Motif ID: Smad4
Z-value: 1.434
Transcription factors associated with Smad4:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Smad4 | ENSMUSG00000024515.7 | Smad4 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Smad4 | mm10_v2_chr18_-_73703739_73703806 | 0.16 | 2.4e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.4 | 13.3 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 4.3 | 30.3 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 3.9 | 19.5 | GO:0021764 | amygdala development(GO:0021764) |
| 3.2 | 9.7 | GO:1902460 | transforming growth factor beta activation(GO:0036363) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 2.8 | 14.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 2.5 | 15.3 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
| 2.5 | 10.1 | GO:0015889 | cobalamin transport(GO:0015889) |
| 2.1 | 6.3 | GO:0060023 | soft palate development(GO:0060023) |
| 2.1 | 14.6 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 2.0 | 8.0 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 1.7 | 8.6 | GO:0060849 | regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 1.7 | 31.6 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 1.6 | 4.8 | GO:1905203 | regulation of connective tissue replacement(GO:1905203) |
| 1.5 | 13.7 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
| 1.1 | 5.6 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 1.1 | 25.4 | GO:0048368 | lateral mesoderm development(GO:0048368) |
| 1.1 | 5.5 | GO:0019230 | proprioception(GO:0019230) |
| 1.0 | 5.2 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.9 | 2.6 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.8 | 2.5 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.8 | 9.8 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.7 | 2.0 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.7 | 4.1 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.7 | 16.7 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.7 | 4.6 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.6 | 8.9 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
| 0.6 | 1.7 | GO:0031660 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.5 | 2.6 | GO:1904672 | regulation of somatic stem cell population maintenance(GO:1904672) |
| 0.5 | 2.0 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.5 | 1.4 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 0.4 | 1.3 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.4 | 2.0 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.4 | 2.7 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.4 | 5.0 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.3 | 1.4 | GO:0055071 | cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
| 0.3 | 0.9 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.3 | 6.6 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.3 | 0.8 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.3 | 1.6 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.3 | 11.9 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.3 | 2.8 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.2 | 1.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.2 | 3.4 | GO:0001711 | endodermal cell fate commitment(GO:0001711) |
| 0.2 | 1.1 | GO:0002339 | B cell selection(GO:0002339) |
| 0.2 | 2.0 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.2 | 0.4 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.2 | 2.3 | GO:0072189 | ureter development(GO:0072189) |
| 0.2 | 4.1 | GO:0031295 | lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
| 0.2 | 0.8 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.2 | 2.2 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.2 | 3.1 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
| 0.2 | 4.9 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.2 | 2.2 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.2 | 1.5 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.1 | 2.3 | GO:0036120 | cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.1 | 4.1 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.1 | 2.1 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.1 | 8.5 | GO:0002066 | columnar/cuboidal epithelial cell development(GO:0002066) |
| 0.1 | 0.9 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.1 | 1.4 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.1 | 1.7 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.1 | 2.3 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.6 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 | 0.3 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.1 | 0.5 | GO:0014005 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.1 | 0.9 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.1 | 3.1 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.1 | 5.1 | GO:1901998 | toxin transport(GO:1901998) |
| 0.1 | 2.8 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.1 | 2.3 | GO:0033622 | integrin activation(GO:0033622) |
| 0.1 | 5.7 | GO:0030279 | negative regulation of ossification(GO:0030279) |
| 0.1 | 0.6 | GO:0051461 | protein import into peroxisome matrix, docking(GO:0016560) regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.1 | 1.0 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.1 | 0.2 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.1 | 0.6 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.1 | 0.6 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.1 | 7.4 | GO:0021954 | central nervous system neuron development(GO:0021954) |
| 0.1 | 0.6 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.1 | 5.4 | GO:0006342 | chromatin silencing(GO:0006342) |
| 0.1 | 0.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.1 | 2.2 | GO:0010972 | negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) negative regulation of cell cycle G2/M phase transition(GO:1902750) |
| 0.1 | 1.7 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 1.3 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.5 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.0 | 4.2 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.0 | 3.8 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 3.2 | GO:0031110 | regulation of microtubule polymerization or depolymerization(GO:0031110) |
| 0.0 | 2.1 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 2.2 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.0 | 1.9 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 2.3 | GO:0070507 | regulation of microtubule cytoskeleton organization(GO:0070507) |
| 0.0 | 1.3 | GO:0003341 | cilium movement(GO:0003341) |
| 0.0 | 0.4 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.0 | 0.9 | GO:0048146 | positive regulation of fibroblast proliferation(GO:0048146) |
| 0.0 | 0.6 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
| 0.0 | 0.8 | GO:0018105 | peptidyl-serine phosphorylation(GO:0018105) |
| 0.0 | 0.4 | GO:0050731 | positive regulation of peptidyl-tyrosine phosphorylation(GO:0050731) |
| 0.0 | 1.8 | GO:0007283 | spermatogenesis(GO:0007283) male gamete generation(GO:0048232) |
| 0.0 | 2.6 | GO:0001701 | in utero embryonic development(GO:0001701) |
| 0.0 | 1.1 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
| 0.0 | 1.9 | GO:0043087 | regulation of GTPase activity(GO:0043087) |
| 0.0 | 5.2 | GO:0007264 | small GTPase mediated signal transduction(GO:0007264) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 8.5 | 25.4 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 5.6 | 16.7 | GO:0038045 | large latent transforming growth factor-beta complex(GO:0038045) |
| 0.9 | 5.2 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.8 | 2.5 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.8 | 8.9 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.7 | 22.3 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.6 | 24.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.6 | 13.4 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.6 | 1.7 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.5 | 6.9 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.5 | 3.8 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.4 | 9.1 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
| 0.3 | 3.4 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.3 | 12.3 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.3 | 12.0 | GO:0000786 | nucleosome(GO:0000786) |
| 0.2 | 0.6 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.2 | 2.9 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.1 | 0.6 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.1 | 2.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 2.3 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 14.6 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 1.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.1 | 2.0 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.1 | 1.3 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.1 | 1.6 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 2.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.1 | 2.0 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 1.2 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 0.4 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.1 | 1.0 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 7.4 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.0 | 0.6 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 8.7 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
| 0.0 | 0.7 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 18.8 | GO:0005874 | microtubule(GO:0005874) |
| 0.0 | 17.4 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 2.8 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 5.7 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 1.9 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.5 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 8.5 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 1.1 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 5.9 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 1.3 | GO:0005930 | axoneme(GO:0005930) |
| 0.0 | 2.0 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.4 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 5.8 | GO:0016604 | nuclear body(GO:0016604) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.4 | 17.7 | GO:0050436 | microfibril binding(GO:0050436) |
| 4.4 | 13.3 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 4.3 | 30.3 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 1.9 | 13.6 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 1.4 | 10.1 | GO:0031419 | cobalamin binding(GO:0031419) |
| 1.3 | 25.4 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 1.1 | 14.6 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 1.1 | 14.2 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 1.0 | 3.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.9 | 11.9 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.7 | 12.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.6 | 9.8 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.6 | 2.8 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
| 0.5 | 5.0 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.4 | 9.8 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.4 | 9.7 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.4 | 6.6 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.3 | 1.4 | GO:0015410 | manganese-transporting ATPase activity(GO:0015410) |
| 0.3 | 19.5 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.3 | 1.8 | GO:0043426 | MRF binding(GO:0043426) |
| 0.3 | 5.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.3 | 4.9 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.3 | 4.1 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.3 | 9.0 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.2 | 0.9 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.2 | 9.4 | GO:0070888 | E-box binding(GO:0070888) |
| 0.2 | 2.2 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.2 | 2.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.2 | 1.7 | GO:0031432 | titin binding(GO:0031432) |
| 0.2 | 4.5 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.2 | 1.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.1 | 3.5 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 31.5 | GO:0042393 | histone binding(GO:0042393) |
| 0.1 | 7.2 | GO:0019955 | cytokine binding(GO:0019955) |
| 0.1 | 0.6 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 1.1 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 5.0 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.1 | 5.5 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 0.6 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.1 | 2.7 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 3.4 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 0.8 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.1 | 1.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.1 | 2.0 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.1 | 1.7 | GO:0051861 | glycolipid binding(GO:0051861) |
| 0.1 | 1.5 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.1 | 6.6 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.1 | 0.2 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.1 | 2.5 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.1 | 1.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 2.2 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.1 | 11.9 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.1 | 0.6 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 1.4 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.0 | 1.4 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 13.0 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.0 | 5.1 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.0 | 2.2 | GO:0044325 | ion channel binding(GO:0044325) |
| 0.0 | 0.7 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.3 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 0.0 | 6.4 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 2.0 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 1.4 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
| 0.0 | 1.3 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 5.8 | GO:0005085 | guanyl-nucleotide exchange factor activity(GO:0005085) |
| 0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 4.1 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 1.2 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 2.8 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.0 | 5.3 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.0 | 7.9 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 5.2 | PID_TCR_JNK_PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.3 | 6.2 | PID_INTEGRIN_CS_PATHWAY | Integrin family cell surface interactions |
| 0.3 | 14.5 | PID_AURORA_B_PATHWAY | Aurora B signaling |
| 0.3 | 7.9 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
| 0.2 | 11.0 | PID_HNF3A_PATHWAY | FOXA1 transcription factor network |
| 0.2 | 27.4 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.2 | 6.5 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
| 0.2 | 8.0 | PID_BMP_PATHWAY | BMP receptor signaling |
| 0.2 | 4.5 | PID_ALK1_PATHWAY | ALK1 signaling events |
| 0.2 | 5.6 | PID_RXR_VDR_PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 4.8 | PID_AMB2_NEUTROPHILS_PATHWAY | amb2 Integrin signaling |
| 0.1 | 9.9 | PID_RAC1_REG_PATHWAY | Regulation of RAC1 activity |
| 0.1 | 4.8 | NABA_COLLAGENS | Genes encoding collagen proteins |
| 0.1 | 9.8 | PID_AR_PATHWAY | Coregulation of Androgen receptor activity |
| 0.1 | 1.8 | PID_CIRCADIAN_PATHWAY | Circadian rhythm pathway |
| 0.1 | 4.1 | PID_RHOA_REG_PATHWAY | Regulation of RhoA activity |
| 0.1 | 1.2 | PID_LPA4_PATHWAY | LPA4-mediated signaling events |
| 0.1 | 6.6 | PID_BETA_CATENIN_NUC_PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.1 | 2.8 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.1 | 2.8 | PID_HES_HEY_PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 3.5 | ST_FAS_SIGNALING_PATHWAY | Fas Signaling Pathway |
| 0.0 | 2.0 | PID_ILK_PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 4.9 | NABA_SECRETED_FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 1.6 | PID_P75_NTR_PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 0.6 | PID_RB_1PATHWAY | Regulation of retinoblastoma protein |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.3 | 30.3 | REACTOME_GABA_SYNTHESIS_RELEASE_REUPTAKE_AND_DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 1.2 | 13.3 | REACTOME_PURINE_CATABOLISM | Genes involved in Purine catabolism |
| 1.0 | 31.0 | REACTOME_YAP1_AND_WWTR1_TAZ_STIMULATED_GENE_EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.8 | 29.4 | REACTOME_PACKAGING_OF_TELOMERE_ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.5 | 14.1 | REACTOME_KINESINS | Genes involved in Kinesins |
| 0.5 | 31.4 | REACTOME_NUCLEAR_RECEPTOR_TRANSCRIPTION_PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.4 | 5.2 | REACTOME_ACTIVATION_OF_THE_AP1_FAMILY_OF_TRANSCRIPTION_FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.3 | 8.0 | REACTOME_SIGNALING_BY_BMP | Genes involved in Signaling by BMP |
| 0.3 | 4.8 | REACTOME_ADVANCED_GLYCOSYLATION_ENDPRODUCT_RECEPTOR_SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.3 | 9.8 | REACTOME_DOWNREGULATION_OF_SMAD2_3_SMAD4_TRANSCRIPTIONAL_ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.2 | 2.8 | REACTOME_NOTCH_HLH_TRANSCRIPTION_PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.1 | 2.8 | REACTOME_DESTABILIZATION_OF_MRNA_BY_TRISTETRAPROLIN_TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 2.3 | REACTOME_PECAM1_INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.1 | 8.6 | REACTOME_TRANSCRIPTIONAL_REGULATION_OF_WHITE_ADIPOCYTE_DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.1 | 3.1 | REACTOME_CELL_DEATH_SIGNALLING_VIA_NRAGE_NRIF_AND_NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.1 | 1.8 | REACTOME_BMAL1_CLOCK_NPAS2_ACTIVATES_CIRCADIAN_EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.1 | 0.6 | REACTOME_RNA_POL_I_PROMOTER_OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.1 | 1.2 | REACTOME_ADENYLATE_CYCLASE_ACTIVATING_PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.1 | 2.1 | REACTOME_CREB_PHOSPHORYLATION_THROUGH_THE_ACTIVATION_OF_CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.1 | 4.8 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
| 0.1 | 6.2 | REACTOME_CELL_SURFACE_INTERACTIONS_AT_THE_VASCULAR_WALL | Genes involved in Cell surface interactions at the vascular wall |
| 0.1 | 1.3 | REACTOME_SYNTHESIS_OF_SUBSTRATES_IN_N_GLYCAN_BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 1.3 | REACTOME_FORMATION_OF_ATP_BY_CHEMIOSMOTIC_COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 0.6 | REACTOME_GAP_JUNCTION_ASSEMBLY | Genes involved in Gap junction assembly |
| 0.1 | 5.2 | REACTOME_FACTORS_INVOLVED_IN_MEGAKARYOCYTE_DEVELOPMENT_AND_PLATELET_PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.1 | 8.8 | REACTOME_SIGNALING_BY_RHO_GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 1.7 | REACTOME_MEIOTIC_SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.0 | 0.3 | REACTOME_NA_CL_DEPENDENT_NEUROTRANSMITTER_TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 1.4 | REACTOME_ION_TRANSPORT_BY_P_TYPE_ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 5.0 | REACTOME_G_ALPHA_I_SIGNALLING_EVENTS | Genes involved in G alpha (i) signalling events |
| 0.0 | 2.0 | REACTOME_FORMATION_OF_THE_TERNARY_COMPLEX_AND_SUBSEQUENTLY_THE_43S_COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 2.2 | REACTOME_PEPTIDE_CHAIN_ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.8 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.2 | REACTOME_SIGNALING_BY_ACTIVATED_POINT_MUTANTS_OF_FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.0 | 0.7 | REACTOME_MRNA_SPLICING_MINOR_PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.7 | REACTOME_CDK_MEDIATED_PHOSPHORYLATION_AND_REMOVAL_OF_CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
| 0.0 | 0.4 | REACTOME_SMOOTH_MUSCLE_CONTRACTION | Genes involved in Smooth Muscle Contraction |
