| 13.6 |
40.8 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 11.0 |
33.0 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 11.0 |
32.9 |
GO:0060489 |
orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 8.5 |
25.4 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 7.9 |
7.9 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 7.7 |
23.2 |
GO:0072034 |
renal vesicle induction(GO:0072034) |
| 7.1 |
28.2 |
GO:0021603 |
cranial nerve formation(GO:0021603) |
| 6.8 |
20.5 |
GO:1904395 |
positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 6.8 |
20.4 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 6.8 |
20.4 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 6.4 |
19.1 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 6.3 |
18.8 |
GO:0030421 |
defecation(GO:0030421) |
| 6.1 |
6.1 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 5.9 |
35.2 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 5.8 |
17.4 |
GO:0061075 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 5.6 |
22.6 |
GO:0021764 |
amygdala development(GO:0021764) |
| 5.6 |
16.7 |
GO:0046544 |
regulation of natural killer cell proliferation(GO:0032817) positive regulation of natural killer cell proliferation(GO:0032819) development of secondary male sexual characteristics(GO:0046544) |
| 5.4 |
21.5 |
GO:0019323 |
pentose catabolic process(GO:0019323) |
| 5.3 |
15.8 |
GO:0071163 |
DNA replication preinitiation complex assembly(GO:0071163) |
| 5.2 |
36.2 |
GO:0060838 |
lymphatic endothelial cell fate commitment(GO:0060838) |
| 5.0 |
15.1 |
GO:0044837 |
assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 5.0 |
15.0 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 4.9 |
29.5 |
GO:0003383 |
apical constriction(GO:0003383) |
| 4.8 |
14.4 |
GO:0014877 |
response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 4.7 |
4.7 |
GO:1904393 |
regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) |
| 4.6 |
23.2 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 4.5 |
13.4 |
GO:2000977 |
regulation of forebrain neuron differentiation(GO:2000977) |
| 4.4 |
13.3 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 4.4 |
22.1 |
GO:0048382 |
mesendoderm development(GO:0048382) |
| 4.3 |
17.4 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 4.2 |
21.0 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 4.2 |
4.2 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 4.1 |
12.2 |
GO:0071898 |
odontoblast differentiation(GO:0071895) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 4.1 |
12.2 |
GO:0071921 |
establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 4.0 |
20.2 |
GO:1904685 |
positive regulation of metalloendopeptidase activity(GO:1904685) |
| 4.0 |
11.9 |
GO:2000256 |
positive regulation of male germ cell proliferation(GO:2000256) |
| 3.9 |
11.6 |
GO:1900041 |
negative regulation of interleukin-2 secretion(GO:1900041) |
| 3.8 |
3.8 |
GO:0072095 |
regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 3.8 |
11.4 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 3.7 |
18.4 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 3.6 |
10.9 |
GO:0072382 |
minus-end-directed vesicle transport along microtubule(GO:0072382) |
| 3.6 |
3.6 |
GO:0046599 |
regulation of centriole replication(GO:0046599) |
| 3.6 |
14.3 |
GO:0051316 |
attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
| 3.6 |
10.7 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 3.5 |
28.3 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 3.5 |
14.1 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 3.5 |
3.5 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 3.5 |
3.5 |
GO:1904672 |
regulation of somatic stem cell population maintenance(GO:1904672) |
| 3.3 |
13.3 |
GO:0061188 |
regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 3.3 |
3.3 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 3.3 |
9.9 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 3.3 |
13.2 |
GO:2000313 |
fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 3.2 |
9.7 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 3.1 |
9.4 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 3.1 |
21.7 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 3.1 |
12.3 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 3.0 |
18.1 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 3.0 |
35.6 |
GO:0060707 |
trophoblast giant cell differentiation(GO:0060707) |
| 2.9 |
5.9 |
GO:0033278 |
cell proliferation in midbrain(GO:0033278) |
| 2.9 |
8.8 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 2.9 |
14.6 |
GO:0000022 |
mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 2.9 |
11.5 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 2.9 |
43.0 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 2.8 |
8.5 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 2.8 |
8.5 |
GO:0060853 |
arterial endothelial cell fate commitment(GO:0060844) blood vessel endothelial cell fate commitment(GO:0060846) endothelial cell fate specification(GO:0060847) Notch signaling pathway involved in arterial endothelial cell fate commitment(GO:0060853) blood vessel endothelial cell fate specification(GO:0097101) |
| 2.8 |
8.4 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 2.8 |
11.1 |
GO:0072103 |
glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 2.8 |
11.1 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 2.8 |
16.6 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 2.8 |
11.0 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 2.7 |
13.6 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 2.7 |
8.0 |
GO:1903490 |
regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 2.7 |
29.3 |
GO:0060059 |
embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 2.7 |
18.6 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 2.6 |
7.9 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 2.6 |
10.3 |
GO:2000054 |
regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 2.6 |
25.7 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 2.6 |
12.9 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 2.6 |
10.2 |
GO:0010940 |
positive regulation of necrotic cell death(GO:0010940) |
| 2.5 |
15.2 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 2.5 |
7.6 |
GO:2000158 |
positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 2.5 |
10.1 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 2.5 |
5.0 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 2.5 |
2.5 |
GO:0097237 |
cellular response to toxic substance(GO:0097237) |
| 2.5 |
7.4 |
GO:0031660 |
regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
| 2.5 |
7.4 |
GO:1904760 |
myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 2.4 |
11.8 |
GO:0002072 |
optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 2.4 |
9.5 |
GO:1902965 |
regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 2.4 |
2.4 |
GO:0032747 |
positive regulation of interleukin-23 production(GO:0032747) |
| 2.3 |
28.1 |
GO:0006930 |
substrate-dependent cell migration, cell extension(GO:0006930) |
| 2.3 |
4.7 |
GO:0014028 |
notochord formation(GO:0014028) |
| 2.3 |
2.3 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 2.3 |
7.0 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 2.3 |
6.9 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 2.3 |
6.9 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 2.3 |
6.8 |
GO:0090235 |
regulation of metaphase plate congression(GO:0090235) |
| 2.3 |
4.5 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 2.3 |
13.5 |
GO:0042535 |
positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 2.3 |
20.3 |
GO:0070874 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 2.3 |
4.5 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 2.2 |
22.5 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 2.2 |
13.3 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 2.2 |
6.7 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 2.2 |
6.6 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 2.2 |
4.4 |
GO:0007228 |
positive regulation of hh target transcription factor activity(GO:0007228) |
| 2.2 |
28.4 |
GO:0002043 |
blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 2.2 |
32.5 |
GO:0040037 |
negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 2.2 |
25.8 |
GO:0071459 |
protein localization to chromosome, centromeric region(GO:0071459) |
| 2.1 |
6.4 |
GO:0086053 |
AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 2.1 |
15.0 |
GO:0030174 |
regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 2.1 |
12.9 |
GO:0090005 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 2.1 |
8.5 |
GO:0071105 |
response to interleukin-11(GO:0071105) |
| 2.1 |
10.6 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 2.1 |
14.8 |
GO:0007440 |
foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
| 2.1 |
10.5 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 2.1 |
6.3 |
GO:2000620 |
positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 2.1 |
10.4 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 2.1 |
12.4 |
GO:1903753 |
negative regulation of p38MAPK cascade(GO:1903753) |
| 2.1 |
6.2 |
GO:0045004 |
DNA replication proofreading(GO:0045004) |
| 2.1 |
8.2 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 2.1 |
12.3 |
GO:0009786 |
regulation of asymmetric cell division(GO:0009786) |
| 2.0 |
8.2 |
GO:0045084 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 2.0 |
12.3 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 2.0 |
2.0 |
GO:0072223 |
metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
| 2.0 |
4.0 |
GO:0036518 |
chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 2.0 |
8.0 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 2.0 |
2.0 |
GO:0060298 |
positive regulation of sarcomere organization(GO:0060298) |
| 2.0 |
13.7 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 2.0 |
27.4 |
GO:0022027 |
interkinetic nuclear migration(GO:0022027) |
| 1.9 |
17.5 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 1.9 |
1.9 |
GO:0032916 |
positive regulation of transforming growth factor beta3 production(GO:0032916) |
| 1.9 |
5.8 |
GO:1902162 |
regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 1.9 |
7.7 |
GO:0030091 |
protein repair(GO:0030091) |
| 1.9 |
5.7 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 1.9 |
5.7 |
GO:0072137 |
condensed mesenchymal cell proliferation(GO:0072137) |
| 1.9 |
9.3 |
GO:0060836 |
lymphatic endothelial cell differentiation(GO:0060836) |
| 1.9 |
9.3 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 1.9 |
7.5 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 1.9 |
5.6 |
GO:0048698 |
negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 1.8 |
5.5 |
GO:1904170 |
regulation of bleb assembly(GO:1904170) |
| 1.8 |
5.5 |
GO:0072429 |
response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 1.8 |
16.3 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 1.8 |
1.8 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 1.8 |
5.4 |
GO:0046671 |
negative regulation of retinal cell programmed cell death(GO:0046671) |
| 1.8 |
12.6 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 1.8 |
7.2 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 1.8 |
21.5 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 1.8 |
8.9 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 1.8 |
5.3 |
GO:0007354 |
zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 1.8 |
1.8 |
GO:0002901 |
mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 1.8 |
3.5 |
GO:0046668 |
regulation of retinal cell programmed cell death(GO:0046668) |
| 1.7 |
7.0 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 1.7 |
6.9 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 1.7 |
5.2 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 1.7 |
3.4 |
GO:0050995 |
negative regulation of lipid catabolic process(GO:0050995) |
| 1.7 |
8.5 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 1.7 |
5.0 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 1.7 |
9.9 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 1.7 |
9.9 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 1.7 |
6.6 |
GO:0014719 |
skeletal muscle satellite cell activation(GO:0014719) |
| 1.7 |
5.0 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 1.6 |
6.6 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 1.6 |
4.9 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 1.6 |
4.9 |
GO:0097278 |
complement-dependent cytotoxicity(GO:0097278) |
| 1.6 |
4.9 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 1.6 |
4.9 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 1.6 |
4.8 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 1.6 |
11.1 |
GO:0044838 |
cell quiescence(GO:0044838) |
| 1.6 |
1.6 |
GO:0033127 |
regulation of histone phosphorylation(GO:0033127) |
| 1.6 |
18.9 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 1.6 |
4.7 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) |
| 1.6 |
4.7 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 1.6 |
15.6 |
GO:0033601 |
positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 1.5 |
26.3 |
GO:0021978 |
telencephalon regionalization(GO:0021978) |
| 1.5 |
3.1 |
GO:0035743 |
CD4-positive, alpha-beta T cell cytokine production(GO:0035743) T-helper 2 cell cytokine production(GO:0035745) |
| 1.5 |
4.6 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 1.5 |
3.1 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 1.5 |
1.5 |
GO:0048319 |
axial mesoderm morphogenesis(GO:0048319) |
| 1.5 |
4.6 |
GO:0023016 |
signal transduction by trans-phosphorylation(GO:0023016) |
| 1.5 |
6.0 |
GO:1905065 |
positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 1.5 |
4.5 |
GO:0000737 |
DNA catabolic process, endonucleolytic(GO:0000737) |
| 1.5 |
1.5 |
GO:0060423 |
foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 1.5 |
5.9 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 1.5 |
8.8 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 1.5 |
5.9 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 1.5 |
2.9 |
GO:0060023 |
soft palate development(GO:0060023) |
| 1.5 |
1.5 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 1.5 |
7.3 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 1.4 |
1.4 |
GO:0048793 |
pronephros development(GO:0048793) |
| 1.4 |
10.1 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 1.4 |
1.4 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 1.4 |
30.1 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 1.4 |
4.3 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 1.4 |
2.9 |
GO:0061511 |
centriole elongation(GO:0061511) |
| 1.4 |
7.1 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 1.4 |
2.8 |
GO:0070278 |
extracellular matrix constituent secretion(GO:0070278) |
| 1.4 |
4.2 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 1.4 |
4.2 |
GO:0070423 |
nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 1.4 |
5.6 |
GO:1903416 |
response to glycoside(GO:1903416) |
| 1.4 |
5.6 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
| 1.4 |
4.2 |
GO:1904627 |
response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 1.4 |
2.8 |
GO:0014841 |
skeletal muscle satellite cell proliferation(GO:0014841) skeletal muscle cell proliferation(GO:0014856) |
| 1.4 |
1.4 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 1.4 |
1.4 |
GO:0046533 |
regulation of photoreceptor cell differentiation(GO:0046532) negative regulation of photoreceptor cell differentiation(GO:0046533) |
| 1.4 |
5.6 |
GO:0014835 |
myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 1.4 |
2.8 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 1.4 |
4.1 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 1.4 |
5.5 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 1.4 |
11.0 |
GO:0043951 |
negative regulation of cAMP-mediated signaling(GO:0043951) |
| 1.4 |
2.7 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 1.4 |
4.1 |
GO:0030208 |
dermatan sulfate biosynthetic process(GO:0030208) |
| 1.4 |
9.5 |
GO:0060325 |
face morphogenesis(GO:0060325) |
| 1.4 |
6.8 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 1.3 |
2.7 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 1.3 |
4.0 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 1.3 |
12.0 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 1.3 |
6.6 |
GO:0045876 |
positive regulation of sister chromatid cohesion(GO:0045876) |
| 1.3 |
2.6 |
GO:0033864 |
positive regulation of NAD(P)H oxidase activity(GO:0033864) |
| 1.3 |
5.2 |
GO:1902340 |
telomeric heterochromatin assembly(GO:0031509) negative regulation of chromosome condensation(GO:1902340) |
| 1.3 |
3.9 |
GO:0006600 |
creatine metabolic process(GO:0006600) |
| 1.3 |
2.6 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 1.3 |
1.3 |
GO:0010918 |
positive regulation of mitochondrial membrane potential(GO:0010918) |
| 1.3 |
19.4 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 1.3 |
10.3 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 1.3 |
18.0 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 1.3 |
12.9 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 1.3 |
3.8 |
GO:0045819 |
plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
| 1.3 |
1.3 |
GO:1901070 |
guanosine-containing compound biosynthetic process(GO:1901070) |
| 1.3 |
35.4 |
GO:0035329 |
hippo signaling(GO:0035329) |
| 1.2 |
5.0 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 1.2 |
14.9 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 1.2 |
4.9 |
GO:0035701 |
hematopoietic stem cell migration(GO:0035701) |
| 1.2 |
3.7 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 1.2 |
2.5 |
GO:1902913 |
positive regulation of melanocyte differentiation(GO:0045636) positive regulation of developmental pigmentation(GO:0048087) positive regulation of pigment cell differentiation(GO:0050942) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 1.2 |
11.1 |
GO:0030853 |
negative regulation of granulocyte differentiation(GO:0030853) |
| 1.2 |
3.7 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 1.2 |
7.3 |
GO:1903690 |
negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 1.2 |
12.2 |
GO:0006977 |
DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 1.2 |
13.4 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 1.2 |
13.4 |
GO:0060213 |
regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 1.2 |
3.6 |
GO:1903011 |
negative regulation of bone development(GO:1903011) |
| 1.2 |
3.6 |
GO:0033326 |
cerebrospinal fluid secretion(GO:0033326) |
| 1.2 |
4.8 |
GO:0046210 |
nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) cellular organohalogen metabolic process(GO:0090345) cellular organofluorine metabolic process(GO:0090346) |
| 1.2 |
2.4 |
GO:0048016 |
inositol phosphate-mediated signaling(GO:0048016) |
| 1.2 |
4.8 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 1.2 |
3.6 |
GO:1990859 |
cellular response to endothelin(GO:1990859) |
| 1.2 |
2.4 |
GO:0000237 |
leptotene(GO:0000237) |
| 1.2 |
3.6 |
GO:0048842 |
positive regulation of axon extension involved in axon guidance(GO:0048842) |
| 1.2 |
3.5 |
GO:0051660 |
establishment of centrosome localization(GO:0051660) |
| 1.2 |
3.5 |
GO:0070346 |
positive regulation of fat cell proliferation(GO:0070346) |
| 1.2 |
4.7 |
GO:0000733 |
DNA strand renaturation(GO:0000733) |
| 1.2 |
1.2 |
GO:0006526 |
arginine biosynthetic process(GO:0006526) |
| 1.2 |
4.7 |
GO:0010510 |
regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 1.1 |
5.7 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 1.1 |
4.6 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 1.1 |
4.6 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 1.1 |
1.1 |
GO:0072069 |
DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) |
| 1.1 |
3.4 |
GO:1904245 |
regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 1.1 |
10.2 |
GO:1903672 |
positive regulation of sprouting angiogenesis(GO:1903672) |
| 1.1 |
2.3 |
GO:0070672 |
response to interleukin-15(GO:0070672) |
| 1.1 |
3.4 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 1.1 |
6.7 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 1.1 |
6.7 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 1.1 |
4.5 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 1.1 |
4.5 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 1.1 |
5.6 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 1.1 |
2.2 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 1.1 |
30.6 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 1.1 |
14.2 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 1.1 |
7.6 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 1.1 |
2.2 |
GO:0072033 |
renal vesicle formation(GO:0072033) |
| 1.1 |
1.1 |
GO:0045736 |
negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 1.1 |
3.2 |
GO:0003360 |
brainstem development(GO:0003360) |
| 1.1 |
4.3 |
GO:0010836 |
negative regulation of protein ADP-ribosylation(GO:0010836) |
| 1.1 |
2.1 |
GO:0019230 |
proprioception(GO:0019230) |
| 1.1 |
4.2 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 1.1 |
3.2 |
GO:0071699 |
olfactory placode formation(GO:0030910) lens induction in camera-type eye(GO:0060235) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 1.1 |
6.3 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 1.1 |
4.2 |
GO:0015705 |
iodide transport(GO:0015705) |
| 1.0 |
13.6 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 1.0 |
1.0 |
GO:0010825 |
positive regulation of centrosome duplication(GO:0010825) |
| 1.0 |
1.0 |
GO:2000049 |
positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 1.0 |
4.1 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 1.0 |
3.1 |
GO:2000416 |
regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
| 1.0 |
7.2 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 1.0 |
8.2 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 1.0 |
5.1 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 1.0 |
23.4 |
GO:0060236 |
regulation of mitotic spindle organization(GO:0060236) |
| 1.0 |
16.3 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 1.0 |
1.0 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) |
| 1.0 |
4.1 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 1.0 |
21.2 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 1.0 |
7.1 |
GO:0000289 |
nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 1.0 |
4.0 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 1.0 |
14.0 |
GO:0006337 |
nucleosome disassembly(GO:0006337) |
| 1.0 |
3.0 |
GO:0045950 |
negative regulation of mitotic recombination(GO:0045950) |
| 1.0 |
5.0 |
GO:0019254 |
carnitine metabolic process, CoA-linked(GO:0019254) |
| 1.0 |
16.9 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 1.0 |
2.0 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 1.0 |
4.9 |
GO:1904936 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 1.0 |
16.8 |
GO:0031297 |
replication fork processing(GO:0031297) |
| 1.0 |
8.9 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 1.0 |
5.9 |
GO:1904426 |
positive regulation of GTP binding(GO:1904426) |
| 1.0 |
6.9 |
GO:0048706 |
embryonic skeletal system development(GO:0048706) |
| 1.0 |
1.0 |
GO:0060158 |
phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 1.0 |
4.9 |
GO:1900147 |
Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 1.0 |
1.0 |
GO:0000212 |
meiotic spindle organization(GO:0000212) |
| 1.0 |
2.9 |
GO:0060070 |
canonical Wnt signaling pathway(GO:0060070) |
| 1.0 |
22.3 |
GO:0035411 |
catenin import into nucleus(GO:0035411) |
| 1.0 |
6.7 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 1.0 |
2.9 |
GO:0060903 |
positive regulation of meiosis I(GO:0060903) |
| 1.0 |
3.8 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 0.9 |
0.9 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.9 |
0.9 |
GO:0098534 |
centriole replication(GO:0007099) centriole assembly(GO:0098534) |
| 0.9 |
0.9 |
GO:0060718 |
chorionic trophoblast cell differentiation(GO:0060718) |
| 0.9 |
0.9 |
GO:0003263 |
cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) |
| 0.9 |
3.8 |
GO:0045671 |
negative regulation of osteoclast differentiation(GO:0045671) |
| 0.9 |
3.8 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.9 |
12.2 |
GO:0000052 |
citrulline metabolic process(GO:0000052) |
| 0.9 |
13.1 |
GO:0007100 |
mitotic centrosome separation(GO:0007100) |
| 0.9 |
0.9 |
GO:2000510 |
positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.9 |
5.6 |
GO:0015842 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.9 |
2.8 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.9 |
1.9 |
GO:0060971 |
embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.9 |
2.8 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.9 |
10.2 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.9 |
0.9 |
GO:0006998 |
nuclear envelope organization(GO:0006998) |
| 0.9 |
3.7 |
GO:0044565 |
dendritic cell proliferation(GO:0044565) |
| 0.9 |
8.3 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.9 |
6.4 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.9 |
7.3 |
GO:0016446 |
somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.9 |
6.3 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.9 |
6.3 |
GO:0031087 |
deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.9 |
8.1 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.9 |
2.7 |
GO:1903378 |
positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.9 |
3.6 |
GO:0002484 |
antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 0.9 |
15.2 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.9 |
5.4 |
GO:0007263 |
nitric oxide mediated signal transduction(GO:0007263) |
| 0.9 |
8.9 |
GO:0048385 |
regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 0.9 |
0.9 |
GO:0045742 |
positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
| 0.9 |
2.7 |
GO:0072182 |
regulation of nephron tubule epithelial cell differentiation(GO:0072182) |
| 0.9 |
5.3 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.9 |
14.2 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.9 |
2.6 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.9 |
7.0 |
GO:1902166 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.9 |
9.6 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.9 |
13.1 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.9 |
5.2 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.9 |
0.9 |
GO:0090204 |
protein localization to nuclear pore(GO:0090204) |
| 0.9 |
2.6 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 0.9 |
3.5 |
GO:0000415 |
negative regulation of histone H3-K36 methylation(GO:0000415) |
| 0.9 |
3.4 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.9 |
0.9 |
GO:0097421 |
liver regeneration(GO:0097421) |
| 0.9 |
6.9 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.9 |
2.6 |
GO:1903348 |
positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.9 |
1.7 |
GO:0060060 |
post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.9 |
25.6 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.9 |
4.3 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 0.8 |
11.0 |
GO:0072520 |
seminiferous tubule development(GO:0072520) |
| 0.8 |
9.3 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.8 |
3.4 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.8 |
1.7 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.8 |
0.8 |
GO:2000373 |
regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.8 |
1.7 |
GO:0051295 |
establishment of meiotic spindle localization(GO:0051295) |
| 0.8 |
1.7 |
GO:0030043 |
actin filament fragmentation(GO:0030043) |
| 0.8 |
2.5 |
GO:0038027 |
apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
| 0.8 |
1.7 |
GO:0097155 |
fasciculation of sensory neuron axon(GO:0097155) |
| 0.8 |
1.7 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.8 |
2.5 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.8 |
9.0 |
GO:0051383 |
kinetochore assembly(GO:0051382) kinetochore organization(GO:0051383) |
| 0.8 |
0.8 |
GO:0080144 |
amino acid homeostasis(GO:0080144) |
| 0.8 |
17.9 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.8 |
2.4 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.8 |
3.2 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.8 |
0.8 |
GO:0033143 |
regulation of intracellular steroid hormone receptor signaling pathway(GO:0033143) |
| 0.8 |
4.8 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.8 |
3.2 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.8 |
4.0 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.8 |
2.4 |
GO:0046356 |
acetyl-CoA catabolic process(GO:0046356) |
| 0.8 |
6.3 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.8 |
10.2 |
GO:0045724 |
positive regulation of cilium assembly(GO:0045724) |
| 0.8 |
3.1 |
GO:0033091 |
positive regulation of immature T cell proliferation(GO:0033091) |
| 0.8 |
3.1 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.8 |
3.1 |
GO:0072344 |
rescue of stalled ribosome(GO:0072344) |
| 0.8 |
3.1 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.8 |
2.3 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.8 |
6.2 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.8 |
3.1 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.8 |
11.6 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.8 |
3.1 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.8 |
6.8 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.8 |
0.8 |
GO:0032486 |
Rap protein signal transduction(GO:0032486) |
| 0.8 |
6.1 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.8 |
5.3 |
GO:0030206 |
chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.8 |
0.8 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.8 |
3.0 |
GO:0031652 |
positive regulation of heat generation(GO:0031652) |
| 0.8 |
3.0 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.8 |
0.8 |
GO:0006590 |
thyroid hormone generation(GO:0006590) |
| 0.7 |
3.0 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.7 |
0.7 |
GO:0070172 |
positive regulation of tooth mineralization(GO:0070172) |
| 0.7 |
0.7 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.7 |
7.4 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.7 |
3.7 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.7 |
1.5 |
GO:1902915 |
negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.7 |
0.7 |
GO:0001928 |
regulation of exocyst assembly(GO:0001928) |
| 0.7 |
7.3 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 0.7 |
1.5 |
GO:1903054 |
negative regulation of extracellular matrix organization(GO:1903054) |
| 0.7 |
4.3 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.7 |
0.7 |
GO:0000963 |
mitochondrial RNA processing(GO:0000963) |
| 0.7 |
3.6 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.7 |
9.3 |
GO:0007080 |
mitotic metaphase plate congression(GO:0007080) |
| 0.7 |
2.1 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.7 |
1.4 |
GO:0035672 |
regulation of cellular pH reduction(GO:0032847) oligopeptide transmembrane transport(GO:0035672) |
| 0.7 |
7.1 |
GO:0006298 |
mismatch repair(GO:0006298) |
| 0.7 |
0.7 |
GO:0006273 |
lagging strand elongation(GO:0006273) |
| 0.7 |
0.7 |
GO:0071707 |
immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
| 0.7 |
2.8 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.7 |
0.7 |
GO:0033122 |
regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.7 |
5.6 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.7 |
2.8 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) selenocysteine metabolic process(GO:0016259) |
| 0.7 |
2.1 |
GO:0090656 |
t-circle formation(GO:0090656) |
| 0.7 |
5.6 |
GO:0090205 |
positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.7 |
2.1 |
GO:0097026 |
dendritic cell dendrite assembly(GO:0097026) |
| 0.7 |
3.5 |
GO:0045974 |
miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.7 |
0.7 |
GO:2000850 |
negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.7 |
1.4 |
GO:0006014 |
D-ribose metabolic process(GO:0006014) |
| 0.7 |
2.8 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.7 |
2.8 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.7 |
1.4 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.7 |
2.1 |
GO:0051611 |
negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.7 |
2.1 |
GO:1905076 |
regulation of interleukin-17 secretion(GO:1905076) |
| 0.7 |
2.7 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.7 |
2.7 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.7 |
2.0 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.7 |
6.1 |
GO:0060340 |
positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.7 |
1.3 |
GO:0010991 |
regulation of SMAD protein complex assembly(GO:0010990) negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.7 |
3.4 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.7 |
0.7 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.7 |
2.0 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.7 |
2.7 |
GO:0035188 |
blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.7 |
2.0 |
GO:1904719 |
excitatory chemical synaptic transmission(GO:0098976) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.7 |
0.7 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.7 |
2.0 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.7 |
0.7 |
GO:1902869 |
regulation of amacrine cell differentiation(GO:1902869) |
| 0.7 |
4.0 |
GO:0046060 |
dATP metabolic process(GO:0046060) |
| 0.7 |
0.7 |
GO:0070365 |
hepatocyte differentiation(GO:0070365) |
| 0.7 |
7.9 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.7 |
2.6 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.7 |
0.7 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.7 |
1.3 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 0.7 |
10.4 |
GO:0098869 |
cellular oxidant detoxification(GO:0098869) |
| 0.6 |
4.5 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.6 |
7.8 |
GO:0045879 |
negative regulation of smoothened signaling pathway(GO:0045879) |
| 0.6 |
3.2 |
GO:0090164 |
asymmetric Golgi ribbon formation(GO:0090164) |
| 0.6 |
1.9 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.6 |
7.0 |
GO:0000244 |
spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.6 |
1.9 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.6 |
5.1 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.6 |
4.5 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.6 |
2.5 |
GO:0015744 |
succinate transport(GO:0015744) |
| 0.6 |
1.9 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.6 |
2.5 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.6 |
2.5 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.6 |
12.0 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.6 |
1.3 |
GO:0000350 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.6 |
0.6 |
GO:0034447 |
very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.6 |
1.9 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.6 |
9.4 |
GO:0097150 |
neuronal stem cell population maintenance(GO:0097150) |
| 0.6 |
2.5 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.6 |
1.3 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 0.6 |
0.6 |
GO:0043633 |
polyadenylation-dependent RNA catabolic process(GO:0043633) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.6 |
2.5 |
GO:2000680 |
regulation of rubidium ion transport(GO:2000680) |
| 0.6 |
3.1 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.6 |
1.2 |
GO:0086098 |
angiotensin-activated signaling pathway involved in heart process(GO:0086098) |
| 0.6 |
16.8 |
GO:0021591 |
ventricular system development(GO:0021591) |
| 0.6 |
3.1 |
GO:0006987 |
activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.6 |
18.0 |
GO:0034724 |
DNA replication-independent nucleosome organization(GO:0034724) |
| 0.6 |
1.2 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.6 |
3.1 |
GO:0051150 |
regulation of smooth muscle cell differentiation(GO:0051150) |
| 0.6 |
1.8 |
GO:0021781 |
glial cell fate commitment(GO:0021781) |
| 0.6 |
2.4 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.6 |
1.2 |
GO:1904706 |
negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.6 |
1.8 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.6 |
3.6 |
GO:0030913 |
paranodal junction assembly(GO:0030913) |
| 0.6 |
1.8 |
GO:0045006 |
DNA deamination(GO:0045006) |
| 0.6 |
3.0 |
GO:1902187 |
negative regulation of viral release from host cell(GO:1902187) |
| 0.6 |
1.2 |
GO:1990839 |
response to endothelin(GO:1990839) |
| 0.6 |
33.5 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.6 |
2.4 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.6 |
5.9 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.6 |
1.8 |
GO:0098974 |
postsynaptic actin cytoskeleton organization(GO:0098974) |
| 0.6 |
4.1 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.6 |
1.8 |
GO:0042097 |
interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
| 0.6 |
1.8 |
GO:2000561 |
CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.6 |
1.8 |
GO:0003338 |
metanephros morphogenesis(GO:0003338) |
| 0.6 |
2.9 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.6 |
1.8 |
GO:0035878 |
nail development(GO:0035878) |
| 0.6 |
1.8 |
GO:1902004 |
positive regulation of beta-amyloid formation(GO:1902004) |
| 0.6 |
1.2 |
GO:0021648 |
vestibulocochlear nerve morphogenesis(GO:0021648) sensory neuron axon guidance(GO:0097374) |
| 0.6 |
3.5 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.6 |
3.5 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.6 |
5.8 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.6 |
1.2 |
GO:0090289 |
regulation of osteoclast proliferation(GO:0090289) |
| 0.6 |
1.1 |
GO:0002309 |
T cell proliferation involved in immune response(GO:0002309) |
| 0.6 |
9.2 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.6 |
1.1 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.6 |
0.6 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) |
| 0.6 |
3.4 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.6 |
2.3 |
GO:0002667 |
lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.6 |
4.0 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.6 |
3.4 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.6 |
3.9 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.6 |
2.3 |
GO:0000098 |
sulfur amino acid catabolic process(GO:0000098) |
| 0.6 |
2.2 |
GO:0072272 |
proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
| 0.6 |
6.2 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.6 |
2.2 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.6 |
2.2 |
GO:0072189 |
ureter development(GO:0072189) |
| 0.6 |
3.9 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.6 |
0.6 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.6 |
4.4 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.6 |
1.7 |
GO:1903630 |
regulation of aminoacyl-tRNA ligase activity(GO:1903630) positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.6 |
4.4 |
GO:0070236 |
negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.6 |
3.3 |
GO:0036066 |
protein O-linked fucosylation(GO:0036066) |
| 0.5 |
11.5 |
GO:0035567 |
non-canonical Wnt signaling pathway(GO:0035567) |
| 0.5 |
16.4 |
GO:0007520 |
myoblast fusion(GO:0007520) |
| 0.5 |
2.2 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.5 |
1.6 |
GO:0000380 |
alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.5 |
1.1 |
GO:1901976 |
regulation of cell cycle checkpoint(GO:1901976) |
| 0.5 |
2.7 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.5 |
2.7 |
GO:0071476 |
cellular hypotonic response(GO:0071476) |
| 0.5 |
1.6 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.5 |
0.5 |
GO:0090100 |
positive regulation of transmembrane receptor protein serine/threonine kinase signaling pathway(GO:0090100) |
| 0.5 |
3.2 |
GO:0030220 |
platelet formation(GO:0030220) |
| 0.5 |
2.7 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.5 |
5.3 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.5 |
1.6 |
GO:0010838 |
positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.5 |
4.2 |
GO:0030238 |
male sex determination(GO:0030238) |
| 0.5 |
7.4 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.5 |
1.6 |
GO:0048701 |
embryonic cranial skeleton morphogenesis(GO:0048701) |
| 0.5 |
0.5 |
GO:2000319 |
negative regulation of T-helper 17 type immune response(GO:2000317) regulation of T-helper 17 cell differentiation(GO:2000319) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
| 0.5 |
2.1 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.5 |
1.6 |
GO:1903215 |
negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.5 |
1.6 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.5 |
5.7 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.5 |
1.6 |
GO:0033030 |
negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.5 |
1.0 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.5 |
2.1 |
GO:1904715 |
negative regulation of chaperone-mediated autophagy(GO:1904715) |
| 0.5 |
0.5 |
GO:0070459 |
prolactin secretion(GO:0070459) |
| 0.5 |
1.5 |
GO:0072675 |
multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.5 |
2.1 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.5 |
5.1 |
GO:1902916 |
positive regulation of protein polyubiquitination(GO:1902916) |
| 0.5 |
9.7 |
GO:2000179 |
positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.5 |
0.5 |
GO:1903960 |
negative regulation of anion transmembrane transport(GO:1903960) |
| 0.5 |
4.6 |
GO:0051353 |
positive regulation of oxidoreductase activity(GO:0051353) |
| 0.5 |
1.5 |
GO:1904569 |
regulation of selenocysteine incorporation(GO:1904569) |
| 0.5 |
7.1 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.5 |
1.5 |
GO:0008228 |
opsonization(GO:0008228) |
| 0.5 |
1.5 |
GO:2000427 |
positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.5 |
0.5 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.5 |
2.5 |
GO:0000303 |
response to superoxide(GO:0000303) |
| 0.5 |
8.5 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.5 |
1.0 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.5 |
4.0 |
GO:0086023 |
adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 0.5 |
2.5 |
GO:0010745 |
negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.5 |
0.5 |
GO:0060689 |
cell differentiation involved in salivary gland development(GO:0060689) |
| 0.5 |
2.5 |
GO:0018364 |
peptidyl-glutamine methylation(GO:0018364) |
| 0.5 |
1.0 |
GO:0086067 |
AV node cell to bundle of His cell communication(GO:0086067) |
| 0.5 |
4.4 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.5 |
1.9 |
GO:0022417 |
protein maturation by protein folding(GO:0022417) |
| 0.5 |
1.5 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.5 |
1.9 |
GO:1903288 |
positive regulation of potassium ion import(GO:1903288) |
| 0.5 |
5.3 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.5 |
1.9 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.5 |
1.5 |
GO:2000659 |
regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.5 |
1.5 |
GO:0098902 |
regulation of membrane depolarization during action potential(GO:0098902) regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.5 |
1.4 |
GO:1900048 |
positive regulation of blood coagulation(GO:0030194) positive regulation of coagulation(GO:0050820) positive regulation of hemostasis(GO:1900048) |
| 0.5 |
1.0 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.5 |
2.8 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.5 |
12.3 |
GO:0008156 |
negative regulation of DNA replication(GO:0008156) |
| 0.5 |
0.9 |
GO:0046666 |
retinal cell programmed cell death(GO:0046666) |
| 0.5 |
9.4 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.5 |
0.5 |
GO:1904729 |
regulation of intestinal lipid absorption(GO:1904729) |
| 0.5 |
0.5 |
GO:2000973 |
regulation of pro-B cell differentiation(GO:2000973) |
| 0.5 |
1.9 |
GO:1903351 |
response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
| 0.5 |
7.0 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.5 |
0.9 |
GO:0009994 |
oocyte differentiation(GO:0009994) |
| 0.5 |
0.5 |
GO:0006296 |
nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.5 |
2.3 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.5 |
2.8 |
GO:0051569 |
regulation of histone H3-K4 methylation(GO:0051569) |
| 0.5 |
0.5 |
GO:1903750 |
regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.5 |
2.3 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.5 |
2.3 |
GO:0006868 |
glutamine transport(GO:0006868) |
| 0.5 |
2.8 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.5 |
2.3 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.5 |
4.1 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.5 |
7.7 |
GO:0042178 |
xenobiotic catabolic process(GO:0042178) |
| 0.5 |
2.7 |
GO:0048102 |
autophagic cell death(GO:0048102) |
| 0.5 |
0.9 |
GO:0033484 |
nitric oxide homeostasis(GO:0033484) |
| 0.5 |
0.9 |
GO:0072048 |
pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
| 0.5 |
4.1 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.4 |
11.2 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.4 |
1.3 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.4 |
2.2 |
GO:0050860 |
negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.4 |
3.6 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.4 |
5.3 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.4 |
3.1 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.4 |
2.7 |
GO:0006560 |
proline metabolic process(GO:0006560) |
| 0.4 |
3.1 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.4 |
4.4 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.4 |
1.3 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.4 |
6.2 |
GO:0030279 |
negative regulation of ossification(GO:0030279) |
| 0.4 |
10.5 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.4 |
1.3 |
GO:0048636 |
positive regulation of striated muscle tissue development(GO:0045844) positive regulation of muscle organ development(GO:0048636) positive regulation of muscle tissue development(GO:1901863) |
| 0.4 |
0.4 |
GO:0002016 |
regulation of blood volume by renin-angiotensin(GO:0002016) brain renin-angiotensin system(GO:0002035) |
| 0.4 |
0.9 |
GO:0060008 |
Sertoli cell differentiation(GO:0060008) |
| 0.4 |
3.0 |
GO:0060068 |
vagina development(GO:0060068) |
| 0.4 |
14.3 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.4 |
1.3 |
GO:0014866 |
skeletal myofibril assembly(GO:0014866) |
| 0.4 |
1.3 |
GO:0032962 |
positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.4 |
3.8 |
GO:0080111 |
DNA demethylation(GO:0080111) |
| 0.4 |
2.1 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.4 |
1.7 |
GO:0051784 |
negative regulation of nuclear division(GO:0051784) |
| 0.4 |
3.8 |
GO:0001947 |
heart looping(GO:0001947) |
| 0.4 |
2.1 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.4 |
0.8 |
GO:0002572 |
pro-T cell differentiation(GO:0002572) |
| 0.4 |
0.8 |
GO:2000298 |
regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.4 |
4.2 |
GO:0006085 |
acetyl-CoA biosynthetic process(GO:0006085) |
| 0.4 |
4.2 |
GO:0090286 |
cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.4 |
0.8 |
GO:1901301 |
regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.4 |
6.2 |
GO:1904293 |
negative regulation of ERAD pathway(GO:1904293) |
| 0.4 |
1.2 |
GO:0030539 |
male genitalia development(GO:0030539) |
| 0.4 |
1.2 |
GO:1903896 |
positive regulation of IRE1-mediated unfolded protein response(GO:1903896) |
| 0.4 |
0.4 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.4 |
0.4 |
GO:0035562 |
negative regulation of chromatin binding(GO:0035562) |
| 0.4 |
2.9 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.4 |
1.2 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.4 |
1.2 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.4 |
0.4 |
GO:0045896 |
regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.4 |
6.9 |
GO:0001738 |
morphogenesis of a polarized epithelium(GO:0001738) |
| 0.4 |
3.7 |
GO:0034377 |
plasma lipoprotein particle assembly(GO:0034377) |
| 0.4 |
2.0 |
GO:0000454 |
snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.4 |
1.2 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.4 |
1.6 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.4 |
11.3 |
GO:0003382 |
epithelial cell morphogenesis(GO:0003382) |
| 0.4 |
2.4 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.4 |
0.4 |
GO:0010040 |
response to iron(II) ion(GO:0010040) |
| 0.4 |
1.6 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.4 |
0.4 |
GO:2000643 |
positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.4 |
0.8 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.4 |
4.4 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.4 |
2.8 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.4 |
0.4 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 0.4 |
0.4 |
GO:0009071 |
serine family amino acid catabolic process(GO:0009071) |
| 0.4 |
1.6 |
GO:0032287 |
peripheral nervous system myelin maintenance(GO:0032287) |
| 0.4 |
0.8 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.4 |
4.3 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.4 |
2.0 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.4 |
6.6 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.4 |
1.2 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 0.4 |
5.8 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.4 |
0.8 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.4 |
4.2 |
GO:0040001 |
establishment of mitotic spindle localization(GO:0040001) |
| 0.4 |
0.4 |
GO:0006404 |
RNA import into nucleus(GO:0006404) |
| 0.4 |
0.8 |
GO:0000480 |
endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.4 |
1.1 |
GO:0042275 |
error-free postreplication DNA repair(GO:0042275) |
| 0.4 |
0.8 |
GO:0044313 |
protein K6-linked deubiquitination(GO:0044313) |
| 0.4 |
1.1 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.4 |
1.1 |
GO:0090467 |
L-arginine import(GO:0043091) arginine import(GO:0090467) |
| 0.4 |
1.9 |
GO:0032485 |
regulation of Ral protein signal transduction(GO:0032485) |
| 0.4 |
0.7 |
GO:0070885 |
negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.4 |
3.7 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.4 |
1.5 |
GO:0030812 |
negative regulation of nucleotide catabolic process(GO:0030812) |
| 0.4 |
0.7 |
GO:0060453 |
regulation of gastric acid secretion(GO:0060453) |
| 0.4 |
2.6 |
GO:0036120 |
cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.4 |
0.7 |
GO:1990253 |
cellular response to leucine starvation(GO:1990253) |
| 0.4 |
5.9 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.4 |
2.2 |
GO:0030263 |
apoptotic chromosome condensation(GO:0030263) |
| 0.4 |
0.7 |
GO:0036118 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.4 |
0.7 |
GO:0006409 |
tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.4 |
0.4 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.4 |
24.1 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.4 |
1.8 |
GO:0048742 |
regulation of skeletal muscle fiber development(GO:0048742) |
| 0.4 |
2.5 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.4 |
1.4 |
GO:0046688 |
response to copper ion(GO:0046688) |
| 0.4 |
1.8 |
GO:0016078 |
tRNA catabolic process(GO:0016078) |
| 0.4 |
0.7 |
GO:0039536 |
negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.4 |
0.4 |
GO:0090303 |
positive regulation of wound healing(GO:0090303) |
| 0.4 |
4.9 |
GO:0007588 |
excretion(GO:0007588) |
| 0.4 |
0.7 |
GO:0031100 |
organ regeneration(GO:0031100) |
| 0.4 |
7.4 |
GO:2000779 |
regulation of double-strand break repair(GO:2000779) |
| 0.4 |
1.1 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.4 |
1.8 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 0.4 |
0.7 |
GO:0032202 |
telomere assembly(GO:0032202) |
| 0.3 |
1.7 |
GO:1902414 |
protein localization to cell junction(GO:1902414) |
| 0.3 |
0.3 |
GO:1901098 |
positive regulation of autophagosome maturation(GO:1901098) |
| 0.3 |
8.4 |
GO:0045737 |
positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.3 |
3.5 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.3 |
1.0 |
GO:0021631 |
optic nerve morphogenesis(GO:0021631) |
| 0.3 |
1.7 |
GO:0036159 |
inner dynein arm assembly(GO:0036159) |
| 0.3 |
0.3 |
GO:0010992 |
ubiquitin homeostasis(GO:0010992) |
| 0.3 |
11.0 |
GO:0035307 |
positive regulation of protein dephosphorylation(GO:0035307) |
| 0.3 |
0.3 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.3 |
4.1 |
GO:0018342 |
protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.3 |
0.7 |
GO:0060571 |
morphogenesis of an epithelial fold(GO:0060571) |
| 0.3 |
0.7 |
GO:1902065 |
response to L-glutamate(GO:1902065) |
| 0.3 |
1.3 |
GO:0002544 |
chronic inflammatory response(GO:0002544) |
| 0.3 |
2.3 |
GO:2000507 |
positive regulation of energy homeostasis(GO:2000507) |
| 0.3 |
0.7 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.3 |
0.3 |
GO:0031627 |
telomeric loop formation(GO:0031627) |
| 0.3 |
0.3 |
GO:0045739 |
positive regulation of DNA repair(GO:0045739) |
| 0.3 |
1.3 |
GO:0071378 |
growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.3 |
2.0 |
GO:0071257 |
cellular response to electrical stimulus(GO:0071257) |
| 0.3 |
1.3 |
GO:0035720 |
intraciliary anterograde transport(GO:0035720) |
| 0.3 |
0.7 |
GO:0035523 |
protein K29-linked deubiquitination(GO:0035523) |
| 0.3 |
2.6 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.3 |
0.6 |
GO:0035790 |
platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.3 |
1.6 |
GO:0072530 |
purine-containing compound transmembrane transport(GO:0072530) |
| 0.3 |
3.5 |
GO:0070102 |
interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.3 |
1.6 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.3 |
1.0 |
GO:0030210 |
heparin biosynthetic process(GO:0030210) |
| 0.3 |
1.3 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.3 |
0.6 |
GO:0003158 |
endothelium development(GO:0003158) |
| 0.3 |
1.3 |
GO:0031118 |
rRNA pseudouridine synthesis(GO:0031118) |
| 0.3 |
1.9 |
GO:0007140 |
male meiosis(GO:0007140) |
| 0.3 |
0.6 |
GO:0046886 |
positive regulation of hormone metabolic process(GO:0032352) positive regulation of hormone biosynthetic process(GO:0046886) |
| 0.3 |
0.6 |
GO:0032804 |
negative regulation of low-density lipoprotein particle receptor catabolic process(GO:0032804) |
| 0.3 |
1.9 |
GO:0048680 |
positive regulation of axon regeneration(GO:0048680) |
| 0.3 |
2.2 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.3 |
1.2 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.3 |
2.5 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.3 |
0.3 |
GO:1903313 |
positive regulation of mRNA metabolic process(GO:1903313) |
| 0.3 |
1.2 |
GO:0033561 |
regulation of water loss via skin(GO:0033561) establishment of skin barrier(GO:0061436) |
| 0.3 |
1.5 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.3 |
7.7 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.3 |
1.5 |
GO:0070828 |
heterochromatin organization(GO:0070828) |
| 0.3 |
0.9 |
GO:0031590 |
wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
| 0.3 |
0.9 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.3 |
2.7 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.3 |
0.6 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 0.3 |
3.9 |
GO:0046622 |
positive regulation of organ growth(GO:0046622) |
| 0.3 |
0.9 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.3 |
6.3 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.3 |
1.2 |
GO:0090521 |
glomerular visceral epithelial cell migration(GO:0090521) |
| 0.3 |
1.5 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.3 |
2.1 |
GO:0031016 |
pancreas development(GO:0031016) |
| 0.3 |
0.9 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.3 |
2.7 |
GO:0006474 |
N-terminal protein amino acid acetylation(GO:0006474) |
| 0.3 |
3.8 |
GO:0070884 |
regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.3 |
2.6 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.3 |
0.6 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.3 |
26.7 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.3 |
0.9 |
GO:0099515 |
actin filament-based transport(GO:0099515) |
| 0.3 |
1.1 |
GO:0015871 |
choline transport(GO:0015871) |
| 0.3 |
1.1 |
GO:1904263 |
positive regulation of TORC1 signaling(GO:1904263) |
| 0.3 |
0.6 |
GO:1900186 |
negative regulation of clathrin-mediated endocytosis(GO:1900186) negative regulation of tumor necrosis factor secretion(GO:1904468) negative regulation of membrane invagination(GO:1905154) |
| 0.3 |
0.9 |
GO:0017185 |
peptidyl-lysine hydroxylation(GO:0017185) |
| 0.3 |
1.4 |
GO:0040032 |
post-embryonic body morphogenesis(GO:0040032) |
| 0.3 |
2.0 |
GO:0009162 |
deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.3 |
1.7 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.3 |
3.9 |
GO:0046033 |
AMP metabolic process(GO:0046033) |
| 0.3 |
1.4 |
GO:0032957 |
inositol trisphosphate metabolic process(GO:0032957) |
| 0.3 |
8.9 |
GO:0032648 |
regulation of interferon-beta production(GO:0032648) |
| 0.3 |
3.9 |
GO:0002066 |
columnar/cuboidal epithelial cell development(GO:0002066) |
| 0.3 |
3.3 |
GO:0032967 |
positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.3 |
1.4 |
GO:0032464 |
positive regulation of protein homooligomerization(GO:0032464) |
| 0.3 |
7.2 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.3 |
0.6 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.3 |
2.2 |
GO:0010667 |
negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
| 0.3 |
1.6 |
GO:1902041 |
regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902041) |
| 0.3 |
0.3 |
GO:0051533 |
positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.3 |
1.6 |
GO:1902894 |
negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.3 |
1.9 |
GO:0045600 |
positive regulation of fat cell differentiation(GO:0045600) |
| 0.3 |
2.7 |
GO:0035584 |
calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.3 |
2.7 |
GO:1900027 |
regulation of ruffle assembly(GO:1900027) |
| 0.3 |
3.5 |
GO:0046827 |
positive regulation of protein export from nucleus(GO:0046827) |
| 0.3 |
1.3 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 0.3 |
4.8 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.3 |
0.5 |
GO:0001658 |
branching involved in ureteric bud morphogenesis(GO:0001658) |
| 0.3 |
0.3 |
GO:0070827 |
chromatin maintenance(GO:0070827) |
| 0.3 |
0.3 |
GO:1902953 |
positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.3 |
0.3 |
GO:0034140 |
negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
| 0.3 |
1.0 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.3 |
1.5 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.3 |
0.8 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) purine-containing compound salvage(GO:0043101) |
| 0.3 |
7.9 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.3 |
1.0 |
GO:1904683 |
regulation of metalloendopeptidase activity(GO:1904683) negative regulation of metalloendopeptidase activity(GO:1904684) |
| 0.3 |
1.3 |
GO:0061034 |
olfactory bulb mitral cell layer development(GO:0061034) |
| 0.3 |
1.3 |
GO:2000270 |
negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.3 |
0.8 |
GO:0097623 |
potassium ion export across plasma membrane(GO:0097623) |
| 0.2 |
2.0 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.2 |
5.9 |
GO:0035335 |
peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.2 |
0.7 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.2 |
1.5 |
GO:0001773 |
myeloid dendritic cell activation(GO:0001773) |
| 0.2 |
2.2 |
GO:0044819 |
G1 DNA damage checkpoint(GO:0044783) mitotic G1/S transition checkpoint(GO:0044819) |
| 0.2 |
0.2 |
GO:2000170 |
positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.2 |
1.0 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.2 |
1.4 |
GO:2001021 |
negative regulation of response to DNA damage stimulus(GO:2001021) |
| 0.2 |
0.7 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.2 |
3.4 |
GO:0001967 |
suckling behavior(GO:0001967) |
| 0.2 |
1.7 |
GO:0050908 |
detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.2 |
2.1 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.2 |
0.2 |
GO:0060290 |
transdifferentiation(GO:0060290) |
| 0.2 |
0.7 |
GO:0045900 |
negative regulation of translational elongation(GO:0045900) |
| 0.2 |
0.9 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.2 |
3.7 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.2 |
0.9 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.2 |
1.2 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.2 |
0.9 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.2 |
0.5 |
GO:0009146 |
purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.2 |
0.9 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.2 |
1.4 |
GO:0032483 |
regulation of Rab protein signal transduction(GO:0032483) |
| 0.2 |
0.7 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.2 |
0.5 |
GO:0031497 |
chromatin assembly(GO:0031497) |
| 0.2 |
0.4 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.2 |
1.1 |
GO:0061156 |
pulmonary artery morphogenesis(GO:0061156) |
| 0.2 |
6.5 |
GO:0033120 |
positive regulation of RNA splicing(GO:0033120) |
| 0.2 |
0.9 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.2 |
8.9 |
GO:0006342 |
chromatin silencing(GO:0006342) |
| 0.2 |
0.4 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.2 |
1.6 |
GO:0016574 |
histone ubiquitination(GO:0016574) |
| 0.2 |
0.7 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.2 |
0.7 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.2 |
1.3 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.2 |
1.5 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.2 |
0.9 |
GO:1990034 |
calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
| 0.2 |
0.7 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.2 |
0.4 |
GO:0038180 |
nerve growth factor signaling pathway(GO:0038180) |
| 0.2 |
0.7 |
GO:2000645 |
negative regulation of receptor catabolic process(GO:2000645) |
| 0.2 |
0.2 |
GO:0061687 |
detoxification of inorganic compound(GO:0061687) |
| 0.2 |
0.9 |
GO:0000160 |
phosphorelay signal transduction system(GO:0000160) |
| 0.2 |
0.6 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.2 |
0.4 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.2 |
0.6 |
GO:1900122 |
positive regulation of receptor binding(GO:1900122) |
| 0.2 |
1.1 |
GO:0070779 |
D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.2 |
1.9 |
GO:0048536 |
spleen development(GO:0048536) |
| 0.2 |
0.8 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.2 |
0.6 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 0.2 |
1.3 |
GO:0019827 |
stem cell population maintenance(GO:0019827) |
| 0.2 |
5.5 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.2 |
0.4 |
GO:2000192 |
negative regulation of fatty acid transport(GO:2000192) |
| 0.2 |
0.2 |
GO:0090241 |
negative regulation of histone H4 acetylation(GO:0090241) |
| 0.2 |
1.9 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.2 |
0.6 |
GO:0048843 |
negative regulation of axon extension involved in axon guidance(GO:0048843) |
| 0.2 |
0.4 |
GO:0021794 |
thalamus development(GO:0021794) |
| 0.2 |
22.6 |
GO:0000398 |
RNA splicing, via transesterification reactions with bulged adenosine as nucleophile(GO:0000377) mRNA splicing, via spliceosome(GO:0000398) |
| 0.2 |
0.4 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.2 |
9.0 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.2 |
0.8 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.2 |
2.0 |
GO:0051352 |
negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.2 |
0.6 |
GO:0061684 |
chaperone-mediated autophagy(GO:0061684) |
| 0.2 |
0.2 |
GO:0046851 |
negative regulation of bone resorption(GO:0045779) negative regulation of bone remodeling(GO:0046851) |
| 0.2 |
1.0 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.2 |
0.6 |
GO:1901890 |
positive regulation of cell junction assembly(GO:1901890) |
| 0.2 |
1.0 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.2 |
0.6 |
GO:0036509 |
trimming of terminal mannose on B branch(GO:0036509) |
| 0.2 |
0.6 |
GO:0098700 |
neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.2 |
0.6 |
GO:0006428 |
isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.2 |
4.8 |
GO:0043267 |
negative regulation of potassium ion transport(GO:0043267) |
| 0.2 |
0.6 |
GO:0070535 |
histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.2 |
7.8 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.2 |
1.0 |
GO:0032911 |
negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.2 |
1.1 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.2 |
0.6 |
GO:0002063 |
chondrocyte development(GO:0002063) |
| 0.2 |
1.5 |
GO:0045948 |
positive regulation of translational initiation(GO:0045948) |
| 0.2 |
2.3 |
GO:0030970 |
retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.2 |
1.5 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.2 |
0.4 |
GO:0009106 |
lipoate metabolic process(GO:0009106) |
| 0.2 |
1.1 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.2 |
0.4 |
GO:0006121 |
mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.2 |
0.4 |
GO:0018195 |
peptidyl-arginine modification(GO:0018195) |
| 0.2 |
0.5 |
GO:0032922 |
circadian regulation of gene expression(GO:0032922) |
| 0.2 |
1.1 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.2 |
0.9 |
GO:0070475 |
rRNA base methylation(GO:0070475) |
| 0.2 |
0.5 |
GO:0006106 |
fumarate metabolic process(GO:0006106) aspartate biosynthetic process(GO:0006532) aspartate catabolic process(GO:0006533) |
| 0.2 |
0.4 |
GO:0071347 |
cellular response to interleukin-1(GO:0071347) |
| 0.2 |
0.5 |
GO:0045945 |
positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.2 |
14.3 |
GO:0043484 |
regulation of RNA splicing(GO:0043484) |
| 0.2 |
1.2 |
GO:0032463 |
negative regulation of protein homooligomerization(GO:0032463) |
| 0.2 |
1.1 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.2 |
0.5 |
GO:0006669 |
sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.2 |
0.9 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.2 |
1.2 |
GO:0045599 |
negative regulation of fat cell differentiation(GO:0045599) |
| 0.2 |
0.7 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.2 |
0.7 |
GO:0043328 |
protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.2 |
11.3 |
GO:0006334 |
nucleosome assembly(GO:0006334) |
| 0.2 |
0.2 |
GO:0061371 |
determination of heart left/right asymmetry(GO:0061371) |
| 0.2 |
1.2 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 0.2 |
0.5 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.2 |
4.4 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.2 |
0.5 |
GO:0009174 |
UMP biosynthetic process(GO:0006222) pyrimidine nucleoside monophosphate metabolic process(GO:0009129) pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.2 |
1.0 |
GO:0006534 |
cysteine metabolic process(GO:0006534) |
| 0.2 |
0.5 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.2 |
2.3 |
GO:0008340 |
determination of adult lifespan(GO:0008340) |
| 0.2 |
1.5 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.2 |
1.0 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.2 |
0.3 |
GO:0031204 |
posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.2 |
0.9 |
GO:0031339 |
negative regulation of vesicle fusion(GO:0031339) |
| 0.2 |
0.3 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 0.2 |
0.2 |
GO:0071649 |
regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.2 |
0.2 |
GO:0034612 |
response to tumor necrosis factor(GO:0034612) |
| 0.2 |
0.3 |
GO:2000623 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.2 |
0.9 |
GO:0032933 |
response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.2 |
0.5 |
GO:0021854 |
hypothalamus development(GO:0021854) |
| 0.2 |
0.3 |
GO:2000018 |
regulation of male gonad development(GO:2000018) positive regulation of male gonad development(GO:2000020) |
| 0.2 |
0.3 |
GO:0042760 |
very long-chain fatty acid catabolic process(GO:0042760) |
| 0.2 |
1.2 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.1 |
3.3 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.1 |
0.4 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 |
0.3 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.1 |
2.5 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.1 |
0.4 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.1 |
0.6 |
GO:0015822 |
ornithine transport(GO:0015822) |
| 0.1 |
0.1 |
GO:0006307 |
DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 |
1.9 |
GO:0060122 |
inner ear receptor stereocilium organization(GO:0060122) |
| 0.1 |
0.4 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.1 |
3.2 |
GO:0007050 |
cell cycle arrest(GO:0007050) |
| 0.1 |
1.1 |
GO:2001273 |
regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.1 |
2.5 |
GO:0040015 |
negative regulation of multicellular organism growth(GO:0040015) |
| 0.1 |
0.5 |
GO:0070193 |
synaptonemal complex organization(GO:0070193) |
| 0.1 |
1.1 |
GO:0031440 |
regulation of mRNA 3'-end processing(GO:0031440) |
| 0.1 |
3.1 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 |
0.4 |
GO:2000543 |
cardiac cell fate specification(GO:0060912) positive regulation of gastrulation(GO:2000543) |
| 0.1 |
2.2 |
GO:0043149 |
contractile actin filament bundle assembly(GO:0030038) stress fiber assembly(GO:0043149) |
| 0.1 |
0.4 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 |
1.6 |
GO:0071712 |
ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.1 |
0.7 |
GO:0007044 |
cell-substrate junction assembly(GO:0007044) |
| 0.1 |
1.9 |
GO:0001841 |
neural tube formation(GO:0001841) |
| 0.1 |
0.1 |
GO:0090148 |
membrane fission(GO:0090148) |
| 0.1 |
0.1 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 0.1 |
0.1 |
GO:0071351 |
interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
| 0.1 |
0.3 |
GO:0042637 |
catagen(GO:0042637) |
| 0.1 |
3.5 |
GO:0071479 |
cellular response to ionizing radiation(GO:0071479) |
| 0.1 |
0.6 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 |
0.3 |
GO:0030321 |
transepithelial chloride transport(GO:0030321) |
| 0.1 |
0.5 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.1 |
0.6 |
GO:0098706 |
ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.1 |
0.4 |
GO:0098734 |
protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.1 |
0.6 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.1 |
0.2 |
GO:0009584 |
detection of visible light(GO:0009584) |
| 0.1 |
0.7 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.1 |
0.4 |
GO:0098543 |
detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.1 |
0.6 |
GO:0061037 |
negative regulation of cartilage development(GO:0061037) |
| 0.1 |
0.1 |
GO:0000414 |
regulation of histone H3-K36 methylation(GO:0000414) |
| 0.1 |
1.3 |
GO:0006515 |
misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.1 |
0.4 |
GO:0051503 |
adenine nucleotide transport(GO:0051503) |
| 0.1 |
4.6 |
GO:0007059 |
chromosome segregation(GO:0007059) |
| 0.1 |
0.9 |
GO:0070072 |
vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 |
0.2 |
GO:0010890 |
positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.1 |
0.5 |
GO:0009249 |
protein lipoylation(GO:0009249) |
| 0.1 |
0.2 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 |
0.6 |
GO:0045048 |
protein insertion into ER membrane(GO:0045048) |
| 0.1 |
0.1 |
GO:0006701 |
progesterone biosynthetic process(GO:0006701) |
| 0.1 |
1.2 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.1 |
0.1 |
GO:0045815 |
positive regulation of gene expression, epigenetic(GO:0045815) |
| 0.1 |
0.6 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.1 |
0.4 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 |
0.6 |
GO:0090199 |
regulation of release of cytochrome c from mitochondria(GO:0090199) |
| 0.1 |
0.1 |
GO:0031017 |
exocrine pancreas development(GO:0031017) |
| 0.1 |
0.6 |
GO:0045992 |
negative regulation of embryonic development(GO:0045992) |
| 0.1 |
0.5 |
GO:0090070 |
positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.1 |
2.4 |
GO:0010761 |
fibroblast migration(GO:0010761) |
| 0.1 |
3.9 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.1 |
0.5 |
GO:0023021 |
termination of signal transduction(GO:0023021) termination of G-protein coupled receptor signaling pathway(GO:0038032) |
| 0.1 |
0.1 |
GO:0035973 |
aggrephagy(GO:0035973) |
| 0.1 |
1.2 |
GO:0009083 |
branched-chain amino acid catabolic process(GO:0009083) |
| 0.1 |
0.3 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 |
0.2 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.1 |
0.2 |
GO:0043921 |
modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
| 0.1 |
0.3 |
GO:1905146 |
protein catabolic process in the vacuole(GO:0007039) lysosomal protein catabolic process(GO:1905146) |
| 0.1 |
0.2 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.1 |
0.6 |
GO:0021859 |
pyramidal neuron differentiation(GO:0021859) |
| 0.1 |
1.5 |
GO:0009410 |
response to xenobiotic stimulus(GO:0009410) |
| 0.1 |
3.5 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.1 |
0.3 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 |
0.2 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.1 |
0.9 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.1 |
0.1 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.1 |
0.2 |
GO:0071286 |
cellular response to magnesium ion(GO:0071286) |
| 0.1 |
0.4 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 |
0.2 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.1 |
1.1 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.1 |
0.4 |
GO:0061084 |
regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) negative regulation of protein folding(GO:1903333) |
| 0.1 |
0.4 |
GO:0060055 |
angiogenesis involved in wound healing(GO:0060055) |
| 0.1 |
0.3 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 |
0.5 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 |
1.3 |
GO:0006493 |
protein O-linked glycosylation(GO:0006493) |
| 0.1 |
1.0 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.1 |
0.4 |
GO:0045840 |
positive regulation of mitotic nuclear division(GO:0045840) |
| 0.1 |
0.1 |
GO:0061470 |
T follicular helper cell differentiation(GO:0061470) |
| 0.1 |
0.4 |
GO:0032049 |
cardiolipin biosynthetic process(GO:0032049) |
| 0.1 |
0.5 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.1 |
0.1 |
GO:0000966 |
RNA 5'-end processing(GO:0000966) |
| 0.1 |
0.3 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.1 |
0.3 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 |
0.8 |
GO:0014003 |
oligodendrocyte development(GO:0014003) |
| 0.1 |
0.4 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.1 |
0.1 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.1 |
0.7 |
GO:0019363 |
pyridine nucleotide biosynthetic process(GO:0019363) |
| 0.1 |
0.2 |
GO:0001865 |
NK T cell differentiation(GO:0001865) regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.1 |
0.3 |
GO:0080184 |
response to stilbenoid(GO:0035634) response to phenylpropanoid(GO:0080184) |
| 0.1 |
0.2 |
GO:0043631 |
mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
| 0.1 |
0.3 |
GO:0043392 |
negative regulation of DNA binding(GO:0043392) |
| 0.1 |
0.3 |
GO:1990022 |
RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.1 |
2.4 |
GO:0006513 |
protein monoubiquitination(GO:0006513) |
| 0.1 |
0.1 |
GO:0042771 |
intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.1 |
0.6 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.1 |
3.8 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.1 |
0.1 |
GO:0001504 |
neurotransmitter uptake(GO:0001504) |
| 0.1 |
0.4 |
GO:0090201 |
negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.1 |
0.3 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 |
0.5 |
GO:0019915 |
lipid storage(GO:0019915) |
| 0.1 |
0.2 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.1 |
0.3 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 |
0.3 |
GO:0051657 |
maintenance of organelle location(GO:0051657) |
| 0.1 |
1.7 |
GO:1902749 |
regulation of cell cycle G2/M phase transition(GO:1902749) |
| 0.1 |
0.2 |
GO:0002374 |
cytokine secretion involved in immune response(GO:0002374) regulation of cytokine secretion involved in immune response(GO:0002739) |
| 0.1 |
0.2 |
GO:0033147 |
negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.1 |
0.4 |
GO:0006265 |
DNA topological change(GO:0006265) |
| 0.1 |
0.5 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.1 |
0.6 |
GO:0009209 |
pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) |
| 0.1 |
0.1 |
GO:0042558 |
pteridine-containing compound metabolic process(GO:0042558) |
| 0.1 |
0.3 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 |
0.2 |
GO:0070162 |
adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 |
1.9 |
GO:0005978 |
glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.0 |
0.1 |
GO:0030825 |
positive regulation of cGMP metabolic process(GO:0030825) positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.0 |
0.4 |
GO:0060425 |
lung morphogenesis(GO:0060425) |
| 0.0 |
0.5 |
GO:0031987 |
locomotion involved in locomotory behavior(GO:0031987) |
| 0.0 |
0.2 |
GO:0030813 |
positive regulation of nucleotide catabolic process(GO:0030813) positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.0 |
0.0 |
GO:1990564 |
protein ufmylation(GO:0071569) protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 |
0.2 |
GO:0044030 |
regulation of DNA methylation(GO:0044030) |
| 0.0 |
0.1 |
GO:0046016 |
positive regulation of transcription by glucose(GO:0046016) |
| 0.0 |
0.3 |
GO:0060979 |
vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.0 |
0.4 |
GO:0006754 |
ATP biosynthetic process(GO:0006754) |
| 0.0 |
0.4 |
GO:0006730 |
one-carbon metabolic process(GO:0006730) |
| 0.0 |
0.1 |
GO:0045579 |
positive regulation of B cell differentiation(GO:0045579) |
| 0.0 |
0.1 |
GO:0006030 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 |
0.6 |
GO:0000187 |
activation of MAPK activity(GO:0000187) |
| 0.0 |
0.1 |
GO:0044130 |
negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.0 |
0.2 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.0 |
0.2 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.0 |
0.1 |
GO:0050651 |
dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.0 |
0.2 |
GO:0019400 |
alditol metabolic process(GO:0019400) |
| 0.0 |
0.1 |
GO:0016479 |
negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.0 |
0.0 |
GO:0034773 |
histone H4-K20 trimethylation(GO:0034773) |
| 0.0 |
0.1 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 |
0.1 |
GO:0060349 |
bone morphogenesis(GO:0060349) |
| 0.0 |
0.1 |
GO:0007258 |
JUN phosphorylation(GO:0007258) |
| 0.0 |
0.1 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 |
0.3 |
GO:0007281 |
germ cell development(GO:0007281) |
| 0.0 |
0.3 |
GO:0060135 |
maternal process involved in female pregnancy(GO:0060135) |
| 0.0 |
0.1 |
GO:0051642 |
centrosome localization(GO:0051642) |
| 0.0 |
0.2 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.0 |
0.4 |
GO:0031290 |
retinal ganglion cell axon guidance(GO:0031290) |
| 0.0 |
0.0 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 0.0 |
0.1 |
GO:0034382 |
chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.0 |
0.2 |
GO:0034142 |
toll-like receptor 4 signaling pathway(GO:0034142) |
| 0.0 |
0.1 |
GO:0034113 |
heterotypic cell-cell adhesion(GO:0034113) |
| 0.0 |
1.5 |
GO:0001578 |
microtubule bundle formation(GO:0001578) |
| 0.0 |
0.1 |
GO:0072176 |
nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
| 0.0 |
0.2 |
GO:0009048 |
dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 |
0.2 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 |
0.2 |
GO:0061635 |
regulation of protein complex stability(GO:0061635) |
| 0.0 |
0.0 |
GO:1903564 |
regulation of protein localization to cilium(GO:1903564) |
| 0.0 |
0.1 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 |
0.1 |
GO:0001302 |
replicative cell aging(GO:0001302) |
| 0.0 |
0.1 |
GO:0048747 |
muscle fiber development(GO:0048747) |
| 0.0 |
0.5 |
GO:0071346 |
cellular response to interferon-gamma(GO:0071346) |
| 0.0 |
0.0 |
GO:0015817 |
histidine transport(GO:0015817) |
| 0.0 |
0.3 |
GO:0060351 |
cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.0 |
0.1 |
GO:0040019 |
positive regulation of embryonic development(GO:0040019) |
| 0.0 |
0.0 |
GO:0035106 |
operant conditioning(GO:0035106) |
| 0.0 |
0.2 |
GO:0006289 |
nucleotide-excision repair(GO:0006289) |
| 0.0 |
0.6 |
GO:0016126 |
sterol biosynthetic process(GO:0016126) |
| 0.0 |
0.1 |
GO:2000483 |
negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.0 |
0.2 |
GO:1900026 |
positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
| 0.0 |
0.1 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |