| 1.7 |
6.9 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
| 1.6 |
4.8 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 1.5 |
1.5 |
GO:0002053 |
positive regulation of mesenchymal cell proliferation(GO:0002053) |
| 1.4 |
4.1 |
GO:0090425 |
hepatocyte cell migration(GO:0002194) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) positive regulation of forebrain neuron differentiation(GO:2000979) |
| 1.2 |
3.7 |
GO:0030421 |
defecation(GO:0030421) |
| 1.1 |
8.7 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 1.1 |
6.4 |
GO:0032196 |
regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) transposition(GO:0032196) |
| 1.0 |
3.1 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 1.0 |
5.1 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 1.0 |
6.1 |
GO:0051987 |
positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.9 |
3.8 |
GO:0060032 |
notochord regression(GO:0060032) |
| 0.9 |
2.8 |
GO:0043988 |
histone H3-S28 phosphorylation(GO:0043988) |
| 0.9 |
2.7 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.9 |
2.6 |
GO:0045004 |
DNA replication proofreading(GO:0045004) |
| 0.9 |
2.6 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.9 |
2.6 |
GO:0002302 |
CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
| 0.8 |
2.4 |
GO:1904956 |
regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
| 0.8 |
2.4 |
GO:0042097 |
interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
| 0.8 |
3.2 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 0.8 |
1.6 |
GO:0060737 |
prostate epithelial cord elongation(GO:0060523) prostate gland morphogenetic growth(GO:0060737) |
| 0.8 |
3.9 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 0.8 |
3.1 |
GO:0036518 |
chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.7 |
2.2 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 0.7 |
11.9 |
GO:0048387 |
negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.7 |
2.8 |
GO:1902990 |
mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.7 |
1.4 |
GO:0060164 |
regulation of timing of neuron differentiation(GO:0060164) |
| 0.7 |
8.0 |
GO:0051988 |
regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.6 |
1.9 |
GO:0045819 |
plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
| 0.6 |
0.6 |
GO:0070837 |
dehydroascorbic acid transport(GO:0070837) |
| 0.6 |
2.5 |
GO:0035905 |
ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
| 0.6 |
1.9 |
GO:2000435 |
regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.6 |
3.1 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.6 |
2.5 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.6 |
1.9 |
GO:0042320 |
regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) circadian sleep/wake cycle, REM sleep(GO:0042747) |
| 0.6 |
2.5 |
GO:0003342 |
proepicardium development(GO:0003342) septum transversum development(GO:0003343) |
| 0.6 |
6.7 |
GO:2000741 |
positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.6 |
1.8 |
GO:0097402 |
neuroblast migration(GO:0097402) |
| 0.6 |
1.8 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.6 |
1.8 |
GO:0048698 |
negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.6 |
6.0 |
GO:0048664 |
neuron fate determination(GO:0048664) |
| 0.6 |
0.6 |
GO:0072602 |
interleukin-4 secretion(GO:0072602) |
| 0.6 |
1.8 |
GO:1902071 |
regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.6 |
3.0 |
GO:0051309 |
female meiosis chromosome separation(GO:0051309) |
| 0.6 |
1.2 |
GO:0044837 |
assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.6 |
1.8 |
GO:0051754 |
meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.6 |
2.3 |
GO:0019323 |
pentose catabolic process(GO:0019323) |
| 0.6 |
0.6 |
GO:0072095 |
regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 0.6 |
2.9 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 0.6 |
2.3 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.6 |
1.7 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 0.6 |
1.1 |
GO:0030220 |
platelet formation(GO:0030220) platelet morphogenesis(GO:0036344) |
| 0.6 |
2.2 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.6 |
2.8 |
GO:0042938 |
dipeptide transport(GO:0042938) |
| 0.6 |
2.8 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 0.5 |
2.2 |
GO:2000795 |
negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.5 |
2.1 |
GO:0033087 |
negative regulation of immature T cell proliferation(GO:0033087) |
| 0.5 |
0.5 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.5 |
1.6 |
GO:0061153 |
trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) odontoblast differentiation(GO:0071895) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.5 |
1.6 |
GO:0035696 |
monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.5 |
1.6 |
GO:0031204 |
posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.5 |
1.5 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.5 |
2.5 |
GO:0038027 |
apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
| 0.5 |
2.5 |
GO:0045669 |
positive regulation of osteoblast differentiation(GO:0045669) |
| 0.5 |
1.5 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.5 |
1.5 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 0.5 |
3.5 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 0.5 |
1.5 |
GO:0002191 |
cap-dependent translational initiation(GO:0002191) |
| 0.5 |
0.5 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 0.5 |
2.0 |
GO:0021847 |
ventricular zone neuroblast division(GO:0021847) |
| 0.5 |
5.9 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.5 |
2.4 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.5 |
0.5 |
GO:0032695 |
negative regulation of interleukin-12 production(GO:0032695) |
| 0.5 |
1.4 |
GO:0072139 |
glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.5 |
3.8 |
GO:0042095 |
interferon-gamma biosynthetic process(GO:0042095) |
| 0.5 |
1.4 |
GO:2000620 |
positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.5 |
1.4 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 0.5 |
4.7 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.5 |
2.3 |
GO:0034441 |
plasma lipoprotein particle oxidation(GO:0034441) |
| 0.5 |
2.3 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 0.5 |
0.5 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.4 |
0.9 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 0.4 |
1.3 |
GO:0071163 |
DNA replication preinitiation complex assembly(GO:0071163) |
| 0.4 |
4.0 |
GO:0070236 |
negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.4 |
7.4 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.4 |
1.3 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.4 |
0.4 |
GO:0030183 |
B cell differentiation(GO:0030183) |
| 0.4 |
2.1 |
GO:1900170 |
negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 0.4 |
1.3 |
GO:0006404 |
RNA import into nucleus(GO:0006404) |
| 0.4 |
1.3 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.4 |
1.7 |
GO:1901894 |
regulation of calcium-transporting ATPase activity(GO:1901894) |
| 0.4 |
1.2 |
GO:0006545 |
glycine biosynthetic process(GO:0006545) |
| 0.4 |
1.2 |
GO:1902524 |
positive regulation of protein K48-linked ubiquitination(GO:1902524) |
| 0.4 |
2.5 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.4 |
1.6 |
GO:0032382 |
positive regulation of intracellular lipid transport(GO:0032379) positive regulation of intracellular sterol transport(GO:0032382) positive regulation of intracellular cholesterol transport(GO:0032385) lipid hydroperoxide transport(GO:1901373) positive regulation of cholesterol import(GO:1904109) positive regulation of sterol import(GO:2000911) |
| 0.4 |
0.4 |
GO:0007044 |
cell-substrate junction assembly(GO:0007044) |
| 0.4 |
2.0 |
GO:2000258 |
negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
| 0.4 |
12.4 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.4 |
1.2 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.4 |
0.4 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.4 |
0.8 |
GO:0045014 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.4 |
3.9 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.4 |
2.7 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.4 |
1.5 |
GO:0060838 |
lymphatic endothelial cell fate commitment(GO:0060838) |
| 0.4 |
1.5 |
GO:2000158 |
positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.4 |
1.9 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.4 |
1.9 |
GO:0021914 |
negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.4 |
2.7 |
GO:0044806 |
G-quadruplex DNA unwinding(GO:0044806) |
| 0.4 |
2.3 |
GO:0072015 |
glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
| 0.4 |
0.4 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.4 |
4.2 |
GO:0072189 |
ureter development(GO:0072189) |
| 0.4 |
1.5 |
GO:0071475 |
cellular hyperosmotic salinity response(GO:0071475) |
| 0.4 |
1.5 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 0.4 |
4.1 |
GO:0006228 |
UTP biosynthetic process(GO:0006228) |
| 0.4 |
3.0 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.4 |
0.4 |
GO:1903463 |
regulation of mitotic cell cycle DNA replication(GO:1903463) |
| 0.4 |
0.7 |
GO:0021861 |
forebrain radial glial cell differentiation(GO:0021861) |
| 0.4 |
1.1 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 0.4 |
2.2 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.4 |
2.1 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.4 |
2.8 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.4 |
0.4 |
GO:0010838 |
positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.4 |
1.1 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 0.3 |
0.3 |
GO:0002331 |
pre-B cell allelic exclusion(GO:0002331) |
| 0.3 |
0.3 |
GO:1903753 |
negative regulation of p38MAPK cascade(GO:1903753) |
| 0.3 |
0.3 |
GO:0042660 |
positive regulation of cell fate specification(GO:0042660) |
| 0.3 |
1.0 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.3 |
1.0 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.3 |
0.3 |
GO:0045168 |
cell-cell signaling involved in cell fate commitment(GO:0045168) |
| 0.3 |
1.0 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.3 |
1.0 |
GO:1900108 |
negative regulation of nodal signaling pathway(GO:1900108) |
| 0.3 |
1.7 |
GO:1902623 |
negative regulation of neutrophil migration(GO:1902623) |
| 0.3 |
1.0 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.3 |
0.7 |
GO:0071670 |
smooth muscle cell chemotaxis(GO:0071670) |
| 0.3 |
1.0 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.3 |
0.3 |
GO:0040037 |
negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.3 |
5.7 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.3 |
0.7 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 0.3 |
0.7 |
GO:1903774 |
positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.3 |
4.3 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.3 |
1.0 |
GO:1904170 |
regulation of bleb assembly(GO:1904170) |
| 0.3 |
3.3 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.3 |
1.6 |
GO:0042780 |
tRNA 3'-end processing(GO:0042780) |
| 0.3 |
0.3 |
GO:0002765 |
immune response-inhibiting signal transduction(GO:0002765) |
| 0.3 |
0.3 |
GO:0033129 |
positive regulation of histone phosphorylation(GO:0033129) |
| 0.3 |
0.3 |
GO:0006401 |
RNA catabolic process(GO:0006401) |
| 0.3 |
0.6 |
GO:2000790 |
regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) |
| 0.3 |
0.9 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.3 |
1.9 |
GO:0000279 |
M phase(GO:0000279) |
| 0.3 |
0.6 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.3 |
0.6 |
GO:0009814 |
defense response, incompatible interaction(GO:0009814) |
| 0.3 |
0.6 |
GO:0051311 |
meiotic metaphase plate congression(GO:0051311) |
| 0.3 |
0.6 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.3 |
0.9 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.3 |
0.3 |
GO:0033083 |
regulation of immature T cell proliferation(GO:0033083) |
| 0.3 |
1.2 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.3 |
2.0 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.3 |
1.1 |
GO:0045343 |
MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.3 |
5.4 |
GO:0070498 |
interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.3 |
2.6 |
GO:0061032 |
visceral serous pericardium development(GO:0061032) |
| 0.3 |
0.9 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 0.3 |
0.8 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.3 |
1.1 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.3 |
0.6 |
GO:0051289 |
protein homotetramerization(GO:0051289) |
| 0.3 |
0.8 |
GO:2000314 |
negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.3 |
0.6 |
GO:0045358 |
negative regulation of interferon-beta biosynthetic process(GO:0045358) |
| 0.3 |
1.9 |
GO:0035948 |
positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.3 |
0.3 |
GO:0035359 |
negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.3 |
0.8 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 0.3 |
1.9 |
GO:2000348 |
regulation of CD40 signaling pathway(GO:2000348) |
| 0.3 |
2.4 |
GO:0070874 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.3 |
2.2 |
GO:2001198 |
regulation of dendritic cell differentiation(GO:2001198) |
| 0.3 |
1.6 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.3 |
0.3 |
GO:1902430 |
negative regulation of beta-amyloid formation(GO:1902430) negative regulation of amyloid precursor protein catabolic process(GO:1902992) |
| 0.3 |
1.6 |
GO:1903690 |
negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.3 |
1.1 |
GO:1905065 |
positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.3 |
1.6 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.3 |
3.4 |
GO:0035881 |
amacrine cell differentiation(GO:0035881) |
| 0.3 |
1.3 |
GO:0033499 |
galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.3 |
0.3 |
GO:1902730 |
positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.3 |
0.8 |
GO:1990046 |
positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) stress-induced mitochondrial fusion(GO:1990046) |
| 0.3 |
1.8 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.3 |
1.3 |
GO:1903899 |
positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.3 |
1.0 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.3 |
1.8 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.3 |
0.5 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.3 |
1.0 |
GO:0045903 |
positive regulation of translational fidelity(GO:0045903) |
| 0.3 |
0.5 |
GO:0006998 |
nuclear envelope organization(GO:0006998) |
| 0.3 |
0.5 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.3 |
0.5 |
GO:1902022 |
L-lysine transport(GO:1902022) |
| 0.3 |
1.3 |
GO:0010745 |
negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.3 |
1.0 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.3 |
0.8 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.3 |
1.5 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.3 |
0.3 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.3 |
2.8 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.3 |
0.3 |
GO:1904959 |
regulation of electron carrier activity(GO:1904732) regulation of cytochrome-c oxidase activity(GO:1904959) |
| 0.2 |
0.5 |
GO:0097155 |
fasciculation of sensory neuron axon(GO:0097155) |
| 0.2 |
3.0 |
GO:0032000 |
positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.2 |
0.7 |
GO:0061386 |
closure of optic fissure(GO:0061386) |
| 0.2 |
1.0 |
GO:0055071 |
cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
| 0.2 |
1.0 |
GO:0072385 |
minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.2 |
0.5 |
GO:0014009 |
glial cell proliferation(GO:0014009) |
| 0.2 |
9.4 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.2 |
0.7 |
GO:0046902 |
regulation of mitochondrial membrane permeability(GO:0046902) |
| 0.2 |
1.0 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 0.2 |
2.4 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.2 |
0.2 |
GO:0001757 |
somite specification(GO:0001757) |
| 0.2 |
0.7 |
GO:2001187 |
positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
| 0.2 |
0.2 |
GO:0042905 |
retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.2 |
1.0 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.2 |
5.1 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.2 |
0.7 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 0.2 |
1.0 |
GO:0009177 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 0.2 |
1.2 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.2 |
1.0 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 0.2 |
0.2 |
GO:1900122 |
positive regulation of receptor binding(GO:1900122) |
| 0.2 |
0.2 |
GO:0034137 |
positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.2 |
2.1 |
GO:0098700 |
neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.2 |
0.2 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.2 |
0.2 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 0.2 |
0.5 |
GO:0030240 |
skeletal muscle thin filament assembly(GO:0030240) |
| 0.2 |
0.7 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.2 |
0.5 |
GO:0034384 |
high-density lipoprotein particle clearance(GO:0034384) |
| 0.2 |
1.8 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.2 |
0.7 |
GO:0046135 |
pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.2 |
1.6 |
GO:0003161 |
cardiac conduction system development(GO:0003161) |
| 0.2 |
1.8 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 0.2 |
0.5 |
GO:0003192 |
mitral valve formation(GO:0003192) |
| 0.2 |
1.8 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.2 |
1.6 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.2 |
2.2 |
GO:0070933 |
histone H4 deacetylation(GO:0070933) |
| 0.2 |
0.9 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.2 |
0.4 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.2 |
0.2 |
GO:0006272 |
leading strand elongation(GO:0006272) |
| 0.2 |
0.7 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.2 |
0.7 |
GO:0044028 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.2 |
0.7 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.2 |
0.7 |
GO:0009566 |
fertilization(GO:0009566) |
| 0.2 |
1.1 |
GO:0010992 |
ubiquitin homeostasis(GO:0010992) |
| 0.2 |
1.7 |
GO:0097341 |
inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) |
| 0.2 |
1.1 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.2 |
0.9 |
GO:2000525 |
regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.2 |
0.2 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.2 |
1.5 |
GO:0051660 |
establishment of centrosome localization(GO:0051660) |
| 0.2 |
0.9 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.2 |
7.1 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.2 |
2.2 |
GO:0070986 |
left/right axis specification(GO:0070986) |
| 0.2 |
0.2 |
GO:0048850 |
hypophysis morphogenesis(GO:0048850) |
| 0.2 |
0.2 |
GO:0002586 |
positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
| 0.2 |
1.5 |
GO:0016584 |
nucleosome positioning(GO:0016584) |
| 0.2 |
1.1 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.2 |
1.7 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.2 |
0.6 |
GO:0044208 |
'de novo' AMP biosynthetic process(GO:0044208) |
| 0.2 |
0.6 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 0.2 |
1.3 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.2 |
1.3 |
GO:0036337 |
Fas signaling pathway(GO:0036337) |
| 0.2 |
0.4 |
GO:0010831 |
positive regulation of myotube differentiation(GO:0010831) |
| 0.2 |
1.5 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.2 |
3.6 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.2 |
1.5 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.2 |
2.7 |
GO:0006309 |
apoptotic DNA fragmentation(GO:0006309) |
| 0.2 |
0.4 |
GO:0042713 |
sperm ejaculation(GO:0042713) |
| 0.2 |
0.2 |
GO:0061309 |
cardiac neural crest cell development involved in outflow tract morphogenesis(GO:0061309) |
| 0.2 |
0.6 |
GO:0030862 |
neuroblast division in subventricular zone(GO:0021849) positive regulation of polarized epithelial cell differentiation(GO:0030862) |
| 0.2 |
0.2 |
GO:0045780 |
positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.2 |
1.0 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.2 |
1.7 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.2 |
0.6 |
GO:1904996 |
positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.2 |
1.2 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.2 |
0.2 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.2 |
1.0 |
GO:0042756 |
drinking behavior(GO:0042756) |
| 0.2 |
0.2 |
GO:0031590 |
wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
| 0.2 |
2.2 |
GO:0072431 |
signal transduction involved in mitotic G1 DNA damage checkpoint(GO:0072431) intracellular signal transduction involved in G1 DNA damage checkpoint(GO:1902400) |
| 0.2 |
0.2 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 0.2 |
2.2 |
GO:0048368 |
lateral mesoderm development(GO:0048368) |
| 0.2 |
0.2 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) strand invasion(GO:0042148) |
| 0.2 |
1.6 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.2 |
0.2 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.2 |
0.6 |
GO:0003349 |
epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.2 |
1.2 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.2 |
0.4 |
GO:0014834 |
skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 0.2 |
1.0 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.2 |
0.6 |
GO:0003347 |
epicardial cell to mesenchymal cell transition(GO:0003347) |
| 0.2 |
0.4 |
GO:0017004 |
cytochrome complex assembly(GO:0017004) |
| 0.2 |
1.2 |
GO:2000288 |
positive regulation of myoblast proliferation(GO:2000288) |
| 0.2 |
0.8 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.2 |
1.9 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.2 |
0.6 |
GO:0044381 |
glucose import in response to insulin stimulus(GO:0044381) |
| 0.2 |
1.3 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.2 |
0.6 |
GO:0045409 |
negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.2 |
1.1 |
GO:1902965 |
regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.2 |
0.8 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 0.2 |
0.4 |
GO:0046881 |
positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
| 0.2 |
0.6 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.2 |
0.4 |
GO:0009162 |
deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.2 |
0.8 |
GO:0033632 |
regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.2 |
0.8 |
GO:0046013 |
T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.2 |
0.4 |
GO:0000965 |
mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.2 |
1.7 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.2 |
0.2 |
GO:0046641 |
positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.2 |
1.7 |
GO:0042136 |
neurotransmitter biosynthetic process(GO:0042136) |
| 0.2 |
0.7 |
GO:0071481 |
cellular response to X-ray(GO:0071481) |
| 0.2 |
1.1 |
GO:0036159 |
inner dynein arm assembly(GO:0036159) |
| 0.2 |
3.0 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.2 |
0.4 |
GO:0051026 |
chiasma assembly(GO:0051026) |
| 0.2 |
0.6 |
GO:0072592 |
oxygen metabolic process(GO:0072592) |
| 0.2 |
0.5 |
GO:2000049 |
positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.2 |
1.1 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.2 |
2.9 |
GO:0033539 |
fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.2 |
0.2 |
GO:1902808 |
positive regulation of cell cycle G1/S phase transition(GO:1902808) |
| 0.2 |
3.2 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.2 |
0.2 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.2 |
0.2 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.2 |
5.5 |
GO:0021846 |
cell proliferation in forebrain(GO:0021846) |
| 0.2 |
0.2 |
GO:1901856 |
negative regulation of cellular respiration(GO:1901856) |
| 0.2 |
1.4 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.2 |
1.6 |
GO:2001275 |
positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
| 0.2 |
0.2 |
GO:0032747 |
positive regulation of interleukin-23 production(GO:0032747) |
| 0.2 |
0.7 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.2 |
0.5 |
GO:0060558 |
regulation of calcidiol 1-monooxygenase activity(GO:0060558) |
| 0.2 |
1.1 |
GO:0006363 |
termination of RNA polymerase I transcription(GO:0006363) |
| 0.2 |
1.6 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.2 |
1.0 |
GO:2001170 |
negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.2 |
1.2 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.2 |
0.3 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.2 |
1.2 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.2 |
0.5 |
GO:0071918 |
urea transmembrane transport(GO:0071918) |
| 0.2 |
1.2 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.2 |
0.5 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.2 |
0.2 |
GO:0060333 |
interferon-gamma-mediated signaling pathway(GO:0060333) |
| 0.2 |
1.4 |
GO:0036444 |
calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.2 |
0.5 |
GO:0045144 |
meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
| 0.2 |
0.2 |
GO:0060018 |
astrocyte fate commitment(GO:0060018) |
| 0.2 |
0.3 |
GO:1900377 |
negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.2 |
0.8 |
GO:0033227 |
dsRNA transport(GO:0033227) |
| 0.2 |
0.5 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.2 |
0.2 |
GO:2000195 |
negative regulation of female gonad development(GO:2000195) |
| 0.2 |
0.5 |
GO:0090305 |
nucleic acid phosphodiester bond hydrolysis(GO:0090305) |
| 0.2 |
2.1 |
GO:0034219 |
carbohydrate transmembrane transport(GO:0034219) |
| 0.2 |
0.3 |
GO:0046110 |
xanthine metabolic process(GO:0046110) |
| 0.2 |
0.5 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.2 |
0.5 |
GO:2001160 |
regulation of histone H3-K79 methylation(GO:2001160) |
| 0.2 |
0.3 |
GO:0070682 |
proteasome regulatory particle assembly(GO:0070682) |
| 0.2 |
2.1 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.2 |
0.8 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.2 |
1.3 |
GO:0032516 |
positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.2 |
0.3 |
GO:0008594 |
photoreceptor cell morphogenesis(GO:0008594) |
| 0.2 |
1.0 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.2 |
1.3 |
GO:0032049 |
cardiolipin biosynthetic process(GO:0032049) |
| 0.2 |
0.6 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.2 |
5.2 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.2 |
0.3 |
GO:2000319 |
negative regulation of T-helper 17 type immune response(GO:2000317) regulation of T-helper 17 cell differentiation(GO:2000319) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
| 0.2 |
1.6 |
GO:0031297 |
replication fork processing(GO:0031297) DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.2 |
2.1 |
GO:0007379 |
segment specification(GO:0007379) |
| 0.2 |
1.7 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.2 |
0.2 |
GO:0007006 |
mitochondrial membrane organization(GO:0007006) |
| 0.2 |
1.6 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.2 |
0.3 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.2 |
1.4 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.2 |
0.5 |
GO:0045006 |
DNA deamination(GO:0045006) |
| 0.2 |
0.9 |
GO:0072553 |
terminal button organization(GO:0072553) |
| 0.2 |
2.0 |
GO:2000009 |
negative regulation of protein localization to cell surface(GO:2000009) |
| 0.2 |
0.2 |
GO:0003406 |
retinal pigment epithelium development(GO:0003406) |
| 0.2 |
1.1 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.2 |
0.5 |
GO:0031293 |
membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.2 |
0.3 |
GO:0046060 |
dATP metabolic process(GO:0046060) |
| 0.2 |
0.2 |
GO:0030497 |
fatty acid elongation(GO:0030497) |
| 0.2 |
0.5 |
GO:0042776 |
mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.2 |
0.6 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.2 |
0.9 |
GO:0000212 |
meiotic spindle organization(GO:0000212) |
| 0.2 |
0.2 |
GO:0071921 |
establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.2 |
0.2 |
GO:0060126 |
somatotropin secreting cell differentiation(GO:0060126) |
| 0.1 |
0.6 |
GO:0006742 |
NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.1 |
0.4 |
GO:1903976 |
negative regulation of glial cell migration(GO:1903976) |
| 0.1 |
0.9 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 |
0.4 |
GO:0035694 |
mitochondrial protein catabolic process(GO:0035694) |
| 0.1 |
0.3 |
GO:0009597 |
detection of virus(GO:0009597) |
| 0.1 |
0.7 |
GO:1990839 |
response to endothelin(GO:1990839) |
| 0.1 |
0.3 |
GO:1902229 |
regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902229) negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.1 |
2.9 |
GO:0032967 |
positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.1 |
0.1 |
GO:0006620 |
posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 |
1.0 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.1 |
1.5 |
GO:1904667 |
negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.1 |
0.1 |
GO:0010796 |
regulation of multivesicular body size(GO:0010796) |
| 0.1 |
0.9 |
GO:0000160 |
phosphorelay signal transduction system(GO:0000160) |
| 0.1 |
1.0 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 |
0.3 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.1 |
1.3 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.1 |
0.1 |
GO:0019249 |
lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.1 |
0.6 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 |
0.7 |
GO:2000177 |
regulation of neural precursor cell proliferation(GO:2000177) |
| 0.1 |
0.7 |
GO:0071688 |
striated muscle myosin thick filament assembly(GO:0071688) |
| 0.1 |
0.3 |
GO:1901563 |
response to camptothecin(GO:1901563) negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.1 |
0.6 |
GO:0015825 |
L-serine transport(GO:0015825) |
| 0.1 |
1.0 |
GO:0032494 |
response to peptidoglycan(GO:0032494) |
| 0.1 |
0.1 |
GO:0035457 |
cellular response to interferon-alpha(GO:0035457) |
| 0.1 |
1.0 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 |
0.1 |
GO:0001539 |
cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
| 0.1 |
0.3 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.1 |
1.0 |
GO:0051231 |
spindle elongation(GO:0051231) |
| 0.1 |
0.5 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.1 |
0.1 |
GO:0071707 |
immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
| 0.1 |
0.3 |
GO:0010911 |
regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) CRD-mediated mRNA stabilization(GO:0070934) regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.1 |
2.3 |
GO:0060749 |
mammary gland alveolus development(GO:0060749) mammary gland lobule development(GO:0061377) |
| 0.1 |
0.8 |
GO:1990564 |
protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 |
0.3 |
GO:0071850 |
mitotic cell cycle arrest(GO:0071850) |
| 0.1 |
0.3 |
GO:0023016 |
signal transduction by trans-phosphorylation(GO:0023016) |
| 0.1 |
2.3 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.1 |
0.1 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.1 |
0.1 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.1 |
0.5 |
GO:2001238 |
positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.1 |
0.7 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 |
0.7 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.1 |
0.4 |
GO:0060686 |
regulation of prostatic bud formation(GO:0060685) negative regulation of prostatic bud formation(GO:0060686) |
| 0.1 |
0.3 |
GO:0007494 |
midgut development(GO:0007494) |
| 0.1 |
0.5 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.1 |
0.1 |
GO:0002507 |
tolerance induction(GO:0002507) |
| 0.1 |
0.6 |
GO:2000018 |
regulation of male gonad development(GO:2000018) positive regulation of male gonad development(GO:2000020) |
| 0.1 |
0.3 |
GO:1903895 |
negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
| 0.1 |
1.2 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.1 |
1.0 |
GO:0033564 |
anterior/posterior axon guidance(GO:0033564) |
| 0.1 |
0.8 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.1 |
0.9 |
GO:0006271 |
DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.1 |
1.4 |
GO:0009226 |
nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.1 |
0.6 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 |
0.9 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 |
0.6 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.1 |
0.1 |
GO:0033522 |
histone H2A ubiquitination(GO:0033522) |
| 0.1 |
0.4 |
GO:0070601 |
centromeric sister chromatid cohesion(GO:0070601) |
| 0.1 |
0.8 |
GO:1901629 |
regulation of presynaptic membrane organization(GO:1901629) |
| 0.1 |
0.6 |
GO:0060631 |
regulation of meiosis I(GO:0060631) |
| 0.1 |
0.3 |
GO:0010712 |
regulation of collagen metabolic process(GO:0010712) |
| 0.1 |
1.4 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
0.1 |
GO:0000350 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.1 |
0.1 |
GO:0010566 |
regulation of ketone biosynthetic process(GO:0010566) |
| 0.1 |
0.1 |
GO:0072173 |
metanephric tubule morphogenesis(GO:0072173) |
| 0.1 |
0.1 |
GO:0009948 |
anterior/posterior axis specification(GO:0009948) |
| 0.1 |
0.6 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.1 |
0.5 |
GO:0006933 |
negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.1 |
0.7 |
GO:0035878 |
nail development(GO:0035878) |
| 0.1 |
0.2 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.1 |
1.1 |
GO:0033603 |
positive regulation of dopamine secretion(GO:0033603) |
| 0.1 |
0.4 |
GO:0046168 |
glycerol-3-phosphate catabolic process(GO:0046168) |
| 0.1 |
0.8 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.1 |
0.1 |
GO:0072615 |
interleukin-17 secretion(GO:0072615) |
| 0.1 |
0.4 |
GO:0046166 |
glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.1 |
0.2 |
GO:0071372 |
response to follicle-stimulating hormone(GO:0032354) response to gonadotropin(GO:0034698) cellular response to gonadotropin stimulus(GO:0071371) cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.1 |
0.7 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.1 |
0.2 |
GO:0002423 |
natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002420) natural killer cell mediated immune response to tumor cell(GO:0002423) regulation of natural killer cell mediated immune response to tumor cell(GO:0002855) regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002858) |
| 0.1 |
2.4 |
GO:0098869 |
cellular oxidant detoxification(GO:0098869) |
| 0.1 |
0.4 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.1 |
0.5 |
GO:1904177 |
regulation of adipose tissue development(GO:1904177) |
| 0.1 |
1.5 |
GO:0097150 |
neuronal stem cell population maintenance(GO:0097150) |
| 0.1 |
0.6 |
GO:0060272 |
embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.1 |
0.5 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 0.1 |
0.1 |
GO:2000426 |
negative regulation of apoptotic cell clearance(GO:2000426) |
| 0.1 |
1.2 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.1 |
0.2 |
GO:0002572 |
pro-T cell differentiation(GO:0002572) |
| 0.1 |
0.5 |
GO:1903215 |
negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 |
0.7 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.1 |
0.5 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.1 |
0.3 |
GO:0006295 |
nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
| 0.1 |
0.2 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.1 |
5.4 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.1 |
0.6 |
GO:0010955 |
negative regulation of protein processing(GO:0010955) negative regulation of protein maturation(GO:1903318) |
| 0.1 |
0.6 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.1 |
1.2 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.1 |
0.3 |
GO:2000110 |
negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.1 |
0.4 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 |
1.2 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.1 |
0.7 |
GO:0021542 |
dentate gyrus development(GO:0021542) |
| 0.1 |
0.6 |
GO:0032929 |
negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 |
0.6 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.1 |
0.4 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.1 |
0.2 |
GO:1903298 |
regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.1 |
0.3 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.1 |
0.2 |
GO:1902746 |
regulation of lens fiber cell differentiation(GO:1902746) |
| 0.1 |
5.2 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
0.8 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.1 |
0.9 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 |
0.1 |
GO:2000780 |
negative regulation of double-strand break repair(GO:2000780) |
| 0.1 |
0.1 |
GO:0006312 |
mitotic recombination(GO:0006312) |
| 0.1 |
0.5 |
GO:0042754 |
negative regulation of circadian rhythm(GO:0042754) |
| 0.1 |
0.8 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.1 |
3.5 |
GO:0032728 |
positive regulation of interferon-beta production(GO:0032728) |
| 0.1 |
0.4 |
GO:0030263 |
apoptotic chromosome condensation(GO:0030263) |
| 0.1 |
0.5 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.1 |
0.1 |
GO:0002925 |
positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.1 |
0.7 |
GO:0061072 |
iris morphogenesis(GO:0061072) |
| 0.1 |
0.4 |
GO:0006616 |
SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.1 |
0.3 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 |
0.2 |
GO:0003350 |
pulmonary myocardium development(GO:0003350) |
| 0.1 |
0.5 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.1 |
0.2 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 |
0.6 |
GO:0045059 |
positive thymic T cell selection(GO:0045059) |
| 0.1 |
0.6 |
GO:0031086 |
nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) |
| 0.1 |
0.5 |
GO:0046477 |
glycosylceramide catabolic process(GO:0046477) |
| 0.1 |
0.1 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.1 |
0.2 |
GO:0006014 |
D-ribose metabolic process(GO:0006014) |
| 0.1 |
1.4 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.1 |
1.0 |
GO:0010972 |
negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
| 0.1 |
0.6 |
GO:1904627 |
response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.1 |
0.1 |
GO:0010940 |
positive regulation of necrotic cell death(GO:0010940) |
| 0.1 |
1.0 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.1 |
0.1 |
GO:0045065 |
cytotoxic T cell differentiation(GO:0045065) |
| 0.1 |
2.1 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.1 |
0.1 |
GO:0044253 |
positive regulation of collagen metabolic process(GO:0010714) positive regulation of multicellular organismal metabolic process(GO:0044253) |
| 0.1 |
0.1 |
GO:0046051 |
UTP metabolic process(GO:0046051) |
| 0.1 |
0.3 |
GO:0019370 |
leukotriene biosynthetic process(GO:0019370) |
| 0.1 |
0.8 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 |
0.4 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.1 |
0.8 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 |
0.4 |
GO:0003365 |
establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.1 |
0.3 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 0.1 |
0.5 |
GO:0044803 |
multi-organism membrane organization(GO:0044803) |
| 0.1 |
0.5 |
GO:0060231 |
mesenchymal to epithelial transition(GO:0060231) |
| 0.1 |
0.3 |
GO:0035864 |
response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.1 |
0.1 |
GO:0034124 |
regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.1 |
0.1 |
GO:0045713 |
low-density lipoprotein particle receptor biosynthetic process(GO:0045713) regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
| 0.1 |
0.4 |
GO:0055118 |
negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.1 |
0.3 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.1 |
1.2 |
GO:1902751 |
positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.1 |
0.5 |
GO:0046599 |
regulation of centriole replication(GO:0046599) |
| 0.1 |
0.8 |
GO:0007016 |
cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.1 |
0.9 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.1 |
0.1 |
GO:0032881 |
regulation of polysaccharide metabolic process(GO:0032881) |
| 0.1 |
0.3 |
GO:0030210 |
heparin biosynthetic process(GO:0030210) |
| 0.1 |
0.6 |
GO:0048102 |
autophagic cell death(GO:0048102) |
| 0.1 |
0.4 |
GO:1904995 |
negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.1 |
0.1 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.1 |
0.5 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 |
1.1 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.1 |
0.3 |
GO:0032755 |
positive regulation of interleukin-6 production(GO:0032755) |
| 0.1 |
0.6 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.1 |
0.2 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.1 |
1.6 |
GO:0042462 |
eye photoreceptor cell development(GO:0042462) |
| 0.1 |
0.5 |
GO:0043144 |
snoRNA processing(GO:0043144) |
| 0.1 |
0.1 |
GO:0060681 |
branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.1 |
2.5 |
GO:0035019 |
somatic stem cell population maintenance(GO:0035019) |
| 0.1 |
0.8 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.1 |
0.1 |
GO:0070192 |
chromosome organization involved in meiotic cell cycle(GO:0070192) |
| 0.1 |
0.3 |
GO:1903378 |
positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.1 |
0.4 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.1 |
0.6 |
GO:1900225 |
NLRP3 inflammasome complex assembly(GO:0044546) regulation of NLRP3 inflammasome complex assembly(GO:1900225) |
| 0.1 |
0.8 |
GO:0015780 |
nucleotide-sugar transport(GO:0015780) |
| 0.1 |
1.1 |
GO:0043486 |
histone exchange(GO:0043486) |
| 0.1 |
0.3 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 0.1 |
0.3 |
GO:0010510 |
regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.1 |
0.9 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 |
0.2 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.1 |
2.8 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.1 |
0.5 |
GO:0098706 |
ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.1 |
0.1 |
GO:0036257 |
multivesicular body organization(GO:0036257) |
| 0.1 |
0.4 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 |
0.4 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 |
0.8 |
GO:1901407 |
regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
| 0.1 |
0.2 |
GO:0086053 |
AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.1 |
3.8 |
GO:0097031 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 |
0.2 |
GO:0030718 |
germ-line stem cell population maintenance(GO:0030718) |
| 0.1 |
0.4 |
GO:1903061 |
regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.1 |
0.1 |
GO:0090289 |
regulation of osteoclast proliferation(GO:0090289) |
| 0.1 |
0.3 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.1 |
0.3 |
GO:1903077 |
negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.1 |
0.2 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.1 |
0.1 |
GO:0072061 |
inner medullary collecting duct development(GO:0072061) |
| 0.1 |
11.9 |
GO:0007059 |
chromosome segregation(GO:0007059) |
| 0.1 |
0.1 |
GO:1904431 |
positive regulation of t-circle formation(GO:1904431) |
| 0.1 |
0.2 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.1 |
0.3 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.1 |
0.3 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.1 |
0.1 |
GO:0046541 |
saliva secretion(GO:0046541) |
| 0.1 |
1.2 |
GO:0009081 |
branched-chain amino acid metabolic process(GO:0009081) branched-chain amino acid catabolic process(GO:0009083) |
| 0.1 |
0.2 |
GO:1903054 |
negative regulation of extracellular matrix organization(GO:1903054) |
| 0.1 |
0.6 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 |
0.3 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 |
0.2 |
GO:0086023 |
adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 0.1 |
0.5 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.1 |
2.5 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.1 |
0.5 |
GO:0032825 |
positive regulation of natural killer cell differentiation(GO:0032825) |
| 0.1 |
0.1 |
GO:0048630 |
skeletal muscle tissue growth(GO:0048630) |
| 0.1 |
0.8 |
GO:0031272 |
regulation of pseudopodium assembly(GO:0031272) |
| 0.1 |
0.3 |
GO:0002484 |
antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 0.1 |
0.7 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.1 |
0.2 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.1 |
0.3 |
GO:0032933 |
response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.1 |
0.2 |
GO:0070213 |
protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 |
0.2 |
GO:0090274 |
positive regulation of somatostatin secretion(GO:0090274) |
| 0.1 |
0.3 |
GO:0046294 |
formaldehyde catabolic process(GO:0046294) |
| 0.1 |
1.0 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.1 |
0.3 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.1 |
2.3 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.1 |
0.7 |
GO:0006614 |
SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.1 |
0.2 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) |
| 0.1 |
0.7 |
GO:0060707 |
trophoblast giant cell differentiation(GO:0060707) |
| 0.1 |
0.1 |
GO:0070417 |
cellular response to cold(GO:0070417) |
| 0.1 |
0.2 |
GO:0032055 |
negative regulation of translation in response to stress(GO:0032055) |
| 0.1 |
0.2 |
GO:0071211 |
protein targeting to vacuole involved in autophagy(GO:0071211) |
| 0.1 |
0.2 |
GO:0002861 |
regulation of inflammatory response to antigenic stimulus(GO:0002861) |
| 0.1 |
0.2 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 |
4.2 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.1 |
0.5 |
GO:0070307 |
lens fiber cell development(GO:0070307) |
| 0.1 |
0.5 |
GO:0071732 |
cellular response to nitric oxide(GO:0071732) |
| 0.1 |
0.2 |
GO:0034433 |
steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.1 |
0.5 |
GO:0015791 |
polyol transport(GO:0015791) |
| 0.1 |
0.2 |
GO:0021978 |
telencephalon regionalization(GO:0021978) |
| 0.1 |
0.6 |
GO:0045600 |
positive regulation of fat cell differentiation(GO:0045600) |
| 0.1 |
0.1 |
GO:0000957 |
mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) negative regulation of RNA catabolic process(GO:1902369) |
| 0.1 |
0.6 |
GO:0060219 |
camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.1 |
0.4 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 |
0.6 |
GO:0035871 |
protein K11-linked deubiquitination(GO:0035871) |
| 0.1 |
1.1 |
GO:0035855 |
megakaryocyte development(GO:0035855) |
| 0.1 |
0.2 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.1 |
0.9 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.1 |
0.2 |
GO:0034242 |
negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.1 |
0.5 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.1 |
0.4 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.1 |
0.2 |
GO:0003360 |
brainstem development(GO:0003360) |
| 0.1 |
0.3 |
GO:0090086 |
negative regulation of protein deubiquitination(GO:0090086) |
| 0.1 |
0.2 |
GO:0007320 |
insemination(GO:0007320) |
| 0.1 |
0.9 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.1 |
0.2 |
GO:0070535 |
histone H2A K63-linked ubiquitination(GO:0070535) negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.1 |
0.5 |
GO:1990440 |
positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.1 |
0.2 |
GO:0044241 |
lipid digestion(GO:0044241) |
| 0.1 |
0.4 |
GO:0047484 |
regulation of response to osmotic stress(GO:0047484) |
| 0.1 |
4.5 |
GO:0043488 |
regulation of mRNA stability(GO:0043488) |
| 0.1 |
2.2 |
GO:0008631 |
intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.1 |
1.3 |
GO:0019730 |
antimicrobial humoral response(GO:0019730) |
| 0.1 |
0.1 |
GO:0060084 |
synaptic transmission involved in micturition(GO:0060084) |
| 0.1 |
0.1 |
GO:0060662 |
tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.1 |
1.3 |
GO:0006044 |
N-acetylglucosamine metabolic process(GO:0006044) |
| 0.1 |
0.4 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.1 |
0.7 |
GO:0009263 |
deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.1 |
1.9 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 |
0.5 |
GO:0008203 |
cholesterol metabolic process(GO:0008203) |
| 0.1 |
0.2 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.1 |
1.3 |
GO:0002066 |
columnar/cuboidal epithelial cell development(GO:0002066) |
| 0.1 |
0.6 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 |
0.1 |
GO:0051972 |
regulation of telomerase activity(GO:0051972) |
| 0.1 |
0.1 |
GO:0002154 |
thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.1 |
0.2 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.1 |
0.1 |
GO:0002385 |
organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
| 0.1 |
0.5 |
GO:0007512 |
adult heart development(GO:0007512) |
| 0.1 |
0.4 |
GO:2000623 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 |
0.1 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 |
0.1 |
GO:0071351 |
interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
| 0.1 |
3.6 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.1 |
1.3 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.1 |
0.4 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 0.1 |
0.4 |
GO:0051045 |
negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.1 |
0.3 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 0.1 |
0.1 |
GO:1990379 |
lipid transport across blood brain barrier(GO:1990379) |
| 0.1 |
1.5 |
GO:0051642 |
centrosome localization(GO:0051642) |
| 0.1 |
0.1 |
GO:0060352 |
cell adhesion molecule production(GO:0060352) |
| 0.1 |
0.1 |
GO:0021942 |
radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.1 |
0.1 |
GO:0050680 |
negative regulation of epithelial cell proliferation(GO:0050680) |
| 0.1 |
0.1 |
GO:0019343 |
cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 0.1 |
0.1 |
GO:0035811 |
negative regulation of urine volume(GO:0035811) |
| 0.1 |
0.1 |
GO:0006072 |
glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.1 |
0.1 |
GO:0021940 |
positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
| 0.1 |
0.4 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.1 |
0.1 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.1 |
0.1 |
GO:0032417 |
positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.1 |
0.3 |
GO:0019243 |
methylglyoxal metabolic process(GO:0009438) methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.1 |
2.9 |
GO:0000725 |
double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.1 |
0.2 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 |
1.1 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 |
0.1 |
GO:0071033 |
nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
| 0.1 |
0.4 |
GO:0019433 |
triglyceride catabolic process(GO:0019433) |
| 0.1 |
0.1 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.1 |
0.3 |
GO:0050651 |
dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.1 |
0.1 |
GO:1904874 |
positive regulation of telomerase RNA localization to Cajal body(GO:1904874) |
| 0.1 |
0.2 |
GO:0071364 |
response to epidermal growth factor(GO:0070849) cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.1 |
0.1 |
GO:0070741 |
response to interleukin-6(GO:0070741) |
| 0.1 |
1.1 |
GO:0014912 |
negative regulation of smooth muscle cell migration(GO:0014912) |
| 0.1 |
0.3 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.1 |
0.3 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.1 |
0.2 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.1 |
0.8 |
GO:0001702 |
gastrulation with mouth forming second(GO:0001702) |
| 0.1 |
0.8 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.1 |
0.1 |
GO:0048704 |
embryonic skeletal system morphogenesis(GO:0048704) |
| 0.1 |
0.2 |
GO:0006361 |
transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) transcription initiation from RNA polymerase I promoter(GO:0006361) |
| 0.1 |
0.4 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.1 |
0.2 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.1 |
0.5 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.1 |
0.2 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 |
0.4 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.1 |
0.8 |
GO:0006525 |
arginine metabolic process(GO:0006525) |
| 0.1 |
0.1 |
GO:0071205 |
protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.1 |
0.2 |
GO:0071699 |
olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.1 |
0.1 |
GO:0046544 |
development of secondary male sexual characteristics(GO:0046544) |
| 0.1 |
0.4 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.1 |
0.5 |
GO:0006801 |
superoxide metabolic process(GO:0006801) |
| 0.1 |
0.6 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.1 |
0.6 |
GO:0051457 |
maintenance of protein location in nucleus(GO:0051457) |
| 0.1 |
0.2 |
GO:1904936 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.1 |
0.5 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.1 |
0.3 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.1 |
0.1 |
GO:2001015 |
negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.1 |
0.2 |
GO:0009396 |
folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.1 |
0.1 |
GO:1903026 |
negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.1 |
0.2 |
GO:0016071 |
mRNA metabolic process(GO:0016071) |
| 0.1 |
0.2 |
GO:0019372 |
lipoxygenase pathway(GO:0019372) |
| 0.1 |
0.2 |
GO:0031442 |
positive regulation of mRNA 3'-end processing(GO:0031442) |
| 0.1 |
0.3 |
GO:0060122 |
inner ear receptor stereocilium organization(GO:0060122) |
| 0.1 |
0.2 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.1 |
0.1 |
GO:0090258 |
negative regulation of mitochondrial fission(GO:0090258) |
| 0.1 |
0.2 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.1 |
0.1 |
GO:0060969 |
negative regulation of gene silencing(GO:0060969) |
| 0.1 |
0.3 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.1 |
0.4 |
GO:0043653 |
mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.1 |
0.9 |
GO:0035025 |
positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.1 |
0.2 |
GO:0035330 |
regulation of hippo signaling(GO:0035330) |
| 0.1 |
0.2 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.1 |
0.7 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.1 |
0.7 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.1 |
1.3 |
GO:0006094 |
gluconeogenesis(GO:0006094) |
| 0.1 |
0.2 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 |
0.4 |
GO:0071044 |
histone mRNA catabolic process(GO:0071044) |
| 0.1 |
0.1 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 |
0.2 |
GO:0033147 |
negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.1 |
0.1 |
GO:0010757 |
negative regulation of plasminogen activation(GO:0010757) |
| 0.1 |
0.2 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.1 |
0.1 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.1 |
0.4 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.1 |
0.4 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 |
0.3 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 0.1 |
0.1 |
GO:0009211 |
pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
| 0.1 |
0.2 |
GO:0019659 |
fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.1 |
0.6 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 |
0.2 |
GO:0002579 |
positive regulation of antigen processing and presentation(GO:0002579) |
| 0.1 |
0.1 |
GO:0046122 |
purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.1 |
0.1 |
GO:0060029 |
convergent extension involved in organogenesis(GO:0060029) |
| 0.1 |
0.2 |
GO:0045742 |
positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
| 0.1 |
0.4 |
GO:0010389 |
regulation of G2/M transition of mitotic cell cycle(GO:0010389) |
| 0.1 |
0.9 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.1 |
0.2 |
GO:0021562 |
vestibulocochlear nerve development(GO:0021562) |
| 0.1 |
0.1 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.1 |
0.2 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 |
0.1 |
GO:0044246 |
regulation of multicellular organismal metabolic process(GO:0044246) |
| 0.1 |
0.1 |
GO:0009068 |
aspartate family amino acid catabolic process(GO:0009068) |
| 0.1 |
0.4 |
GO:0045671 |
negative regulation of osteoclast differentiation(GO:0045671) |
| 0.1 |
0.2 |
GO:2000616 |
negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.1 |
0.1 |
GO:1900150 |
regulation of defense response to fungus(GO:1900150) |
| 0.1 |
1.4 |
GO:0032330 |
regulation of chondrocyte differentiation(GO:0032330) |
| 0.1 |
0.2 |
GO:0050849 |
negative regulation of calcium-mediated signaling(GO:0050849) |
| 0.1 |
0.1 |
GO:0097274 |
ductus arteriosus closure(GO:0097070) urea homeostasis(GO:0097274) |
| 0.1 |
0.3 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.1 |
0.1 |
GO:0060700 |
regulation of ribonuclease activity(GO:0060700) |
| 0.1 |
0.6 |
GO:0045737 |
positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 |
0.1 |
GO:0048806 |
genitalia development(GO:0048806) |
| 0.0 |
0.2 |
GO:0090400 |
stress-induced premature senescence(GO:0090400) |
| 0.0 |
0.6 |
GO:0072528 |
pyrimidine-containing compound biosynthetic process(GO:0072528) |
| 0.0 |
0.3 |
GO:0045214 |
sarcomere organization(GO:0045214) |
| 0.0 |
0.4 |
GO:0042118 |
endothelial cell activation(GO:0042118) |
| 0.0 |
0.0 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 |
0.1 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 0.0 |
0.3 |
GO:0098734 |
protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 |
0.5 |
GO:0036010 |
protein localization to endosome(GO:0036010) |
| 0.0 |
0.1 |
GO:1904468 |
negative regulation of tumor necrosis factor secretion(GO:1904468) |
| 0.0 |
0.8 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.0 |
0.9 |
GO:0009649 |
entrainment of circadian clock(GO:0009649) |
| 0.0 |
0.1 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.0 |
0.0 |
GO:0051562 |
negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.0 |
0.2 |
GO:0070508 |
sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.0 |
0.3 |
GO:0071803 |
positive regulation of podosome assembly(GO:0071803) |
| 0.0 |
0.1 |
GO:0019530 |
taurine metabolic process(GO:0019530) |
| 0.0 |
0.3 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.0 |
0.2 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 |
1.5 |
GO:0042491 |
auditory receptor cell differentiation(GO:0042491) |
| 0.0 |
0.6 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.0 |
0.2 |
GO:0072675 |
multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.0 |
0.6 |
GO:0090307 |
mitotic spindle assembly(GO:0090307) |
| 0.0 |
0.7 |
GO:0070207 |
protein homotrimerization(GO:0070207) |
| 0.0 |
0.7 |
GO:0032611 |
interleukin-1 beta production(GO:0032611) |
| 0.0 |
0.1 |
GO:0070203 |
regulation of establishment of protein localization to chromosome(GO:0070202) regulation of establishment of protein localization to telomere(GO:0070203) |
| 0.0 |
0.5 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.0 |
0.1 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) glucose 1-phosphate metabolic process(GO:0019255) |
| 0.0 |
0.6 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 |
1.1 |
GO:0046827 |
positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 |
0.1 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.0 |
0.3 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.0 |
0.1 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.0 |
0.0 |
GO:0072719 |
cellular response to cisplatin(GO:0072719) |
| 0.0 |
1.0 |
GO:0000038 |
very long-chain fatty acid metabolic process(GO:0000038) |
| 0.0 |
0.2 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 |
0.3 |
GO:0030521 |
androgen receptor signaling pathway(GO:0030521) |
| 0.0 |
0.1 |
GO:1902570 |
protein localization to nucleolus(GO:1902570) |
| 0.0 |
0.4 |
GO:0008105 |
asymmetric protein localization(GO:0008105) |
| 0.0 |
0.1 |
GO:0006558 |
L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
| 0.0 |
0.4 |
GO:0042501 |
serine phosphorylation of STAT protein(GO:0042501) |
| 0.0 |
0.4 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.0 |
0.3 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 |
0.1 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.0 |
0.4 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.0 |
0.2 |
GO:0002934 |
desmosome organization(GO:0002934) |
| 0.0 |
0.1 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 |
0.2 |
GO:0032898 |
neurotrophin production(GO:0032898) |
| 0.0 |
0.1 |
GO:1903912 |
negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.0 |
0.1 |
GO:0046292 |
formaldehyde metabolic process(GO:0046292) |
| 0.0 |
0.1 |
GO:0032056 |
positive regulation of translation in response to stress(GO:0032056) |
| 0.0 |
0.5 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.0 |
0.1 |
GO:0006624 |
vacuolar protein processing(GO:0006624) |
| 0.0 |
0.4 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 |
0.3 |
GO:0006303 |
double-strand break repair via nonhomologous end joining(GO:0006303) |
| 0.0 |
0.1 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.0 |
0.2 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.0 |
0.0 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.0 |
0.4 |
GO:0030520 |
intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 |
0.2 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 |
0.2 |
GO:0031573 |
intra-S DNA damage checkpoint(GO:0031573) |
| 0.0 |
0.2 |
GO:0015670 |
carbon dioxide transport(GO:0015670) |
| 0.0 |
0.1 |
GO:0001907 |
killing by symbiont of host cells(GO:0001907) induction of programmed cell death(GO:0012502) disruption by symbiont of host cell(GO:0044004) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
| 0.0 |
0.2 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.0 |
0.2 |
GO:0048853 |
forebrain morphogenesis(GO:0048853) |
| 0.0 |
0.1 |
GO:0090070 |
positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.0 |
0.2 |
GO:0071577 |
zinc II ion transmembrane transport(GO:0071577) |
| 0.0 |
0.2 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 |
0.1 |
GO:2000773 |
negative regulation of cellular senescence(GO:2000773) |
| 0.0 |
0.3 |
GO:0001773 |
myeloid dendritic cell activation(GO:0001773) |
| 0.0 |
0.0 |
GO:0006544 |
glycine metabolic process(GO:0006544) |
| 0.0 |
0.2 |
GO:0070171 |
negative regulation of tooth mineralization(GO:0070171) |
| 0.0 |
0.0 |
GO:0035720 |
intraciliary anterograde transport(GO:0035720) |
| 0.0 |
0.4 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.0 |
0.6 |
GO:0030033 |
microvillus assembly(GO:0030033) |
| 0.0 |
0.0 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.0 |
0.1 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.0 |
1.1 |
GO:0007608 |
sensory perception of smell(GO:0007608) |
| 0.0 |
0.2 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.0 |
0.0 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.0 |
0.1 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.0 |
0.2 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.0 |
0.2 |
GO:1902775 |
mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 |
0.4 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.0 |
0.1 |
GO:0003215 |
cardiac right ventricle morphogenesis(GO:0003215) |
| 0.0 |
0.1 |
GO:0032486 |
Rap protein signal transduction(GO:0032486) |
| 0.0 |
0.2 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.0 |
1.2 |
GO:0070303 |
negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
| 0.0 |
0.1 |
GO:0030913 |
paranodal junction assembly(GO:0030913) |
| 0.0 |
0.1 |
GO:0016446 |
somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 |
0.3 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.0 |
0.2 |
GO:0007342 |
fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.0 |
0.8 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.0 |
0.5 |
GO:0031365 |
N-terminal protein amino acid modification(GO:0031365) |
| 0.0 |
0.6 |
GO:0008156 |
negative regulation of DNA replication(GO:0008156) |
| 0.0 |
0.2 |
GO:0003417 |
growth plate cartilage development(GO:0003417) |
| 0.0 |
0.7 |
GO:0035196 |
production of miRNAs involved in gene silencing by miRNA(GO:0035196) |
| 0.0 |
0.1 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.0 |
0.1 |
GO:0046341 |
CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 |
0.3 |
GO:0071578 |
zinc II ion transmembrane import(GO:0071578) |
| 0.0 |
0.5 |
GO:0010866 |
regulation of triglyceride biosynthetic process(GO:0010866) |
| 0.0 |
0.0 |
GO:0061370 |
testosterone biosynthetic process(GO:0061370) |
| 0.0 |
0.2 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 |
0.1 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.0 |
0.2 |
GO:0061635 |
regulation of protein complex stability(GO:0061635) |
| 0.0 |
0.3 |
GO:0006750 |
glutathione biosynthetic process(GO:0006750) |
| 0.0 |
0.2 |
GO:0050855 |
regulation of B cell receptor signaling pathway(GO:0050855) positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 |
0.0 |
GO:0032497 |
detection of lipopolysaccharide(GO:0032497) |
| 0.0 |
0.3 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.0 |
0.3 |
GO:2000381 |
negative regulation of mesoderm development(GO:2000381) |
| 0.0 |
0.6 |
GO:0009164 |
nucleoside catabolic process(GO:0009164) ribonucleoside catabolic process(GO:0042454) |
| 0.0 |
0.1 |
GO:0006071 |
glycerol metabolic process(GO:0006071) |
| 0.0 |
1.3 |
GO:0051297 |
centrosome organization(GO:0051297) |
| 0.0 |
0.3 |
GO:0000289 |
nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 |
0.4 |
GO:0007093 |
mitotic cell cycle checkpoint(GO:0007093) |
| 0.0 |
0.3 |
GO:0051570 |
regulation of histone H3-K9 methylation(GO:0051570) |
| 0.0 |
0.0 |
GO:0042182 |
ketone catabolic process(GO:0042182) |
| 0.0 |
0.2 |
GO:0007021 |
tubulin complex assembly(GO:0007021) |
| 0.0 |
0.4 |
GO:0000184 |
nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 |
0.1 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.0 |
0.1 |
GO:0051567 |
histone H3-K9 methylation(GO:0051567) |
| 0.0 |
0.1 |
GO:0006121 |
mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.0 |
0.1 |
GO:0072344 |
rescue of stalled ribosome(GO:0072344) |
| 0.0 |
0.2 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.0 |
0.0 |
GO:0042094 |
interleukin-2 biosynthetic process(GO:0042094) |
| 0.0 |
0.0 |
GO:0032415 |
regulation of sodium:proton antiporter activity(GO:0032415) |
| 0.0 |
1.6 |
GO:0000380 |
alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.0 |
0.2 |
GO:0071225 |
cellular response to muramyl dipeptide(GO:0071225) |
| 0.0 |
0.2 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.0 |
0.4 |
GO:0035116 |
embryonic hindlimb morphogenesis(GO:0035116) |
| 0.0 |
0.2 |
GO:0090074 |
negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 |
0.1 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.0 |
0.3 |
GO:0021670 |
lateral ventricle development(GO:0021670) |
| 0.0 |
0.1 |
GO:0035617 |
stress granule disassembly(GO:0035617) |
| 0.0 |
0.2 |
GO:1900095 |
regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.0 |
0.1 |
GO:0034116 |
positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.0 |
0.1 |
GO:0048708 |
astrocyte differentiation(GO:0048708) |
| 0.0 |
0.4 |
GO:0032608 |
interferon-beta production(GO:0032608) |
| 0.0 |
0.1 |
GO:0002063 |
chondrocyte development(GO:0002063) |
| 0.0 |
0.1 |
GO:0018103 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 |
0.2 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational elongation(GO:0045901) positive regulation of translational termination(GO:0045905) |
| 0.0 |
0.0 |
GO:0060467 |
negative regulation of fertilization(GO:0060467) |
| 0.0 |
0.2 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.0 |
0.1 |
GO:0050996 |
positive regulation of lipid catabolic process(GO:0050996) |
| 0.0 |
0.1 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.0 |
0.1 |
GO:0001676 |
long-chain fatty acid metabolic process(GO:0001676) |
| 0.0 |
0.1 |
GO:0097476 |
spinal cord motor neuron migration(GO:0097476) |
| 0.0 |
0.5 |
GO:0000470 |
maturation of LSU-rRNA(GO:0000470) |
| 0.0 |
0.2 |
GO:0010172 |
embryonic body morphogenesis(GO:0010172) |
| 0.0 |
0.1 |
GO:0050747 |
positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.0 |
1.0 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.0 |
0.1 |
GO:0019695 |
choline metabolic process(GO:0019695) |
| 0.0 |
0.2 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.0 |
0.1 |
GO:0072176 |
nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
| 0.0 |
0.6 |
GO:0065004 |
protein-DNA complex assembly(GO:0065004) |
| 0.0 |
0.1 |
GO:0060438 |
trachea development(GO:0060438) |
| 0.0 |
0.0 |
GO:0009219 |
pyrimidine deoxyribonucleotide metabolic process(GO:0009219) |
| 0.0 |
0.0 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 |
0.2 |
GO:0060416 |
response to growth hormone(GO:0060416) |
| 0.0 |
0.9 |
GO:0008589 |
regulation of smoothened signaling pathway(GO:0008589) |
| 0.0 |
0.1 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 |
0.7 |
GO:0007569 |
cell aging(GO:0007569) |
| 0.0 |
0.1 |
GO:0060351 |
cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.0 |
0.1 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.0 |
0.3 |
GO:0007042 |
lysosomal lumen acidification(GO:0007042) |
| 0.0 |
0.1 |
GO:0035511 |
oxidative DNA demethylation(GO:0035511) oxidative demethylation(GO:0070989) |
| 0.0 |
0.6 |
GO:0010390 |
histone monoubiquitination(GO:0010390) |
| 0.0 |
0.2 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.0 |
0.2 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 |
0.0 |
GO:0009838 |
abscission(GO:0009838) |
| 0.0 |
0.1 |
GO:0046501 |
protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.0 |
0.6 |
GO:0000768 |
syncytium formation by plasma membrane fusion(GO:0000768) syncytium formation(GO:0006949) |
| 0.0 |
0.1 |
GO:1903203 |
neuron death in response to oxidative stress(GO:0036475) regulation of oxidative stress-induced neuron death(GO:1903203) |
| 0.0 |
0.2 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.0 |
0.6 |
GO:0097320 |
membrane tubulation(GO:0097320) |
| 0.0 |
0.1 |
GO:0071539 |
protein localization to centrosome(GO:0071539) |
| 0.0 |
0.4 |
GO:0043001 |
Golgi to plasma membrane protein transport(GO:0043001) |
| 0.0 |
0.0 |
GO:0042795 |
snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 |
0.0 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 |
0.0 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 0.0 |
0.0 |
GO:0060594 |
mammary gland specification(GO:0060594) |
| 0.0 |
0.0 |
GO:0090286 |
cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 |
0.3 |
GO:0070536 |
protein K63-linked deubiquitination(GO:0070536) |
| 0.0 |
0.8 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.0 |
0.0 |
GO:0021554 |
optic nerve development(GO:0021554) |
| 0.0 |
0.2 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 |
0.2 |
GO:0045040 |
protein import into mitochondrial outer membrane(GO:0045040) establishment of protein localization to mitochondrial membrane(GO:0090151) |
| 0.0 |
0.1 |
GO:0019395 |
fatty acid oxidation(GO:0019395) |
| 0.0 |
0.1 |
GO:0045058 |
T cell selection(GO:0045058) |
| 0.0 |
0.2 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.0 |
0.0 |
GO:2000504 |
positive regulation of blood vessel remodeling(GO:2000504) |
| 0.0 |
0.2 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.0 |
0.0 |
GO:1903566 |
positive regulation of protein localization to cilium(GO:1903566) |
| 0.0 |
0.1 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 |
0.1 |
GO:0035195 |
gene silencing by miRNA(GO:0035195) |
| 0.0 |
0.4 |
GO:0006940 |
regulation of smooth muscle contraction(GO:0006940) |
| 0.0 |
0.1 |
GO:0043584 |
nose development(GO:0043584) |
| 0.0 |
0.2 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.0 |
0.0 |
GO:0060693 |
regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.0 |
0.1 |
GO:1901678 |
iron coordination entity transport(GO:1901678) |
| 0.0 |
0.1 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.0 |
0.0 |
GO:2001245 |
regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.0 |
0.3 |
GO:0014002 |
astrocyte development(GO:0014002) |
| 0.0 |
0.2 |
GO:0045070 |
positive regulation of viral genome replication(GO:0045070) |
| 0.0 |
0.2 |
GO:0031498 |
nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) |
| 0.0 |
0.1 |
GO:0018195 |
peptidyl-arginine modification(GO:0018195) |
| 0.0 |
0.2 |
GO:0032793 |
positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.0 |
0.8 |
GO:0007224 |
smoothened signaling pathway(GO:0007224) |
| 0.0 |
0.1 |
GO:0080111 |
DNA demethylation(GO:0080111) |
| 0.0 |
0.9 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.0 |
0.1 |
GO:0043619 |
regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.0 |
0.2 |
GO:0048873 |
homeostasis of number of cells within a tissue(GO:0048873) |
| 0.0 |
1.0 |
GO:0032543 |
mitochondrial translation(GO:0032543) |
| 0.0 |
0.0 |
GO:0070859 |
positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
| 0.0 |
0.8 |
GO:0090263 |
positive regulation of canonical Wnt signaling pathway(GO:0090263) |
| 0.0 |
0.5 |
GO:2001222 |
regulation of neuron migration(GO:2001222) |
| 0.0 |
0.0 |
GO:0061502 |
early endosome to recycling endosome transport(GO:0061502) |
| 0.0 |
0.1 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.0 |
1.5 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.0 |
0.5 |
GO:0032011 |
ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 |
0.0 |
GO:0002863 |
positive regulation of inflammatory response to antigenic stimulus(GO:0002863) |
| 0.0 |
0.1 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.0 |
0.0 |
GO:0098914 |
membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.0 |
0.1 |
GO:0050915 |
sensory perception of sour taste(GO:0050915) |
| 0.0 |
0.0 |
GO:0032224 |
positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 |
0.1 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.0 |
0.1 |
GO:0032229 |
negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.0 |
0.0 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 0.0 |
0.1 |
GO:0033194 |
response to hydroperoxide(GO:0033194) |
| 0.0 |
0.1 |
GO:0034285 |
response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.0 |
0.0 |
GO:1901071 |
glucosamine-containing compound metabolic process(GO:1901071) |
| 0.0 |
0.0 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) regulation of vitamin D receptor signaling pathway(GO:0070562) cellular response to vitamin D(GO:0071305) |
| 0.0 |
0.2 |
GO:0051085 |
chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 |
0.0 |
GO:0016445 |
somatic diversification of immunoglobulins(GO:0016445) |
| 0.0 |
0.2 |
GO:0044030 |
regulation of DNA methylation(GO:0044030) |
| 0.0 |
0.1 |
GO:0060768 |
epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.0 |
0.8 |
GO:0006342 |
chromatin silencing(GO:0006342) |
| 0.0 |
0.0 |
GO:1902953 |
positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.0 |
0.1 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.0 |
0.1 |
GO:0045911 |
positive regulation of DNA recombination(GO:0045911) |
| 0.0 |
0.1 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.0 |
0.1 |
GO:0010990 |
regulation of SMAD protein complex assembly(GO:0010990) |
| 0.0 |
0.1 |
GO:0006582 |
melanin metabolic process(GO:0006582) melanin biosynthetic process(GO:0042438) secondary metabolite biosynthetic process(GO:0044550) |
| 0.0 |
0.0 |
GO:0034141 |
positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.0 |
0.1 |
GO:0010574 |
regulation of vascular endothelial growth factor production(GO:0010574) |
| 0.0 |
0.0 |
GO:0010637 |
negative regulation of mitochondrial fusion(GO:0010637) |
| 0.0 |
0.0 |
GO:0010728 |
regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.0 |
0.1 |
GO:0045943 |
positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 |
0.0 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.0 |
0.0 |
GO:0003214 |
cardiac left ventricle morphogenesis(GO:0003214) |
| 0.0 |
0.3 |
GO:0035458 |
cellular response to interferon-beta(GO:0035458) |
| 0.0 |
0.1 |
GO:0070162 |
adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 |
0.0 |
GO:0061756 |
leukocyte tethering or rolling(GO:0050901) leukocyte adhesion to vascular endothelial cell(GO:0061756) |
| 0.0 |
0.2 |
GO:0097034 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.0 |
0.1 |
GO:0014883 |
transition between fast and slow fiber(GO:0014883) |
| 0.0 |
0.1 |
GO:1904738 |
vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.0 |
0.1 |
GO:0010591 |
regulation of lamellipodium assembly(GO:0010591) |
| 0.0 |
0.1 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.0 |
0.1 |
GO:0002551 |
mast cell chemotaxis(GO:0002551) regulation of mast cell chemotaxis(GO:0060753) mast cell migration(GO:0097531) |
| 0.0 |
0.0 |
GO:0045351 |
type I interferon biosynthetic process(GO:0045351) |
| 0.0 |
0.0 |
GO:0070346 |
fat cell proliferation(GO:0070341) white fat cell proliferation(GO:0070343) regulation of fat cell proliferation(GO:0070344) positive regulation of fat cell proliferation(GO:0070346) regulation of white fat cell proliferation(GO:0070350) |
| 0.0 |
0.0 |
GO:0046874 |
quinolinate metabolic process(GO:0046874) |
| 0.0 |
0.3 |
GO:0095500 |
acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.0 |
0.0 |
GO:1902166 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.0 |
0.0 |
GO:0050872 |
white fat cell differentiation(GO:0050872) |
| 0.0 |
0.0 |
GO:0006662 |
glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) |
| 0.0 |
0.0 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 |
0.2 |
GO:0016578 |
histone deubiquitination(GO:0016578) |
| 0.0 |
0.1 |
GO:0060856 |
establishment of blood-brain barrier(GO:0060856) |
| 0.0 |
0.1 |
GO:0006777 |
Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.0 |
0.1 |
GO:0042167 |
porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.0 |
0.1 |
GO:0061732 |
mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 |
0.2 |
GO:0006997 |
nucleus organization(GO:0006997) |
| 0.0 |
0.0 |
GO:0042640 |
anagen(GO:0042640) |
| 0.0 |
0.0 |
GO:0015911 |
plasma membrane long-chain fatty acid transport(GO:0015911) fatty acid transmembrane transport(GO:1902001) |
| 0.0 |
0.0 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.0 |
0.0 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.0 |
0.1 |
GO:0009437 |
amino-acid betaine metabolic process(GO:0006577) carnitine metabolic process(GO:0009437) |
| 0.0 |
0.0 |
GO:0051775 |
response to redox state(GO:0051775) |
| 0.0 |
0.0 |
GO:0060279 |
positive regulation of ovulation(GO:0060279) |
| 0.0 |
0.1 |
GO:0048755 |
branching morphogenesis of a nerve(GO:0048755) |
