| 7.9 |
55.4 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 6.7 |
20.1 |
GO:0030421 |
defecation(GO:0030421) |
| 5.1 |
20.6 |
GO:0003360 |
brainstem development(GO:0003360) |
| 4.9 |
14.7 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 4.9 |
24.3 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 4.3 |
13.0 |
GO:0060364 |
frontal suture morphogenesis(GO:0060364) |
| 4.3 |
4.3 |
GO:0090194 |
negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
| 4.0 |
12.0 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 3.7 |
11.0 |
GO:0014877 |
response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 3.6 |
29.1 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 3.6 |
17.9 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 3.6 |
14.2 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 3.5 |
7.1 |
GO:0072197 |
ureter morphogenesis(GO:0072197) |
| 3.4 |
10.3 |
GO:0044837 |
assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 3.4 |
3.4 |
GO:0014009 |
glial cell proliferation(GO:0014009) |
| 3.4 |
3.4 |
GO:0000279 |
M phase(GO:0000279) |
| 3.4 |
13.5 |
GO:0060032 |
notochord regression(GO:0060032) |
| 3.3 |
9.8 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 3.2 |
3.2 |
GO:0014809 |
regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 3.2 |
9.5 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 3.1 |
9.3 |
GO:0072382 |
minus-end-directed vesicle transport along microtubule(GO:0072382) |
| 3.1 |
9.2 |
GO:0060489 |
orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 3.0 |
18.0 |
GO:0071499 |
response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
| 2.9 |
8.7 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 2.9 |
14.5 |
GO:0048382 |
mesendoderm development(GO:0048382) |
| 2.8 |
8.5 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 2.7 |
2.7 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 2.7 |
8.2 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 2.7 |
8.1 |
GO:0090235 |
regulation of metaphase plate congression(GO:0090235) |
| 2.6 |
7.9 |
GO:0003150 |
muscular septum morphogenesis(GO:0003150) |
| 2.6 |
7.9 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 2.6 |
10.4 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 2.6 |
7.8 |
GO:1902162 |
regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 2.6 |
10.3 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 2.6 |
12.9 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 2.6 |
15.4 |
GO:0072103 |
glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 2.6 |
2.6 |
GO:2000297 |
negative regulation of synapse maturation(GO:2000297) |
| 2.5 |
7.5 |
GO:0031660 |
regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
| 2.4 |
7.3 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 2.4 |
7.3 |
GO:1901420 |
negative regulation of response to alcohol(GO:1901420) |
| 2.4 |
4.8 |
GO:1902913 |
positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 2.3 |
16.3 |
GO:0071699 |
olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 2.3 |
7.0 |
GO:0061075 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 2.3 |
6.9 |
GO:0051124 |
synaptic growth at neuromuscular junction(GO:0051124) |
| 2.3 |
22.9 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 2.3 |
9.0 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 2.2 |
4.5 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 2.2 |
2.2 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 2.2 |
9.0 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 2.2 |
2.2 |
GO:0043267 |
negative regulation of potassium ion transport(GO:0043267) |
| 2.2 |
6.7 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 2.2 |
48.6 |
GO:0030903 |
notochord development(GO:0030903) |
| 2.2 |
2.2 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 2.2 |
6.5 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 2.1 |
10.7 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 2.1 |
6.4 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 2.1 |
10.6 |
GO:0044806 |
G-quadruplex DNA unwinding(GO:0044806) |
| 2.1 |
4.2 |
GO:2000373 |
regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 2.1 |
20.6 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 2.1 |
8.2 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 2.1 |
6.2 |
GO:0071930 |
negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 2.0 |
6.1 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 2.0 |
6.1 |
GO:0071898 |
regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 2.0 |
2.0 |
GO:1903490 |
regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 2.0 |
4.0 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 2.0 |
2.0 |
GO:0021938 |
smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 2.0 |
25.5 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 1.9 |
5.8 |
GO:0045004 |
DNA replication proofreading(GO:0045004) |
| 1.9 |
7.7 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 1.9 |
7.7 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 1.9 |
1.9 |
GO:0045736 |
negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 1.9 |
7.6 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 1.9 |
7.4 |
GO:1903519 |
apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 1.9 |
5.6 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 1.9 |
16.7 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 1.8 |
9.2 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 1.8 |
5.5 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 1.8 |
1.8 |
GO:0072235 |
distal convoluted tubule development(GO:0072025) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) |
| 1.8 |
5.4 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 1.8 |
14.3 |
GO:0030174 |
regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 1.8 |
8.9 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 1.7 |
19.2 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 1.7 |
36.7 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 1.7 |
7.0 |
GO:0046655 |
glycine biosynthetic process(GO:0006545) folic acid metabolic process(GO:0046655) |
| 1.7 |
7.0 |
GO:0060857 |
establishment of glial blood-brain barrier(GO:0060857) |
| 1.7 |
10.4 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 1.7 |
6.9 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
| 1.7 |
3.4 |
GO:2001027 |
negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 1.7 |
1.7 |
GO:0042660 |
positive regulation of cell fate specification(GO:0042660) |
| 1.7 |
3.4 |
GO:0002248 |
connective tissue replacement involved in inflammatory response wound healing(GO:0002248) |
| 1.7 |
8.4 |
GO:0090521 |
glomerular visceral epithelial cell migration(GO:0090521) |
| 1.7 |
1.7 |
GO:0072223 |
metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
| 1.7 |
5.0 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 1.7 |
8.4 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 1.7 |
16.7 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 1.7 |
5.0 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 1.7 |
6.7 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 1.7 |
11.6 |
GO:1904627 |
response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 1.6 |
4.8 |
GO:0097350 |
neutrophil clearance(GO:0097350) |
| 1.6 |
3.2 |
GO:0048319 |
axial mesoderm morphogenesis(GO:0048319) |
| 1.6 |
4.8 |
GO:0019343 |
cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 1.6 |
12.8 |
GO:0090091 |
positive regulation of extracellular matrix disassembly(GO:0090091) |
| 1.6 |
6.4 |
GO:0030091 |
protein repair(GO:0030091) |
| 1.6 |
4.8 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 1.6 |
11.2 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 1.6 |
14.3 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 1.6 |
3.2 |
GO:0072236 |
metanephric loop of Henle development(GO:0072236) |
| 1.6 |
20.5 |
GO:1902459 |
positive regulation of stem cell population maintenance(GO:1902459) |
| 1.6 |
7.8 |
GO:1904685 |
positive regulation of metalloendopeptidase activity(GO:1904685) |
| 1.6 |
9.3 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 1.6 |
6.2 |
GO:0006244 |
pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 1.5 |
3.1 |
GO:0048546 |
digestive tract morphogenesis(GO:0048546) |
| 1.5 |
6.1 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 1.5 |
4.6 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 1.5 |
6.1 |
GO:0061743 |
motor learning(GO:0061743) |
| 1.5 |
4.6 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 1.5 |
6.0 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 1.5 |
1.5 |
GO:0051660 |
establishment of centrosome localization(GO:0051660) |
| 1.5 |
5.9 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 1.5 |
5.8 |
GO:0015705 |
iodide transport(GO:0015705) |
| 1.5 |
2.9 |
GO:0009814 |
defense response, incompatible interaction(GO:0009814) |
| 1.4 |
4.3 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 1.4 |
4.3 |
GO:0046104 |
thymidine metabolic process(GO:0046104) |
| 1.4 |
2.9 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 1.4 |
4.2 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 1.4 |
5.6 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 1.4 |
7.0 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 1.4 |
9.8 |
GO:1903753 |
negative regulation of p38MAPK cascade(GO:1903753) |
| 1.4 |
1.4 |
GO:0035584 |
calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 1.4 |
13.9 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 1.4 |
1.4 |
GO:0060579 |
ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 1.4 |
1.4 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 1.4 |
8.3 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 1.4 |
19.3 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 1.4 |
1.4 |
GO:0090272 |
negative regulation of fibroblast growth factor production(GO:0090272) |
| 1.4 |
5.5 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) |
| 1.4 |
5.5 |
GO:2000138 |
positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 1.4 |
10.9 |
GO:0032825 |
positive regulation of natural killer cell differentiation(GO:0032825) |
| 1.3 |
5.4 |
GO:0072137 |
condensed mesenchymal cell proliferation(GO:0072137) |
| 1.3 |
8.0 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 1.3 |
2.7 |
GO:0007494 |
midgut development(GO:0007494) |
| 1.3 |
1.3 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 1.3 |
2.7 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 1.3 |
17.2 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 1.3 |
1.3 |
GO:0007588 |
excretion(GO:0007588) |
| 1.3 |
2.6 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 1.3 |
12.9 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 1.3 |
5.1 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 1.3 |
9.0 |
GO:0061299 |
retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 1.3 |
3.8 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 1.3 |
1.3 |
GO:0002063 |
chondrocyte development(GO:0002063) |
| 1.3 |
14.0 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 1.3 |
2.5 |
GO:0032229 |
negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 1.3 |
2.5 |
GO:0071707 |
immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
| 1.3 |
3.8 |
GO:0060923 |
cardiac muscle cell fate commitment(GO:0060923) |
| 1.3 |
5.1 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 1.3 |
3.8 |
GO:0014834 |
skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 1.3 |
5.0 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 1.3 |
5.0 |
GO:0010519 |
negative regulation of phospholipase activity(GO:0010519) |
| 1.3 |
3.8 |
GO:0098968 |
neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 1.2 |
2.5 |
GO:0071205 |
protein localization to juxtaparanode region of axon(GO:0071205) |
| 1.2 |
3.7 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 1.2 |
2.5 |
GO:0045950 |
negative regulation of mitotic recombination(GO:0045950) |
| 1.2 |
4.9 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 1.2 |
4.9 |
GO:0006977 |
DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 1.2 |
3.6 |
GO:1903070 |
negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 1.2 |
3.6 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 1.2 |
8.4 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 1.2 |
2.4 |
GO:1904760 |
myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 1.2 |
8.4 |
GO:0000320 |
re-entry into mitotic cell cycle(GO:0000320) |
| 1.2 |
3.6 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 1.2 |
2.4 |
GO:0061180 |
mammary gland epithelium development(GO:0061180) |
| 1.2 |
15.2 |
GO:0060707 |
trophoblast giant cell differentiation(GO:0060707) |
| 1.2 |
2.3 |
GO:0010248 |
B cell negative selection(GO:0002352) establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 1.2 |
5.9 |
GO:0060026 |
convergent extension(GO:0060026) |
| 1.2 |
2.3 |
GO:1901355 |
response to rapamycin(GO:1901355) |
| 1.2 |
5.8 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 1.1 |
10.3 |
GO:0071493 |
cellular response to UV-B(GO:0071493) |
| 1.1 |
6.9 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 1.1 |
2.3 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 1.1 |
1.1 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 1.1 |
30.6 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 1.1 |
6.7 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 1.1 |
9.0 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 1.1 |
2.2 |
GO:0030432 |
peristalsis(GO:0030432) |
| 1.1 |
4.5 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 1.1 |
5.6 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 1.1 |
6.7 |
GO:0098762 |
meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
| 1.1 |
5.5 |
GO:2000427 |
positive regulation of apoptotic cell clearance(GO:2000427) |
| 1.1 |
3.3 |
GO:0034241 |
positive regulation of macrophage fusion(GO:0034241) |
| 1.1 |
7.7 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 1.1 |
6.6 |
GO:0046459 |
short-chain fatty acid metabolic process(GO:0046459) |
| 1.1 |
5.5 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 1.1 |
33.9 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 1.1 |
2.2 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 1.1 |
3.3 |
GO:0071649 |
regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 1.1 |
4.3 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 1.1 |
4.3 |
GO:2001185 |
regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 1.1 |
2.2 |
GO:0060591 |
chondroblast differentiation(GO:0060591) |
| 1.1 |
1.1 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) |
| 1.1 |
3.2 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 1.1 |
5.4 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 1.1 |
10.7 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 1.1 |
1.1 |
GO:0016554 |
cytidine to uridine editing(GO:0016554) |
| 1.1 |
7.5 |
GO:1904714 |
regulation of chaperone-mediated autophagy(GO:1904714) |
| 1.1 |
2.1 |
GO:0033864 |
positive regulation of NAD(P)H oxidase activity(GO:0033864) |
| 1.1 |
9.6 |
GO:0010715 |
regulation of extracellular matrix disassembly(GO:0010715) |
| 1.1 |
24.4 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 1.1 |
5.3 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 1.0 |
8.3 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 1.0 |
4.1 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 1.0 |
6.2 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 1.0 |
12.4 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 1.0 |
2.1 |
GO:0006271 |
DNA strand elongation involved in DNA replication(GO:0006271) |
| 1.0 |
6.2 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 1.0 |
5.1 |
GO:0006868 |
glutamine transport(GO:0006868) |
| 1.0 |
3.1 |
GO:0060718 |
chorionic trophoblast cell differentiation(GO:0060718) |
| 1.0 |
4.1 |
GO:0006344 |
maintenance of chromatin silencing(GO:0006344) |
| 1.0 |
5.1 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 1.0 |
1.0 |
GO:0007354 |
zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 1.0 |
2.0 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 1.0 |
21.1 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 1.0 |
4.0 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 1.0 |
2.0 |
GO:0010847 |
regulation of chromatin assembly(GO:0010847) |
| 1.0 |
5.0 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 1.0 |
4.0 |
GO:0072272 |
proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
| 1.0 |
2.0 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 1.0 |
2.0 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 1.0 |
23.6 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 1.0 |
3.0 |
GO:0071579 |
regulation of zinc ion transport(GO:0071579) |
| 1.0 |
7.9 |
GO:0072615 |
interleukin-17 secretion(GO:0072615) |
| 1.0 |
2.9 |
GO:1903976 |
negative regulation of glial cell migration(GO:1903976) |
| 1.0 |
6.8 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 1.0 |
7.8 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 1.0 |
1.9 |
GO:0003357 |
noradrenergic neuron differentiation(GO:0003357) |
| 1.0 |
1.0 |
GO:0090035 |
regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 1.0 |
4.8 |
GO:1904936 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 1.0 |
1.0 |
GO:0061298 |
retina vasculature development in camera-type eye(GO:0061298) |
| 1.0 |
6.7 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 1.0 |
2.9 |
GO:0035188 |
blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 1.0 |
2.9 |
GO:0060800 |
regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 1.0 |
3.8 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 1.0 |
6.7 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.9 |
5.7 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.9 |
29.1 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.9 |
0.9 |
GO:0048146 |
positive regulation of fibroblast proliferation(GO:0048146) |
| 0.9 |
0.9 |
GO:0048745 |
smooth muscle tissue development(GO:0048745) |
| 0.9 |
5.5 |
GO:2000773 |
negative regulation of cellular senescence(GO:2000773) |
| 0.9 |
3.7 |
GO:0060903 |
positive regulation of meiosis I(GO:0060903) |
| 0.9 |
6.4 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.9 |
2.7 |
GO:1902071 |
regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.9 |
3.6 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.9 |
3.6 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.9 |
8.1 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) |
| 0.9 |
1.8 |
GO:0034380 |
high-density lipoprotein particle assembly(GO:0034380) |
| 0.9 |
2.7 |
GO:0046356 |
acetyl-CoA catabolic process(GO:0046356) |
| 0.9 |
17.1 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.9 |
0.9 |
GO:0071451 |
cellular response to oxygen radical(GO:0071450) cellular response to superoxide(GO:0071451) |
| 0.9 |
2.7 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.9 |
0.9 |
GO:1902915 |
negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.9 |
2.7 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.9 |
0.9 |
GO:0070172 |
positive regulation of tooth mineralization(GO:0070172) |
| 0.9 |
6.2 |
GO:0016584 |
nucleosome positioning(GO:0016584) |
| 0.9 |
5.3 |
GO:0071459 |
protein localization to kinetochore(GO:0034501) protein localization to chromosome, centromeric region(GO:0071459) |
| 0.9 |
12.3 |
GO:0071257 |
cellular response to electrical stimulus(GO:0071257) |
| 0.9 |
0.9 |
GO:0001306 |
age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.9 |
6.1 |
GO:0070102 |
interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.9 |
7.0 |
GO:0007440 |
foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
| 0.9 |
0.9 |
GO:0000212 |
meiotic spindle organization(GO:0000212) |
| 0.9 |
2.6 |
GO:0007290 |
spermatid nucleus elongation(GO:0007290) |
| 0.9 |
2.6 |
GO:0023016 |
signal transduction by trans-phosphorylation(GO:0023016) |
| 0.9 |
7.7 |
GO:0070874 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.8 |
0.8 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 0.8 |
3.4 |
GO:2001271 |
negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.8 |
4.2 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.8 |
6.7 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.8 |
4.2 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.8 |
10.0 |
GO:0060252 |
positive regulation of glial cell proliferation(GO:0060252) |
| 0.8 |
2.5 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.8 |
0.8 |
GO:0060272 |
embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.8 |
3.3 |
GO:0010836 |
negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.8 |
1.7 |
GO:0006998 |
nuclear envelope organization(GO:0006998) |
| 0.8 |
36.3 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.8 |
2.5 |
GO:0014891 |
striated muscle atrophy(GO:0014891) |
| 0.8 |
4.1 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.8 |
2.5 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.8 |
11.5 |
GO:0021978 |
telencephalon regionalization(GO:0021978) |
| 0.8 |
2.5 |
GO:0002191 |
cap-dependent translational initiation(GO:0002191) |
| 0.8 |
2.4 |
GO:2000425 |
regulation of apoptotic cell clearance(GO:2000425) |
| 0.8 |
2.4 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.8 |
3.2 |
GO:0006409 |
tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.8 |
4.8 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 0.8 |
1.6 |
GO:0030214 |
hyaluronan catabolic process(GO:0030214) |
| 0.8 |
3.2 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.8 |
7.3 |
GO:0070236 |
negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.8 |
2.4 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.8 |
0.8 |
GO:2001171 |
positive regulation of ATP biosynthetic process(GO:2001171) |
| 0.8 |
3.2 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.8 |
8.0 |
GO:0035999 |
tetrahydrofolate interconversion(GO:0035999) |
| 0.8 |
2.4 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.8 |
0.8 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.8 |
3.2 |
GO:0002175 |
protein localization to paranode region of axon(GO:0002175) |
| 0.8 |
1.6 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.8 |
0.8 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.8 |
7.9 |
GO:0060059 |
embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.8 |
2.3 |
GO:0051026 |
chiasma assembly(GO:0051026) |
| 0.8 |
0.8 |
GO:1903960 |
negative regulation of anion channel activity(GO:0010360) negative regulation of anion transmembrane transport(GO:1903960) |
| 0.8 |
5.4 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.8 |
0.8 |
GO:0050689 |
negative regulation of defense response to virus by host(GO:0050689) |
| 0.8 |
3.9 |
GO:0003383 |
apical constriction(GO:0003383) |
| 0.8 |
5.4 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.8 |
2.3 |
GO:0031204 |
posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.8 |
4.6 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) |
| 0.8 |
0.8 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 0.8 |
2.3 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.8 |
3.8 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 0.8 |
6.0 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.8 |
3.0 |
GO:0021873 |
forebrain neuroblast division(GO:0021873) |
| 0.8 |
8.3 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.8 |
2.3 |
GO:0032962 |
regulation of inositol trisphosphate biosynthetic process(GO:0032960) positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.7 |
3.0 |
GO:2000158 |
positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.7 |
5.2 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.7 |
0.7 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.7 |
11.0 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.7 |
2.2 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.7 |
1.5 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.7 |
4.4 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.7 |
7.3 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.7 |
5.1 |
GO:0032464 |
positive regulation of protein homooligomerization(GO:0032464) |
| 0.7 |
1.5 |
GO:2000192 |
negative regulation of fatty acid transport(GO:2000192) |
| 0.7 |
0.7 |
GO:0010324 |
membrane invagination(GO:0010324) |
| 0.7 |
2.2 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 0.7 |
1.5 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 0.7 |
5.1 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.7 |
1.4 |
GO:0051024 |
positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.7 |
2.2 |
GO:0046135 |
pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.7 |
1.4 |
GO:0010635 |
regulation of mitochondrial fusion(GO:0010635) |
| 0.7 |
3.6 |
GO:0009449 |
gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.7 |
6.5 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.7 |
2.9 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.7 |
0.7 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.7 |
2.9 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.7 |
2.1 |
GO:0006526 |
arginine biosynthetic process(GO:0006526) |
| 0.7 |
1.4 |
GO:0090199 |
regulation of release of cytochrome c from mitochondria(GO:0090199) |
| 0.7 |
1.4 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.7 |
7.8 |
GO:0043488 |
regulation of mRNA stability(GO:0043488) |
| 0.7 |
5.0 |
GO:0044829 |
positive regulation by host of viral genome replication(GO:0044829) |
| 0.7 |
2.1 |
GO:0051365 |
cellular response to potassium ion starvation(GO:0051365) |
| 0.7 |
1.4 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.7 |
0.7 |
GO:0036118 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.7 |
1.4 |
GO:0051295 |
establishment of meiotic spindle localization(GO:0051295) |
| 0.7 |
4.2 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.7 |
11.2 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.7 |
0.7 |
GO:0071896 |
protein localization to adherens junction(GO:0071896) |
| 0.7 |
2.8 |
GO:1902268 |
negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.7 |
2.1 |
GO:0048669 |
collateral sprouting in absence of injury(GO:0048669) |
| 0.7 |
2.8 |
GO:1900186 |
negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.7 |
2.8 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.7 |
2.1 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.7 |
2.1 |
GO:0048162 |
preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.7 |
4.1 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.7 |
2.1 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.7 |
0.7 |
GO:0002200 |
somatic diversification of immune receptors(GO:0002200) |
| 0.7 |
2.1 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.7 |
4.1 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.7 |
2.0 |
GO:0044793 |
negative regulation by host of viral process(GO:0044793) |
| 0.7 |
1.4 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 0.7 |
2.0 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.7 |
2.7 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.7 |
10.2 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.7 |
4.1 |
GO:2000381 |
negative regulation of mesoderm development(GO:2000381) |
| 0.7 |
6.8 |
GO:0021924 |
cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
| 0.7 |
3.4 |
GO:1904683 |
regulation of metalloendopeptidase activity(GO:1904683) |
| 0.7 |
5.4 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.7 |
2.0 |
GO:0086053 |
AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.7 |
2.7 |
GO:0015744 |
succinate transport(GO:0015744) |
| 0.7 |
2.7 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.7 |
4.0 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.7 |
2.7 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.7 |
2.0 |
GO:0019323 |
pentose catabolic process(GO:0019323) |
| 0.7 |
0.7 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.7 |
0.7 |
GO:0019433 |
triglyceride catabolic process(GO:0019433) |
| 0.7 |
2.6 |
GO:0060068 |
vagina development(GO:0060068) |
| 0.6 |
1.3 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.6 |
2.6 |
GO:1903504 |
regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.6 |
1.9 |
GO:2000542 |
negative regulation of endodermal cell differentiation(GO:1903225) negative regulation of gastrulation(GO:2000542) |
| 0.6 |
1.3 |
GO:0034384 |
high-density lipoprotein particle clearance(GO:0034384) |
| 0.6 |
5.8 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.6 |
4.5 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.6 |
0.6 |
GO:0009794 |
regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.6 |
0.6 |
GO:0097168 |
mesenchymal stem cell proliferation(GO:0097168) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.6 |
1.9 |
GO:1904719 |
excitatory chemical synaptic transmission(GO:0098976) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.6 |
3.8 |
GO:0021539 |
subthalamus development(GO:0021539) |
| 0.6 |
7.6 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.6 |
6.3 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.6 |
4.4 |
GO:0048706 |
embryonic skeletal system development(GO:0048706) |
| 0.6 |
3.1 |
GO:0051971 |
positive regulation of transmission of nerve impulse(GO:0051971) |
| 0.6 |
4.4 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.6 |
1.2 |
GO:1904245 |
regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 0.6 |
3.7 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.6 |
3.7 |
GO:0072189 |
ureter development(GO:0072189) |
| 0.6 |
1.2 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.6 |
1.8 |
GO:0045656 |
negative regulation of monocyte differentiation(GO:0045656) |
| 0.6 |
0.6 |
GO:0010825 |
positive regulation of centrosome duplication(GO:0010825) |
| 0.6 |
1.8 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.6 |
1.8 |
GO:0072217 |
regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003339) negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) negative regulation of metanephros development(GO:0072217) |
| 0.6 |
3.1 |
GO:1990839 |
response to endothelin(GO:1990839) |
| 0.6 |
5.5 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.6 |
0.6 |
GO:0001771 |
immunological synapse formation(GO:0001771) |
| 0.6 |
4.3 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 0.6 |
1.2 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.6 |
2.4 |
GO:0034441 |
plasma lipoprotein particle oxidation(GO:0034441) |
| 0.6 |
2.4 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 0.6 |
10.6 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.6 |
2.3 |
GO:0044253 |
positive regulation of collagen metabolic process(GO:0010714) positive regulation of collagen biosynthetic process(GO:0032967) positive regulation of multicellular organismal metabolic process(GO:0044253) |
| 0.6 |
2.3 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.6 |
2.3 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.6 |
8.8 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.6 |
9.9 |
GO:0033260 |
nuclear DNA replication(GO:0033260) |
| 0.6 |
0.6 |
GO:0002432 |
granuloma formation(GO:0002432) |
| 0.6 |
1.2 |
GO:1903719 |
regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.6 |
1.2 |
GO:0090205 |
positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.6 |
1.2 |
GO:0002765 |
immune response-inhibiting signal transduction(GO:0002765) |
| 0.6 |
1.2 |
GO:0000720 |
pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.6 |
6.3 |
GO:0070836 |
caveola assembly(GO:0070836) |
| 0.6 |
1.2 |
GO:0032493 |
response to bacterial lipoprotein(GO:0032493) |
| 0.6 |
2.3 |
GO:0032000 |
positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.6 |
1.7 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.6 |
1.7 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.6 |
2.3 |
GO:0009256 |
10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.6 |
0.6 |
GO:0007521 |
muscle cell fate determination(GO:0007521) |
| 0.6 |
8.5 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.6 |
1.1 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 0.6 |
2.3 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.6 |
5.1 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.6 |
1.7 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.6 |
3.4 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.6 |
5.6 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.6 |
17.4 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.6 |
1.7 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.6 |
1.1 |
GO:1901526 |
positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.6 |
6.1 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.6 |
2.2 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.6 |
3.3 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.6 |
1.7 |
GO:0010667 |
negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
| 0.6 |
1.7 |
GO:1990046 |
positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) stress-induced mitochondrial fusion(GO:1990046) |
| 0.5 |
1.1 |
GO:0043652 |
engulfment of apoptotic cell(GO:0043652) |
| 0.5 |
2.2 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.5 |
4.4 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.5 |
0.5 |
GO:0046902 |
regulation of mitochondrial membrane permeability(GO:0046902) regulation of membrane permeability(GO:0090559) |
| 0.5 |
0.5 |
GO:0030222 |
eosinophil differentiation(GO:0030222) |
| 0.5 |
1.6 |
GO:0019659 |
fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.5 |
2.2 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.5 |
3.3 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.5 |
1.6 |
GO:0072182 |
glomerular parietal epithelial cell differentiation(GO:0072139) regulation of nephron tubule epithelial cell differentiation(GO:0072182) positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.5 |
1.1 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.5 |
4.3 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.5 |
4.3 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.5 |
1.6 |
GO:0070476 |
rRNA (guanine-N7)-methylation(GO:0070476) |
| 0.5 |
1.6 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.5 |
2.7 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.5 |
5.9 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.5 |
3.7 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.5 |
4.2 |
GO:0035881 |
amacrine cell differentiation(GO:0035881) |
| 0.5 |
1.1 |
GO:0034334 |
adherens junction maintenance(GO:0034334) |
| 0.5 |
1.6 |
GO:1905000 |
regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.5 |
1.0 |
GO:0010958 |
regulation of amino acid import(GO:0010958) |
| 0.5 |
1.0 |
GO:0007228 |
positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.5 |
4.2 |
GO:0003062 |
regulation of heart rate by chemical signal(GO:0003062) |
| 0.5 |
1.6 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.5 |
2.1 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.5 |
3.1 |
GO:0071883 |
activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.5 |
4.1 |
GO:0014823 |
response to activity(GO:0014823) |
| 0.5 |
1.5 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.5 |
1.0 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.5 |
0.5 |
GO:0035441 |
cell migration involved in vasculogenesis(GO:0035441) |
| 0.5 |
2.0 |
GO:0030202 |
heparin metabolic process(GO:0030202) |
| 0.5 |
1.5 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.5 |
0.5 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.5 |
1.5 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 0.5 |
2.0 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.5 |
1.0 |
GO:0072180 |
mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) mesonephric duct development(GO:0072177) mesonephric duct morphogenesis(GO:0072180) |
| 0.5 |
2.0 |
GO:1903288 |
positive regulation of potassium ion import(GO:1903288) |
| 0.5 |
1.0 |
GO:1904751 |
positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.5 |
4.4 |
GO:0036342 |
post-anal tail morphogenesis(GO:0036342) |
| 0.5 |
1.0 |
GO:0090204 |
protein localization to nuclear pore(GO:0090204) |
| 0.5 |
2.4 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.5 |
0.5 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 0.5 |
1.4 |
GO:0042097 |
interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
| 0.5 |
1.9 |
GO:1901673 |
regulation of mitotic spindle assembly(GO:1901673) |
| 0.5 |
5.8 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.5 |
4.8 |
GO:0006337 |
nucleosome disassembly(GO:0006337) |
| 0.5 |
1.4 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.5 |
1.0 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.5 |
1.4 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.5 |
0.5 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.5 |
0.9 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.5 |
0.5 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 0.5 |
4.1 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.5 |
23.9 |
GO:0050830 |
defense response to Gram-positive bacterium(GO:0050830) |
| 0.5 |
0.9 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.5 |
2.3 |
GO:0097201 |
negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
| 0.5 |
0.9 |
GO:0002725 |
negative regulation of T cell cytokine production(GO:0002725) |
| 0.5 |
0.5 |
GO:0045616 |
regulation of keratinocyte differentiation(GO:0045616) |
| 0.5 |
3.2 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.5 |
4.5 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.4 |
8.1 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.4 |
1.3 |
GO:0009414 |
response to water deprivation(GO:0009414) |
| 0.4 |
2.7 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 0.4 |
1.8 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.4 |
1.8 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.4 |
3.5 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.4 |
1.3 |
GO:0002457 |
T cell antigen processing and presentation(GO:0002457) |
| 0.4 |
6.6 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.4 |
0.9 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.4 |
1.3 |
GO:0030043 |
actin filament fragmentation(GO:0030043) |
| 0.4 |
1.3 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.4 |
3.5 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.4 |
1.3 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.4 |
3.0 |
GO:0070458 |
detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.4 |
1.7 |
GO:0007044 |
cell-substrate junction assembly(GO:0007044) |
| 0.4 |
3.0 |
GO:0051307 |
meiotic chromosome separation(GO:0051307) |
| 0.4 |
3.0 |
GO:0090224 |
regulation of mitotic spindle organization(GO:0060236) regulation of spindle organization(GO:0090224) |
| 0.4 |
7.2 |
GO:0044381 |
glucose import in response to insulin stimulus(GO:0044381) |
| 0.4 |
3.4 |
GO:0030220 |
platelet formation(GO:0030220) |
| 0.4 |
1.7 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.4 |
0.4 |
GO:0035728 |
response to hepatocyte growth factor(GO:0035728) |
| 0.4 |
0.4 |
GO:0061684 |
chaperone-mediated autophagy(GO:0061684) |
| 0.4 |
0.4 |
GO:0010643 |
cell communication by chemical coupling(GO:0010643) |
| 0.4 |
1.3 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.4 |
3.3 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.4 |
0.8 |
GO:0021983 |
pituitary gland development(GO:0021983) |
| 0.4 |
1.2 |
GO:0072070 |
proximal/distal pattern formation involved in nephron development(GO:0072047) loop of Henle development(GO:0072070) specification of nephron tubule identity(GO:0072081) specification of loop of Henle identity(GO:0072086) |
| 0.4 |
2.1 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.4 |
0.8 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.4 |
1.2 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.4 |
0.8 |
GO:1904578 |
response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.4 |
1.6 |
GO:0051013 |
microtubule severing(GO:0051013) |
| 0.4 |
4.9 |
GO:1990748 |
cellular detoxification(GO:1990748) |
| 0.4 |
0.4 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.4 |
0.8 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.4 |
0.8 |
GO:0098914 |
membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.4 |
0.4 |
GO:0042537 |
benzene-containing compound metabolic process(GO:0042537) |
| 0.4 |
0.8 |
GO:1990504 |
dense core granule exocytosis(GO:1990504) |
| 0.4 |
1.6 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.4 |
6.4 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.4 |
1.2 |
GO:0032369 |
negative regulation of lipid transport(GO:0032369) |
| 0.4 |
2.0 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.4 |
7.9 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.4 |
4.7 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.4 |
0.4 |
GO:0038027 |
apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
| 0.4 |
0.8 |
GO:0032332 |
positive regulation of chondrocyte differentiation(GO:0032332) |
| 0.4 |
2.0 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.4 |
1.2 |
GO:0034473 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.4 |
1.2 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.4 |
1.6 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.4 |
1.6 |
GO:0031442 |
positive regulation of mRNA 3'-end processing(GO:0031442) |
| 0.4 |
2.3 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 0.4 |
0.4 |
GO:0021520 |
spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.4 |
1.9 |
GO:0046653 |
tetrahydrofolate metabolic process(GO:0046653) |
| 0.4 |
1.2 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.4 |
0.4 |
GO:0030860 |
regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.4 |
1.1 |
GO:0042796 |
snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.4 |
0.4 |
GO:0002678 |
positive regulation of chronic inflammatory response(GO:0002678) |
| 0.4 |
3.4 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.4 |
0.8 |
GO:0018171 |
peptidyl-cysteine oxidation(GO:0018171) |
| 0.4 |
2.7 |
GO:0046827 |
positive regulation of protein export from nucleus(GO:0046827) |
| 0.4 |
8.7 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.4 |
0.4 |
GO:0032056 |
positive regulation of translation in response to stress(GO:0032056) |
| 0.4 |
1.1 |
GO:0008625 |
extrinsic apoptotic signaling pathway via death domain receptors(GO:0008625) |
| 0.4 |
0.7 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.4 |
0.7 |
GO:0042637 |
catagen(GO:0042637) |
| 0.4 |
2.6 |
GO:0006534 |
cysteine metabolic process(GO:0006534) |
| 0.4 |
0.7 |
GO:0051353 |
positive regulation of oxidoreductase activity(GO:0051353) |
| 0.4 |
3.0 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.4 |
0.4 |
GO:0040019 |
positive regulation of embryonic development(GO:0040019) |
| 0.4 |
3.7 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.4 |
1.1 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.4 |
1.8 |
GO:1903026 |
negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.4 |
1.5 |
GO:0086028 |
bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.4 |
0.4 |
GO:0090344 |
negative regulation of cell aging(GO:0090344) |
| 0.4 |
1.8 |
GO:0045918 |
negative regulation of cytolysis(GO:0045918) |
| 0.4 |
2.9 |
GO:0090103 |
cochlea morphogenesis(GO:0090103) |
| 0.4 |
1.5 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.4 |
1.4 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.4 |
0.4 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.4 |
1.1 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.4 |
3.6 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.4 |
0.4 |
GO:0036344 |
platelet morphogenesis(GO:0036344) |
| 0.4 |
1.1 |
GO:0070307 |
lens fiber cell development(GO:0070307) |
| 0.4 |
1.4 |
GO:0051195 |
negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.4 |
0.4 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.4 |
2.8 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.3 |
0.7 |
GO:0006338 |
chromatin remodeling(GO:0006338) |
| 0.3 |
3.5 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.3 |
0.3 |
GO:0036006 |
response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
| 0.3 |
1.4 |
GO:0033089 |
positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
| 0.3 |
0.7 |
GO:0038061 |
NIK/NF-kappaB signaling(GO:0038061) |
| 0.3 |
2.1 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.3 |
2.0 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.3 |
0.7 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.3 |
5.8 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.3 |
2.0 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.3 |
4.4 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.3 |
1.3 |
GO:1903237 |
negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.3 |
2.0 |
GO:0042058 |
regulation of epidermal growth factor receptor signaling pathway(GO:0042058) |
| 0.3 |
1.7 |
GO:0019254 |
carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.3 |
0.3 |
GO:0003338 |
metanephros morphogenesis(GO:0003338) |
| 0.3 |
1.7 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.3 |
1.0 |
GO:1903630 |
regulation of aminoacyl-tRNA ligase activity(GO:1903630) positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.3 |
1.7 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.3 |
3.3 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.3 |
5.3 |
GO:0042246 |
tissue regeneration(GO:0042246) |
| 0.3 |
1.3 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.3 |
3.0 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.3 |
2.3 |
GO:0002523 |
leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.3 |
4.6 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.3 |
3.6 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 0.3 |
0.7 |
GO:0072093 |
metanephric renal vesicle formation(GO:0072093) |
| 0.3 |
0.7 |
GO:0016479 |
negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.3 |
0.6 |
GO:0003180 |
aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
| 0.3 |
0.6 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.3 |
1.0 |
GO:0051533 |
positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.3 |
0.6 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.3 |
0.6 |
GO:0044773 |
mitotic DNA damage checkpoint(GO:0044773) |
| 0.3 |
1.0 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.3 |
0.3 |
GO:0007006 |
mitochondrial membrane organization(GO:0007006) |
| 0.3 |
1.6 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.3 |
0.6 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.3 |
3.2 |
GO:0031297 |
replication fork processing(GO:0031297) |
| 0.3 |
0.3 |
GO:0019249 |
lactate biosynthetic process(GO:0019249) |
| 0.3 |
0.9 |
GO:0048286 |
lung alveolus development(GO:0048286) |
| 0.3 |
0.3 |
GO:0002339 |
B cell selection(GO:0002339) |
| 0.3 |
2.5 |
GO:0035437 |
maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.3 |
1.3 |
GO:0010998 |
regulation of translational initiation by eIF2 alpha phosphorylation(GO:0010998) |
| 0.3 |
2.8 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.3 |
5.9 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.3 |
0.6 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.3 |
1.8 |
GO:0000447 |
endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.3 |
0.3 |
GO:1902608 |
regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.3 |
0.3 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.3 |
0.6 |
GO:0002385 |
organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
| 0.3 |
1.8 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.3 |
1.5 |
GO:0070171 |
regulation of tooth mineralization(GO:0070170) negative regulation of tooth mineralization(GO:0070171) |
| 0.3 |
0.3 |
GO:0006106 |
fumarate metabolic process(GO:0006106) |
| 0.3 |
4.5 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.3 |
0.6 |
GO:0000454 |
snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.3 |
3.0 |
GO:0036120 |
response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.3 |
1.5 |
GO:0042938 |
dipeptide transport(GO:0042938) |
| 0.3 |
0.9 |
GO:0045989 |
positive regulation of striated muscle contraction(GO:0045989) |
| 0.3 |
0.3 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.3 |
3.3 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.3 |
0.9 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.3 |
1.5 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 0.3 |
3.8 |
GO:0046697 |
decidualization(GO:0046697) |
| 0.3 |
5.6 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.3 |
2.9 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.3 |
0.9 |
GO:0006600 |
creatine metabolic process(GO:0006600) |
| 0.3 |
0.3 |
GO:0006501 |
C-terminal protein lipidation(GO:0006501) |
| 0.3 |
0.6 |
GO:0002901 |
mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.3 |
0.3 |
GO:0001946 |
lymphangiogenesis(GO:0001946) |
| 0.3 |
1.2 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.3 |
2.3 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.3 |
0.6 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.3 |
2.3 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.3 |
1.7 |
GO:0002467 |
germinal center formation(GO:0002467) |
| 0.3 |
0.3 |
GO:0033762 |
response to glucagon(GO:0033762) |
| 0.3 |
0.3 |
GO:0036228 |
protein targeting to nuclear inner membrane(GO:0036228) |
| 0.3 |
1.7 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.3 |
0.9 |
GO:0060468 |
prevention of polyspermy(GO:0060468) |
| 0.3 |
2.3 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.3 |
4.3 |
GO:0051299 |
centrosome separation(GO:0051299) |
| 0.3 |
0.8 |
GO:0007520 |
myoblast fusion(GO:0007520) |
| 0.3 |
3.9 |
GO:0000289 |
nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.3 |
0.3 |
GO:0035701 |
hematopoietic stem cell migration(GO:0035701) |
| 0.3 |
1.1 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.3 |
1.4 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.3 |
2.2 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 0.3 |
2.0 |
GO:0031087 |
deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.3 |
1.4 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.3 |
4.7 |
GO:0060351 |
cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.3 |
0.8 |
GO:0015793 |
glycerol transport(GO:0015793) |
| 0.3 |
2.5 |
GO:0045048 |
protein insertion into ER membrane(GO:0045048) |
| 0.3 |
2.5 |
GO:1901409 |
positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.3 |
3.3 |
GO:1900027 |
regulation of ruffle assembly(GO:1900027) |
| 0.3 |
3.0 |
GO:1904293 |
negative regulation of ERAD pathway(GO:1904293) |
| 0.3 |
0.5 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.3 |
1.4 |
GO:0010636 |
positive regulation of mitochondrial fusion(GO:0010636) |
| 0.3 |
0.3 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.3 |
0.3 |
GO:1902744 |
negative regulation of lamellipodium organization(GO:1902744) |
| 0.3 |
0.3 |
GO:0043489 |
RNA stabilization(GO:0043489) |
| 0.3 |
1.3 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.3 |
0.3 |
GO:0070813 |
hydrogen sulfide metabolic process(GO:0070813) |
| 0.3 |
3.2 |
GO:0060134 |
prepulse inhibition(GO:0060134) |
| 0.3 |
1.3 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.3 |
1.9 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.3 |
1.1 |
GO:0072674 |
multinuclear osteoclast differentiation(GO:0072674) |
| 0.3 |
0.3 |
GO:1900377 |
negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.3 |
1.3 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.3 |
9.7 |
GO:0010633 |
negative regulation of epithelial cell migration(GO:0010633) |
| 0.3 |
0.5 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.3 |
0.5 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.3 |
0.5 |
GO:0006590 |
thyroid hormone generation(GO:0006590) |
| 0.3 |
1.3 |
GO:0040032 |
post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.3 |
0.5 |
GO:1901642 |
purine nucleoside transmembrane transport(GO:0015860) nucleoside transmembrane transport(GO:1901642) |
| 0.3 |
2.6 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.3 |
0.5 |
GO:0097501 |
stress response to metal ion(GO:0097501) |
| 0.3 |
1.8 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.3 |
0.8 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.3 |
0.8 |
GO:0006669 |
sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.3 |
1.8 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.3 |
1.0 |
GO:0000303 |
response to superoxide(GO:0000303) |
| 0.3 |
0.8 |
GO:0030828 |
positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.3 |
1.3 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.3 |
0.5 |
GO:0006014 |
D-ribose metabolic process(GO:0006014) |
| 0.3 |
4.0 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 0.3 |
0.5 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.2 |
0.5 |
GO:0045583 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.2 |
0.2 |
GO:0080144 |
amino acid homeostasis(GO:0080144) |
| 0.2 |
1.7 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.2 |
2.5 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.2 |
2.4 |
GO:0035019 |
somatic stem cell population maintenance(GO:0035019) |
| 0.2 |
0.2 |
GO:0060644 |
mammary gland epithelial cell differentiation(GO:0060644) |
| 0.2 |
1.2 |
GO:0009068 |
aspartate family amino acid catabolic process(GO:0009068) |
| 0.2 |
0.5 |
GO:1901988 |
negative regulation of cell cycle phase transition(GO:1901988) |
| 0.2 |
0.2 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) |
| 0.2 |
0.5 |
GO:2000035 |
regulation of stem cell division(GO:2000035) |
| 0.2 |
1.4 |
GO:0006363 |
termination of RNA polymerase I transcription(GO:0006363) |
| 0.2 |
0.7 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.2 |
0.2 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.2 |
0.7 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.2 |
2.1 |
GO:0097194 |
execution phase of apoptosis(GO:0097194) |
| 0.2 |
1.4 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.2 |
1.4 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.2 |
1.4 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.2 |
1.2 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.2 |
2.1 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.2 |
0.9 |
GO:0071539 |
protein localization to centrosome(GO:0071539) |
| 0.2 |
2.5 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.2 |
4.5 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.2 |
0.2 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.2 |
2.7 |
GO:0010574 |
regulation of vascular endothelial growth factor production(GO:0010574) |
| 0.2 |
1.1 |
GO:0035994 |
response to muscle stretch(GO:0035994) |
| 0.2 |
0.2 |
GO:0031017 |
exocrine pancreas development(GO:0031017) |
| 0.2 |
0.4 |
GO:0032532 |
regulation of microvillus length(GO:0032532) |
| 0.2 |
2.7 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.2 |
2.4 |
GO:0006474 |
N-terminal protein amino acid acetylation(GO:0006474) |
| 0.2 |
1.3 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.2 |
1.3 |
GO:0046490 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.2 |
1.7 |
GO:0042167 |
porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.2 |
1.1 |
GO:1905050 |
positive regulation of metallopeptidase activity(GO:1905050) |
| 0.2 |
7.3 |
GO:0042168 |
heme metabolic process(GO:0042168) |
| 0.2 |
6.6 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.2 |
0.2 |
GO:0034392 |
negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.2 |
1.5 |
GO:0042590 |
antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.2 |
0.9 |
GO:0035360 |
positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.2 |
0.4 |
GO:0036090 |
cleavage furrow ingression(GO:0036090) |
| 0.2 |
2.1 |
GO:0032957 |
inositol trisphosphate metabolic process(GO:0032957) |
| 0.2 |
0.6 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.2 |
0.2 |
GO:0001788 |
antibody-dependent cellular cytotoxicity(GO:0001788) |
| 0.2 |
1.7 |
GO:1903298 |
regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.2 |
0.6 |
GO:0010641 |
positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
| 0.2 |
0.4 |
GO:0044788 |
modulation by host of viral process(GO:0044788) |
| 0.2 |
0.8 |
GO:0046668 |
retinal cell programmed cell death(GO:0046666) regulation of retinal cell programmed cell death(GO:0046668) |
| 0.2 |
0.6 |
GO:0071353 |
cellular response to interleukin-4(GO:0071353) |
| 0.2 |
1.9 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.2 |
0.6 |
GO:0006030 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.2 |
0.4 |
GO:0033632 |
regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.2 |
0.6 |
GO:0036093 |
germ cell proliferation(GO:0036093) |
| 0.2 |
2.3 |
GO:0051457 |
maintenance of protein location in nucleus(GO:0051457) |
| 0.2 |
3.3 |
GO:0000338 |
protein deneddylation(GO:0000338) |
| 0.2 |
0.4 |
GO:0045760 |
positive regulation of action potential(GO:0045760) |
| 0.2 |
0.6 |
GO:1905244 |
regulation of modification of synaptic structure(GO:1905244) |
| 0.2 |
0.8 |
GO:0007175 |
negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.2 |
0.2 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.2 |
0.2 |
GO:1900122 |
positive regulation of receptor binding(GO:1900122) |
| 0.2 |
1.0 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.2 |
1.0 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.2 |
1.0 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.2 |
2.2 |
GO:0070206 |
protein trimerization(GO:0070206) |
| 0.2 |
1.6 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.2 |
1.2 |
GO:0034377 |
plasma lipoprotein particle assembly(GO:0034377) |
| 0.2 |
0.2 |
GO:0006041 |
glucosamine metabolic process(GO:0006041) |
| 0.2 |
1.5 |
GO:0032688 |
negative regulation of interferon-beta production(GO:0032688) |
| 0.2 |
3.1 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 0.2 |
0.2 |
GO:0010694 |
positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.2 |
1.9 |
GO:0046051 |
UTP metabolic process(GO:0046051) |
| 0.2 |
2.5 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.2 |
0.8 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.2 |
1.0 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 0.2 |
0.8 |
GO:1903756 |
regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.2 |
0.6 |
GO:2000348 |
regulation of CD40 signaling pathway(GO:2000348) |
| 0.2 |
3.2 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.2 |
0.9 |
GO:0046456 |
icosanoid biosynthetic process(GO:0046456) fatty acid derivative biosynthetic process(GO:1901570) |
| 0.2 |
1.1 |
GO:0009081 |
branched-chain amino acid metabolic process(GO:0009081) |
| 0.2 |
0.7 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.2 |
0.2 |
GO:1901857 |
positive regulation of cellular respiration(GO:1901857) |
| 0.2 |
0.9 |
GO:0090005 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.2 |
4.8 |
GO:0015985 |
energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.2 |
0.4 |
GO:1902188 |
positive regulation of viral release from host cell(GO:1902188) |
| 0.2 |
1.7 |
GO:0071712 |
ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.2 |
0.4 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.2 |
1.1 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.2 |
2.2 |
GO:0009125 |
nucleoside monophosphate catabolic process(GO:0009125) |
| 0.2 |
1.3 |
GO:0043201 |
response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.2 |
0.7 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.2 |
1.3 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.2 |
1.8 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.2 |
1.1 |
GO:0032494 |
response to peptidoglycan(GO:0032494) |
| 0.2 |
0.2 |
GO:0010870 |
positive regulation of receptor biosynthetic process(GO:0010870) |
| 0.2 |
0.5 |
GO:0031652 |
positive regulation of heat generation(GO:0031652) |
| 0.2 |
0.7 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 0.2 |
0.2 |
GO:0061010 |
gall bladder development(GO:0061010) |
| 0.2 |
1.8 |
GO:0043486 |
histone exchange(GO:0043486) |
| 0.2 |
0.2 |
GO:0045900 |
negative regulation of translational elongation(GO:0045900) |
| 0.2 |
0.2 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.2 |
1.7 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.2 |
0.3 |
GO:0010172 |
embryonic body morphogenesis(GO:0010172) |
| 0.2 |
0.7 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.2 |
1.2 |
GO:0060307 |
regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) |
| 0.2 |
0.3 |
GO:0042984 |
amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.2 |
0.5 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 0.2 |
0.5 |
GO:1901072 |
glucosamine-containing compound catabolic process(GO:1901072) |
| 0.2 |
0.5 |
GO:0061739 |
protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.2 |
0.3 |
GO:0033484 |
nitric oxide homeostasis(GO:0033484) |
| 0.2 |
0.5 |
GO:0060334 |
regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.2 |
1.0 |
GO:0045579 |
positive regulation of B cell differentiation(GO:0045579) |
| 0.2 |
0.3 |
GO:2001233 |
regulation of apoptotic signaling pathway(GO:2001233) |
| 0.2 |
0.3 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.2 |
1.8 |
GO:0009299 |
mRNA transcription(GO:0009299) |
| 0.2 |
0.8 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.2 |
0.3 |
GO:0035790 |
platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.2 |
0.5 |
GO:0006336 |
DNA replication-independent nucleosome assembly(GO:0006336) |
| 0.2 |
0.3 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.2 |
1.1 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.2 |
1.9 |
GO:0030890 |
positive regulation of B cell proliferation(GO:0030890) |
| 0.2 |
4.1 |
GO:0071230 |
cellular response to amino acid stimulus(GO:0071230) |
| 0.2 |
1.9 |
GO:0090022 |
regulation of neutrophil chemotaxis(GO:0090022) |
| 0.2 |
0.8 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.2 |
3.8 |
GO:0032435 |
negative regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032435) |
| 0.2 |
0.6 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.2 |
1.7 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.2 |
0.8 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.2 |
4.1 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.2 |
5.9 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.2 |
0.9 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.2 |
0.9 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.2 |
0.6 |
GO:0002143 |
tRNA wobble position uridine thiolation(GO:0002143) |
| 0.2 |
1.4 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.2 |
0.3 |
GO:0006549 |
isoleucine metabolic process(GO:0006549) |
| 0.2 |
0.5 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.2 |
0.6 |
GO:0043649 |
dicarboxylic acid catabolic process(GO:0043649) |
| 0.2 |
0.8 |
GO:0032911 |
negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.2 |
0.5 |
GO:0097029 |
mature conventional dendritic cell differentiation(GO:0097029) |
| 0.2 |
0.6 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.2 |
0.3 |
GO:0051001 |
negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.2 |
0.5 |
GO:0006661 |
phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.2 |
0.8 |
GO:0071670 |
smooth muscle cell chemotaxis(GO:0071670) |
| 0.2 |
0.3 |
GO:0031953 |
negative regulation of protein autophosphorylation(GO:0031953) |
| 0.2 |
0.3 |
GO:1904667 |
negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.2 |
9.5 |
GO:0001578 |
microtubule bundle formation(GO:0001578) |
| 0.1 |
0.7 |
GO:0046349 |
amino sugar biosynthetic process(GO:0046349) |
| 0.1 |
3.4 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.1 |
1.0 |
GO:0036037 |
CD8-positive, alpha-beta T cell activation(GO:0036037) |
| 0.1 |
0.3 |
GO:1902166 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.1 |
0.4 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.1 |
0.9 |
GO:0046548 |
retinal rod cell development(GO:0046548) |
| 0.1 |
0.4 |
GO:0001828 |
inner cell mass cell fate commitment(GO:0001827) inner cell mass cellular morphogenesis(GO:0001828) |
| 0.1 |
0.3 |
GO:0015791 |
polyol transport(GO:0015791) |
| 0.1 |
1.4 |
GO:0009048 |
dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 |
0.1 |
GO:0031643 |
positive regulation of myelination(GO:0031643) |
| 0.1 |
0.9 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.1 |
0.7 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.1 |
0.6 |
GO:0035948 |
positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.1 |
4.4 |
GO:0007026 |
negative regulation of microtubule depolymerization(GO:0007026) |
| 0.1 |
0.3 |
GO:0006119 |
regulation of oxidative phosphorylation(GO:0002082) oxidative phosphorylation(GO:0006119) |
| 0.1 |
0.4 |
GO:0046322 |
negative regulation of fatty acid oxidation(GO:0046322) |
| 0.1 |
0.4 |
GO:0051352 |
negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.1 |
1.7 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.1 |
1.4 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.1 |
0.4 |
GO:0021854 |
hypothalamus development(GO:0021854) |
| 0.1 |
0.6 |
GO:0033148 |
positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.1 |
0.3 |
GO:2000059 |
negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.1 |
0.8 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 |
0.8 |
GO:0060765 |
regulation of androgen receptor signaling pathway(GO:0060765) |
| 0.1 |
1.1 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.1 |
0.3 |
GO:0043921 |
modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
| 0.1 |
0.4 |
GO:0060947 |
cardiac vascular smooth muscle cell differentiation(GO:0060947) |
| 0.1 |
0.4 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.1 |
0.7 |
GO:0046015 |
regulation of transcription by glucose(GO:0046015) |
| 0.1 |
7.4 |
GO:0007286 |
spermatid development(GO:0007286) |
| 0.1 |
1.3 |
GO:0090286 |
cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 |
0.5 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.1 |
0.4 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 |
1.1 |
GO:0000052 |
citrulline metabolic process(GO:0000052) |
| 0.1 |
0.5 |
GO:0002716 |
negative regulation of natural killer cell mediated immunity(GO:0002716) negative regulation of natural killer cell mediated cytotoxicity(GO:0045953) |
| 0.1 |
0.7 |
GO:0050684 |
regulation of mRNA processing(GO:0050684) |
| 0.1 |
0.3 |
GO:1903273 |
regulation of sodium ion export(GO:1903273) positive regulation of sodium ion export(GO:1903275) regulation of sodium ion export from cell(GO:1903276) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.1 |
0.1 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.1 |
0.3 |
GO:0035356 |
cellular triglyceride homeostasis(GO:0035356) |
| 0.1 |
0.4 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 |
1.4 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.1 |
0.4 |
GO:2000561 |
CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
| 0.1 |
1.6 |
GO:0044243 |
multicellular organism catabolic process(GO:0044243) |
| 0.1 |
0.4 |
GO:0006361 |
transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) transcription initiation from RNA polymerase I promoter(GO:0006361) |
| 0.1 |
0.4 |
GO:0018126 |
protein hydroxylation(GO:0018126) |
| 0.1 |
0.4 |
GO:0070508 |
sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.1 |
0.8 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.1 |
1.0 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 |
0.3 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.1 |
0.3 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.1 |
0.4 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 |
0.4 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.1 |
0.1 |
GO:0045084 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.1 |
0.4 |
GO:0035511 |
oxidative DNA demethylation(GO:0035511) |
| 0.1 |
0.1 |
GO:0030422 |
production of siRNA involved in RNA interference(GO:0030422) |
| 0.1 |
0.4 |
GO:0045040 |
protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 |
2.3 |
GO:0015936 |
coenzyme A metabolic process(GO:0015936) |
| 0.1 |
1.2 |
GO:0071356 |
cellular response to tumor necrosis factor(GO:0071356) |
| 0.1 |
0.7 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 |
0.4 |
GO:0046645 |
positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
| 0.1 |
0.4 |
GO:0071918 |
urea transmembrane transport(GO:0071918) |
| 0.1 |
0.2 |
GO:0071354 |
cellular response to interleukin-6(GO:0071354) |
| 0.1 |
0.6 |
GO:0051189 |
molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 |
2.8 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.1 |
1.1 |
GO:0046329 |
negative regulation of JNK cascade(GO:0046329) |
| 0.1 |
1.1 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) peptidyl-proline modification(GO:0018208) |
| 0.1 |
0.5 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 |
0.7 |
GO:0045792 |
negative regulation of cell size(GO:0045792) |
| 0.1 |
0.5 |
GO:0009109 |
coenzyme catabolic process(GO:0009109) |
| 0.1 |
0.4 |
GO:0017185 |
peptidyl-lysine hydroxylation(GO:0017185) |
| 0.1 |
0.5 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.1 |
0.2 |
GO:0060965 |
negative regulation of gene silencing by miRNA(GO:0060965) |
| 0.1 |
0.2 |
GO:0080111 |
DNA demethylation(GO:0080111) |
| 0.1 |
0.9 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 |
0.9 |
GO:0006855 |
drug transmembrane transport(GO:0006855) |
| 0.1 |
4.7 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.1 |
0.3 |
GO:0019732 |
antifungal humoral response(GO:0019732) antifungal innate immune response(GO:0061760) regulation of defense response to fungus(GO:1900150) regulation of antifungal innate immune response(GO:1905034) negative regulation of antifungal innate immune response(GO:1905035) |
| 0.1 |
0.1 |
GO:0061217 |
regulation of mesonephros development(GO:0061217) |
| 0.1 |
0.8 |
GO:0048661 |
positive regulation of smooth muscle cell proliferation(GO:0048661) |
| 0.1 |
0.6 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.1 |
0.2 |
GO:0097026 |
dendritic cell dendrite assembly(GO:0097026) |
| 0.1 |
0.1 |
GO:1900673 |
olefin metabolic process(GO:1900673) |
| 0.1 |
0.2 |
GO:0015675 |
nickel cation transport(GO:0015675) |
| 0.1 |
8.0 |
GO:0007059 |
chromosome segregation(GO:0007059) |
| 0.1 |
0.2 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 |
1.8 |
GO:0035195 |
gene silencing by miRNA(GO:0035195) |
| 0.1 |
1.2 |
GO:0006366 |
transcription from RNA polymerase II promoter(GO:0006366) |
| 0.1 |
0.2 |
GO:1901550 |
regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.1 |
2.1 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.1 |
0.9 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 |
0.9 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 |
0.2 |
GO:0002428 |
antigen processing and presentation of peptide antigen via MHC class Ib(GO:0002428) antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway(GO:0002488) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway, TAP-dependent(GO:0002489) positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) |
| 0.1 |
0.1 |
GO:0048619 |
embryonic hindgut morphogenesis(GO:0048619) |
| 0.1 |
0.4 |
GO:1903527 |
regulation of membrane tubulation(GO:1903525) positive regulation of membrane tubulation(GO:1903527) |
| 0.1 |
0.2 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 |
0.2 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.1 |
0.2 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.1 |
2.1 |
GO:0007566 |
embryo implantation(GO:0007566) |
| 0.1 |
1.2 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.1 |
1.3 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.1 |
4.0 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.1 |
4.9 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
0.3 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.1 |
0.4 |
GO:0050667 |
homocysteine metabolic process(GO:0050667) |
| 0.1 |
0.1 |
GO:0071838 |
cell proliferation in bone marrow(GO:0071838) |
| 0.1 |
6.8 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.1 |
0.5 |
GO:0006551 |
leucine metabolic process(GO:0006551) |
| 0.1 |
0.5 |
GO:0006515 |
misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.1 |
0.9 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.1 |
0.1 |
GO:0033690 |
positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 |
0.9 |
GO:0033327 |
Leydig cell differentiation(GO:0033327) |
| 0.1 |
0.2 |
GO:0070213 |
protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 |
0.6 |
GO:0043501 |
skeletal muscle adaptation(GO:0043501) |
| 0.1 |
0.3 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.1 |
0.5 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.1 |
0.3 |
GO:2000858 |
mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) positive regulation of mineralocorticoid secretion(GO:2000857) regulation of aldosterone secretion(GO:2000858) positive regulation of aldosterone secretion(GO:2000860) |
| 0.1 |
0.4 |
GO:0006289 |
nucleotide-excision repair(GO:0006289) |
| 0.1 |
2.1 |
GO:0045599 |
negative regulation of fat cell differentiation(GO:0045599) |
| 0.1 |
0.3 |
GO:1903846 |
positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.1 |
0.3 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 |
0.3 |
GO:0040001 |
establishment of mitotic spindle localization(GO:0040001) |
| 0.1 |
1.5 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.1 |
0.2 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.1 |
0.5 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.1 |
3.9 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.1 |
0.8 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.1 |
0.4 |
GO:0006172 |
ADP biosynthetic process(GO:0006172) |
| 0.1 |
0.3 |
GO:0046500 |
S-adenosylmethionine metabolic process(GO:0046500) |
| 0.1 |
0.2 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.1 |
0.4 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.1 |
1.2 |
GO:1902749 |
regulation of cell cycle G2/M phase transition(GO:1902749) |
| 0.1 |
0.8 |
GO:1903541 |
regulation of exosomal secretion(GO:1903541) positive regulation of exosomal secretion(GO:1903543) |
| 0.1 |
0.6 |
GO:0006691 |
leukotriene metabolic process(GO:0006691) |
| 0.1 |
0.1 |
GO:2001235 |
positive regulation of apoptotic signaling pathway(GO:2001235) |
| 0.1 |
0.3 |
GO:2000194 |
regulation of female gonad development(GO:2000194) |
| 0.1 |
0.5 |
GO:1900046 |
regulation of blood coagulation(GO:0030193) regulation of hemostasis(GO:1900046) |
| 0.1 |
0.4 |
GO:0007320 |
insemination(GO:0007320) |
| 0.1 |
1.5 |
GO:0031016 |
pancreas development(GO:0031016) |
| 0.1 |
0.2 |
GO:0006586 |
tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
| 0.1 |
1.2 |
GO:0033962 |
cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.1 |
0.2 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.1 |
1.1 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.1 |
0.2 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 |
0.7 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.1 |
0.3 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 |
1.3 |
GO:0050435 |
beta-amyloid metabolic process(GO:0050435) |
| 0.1 |
4.6 |
GO:0006073 |
glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
| 0.1 |
0.2 |
GO:0035767 |
endothelial cell chemotaxis(GO:0035767) |
| 0.1 |
0.3 |
GO:1901223 |
negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.1 |
0.2 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 0.1 |
0.1 |
GO:0042119 |
neutrophil activation(GO:0042119) |
| 0.1 |
0.1 |
GO:0010626 |
negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.1 |
0.8 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.1 |
1.9 |
GO:0034314 |
Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.1 |
0.1 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.1 |
0.1 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.1 |
1.1 |
GO:0060325 |
face morphogenesis(GO:0060325) |
| 0.1 |
0.2 |
GO:0060830 |
ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.1 |
0.1 |
GO:0043633 |
polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.1 |
0.1 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.1 |
1.4 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.1 |
0.4 |
GO:0032462 |
regulation of protein homooligomerization(GO:0032462) |
| 0.1 |
0.5 |
GO:0050901 |
leukocyte tethering or rolling(GO:0050901) |
| 0.1 |
0.3 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.1 |
0.6 |
GO:0006309 |
apoptotic DNA fragmentation(GO:0006309) |
| 0.1 |
0.8 |
GO:0010883 |
regulation of lipid storage(GO:0010883) |
| 0.1 |
0.1 |
GO:0032729 |
positive regulation of interferon-gamma production(GO:0032729) |
| 0.1 |
0.1 |
GO:2001013 |
epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 |
0.1 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 |
0.1 |
GO:1902109 |
negative regulation of mitochondrial membrane permeability(GO:0035795) negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.1 |
1.7 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.1 |
0.5 |
GO:0005976 |
polysaccharide metabolic process(GO:0005976) |
| 0.1 |
0.2 |
GO:0001193 |
maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
| 0.1 |
0.1 |
GO:0090500 |
endocardial cushion to mesenchymal transition(GO:0090500) |
| 0.1 |
0.4 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.1 |
0.2 |
GO:0034505 |
tooth mineralization(GO:0034505) |
| 0.1 |
0.2 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.1 |
2.6 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.1 |
0.5 |
GO:0090043 |
tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
| 0.1 |
0.1 |
GO:0035067 |
negative regulation of histone acetylation(GO:0035067) |
| 0.1 |
0.1 |
GO:0035523 |
protein K29-linked deubiquitination(GO:0035523) |
| 0.1 |
0.1 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.1 |
0.1 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.1 |
0.5 |
GO:0031529 |
ruffle organization(GO:0031529) |
| 0.1 |
0.1 |
GO:0035510 |
DNA dealkylation(GO:0035510) |
| 0.1 |
0.1 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 0.1 |
0.4 |
GO:0051693 |
actin filament capping(GO:0051693) |
| 0.1 |
0.1 |
GO:0090303 |
positive regulation of wound healing(GO:0090303) |
| 0.0 |
0.4 |
GO:0071542 |
dopaminergic neuron differentiation(GO:0071542) |
| 0.0 |
0.1 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 |
0.6 |
GO:0001702 |
gastrulation with mouth forming second(GO:0001702) |
| 0.0 |
0.1 |
GO:1902692 |
regulation of neuroblast proliferation(GO:1902692) |
| 0.0 |
0.1 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 |
0.5 |
GO:1903077 |
negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.0 |
0.3 |
GO:0031440 |
regulation of mRNA 3'-end processing(GO:0031440) |
| 0.0 |
0.1 |
GO:0071260 |
cellular response to mechanical stimulus(GO:0071260) |
| 0.0 |
0.2 |
GO:0045948 |
positive regulation of translational initiation(GO:0045948) |
| 0.0 |
0.2 |
GO:0070168 |
negative regulation of biomineral tissue development(GO:0070168) |
| 0.0 |
0.0 |
GO:0060192 |
negative regulation of lipase activity(GO:0060192) |
| 0.0 |
0.1 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.0 |
0.1 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.0 |
0.2 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.0 |
0.0 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 |
0.2 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.0 |
0.6 |
GO:0030838 |
positive regulation of actin filament polymerization(GO:0030838) |
| 0.0 |
0.1 |
GO:0060075 |
regulation of resting membrane potential(GO:0060075) |
| 0.0 |
0.2 |
GO:0034982 |
mitochondrial protein processing(GO:0034982) |
| 0.0 |
10.5 |
GO:0008380 |
RNA splicing(GO:0008380) |
| 0.0 |
0.1 |
GO:0010592 |
positive regulation of lamellipodium assembly(GO:0010592) |
| 0.0 |
0.1 |
GO:0046368 |
GDP-L-fucose metabolic process(GO:0046368) |
| 0.0 |
0.2 |
GO:0006560 |
proline metabolic process(GO:0006560) |
| 0.0 |
0.1 |
GO:0031062 |
positive regulation of histone methylation(GO:0031062) |
| 0.0 |
0.0 |
GO:0003100 |
regulation of systemic arterial blood pressure by endothelin(GO:0003100) vein smooth muscle contraction(GO:0014826) |
| 0.0 |
0.1 |
GO:0034219 |
carbohydrate transmembrane transport(GO:0034219) |
| 0.0 |
0.3 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.0 |
0.1 |
GO:0050892 |
intestinal absorption(GO:0050892) |
| 0.0 |
0.0 |
GO:0010869 |
regulation of receptor biosynthetic process(GO:0010869) low-density lipoprotein particle receptor biosynthetic process(GO:0045713) regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
| 0.0 |
0.3 |
GO:0030520 |
intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 |
0.5 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.0 |
0.0 |
GO:0002578 |
negative regulation of antigen processing and presentation(GO:0002578) |
| 0.0 |
0.2 |
GO:0034331 |
cell junction maintenance(GO:0034331) |
| 0.0 |
0.7 |
GO:0050688 |
regulation of defense response to virus(GO:0050688) |
| 0.0 |
0.4 |
GO:0048016 |
inositol phosphate-mediated signaling(GO:0048016) |
| 0.0 |
0.8 |
GO:0006383 |
transcription from RNA polymerase III promoter(GO:0006383) |
| 0.0 |
0.1 |
GO:0032757 |
positive regulation of interleukin-8 production(GO:0032757) |
| 0.0 |
0.1 |
GO:0050747 |
positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.0 |
1.1 |
GO:0006342 |
chromatin silencing(GO:0006342) |
| 0.0 |
0.0 |
GO:0050819 |
negative regulation of coagulation(GO:0050819) |
| 0.0 |
0.6 |
GO:0042775 |
mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
| 0.0 |
0.3 |
GO:1901841 |
regulation of high voltage-gated calcium channel activity(GO:1901841) |
| 0.0 |
0.1 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.0 |
0.1 |
GO:0006415 |
translational termination(GO:0006415) |
| 0.0 |
1.0 |
GO:0097031 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 |
0.0 |
GO:0033523 |
histone H2B ubiquitination(GO:0033523) |
| 0.0 |
0.1 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.0 |
0.4 |
GO:0045670 |
regulation of osteoclast differentiation(GO:0045670) |
| 0.0 |
0.2 |
GO:0051290 |
protein heterotetramerization(GO:0051290) |
| 0.0 |
0.2 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.0 |
0.1 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.0 |
0.1 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.0 |
0.1 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.0 |
0.0 |
GO:0070534 |
protein K63-linked ubiquitination(GO:0070534) |
| 0.0 |
0.4 |
GO:0043550 |
regulation of lipid kinase activity(GO:0043550) |
| 0.0 |
0.3 |
GO:0090090 |
negative regulation of canonical Wnt signaling pathway(GO:0090090) |
| 0.0 |
0.1 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.0 |
0.1 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 0.0 |
0.0 |
GO:0019471 |
4-hydroxyproline metabolic process(GO:0019471) |
| 0.0 |
0.4 |
GO:0045137 |
development of primary sexual characteristics(GO:0045137) |
| 0.0 |
0.0 |
GO:0036337 |
Fas signaling pathway(GO:0036337) |
| 0.0 |
0.0 |
GO:1904017 |
response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.0 |
0.1 |
GO:0045737 |
positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 |
0.0 |
GO:0019081 |
viral translation(GO:0019081) |
| 0.0 |
0.0 |
GO:0014745 |
negative regulation of cardiac muscle adaptation(GO:0010616) negative regulation of muscle adaptation(GO:0014745) |
| 0.0 |
0.1 |
GO:0035774 |
positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.0 |
0.4 |
GO:0007229 |
integrin-mediated signaling pathway(GO:0007229) |
| 0.0 |
0.0 |
GO:0090195 |
chemokine secretion(GO:0090195) regulation of chemokine secretion(GO:0090196) positive regulation of chemokine secretion(GO:0090197) |
