Motif ID: Nrf1
Z-value: 2.685

Transcription factors associated with Nrf1:
Gene Symbol | Entrez ID | Gene Name |
---|---|---|
Nrf1 | ENSMUSG00000058440.8 | Nrf1 |
Activity-expression correlation:
Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Nrf1 | mm10_v2_chr6_+_30048062_30048078 | -0.15 | 3.5e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 11.8 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
1.4 | 1.4 | GO:0044830 | modulation by host of viral RNA genome replication(GO:0044830) |
1.4 | 1.4 | GO:0045976 | negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
1.3 | 4.0 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
1.2 | 6.0 | GO:0007403 | glial cell fate determination(GO:0007403) |
1.2 | 1.2 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
1.1 | 3.4 | GO:0051892 | negative regulation of cardioblast differentiation(GO:0051892) |
1.1 | 3.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
1.1 | 5.3 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.9 | 2.8 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
0.9 | 3.6 | GO:0086048 | membrane depolarization during bundle of His cell action potential(GO:0086048) |
0.9 | 2.6 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.9 | 3.5 | GO:0030043 | actin filament fragmentation(GO:0030043) |
0.8 | 3.9 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.8 | 2.3 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.8 | 3.1 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
0.7 | 2.2 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
0.7 | 2.2 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
0.7 | 2.9 | GO:0006203 | dGTP catabolic process(GO:0006203) dATP catabolic process(GO:0046061) |
0.7 | 2.1 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.7 | 2.1 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
0.7 | 3.4 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.7 | 2.0 | GO:1990859 | cellular response to endothelin(GO:1990859) |
0.7 | 2.0 | GO:0098928 | presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
0.7 | 3.3 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.7 | 2.0 | GO:0019389 | glucuronoside metabolic process(GO:0019389) |
0.7 | 2.0 | GO:1904959 | regulation of electron carrier activity(GO:1904732) regulation of cytochrome-c oxidase activity(GO:1904959) |
0.6 | 1.9 | GO:0072554 | arterial endothelial cell fate commitment(GO:0060844) blood vessel endothelial cell fate commitment(GO:0060846) endothelial cell fate specification(GO:0060847) Notch signaling pathway involved in arterial endothelial cell fate commitment(GO:0060853) canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:0061317) blood vessel lumenization(GO:0072554) regulation of heart induction(GO:0090381) blood vessel endothelial cell fate specification(GO:0097101) regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901295) positive regulation of heart induction(GO:1901321) regulation of canonical Wnt signaling pathway involved in heart development(GO:1905066) |
0.6 | 3.2 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.6 | 1.9 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.6 | 3.7 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.6 | 1.9 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.6 | 4.3 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
0.6 | 4.2 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.6 | 3.6 | GO:0090005 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.6 | 3.6 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.6 | 8.3 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.6 | 2.4 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.6 | 3.0 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.6 | 3.5 | GO:0003383 | apical constriction(GO:0003383) |
0.6 | 1.7 | GO:0036509 | trimming of terminal mannose on B branch(GO:0036509) |
0.6 | 3.4 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
0.6 | 1.7 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.6 | 1.1 | GO:1903061 | regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
0.6 | 1.7 | GO:1904719 | excitatory chemical synaptic transmission(GO:0098976) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
0.6 | 1.1 | GO:0036508 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) glycoprotein ERAD pathway(GO:0097466) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
0.6 | 1.7 | GO:0048209 | regulation of vesicle targeting, to, from or within Golgi(GO:0048209) |
0.6 | 0.6 | GO:0010845 | positive regulation of reciprocal meiotic recombination(GO:0010845) |
0.5 | 1.6 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) |
0.5 | 5.8 | GO:1990173 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
0.5 | 2.1 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.5 | 1.5 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
0.5 | 1.5 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.5 | 0.5 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.5 | 1.5 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.5 | 1.4 | GO:0016132 | brassinosteroid metabolic process(GO:0016131) brassinosteroid biosynthetic process(GO:0016132) |
0.5 | 1.9 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.5 | 1.9 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
0.5 | 1.8 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.5 | 1.4 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
0.4 | 1.8 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
0.4 | 1.3 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.4 | 3.6 | GO:0015791 | polyol transport(GO:0015791) |
0.4 | 1.7 | GO:2000256 | endomitotic cell cycle(GO:0007113) thrombopoietin-mediated signaling pathway(GO:0038163) positive regulation of male germ cell proliferation(GO:2000256) |
0.4 | 1.7 | GO:0006780 | uroporphyrinogen III biosynthetic process(GO:0006780) |
0.4 | 1.3 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.4 | 2.1 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
0.4 | 1.7 | GO:0099527 | postsynapse to nucleus signaling pathway(GO:0099527) |
0.4 | 2.1 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
0.4 | 1.2 | GO:0045575 | basophil activation involved in immune response(GO:0002276) basophil activation(GO:0045575) |
0.4 | 1.2 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.4 | 1.2 | GO:0035973 | aggrephagy(GO:0035973) |
0.4 | 2.4 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.4 | 1.2 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) negative regulation of interleukin-6-mediated signaling pathway(GO:0070104) |
0.4 | 0.4 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) synaptic vesicle budding(GO:0070142) |
0.4 | 1.6 | GO:2001045 | closure of optic fissure(GO:0061386) negative regulation of integrin-mediated signaling pathway(GO:2001045) |
0.4 | 1.2 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.4 | 0.4 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
0.4 | 1.1 | GO:1903490 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
0.4 | 0.8 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.4 | 1.5 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
0.4 | 1.5 | GO:0030576 | Cajal body organization(GO:0030576) |
0.4 | 4.1 | GO:1905216 | positive regulation of RNA binding(GO:1905216) |
0.4 | 1.1 | GO:0072076 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) nephrogenic mesenchyme development(GO:0072076) cell proliferation involved in heart valve development(GO:2000793) |
0.4 | 1.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.4 | 0.4 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.4 | 1.8 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.4 | 0.7 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.4 | 1.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.4 | 4.3 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
0.4 | 2.2 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
0.4 | 1.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.4 | 2.8 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.3 | 1.4 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.3 | 1.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.3 | 2.0 | GO:0001927 | exocyst assembly(GO:0001927) |
0.3 | 1.0 | GO:0007172 | signal complex assembly(GO:0007172) |
0.3 | 1.7 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
0.3 | 1.0 | GO:0046098 | regulation of primitive erythrocyte differentiation(GO:0010725) guanine metabolic process(GO:0046098) |
0.3 | 1.0 | GO:0019659 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.3 | 0.3 | GO:1904809 | dense core granule localization(GO:0032253) dense core granule transport(GO:1901950) regulation of dense core granule transport(GO:1904809) positive regulation of dense core granule transport(GO:1904811) |
0.3 | 1.0 | GO:1901536 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.3 | 0.3 | GO:0032805 | positive regulation of low-density lipoprotein particle receptor catabolic process(GO:0032805) |
0.3 | 1.3 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.3 | 0.9 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.3 | 0.6 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
0.3 | 1.6 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.3 | 0.9 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
0.3 | 0.9 | GO:0061588 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylserine scrambling(GO:0061589) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.3 | 0.6 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.3 | 1.8 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.3 | 1.2 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.3 | 2.7 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.3 | 1.5 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.3 | 1.2 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
0.3 | 0.3 | GO:0033122 | regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
0.3 | 3.2 | GO:0035036 | binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
0.3 | 2.3 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.3 | 0.6 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.3 | 0.6 | GO:0042320 | regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) circadian sleep/wake cycle, REM sleep(GO:0042747) |
0.3 | 0.9 | GO:0060129 | heart induction(GO:0003129) BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
0.3 | 1.4 | GO:0019230 | proprioception(GO:0019230) |
0.3 | 2.0 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
0.3 | 1.4 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.3 | 2.3 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.3 | 1.1 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.3 | 5.6 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.3 | 1.1 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.3 | 0.6 | GO:2000812 | regulation of barbed-end actin filament capping(GO:2000812) |
0.3 | 0.8 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.3 | 3.3 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.3 | 0.5 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.3 | 3.0 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.3 | 0.8 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
0.3 | 3.5 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.3 | 3.0 | GO:0002176 | male germ cell proliferation(GO:0002176) |
0.3 | 1.1 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.3 | 0.8 | GO:0070844 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
0.3 | 3.9 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.3 | 0.8 | GO:0003245 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
0.3 | 2.3 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.3 | 0.8 | GO:0009174 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.3 | 0.8 | GO:0072014 | proximal tubule development(GO:0072014) |
0.3 | 1.5 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.3 | 1.8 | GO:0007144 | female meiosis I(GO:0007144) |
0.3 | 3.8 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.3 | 1.0 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.2 | 0.7 | GO:0061083 | regulation of protein refolding(GO:0061083) |
0.2 | 0.7 | GO:2000850 | protein-chromophore linkage(GO:0018298) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.2 | 0.5 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.2 | 1.0 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.2 | 1.0 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.2 | 1.4 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
0.2 | 1.7 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.2 | 1.0 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.2 | 3.5 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
0.2 | 6.1 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.2 | 0.7 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.2 | 0.7 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.2 | 0.9 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.2 | 0.7 | GO:0034143 | regulation of toll-like receptor 4 signaling pathway(GO:0034143) |
0.2 | 0.9 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.2 | 2.8 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.2 | 0.7 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
0.2 | 0.9 | GO:0033091 | positive regulation of immature T cell proliferation(GO:0033091) |
0.2 | 1.6 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.2 | 0.7 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.2 | 1.1 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.2 | 0.2 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.2 | 8.9 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.2 | 1.6 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.2 | 1.3 | GO:0090070 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
0.2 | 0.7 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) alveolar secondary septum development(GO:0061144) |
0.2 | 0.4 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.2 | 1.5 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.2 | 0.6 | GO:0003100 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) regulation of systemic arterial blood pressure by endothelin(GO:0003100) beta selection(GO:0043366) response to chemokine(GO:1990868) cellular response to chemokine(GO:1990869) |
0.2 | 1.7 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.2 | 0.9 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.2 | 1.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.2 | 0.8 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
0.2 | 1.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.2 | 1.3 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.2 | 1.0 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) cellular response to actinomycin D(GO:0072717) |
0.2 | 1.7 | GO:0006983 | ER overload response(GO:0006983) |
0.2 | 1.0 | GO:0042117 | monocyte activation(GO:0042117) |
0.2 | 3.7 | GO:0045116 | protein neddylation(GO:0045116) |
0.2 | 0.6 | GO:1903294 | regulation of glutamate secretion, neurotransmission(GO:1903294) positive regulation of glutamate secretion, neurotransmission(GO:1903296) |
0.2 | 2.9 | GO:0006706 | steroid catabolic process(GO:0006706) |
0.2 | 1.0 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.2 | 1.2 | GO:1901911 | diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
0.2 | 0.6 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.2 | 0.8 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.2 | 0.6 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) protein K29-linked ubiquitination(GO:0035519) |
0.2 | 1.6 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.2 | 0.8 | GO:0010889 | regulation of sequestering of triglyceride(GO:0010889) |
0.2 | 0.6 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.2 | 0.6 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
0.2 | 1.7 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.2 | 0.2 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.2 | 0.6 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.2 | 1.5 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.2 | 1.3 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.2 | 0.9 | GO:0051697 | protein delipidation(GO:0051697) |
0.2 | 0.8 | GO:0046368 | GDP-L-fucose metabolic process(GO:0046368) |
0.2 | 0.9 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.2 | 0.7 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.2 | 1.5 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.2 | 0.6 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.2 | 0.6 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.2 | 0.7 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.2 | 1.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.2 | 0.2 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
0.2 | 1.3 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.2 | 0.9 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
0.2 | 0.5 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) regulation of opioid receptor signaling pathway(GO:2000474) |
0.2 | 1.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.2 | 0.5 | GO:0019085 | early viral transcription(GO:0019085) |
0.2 | 6.8 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.2 | 2.3 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.2 | 0.7 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.2 | 0.7 | GO:0061511 | centriole elongation(GO:0061511) |
0.2 | 1.1 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.2 | 1.4 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.2 | 0.9 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.2 | 0.7 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.2 | 2.2 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.2 | 0.9 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
0.2 | 1.0 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.2 | 0.7 | GO:0070257 | mucus secretion(GO:0070254) regulation of mucus secretion(GO:0070255) positive regulation of mucus secretion(GO:0070257) |
0.2 | 4.9 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
0.2 | 3.7 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
0.2 | 0.5 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.2 | 0.7 | GO:0016240 | autophagosome docking(GO:0016240) |
0.2 | 2.0 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.2 | 0.5 | GO:0042275 | error-free postreplication DNA repair(GO:0042275) |
0.2 | 0.8 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.2 | 1.6 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.2 | 2.7 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.2 | 1.6 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.2 | 0.8 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.2 | 1.6 | GO:0016926 | protein desumoylation(GO:0016926) |
0.2 | 0.8 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.2 | 0.3 | GO:0071335 | hair follicle cell proliferation(GO:0071335) regulation of hair follicle cell proliferation(GO:0071336) positive regulation of hair follicle cell proliferation(GO:0071338) |
0.2 | 1.5 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.2 | 0.5 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.2 | 1.2 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.2 | 1.7 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.7 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
0.1 | 0.7 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.1 | 0.4 | GO:2000642 | negative regulation of early endosome to late endosome transport(GO:2000642) |
0.1 | 0.9 | GO:0051013 | microtubule severing(GO:0051013) |
0.1 | 0.7 | GO:0015819 | lysine transport(GO:0015819) |
0.1 | 0.4 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.1 | 0.7 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.1 | 6.5 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
0.1 | 4.1 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.1 | 4.4 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.1 | 3.2 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.1 | 1.3 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
0.1 | 5.1 | GO:0042168 | heme metabolic process(GO:0042168) |
0.1 | 0.8 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
0.1 | 0.8 | GO:1903003 | positive regulation of protein deubiquitination(GO:1903003) |
0.1 | 0.7 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.1 | 1.2 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.1 | 2.0 | GO:1901020 | negative regulation of calcium ion transmembrane transporter activity(GO:1901020) |
0.1 | 0.4 | GO:0016598 | protein arginylation(GO:0016598) |
0.1 | 0.3 | GO:1905077 | negative regulation of interleukin-17 secretion(GO:1905077) |
0.1 | 1.2 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.1 | 0.7 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 0.9 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
0.1 | 0.7 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.1 | 2.4 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.1 | 1.5 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.1 | 0.5 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.1 | 1.6 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.1 | 0.4 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.1 | 1.8 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
0.1 | 0.4 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.3 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.1 | 0.3 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 1.4 | GO:1900027 | regulation of ruffle assembly(GO:1900027) |
0.1 | 1.1 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.1 | 0.8 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.1 | 0.5 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
0.1 | 0.2 | GO:0002423 | natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002420) natural killer cell mediated immune response to tumor cell(GO:0002423) regulation of natural killer cell mediated immune response to tumor cell(GO:0002855) regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002858) |
0.1 | 1.0 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.1 | 0.5 | GO:0055071 | cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
0.1 | 3.0 | GO:0042772 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) DNA damage response, signal transduction resulting in transcription(GO:0042772) |
0.1 | 2.0 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
0.1 | 1.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.1 | 0.9 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.1 | 0.6 | GO:0035547 | interferon-beta secretion(GO:0035546) regulation of interferon-beta secretion(GO:0035547) positive regulation of interferon-beta secretion(GO:0035549) CRD-mediated mRNA stabilization(GO:0070934) |
0.1 | 0.7 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.1 | 0.3 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.1 | 0.1 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
0.1 | 0.7 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.1 | 1.5 | GO:0001916 | positive regulation of T cell mediated cytotoxicity(GO:0001916) |
0.1 | 0.6 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.1 | 0.2 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.1 | 0.2 | GO:0090646 | mitochondrial tRNA processing(GO:0090646) |
0.1 | 1.7 | GO:0046498 | S-adenosylhomocysteine metabolic process(GO:0046498) |
0.1 | 1.2 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.1 | 0.4 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 0.5 | GO:0046060 | dATP metabolic process(GO:0046060) |
0.1 | 0.4 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.1 | 1.6 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.1 | 0.4 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 4.2 | GO:0032410 | negative regulation of transporter activity(GO:0032410) |
0.1 | 0.4 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.1 | 0.8 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.1 | 0.4 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.1 | 0.7 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.1 | 0.4 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.1 | 0.9 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.1 | 1.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.1 | 0.2 | GO:0002681 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
0.1 | 0.3 | GO:0048698 | negative regulation of collateral sprouting in absence of injury(GO:0048698) |
0.1 | 0.4 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
0.1 | 0.8 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 0.3 | GO:0051933 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
0.1 | 0.6 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.1 | 0.2 | GO:0031038 | myosin II filament organization(GO:0031038) regulation of myosin II filament organization(GO:0043519) |
0.1 | 0.7 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.1 | 1.9 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) |
0.1 | 2.0 | GO:0006541 | glutamine metabolic process(GO:0006541) |
0.1 | 0.1 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.1 | 0.9 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.1 | 0.6 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.1 | 1.8 | GO:0034308 | primary alcohol metabolic process(GO:0034308) |
0.1 | 0.8 | GO:1904152 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.1 | 0.5 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 0.5 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.1 | 0.8 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.1 | 0.5 | GO:1903527 | regulation of membrane tubulation(GO:1903525) positive regulation of membrane tubulation(GO:1903527) |
0.1 | 0.5 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.1 | 0.6 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 0.3 | GO:2000018 | embryonic heart tube left/right pattern formation(GO:0060971) regulation of male gonad development(GO:2000018) positive regulation of male gonad development(GO:2000020) |
0.1 | 1.5 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.1 | 1.2 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.1 | 1.2 | GO:0006337 | nucleosome disassembly(GO:0006337) |
0.1 | 0.1 | GO:1903170 | negative regulation of calcium ion transmembrane transport(GO:1903170) |
0.1 | 0.4 | GO:0099612 | protein localization to axon(GO:0099612) |
0.1 | 0.8 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.1 | 0.5 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.4 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.1 | 0.3 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 1.9 | GO:1990090 | response to nerve growth factor(GO:1990089) cellular response to nerve growth factor stimulus(GO:1990090) |
0.1 | 0.4 | GO:0035617 | stress granule disassembly(GO:0035617) |
0.1 | 10.4 | GO:0006457 | protein folding(GO:0006457) |
0.1 | 0.5 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.3 | GO:0002188 | translation reinitiation(GO:0002188) |
0.1 | 2.8 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
0.1 | 0.3 | GO:0035553 | oxidative single-stranded RNA demethylation(GO:0035553) |
0.1 | 1.5 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.1 | 0.2 | GO:0010814 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
0.1 | 0.1 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.1 | 0.4 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.1 | 0.6 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.1 | GO:0051311 | meiotic metaphase plate congression(GO:0051311) |
0.1 | 1.4 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.1 | 5.9 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.1 | 0.6 | GO:0061718 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
0.1 | 1.6 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
0.1 | 2.5 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.1 | 1.1 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.1 | 0.9 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.1 | 1.5 | GO:0033006 | regulation of mast cell activation involved in immune response(GO:0033006) regulation of mast cell degranulation(GO:0043304) |
0.1 | 2.0 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
0.1 | 0.2 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.1 | 0.5 | GO:0007141 | male meiosis I(GO:0007141) |
0.1 | 1.6 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.1 | 0.5 | GO:0007296 | vitellogenesis(GO:0007296) |
0.1 | 1.1 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.1 | 0.6 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.1 | 0.8 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.1 | 0.4 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.1 | 0.5 | GO:0010884 | positive regulation of lipid storage(GO:0010884) |
0.1 | 0.2 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.1 | 0.2 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
0.1 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
0.1 | 1.0 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.1 | 1.1 | GO:0003351 | epithelial cilium movement(GO:0003351) |
0.1 | 0.5 | GO:0015808 | L-alanine transport(GO:0015808) |
0.1 | 0.8 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.1 | 0.8 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
0.1 | 0.6 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.1 | 0.6 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.1 | 0.8 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.1 | 0.4 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.1 | 0.6 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.1 | 0.7 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.1 | 1.8 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.1 | 0.2 | GO:0003356 | regulation of cilium movement(GO:0003352) regulation of cilium beat frequency(GO:0003356) |
0.1 | 0.2 | GO:0097309 | cap1 mRNA methylation(GO:0097309) |
0.1 | 0.6 | GO:0030238 | male sex determination(GO:0030238) |
0.1 | 0.5 | GO:0070986 | left/right axis specification(GO:0070986) |
0.1 | 0.7 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.1 | 1.5 | GO:0050850 | positive regulation of calcium-mediated signaling(GO:0050850) |
0.1 | 0.5 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.1 | 0.8 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.1 | 0.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 2.5 | GO:0001881 | receptor recycling(GO:0001881) |
0.1 | 0.2 | GO:0002302 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
0.1 | 1.3 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.1 | 0.5 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.1 | 0.3 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.1 | 1.1 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.1 | 0.6 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
0.1 | 0.4 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.1 | 0.5 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.1 | 0.7 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.1 | 0.6 | GO:0031294 | lymphocyte costimulation(GO:0031294) |
0.1 | 0.3 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
0.1 | 0.6 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.1 | 1.2 | GO:0002534 | cytokine production involved in inflammatory response(GO:0002534) |
0.1 | 0.4 | GO:0019359 | NAD biosynthetic process(GO:0009435) nicotinamide nucleotide biosynthetic process(GO:0019359) |
0.1 | 0.4 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.1 | 1.8 | GO:0043631 | RNA polyadenylation(GO:0043631) |
0.1 | 2.6 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.1 | 2.3 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.1 | 0.3 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.1 | 0.2 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.1 | 0.8 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
0.1 | 0.3 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 1.4 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.1 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
0.1 | 0.5 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
0.1 | 2.1 | GO:0035690 | cellular response to drug(GO:0035690) |
0.1 | 0.3 | GO:0098909 | regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
0.1 | 0.3 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.1 | 1.0 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.1 | 0.3 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.1 | 0.5 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.1 | 0.5 | GO:0051701 | interaction with host(GO:0051701) |
0.1 | 2.6 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.1 | 0.8 | GO:0060761 | negative regulation of response to cytokine stimulus(GO:0060761) |
0.0 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.5 | GO:1903963 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.0 | 0.5 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.2 | GO:0072272 | pattern specification involved in metanephros development(GO:0072268) proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
0.0 | 1.2 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
0.0 | 0.8 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.4 | GO:0031643 | positive regulation of myelination(GO:0031643) |
0.0 | 0.4 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.7 | GO:0071168 | protein localization to chromatin(GO:0071168) |
0.0 | 0.1 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
0.0 | 0.2 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.0 | 0.2 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.0 | 0.3 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
0.0 | 0.3 | GO:0021800 | cerebral cortex tangential migration(GO:0021800) |
0.0 | 0.8 | GO:0042755 | eating behavior(GO:0042755) |
0.0 | 1.1 | GO:0031047 | gene silencing by RNA(GO:0031047) |
0.0 | 1.9 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.0 | 0.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.7 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 1.7 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
0.0 | 0.1 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
0.0 | 0.4 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.7 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.0 | 0.3 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
0.0 | 0.3 | GO:0032625 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
0.0 | 1.7 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 1.3 | GO:0001947 | heart looping(GO:0001947) |
0.0 | 1.0 | GO:0014047 | glutamate secretion(GO:0014047) |
0.0 | 0.3 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.0 | 0.4 | GO:0031017 | exocrine pancreas development(GO:0031017) |
0.0 | 0.3 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 1.0 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
0.0 | 0.4 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
0.0 | 1.1 | GO:1990542 | mitochondrial transmembrane transport(GO:1990542) |
0.0 | 0.3 | GO:0061085 | regulation of histone H3-K27 methylation(GO:0061085) positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.0 | 0.5 | GO:0042775 | mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
0.0 | 0.6 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.0 | 0.7 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
0.0 | 0.4 | GO:0006405 | RNA export from nucleus(GO:0006405) |
0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.9 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.0 | 0.9 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
0.0 | 0.5 | GO:0007097 | nuclear migration(GO:0007097) establishment of nucleus localization(GO:0040023) |
0.0 | 1.0 | GO:0007492 | endoderm development(GO:0007492) |
0.0 | 0.5 | GO:0071709 | membrane assembly(GO:0071709) |
0.0 | 0.5 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.3 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.0 | 0.1 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
0.0 | 0.2 | GO:2000303 | regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) regulation of ceramide biosynthetic process(GO:2000303) |
0.0 | 0.3 | GO:0090190 | positive regulation of mesonephros development(GO:0061213) positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
0.0 | 1.0 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.3 | GO:0060416 | response to growth hormone(GO:0060416) |
0.0 | 0.5 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.0 | 0.4 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.0 | 2.2 | GO:0021987 | cerebral cortex development(GO:0021987) |
0.0 | 1.7 | GO:0032088 | negative regulation of NF-kappaB transcription factor activity(GO:0032088) |
0.0 | 0.1 | GO:0060025 | regulation of synaptic activity(GO:0060025) |
0.0 | 0.7 | GO:2000171 | negative regulation of dendrite development(GO:2000171) |
0.0 | 0.2 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.0 | 0.3 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.4 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.0 | 0.2 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.3 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.3 | GO:0006415 | translational termination(GO:0006415) |
0.0 | 0.3 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.0 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.0 | 0.3 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.0 | 0.2 | GO:0036480 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
0.0 | 0.2 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
0.0 | 0.1 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.0 | 0.4 | GO:0032526 | response to retinoic acid(GO:0032526) |
0.0 | 0.7 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.1 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
0.0 | 0.1 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
0.0 | 0.6 | GO:0003170 | heart valve development(GO:0003170) |
0.0 | 0.6 | GO:0045727 | positive regulation of translation(GO:0045727) |
0.0 | 1.2 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.0 | 1.0 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 1.1 | GO:0007632 | visual behavior(GO:0007632) |
0.0 | 0.4 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.6 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
0.0 | 0.8 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.0 | 0.3 | GO:1904591 | positive regulation of protein import(GO:1904591) |
0.0 | 0.1 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.0 | 0.2 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.0 | 0.3 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.6 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.3 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.0 | 0.5 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 1.5 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.0 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
0.0 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.1 | GO:0061042 | vascular wound healing(GO:0061042) |
0.0 | 0.1 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.0 | GO:0003374 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
0.0 | 0.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.9 | GO:0009060 | aerobic respiration(GO:0009060) |
0.0 | 0.0 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.3 | GO:0002446 | neutrophil mediated immunity(GO:0002446) |
0.0 | 0.5 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
0.0 | 0.7 | GO:0015992 | proton transport(GO:0015992) |
0.0 | 0.1 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.0 | 0.3 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
0.0 | 0.1 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.0 | 0.2 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
0.0 | 0.1 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.0 | 0.2 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.0 | 0.1 | GO:0046543 | development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
0.0 | 0.3 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.4 | GO:0035058 | nonmotile primary cilium assembly(GO:0035058) regulation of nonmotile primary cilium assembly(GO:1902855) |
0.0 | 0.2 | GO:0006968 | cellular defense response(GO:0006968) |
0.0 | 0.2 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
0.0 | 0.2 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.0 | 0.9 | GO:0030308 | negative regulation of cell growth(GO:0030308) |
0.0 | 0.2 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
0.0 | 0.3 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.0 | 1.0 | GO:0007612 | learning(GO:0007612) |
0.0 | 0.3 | GO:2000179 | positive regulation of neural precursor cell proliferation(GO:2000179) |
0.0 | 0.1 | GO:0035411 | catenin import into nucleus(GO:0035411) |
0.0 | 0.3 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.0 | 0.1 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
0.0 | 0.1 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.0 | 0.2 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
0.0 | 2.0 | GO:0007411 | axon guidance(GO:0007411) |
0.0 | 0.1 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.1 | GO:0000422 | mitophagy(GO:0000422) mitochondrion disassembly(GO:0061726) |
0.0 | 0.1 | GO:0033598 | mammary gland epithelial cell proliferation(GO:0033598) |
0.0 | 1.2 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
0.0 | 0.4 | GO:0030838 | positive regulation of actin filament polymerization(GO:0030838) |
0.0 | 0.3 | GO:0030032 | lamellipodium assembly(GO:0030032) |
0.0 | 1.0 | GO:0048193 | Golgi vesicle transport(GO:0048193) |
0.0 | 0.6 | GO:0006413 | translational initiation(GO:0006413) |
0.0 | 0.1 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.0 | 0.2 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.0 | 0.1 | GO:0097035 | regulation of membrane lipid distribution(GO:0097035) |
0.0 | 0.1 | GO:0033273 | response to vitamin(GO:0033273) |
0.0 | 0.3 | GO:0032091 | negative regulation of protein binding(GO:0032091) |
0.0 | 0.2 | GO:0035065 | regulation of histone acetylation(GO:0035065) |
0.0 | 0.1 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
0.0 | 0.3 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 1.3 | GO:0051291 | protein heterooligomerization(GO:0051291) |
0.0 | 0.2 | GO:0019933 | cAMP-mediated signaling(GO:0019933) |
Gene overrepresentation in cellular_component category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.9 | 5.7 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
1.3 | 2.6 | GO:0000812 | Swr1 complex(GO:0000812) |
1.2 | 3.7 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
0.8 | 3.1 | GO:0043259 | laminin-1 complex(GO:0005606) laminin-10 complex(GO:0043259) |
0.7 | 4.7 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.6 | 4.9 | GO:0033269 | internode region of axon(GO:0033269) |
0.6 | 3.5 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.6 | 5.5 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.5 | 1.6 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.5 | 4.6 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.5 | 2.5 | GO:0001652 | granular component(GO:0001652) |
0.5 | 1.5 | GO:0031417 | NatC complex(GO:0031417) |
0.5 | 2.0 | GO:0071942 | XPC complex(GO:0071942) |
0.5 | 0.5 | GO:0035061 | interchromatin granule(GO:0035061) |
0.5 | 1.5 | GO:0097233 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
0.5 | 5.8 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.5 | 2.8 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.4 | 1.7 | GO:1903349 | omegasome membrane(GO:1903349) |
0.4 | 2.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.4 | 4.6 | GO:0005642 | annulate lamellae(GO:0005642) |
0.4 | 6.3 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.4 | 1.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.4 | 1.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.4 | 1.9 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.4 | 0.8 | GO:0044194 | cytolytic granule(GO:0044194) |
0.4 | 2.9 | GO:0031415 | NatA complex(GO:0031415) |
0.4 | 2.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.4 | 2.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.3 | 2.4 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.3 | 1.4 | GO:1902636 | kinociliary basal body(GO:1902636) |
0.3 | 4.7 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.3 | 1.6 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.3 | 1.0 | GO:0031533 | mRNA cap methyltransferase complex(GO:0031533) |
0.3 | 1.3 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.3 | 2.5 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.3 | 1.8 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.3 | 0.9 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.3 | 0.9 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.3 | 4.0 | GO:0005922 | connexon complex(GO:0005922) |
0.3 | 1.4 | GO:0070820 | tertiary granule(GO:0070820) |
0.3 | 7.4 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.3 | 0.9 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
0.3 | 0.8 | GO:0042642 | actomyosin, myosin complex part(GO:0042642) |
0.3 | 4.5 | GO:0043196 | varicosity(GO:0043196) |
0.3 | 1.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.3 | 1.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.3 | 1.9 | GO:0005827 | polar microtubule(GO:0005827) |
0.3 | 1.0 | GO:0072487 | MSL complex(GO:0072487) |
0.3 | 4.0 | GO:0030008 | TRAPP complex(GO:0030008) |
0.2 | 1.5 | GO:0033010 | paranodal junction(GO:0033010) |
0.2 | 1.0 | GO:0032021 | NELF complex(GO:0032021) |
0.2 | 2.4 | GO:0016272 | prefoldin complex(GO:0016272) |
0.2 | 0.7 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
0.2 | 0.9 | GO:0070552 | BRISC complex(GO:0070552) |
0.2 | 1.6 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.2 | 1.4 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.2 | 0.9 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
0.2 | 0.7 | GO:0043224 | nuclear SCF ubiquitin ligase complex(GO:0043224) |
0.2 | 5.2 | GO:0045120 | pronucleus(GO:0045120) |
0.2 | 0.2 | GO:1990635 | proximal dendrite(GO:1990635) |
0.2 | 1.3 | GO:0033391 | chromatoid body(GO:0033391) |
0.2 | 2.7 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.2 | 2.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.2 | 1.4 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.2 | 0.4 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.2 | 2.0 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.2 | 3.3 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.2 | 3.1 | GO:0032433 | filopodium tip(GO:0032433) |
0.2 | 1.6 | GO:0042382 | paraspeckles(GO:0042382) |
0.2 | 0.8 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.2 | 6.3 | GO:0090544 | BAF-type complex(GO:0090544) |
0.2 | 1.5 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.2 | 3.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.2 | 0.8 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.2 | 1.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.2 | 0.4 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
0.2 | 1.7 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.2 | 1.7 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.2 | 0.5 | GO:0048179 | activin receptor complex(GO:0048179) |
0.2 | 1.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.2 | 0.5 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
0.2 | 2.5 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.2 | 0.5 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.2 | 1.1 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
0.2 | 0.5 | GO:0030677 | ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.2 | 0.9 | GO:0036396 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
0.2 | 2.4 | GO:0005869 | dynactin complex(GO:0005869) |
0.2 | 1.9 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.2 | 1.4 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.2 | 1.5 | GO:0036157 | outer dynein arm(GO:0036157) |
0.2 | 1.3 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
0.2 | 0.5 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
0.2 | 1.6 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.2 | 1.8 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.2 | 0.2 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.2 | 2.0 | GO:0046930 | pore complex(GO:0046930) |
0.2 | 2.0 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.2 | 0.6 | GO:0099569 | presynaptic cytoskeleton(GO:0099569) |
0.2 | 0.3 | GO:0000322 | storage vacuole(GO:0000322) |
0.2 | 7.3 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.2 | 1.7 | GO:0097346 | INO80-type complex(GO:0097346) |
0.2 | 1.2 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.2 | 0.9 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
0.1 | 1.2 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.1 | 0.6 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.1 | 1.3 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 1.3 | GO:0032797 | SMN complex(GO:0032797) |
0.1 | 0.1 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.1 | 1.9 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
0.1 | 1.0 | GO:0070695 | FHF complex(GO:0070695) |
0.1 | 0.7 | GO:0097226 | sperm mitochondrial sheath(GO:0097226) |
0.1 | 2.0 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 3.5 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.1 | 0.9 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 3.8 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.1 | 1.9 | GO:0016580 | Sin3 complex(GO:0016580) |
0.1 | 0.5 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 1.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 2.0 | GO:0032039 | integrator complex(GO:0032039) |
0.1 | 1.6 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.5 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.1 | 2.2 | GO:0033176 | proton-transporting V-type ATPase complex(GO:0033176) |
0.1 | 0.5 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.1 | 1.6 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
0.1 | 0.8 | GO:0097422 | tubular endosome(GO:0097422) |
0.1 | 1.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 1.0 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 0.1 | GO:0000799 | nuclear condensin complex(GO:0000799) |
0.1 | 1.1 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.3 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.1 | 1.9 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 0.4 | GO:1990769 | proximal neuron projection(GO:1990769) |
0.1 | 0.5 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.1 | 0.3 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
0.1 | 2.0 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
0.1 | 0.8 | GO:0090543 | Flemming body(GO:0090543) |
0.1 | 0.4 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.1 | 0.5 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 2.5 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 2.0 | GO:0000242 | pericentriolar material(GO:0000242) |
0.1 | 5.9 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.1 | 1.6 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 1.2 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.1 | 1.8 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 1.3 | GO:0044754 | secondary lysosome(GO:0005767) autolysosome(GO:0044754) |
0.1 | 1.9 | GO:0043197 | dendritic spine(GO:0043197) neuron spine(GO:0044309) |
0.1 | 1.4 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.1 | 2.4 | GO:0043194 | axon initial segment(GO:0043194) |
0.1 | 0.7 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.1 | 0.4 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.1 | 3.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 0.7 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 0.6 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.9 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.1 | 1.2 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.1 | 0.5 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.1 | 1.7 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.1 | 0.6 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.1 | 1.1 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 1.7 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.1 | 3.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.1 | 0.4 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.1 | 5.6 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.1 | 1.5 | GO:0000145 | exocyst(GO:0000145) |
0.1 | 1.0 | GO:0030286 | dynein complex(GO:0030286) |
0.1 | 0.4 | GO:0000235 | astral microtubule(GO:0000235) |
0.1 | 1.4 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.1 | 1.2 | GO:0034451 | centriolar satellite(GO:0034451) |
0.1 | 0.9 | GO:0070938 | contractile ring(GO:0070938) |
0.1 | 0.9 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 5.2 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.1 | 0.5 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.1 | 1.1 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 5.2 | GO:0005643 | nuclear pore(GO:0005643) |
0.1 | 0.2 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
0.1 | 0.6 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 1.0 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.1 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.1 | 0.2 | GO:1990423 | Dsl1p complex(GO:0070939) RZZ complex(GO:1990423) |
0.1 | 0.4 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.1 | 0.6 | GO:0001739 | sex chromatin(GO:0001739) |
0.1 | 0.7 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.1 | 0.7 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) |
0.1 | 2.1 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 11.9 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.1 | 1.0 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.1 | 0.3 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
0.1 | 14.8 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
0.1 | 0.8 | GO:0016460 | myosin II complex(GO:0016460) |
0.1 | 0.2 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 1.0 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.7 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.1 | 0.2 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 2.4 | GO:0043209 | myelin sheath(GO:0043209) |
0.1 | 4.4 | GO:0001669 | acrosomal vesicle(GO:0001669) |
0.1 | 0.6 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 0.8 | GO:0030663 | COPI vesicle coat(GO:0030126) COPI-coated vesicle membrane(GO:0030663) |
0.1 | 5.0 | GO:0031965 | nuclear membrane(GO:0031965) |
0.1 | 3.0 | GO:0005811 | lipid particle(GO:0005811) |
0.1 | 0.8 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.1 | 0.2 | GO:0008091 | spectrin(GO:0008091) |
0.1 | 0.6 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 3.5 | GO:0005844 | polysome(GO:0005844) |
0.1 | 0.5 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.1 | 2.9 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.1 | 3.4 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
0.1 | 0.4 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.3 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.5 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 1.8 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 1.4 | GO:0045121 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
0.0 | 0.5 | GO:0070461 | SAGA-type complex(GO:0070461) |
0.0 | 1.2 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.2 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.0 | 1.2 | GO:0098797 | plasma membrane protein complex(GO:0098797) |
0.0 | 1.5 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 2.1 | GO:0030027 | lamellipodium(GO:0030027) |
0.0 | 0.5 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 1.5 | GO:0099738 | cell cortex region(GO:0099738) |
0.0 | 0.9 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.8 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.7 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 4.5 | GO:0019867 | mitochondrial outer membrane(GO:0005741) outer membrane(GO:0019867) organelle outer membrane(GO:0031968) |
0.0 | 1.4 | GO:0002102 | podosome(GO:0002102) |
0.0 | 5.2 | GO:0043296 | apical junction complex(GO:0043296) |
0.0 | 0.6 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 1.9 | GO:0014704 | intercalated disc(GO:0014704) |
0.0 | 1.6 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 0.8 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.4 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.6 | GO:0044291 | cell-cell contact zone(GO:0044291) |
0.0 | 0.4 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.5 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 0.2 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 2.5 | GO:0072562 | blood microparticle(GO:0072562) |
0.0 | 0.4 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.3 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 1.6 | GO:0005902 | microvillus(GO:0005902) |
0.0 | 7.8 | GO:0060076 | excitatory synapse(GO:0060076) |
0.0 | 1.7 | GO:0036126 | sperm flagellum(GO:0036126) |
0.0 | 0.4 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.8 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 3.3 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.5 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.2 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 1.0 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 3.8 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 2.2 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 1.2 | GO:0000139 | Golgi membrane(GO:0000139) |
0.0 | 0.8 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 2.4 | GO:0030426 | growth cone(GO:0030426) |
0.0 | 1.0 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.2 | GO:0097386 | glial cell projection(GO:0097386) |
0.0 | 0.2 | GO:0030672 | transport vesicle membrane(GO:0030658) synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.0 | 1.0 | GO:0022627 | small ribosomal subunit(GO:0015935) cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.2 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.5 | GO:0030175 | filopodium(GO:0030175) |
0.0 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.0 | 0.2 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 1.6 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 0.0 | GO:0035101 | FACT complex(GO:0035101) |
0.0 | 24.1 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 1.2 | GO:0016605 | PML body(GO:0016605) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 4.7 | GO:0005874 | microtubule(GO:0005874) |
0.0 | 0.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 1.0 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.7 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.3 | GO:0032040 | small-subunit processome(GO:0032040) |
0.0 | 0.5 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
0.0 | 0.8 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.6 | GO:0036064 | ciliary basal body(GO:0036064) |
0.0 | 0.2 | GO:0008180 | COP9 signalosome(GO:0008180) |
Gene overrepresentation in molecular_function category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 4.1 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
1.3 | 4.0 | GO:0086077 | gap junction channel activity involved in AV node cell-bundle of His cell electrical coupling(GO:0086077) |
1.0 | 3.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.9 | 2.8 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
0.9 | 3.5 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.8 | 12.9 | GO:0030957 | Tat protein binding(GO:0030957) |
0.8 | 2.3 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.7 | 2.1 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.6 | 2.5 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.6 | 3.7 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.6 | 4.8 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.6 | 3.6 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
0.6 | 1.8 | GO:0004816 | asparagine-tRNA ligase activity(GO:0004816) |
0.6 | 6.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.6 | 3.4 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
0.5 | 3.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.5 | 2.1 | GO:0033883 | pyridoxal phosphatase activity(GO:0033883) |
0.5 | 1.5 | GO:0070140 | isopeptidase activity(GO:0070122) ubiquitin-like protein-specific isopeptidase activity(GO:0070138) SUMO-specific isopeptidase activity(GO:0070140) |
0.5 | 1.9 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.5 | 1.4 | GO:0009918 | sterol delta7 reductase activity(GO:0009918) 7-dehydrocholesterol reductase activity(GO:0047598) |
0.5 | 1.4 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.5 | 2.4 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.5 | 1.9 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.5 | 0.5 | GO:0098809 | nitrite reductase activity(GO:0098809) |
0.4 | 12.5 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.4 | 1.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.4 | 1.5 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
0.4 | 1.5 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
0.4 | 1.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.4 | 1.8 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.4 | 1.4 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.4 | 2.5 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.4 | 1.1 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
0.4 | 1.4 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
0.3 | 1.7 | GO:1904047 | S-adenosyl-L-methionine binding(GO:1904047) |
0.3 | 1.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.3 | 16.2 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.3 | 1.4 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.3 | 1.7 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.3 | 2.4 | GO:0048101 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.3 | 1.0 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.3 | 4.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.3 | 3.9 | GO:0051861 | glycolipid binding(GO:0051861) |
0.3 | 1.0 | GO:0015928 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
0.3 | 3.9 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.3 | 1.0 | GO:0004482 | mRNA (guanine-N7-)-methyltransferase activity(GO:0004482) |
0.3 | 1.0 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.3 | 1.9 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
0.3 | 2.8 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.3 | 0.9 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.3 | 1.3 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
0.3 | 1.6 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.3 | 0.9 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.3 | 1.9 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.3 | 1.8 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
0.3 | 2.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.3 | 1.8 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.3 | 5.9 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.3 | 4.4 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.3 | 1.2 | GO:0004844 | mismatch base pair DNA N-glycosylase activity(GO:0000700) uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.3 | 0.9 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.3 | 1.4 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
0.3 | 2.0 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.3 | 1.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.3 | 1.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.3 | 0.6 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.3 | 3.0 | GO:1990405 | protein antigen binding(GO:1990405) |
0.3 | 3.6 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.3 | 0.8 | GO:0031403 | lithium ion binding(GO:0031403) |
0.3 | 1.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.3 | 1.3 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.3 | 2.6 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.3 | 1.8 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.3 | 0.8 | GO:0046969 | histone deacetylase activity (H3-K9 specific)(GO:0032129) NAD-dependent histone deacetylase activity (H3-K9 specific)(GO:0046969) |
0.3 | 2.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.3 | 2.6 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.3 | 5.5 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.3 | 0.8 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.2 | 0.7 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.2 | 0.7 | GO:0031208 | POZ domain binding(GO:0031208) |
0.2 | 1.0 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.2 | 1.5 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
0.2 | 0.7 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.2 | 0.7 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.2 | 1.0 | GO:0003883 | CTP synthase activity(GO:0003883) |
0.2 | 1.0 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.2 | 1.9 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.2 | 1.0 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.2 | 1.2 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
0.2 | 2.4 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.2 | 1.6 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.2 | 0.2 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.2 | 1.6 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.2 | 2.0 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.2 | 2.6 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.2 | 1.1 | GO:0047134 | thioredoxin-disulfide reductase activity(GO:0004791) protein-disulfide reductase activity(GO:0047134) |
0.2 | 1.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.2 | 1.7 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.2 | 1.0 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.2 | 0.8 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.2 | 0.2 | GO:0097677 | STAT family protein binding(GO:0097677) |
0.2 | 1.6 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.2 | 0.2 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.2 | 1.2 | GO:0000298 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
0.2 | 0.8 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
0.2 | 0.6 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.2 | 0.6 | GO:0004473 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
0.2 | 1.7 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.2 | 1.0 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.2 | 6.8 | GO:0050699 | WW domain binding(GO:0050699) |
0.2 | 1.3 | GO:0043199 | sulfate binding(GO:0043199) |
0.2 | 0.6 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.2 | 0.6 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.2 | 1.5 | GO:0016531 | copper chaperone activity(GO:0016531) |
0.2 | 11.9 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.2 | 0.9 | GO:0050700 | CARD domain binding(GO:0050700) |
0.2 | 0.7 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.2 | 0.5 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
0.2 | 1.4 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.2 | 2.8 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.2 | 1.4 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
0.2 | 0.7 | GO:0003681 | bent DNA binding(GO:0003681) |
0.2 | 1.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.2 | 1.4 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.2 | 0.9 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.2 | 1.0 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.2 | 0.8 | GO:0010340 | carboxyl-O-methyltransferase activity(GO:0010340) protein carboxyl O-methyltransferase activity(GO:0051998) |
0.2 | 0.5 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.2 | 2.0 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.2 | 1.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.2 | 3.8 | GO:0031489 | myosin V binding(GO:0031489) |
0.2 | 1.0 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.2 | 0.8 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.2 | 2.6 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.2 | 3.1 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.2 | 4.6 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.2 | 2.9 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.2 | 1.7 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.2 | 3.6 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.2 | 0.6 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.1 | 1.3 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.1 | 5.1 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 0.9 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.7 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
0.1 | 0.7 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.1 | 1.0 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 6.7 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.1 | 1.9 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 3.2 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.1 | 0.5 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.1 | 0.5 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.1 | 4.1 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.1 | 2.7 | GO:0008143 | poly(A) binding(GO:0008143) |
0.1 | 1.0 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.1 | 9.6 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.1 | 1.0 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 0.6 | GO:0044020 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.1 | 0.4 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 1.4 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.5 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.1 | 0.5 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.1 | 0.6 | GO:0043515 | kinetochore binding(GO:0043515) |
0.1 | 0.5 | GO:0015410 | manganese-transporting ATPase activity(GO:0015410) |
0.1 | 1.6 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.1 | 1.6 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 1.0 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.8 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.1 | 1.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 1.8 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.3 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.1 | 0.3 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
0.1 | 0.9 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.1 | 0.8 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
0.1 | 3.5 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 5.0 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 0.3 | GO:0035242 | histone-arginine N-methyltransferase activity(GO:0008469) protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.1 | 1.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.3 | GO:0034190 | very-low-density lipoprotein particle binding(GO:0034189) apolipoprotein receptor binding(GO:0034190) |
0.1 | 0.4 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.1 | 1.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 1.6 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.1 | 2.2 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 1.1 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 5.8 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.1 | 4.2 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.1 | 1.6 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.1 | 5.5 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.1 | 0.7 | GO:0048185 | activin binding(GO:0048185) |
0.1 | 0.9 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
0.1 | 1.0 | GO:0000339 | RNA cap binding(GO:0000339) |
0.1 | 1.4 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.5 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.1 | 1.3 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.1 | 0.5 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
0.1 | 0.9 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 0.4 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.1 | 0.5 | GO:0008494 | translation activator activity(GO:0008494) |
0.1 | 1.1 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.1 | 0.5 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 2.6 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.1 | 0.3 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
0.1 | 0.2 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 2.9 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.1 | 0.4 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 2.7 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.1 | 2.2 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.1 | 0.7 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.7 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.1 | 0.3 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.1 | 0.8 | GO:0031996 | thioesterase binding(GO:0031996) |
0.1 | 1.2 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
0.1 | 0.4 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.1 | 0.3 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.1 | 0.5 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.1 | 0.1 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.1 | 1.5 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.1 | 0.3 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 0.7 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 0.8 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
0.1 | 4.6 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.1 | 0.9 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.1 | 0.8 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.1 | 1.0 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.1 | 0.5 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
0.1 | 1.0 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 0.4 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.1 | 1.8 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.1 | 0.6 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.1 | 0.9 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.1 | 0.4 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.9 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.1 | 0.3 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.1 | 0.4 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.1 | 1.6 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.1 | 0.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.1 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.1 | 0.8 | GO:0015250 | water channel activity(GO:0015250) |
0.1 | 1.4 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.1 | 1.4 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 1.0 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 3.2 | GO:0019003 | GDP binding(GO:0019003) |
0.1 | 0.3 | GO:0034602 | oxoglutarate dehydrogenase (NAD+) activity(GO:0034602) |
0.1 | 0.5 | GO:0048495 | Roundabout binding(GO:0048495) |
0.1 | 0.9 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.1 | 0.7 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.1 | 0.2 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.1 | 2.0 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.1 | 0.6 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
0.1 | 0.8 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.1 | 2.6 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.1 | 0.3 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 1.7 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 0.4 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.1 | 0.5 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
0.1 | 0.5 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 0.6 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 0.7 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.1 | 0.9 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.1 | 0.2 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
0.1 | 0.5 | GO:0015266 | protein channel activity(GO:0015266) |
0.1 | 1.8 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.1 | 2.9 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.1 | 1.6 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.2 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.1 | 2.4 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 0.3 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.1 | 1.2 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.1 | 0.3 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 0.2 | GO:0015232 | heme transporter activity(GO:0015232) |
0.1 | 0.6 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 8.6 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.5 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 1.9 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.2 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
0.0 | 1.2 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 2.8 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.8 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 1.3 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.7 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.7 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.0 | 4.4 | GO:0008013 | beta-catenin binding(GO:0008013) |
0.0 | 0.3 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.5 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.0 | 0.6 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 0.8 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.2 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.2 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
0.0 | 2.5 | GO:0004004 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) |
0.0 | 0.5 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 1.1 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.0 | 1.5 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.3 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
0.0 | 1.0 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 0.6 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.6 | GO:0022839 | ion gated channel activity(GO:0022839) |
0.0 | 0.4 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.5 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.7 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.0 | 0.3 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
0.0 | 0.5 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 7.4 | GO:0061659 | ubiquitin-like protein ligase activity(GO:0061659) |
0.0 | 1.0 | GO:0004532 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity(GO:0004532) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.0 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.0 | 0.3 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.7 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
0.0 | 0.8 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.0 | 0.3 | GO:0051393 | alpha-actinin binding(GO:0051393) |
0.0 | 0.3 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.0 | 0.5 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.0 | 0.6 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 1.5 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.4 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 1.4 | GO:0005506 | iron ion binding(GO:0005506) |
0.0 | 0.1 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
0.0 | 0.3 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.4 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.0 | 0.1 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
0.0 | 0.6 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.5 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 1.1 | GO:0097110 | scaffold protein binding(GO:0097110) |
0.0 | 0.3 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.3 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.2 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.2 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.0 | 0.5 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 3.2 | GO:0051015 | actin filament binding(GO:0051015) |
0.0 | 2.3 | GO:0019783 | ubiquitin-like protein-specific protease activity(GO:0019783) |
0.0 | 0.5 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.6 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.8 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.2 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.6 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
0.0 | 0.6 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.6 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.2 | GO:0019825 | oxygen binding(GO:0019825) |
0.0 | 0.1 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.4 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.1 | GO:0043423 | NMDA glutamate receptor activity(GO:0004972) 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.3 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.0 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
0.0 | 0.3 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.0 | 0.3 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.0 | 1.7 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.3 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 1.0 | GO:0051117 | ATPase binding(GO:0051117) |
0.0 | 0.3 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.3 | GO:0019209 | kinase activator activity(GO:0019209) |
0.0 | 0.2 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.0 | 0.2 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 0.2 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
Gene overrepresentation in C2:CP category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.7 | 1.7 | SA_PTEN_PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.5 | 6.8 | PID_ERB_GENOMIC_PATHWAY | Validated nuclear estrogen receptor beta network |
0.4 | 3.1 | PID_INTEGRIN4_PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.3 | 4.4 | SA_G1_AND_S_PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.2 | 4.6 | PID_DNA_PK_PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.2 | 2.4 | PID_TCR_JNK_PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.2 | 4.1 | PID_EPHA2_FWD_PATHWAY | EPHA2 forward signaling |
0.1 | 4.1 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
0.1 | 1.3 | PID_ALK2_PATHWAY | ALK2 signaling events |
0.1 | 2.0 | PID_SYNDECAN_3_PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 1.5 | PID_INTEGRIN2_PATHWAY | Beta2 integrin cell surface interactions |
0.1 | 6.4 | PID_PLK1_PATHWAY | PLK1 signaling events |
0.1 | 5.5 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
0.1 | 3.5 | PID_P38_MK2_PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 0.5 | PID_PI3KCI_AKT_PATHWAY | Class I PI3K signaling events mediated by Akt |
0.1 | 3.3 | PID_FOXM1_PATHWAY | FOXM1 transcription factor network |
0.1 | 1.3 | PID_RANBP2_PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 1.9 | PID_HIF1A_PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 6.5 | PID_NOTCH_PATHWAY | Notch signaling pathway |
0.1 | 4.5 | PID_P75_NTR_PATHWAY | p75(NTR)-mediated signaling |
0.1 | 5.5 | PID_AR_PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 0.6 | ST_JNK_MAPK_PATHWAY | JNK MAPK Pathway |
0.1 | 1.3 | PID_WNT_NONCANONICAL_PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 2.4 | PID_AURORA_B_PATHWAY | Aurora B signaling |
0.1 | 1.1 | PID_IL1_PATHWAY | IL1-mediated signaling events |
0.1 | 0.8 | PID_ARF6_DOWNSTREAM_PATHWAY | Arf6 downstream pathway |
0.1 | 0.7 | PID_MAPK_TRK_PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.1 | 2.4 | PID_BETA_CATENIN_NUC_PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.1 | 2.4 | PID_CERAMIDE_PATHWAY | Ceramide signaling pathway |
0.1 | 0.8 | PID_P38_MKK3_6PATHWAY | p38 MAPK signaling pathway |
0.1 | 5.0 | PID_MYC_ACTIV_PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 1.1 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
0.0 | 3.1 | WNT_SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.4 | ST_INTEGRIN_SIGNALING_PATHWAY | Integrin Signaling Pathway |
0.0 | 1.1 | PID_ARF_3PATHWAY | Arf1 pathway |
0.0 | 1.5 | SIG_REGULATION_OF_THE_ACTIN_CYTOSKELETON_BY_RHO_GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 2.4 | PID_CMYB_PATHWAY | C-MYB transcription factor network |
0.0 | 0.4 | PID_NFAT_TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 1.4 | PID_SYNDECAN_1_PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.4 | PID_SMAD2_3NUCLEAR_PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.0 | 0.8 | PID_IFNG_PATHWAY | IFN-gamma pathway |
0.0 | 0.6 | PID_NECTIN_PATHWAY | Nectin adhesion pathway |
0.0 | 0.4 | PID_SMAD2_3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.5 | PID_ATM_PATHWAY | ATM pathway |
0.0 | 0.5 | PID_HEDGEHOG_GLI_PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 1.8 | PID_ERBB1_DOWNSTREAM_PATHWAY | ErbB1 downstream signaling |
0.0 | 0.3 | ST_G_ALPHA_S_PATHWAY | G alpha s Pathway |
0.0 | 0.5 | PID_HDAC_CLASSI_PATHWAY | Signaling events mediated by HDAC Class I |
0.0 | 0.5 | PID_CASPASE_PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.5 | PID_ECADHERIN_STABILIZATION_PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.1 | PID_IL2_PI3K_PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 0.5 | PID_AJDISS_2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.5 | PID_LIS1_PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.5 | PID_TRKR_PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.4 | PID_HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.2 | PID_ALPHA_SYNUCLEIN_PATHWAY | Alpha-synuclein signaling |
0.0 | 0.2 | PID_NCADHERIN_PATHWAY | N-cadherin signaling events |
0.0 | 0.5 | PID_TGFBR_PATHWAY | TGF-beta receptor signaling |
0.0 | 0.3 | PID_CDC42_REG_PATHWAY | Regulation of CDC42 activity |
Gene overrepresentation in C2:CP:REACTOME category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 1.0 | REACTOME_AUTODEGRADATION_OF_THE_E3_UBIQUITIN_LIGASE_COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
0.6 | 0.6 | REACTOME_SIGNAL_REGULATORY_PROTEIN_SIRP_FAMILY_INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.4 | 1.5 | REACTOME_ABORTIVE_ELONGATION_OF_HIV1_TRANSCRIPT_IN_THE_ABSENCE_OF_TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.3 | 2.4 | REACTOME_CYTOSOLIC_SULFONATION_OF_SMALL_MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.3 | 4.0 | REACTOME_GAP_JUNCTION_ASSEMBLY | Genes involved in Gap junction assembly |
0.3 | 11.8 | REACTOME_POST_TRANSLATIONAL_MODIFICATION_SYNTHESIS_OF_GPI_ANCHORED_PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.3 | 10.0 | REACTOME_PREFOLDIN_MEDIATED_TRANSFER_OF_SUBSTRATE_TO_CCT_TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.3 | 6.4 | REACTOME_HORMONE_SENSITIVE_LIPASE_HSL_MEDIATED_TRIACYLGLYCEROL_HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.3 | 3.2 | REACTOME_FORMATION_OF_INCISION_COMPLEX_IN_GG_NER | Genes involved in Formation of incision complex in GG-NER |
0.3 | 1.0 | REACTOME_GRB2_SOS_PROVIDES_LINKAGE_TO_MAPK_SIGNALING_FOR_INTERGRINS_ | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.3 | 1.5 | REACTOME_POST_CHAPERONIN_TUBULIN_FOLDING_PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.2 | 1.9 | REACTOME_MICRORNA_MIRNA_BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.2 | 3.9 | REACTOME_INTEGRATION_OF_PROVIRUS | Genes involved in Integration of provirus |
0.2 | 7.1 | REACTOME_MRNA_SPLICING_MINOR_PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.2 | 10.9 | REACTOME_RNA_POL_II_TRANSCRIPTION_PRE_INITIATION_AND_PROMOTER_OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.2 | 0.4 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_EARLY_ENDOSOME_MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.2 | 2.6 | REACTOME_SYNTHESIS_OF_PE | Genes involved in Synthesis of PE |
0.2 | 5.9 | REACTOME_CYTOSOLIC_TRNA_AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.2 | 2.9 | REACTOME_P130CAS_LINKAGE_TO_MAPK_SIGNALING_FOR_INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.2 | 2.1 | REACTOME_RECRUITMENT_OF_NUMA_TO_MITOTIC_CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.2 | 4.9 | REACTOME_CHOLESTEROL_BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.2 | 6.4 | REACTOME_TIGHT_JUNCTION_INTERACTIONS | Genes involved in Tight junction interactions |
0.2 | 4.4 | REACTOME_INSULIN_RECEPTOR_RECYCLING | Genes involved in Insulin receptor recycling |
0.2 | 2.8 | REACTOME_ERKS_ARE_INACTIVATED | Genes involved in ERKs are inactivated |
0.2 | 2.8 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_LATE_ENDOSOME_MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.2 | 6.2 | REACTOME_TRANSPORT_OF_RIBONUCLEOPROTEINS_INTO_THE_HOST_NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.2 | 2.2 | REACTOME_CALNEXIN_CALRETICULIN_CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.2 | 1.8 | REACTOME_PROTEOLYTIC_CLEAVAGE_OF_SNARE_COMPLEX_PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.2 | 3.7 | REACTOME_SEMA3A_PAK_DEPENDENT_AXON_REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.2 | 2.0 | REACTOME_REGULATION_OF_BETA_CELL_DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.2 | 1.2 | REACTOME_IRAK1_RECRUITS_IKK_COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.2 | 9.4 | REACTOME_REGULATION_OF_ORNITHINE_DECARBOXYLASE_ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.2 | 0.3 | REACTOME_TRAF6_MEDIATED_IRF7_ACTIVATION_IN_TLR7_8_OR_9_SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.2 | 2.3 | REACTOME_PROCESSING_OF_INTRONLESS_PRE_MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.2 | 0.8 | REACTOME_DESTABILIZATION_OF_MRNA_BY_AUF1_HNRNP_D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 8.1 | REACTOME_FORMATION_OF_THE_TERNARY_COMPLEX_AND_SUBSEQUENTLY_THE_43S_COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.1 | 1.0 | REACTOME_P75NTR_RECRUITS_SIGNALLING_COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.1 | 1.4 | REACTOME_ABACAVIR_TRANSPORT_AND_METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 3.1 | REACTOME_ENOS_ACTIVATION_AND_REGULATION | Genes involved in eNOS activation and regulation |
0.1 | 2.9 | REACTOME_METABOLISM_OF_PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 1.3 | REACTOME_SCFSKP2_MEDIATED_DEGRADATION_OF_P27_P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
0.1 | 2.8 | REACTOME_INHIBITION_OF_THE_PROTEOLYTIC_ACTIVITY_OF_APC_C_REQUIRED_FOR_THE_ONSET_OF_ANAPHASE_BY_MITOTIC_SPINDLE_CHECKPOINT_COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.1 | 1.2 | REACTOME_CYCLIN_E_ASSOCIATED_EVENTS_DURING_G1_S_TRANSITION_ | Genes involved in Cyclin E associated events during G1/S transition |
0.1 | 25.0 | REACTOME_ANTIGEN_PROCESSING_UBIQUITINATION_PROTEASOME_DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.1 | 1.9 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PC | Genes involved in Acyl chain remodelling of PC |
0.1 | 4.5 | REACTOME_ACTIVATED_NOTCH1_TRANSMITS_SIGNAL_TO_THE_NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.1 | 3.9 | REACTOME_G_BETA_GAMMA_SIGNALLING_THROUGH_PLC_BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.1 | 1.7 | REACTOME_VITAMIN_B5_PANTOTHENATE_METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.1 | 4.5 | REACTOME_INTERACTION_BETWEEN_L1_AND_ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 0.9 | REACTOME_REGULATION_OF_SIGNALING_BY_CBL | Genes involved in Regulation of signaling by CBL |
0.1 | 0.7 | REACTOME_NRIF_SIGNALS_CELL_DEATH_FROM_THE_NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.1 | 1.7 | REACTOME_NEGATIVE_REGULATORS_OF_RIG_I_MDA5_SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.1 | 1.4 | REACTOME_CDC6_ASSOCIATION_WITH_THE_ORC_ORIGIN_COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.1 | 2.6 | REACTOME_INSULIN_SYNTHESIS_AND_PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 1.6 | REACTOME_CITRIC_ACID_CYCLE_TCA_CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.1 | 2.9 | REACTOME_KINESINS | Genes involved in Kinesins |
0.1 | 1.4 | REACTOME_TGF_BETA_RECEPTOR_SIGNALING_IN_EMT_EPITHELIAL_TO_MESENCHYMAL_TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 1.2 | REACTOME_BASE_FREE_SUGAR_PHOSPHATE_REMOVAL_VIA_THE_SINGLE_NUCLEOTIDE_REPLACEMENT_PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 0.7 | REACTOME_TANDEM_PORE_DOMAIN_POTASSIUM_CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 0.4 | REACTOME_APC_C_CDH1_MEDIATED_DEGRADATION_OF_CDC20_AND_OTHER_APC_C_CDH1_TARGETED_PROTEINS_IN_LATE_MITOSIS_EARLY_G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.1 | 8.5 | REACTOME_L1CAM_INTERACTIONS | Genes involved in L1CAM interactions |
0.1 | 2.0 | REACTOME_TGF_BETA_RECEPTOR_SIGNALING_ACTIVATES_SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.1 | 0.2 | REACTOME_RESOLUTION_OF_AP_SITES_VIA_THE_SINGLE_NUCLEOTIDE_REPLACEMENT_PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.1 | 3.6 | REACTOME_GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.1 | 1.4 | REACTOME_MRNA_DECAY_BY_5_TO_3_EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 1.4 | REACTOME_TRAF3_DEPENDENT_IRF_ACTIVATION_PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.1 | 6.6 | REACTOME_RESPIRATORY_ELECTRON_TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 1.5 | REACTOME_NOTCH_HLH_TRANSCRIPTION_PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.1 | 0.7 | REACTOME_FORMATION_OF_RNA_POL_II_ELONGATION_COMPLEX_ | Genes involved in Formation of RNA Pol II elongation complex |
0.1 | 0.9 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 1.8 | REACTOME_PYRIMIDINE_METABOLISM | Genes involved in Pyrimidine metabolism |
0.1 | 1.2 | REACTOME_METABOLISM_OF_NON_CODING_RNA | Genes involved in Metabolism of non-coding RNA |
0.1 | 1.8 | REACTOME_RNA_POL_III_TRANSCRIPTION_TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 1.4 | REACTOME_FORMATION_OF_ATP_BY_CHEMIOSMOTIC_COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 0.3 | REACTOME_SEMA3A_PLEXIN_REPULSION_SIGNALING_BY_INHIBITING_INTEGRIN_ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 0.3 | REACTOME_CD28_DEPENDENT_VAV1_PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.1 | 1.1 | REACTOME_REGULATION_OF_APOPTOSIS | Genes involved in Regulation of Apoptosis |
0.1 | 3.4 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.7 | REACTOME_ADVANCED_GLYCOSYLATION_ENDPRODUCT_RECEPTOR_SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.1 | 0.6 | REACTOME_PRESYNAPTIC_NICOTINIC_ACETYLCHOLINE_RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.1 | 0.7 | REACTOME_DEPOSITION_OF_NEW_CENPA_CONTAINING_NUCLEOSOMES_AT_THE_CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 2.1 | REACTOME_HOST_INTERACTIONS_OF_HIV_FACTORS | Genes involved in Host Interactions of HIV factors |
0.1 | 1.9 | REACTOME_DEADENYLATION_OF_MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 1.0 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 2.9 | REACTOME_TRANSPORT_TO_THE_GOLGI_AND_SUBSEQUENT_MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.1 | 0.7 | REACTOME_SYNTHESIS_OF_BILE_ACIDS_AND_BILE_SALTS_VIA_7ALPHA_HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.1 | 0.5 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_ATF6_ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.1 | 4.1 | REACTOME_INFLUENZA_LIFE_CYCLE | Genes involved in Influenza Life Cycle |
0.1 | 0.4 | REACTOME_REMOVAL_OF_THE_FLAP_INTERMEDIATE_FROM_THE_C_STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.1 | 0.5 | REACTOME_OXYGEN_DEPENDENT_PROLINE_HYDROXYLATION_OF_HYPOXIA_INDUCIBLE_FACTOR_ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.1 | 1.6 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 0.8 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 0.5 | REACTOME_DOWNSTREAM_TCR_SIGNALING | Genes involved in Downstream TCR signaling |
0.1 | 2.0 | REACTOME_SIGNALING_BY_ROBO_RECEPTOR | Genes involved in Signaling by Robo receptor |
0.1 | 1.4 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 3.8 | REACTOME_MRNA_SPLICING | Genes involved in mRNA Splicing |
0.1 | 2.1 | REACTOME_SPHINGOLIPID_DE_NOVO_BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.1 | 2.1 | REACTOME_PI_METABOLISM | Genes involved in PI Metabolism |
0.0 | 0.7 | REACTOME_METABOLISM_OF_POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.5 | REACTOME_COPI_MEDIATED_TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.2 | REACTOME_PEPTIDE_CHAIN_ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.5 | REACTOME_BMAL1_CLOCK_NPAS2_ACTIVATES_CIRCADIAN_EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 0.4 | REACTOME_GABA_SYNTHESIS_RELEASE_REUPTAKE_AND_DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.9 | REACTOME_DOWNREGULATION_OF_SMAD2_3_SMAD4_TRANSCRIPTIONAL_ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.6 | REACTOME_IL1_SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 1.0 | REACTOME_SYNTHESIS_AND_INTERCONVERSION_OF_NUCLEOTIDE_DI_AND_TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.3 | REACTOME_DOUBLE_STRAND_BREAK_REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 0.6 | REACTOME_SYNTHESIS_OF_PC | Genes involved in Synthesis of PC |
0.0 | 3.6 | REACTOME_P75_NTR_RECEPTOR_MEDIATED_SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 1.3 | REACTOME_PACKAGING_OF_TELOMERE_ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.3 | REACTOME_ER_PHAGOSOME_PATHWAY | Genes involved in ER-Phagosome pathway |
0.0 | 0.5 | REACTOME_ALPHA_LINOLENIC_ACID_ALA_METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.4 | REACTOME_CHYLOMICRON_MEDIATED_LIPID_TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.5 | REACTOME_ABCA_TRANSPORTERS_IN_LIPID_HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.3 | REACTOME_PRE_NOTCH_PROCESSING_IN_GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.4 | REACTOME_MITOCHONDRIAL_TRNA_AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.1 | REACTOME_THROMBOXANE_SIGNALLING_THROUGH_TP_RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.0 | 0.5 | REACTOME_AMINO_ACID_SYNTHESIS_AND_INTERCONVERSION_TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 1.2 | REACTOME_CLASS_B_2_SECRETIN_FAMILY_RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.2 | REACTOME_METAL_ION_SLC_TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.8 | REACTOME_VOLTAGE_GATED_POTASSIUM_CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 0.4 | REACTOME_PTM_GAMMA_CARBOXYLATION_HYPUSINE_FORMATION_AND_ARYLSULFATASE_ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.0 | 0.5 | REACTOME_POST_NMDA_RECEPTOR_ACTIVATION_EVENTS | Genes involved in Post NMDA receptor activation events |
0.0 | 1.0 | REACTOME_LOSS_OF_NLP_FROM_MITOTIC_CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.4 | REACTOME_PYRUVATE_METABOLISM | Genes involved in Pyruvate metabolism |
0.0 | 1.5 | REACTOME_SIGNALING_BY_RHO_GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.2 | REACTOME_G0_AND_EARLY_G1 | Genes involved in G0 and Early G1 |
0.0 | 0.2 | REACTOME_IMMUNOREGULATORY_INTERACTIONS_BETWEEN_A_LYMPHOID_AND_A_NON_LYMPHOID_CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.5 | REACTOME_NETRIN1_SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.7 | REACTOME_INTEGRIN_CELL_SURFACE_INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.4 | REACTOME_MHC_CLASS_II_ANTIGEN_PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.3 | REACTOME_INTERFERON_ALPHA_BETA_SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.5 | REACTOME_TRANSLATION | Genes involved in Translation |
0.0 | 0.2 | REACTOME_AMYLOIDS | Genes involved in Amyloids |