 3.1 | GO:0031970 | mitochondrial intermembrane space(GO:0005758) organelle envelope lumen(GO:0031970) |
0.0 | 0.4 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 2.0 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.2 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 3.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 1.1 | GO:0044291 | cell-cell contact zone(GO:0044291) |
0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.4 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.8 | GO:0009986 | cell surface(GO:0009986) |
0.0 | 0.6 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.8 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.3 | GO:0097526 | U4/U6 x U5 tri-snRNP complex(GO:0046540) spliceosomal tri-snRNP complex(GO:0097526) |
0.0 | 0.4 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 1.8 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.2 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.3 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.0 | 0.4 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 2.2 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.5 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.5 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.4 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 2.0 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.0 | 0.3 | GO:0000805 | X chromosome(GO:0000805) |
0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.3 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.6 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.0 | 2.0 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.9 | GO:0005901 | caveola(GO:0005901) |
0.0 | 0.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 1.0 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.1 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.0 | 6.6 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.3 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 1.5 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
0.0 | 3.3 | GO:0030027 | lamellipodium(GO:0030027) |
0.0 | 10.7 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 1.3 | GO:0031901 | early endosome membrane(GO:0031901) |
0.0 | 0.1 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.9 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 2.5 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.0 | 0.2 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) |
0.0 | 5.9 | GO:0005925 | focal adhesion(GO:0005925) |
0.0 | 22.3 | GO:0005615 | extracellular space(GO:0005615) |
0.0 | 0.6 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.0 | 0.1 | GO:0097361 | CIA complex(GO:0097361) |
0.0 | 0.6 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 0.5 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.0 | 0.3 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.0 | 0.7 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.0 | 0.2 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.3 | GO:0016460 | myosin II complex(GO:0016460) |
0.0 | 0.3 | GO:0031105 | septin complex(GO:0031105) |
0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.7 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
0.0 | 3.3 | GO:0005802 | trans-Golgi network(GO:0005802) |
0.0 | 0.7 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.3 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.7 | GO:0005903 | brush border(GO:0005903) |
0.0 | 0.6 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.2 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.5 | GO:0045121 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
0.0 | 0.3 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.1 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.3 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.2 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 0.4 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 1.3 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.3 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.5 | GO:0016324 | apical plasma membrane(GO:0016324) |
0.0 | 0.2 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.0 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.0 | 0.6 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.2 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
0.0 | 0.0 | GO:0005745 | m-AAA complex(GO:0005745) |
0.0 | 0.4 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
Gene overrepresentation in molecular_function category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.4 | 7.1 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
1.2 | 4.9 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
1.2 | 3.6 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
1.1 | 5.4 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
1.0 | 4.1 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
1.0 | 5.1 | GO:0005534 | galactose binding(GO:0005534) |
1.0 | 3.9 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
1.0 | 3.9 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.9 | 3.7 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.9 | 4.7 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.9 | 2.8 | GO:0005118 | sevenless binding(GO:0005118) |
0.9 | 8.0 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.9 | 3.5 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.8 | 3.4 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.8 | 3.3 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.8 | 3.2 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
0.7 | 8.1 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.7 | 2.1 | GO:0098809 | nitrite reductase activity(GO:0098809) |
0.7 | 2.1 | GO:0019120 | hydrolase activity, acting on acid halide bonds(GO:0016824) hydrolase activity, acting on acid halide bonds, in C-halide compounds(GO:0019120) alkylhalidase activity(GO:0047651) |
0.7 | 4.0 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.6 | 3.0 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.5 | 2.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.5 | 4.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.5 | 0.5 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.5 | 1.4 | GO:0004568 | chitinase activity(GO:0004568) |
0.5 | 2.4 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.5 | 1.8 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.4 | 2.2 | GO:0097643 | amylin receptor activity(GO:0097643) |
0.4 | 3.8 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.4 | 2.1 | GO:0050700 | CARD domain binding(GO:0050700) |
0.4 | 2.8 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.4 | 1.2 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.4 | 0.4 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.4 | 1.1 | GO:0031403 | lithium ion binding(GO:0031403) |
0.4 | 1.1 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
0.4 | 2.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.4 | 2.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.4 | 1.4 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.4 | 2.5 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) lysophosphatidic acid receptor activity(GO:0070915) |
0.4 | 4.9 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
0.3 | 3.5 | GO:0031404 | chloride ion binding(GO:0031404) |
0.3 | 3.5 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.3 | 2.4 | GO:0000150 | recombinase activity(GO:0000150) |
0.3 | 1.4 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.3 | 1.4 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.3 | 2.3 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.3 | 4.2 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.3 | 1.0 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.3 | 0.9 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
0.3 | 1.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.3 | 0.9 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
0.3 | 1.2 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.3 | 1.2 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.3 | 0.9 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.3 | 0.9 | GO:0046997 | sarcosine dehydrogenase activity(GO:0008480) oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
0.3 | 0.6 | GO:0015925 | galactosidase activity(GO:0015925) |
0.3 | 1.4 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.3 | 2.9 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.3 | 4.5 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.3 | 3.1 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.3 | 0.8 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.3 | 1.3 | GO:1990188 | euchromatin binding(GO:1990188) |
0.3 | 2.0 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.3 | 1.0 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.2 | 1.0 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
0.2 | 1.0 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.2 | 1.7 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.2 | 1.4 | GO:0043199 | sulfate binding(GO:0043199) |
0.2 | 1.2 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.2 | 6.1 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.2 | 1.8 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
0.2 | 0.4 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.2 | 0.9 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.2 | 0.9 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.2 | 0.4 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.2 | 3.5 | GO:0003680 | AT DNA binding(GO:0003680) |
0.2 | 1.3 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.2 | 0.9 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.2 | 1.5 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.2 | 2.1 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
0.2 | 1.2 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.2 | 1.0 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.2 | 1.6 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.2 | 0.8 | GO:0042806 | fucose binding(GO:0042806) |
0.2 | 1.0 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.2 | 4.1 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.2 | 1.7 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.2 | 0.6 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
0.2 | 0.4 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.2 | 0.7 | GO:0035877 | death effector domain binding(GO:0035877) |
0.2 | 2.2 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.2 | 2.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.2 | 0.5 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
0.2 | 0.4 | GO:0015238 | xenobiotic-transporting ATPase activity(GO:0008559) drug transmembrane transporter activity(GO:0015238) xenobiotic transporter activity(GO:0042910) |
0.2 | 0.5 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.2 | 1.4 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.2 | 1.8 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.2 | 1.5 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.2 | 0.5 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.2 | 0.8 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.2 | 1.5 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.2 | 0.5 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.2 | 1.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.2 | 1.5 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.2 | 1.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.1 | 0.1 | GO:0042328 | heparan sulfate N-acetylglucosaminyltransferase activity(GO:0042328) |
0.1 | 1.6 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.1 | 0.7 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 1.2 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.1 | 1.0 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.1 | 0.6 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.4 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
0.1 | 0.4 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.1 | 0.6 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.1 | 1.0 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 1.0 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.3 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.1 | 0.4 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.1 | 1.8 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.1 | 0.7 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 0.8 | GO:0000298 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
0.1 | 1.7 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.1 | 0.5 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.1 | 0.7 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.1 | 0.8 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.1 | 1.7 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.1 | 0.5 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) tapasin binding(GO:0046980) |
0.1 | 0.5 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.1 | 2.5 | GO:0008483 | transaminase activity(GO:0008483) |
0.1 | 0.6 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.5 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 1.5 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 3.1 | GO:0005504 | fatty acid binding(GO:0005504) |
0.1 | 1.0 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 0.5 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 1.6 | GO:0008227 | G-protein coupled amine receptor activity(GO:0008227) |
0.1 | 1.0 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 0.4 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
0.1 | 0.5 | GO:0004921 | interleukin-11 receptor activity(GO:0004921) interleukin-11 binding(GO:0019970) |
0.1 | 1.7 | GO:0035173 | histone kinase activity(GO:0035173) |
0.1 | 0.5 | GO:0004064 | arylesterase activity(GO:0004064) |
0.1 | 1.3 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.1 | 0.9 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.6 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 1.5 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.3 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
0.1 | 0.8 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 1.2 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.1 | 0.7 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.1 | 1.0 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.1 | 0.7 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.1 | 0.5 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.1 | 4.2 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.9 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.1 | 0.4 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.1 | 0.6 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 1.1 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 1.6 | GO:0071949 | FAD binding(GO:0071949) |
0.1 | 0.3 | GO:0038132 | neuregulin binding(GO:0038132) |
0.1 | 4.1 | GO:0004407 | histone deacetylase activity(GO:0004407) protein deacetylase activity(GO:0033558) |
0.1 | 0.2 | GO:0031014 | troponin T binding(GO:0031014) |
0.1 | 0.5 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.1 | 0.9 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 0.3 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
0.1 | 0.3 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
0.1 | 1.5 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 1.4 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 0.5 | GO:0004342 | glucosamine-6-phosphate deaminase activity(GO:0004342) |
0.1 | 0.3 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 1.2 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.1 | 0.5 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.1 | 0.6 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.1 | 0.5 | GO:0009374 | biotin binding(GO:0009374) |
0.1 | 5.9 | GO:0005518 | collagen binding(GO:0005518) |
0.1 | 3.3 | GO:0005507 | copper ion binding(GO:0005507) |
0.1 | 0.4 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.1 | 0.3 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.1 | 0.5 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.1 | 0.8 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.1 | 1.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.1 | 1.9 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.3 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 0.6 | GO:0015616 | DNA translocase activity(GO:0015616) |
0.1 | 0.2 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.1 | 1.0 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 1.3 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.1 | 0.2 | GO:0004637 | phosphoribosylamine-glycine ligase activity(GO:0004637) |
0.1 | 0.2 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.1 | 0.2 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
0.1 | 1.0 | GO:0019213 | deacetylase activity(GO:0019213) |
0.1 | 0.7 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.1 | 0.3 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.1 | 0.2 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
0.1 | 0.9 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.1 | 0.8 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.3 | GO:0048039 | ubiquinone binding(GO:0048039) |
0.1 | 0.6 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.1 | 0.2 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 0.6 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
0.1 | 0.4 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.1 | 0.4 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
0.1 | 0.1 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.1 | 0.7 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 1.7 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.2 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.1 | 0.3 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.1 | 0.3 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.1 | 0.2 | GO:0035605 | peptidyl-cysteine S-nitrosylase activity(GO:0035605) |
0.1 | 0.4 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
0.1 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 3.5 | GO:0019955 | cytokine binding(GO:0019955) |
0.1 | 1.0 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 0.3 | GO:0070403 | NAD+ binding(GO:0070403) |
0.1 | 0.3 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.1 | 0.7 | GO:0046977 | TAP binding(GO:0046977) |
0.1 | 0.4 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 0.5 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
0.1 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.3 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.1 | 0.3 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 1.3 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.1 | 0.3 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.1 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.1 | 1.0 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.1 | 0.5 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.1 | 1.1 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.1 | 0.6 | GO:0015026 | coreceptor activity(GO:0015026) |
0.1 | 0.2 | GO:0036468 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
0.1 | 0.5 | GO:0097617 | annealing activity(GO:0097617) |
0.1 | 1.4 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.1 | 0.6 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 0.7 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.1 | 1.3 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.4 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) inositol trisphosphate phosphatase activity(GO:0046030) |
0.0 | 0.8 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 1.0 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.0 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 3.6 | GO:0008083 | growth factor activity(GO:0008083) |
0.0 | 0.1 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
0.0 | 0.7 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
0.0 | 2.2 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
0.0 | 4.2 | GO:0005178 | integrin binding(GO:0005178) |
0.0 | 0.2 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.0 | 0.6 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
0.0 | 1.1 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.5 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.7 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.3 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.9 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.0 | 0.2 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.0 | 7.2 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.9 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.5 | GO:0015464 | acetylcholine receptor activity(GO:0015464) |
0.0 | 0.3 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.4 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.4 | GO:0050733 | pre-mRNA 3'-splice site binding(GO:0030628) RS domain binding(GO:0050733) |
0.0 | 2.4 | GO:0005125 | cytokine activity(GO:0005125) |
0.0 | 0.3 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
0.0 | 0.8 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
0.0 | 0.7 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.2 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 0.5 | GO:0004659 | prenyltransferase activity(GO:0004659) |
0.0 | 1.3 | GO:0050660 | flavin adenine dinucleotide binding(GO:0050660) |
0.0 | 0.3 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.0 | 0.1 | GO:0001851 | complement component C3b binding(GO:0001851) |
0.0 | 1.4 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
0.0 | 1.1 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 1.0 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
0.0 | 1.5 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.0 | 0.1 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.3 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.0 | 0.4 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.9 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.0 | 0.2 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.4 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 6.1 | GO:0003714 | transcription corepressor activity(GO:0003714) |
0.0 | 0.2 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.2 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.2 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
0.0 | 0.3 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 0.2 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.5 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.0 | 0.1 | GO:0015254 | glycerol channel activity(GO:0015254) |
0.0 | 0.8 | GO:0019843 | rRNA binding(GO:0019843) |
0.0 | 0.7 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.0 | 0.1 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
0.0 | 0.5 | GO:0030371 | translation repressor activity(GO:0030371) |
0.0 | 0.2 | GO:0035242 | histone-arginine N-methyltransferase activity(GO:0008469) protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.2 | GO:0004984 | olfactory receptor activity(GO:0004984) |
0.0 | 0.4 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.0 | 0.2 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.0 | 0.4 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.1 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) |
0.0 | 0.3 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.0 | 0.0 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.0 | 2.4 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
0.0 | 0.3 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.6 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 0.1 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.1 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.0 | 0.4 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
0.0 | 1.0 | GO:0030295 | protein kinase activator activity(GO:0030295) |
0.0 | 0.5 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 0.5 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.4 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.2 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.4 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.4 | GO:0042805 | actinin binding(GO:0042805) |
0.0 | 0.9 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.1 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.0 | 1.1 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 1.7 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
0.0 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.0 | 0.3 | GO:0004527 | exonuclease activity(GO:0004527) |
0.0 | 0.2 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.0 | 0.4 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.3 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.3 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.0 | 0.3 | GO:0019842 | vitamin binding(GO:0019842) |
0.0 | 0.6 | GO:0001098 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
0.0 | 2.1 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.4 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.0 | 0.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 0.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.4 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.1 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.0 | 0.8 | GO:0008186 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.0 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.3 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.1 | GO:0019209 | kinase activator activity(GO:0019209) |
0.0 | 0.2 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.2 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
Gene overrepresentation in C2:CP category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 5.1 | ST_INTERFERON_GAMMA_PATHWAY | Interferon gamma pathway. |
0.4 | 2.9 | PID_INTEGRIN4_PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.4 | 4.9 | PID_INTEGRIN2_PATHWAY | Beta2 integrin cell surface interactions |
0.3 | 2.7 | SA_MMP_CYTOKINE_CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.2 | 2.9 | NABA_BASEMENT_MEMBRANES | Genes encoding structural components of basement membranes |
0.2 | 3.9 | PID_BARD1_PATHWAY | BARD1 signaling events |
0.2 | 3.8 | PID_S1P_META_PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.2 | 8.1 | ST_WNT_BETA_CATENIN_PATHWAY | Wnt/beta-catenin Pathway |
0.2 | 8.4 | PID_FANCONI_PATHWAY | Fanconi anemia pathway |
0.1 | 7.0 | PID_BMP_PATHWAY | BMP receptor signaling |
0.1 | 6.3 | NABA_COLLAGENS | Genes encoding collagen proteins |
0.1 | 4.8 | PID_HNF3B_PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 3.2 | PID_PRL_SIGNALING_EVENTS_PATHWAY | Signaling events mediated by PRL |
0.1 | 0.7 | SA_G2_AND_M_PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 0.2 | PID_FAS_PATHWAY | FAS (CD95) signaling pathway |
0.1 | 8.1 | PID_MYC_REPRESS_PATHWAY | Validated targets of C-MYC transcriptional repression |
0.1 | 9.5 | PID_CDC42_PATHWAY | CDC42 signaling events |
0.1 | 1.4 | PID_ANTHRAX_PATHWAY | Cellular roles of Anthrax toxin |
0.1 | 0.6 | ST_PAC1_RECEPTOR_PATHWAY | PAC1 Receptor Pathway |
0.1 | 0.6 | PID_TCR_JNK_PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 1.6 | PID_CIRCADIAN_PATHWAY | Circadian rhythm pathway |
0.1 | 0.5 | PID_IL6_7_PATHWAY | IL6-mediated signaling events |
0.1 | 0.8 | SA_REG_CASCADE_OF_CYCLIN_EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.1 | 3.2 | PID_A6B1_A6B4_INTEGRIN_PATHWAY | a6b1 and a6b4 Integrin signaling |
0.1 | 3.3 | PID_EPHB_FWD_PATHWAY | EPHB forward signaling |
0.1 | 0.5 | PID_WNT_NONCANONICAL_PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 0.9 | PID_VEGF_VEGFR_PATHWAY | VEGF and VEGFR signaling network |
0.1 | 2.0 | PID_NETRIN_PATHWAY | Netrin-mediated signaling events |
0.1 | 1.3 | PID_SYNDECAN_4_PATHWAY | Syndecan-4-mediated signaling events |
0.1 | 1.0 | PID_AMB2_NEUTROPHILS_PATHWAY | amb2 Integrin signaling |
0.1 | 3.7 | PID_LYSOPHOSPHOLIPID_PATHWAY | LPA receptor mediated events |
0.1 | 0.5 | PID_INTEGRIN_A9B1_PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 0.1 | PID_ECADHERIN_KERATINOCYTE_PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 8.6 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.1 | 0.8 | PID_INSULIN_GLUCOSE_PATHWAY | Insulin-mediated glucose transport |
0.1 | 0.5 | PID_SYNDECAN_2_PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 3.4 | PID_E2F_PATHWAY | E2F transcription factor network |
0.0 | 0.9 | PID_ECADHERIN_NASCENT_AJ_PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 1.2 | PID_HIV_NEF_PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 1.2 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 1.6 | PID_ECADHERIN_STABILIZATION_PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 2.7 | PID_NOTCH_PATHWAY | Notch signaling pathway |
0.0 | 2.2 | PID_P73PATHWAY | p73 transcription factor network |
0.0 | 1.3 | PID_MET_PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 3.4 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 2.2 | PID_MYC_ACTIV_PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.2 | PID_GMCSF_PATHWAY | GMCSF-mediated signaling events |
0.0 | 0.7 | PID_TNF_PATHWAY | TNF receptor signaling pathway |
0.0 | 0.3 | PID_EPHA_FWDPATHWAY | EPHA forward signaling |
0.0 | 0.2 | ST_TUMOR_NECROSIS_FACTOR_PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 0.3 | PID_ATR_PATHWAY | ATR signaling pathway |
0.0 | 0.1 | SA_CASPASE_CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.8 | PID_SMAD2_3NUCLEAR_PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.0 | 0.6 | PID_P53_REGULATION_PATHWAY | p53 pathway |
0.0 | 0.3 | PID_FGF_PATHWAY | FGF signaling pathway |
0.0 | 0.8 | PID_AR_PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.4 | PID_CASPASE_PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.2 | PID_IL2_1PATHWAY | IL2-mediated signaling events |
0.0 | 0.2 | PID_AVB3_INTEGRIN_PATHWAY | Integrins in angiogenesis |
Gene overrepresentation in C2:CP:REACTOME category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 1.5 | REACTOME_APC_C_CDC20_MEDIATED_DEGRADATION_OF_MITOTIC_PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.5 | 4.3 | REACTOME_THE_ACTIVATION_OF_ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.3 | 6.1 | REACTOME_PRE_NOTCH_PROCESSING_IN_GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.3 | 4.7 | REACTOME_MITOCHONDRIAL_FATTY_ACID_BETA_OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.3 | 3.6 | REACTOME_SYNTHESIS_SECRETION_AND_INACTIVATION_OF_GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.3 | 2.6 | REACTOME_NA_CL_DEPENDENT_NEUROTRANSMITTER_TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.2 | 4.0 | REACTOME_NFKB_ACTIVATION_THROUGH_FADD_RIP1_PATHWAY_MEDIATED_BY_CASPASE_8_AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.2 | 5.2 | REACTOME_IMMUNOREGULATORY_INTERACTIONS_BETWEEN_A_LYMPHOID_AND_A_NON_LYMPHOID_CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.2 | 5.4 | REACTOME_ACTIVATED_AMPK_STIMULATES_FATTY_ACID_OXIDATION_IN_MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.2 | 3.6 | REACTOME_SEMA3A_PLEXIN_REPULSION_SIGNALING_BY_INHIBITING_INTEGRIN_ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.2 | 1.2 | REACTOME_CREATION_OF_C4_AND_C2_ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.2 | 1.2 | REACTOME_REGULATION_OF_ORNITHINE_DECARBOXYLASE_ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.2 | 4.9 | REACTOME_SULFUR_AMINO_ACID_METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.2 | 2.2 | REACTOME_CDC6_ASSOCIATION_WITH_THE_ORC_ORIGIN_COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.2 | 11.1 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
0.2 | 1.4 | REACTOME_REGULATION_OF_INSULIN_SECRETION_BY_ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.2 | 1.0 | REACTOME_ORGANIC_CATION_ANION_ZWITTERION_TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.2 | 1.4 | REACTOME_BILE_SALT_AND_ORGANIC_ANION_SLC_TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.2 | 1.4 | REACTOME_GLUCAGON_TYPE_LIGAND_RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.2 | 4.8 | REACTOME_SIGNALING_BY_BMP | Genes involved in Signaling by BMP |
0.2 | 3.1 | REACTOME_CHONDROITIN_SULFATE_BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.2 | 2.5 | REACTOME_MTORC1_MEDIATED_SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 0.4 | REACTOME_FGFR2C_LIGAND_BINDING_AND_ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.1 | 4.1 | REACTOME_REGULATION_OF_BETA_CELL_DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.1 | 3.1 | REACTOME_G0_AND_EARLY_G1 | Genes involved in G0 and Early G1 |
0.1 | 1.4 | REACTOME_HYALURONAN_UPTAKE_AND_DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.1 | 1.4 | REACTOME_REMOVAL_OF_THE_FLAP_INTERMEDIATE_FROM_THE_C_STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.1 | 0.4 | REACTOME_HORMONE_LIGAND_BINDING_RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.1 | 0.7 | REACTOME_ASSOCIATION_OF_LICENSING_FACTORS_WITH_THE_PRE_REPLICATIVE_COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.1 | 1.4 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 1.7 | REACTOME_TETRAHYDROBIOPTERIN_BH4_SYNTHESIS_RECYCLING_SALVAGE_AND_REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 1.1 | REACTOME_METABOLISM_OF_POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 1.1 | REACTOME_MRNA_DECAY_BY_3_TO_5_EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 0.3 | REACTOME_ADP_SIGNALLING_THROUGH_P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.1 | 1.2 | REACTOME_AMINE_LIGAND_BINDING_RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.1 | 0.9 | REACTOME_EXTRINSIC_PATHWAY_FOR_APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 1.4 | REACTOME_PTM_GAMMA_CARBOXYLATION_HYPUSINE_FORMATION_AND_ARYLSULFATASE_ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.1 | 2.4 | REACTOME_PHASE1_FUNCTIONALIZATION_OF_COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.1 | 0.6 | REACTOME_APOPTOTIC_CLEAVAGE_OF_CELL_ADHESION_PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 1.1 | REACTOME_BASE_FREE_SUGAR_PHOSPHATE_REMOVAL_VIA_THE_SINGLE_NUCLEOTIDE_REPLACEMENT_PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 2.1 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 1.8 | REACTOME_PYRUVATE_METABOLISM | Genes involved in Pyruvate metabolism |
0.1 | 1.2 | REACTOME_SIGNALING_BY_NODAL | Genes involved in Signaling by NODAL |
0.1 | 1.4 | REACTOME_ADENYLATE_CYCLASE_INHIBITORY_PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.1 | 2.0 | REACTOME_BRANCHED_CHAIN_AMINO_ACID_CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.1 | 0.6 | REACTOME_CYTOSOLIC_SULFONATION_OF_SMALL_MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 2.3 | REACTOME_AMINO_ACID_SYNTHESIS_AND_INTERCONVERSION_TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 0.6 | REACTOME_TANDEM_PORE_DOMAIN_POTASSIUM_CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 0.8 | REACTOME_SIGNALING_BY_FGFR3_MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.1 | 2.5 | REACTOME_SEMA4D_INDUCED_CELL_MIGRATION_AND_GROWTH_CONE_COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.1 | 6.7 | REACTOME_RESPONSE_TO_ELEVATED_PLATELET_CYTOSOLIC_CA2_ | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.1 | 1.2 | REACTOME_HOMOLOGOUS_RECOMBINATION_REPAIR_OF_REPLICATION_INDEPENDENT_DOUBLE_STRAND_BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.1 | 1.7 | REACTOME_GABA_SYNTHESIS_RELEASE_REUPTAKE_AND_DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 8.5 | REACTOME_PEPTIDE_CHAIN_ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 1.1 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 2.9 | REACTOME_ION_TRANSPORT_BY_P_TYPE_ATPASES | Genes involved in Ion transport by P-type ATPases |
0.1 | 0.5 | REACTOME_DESTABILIZATION_OF_MRNA_BY_TRISTETRAPROLIN_TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.1 | 4.0 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.6 | REACTOME_TRANSPORT_OF_ORGANIC_ANIONS | Genes involved in Transport of organic anions |
0.1 | 2.4 | REACTOME_TIGHT_JUNCTION_INTERACTIONS | Genes involved in Tight junction interactions |
0.1 | 0.4 | REACTOME_ELEVATION_OF_CYTOSOLIC_CA2_LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 0.8 | REACTOME_CHYLOMICRON_MEDIATED_LIPID_TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.1 | 0.6 | REACTOME_GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 1.6 | REACTOME_SYNTHESIS_OF_PC | Genes involved in Synthesis of PC |
0.1 | 0.4 | REACTOME_RAP1_SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 0.4 | REACTOME_DESTABILIZATION_OF_MRNA_BY_KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.1 | 0.9 | REACTOME_POST_CHAPERONIN_TUBULIN_FOLDING_PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 0.4 | REACTOME_IRAK1_RECRUITS_IKK_COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.1 | 1.0 | REACTOME_MRNA_DECAY_BY_5_TO_3_EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 0.3 | REACTOME_DOWNREGULATION_OF_ERBB2_ERBB3_SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 3.7 | REACTOME_NUCLEAR_RECEPTOR_TRANSCRIPTION_PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 6.4 | REACTOME_G_ALPHA_I_SIGNALLING_EVENTS | Genes involved in G alpha (i) signalling events |
0.1 | 1.1 | REACTOME_AMYLOIDS | Genes involved in Amyloids |
0.1 | 0.8 | REACTOME_GLYCOGEN_BREAKDOWN_GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 0.4 | REACTOME_KERATAN_SULFATE_DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 1.0 | REACTOME_CASPASE_MEDIATED_CLEAVAGE_OF_CYTOSKELETAL_PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 1.1 | REACTOME_MITOCHONDRIAL_TRNA_AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.8 | REACTOME_PURINE_SALVAGE | Genes involved in Purine salvage |
0.0 | 0.4 | REACTOME_CTNNB1_PHOSPHORYLATION_CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.7 | REACTOME_APOPTOSIS_INDUCED_DNA_FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 1.1 | REACTOME_GLYCOSPHINGOLIPID_METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 2.5 | REACTOME_DEPOSITION_OF_NEW_CENPA_CONTAINING_NUCLEOSOMES_AT_THE_CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.5 | REACTOME_IRON_UPTAKE_AND_TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 1.0 | REACTOME_IL1_SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 1.4 | REACTOME_INTERFERON_ALPHA_BETA_SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.1 | REACTOME_CA_DEPENDENT_EVENTS | Genes involved in Ca-dependent events |
0.0 | 2.9 | REACTOME_NOTCH1_INTRACELLULAR_DOMAIN_REGULATES_TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.6 | REACTOME_ACTIVATION_OF_BH3_ONLY_PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 1.7 | REACTOME_MRNA_SPLICING_MINOR_PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 1.4 | REACTOME_LATE_PHASE_OF_HIV_LIFE_CYCLE | Genes involved in Late Phase of HIV Life Cycle |
0.0 | 0.7 | REACTOME_PYRIMIDINE_METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 1.0 | REACTOME_TRANSPORT_OF_VITAMINS_NUCLEOSIDES_AND_RELATED_MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.2 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_GOLGI_MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.6 | REACTOME_FORMATION_OF_INCISION_COMPLEX_IN_GG_NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.6 | REACTOME_METABOLISM_OF_PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.1 | REACTOME_PROCESSIVE_SYNTHESIS_ON_THE_LAGGING_STRAND | Genes involved in Processive synthesis on the lagging strand |
0.0 | 0.3 | REACTOME_AMINE_DERIVED_HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.6 | REACTOME_CELL_EXTRACELLULAR_MATRIX_INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.5 | REACTOME_MITOTIC_M_M_G1_PHASES | Genes involved in Mitotic M-M/G1 phases |
0.0 | 1.3 | REACTOME_G_ALPHA_S_SIGNALLING_EVENTS | Genes involved in G alpha (s) signalling events |
0.0 | 0.7 | REACTOME_G1_PHASE | Genes involved in G1 Phase |
0.0 | 0.7 | REACTOME_LATENT_INFECTION_OF_HOMO_SAPIENS_WITH_MYCOBACTERIUM_TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.3 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 2.6 | REACTOME_MRNA_PROCESSING | Genes involved in mRNA Processing |
0.0 | 0.2 | REACTOME_IL_7_SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.2 | REACTOME_CYCLIN_A_B1_ASSOCIATED_EVENTS_DURING_G2_M_TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.3 | REACTOME_PHOSPHORYLATION_OF_THE_APC_C | Genes involved in Phosphorylation of the APC/C |
0.0 | 0.5 | REACTOME_NONSENSE_MEDIATED_DECAY_ENHANCED_BY_THE_EXON_JUNCTION_COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.6 | REACTOME_ENDOSOMAL_SORTING_COMPLEX_REQUIRED_FOR_TRANSPORT_ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.3 | REACTOME_PROCESSING_OF_INTRONLESS_PRE_MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.0 | 1.1 | REACTOME_METABOLISM_OF_VITAMINS_AND_COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 0.2 | REACTOME_STEROID_HORMONES | Genes involved in Steroid hormones |
0.0 | 1.4 | REACTOME_MITOTIC_PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.0 | 0.1 | REACTOME_CHEMOKINE_RECEPTORS_BIND_CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.8 | REACTOME_TRANSCRIPTIONAL_REGULATION_OF_WHITE_ADIPOCYTE_DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.4 | REACTOME_PEROXISOMAL_LIPID_METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.1 | REACTOME_PASSIVE_TRANSPORT_BY_AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 0.9 | REACTOME_RESPIRATORY_ELECTRON_TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.3 | REACTOME_SYNTHESIS_OF_PA | Genes involved in Synthesis of PA |
0.0 | 0.2 | REACTOME_INTRINSIC_PATHWAY_FOR_APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 0.2 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.3 | REACTOME_SYNTHESIS_AND_INTERCONVERSION_OF_NUCLEOTIDE_DI_AND_TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.3 | REACTOME_MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.1 | REACTOME_RECRUITMENT_OF_NUMA_TO_MITOTIC_CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |