Motif ID: Foxj3_Tbl1xr1
Z-value: 1.064


Transcription factors associated with Foxj3_Tbl1xr1:
Gene Symbol | Entrez ID | Gene Name |
---|---|---|
Foxj3 | ENSMUSG00000032998.10 | Foxj3 |
Tbl1xr1 | ENSMUSG00000027630.8 | Tbl1xr1 |
Activity-expression correlation:
Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Foxj3 | mm10_v2_chr4_+_119539652_119539698 | -0.19 | 2.2e-01 | Click! |
Tbl1xr1 | mm10_v2_chr3_+_22076644_22076681 | -0.08 | 6.0e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 3.1 | GO:1990523 | bone regeneration(GO:1990523) |
0.9 | 3.5 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
0.8 | 8.6 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.7 | 5.6 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.6 | 1.8 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
0.6 | 2.3 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.6 | 2.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.5 | 1.6 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
0.5 | 0.5 | GO:1902460 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
0.5 | 1.6 | GO:0090425 | hepatocyte cell migration(GO:0002194) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) positive regulation of forebrain neuron differentiation(GO:2000979) |
0.5 | 1.5 | GO:0030421 | defecation(GO:0030421) |
0.5 | 1.5 | GO:0046110 | xanthine metabolic process(GO:0046110) |
0.5 | 1.4 | GO:0042097 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
0.5 | 1.4 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
0.5 | 1.4 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.4 | 3.1 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.4 | 1.3 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
0.4 | 0.4 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.4 | 1.7 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
0.4 | 2.0 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
0.4 | 1.6 | GO:0035905 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.4 | 1.2 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
0.4 | 1.9 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.4 | 1.1 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.4 | 0.4 | GO:0003134 | BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
0.4 | 1.8 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.4 | 1.4 | GO:2000795 | negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
0.4 | 1.4 | GO:1904565 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
0.3 | 0.7 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.3 | 0.3 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
0.3 | 1.0 | GO:0034287 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.3 | 1.0 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.3 | 1.7 | GO:0021856 | cerebral cortex tangential migration using cell-axon interactions(GO:0021824) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) facioacoustic ganglion development(GO:1903375) |
0.3 | 1.0 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.3 | 1.0 | GO:0097350 | neutrophil clearance(GO:0097350) |
0.3 | 1.0 | GO:0045819 | plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
0.3 | 1.3 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
0.3 | 0.6 | GO:0033083 | immature T cell proliferation(GO:0033079) regulation of immature T cell proliferation(GO:0033083) |
0.3 | 1.3 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.3 | 1.2 | GO:0003342 | proepicardium development(GO:0003342) septum transversum development(GO:0003343) |
0.3 | 1.5 | GO:0070494 | regulation of thrombin receptor signaling pathway(GO:0070494) negative regulation of thrombin receptor signaling pathway(GO:0070495) |
0.3 | 1.2 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.3 | 1.7 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.3 | 0.9 | GO:0045004 | DNA replication proofreading(GO:0045004) |
0.3 | 0.3 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.3 | 1.4 | GO:1900170 | negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
0.3 | 1.4 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
0.3 | 1.6 | GO:0032196 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) transposition(GO:0032196) |
0.3 | 3.0 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.3 | 0.8 | GO:0060745 | mammary gland branching involved in pregnancy(GO:0060745) |
0.3 | 0.5 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.3 | 1.3 | GO:0090427 | activation of meiosis(GO:0090427) |
0.3 | 0.8 | GO:1904170 | regulation of bleb assembly(GO:1904170) |
0.3 | 0.3 | GO:0009067 | asparagine biosynthetic process(GO:0006529) aspartate family amino acid biosynthetic process(GO:0009067) |
0.2 | 0.7 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.2 | 1.5 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.2 | 0.7 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.2 | 2.7 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.2 | 1.0 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.2 | 1.0 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
0.2 | 0.2 | GO:2000256 | positive regulation of male germ cell proliferation(GO:2000256) |
0.2 | 0.5 | GO:0001803 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
0.2 | 0.2 | GO:0061054 | dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
0.2 | 2.8 | GO:0048664 | neuron fate determination(GO:0048664) |
0.2 | 0.2 | GO:0035989 | tendon development(GO:0035989) |
0.2 | 3.2 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.2 | 1.4 | GO:0031120 | snRNA pseudouridine synthesis(GO:0031120) |
0.2 | 0.7 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
0.2 | 0.9 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.2 | 0.7 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
0.2 | 0.7 | GO:1902524 | positive regulation of protein K48-linked ubiquitination(GO:1902524) |
0.2 | 1.1 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.2 | 1.6 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.2 | 0.9 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.2 | 0.7 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
0.2 | 0.2 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.2 | 0.7 | GO:2000314 | negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
0.2 | 1.1 | GO:1902623 | negative regulation of neutrophil migration(GO:1902623) |
0.2 | 0.6 | GO:0061744 | motor behavior(GO:0061744) |
0.2 | 0.6 | GO:0001193 | maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
0.2 | 0.6 | GO:1905203 | regulation of connective tissue replacement(GO:1905203) |
0.2 | 1.5 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.2 | 0.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.2 | 0.4 | GO:1902022 | L-lysine transport(GO:1902022) |
0.2 | 0.8 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.2 | 0.4 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.2 | 0.8 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.2 | 0.6 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.2 | 0.6 | GO:0006404 | RNA import into nucleus(GO:0006404) |
0.2 | 1.0 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.2 | 0.8 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
0.2 | 0.6 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.2 | 0.6 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.2 | 0.2 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.2 | 0.2 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
0.2 | 1.0 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.2 | 0.6 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
0.2 | 0.8 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.2 | 0.4 | GO:0060242 | contact inhibition(GO:0060242) |
0.2 | 0.6 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
0.2 | 1.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.2 | 1.1 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.2 | 1.8 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.2 | 0.7 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.2 | 0.4 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
0.2 | 0.5 | GO:0014738 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.2 | 0.2 | GO:1902730 | positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.2 | 0.5 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.2 | 0.5 | GO:2000319 | negative regulation of T-helper 17 type immune response(GO:2000317) regulation of T-helper 17 cell differentiation(GO:2000319) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
0.2 | 0.2 | GO:1900275 | negative regulation of phospholipase C activity(GO:1900275) |
0.2 | 2.3 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.2 | 0.5 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.2 | 0.2 | GO:0018158 | protein oxidation(GO:0018158) |
0.2 | 0.5 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.2 | 0.5 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
0.2 | 2.6 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.2 | 1.0 | GO:1903056 | positive regulation of lens fiber cell differentiation(GO:1902748) regulation of melanosome organization(GO:1903056) |
0.2 | 0.5 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.2 | 1.0 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.2 | 1.9 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.2 | 0.7 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
0.2 | 0.7 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.2 | 0.2 | GO:0003195 | tricuspid valve formation(GO:0003195) |
0.2 | 3.0 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.2 | 0.2 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) |
0.2 | 0.8 | GO:0042891 | antibiotic transport(GO:0042891) |
0.2 | 0.2 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.2 | 1.3 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.2 | 0.2 | GO:0042160 | lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
0.2 | 1.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.2 | 0.7 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
0.2 | 0.5 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.2 | 0.2 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.2 | 0.3 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.2 | 0.8 | GO:0014062 | regulation of serotonin secretion(GO:0014062) |
0.2 | 0.5 | GO:0032765 | positive regulation of mast cell cytokine production(GO:0032765) |
0.2 | 1.1 | GO:0015862 | uridine transport(GO:0015862) |
0.2 | 0.9 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
0.2 | 1.1 | GO:0042976 | activation of Janus kinase activity(GO:0042976) |
0.2 | 0.2 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
0.2 | 0.3 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.2 | 0.3 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
0.2 | 0.9 | GO:0036337 | Fas signaling pathway(GO:0036337) |
0.1 | 0.4 | GO:1990046 | positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) stress-induced mitochondrial fusion(GO:1990046) |
0.1 | 0.4 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
0.1 | 0.4 | GO:2001160 | regulation of histone H3-K79 methylation(GO:2001160) |
0.1 | 0.4 | GO:0046689 | response to mercury ion(GO:0046689) |
0.1 | 0.4 | GO:0014877 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.1 | 0.1 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.1 | 1.5 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.4 | GO:1903977 | positive regulation of Schwann cell migration(GO:1900149) positive regulation of glial cell migration(GO:1903977) |
0.1 | 0.6 | GO:2000158 | positive regulation of ubiquitin-specific protease activity(GO:2000158) |
0.1 | 0.4 | GO:0050904 | diapedesis(GO:0050904) |
0.1 | 0.3 | GO:0006272 | leading strand elongation(GO:0006272) |
0.1 | 2.1 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) |
0.1 | 0.1 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
0.1 | 0.9 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.1 | 1.0 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 0.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.1 | 0.9 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 0.6 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.1 | 0.3 | GO:0002423 | natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002420) natural killer cell mediated immune response to tumor cell(GO:0002423) regulation of natural killer cell mediated immune response to tumor cell(GO:0002855) regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002858) |
0.1 | 1.0 | GO:0042756 | drinking behavior(GO:0042756) |
0.1 | 0.1 | GO:1904833 | positive regulation of superoxide dismutase activity(GO:1901671) positive regulation of removal of superoxide radicals(GO:1904833) |
0.1 | 0.4 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.1 | 1.0 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.1 | 0.8 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.1 | 0.7 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.1 | 0.6 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 0.1 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
0.1 | 0.1 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.1 | 1.0 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.1 | 0.4 | GO:0046356 | acetyl-CoA catabolic process(GO:0046356) |
0.1 | 0.4 | GO:1904395 | positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.1 | 0.6 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
0.1 | 0.3 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.1 | 0.1 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
0.1 | 0.1 | GO:0045349 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
0.1 | 0.6 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 1.0 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.1 | GO:0060667 | fibroblast growth factor receptor signaling pathway involved in mammary gland specification(GO:0060595) mammary gland bud formation(GO:0060615) branch elongation involved in salivary gland morphogenesis(GO:0060667) mesenchymal cell differentiation involved in lung development(GO:0060915) |
0.1 | 0.3 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.1 | 0.1 | GO:1903463 | regulation of mitotic cell cycle DNA replication(GO:1903463) |
0.1 | 0.3 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 0.3 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.1 | 0.1 | GO:2000426 | negative regulation of apoptotic cell clearance(GO:2000426) |
0.1 | 0.1 | GO:0002585 | regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) regulation of antigen processing and presentation of peptide antigen(GO:0002583) positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
0.1 | 0.1 | GO:0050855 | regulation of B cell receptor signaling pathway(GO:0050855) negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.1 | 5.6 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.1 | 0.9 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
0.1 | 0.9 | GO:0007418 | ventral midline development(GO:0007418) |
0.1 | 0.4 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 2.1 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 0.4 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.1 | 0.4 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
0.1 | 0.5 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.1 | 0.1 | GO:0072173 | metanephric tubule morphogenesis(GO:0072173) |
0.1 | 0.8 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
0.1 | 0.3 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.1 | 1.2 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.1 | 0.5 | GO:0070305 | response to cGMP(GO:0070305) cellular response to cGMP(GO:0071321) |
0.1 | 0.4 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 1.7 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.1 | 0.3 | GO:2000790 | regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) |
0.1 | 2.2 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.1 | 0.3 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.1 | 0.5 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.1 | 0.3 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.1 | 0.8 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
0.1 | 0.5 | GO:2000258 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
0.1 | 0.4 | GO:1905065 | positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
0.1 | 0.1 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.1 | 0.5 | GO:2000911 | positive regulation of cholesterol import(GO:1904109) positive regulation of sterol import(GO:2000911) |
0.1 | 0.6 | GO:0052428 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.1 | 0.5 | GO:0021861 | forebrain radial glial cell differentiation(GO:0021861) |
0.1 | 0.5 | GO:0075136 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.1 | 0.9 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.2 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.1 | 0.5 | GO:0051933 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
0.1 | 0.7 | GO:0097473 | cellular response to light intensity(GO:0071484) cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
0.1 | 0.6 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.1 | 0.1 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) |
0.1 | 0.6 | GO:0080184 | response to stilbenoid(GO:0035634) response to phenylpropanoid(GO:0080184) |
0.1 | 0.4 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
0.1 | 0.8 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.1 | 0.4 | GO:0032701 | negative regulation of interleukin-18 production(GO:0032701) |
0.1 | 0.6 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.1 | 0.1 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
0.1 | 0.7 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.1 | 0.2 | GO:1903895 | negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
0.1 | 0.8 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.1 | 0.2 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.1 | 0.6 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.1 | 0.5 | GO:0000237 | leptotene(GO:0000237) |
0.1 | 0.4 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.1 | 0.6 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.1 | 1.2 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
0.1 | 0.5 | GO:0019323 | pentose catabolic process(GO:0019323) |
0.1 | 0.7 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 0.8 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.1 | 1.0 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.1 | 0.2 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.1 | 0.1 | GO:1905075 | occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
0.1 | 0.2 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.1 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.1 | 0.4 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.1 | 0.1 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.1 | 0.1 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.1 | 0.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.1 | 0.3 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) |
0.1 | 2.3 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
0.1 | 2.5 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.1 | 0.2 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
0.1 | 0.4 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.1 | 0.3 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
0.1 | 0.1 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
0.1 | 0.2 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.1 | 0.9 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
0.1 | 0.5 | GO:0002339 | B cell selection(GO:0002339) |
0.1 | 0.8 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.1 | 0.5 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.1 | 0.1 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
0.1 | 0.9 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.1 | 1.1 | GO:0072202 | cell differentiation involved in metanephros development(GO:0072202) |
0.1 | 0.4 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
0.1 | 0.2 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 0.3 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.1 | 0.3 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.3 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.2 | GO:0001757 | somite specification(GO:0001757) |
0.1 | 0.4 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.1 | 1.1 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
0.1 | 0.8 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.1 | 0.1 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
0.1 | 0.1 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.1 | 0.8 | GO:1903874 | ferrous iron transmembrane transport(GO:1903874) |
0.1 | 1.8 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
0.1 | 0.2 | GO:0051030 | snRNA transport(GO:0051030) |
0.1 | 0.4 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.1 | 0.2 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.1 | 1.9 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.1 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.3 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.1 | 0.2 | GO:0071707 | immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
0.1 | 0.2 | GO:0035947 | regulation of gluconeogenesis by regulation of transcription from RNA polymerase II promoter(GO:0035947) |
0.1 | 0.4 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.2 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.1 | 0.5 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
0.1 | 0.2 | GO:0036292 | DNA rewinding(GO:0036292) |
0.1 | 0.2 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.1 | 0.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.1 | 0.5 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 0.4 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.1 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.1 | 0.8 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.1 | 1.0 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
0.1 | 1.5 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
0.1 | 0.4 | GO:0007320 | insemination(GO:0007320) |
0.1 | 0.2 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
0.1 | 0.4 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.1 | GO:0051026 | chiasma assembly(GO:0051026) |
0.1 | 0.1 | GO:1904578 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
0.1 | 0.5 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.1 | 0.5 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
0.1 | 0.4 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
0.1 | 0.2 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.1 | 0.5 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.1 | 0.3 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.1 | 0.8 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) |
0.1 | 0.1 | GO:0044253 | positive regulation of collagen metabolic process(GO:0010714) positive regulation of multicellular organismal metabolic process(GO:0044253) |
0.1 | 0.5 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.1 | 0.2 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.1 | 0.6 | GO:0042402 | cellular biogenic amine catabolic process(GO:0042402) |
0.1 | 0.4 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
0.1 | 0.4 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.1 | 0.7 | GO:0072529 | pyrimidine-containing compound catabolic process(GO:0072529) |
0.1 | 0.1 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.1 | 0.6 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 0.3 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.1 | 0.3 | GO:0044028 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
0.1 | 0.1 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.1 | 0.4 | GO:0019695 | choline metabolic process(GO:0019695) |
0.1 | 0.4 | GO:0015825 | L-serine transport(GO:0015825) |
0.1 | 0.6 | GO:0072081 | proximal/distal pattern formation involved in nephron development(GO:0072047) specification of nephron tubule identity(GO:0072081) specification of loop of Henle identity(GO:0072086) |
0.1 | 0.6 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.1 | 0.7 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
0.1 | 0.7 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.1 | 0.4 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.1 | 0.9 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.1 | 0.3 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.1 | 0.6 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.1 | 0.3 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.1 | 0.3 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.1 | 0.1 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.1 | 0.7 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.1 | 1.4 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.1 | 0.4 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.1 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.1 | 0.4 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
0.1 | 0.2 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.1 | 0.2 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.1 | 0.2 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.5 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 1.5 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.1 | 0.2 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.1 | 1.5 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.1 | 0.5 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.1 | 0.4 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.1 | 0.2 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
0.1 | 0.6 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.1 | 0.3 | GO:0048687 | positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) |
0.1 | 0.7 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.1 | 0.2 | GO:1904238 | pericyte cell differentiation(GO:1904238) |
0.1 | 0.6 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.1 | 0.4 | GO:0042255 | ribosome assembly(GO:0042255) |
0.1 | 0.4 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
0.1 | 2.5 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.1 | 0.5 | GO:1904177 | regulation of adipose tissue development(GO:1904177) |
0.1 | 0.4 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 0.3 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
0.1 | 0.3 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.1 | 0.3 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.1 | 0.5 | GO:0043586 | tongue development(GO:0043586) |
0.1 | 0.3 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.1 | 0.3 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.1 | 0.3 | GO:0051096 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
0.1 | 0.3 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.1 | 0.3 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.1 | 0.3 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.1 | 0.3 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.1 | 0.4 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.9 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.1 | 0.3 | GO:1900150 | regulation of defense response to fungus(GO:1900150) |
0.1 | 0.4 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
0.1 | 0.3 | GO:0043144 | snoRNA processing(GO:0043144) |
0.1 | 0.1 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
0.1 | 0.1 | GO:0006998 | nuclear envelope organization(GO:0006998) |
0.1 | 1.3 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.1 | 0.2 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.1 | 0.6 | GO:0046549 | retinal cone cell development(GO:0046549) |
0.1 | 0.2 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.1 | 0.2 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.1 | 0.2 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
0.1 | 0.4 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.1 | 0.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 0.3 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
0.1 | 0.2 | GO:0006710 | androgen catabolic process(GO:0006710) |
0.1 | 0.2 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.1 | 0.4 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.1 | 0.4 | GO:0035036 | binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
0.1 | 0.2 | GO:0010730 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
0.1 | 1.2 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.2 | GO:0060558 | regulation of calcidiol 1-monooxygenase activity(GO:0060558) |
0.1 | 0.5 | GO:0090070 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
0.1 | 0.6 | GO:0002920 | regulation of humoral immune response(GO:0002920) |
0.1 | 0.2 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
0.1 | 0.2 | GO:1904139 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.1 | 0.2 | GO:0006011 | UDP-glucose metabolic process(GO:0006011) |
0.1 | 0.2 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.1 | 0.2 | GO:0031590 | wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
0.1 | 0.3 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.1 | 0.1 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.1 | 0.9 | GO:0031272 | regulation of pseudopodium assembly(GO:0031272) |
0.1 | 0.4 | GO:1902583 | viral mRNA export from host cell nucleus(GO:0046784) intracellular transport of virus(GO:0075733) multi-organism intracellular transport(GO:1902583) |
0.1 | 0.3 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.3 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.1 | 0.9 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.1 | 0.2 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
0.1 | 2.8 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.1 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.1 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.1 | 0.1 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) quinolinate metabolic process(GO:0046874) |
0.1 | 0.8 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.1 | 0.8 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.1 | 0.9 | GO:0072189 | ureter development(GO:0072189) |
0.1 | 0.5 | GO:0001980 | regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
0.1 | 0.2 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
0.1 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.1 | 0.7 | GO:0097341 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) |
0.1 | 0.1 | GO:0001676 | long-chain fatty acid metabolic process(GO:0001676) |
0.1 | 0.3 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.1 | 0.6 | GO:0043029 | T cell homeostasis(GO:0043029) |
0.1 | 0.2 | GO:0030827 | negative regulation of cGMP metabolic process(GO:0030824) negative regulation of cGMP biosynthetic process(GO:0030827) negative regulation of guanylate cyclase activity(GO:0031283) |
0.1 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.1 | 0.1 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
0.1 | 0.8 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.1 | 0.4 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.1 | 1.8 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.1 | 0.1 | GO:0046051 | UTP metabolic process(GO:0046051) |
0.1 | 3.3 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
0.1 | 0.4 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.1 | 0.8 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 0.1 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.1 | 0.1 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.1 | 0.2 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
0.1 | 0.2 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.1 | 0.2 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.1 | 0.6 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
0.1 | 0.9 | GO:0044550 | secondary metabolite biosynthetic process(GO:0044550) |
0.1 | 1.4 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.1 | 0.4 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.1 | 0.3 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.1 | 1.0 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.1 | 0.2 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.1 | 0.6 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.1 | 0.1 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
0.1 | 0.4 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.1 | 0.6 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.1 | 0.1 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.1 | 0.3 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.3 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.6 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.1 | 0.1 | GO:0060594 | mammary gland specification(GO:0060594) |
0.1 | 0.3 | GO:0032804 | negative regulation of low-density lipoprotein particle receptor catabolic process(GO:0032804) dibasic protein processing(GO:0090472) |
0.1 | 0.2 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.1 | 0.7 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.1 | 0.1 | GO:0060849 | regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
0.1 | 0.1 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.1 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.1 | 0.5 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.1 | 0.3 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
0.1 | 0.1 | GO:0009814 | defense response, incompatible interaction(GO:0009814) |
0.1 | 0.4 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.1 | 0.4 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.1 | 0.2 | GO:0050909 | sensory perception of taste(GO:0050909) |
0.1 | 0.2 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.1 | 0.9 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.1 | 0.2 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.1 | 0.3 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.1 | 0.7 | GO:0006534 | cysteine metabolic process(GO:0006534) |
0.1 | 0.1 | GO:1903207 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.1 | 1.0 | GO:0060707 | trophoblast giant cell differentiation(GO:0060707) |
0.1 | 0.1 | GO:0033522 | histone H2A ubiquitination(GO:0033522) |
0.1 | 0.1 | GO:0071600 | otic vesicle morphogenesis(GO:0071600) |
0.1 | 0.1 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.1 | 0.2 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) |
0.1 | 0.2 | GO:0050957 | equilibrioception(GO:0050957) |
0.1 | 0.2 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.1 | 0.6 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.1 | 0.2 | GO:0009177 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate metabolic process(GO:0009176) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
0.1 | 0.6 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.1 | 0.1 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
0.1 | 0.3 | GO:0098700 | neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.1 | 0.1 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
0.1 | 0.1 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
0.1 | 0.1 | GO:0070384 | Harderian gland development(GO:0070384) |
0.1 | 0.3 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
0.1 | 1.2 | GO:0060416 | response to growth hormone(GO:0060416) |
0.1 | 0.3 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
0.1 | 0.2 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.1 | 1.0 | GO:0030903 | notochord development(GO:0030903) |
0.1 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.4 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 0.5 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.1 | 0.1 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
0.1 | 0.1 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.1 | 0.3 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.1 | 0.3 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
0.1 | 3.7 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.1 | 0.4 | GO:0097646 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
0.1 | 0.4 | GO:1901970 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.1 | 0.2 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.1 | 0.2 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.1 | 0.6 | GO:0033273 | response to vitamin(GO:0033273) |
0.1 | 0.2 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.2 | GO:1905247 | positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
0.1 | 0.4 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
0.1 | 0.3 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.1 | 2.8 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.1 | 0.2 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
0.1 | 0.1 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
0.1 | 0.1 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.1 | 3.3 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.1 | 0.1 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.1 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.1 | 0.2 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) cardiolipin biosynthetic process(GO:0032049) |
0.1 | 0.1 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
0.1 | 0.3 | GO:0031034 | myosin filament assembly(GO:0031034) striated muscle myosin thick filament assembly(GO:0071688) |
0.1 | 1.6 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.1 | 0.2 | GO:0048698 | negative regulation of collateral sprouting in absence of injury(GO:0048698) |
0.1 | 0.2 | GO:2000616 | negative regulation of histone H3-K9 acetylation(GO:2000616) |
0.1 | 0.5 | GO:0042167 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 0.3 | GO:1901563 | response to camptothecin(GO:1901563) |
0.1 | 0.1 | GO:0042938 | dipeptide transport(GO:0042938) |
0.1 | 0.7 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.2 | GO:2000279 | negative regulation of DNA biosynthetic process(GO:2000279) |
0.1 | 0.3 | GO:0015788 | UDP-N-acetylglucosamine transport(GO:0015788) |
0.1 | 0.1 | GO:0071211 | protein targeting to vacuole involved in autophagy(GO:0071211) |
0.1 | 0.2 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
0.1 | 0.4 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
0.1 | 0.3 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.1 | 0.9 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) branched-chain amino acid catabolic process(GO:0009083) |
0.1 | 0.2 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.1 | 0.3 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.2 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.1 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.1 | 0.2 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.1 | 1.2 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.1 | 1.3 | GO:0042773 | ATP synthesis coupled electron transport(GO:0042773) |
0.1 | 0.1 | GO:0042117 | monocyte activation(GO:0042117) |
0.1 | 0.4 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.1 | 0.1 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
0.1 | 0.1 | GO:0031652 | positive regulation of heat generation(GO:0031652) |
0.1 | 0.1 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
0.1 | 0.1 | GO:0019405 | alditol catabolic process(GO:0019405) |
0.1 | 0.1 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.1 | 0.2 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
0.1 | 0.2 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.4 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.1 | 0.2 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.1 | 0.3 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.1 | 0.1 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
0.1 | 0.4 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
0.1 | 2.0 | GO:0035456 | response to interferon-beta(GO:0035456) |
0.1 | 0.3 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
0.1 | 0.2 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.1 | 0.2 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.2 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.1 | GO:1902188 | positive regulation of viral release from host cell(GO:1902188) |
0.1 | 0.1 | GO:1904959 | regulation of electron carrier activity(GO:1904732) regulation of cytochrome-c oxidase activity(GO:1904959) |
0.1 | 0.1 | GO:0003190 | heart valve formation(GO:0003188) atrioventricular valve formation(GO:0003190) mitral valve formation(GO:0003192) |
0.1 | 0.5 | GO:0042640 | anagen(GO:0042640) |
0.1 | 0.8 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
0.1 | 0.4 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.1 | 0.4 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.1 | 0.2 | GO:0046032 | ADP catabolic process(GO:0046032) |
0.1 | 0.4 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.4 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.6 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.2 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
0.0 | 0.1 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
0.0 | 0.8 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
0.0 | 0.3 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.0 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.0 | 0.0 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
0.0 | 0.1 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.1 | GO:0031657 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.0 | 0.2 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.0 | 0.7 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.0 | 0.2 | GO:1904705 | regulation of vascular smooth muscle cell proliferation(GO:1904705) vascular smooth muscle cell proliferation(GO:1990874) |
0.0 | 0.1 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
0.0 | 0.4 | GO:0042832 | defense response to protozoan(GO:0042832) |
0.0 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.0 | 1.1 | GO:0006298 | mismatch repair(GO:0006298) |
0.0 | 0.1 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.0 | 0.4 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.0 | 0.2 | GO:0061042 | vascular wound healing(GO:0061042) |
0.0 | 0.1 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.0 | 0.2 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.0 | 0.0 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.0 | 0.0 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.0 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.0 | 0.2 | GO:0019659 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.0 | 0.1 | GO:0001991 | regulation of systemic arterial blood pressure by circulatory renin-angiotensin(GO:0001991) |
0.0 | 0.7 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.1 | GO:0008272 | sulfate transport(GO:0008272) |
0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.5 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.3 | GO:0007035 | vacuolar acidification(GO:0007035) |
0.0 | 0.2 | GO:2000794 | regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
0.0 | 0.1 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
0.0 | 0.6 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
0.0 | 0.2 | GO:0006953 | acute-phase response(GO:0006953) |
0.0 | 0.8 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.3 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.0 | 0.2 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.0 | 0.1 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
0.0 | 0.1 | GO:2000674 | regulation of type B pancreatic cell apoptotic process(GO:2000674) |
0.0 | 0.1 | GO:0001659 | temperature homeostasis(GO:0001659) |
0.0 | 0.8 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
0.0 | 0.0 | GO:0009595 | detection of biotic stimulus(GO:0009595) detection of bacterium(GO:0016045) detection of other organism(GO:0098543) detection of external biotic stimulus(GO:0098581) |
0.0 | 0.3 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.0 | 0.8 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.0 | 0.1 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
0.0 | 0.2 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.2 | GO:1904627 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
0.0 | 0.4 | GO:0045931 | positive regulation of mitotic cell cycle(GO:0045931) |
0.0 | 0.2 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.0 | 0.3 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.0 | 0.2 | GO:0050812 | regulation of acyl-CoA biosynthetic process(GO:0050812) |
0.0 | 0.1 | GO:0035106 | operant conditioning(GO:0035106) |
0.0 | 0.1 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
0.0 | 0.1 | GO:0042196 | dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
0.0 | 0.3 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
0.0 | 0.0 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) |
0.0 | 0.3 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.0 | 0.1 | GO:1902741 | type I interferon secretion(GO:0072641) interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
0.0 | 0.2 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.0 | 0.6 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) ribonucleoside catabolic process(GO:0042454) purine ribonucleoside catabolic process(GO:0046130) |
0.0 | 0.1 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.4 | GO:0006465 | signal peptide processing(GO:0006465) |
0.0 | 0.0 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.0 | 0.3 | GO:0019433 | triglyceride catabolic process(GO:0019433) |
0.0 | 0.1 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.0 | 0.2 | GO:0051004 | regulation of lipoprotein lipase activity(GO:0051004) |
0.0 | 0.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.0 | 0.2 | GO:0098706 | iron ion transmembrane transport(GO:0034755) iron ion import into cell(GO:0097459) ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) iron ion import across plasma membrane(GO:0098711) |
0.0 | 0.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.0 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.0 | 0.1 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
0.0 | 0.3 | GO:0032731 | positive regulation of interleukin-1 beta production(GO:0032731) |
0.0 | 0.0 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.0 | 0.3 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 1.1 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.0 | 0.0 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.0 | 0.1 | GO:0060572 | morphogenesis of an epithelial bud(GO:0060572) |
0.0 | 0.2 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.1 | GO:1901072 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) glucosamine-containing compound catabolic process(GO:1901072) |
0.0 | 0.1 | GO:0051309 | female meiosis chromosome separation(GO:0051309) |
0.0 | 0.2 | GO:0002086 | diaphragm contraction(GO:0002086) |
0.0 | 0.1 | GO:0097435 | fibril organization(GO:0097435) |
0.0 | 0.1 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.0 | 0.4 | GO:0071456 | cellular response to decreased oxygen levels(GO:0036294) cellular response to hypoxia(GO:0071456) |
0.0 | 0.6 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.0 | 0.5 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.2 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
0.0 | 0.2 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.0 | 0.1 | GO:0002676 | regulation of chronic inflammatory response(GO:0002676) |
0.0 | 0.4 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.5 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
0.0 | 0.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.0 | GO:0016114 | terpenoid biosynthetic process(GO:0016114) |
0.0 | 0.2 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
0.0 | 0.5 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.0 | GO:0090193 | glomerular mesangium development(GO:0072109) regulation of glomerular mesangial cell proliferation(GO:0072124) positive regulation of glomerular mesangial cell proliferation(GO:0072126) regulation of glomerulus development(GO:0090192) positive regulation of glomerulus development(GO:0090193) |
0.0 | 0.1 | GO:0043383 | negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
0.0 | 0.2 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.0 | 0.2 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.0 | 0.1 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
0.0 | 0.1 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
0.0 | 0.2 | GO:0033580 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
0.0 | 0.0 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.0 | 0.3 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.2 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.0 | 1.0 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
0.0 | 0.2 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.0 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.2 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.0 | 0.2 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
0.0 | 0.1 | GO:0045187 | regulation of circadian sleep/wake cycle(GO:0042749) regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
0.0 | 0.1 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
0.0 | 0.3 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 0.4 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.0 | 0.3 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.0 | 0.1 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
0.0 | 0.3 | GO:0035337 | fatty-acyl-CoA metabolic process(GO:0035337) |
0.0 | 0.1 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.2 | GO:2000194 | regulation of female gonad development(GO:2000194) |
0.0 | 0.2 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.1 | GO:0015791 | polyol transport(GO:0015791) |
0.0 | 0.3 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.0 | 0.1 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
0.0 | 0.0 | GO:0003091 | renal water homeostasis(GO:0003091) |
0.0 | 0.2 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.0 | 0.2 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 0.4 | GO:0042311 | vasodilation(GO:0042311) |
0.0 | 0.2 | GO:0030242 | pexophagy(GO:0030242) |
0.0 | 0.1 | GO:0014005 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
0.0 | 0.6 | GO:0030225 | macrophage differentiation(GO:0030225) |
0.0 | 0.5 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
0.0 | 0.2 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
0.0 | 0.1 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
0.0 | 0.1 | GO:0051316 | attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
0.0 | 0.2 | GO:0090234 | regulation of kinetochore assembly(GO:0090234) |
0.0 | 0.2 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.3 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.0 | 0.1 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.0 | GO:2000780 | negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
0.0 | 0.5 | GO:0031365 | N-terminal protein amino acid modification(GO:0031365) |
0.0 | 0.0 | GO:1990379 | lipid transport across blood brain barrier(GO:1990379) |
0.0 | 0.1 | GO:0071481 | cellular response to X-ray(GO:0071481) |
0.0 | 0.1 | GO:0070343 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.0 | 0.1 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.0 | 0.0 | GO:0032621 | interleukin-18 production(GO:0032621) |
0.0 | 0.1 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.2 | GO:0030431 | sleep(GO:0030431) |
0.0 | 0.2 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
0.0 | 0.4 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.0 | 1.7 | GO:0098773 | skin epidermis development(GO:0098773) |
0.0 | 0.2 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.0 | 0.2 | GO:0006983 | ER overload response(GO:0006983) |
0.0 | 0.3 | GO:0033574 | response to testosterone(GO:0033574) |
0.0 | 0.1 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.0 | 0.2 | GO:0071428 | rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
0.0 | 0.4 | GO:0001675 | acrosome assembly(GO:0001675) |
0.0 | 1.0 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.1 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.0 | 0.2 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
0.0 | 0.1 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.0 | 0.1 | GO:0002347 | response to tumor cell(GO:0002347) |
0.0 | 0.1 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.0 | 0.3 | GO:1903963 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.0 | 0.2 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.0 | 0.1 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.1 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.0 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.3 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.0 | 0.1 | GO:0019395 | fatty acid oxidation(GO:0019395) lipid oxidation(GO:0034440) |
0.0 | 0.1 | GO:0006026 | aminoglycan catabolic process(GO:0006026) |
0.0 | 0.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.1 | GO:0009208 | pyrimidine ribonucleoside triphosphate metabolic process(GO:0009208) |
0.0 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.1 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.0 | 0.5 | GO:0044804 | nucleophagy(GO:0044804) |
0.0 | 0.0 | GO:0035455 | response to interferon-alpha(GO:0035455) |
0.0 | 0.3 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.2 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.0 | 0.1 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
0.0 | 0.1 | GO:0060346 | bone trabecula formation(GO:0060346) |
0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
0.0 | 0.1 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.1 | GO:0072530 | purine-containing compound transmembrane transport(GO:0072530) |
0.0 | 0.2 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.0 | 0.4 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
0.0 | 0.0 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.2 | GO:0044241 | lipid digestion(GO:0044241) |
0.0 | 0.0 | GO:0002360 | T cell lineage commitment(GO:0002360) |
0.0 | 0.0 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
0.0 | 0.4 | GO:0072528 | pyrimidine-containing compound biosynthetic process(GO:0072528) |
0.0 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.1 | GO:0051311 | meiotic metaphase plate congression(GO:0051311) |
0.0 | 0.1 | GO:0042730 | fibrinolysis(GO:0042730) |
0.0 | 0.1 | GO:0034308 | primary alcohol metabolic process(GO:0034308) |
0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 0.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.1 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.1 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.0 | 0.1 | GO:0032570 | response to progesterone(GO:0032570) |
0.0 | 0.0 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
0.0 | 0.1 | GO:0006968 | cellular defense response(GO:0006968) |
0.0 | 0.4 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.3 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.0 | 0.2 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.2 | GO:0098964 | dendritic transport of ribonucleoprotein complex(GO:0098961) dendritic transport of messenger ribonucleoprotein complex(GO:0098963) anterograde dendritic transport of messenger ribonucleoprotein complex(GO:0098964) |
0.0 | 0.1 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
0.0 | 0.1 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.0 | 0.1 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
0.0 | 0.7 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.5 | GO:0010842 | retina layer formation(GO:0010842) |
0.0 | 0.1 | GO:0032096 | negative regulation of response to food(GO:0032096) negative regulation of appetite(GO:0032099) |
0.0 | 0.1 | GO:1900244 | positive regulation of synaptic vesicle endocytosis(GO:1900244) |
0.0 | 0.2 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.0 | 0.1 | GO:0046851 | negative regulation of bone resorption(GO:0045779) negative regulation of bone remodeling(GO:0046851) |
0.0 | 0.1 | GO:0007063 | regulation of sister chromatid cohesion(GO:0007063) |
0.0 | 0.2 | GO:0010955 | negative regulation of protein processing(GO:0010955) negative regulation of protein maturation(GO:1903318) |
0.0 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
0.0 | 0.2 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.1 | GO:1903902 | positive regulation of viral life cycle(GO:1903902) |
0.0 | 0.2 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.1 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
0.0 | 0.0 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
0.0 | 0.6 | GO:0045670 | regulation of osteoclast differentiation(GO:0045670) |
0.0 | 0.1 | GO:0060055 | angiogenesis involved in wound healing(GO:0060055) |
0.0 | 0.3 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.0 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.0 | 0.2 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
0.0 | 0.3 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
0.0 | 0.1 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
0.0 | 0.1 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.0 | 0.1 | GO:0070625 | zymogen granule exocytosis(GO:0070625) |
0.0 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.3 | GO:0019884 | antigen processing and presentation of exogenous antigen(GO:0019884) |
0.0 | 0.1 | GO:0014821 | phasic smooth muscle contraction(GO:0014821) |
0.0 | 0.1 | GO:0046688 | response to copper ion(GO:0046688) |
0.0 | 0.1 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.0 | 0.0 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.3 | GO:1901629 | regulation of presynaptic membrane organization(GO:1901629) |
0.0 | 0.7 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
0.0 | 0.2 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.0 | 0.1 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
0.0 | 0.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.1 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
0.0 | 0.1 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
0.0 | 0.3 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
0.0 | 0.2 | GO:0042633 | molting cycle(GO:0042303) hair cycle(GO:0042633) |
0.0 | 0.0 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.0 | 0.0 | GO:0030862 | positive regulation of polarized epithelial cell differentiation(GO:0030862) |
0.0 | 0.0 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.0 | 0.1 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.0 | 0.2 | GO:0031664 | regulation of lipopolysaccharide-mediated signaling pathway(GO:0031664) |
0.0 | 0.0 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.0 | 0.0 | GO:0040018 | positive regulation of multicellular organism growth(GO:0040018) |
0.0 | 0.3 | GO:0031297 | replication fork processing(GO:0031297) |
0.0 | 0.1 | GO:0018126 | protein hydroxylation(GO:0018126) |
0.0 | 0.2 | GO:0070986 | left/right axis specification(GO:0070986) |
0.0 | 0.0 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.0 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
0.0 | 0.0 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
0.0 | 0.1 | GO:0042559 | pteridine-containing compound biosynthetic process(GO:0042559) |
0.0 | 0.1 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.0 | 0.0 | GO:2000812 | regulation of barbed-end actin filament capping(GO:2000812) |
0.0 | 0.1 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
0.0 | 0.1 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.0 | 0.1 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.0 | 0.1 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.0 | 0.4 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.1 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.0 | 0.2 | GO:0030104 | water homeostasis(GO:0030104) |
0.0 | 0.0 | GO:0090327 | negative regulation of locomotion involved in locomotory behavior(GO:0090327) |
0.0 | 0.0 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
0.0 | 0.1 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
0.0 | 0.1 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
0.0 | 0.0 | GO:0032673 | regulation of interleukin-4 production(GO:0032673) positive regulation of interleukin-4 production(GO:0032753) |
0.0 | 0.0 | GO:0060312 | regulation of blood vessel remodeling(GO:0060312) |
0.0 | 0.3 | GO:0048662 | negative regulation of smooth muscle cell proliferation(GO:0048662) |
0.0 | 0.1 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
0.0 | 0.0 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
0.0 | 0.0 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.0 | GO:0035928 | RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) rRNA transport(GO:0051029) |
0.0 | 0.1 | GO:0071470 | cellular response to osmotic stress(GO:0071470) |
0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.2 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
0.0 | 0.4 | GO:0001756 | somitogenesis(GO:0001756) |
0.0 | 0.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.2 | GO:0009142 | nucleoside triphosphate biosynthetic process(GO:0009142) |
0.0 | 0.1 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.0 | 0.0 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.0 | 0.1 | GO:0042182 | ketone catabolic process(GO:0042182) |
0.0 | 0.1 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.0 | 0.1 | GO:0071624 | positive regulation of granulocyte chemotaxis(GO:0071624) positive regulation of neutrophil chemotaxis(GO:0090023) |
0.0 | 0.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) rRNA (guanine-N7)-methylation(GO:0070476) |
0.0 | 0.1 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
0.0 | 0.1 | GO:0070092 | glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.3 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
0.0 | 0.2 | GO:0042119 | neutrophil activation(GO:0042119) |
0.0 | 0.0 | GO:0042993 | positive regulation of transcription factor import into nucleus(GO:0042993) |
0.0 | 0.7 | GO:0006400 | tRNA modification(GO:0006400) |
0.0 | 0.1 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.0 | 0.1 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.1 | GO:0043174 | purine ribonucleoside salvage(GO:0006166) nucleoside salvage(GO:0043174) |
0.0 | 0.2 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.3 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
0.0 | 0.1 | GO:0071569 | protein ufmylation(GO:0071569) |
0.0 | 0.1 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.1 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
0.0 | 0.1 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.0 | GO:0071806 | intracellular protein transmembrane transport(GO:0065002) protein transmembrane transport(GO:0071806) |
0.0 | 0.0 | GO:0002544 | chronic inflammatory response(GO:0002544) |
0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.0 | 0.0 | GO:0045069 | regulation of viral genome replication(GO:0045069) |
0.0 | 0.1 | GO:0014002 | astrocyte development(GO:0014002) |
0.0 | 0.6 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.0 | GO:1903960 | negative regulation of anion transmembrane transport(GO:1903960) |
0.0 | 0.1 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
0.0 | 0.2 | GO:0006303 | non-recombinational repair(GO:0000726) double-strand break repair via nonhomologous end joining(GO:0006303) |
0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.0 | 0.0 | GO:0070232 | regulation of T cell apoptotic process(GO:0070232) |
0.0 | 0.2 | GO:0006555 | methionine metabolic process(GO:0006555) |
0.0 | 0.1 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.0 | 0.1 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
0.0 | 0.1 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.1 | GO:0090282 | trophectodermal cellular morphogenesis(GO:0001831) positive regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071931) positive regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0090282) |
0.0 | 0.5 | GO:0031050 | dsRNA fragmentation(GO:0031050) production of miRNAs involved in gene silencing by miRNA(GO:0035196) production of small RNA involved in gene silencing by RNA(GO:0070918) |
0.0 | 0.0 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.0 | 0.6 | GO:0000956 | nuclear-transcribed mRNA catabolic process(GO:0000956) |
0.0 | 0.1 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.0 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
0.0 | 0.1 | GO:0034285 | response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
0.0 | 0.1 | GO:0046033 | AMP metabolic process(GO:0046033) |
0.0 | 0.2 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
0.0 | 0.9 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.0 | 0.1 | GO:1905169 | protein localization to phagocytic vesicle(GO:1905161) regulation of protein localization to phagocytic vesicle(GO:1905169) positive regulation of protein localization to phagocytic vesicle(GO:1905171) |
0.0 | 0.0 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.0 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.0 | 0.0 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.2 | GO:0045056 | transcytosis(GO:0045056) |
0.0 | 0.0 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
0.0 | 0.0 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.0 | 0.2 | GO:0000338 | protein deneddylation(GO:0000338) |
0.0 | 0.2 | GO:0036037 | CD8-positive, alpha-beta T cell activation(GO:0036037) CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
0.0 | 0.0 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.0 | 0.0 | GO:0060261 | positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
0.0 | 0.0 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
0.0 | 0.1 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.0 | GO:0006544 | glycine metabolic process(GO:0006544) |
0.0 | 0.0 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.0 | 0.5 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.2 | GO:0030520 | intracellular estrogen receptor signaling pathway(GO:0030520) |
0.0 | 0.0 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.0 | 0.0 | GO:0060965 | negative regulation of gene silencing by miRNA(GO:0060965) |
0.0 | 0.1 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.0 | 0.4 | GO:0001919 | regulation of receptor recycling(GO:0001919) |
0.0 | 0.1 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
0.0 | 0.1 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) negative regulation of peptidyl-lysine acetylation(GO:2000757) |
0.0 | 0.1 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.0 | 0.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.0 | 0.1 | GO:0090383 | phagosome acidification(GO:0090383) |
0.0 | 0.0 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.1 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
0.0 | 0.2 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 0.3 | GO:0007608 | sensory perception of smell(GO:0007608) |
0.0 | 0.0 | GO:2000542 | negative regulation of gastrulation(GO:2000542) |
0.0 | 0.0 | GO:0021852 | pyramidal neuron migration(GO:0021852) |
0.0 | 0.0 | GO:0046639 | negative regulation of T-helper 2 cell differentiation(GO:0045629) negative regulation of alpha-beta T cell differentiation(GO:0046639) |
0.0 | 0.1 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
0.0 | 0.0 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.1 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
0.0 | 0.0 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.0 | 0.1 | GO:0009437 | amino-acid betaine metabolic process(GO:0006577) carnitine metabolic process(GO:0009437) |
0.0 | 0.2 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.0 | GO:2001022 | positive regulation of response to DNA damage stimulus(GO:2001022) |
0.0 | 0.1 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.2 | GO:0030199 | collagen fibril organization(GO:0030199) |
0.0 | 0.2 | GO:0019731 | antibacterial humoral response(GO:0019731) |
0.0 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.0 | 0.1 | GO:0042755 | eating behavior(GO:0042755) |
0.0 | 0.0 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.0 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.0 | 0.0 | GO:0043686 | co-translational protein modification(GO:0043686) |
0.0 | 0.1 | GO:0007398 | ectoderm development(GO:0007398) |
0.0 | 0.2 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.0 | 0.0 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
0.0 | 0.3 | GO:0095500 | acetylcholine receptor signaling pathway(GO:0095500) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
0.0 | 0.1 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
0.0 | 0.3 | GO:0006749 | glutathione metabolic process(GO:0006749) |
0.0 | 0.1 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
0.0 | 0.1 | GO:0010390 | histone monoubiquitination(GO:0010390) |
0.0 | 0.1 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.0 | 0.0 | GO:0035063 | nuclear speck organization(GO:0035063) |
0.0 | 0.4 | GO:0090305 | nucleic acid phosphodiester bond hydrolysis(GO:0090305) |
0.0 | 0.1 | GO:0045776 | negative regulation of blood pressure(GO:0045776) |
0.0 | 0.1 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.0 | 0.1 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.0 | 0.0 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.1 | GO:0032298 | positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
0.0 | 0.0 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.0 | 0.8 | GO:0042254 | ribosome biogenesis(GO:0042254) |
0.0 | 0.0 | GO:0006361 | transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) transcription initiation from RNA polymerase I promoter(GO:0006361) |
0.0 | 0.0 | GO:0070168 | negative regulation of biomineral tissue development(GO:0070168) |
0.0 | 0.1 | GO:0006301 | postreplication repair(GO:0006301) |
0.0 | 0.1 | GO:0043486 | histone exchange(GO:0043486) |
Gene overrepresentation in cellular_component category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 6.1 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.6 | 5.4 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
0.5 | 1.4 | GO:0038045 | large latent transforming growth factor-beta complex(GO:0038045) |
0.3 | 1.2 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.3 | 1.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.3 | 1.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.3 | 1.4 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.2 | 0.7 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
0.2 | 0.7 | GO:0042585 | germinal vesicle(GO:0042585) |
0.2 | 1.5 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.2 | 1.2 | GO:0005587 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.2 | 2.6 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.2 | 1.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.2 | 1.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.2 | 0.6 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
0.2 | 2.4 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.2 | 1.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.2 | 2.9 | GO:0098644 | complex of collagen trimers(GO:0098644) |
0.2 | 0.2 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
0.2 | 2.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.2 | 0.8 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.2 | 0.8 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.2 | 0.6 | GO:0036125 | mitochondrial fatty acid beta-oxidation multienzyme complex(GO:0016507) fatty acid beta-oxidation multienzyme complex(GO:0036125) |
0.2 | 0.4 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.2 | 1.1 | GO:0097443 | sorting endosome(GO:0097443) |
0.2 | 1.4 | GO:0042629 | mast cell granule(GO:0042629) |
0.2 | 1.2 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.2 | 1.2 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
0.2 | 1.8 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.2 | 0.5 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.2 | 0.5 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
0.2 | 1.5 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.2 | 0.6 | GO:0043511 | inhibin complex(GO:0043511) |
0.2 | 0.3 | GO:0005581 | collagen trimer(GO:0005581) |
0.2 | 0.5 | GO:0098835 | presynaptic endocytic zone(GO:0098833) presynaptic endocytic zone membrane(GO:0098835) |
0.2 | 0.6 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
0.2 | 0.5 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
0.2 | 2.0 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.2 | 1.2 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
0.1 | 0.6 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 11.2 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.1 | 0.7 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 0.9 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.1 | 0.7 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 0.6 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
0.1 | 0.6 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.1 | 0.6 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.1 | 3.2 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 1.1 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.4 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 0.8 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 0.9 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
0.1 | 1.5 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 6.6 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.1 | 4.3 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.1 | 2.0 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 0.6 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
0.1 | 0.4 | GO:0043596 | nuclear replication fork(GO:0043596) |
0.1 | 1.3 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 0.2 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.1 | 0.4 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 0.8 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.1 | 0.4 | GO:0000801 | central element(GO:0000801) |
0.1 | 0.3 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 0.3 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
0.1 | 1.6 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 0.5 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.1 | 4.5 | GO:0034707 | chloride channel complex(GO:0034707) |
0.1 | 9.4 | GO:0070469 | respiratory chain(GO:0070469) |
0.1 | 0.4 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
0.1 | 6.7 | GO:0015934 | large ribosomal subunit(GO:0015934) |
0.1 | 0.6 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.3 | GO:0071914 | prominosome(GO:0071914) |
0.1 | 0.3 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
0.1 | 0.3 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
0.1 | 0.4 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.1 | 0.4 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.1 | 0.3 | GO:0031983 | vesicle lumen(GO:0031983) |
0.1 | 0.4 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.1 | 0.3 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.1 | 0.4 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 0.2 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 0.3 | GO:0030690 | Noc1p-Noc2p complex(GO:0030690) |
0.1 | 0.8 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.1 | 0.7 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.1 | 1.0 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.1 | 0.1 | GO:0000811 | GINS complex(GO:0000811) DNA replication preinitiation complex(GO:0031261) |
0.1 | 0.3 | GO:0031251 | PAN complex(GO:0031251) |
0.1 | 2.4 | GO:0005685 | U1 snRNP(GO:0005685) |
0.1 | 1.2 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.1 | 0.8 | GO:0042611 | MHC protein complex(GO:0042611) |
0.1 | 1.4 | GO:0097449 | astrocyte projection(GO:0097449) |
0.1 | 0.3 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
0.1 | 0.3 | GO:0098855 | HCN channel complex(GO:0098855) |
0.1 | 0.5 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.1 | 0.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.7 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 0.6 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.3 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.3 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.1 | 1.1 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.1 | 0.4 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 0.2 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 0.4 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 0.3 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.1 | 0.5 | GO:0070847 | core mediator complex(GO:0070847) |
0.1 | 0.6 | GO:0042581 | specific granule(GO:0042581) |
0.1 | 0.9 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 0.7 | GO:0097165 | nuclear stress granule(GO:0097165) |
0.1 | 0.2 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
0.1 | 0.2 | GO:0071953 | fibrinogen complex(GO:0005577) elastic fiber(GO:0071953) |
0.1 | 1.1 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.1 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.5 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.1 | 0.3 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.1 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.1 | 1.0 | GO:0043219 | lateral loop(GO:0043219) |
0.1 | 0.2 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
0.1 | 1.0 | GO:0005922 | connexon complex(GO:0005922) |
0.1 | 0.5 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 1.2 | GO:0036038 | MKS complex(GO:0036038) |
0.1 | 0.4 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 0.4 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 0.4 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
0.1 | 0.2 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
0.1 | 0.2 | GO:0070985 | TFIIK complex(GO:0070985) |
0.1 | 0.4 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.1 | 0.5 | GO:0043203 | axon hillock(GO:0043203) |
0.1 | 0.1 | GO:0098842 | postsynaptic early endosome(GO:0098842) |
0.1 | 1.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.2 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
0.1 | 0.4 | GO:0097513 | myosin II filament(GO:0097513) |
0.1 | 4.2 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.1 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.1 | 0.9 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.1 | 2.4 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.1 | 1.2 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 0.9 | GO:0016589 | NURF complex(GO:0016589) |
0.1 | 0.7 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
0.1 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.4 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 0.3 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
0.1 | 0.2 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.1 | 0.2 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.1 | 0.2 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.1 | 0.1 | GO:0097526 | spliceosomal tri-snRNP complex(GO:0097526) |
0.1 | 0.6 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.1 | 1.2 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.1 | 0.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 0.2 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 0.4 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.1 | 0.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.1 | 0.5 | GO:0061617 | MICOS complex(GO:0061617) |
0.1 | 0.9 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 1.0 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 0.2 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.2 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 0.8 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.1 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 8.7 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.1 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) platelet dense granule(GO:0042827) |
0.1 | 0.8 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.1 | 0.5 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.1 | 0.7 | GO:0005839 | proteasome core complex(GO:0005839) |
0.1 | 1.5 | GO:0032040 | small-subunit processome(GO:0032040) |
0.1 | 0.2 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
0.1 | 0.8 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.1 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.1 | 0.3 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.2 | GO:0034657 | GID complex(GO:0034657) |
0.1 | 0.4 | GO:0005787 | signal peptidase complex(GO:0005787) |
0.1 | 0.4 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 0.2 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.6 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.1 | 0.4 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.1 | 0.6 | GO:0005605 | basal lamina(GO:0005605) |
0.0 | 0.3 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.6 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.3 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.6 | GO:0016460 | myosin II complex(GO:0016460) |
0.0 | 0.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 0.2 | GO:0097441 | basilar dendrite(GO:0097441) |
0.0 | 0.2 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.0 | 0.4 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.3 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.6 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.5 | GO:0001741 | XY body(GO:0001741) |
0.0 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.3 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 0.8 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 0.4 | GO:0019814 | immunoglobulin complex(GO:0019814) |
0.0 | 0.3 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.1 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 1.0 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.0 | 0.5 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.0 | 0.1 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) |
0.0 | 0.3 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.1 | GO:0030677 | ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.0 | 0.1 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
0.0 | 0.2 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
0.0 | 0.4 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.0 | 3.6 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.5 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
0.0 | 0.6 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.2 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.0 | 0.3 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 1.4 | GO:0044815 | DNA packaging complex(GO:0044815) |
0.0 | 6.4 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.1 | GO:0051286 | cell tip(GO:0051286) |
0.0 | 0.1 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.0 | 0.3 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.1 | GO:0005940 | septin ring(GO:0005940) |
0.0 | 0.1 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.4 | GO:0031011 | Ino80 complex(GO:0031011) |
0.0 | 0.8 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.0 | 0.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.0 | 0.2 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.1 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.3 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
0.0 | 0.1 | GO:1990037 | Lewy body core(GO:1990037) |
0.0 | 0.8 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.0 | 0.5 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 1.9 | GO:0005604 | basement membrane(GO:0005604) |
0.0 | 0.5 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.1 | GO:1902636 | kinociliary basal body(GO:1902636) |
0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.0 | 0.4 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.9 | GO:0051233 | spindle midzone(GO:0051233) |
0.0 | 0.2 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
0.0 | 0.3 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.0 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.1 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.2 | GO:0042825 | TAP complex(GO:0042825) |
0.0 | 0.3 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.0 | 0.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 0.2 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.2 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 0.2 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.3 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.3 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.1 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.1 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.0 | 0.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.0 | 0.5 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.2 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.3 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.3 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.1 | GO:0043540 | 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase complex(GO:0043540) |
0.0 | 0.1 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 3.6 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.1 | GO:0031533 | mRNA cap methyltransferase complex(GO:0031533) |
0.0 | 7.0 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.1 | GO:0044754 | secondary lysosome(GO:0005767) autolysosome(GO:0044754) |
0.0 | 0.1 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.3 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.0 | GO:0014802 | terminal cisterna(GO:0014802) |
0.0 | 0.6 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 0.2 | GO:1990391 | DNA repair complex(GO:1990391) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.1 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.3 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 0.2 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.1 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.0 | 0.6 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 0.1 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.1 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.2 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.2 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.2 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.2 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.2 | GO:0031305 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
0.0 | 0.1 | GO:0008278 | cohesin complex(GO:0008278) |
0.0 | 0.2 | GO:0032156 | septin cytoskeleton(GO:0032156) |
0.0 | 0.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.2 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
0.0 | 0.0 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
0.0 | 1.1 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.9 | GO:0036126 | sperm flagellum(GO:0036126) |
0.0 | 0.0 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
0.0 | 1.9 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.0 | 0.1 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
0.0 | 0.0 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.0 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.0 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.0 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.0 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.0 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.0 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.0 | GO:0001673 | male germ cell nucleus(GO:0001673) |
Gene overrepresentation in molecular_function category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 6.1 | GO:0031720 | haptoglobin binding(GO:0031720) |
1.5 | 10.6 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.7 | 2.9 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.6 | 1.7 | GO:0030549 | acetylcholine receptor activator activity(GO:0030549) |
0.5 | 2.0 | GO:0001011 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
0.4 | 2.9 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.4 | 1.2 | GO:0051870 | methotrexate binding(GO:0051870) |
0.4 | 1.6 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
0.4 | 1.5 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.4 | 1.5 | GO:0005008 | hepatocyte growth factor-activated receptor activity(GO:0005008) |
0.4 | 1.1 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.4 | 1.4 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.4 | 1.4 | GO:0050436 | microfibril binding(GO:0050436) |
0.4 | 1.4 | GO:0038049 | glucocorticoid receptor activity(GO:0004883) transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
0.3 | 1.4 | GO:0003681 | bent DNA binding(GO:0003681) |
0.3 | 1.4 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.3 | 1.0 | GO:0005110 | frizzled-2 binding(GO:0005110) |
0.3 | 1.0 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
0.3 | 0.3 | GO:0000987 | core promoter proximal region sequence-specific DNA binding(GO:0000987) core promoter proximal region DNA binding(GO:0001159) |
0.3 | 1.3 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
0.3 | 1.0 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
0.3 | 1.9 | GO:0004984 | olfactory receptor activity(GO:0004984) |
0.3 | 0.9 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.3 | 6.9 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.3 | 0.9 | GO:0042936 | dipeptide transporter activity(GO:0042936) |
0.3 | 0.9 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
0.3 | 1.2 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.3 | 2.0 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
0.3 | 3.9 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
0.3 | 1.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.3 | 0.8 | GO:0052740 | phosphatidylserine 1-acylhydrolase activity(GO:0052739) 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
0.3 | 5.7 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.3 | 1.6 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.3 | 1.3 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.3 | 1.3 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.3 | 1.8 | GO:1901612 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
0.3 | 0.8 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.3 | 1.5 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
0.3 | 1.0 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
0.3 | 1.8 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.2 | 0.7 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.2 | 1.2 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.2 | 0.7 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) |
0.2 | 0.7 | GO:0004510 | tryptophan 5-monooxygenase activity(GO:0004510) |
0.2 | 0.7 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
0.2 | 0.7 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.2 | 0.7 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
0.2 | 0.9 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.2 | 0.7 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.2 | 1.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.2 | 0.6 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
0.2 | 1.9 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.2 | 0.2 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.2 | 3.4 | GO:0001848 | complement binding(GO:0001848) |
0.2 | 1.0 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
0.2 | 1.4 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.2 | 0.6 | GO:0071568 | UFM1 transferase activity(GO:0071568) |
0.2 | 1.0 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.2 | 1.0 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.2 | 0.6 | GO:0016015 | morphogen activity(GO:0016015) |
0.2 | 1.1 | GO:0019841 | retinol binding(GO:0019841) |
0.2 | 0.8 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.2 | 0.6 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
0.2 | 0.5 | GO:0004875 | complement receptor activity(GO:0004875) |
0.2 | 0.9 | GO:0004342 | glucosamine-6-phosphate deaminase activity(GO:0004342) |
0.2 | 0.7 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
0.2 | 4.0 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.2 | 0.2 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.2 | 1.8 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.2 | 0.5 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.2 | 2.8 | GO:0017166 | vinculin binding(GO:0017166) |
0.2 | 0.2 | GO:0001846 | opsonin binding(GO:0001846) |
0.2 | 0.5 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.2 | 1.3 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.2 | 1.3 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.2 | 0.5 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.2 | 0.6 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
0.2 | 4.6 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.2 | 0.2 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.2 | 1.8 | GO:0038191 | neuropilin binding(GO:0038191) |
0.2 | 3.6 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.2 | 0.6 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.2 | 0.5 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.2 | 0.6 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) phospholipase A2 inhibitor activity(GO:0019834) |
0.1 | 0.4 | GO:0003796 | lysozyme activity(GO:0003796) |
0.1 | 0.4 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
0.1 | 0.6 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
0.1 | 0.9 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.4 | GO:0005118 | sevenless binding(GO:0005118) |
0.1 | 1.2 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.1 | 0.7 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 0.6 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.1 | 2.0 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
0.1 | 0.6 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
0.1 | 0.4 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.1 | 1.0 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.1 | 0.7 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
0.1 | 0.8 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
0.1 | 1.0 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.1 | 1.5 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.1 | 1.8 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.7 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
0.1 | 0.5 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 0.3 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
0.1 | 0.4 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
0.1 | 0.9 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 0.6 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.1 | 0.4 | GO:0001042 | RNA polymerase I core binding(GO:0001042) |
0.1 | 0.4 | GO:0001729 | ceramide kinase activity(GO:0001729) |
0.1 | 0.4 | GO:0097677 | STAT family protein binding(GO:0097677) |
0.1 | 0.5 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.1 | 4.7 | GO:0005504 | fatty acid binding(GO:0005504) |
0.1 | 0.5 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 0.5 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.6 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.1 | 0.5 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 0.5 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.1 | 0.5 | GO:0019808 | polyamine binding(GO:0019808) |
0.1 | 0.4 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.1 | 0.6 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
0.1 | 0.8 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 1.8 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 1.1 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
0.1 | 1.0 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.1 | 1.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 2.6 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.1 | 0.6 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
0.1 | 0.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.1 | 1.4 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 0.1 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
0.1 | 0.3 | GO:0018738 | S-formylglutathione hydrolase activity(GO:0018738) |
0.1 | 0.5 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 0.3 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
0.1 | 0.3 | GO:0047710 | bis(5'-adenosyl)-triphosphatase activity(GO:0047710) |
0.1 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.1 | 1.7 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.1 | 0.4 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 0.4 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
0.1 | 0.8 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.1 | 16.5 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 0.4 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.1 | 0.4 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.1 | 2.7 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.1 | 0.4 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.1 | 0.3 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.1 | 0.3 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.1 | 0.3 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.2 | GO:0031014 | troponin T binding(GO:0031014) |
0.1 | 0.5 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 0.2 | GO:0004879 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
0.1 | 0.5 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
0.1 | 0.3 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
0.1 | 1.9 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.1 | 0.3 | GO:0046911 | hydroxyapatite binding(GO:0046848) metal chelating activity(GO:0046911) phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.1 | 1.2 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 0.4 | GO:0004064 | arylesterase activity(GO:0004064) |
0.1 | 1.6 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.1 | 1.0 | GO:0050733 | RS domain binding(GO:0050733) |
0.1 | 0.8 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 0.6 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 0.4 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.1 | 0.1 | GO:0016835 | carbon-oxygen lyase activity(GO:0016835) |
0.1 | 0.5 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
0.1 | 0.6 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.1 | 0.6 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.1 | 0.8 | GO:0032564 | dATP binding(GO:0032564) |
0.1 | 0.4 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.1 | 0.4 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.1 | 0.1 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
0.1 | 3.0 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.8 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.1 | 0.5 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.1 | 0.5 | GO:0008329 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.1 | 0.5 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.1 | 0.3 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.1 | 0.6 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.1 | 0.3 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.1 | 0.6 | GO:0015266 | protein channel activity(GO:0015266) |
0.1 | 0.4 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.1 | 0.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.1 | 0.2 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
0.1 | 0.3 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.1 | 1.9 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.2 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.1 | 0.3 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
0.1 | 1.5 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
0.1 | 0.3 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.6 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 0.3 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.3 | GO:0004673 | phosphorelay sensor kinase activity(GO:0000155) protein histidine kinase activity(GO:0004673) |
0.1 | 0.2 | GO:0004492 | methylmalonyl-CoA decarboxylase activity(GO:0004492) |
0.1 | 0.3 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.1 | 0.3 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.5 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.1 | 2.0 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
0.1 | 0.5 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.1 | 0.4 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.3 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.1 | 0.5 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.7 | GO:0045125 | bioactive lipid receptor activity(GO:0045125) |
0.1 | 0.4 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.1 | 0.9 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.1 | 0.6 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 0.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 0.3 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.1 | 1.7 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.1 | 0.3 | GO:0008802 | betaine-aldehyde dehydrogenase activity(GO:0008802) |
0.1 | 0.2 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
0.1 | 0.3 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.1 | 2.2 | GO:0000977 | RNA polymerase II regulatory region sequence-specific DNA binding(GO:0000977) |
0.1 | 0.6 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.1 | 0.5 | GO:0015091 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
0.1 | 0.1 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 0.3 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.1 | 0.4 | GO:0097643 | amylin receptor activity(GO:0097643) |
0.1 | 0.3 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.1 | 2.0 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.1 | 0.4 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.1 | 1.0 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.1 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.1 | 0.3 | GO:0089720 | caspase binding(GO:0089720) |
0.1 | 0.6 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.1 | 0.9 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.1 | 1.1 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 0.2 | GO:0035939 | microsatellite binding(GO:0035939) |
0.1 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.1 | 1.3 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.1 | 0.3 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.1 | 0.3 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.1 | 0.2 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.1 | 0.6 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.3 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 1.0 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.1 | 0.3 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 0.3 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
0.1 | 0.5 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
0.1 | 2.5 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.1 | 0.1 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.1 | 1.6 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.1 | 0.2 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.1 | 0.2 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.1 | 0.5 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.1 | 0.6 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.1 | 0.5 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.1 | 0.3 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.1 | 1.0 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.1 | 0.5 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.1 | 0.5 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.1 | 2.4 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.1 | 0.5 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 1.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 0.2 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.2 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
0.1 | 1.3 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.1 | 0.6 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.1 | 0.2 | GO:0004962 | endothelin receptor activity(GO:0004962) |
0.1 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.2 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.1 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.1 | 0.1 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.1 | 0.4 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.1 | 0.3 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.1 | 0.5 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.1 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.1 | 0.5 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.3 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.1 | 0.2 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.1 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.1 | 0.6 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.1 | 1.4 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.1 | 0.5 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 0.8 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 0.1 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.1 | 0.2 | GO:0098770 | FBXO family protein binding(GO:0098770) |
0.1 | 0.6 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.1 | 0.5 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.1 | 0.3 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 1.2 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.1 | 0.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.2 | GO:0070615 | nucleosome-dependent ATPase activity(GO:0070615) |
0.1 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
0.1 | 0.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 0.7 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.1 | 0.4 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.3 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.1 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.0 | 0.1 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.0 | GO:0070052 | collagen V binding(GO:0070052) |
0.0 | 0.8 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.4 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.2 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.3 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.0 | 0.3 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.4 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 1.0 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.0 | 1.8 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.6 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.0 | 0.4 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.1 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.2 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 1.9 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
0.0 | 2.6 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.4 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.5 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.5 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.2 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 3.8 | GO:0008083 | growth factor activity(GO:0008083) |
0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.4 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.0 | 0.2 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.0 | 0.1 | GO:0019120 | hydrolase activity, acting on acid halide bonds(GO:0016824) hydrolase activity, acting on acid halide bonds, in C-halide compounds(GO:0019120) alkylhalidase activity(GO:0047651) |
0.0 | 0.1 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.1 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.0 | 0.7 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.3 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.0 | 0.0 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
0.0 | 0.2 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.0 | 0.1 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.0 | 0.6 | GO:0070403 | NAD+ binding(GO:0070403) |
0.0 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.3 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.5 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 1.8 | GO:0005125 | cytokine activity(GO:0005125) |
0.0 | 1.7 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.2 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.0 | 0.0 | GO:0033293 | monocarboxylic acid binding(GO:0033293) |
0.0 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.1 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 0.2 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.1 | GO:0004104 | cholinesterase activity(GO:0004104) choline binding(GO:0033265) |
0.0 | 0.3 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.0 | 0.5 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.2 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.0 | 0.5 | GO:0016917 | GABA receptor activity(GO:0016917) |
0.0 | 0.4 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.3 | GO:0015925 | galactosidase activity(GO:0015925) |
0.0 | 0.5 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.5 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.1 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.6 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.5 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.1 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
0.0 | 0.2 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
0.0 | 0.3 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.2 | GO:0033883 | pyridoxal phosphatase activity(GO:0033883) |
0.0 | 3.2 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 2.3 | GO:0008201 | heparin binding(GO:0008201) |
0.0 | 0.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.0 | 0.2 | GO:0042731 | PH domain binding(GO:0042731) |
0.0 | 2.5 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
0.0 | 0.2 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.0 | 0.7 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.6 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.0 | 1.6 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.1 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.0 | 0.2 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
0.0 | 0.4 | GO:0019531 | secondary active sulfate transmembrane transporter activity(GO:0008271) oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.4 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.2 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.0 | 0.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.0 | 0.3 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.1 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.6 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.1 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
0.0 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.4 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.1 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.1 | GO:0050347 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
0.0 | 0.9 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 1.3 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
0.0 | 0.7 | GO:0070717 | poly-purine tract binding(GO:0070717) |
0.0 | 0.2 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
0.0 | 0.8 | GO:0019843 | rRNA binding(GO:0019843) |
0.0 | 0.2 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.0 | 0.1 | GO:0003883 | CTP synthase activity(GO:0003883) |
0.0 | 0.5 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 1.3 | GO:0005254 | chloride channel activity(GO:0005254) |
0.0 | 0.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.0 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.0 | 0.4 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
0.0 | 0.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.6 | GO:0042805 | actinin binding(GO:0042805) |
0.0 | 0.2 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.1 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
0.0 | 0.1 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.4 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.0 | 0.1 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
0.0 | 0.0 | GO:0051429 | corticotropin-releasing hormone receptor binding(GO:0051429) corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.0 | 0.3 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.1 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
0.0 | 0.1 | GO:0016004 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.2 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.0 | 0.2 | GO:0030515 | snoRNA binding(GO:0030515) |
0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.5 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
0.0 | 1.5 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 0.1 | GO:0005171 | hepatocyte growth factor receptor binding(GO:0005171) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.4 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 0.7 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.3 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.7 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.5 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.0 | 0.2 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.0 | 0.2 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.6 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.0 | 0.3 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.0 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.0 | 0.6 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.9 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.3 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.1 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
0.0 | 0.2 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.1 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
0.0 | 0.2 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.0 | 0.0 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.1 | GO:0031404 | chloride ion binding(GO:0031404) |
0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.3 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.2 | GO:0005123 | death receptor binding(GO:0005123) |
0.0 | 0.3 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.1 | GO:0035173 | histone kinase activity(GO:0035173) |
0.0 | 0.1 | GO:0016901 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.0 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.0 | 0.1 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
0.0 | 0.0 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.0 | 0.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.0 | 0.2 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
0.0 | 0.5 | GO:0004521 | endoribonuclease activity(GO:0004521) |
0.0 | 0.0 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.0 | 0.3 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.4 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.3 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.1 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.6 | GO:0001098 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
0.0 | 0.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.0 | 0.1 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
0.0 | 0.3 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 0.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.2 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
0.0 | 0.0 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.0 | 0.2 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.1 | GO:0004482 | mRNA (guanine-N7-)-methyltransferase activity(GO:0004482) |
0.0 | 0.3 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.1 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 1.0 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.1 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.0 | 0.1 | GO:0015616 | DNA translocase activity(GO:0015616) |
0.0 | 0.2 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.0 | 0.1 | GO:1901505 | carbohydrate derivative transporter activity(GO:1901505) |
0.0 | 0.4 | GO:0016836 | hydro-lyase activity(GO:0016836) |
0.0 | 0.7 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.1 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.0 | 0.2 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
0.0 | 0.1 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.1 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
0.0 | 0.2 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
0.0 | 0.1 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.0 | 0.5 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.0 | GO:0016741 | transferase activity, transferring one-carbon groups(GO:0016741) |
0.0 | 0.1 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.1 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.1 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.2 | GO:0051536 | iron-sulfur cluster binding(GO:0051536) metal cluster binding(GO:0051540) |
0.0 | 0.0 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.5 | GO:0004866 | endopeptidase inhibitor activity(GO:0004866) |
0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.2 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.0 | 0.2 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
0.0 | 0.0 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.0 | 0.0 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.3 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.1 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.0 | 0.1 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.1 | GO:0016531 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.2 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.0 | 0.0 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.1 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
0.0 | 0.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.2 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.1 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.0 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 0.0 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.0 | 0.1 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.0 | 0.2 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
0.0 | 0.0 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.0 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 0.0 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.7 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.0 | 0.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.0 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.1 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.0 | 0.1 | GO:0046527 | glucosyltransferase activity(GO:0046527) |
Gene overrepresentation in C2:CP category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.2 | PID_RHODOPSIN_PATHWAY | Visual signal transduction: Rods |
0.2 | 4.9 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
0.2 | 0.2 | ST_T_CELL_SIGNAL_TRANSDUCTION | T Cell Signal Transduction |
0.2 | 2.1 | PID_INTEGRIN2_PATHWAY | Beta2 integrin cell surface interactions |
0.1 | 0.3 | PID_IL3_PATHWAY | IL3-mediated signaling events |
0.1 | 0.4 | SA_PROGRAMMED_CELL_DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.1 | 0.1 | PID_AR_NONGENOMIC_PATHWAY | Nongenotropic Androgen signaling |
0.1 | 3.3 | PID_IL12_STAT4_PATHWAY | IL12 signaling mediated by STAT4 |
0.1 | 0.2 | PID_HIV_NEF_PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.1 | 6.3 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.1 | 5.5 | PID_HNF3A_PATHWAY | FOXA1 transcription factor network |
0.1 | 0.3 | PID_AMB2_NEUTROPHILS_PATHWAY | amb2 Integrin signaling |
0.1 | 5.8 | PID_INTEGRIN1_PATHWAY | Beta1 integrin cell surface interactions |
0.1 | 3.3 | NABA_PROTEOGLYCANS | Genes encoding proteoglycans |
0.1 | 6.4 | PID_AP1_PATHWAY | AP-1 transcription factor network |
0.1 | 0.2 | PID_THROMBIN_PAR4_PATHWAY | PAR4-mediated thrombin signaling events |
0.1 | 0.2 | PID_FAS_PATHWAY | FAS (CD95) signaling pathway |
0.1 | 0.2 | PID_IL8_CXCR2_PATHWAY | IL8- and CXCR2-mediated signaling events |
0.1 | 0.4 | PID_TCR_RAS_PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.1 | 1.2 | PID_SYNDECAN_2_PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 0.7 | SA_MMP_CYTOKINE_CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.1 | 0.3 | PID_IL6_7_PATHWAY | IL6-mediated signaling events |
0.1 | 0.3 | SA_FAS_SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 0.4 | PID_TRAIL_PATHWAY | TRAIL signaling pathway |
0.1 | 0.7 | PID_VEGF_VEGFR_PATHWAY | VEGF and VEGFR signaling network |
0.1 | 2.3 | PID_SYNDECAN_1_PATHWAY | Syndecan-1-mediated signaling events |
0.1 | 0.1 | ST_GRANULE_CELL_SURVIVAL_PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.1 | 1.1 | PID_INTEGRIN3_PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 3.9 | PID_MYC_REPRESS_PATHWAY | Validated targets of C-MYC transcriptional repression |
0.1 | 1.4 | PID_HDAC_CLASSIII_PATHWAY | Signaling events mediated by HDAC Class III |
0.1 | 0.2 | SA_REG_CASCADE_OF_CYCLIN_EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.1 | 1.9 | PID_DELTA_NP63_PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 0.7 | PID_INTEGRIN_A9B1_PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 0.6 | PID_PTP1B_PATHWAY | Signaling events mediated by PTP1B |
0.1 | 0.3 | PID_RETINOIC_ACID_PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 0.2 | ST_INTERFERON_GAMMA_PATHWAY | Interferon gamma pathway. |
0.1 | 0.8 | PID_IL23_PATHWAY | IL23-mediated signaling events |
0.0 | 0.1 | SA_G2_AND_M_PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.3 | NABA_COLLAGENS | Genes encoding collagen proteins |
0.0 | 5.3 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 1.9 | SIG_PIP3_SIGNALING_IN_B_LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.8 | ST_WNT_BETA_CATENIN_PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 4.4 | NABA_CORE_MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
0.0 | 0.2 | PID_ANTHRAX_PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.0 | PID_S1P_S1P4_PATHWAY | S1P4 pathway |
0.0 | 0.6 | PID_WNT_CANONICAL_PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.8 | PID_NECTIN_PATHWAY | Nectin adhesion pathway |
0.0 | 0.4 | PID_SYNDECAN_4_PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 2.3 | PID_BETA_CATENIN_NUC_PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 1.4 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 5.1 | NABA_SECRETED_FACTORS | Genes encoding secreted soluble factors |
0.0 | 1.0 | ST_P38_MAPK_PATHWAY | p38 MAPK Pathway |
0.0 | 0.3 | PID_TOLL_ENDOGENOUS_PATHWAY | Endogenous TLR signaling |
0.0 | 0.2 | PID_A6B1_A6B4_INTEGRIN_PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 1.5 | PID_P53_REGULATION_PATHWAY | p53 pathway |
0.0 | 0.1 | PID_CERAMIDE_PATHWAY | Ceramide signaling pathway |
0.0 | 0.4 | PID_BARD1_PATHWAY | BARD1 signaling events |
0.0 | 1.1 | PID_AURORA_B_PATHWAY | Aurora B signaling |
0.0 | 0.2 | PID_S1P_S1P1_PATHWAY | S1P1 pathway |
0.0 | 1.3 | PID_HES_HEY_PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.4 | PID_ATR_PATHWAY | ATR signaling pathway |
0.0 | 1.3 | PID_PLK1_PATHWAY | PLK1 signaling events |
0.0 | 1.5 | PID_E2F_PATHWAY | E2F transcription factor network |
0.0 | 0.0 | ST_IL_13_PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 1.1 | PID_FANCONI_PATHWAY | Fanconi anemia pathway |
0.0 | 0.3 | PID_ALPHA_SYNUCLEIN_PATHWAY | Alpha-synuclein signaling |
0.0 | 1.0 | PID_RAC1_PATHWAY | RAC1 signaling pathway |
0.0 | 0.1 | ST_WNT_CA2_CYCLIC_GMP_PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.6 | ST_TUMOR_NECROSIS_FACTOR_PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 1.1 | PID_LYSOPHOSPHOLIPID_PATHWAY | LPA receptor mediated events |
0.0 | 0.1 | PID_FOXO_PATHWAY | FoxO family signaling |
0.0 | 0.1 | ST_JNK_MAPK_PATHWAY | JNK MAPK Pathway |
0.0 | 1.5 | PID_MYC_ACTIV_PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.8 | PID_P73PATHWAY | p73 transcription factor network |
0.0 | 0.5 | ST_G_ALPHA_I_PATHWAY | G alpha i Pathway |
0.0 | 0.0 | PID_VEGFR1_PATHWAY | VEGFR1 specific signals |
0.0 | 0.1 | PID_EPO_PATHWAY | EPO signaling pathway |
0.0 | 0.0 | PID_NFAT_3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.3 | PID_BCR_5PATHWAY | BCR signaling pathway |
0.0 | 0.1 | PID_FRA_PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.1 | PID_IL2_PI3K_PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 0.2 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
0.0 | 0.1 | PID_FOXM1_PATHWAY | FOXM1 transcription factor network |
0.0 | 0.1 | PID_NFKAPPAB_CANONICAL_PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.3 | PID_DNA_PK_PATHWAY | DNA-PK pathway in nonhomologous end joining |
Gene overrepresentation in C2:CP:REACTOME category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 2.9 | REACTOME_TRANSPORT_OF_ORGANIC_ANIONS | Genes involved in Transport of organic anions |
0.3 | 0.3 | REACTOME_PLATELET_AGGREGATION_PLUG_FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.2 | 0.7 | REACTOME_SEROTONIN_RECEPTORS | Genes involved in Serotonin receptors |
0.2 | 0.4 | REACTOME_BILE_ACID_AND_BILE_SALT_METABOLISM | Genes involved in Bile acid and bile salt metabolism |
0.2 | 1.5 | REACTOME_TANDEM_PORE_DOMAIN_POTASSIUM_CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.2 | 0.2 | REACTOME_MRNA_DECAY_BY_3_TO_5_EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.2 | 1.2 | REACTOME_CREATION_OF_C4_AND_C2_ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.2 | 3.2 | REACTOME_SYNTHESIS_SECRETION_AND_DEACYLATION_OF_GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.2 | 1.6 | REACTOME_P2Y_RECEPTORS | Genes involved in P2Y receptors |
0.2 | 3.8 | REACTOME_IMMUNOREGULATORY_INTERACTIONS_BETWEEN_A_LYMPHOID_AND_A_NON_LYMPHOID_CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.2 | 0.2 | REACTOME_INTERACTIONS_OF_VPR_WITH_HOST_CELLULAR_PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.2 | 1.3 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PI | Genes involved in Acyl chain remodelling of PI |
0.2 | 3.8 | REACTOME_HS_GAG_DEGRADATION | Genes involved in HS-GAG degradation |
0.2 | 4.2 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
0.2 | 0.6 | REACTOME_GLYCOPROTEIN_HORMONES | Genes involved in Glycoprotein hormones |
0.2 | 16.9 | REACTOME_PEPTIDE_CHAIN_ELONGATION | Genes involved in Peptide chain elongation |
0.2 | 0.9 | REACTOME_DOWNREGULATION_OF_ERBB2_ERBB3_SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.2 | 2.3 | REACTOME_REPAIR_SYNTHESIS_FOR_GAP_FILLING_BY_DNA_POL_IN_TC_NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.1 | 2.5 | REACTOME_MITOCHONDRIAL_FATTY_ACID_BETA_OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 0.1 | REACTOME_SIGNALING_BY_CONSTITUTIVELY_ACTIVE_EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 0.8 | REACTOME_COMMON_PATHWAY | Genes involved in Common Pathway |
0.1 | 2.8 | REACTOME_CHONDROITIN_SULFATE_BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.1 | 1.1 | REACTOME_REGULATION_OF_INSULIN_SECRETION_BY_ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.9 | REACTOME_THE_NLRP3_INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.1 | 0.9 | REACTOME_ENDOGENOUS_STEROLS | Genes involved in Endogenous sterols |
0.1 | 3.4 | REACTOME_RNA_POL_III_TRANSCRIPTION_TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 1.1 | REACTOME_KERATAN_SULFATE_DEGRADATION | Genes involved in Keratan sulfate degradation |
0.1 | 1.9 | REACTOME_APOPTOSIS_INDUCED_DNA_FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.1 | 3.0 | REACTOME_SYNTHESIS_AND_INTERCONVERSION_OF_NUCLEOTIDE_DI_AND_TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 1.5 | REACTOME_ASSOCIATION_OF_LICENSING_FACTORS_WITH_THE_PRE_REPLICATIVE_COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.1 | 0.9 | REACTOME_GAP_JUNCTION_DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 1.8 | REACTOME_DESTABILIZATION_OF_MRNA_BY_BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.1 | 3.5 | REACTOME_REGULATION_OF_BETA_CELL_DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.1 | 0.3 | REACTOME_HORMONE_LIGAND_BINDING_RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.1 | 6.6 | REACTOME_RESPIRATORY_ELECTRON_TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 5.3 | REACTOME_DEPOSITION_OF_NEW_CENPA_CONTAINING_NUCLEOSOMES_AT_THE_CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 1.1 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 1.0 | REACTOME_CHYLOMICRON_MEDIATED_LIPID_TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.1 | 0.1 | REACTOME_CLASS_I_MHC_MEDIATED_ANTIGEN_PROCESSING_PRESENTATION | Genes involved in Class I MHC mediated antigen processing & presentation |
0.1 | 4.5 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.4 | REACTOME_SYNTHESIS_SECRETION_AND_INACTIVATION_OF_GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.1 | 1.4 | REACTOME_SEMA3A_PLEXIN_REPULSION_SIGNALING_BY_INHIBITING_INTEGRIN_ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 0.3 | REACTOME_POL_SWITCHING | Genes involved in Polymerase switching |
0.1 | 0.9 | REACTOME_AMINE_DERIVED_HORMONES | Genes involved in Amine-derived hormones |
0.1 | 1.9 | REACTOME_BRANCHED_CHAIN_AMINO_ACID_CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.1 | 0.4 | REACTOME_HYALURONAN_UPTAKE_AND_DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.1 | 0.1 | REACTOME_CDK_MEDIATED_PHOSPHORYLATION_AND_REMOVAL_OF_CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
0.1 | 0.5 | REACTOME_VEGF_LIGAND_RECEPTOR_INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 1.3 | REACTOME_INTEGRATION_OF_PROVIRUS | Genes involved in Integration of provirus |
0.1 | 0.6 | REACTOME_THE_ACTIVATION_OF_ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.1 | 2.0 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 4.6 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
0.1 | 0.8 | REACTOME_PROLACTIN_RECEPTOR_SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 1.5 | REACTOME_AMINE_COMPOUND_SLC_TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.1 | 3.8 | REACTOME_VIF_MEDIATED_DEGRADATION_OF_APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.1 | 1.0 | REACTOME_MRNA_DECAY_BY_5_TO_3_EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 1.5 | REACTOME_RNA_POL_I_PROMOTER_OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 0.7 | REACTOME_METABOLISM_OF_POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 0.3 | REACTOME_DESTABILIZATION_OF_MRNA_BY_AUF1_HNRNP_D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 0.8 | REACTOME_EXTRINSIC_PATHWAY_FOR_APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 1.1 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 0.4 | REACTOME_CYTOCHROME_P450_ARRANGED_BY_SUBSTRATE_TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.1 | 1.3 | REACTOME_METABOLISM_OF_PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 0.3 | REACTOME_REGULATION_OF_THE_FANCONI_ANEMIA_PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.1 | 1.4 | REACTOME_CHEMOKINE_RECEPTORS_BIND_CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.1 | 0.9 | REACTOME_ANTIGEN_PROCESSING_CROSS_PRESENTATION | Genes involved in Antigen processing-Cross presentation |
0.1 | 0.6 | REACTOME_EXTENSION_OF_TELOMERES | Genes involved in Extension of Telomeres |
0.1 | 1.1 | REACTOME_SULFUR_AMINO_ACID_METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.1 | 0.5 | REACTOME_TRAFFICKING_AND_PROCESSING_OF_ENDOSOMAL_TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.1 | 2.0 | REACTOME_SEMA4D_IN_SEMAPHORIN_SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.1 | 0.8 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 1.4 | REACTOME_YAP1_AND_WWTR1_TAZ_STIMULATED_GENE_EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 1.9 | REACTOME_G1_PHASE | Genes involved in G1 Phase |
0.1 | 1.1 | REACTOME_MITOCHONDRIAL_TRNA_AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.1 | 0.2 | REACTOME_REGULATION_OF_COMPLEMENT_CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 1.2 | REACTOME_SRP_DEPENDENT_COTRANSLATIONAL_PROTEIN_TARGETING_TO_MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.1 | 0.6 | REACTOME_ACTIVATION_OF_CHAPERONES_BY_ATF6_ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.0 | 0.3 | REACTOME_PLATELET_SENSITIZATION_BY_LDL | Genes involved in Platelet sensitization by LDL |
0.0 | 0.1 | REACTOME_MRNA_CAPPING | Genes involved in mRNA Capping |
0.0 | 0.9 | REACTOME_APC_C_CDH1_MEDIATED_DEGRADATION_OF_CDC20_AND_OTHER_APC_C_CDH1_TARGETED_PROTEINS_IN_LATE_MITOSIS_EARLY_G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.0 | 4.3 | REACTOME_MITOTIC_PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.0 | 0.1 | REACTOME_ADP_SIGNALLING_THROUGH_P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
0.0 | 0.1 | REACTOME_APOPTOTIC_CLEAVAGE_OF_CELL_ADHESION_PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.4 | REACTOME_PASSIVE_TRANSPORT_BY_AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 0.4 | REACTOME_PYRIMIDINE_CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.2 | REACTOME_SIGNALING_BY_EGFR_IN_CANCER | Genes involved in Signaling by EGFR in Cancer |
0.0 | 0.6 | REACTOME_FORMATION_OF_ATP_BY_CHEMIOSMOTIC_COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.9 | REACTOME_PRE_NOTCH_PROCESSING_IN_GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.9 | REACTOME_INWARDLY_RECTIFYING_K_CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.0 | 0.6 | REACTOME_TETRAHYDROBIOPTERIN_BH4_SYNTHESIS_RECYCLING_SALVAGE_AND_REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 0.9 | REACTOME_MEIOTIC_RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 2.9 | REACTOME_NUCLEAR_RECEPTOR_TRANSCRIPTION_PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.1 | REACTOME_P53_INDEPENDENT_G1_S_DNA_DAMAGE_CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
0.0 | 0.7 | REACTOME_HORMONE_SENSITIVE_LIPASE_HSL_MEDIATED_TRIACYLGLYCEROL_HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.4 | REACTOME_FORMATION_OF_INCISION_COMPLEX_IN_GG_NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.2 | REACTOME_CD28_DEPENDENT_VAV1_PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.0 | 0.4 | REACTOME_AMYLOIDS | Genes involved in Amyloids |
0.0 | 1.5 | REACTOME_GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.5 | REACTOME_GAP_JUNCTION_ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.3 | REACTOME_G1_S_SPECIFIC_TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.0 | 0.6 | REACTOME_SYNTHESIS_OF_VERY_LONG_CHAIN_FATTY_ACYL_COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.0 | 1.8 | REACTOME_CLEAVAGE_OF_GROWING_TRANSCRIPT_IN_THE_TERMINATION_REGION_ | Genes involved in Cleavage of Growing Transcript in the Termination Region |
0.0 | 0.2 | REACTOME_ELEVATION_OF_CYTOSOLIC_CA2_LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 1.3 | REACTOME_ASSOCIATION_OF_TRIC_CCT_WITH_TARGET_PROTEINS_DURING_BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 2.4 | REACTOME_CLASS_B_2_SECRETIN_FAMILY_RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 1.1 | REACTOME_RNA_POL_II_TRANSCRIPTION_PRE_INITIATION_AND_PROMOTER_OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.0 | 0.2 | REACTOME_ADVANCED_GLYCOSYLATION_ENDPRODUCT_RECEPTOR_SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.3 | REACTOME_METAL_ION_SLC_TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.5 | REACTOME_GROWTH_HORMONE_RECEPTOR_SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 0.3 | REACTOME_P130CAS_LINKAGE_TO_MAPK_SIGNALING_FOR_INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.2 | REACTOME_INTRINSIC_PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 0.6 | REACTOME_TIE2_SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.2 | REACTOME_MEMBRANE_BINDING_AND_TARGETTING_OF_GAG_PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.6 | REACTOME_PROTEIN_FOLDING | Genes involved in Protein folding |
0.0 | 0.4 | REACTOME_SYNTHESIS_OF_DNA | Genes involved in Synthesis of DNA |
0.0 | 1.7 | REACTOME_PPARA_ACTIVATES_GENE_EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.0 | 0.3 | REACTOME_VITAMIN_B5_PANTOTHENATE_METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 1.0 | REACTOME_AMINO_ACID_AND_OLIGOPEPTIDE_SLC_TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.0 | 0.2 | REACTOME_RNA_POL_II_TRANSCRIPTION | Genes involved in RNA Polymerase II Transcription |
0.0 | 0.2 | REACTOME_BASIGIN_INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.3 | REACTOME_ALPHA_LINOLENIC_ACID_ALA_METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.1 | REACTOME_RNA_POL_I_TRANSCRIPTION_TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.0 | 0.3 | REACTOME_IONOTROPIC_ACTIVITY_OF_KAINATE_RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.0 | 1.0 | REACTOME_LOSS_OF_NLP_FROM_MITOTIC_CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.6 | REACTOME_TIGHT_JUNCTION_INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.3 | REACTOME_TRAF6_MEDIATED_IRF7_ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.0 | 0.4 | REACTOME_SYNTHESIS_OF_GLYCOSYLPHOSPHATIDYLINOSITOL_GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.0 | 0.2 | REACTOME_PYRIMIDINE_METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.1 | REACTOME_PHOSPHORYLATION_OF_CD3_AND_TCR_ZETA_CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.1 | REACTOME_INHIBITION_OF_INSULIN_SECRETION_BY_ADRENALINE_NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.0 | REACTOME_SHC1_EVENTS_IN_EGFR_SIGNALING | Genes involved in SHC1 events in EGFR signaling |
0.0 | 0.1 | REACTOME_ACTIVATION_OF_ATR_IN_RESPONSE_TO_REPLICATION_STRESS | Genes involved in Activation of ATR in response to replication stress |
0.0 | 0.2 | REACTOME_SYNTHESIS_OF_SUBSTRATES_IN_N_GLYCAN_BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.4 | REACTOME_DEADENYLATION_DEPENDENT_MRNA_DECAY | Genes involved in Deadenylation-dependent mRNA decay |
0.0 | 0.2 | REACTOME_ACTIVATION_OF_RAC | Genes involved in Activation of Rac |
0.0 | 0.5 | REACTOME_TRANSLATION | Genes involved in Translation |
0.0 | 0.1 | REACTOME_RNA_POL_III_TRANSCRIPTION_INITIATION_FROM_TYPE_3_PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |