Motif ID: Sox14
Z-value: 0.982
Transcription factors associated with Sox14:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Sox14 | ENSMUSG00000053747.8 | Sox14 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Sox14 | mm10_v2_chr9_-_99876147_99876193 | -0.27 | 4.7e-02 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.4 | 4.3 | GO:0042560 | 10-formyltetrahydrofolate catabolic process(GO:0009258) folic acid-containing compound catabolic process(GO:0009397) pteridine-containing compound catabolic process(GO:0042560) |
| 1.3 | 5.0 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 1.0 | 3.1 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.9 | 2.7 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.8 | 2.5 | GO:0030070 | insulin processing(GO:0030070) |
| 0.8 | 3.1 | GO:0031161 | phosphatidylinositol catabolic process(GO:0031161) |
| 0.7 | 4.3 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.7 | 3.9 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.6 | 1.9 | GO:0015882 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.6 | 1.8 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) |
| 0.6 | 6.5 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
| 0.6 | 2.9 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
| 0.5 | 3.5 | GO:0061092 | involuntary skeletal muscle contraction(GO:0003011) regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.5 | 2.5 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.5 | 1.5 | GO:1902022 | L-lysine transport(GO:1902022) |
| 0.5 | 1.9 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.5 | 1.4 | GO:0060912 | cardiac cell fate specification(GO:0060912) |
| 0.5 | 1.4 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.4 | 1.8 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.4 | 2.2 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.4 | 4.3 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.4 | 1.7 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 0.4 | 10.6 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.4 | 1.5 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
| 0.4 | 1.1 | GO:0002182 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.4 | 4.6 | GO:1901898 | negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 0.3 | 4.8 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.3 | 2.3 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.3 | 0.9 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.3 | 0.9 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.3 | 3.4 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.3 | 0.9 | GO:1900369 | negative regulation of RNA interference(GO:1900369) |
| 0.3 | 0.9 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
| 0.3 | 2.5 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
| 0.3 | 3.2 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.3 | 1.0 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.2 | 2.0 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.2 | 1.0 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.2 | 5.6 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.2 | 2.2 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
| 0.2 | 1.0 | GO:2000110 | protein sialylation(GO:1990743) negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.2 | 3.5 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) |
| 0.2 | 0.9 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.2 | 2.7 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.2 | 1.0 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.2 | 1.2 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.2 | 1.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.2 | 0.6 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.2 | 0.7 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.2 | 0.5 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.2 | 1.2 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.2 | 0.7 | GO:0070197 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.2 | 1.6 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.2 | 0.9 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.1 | 1.0 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.1 | 2.4 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.1 | 2.6 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.1 | 1.0 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.1 | 0.7 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.1 | 0.8 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.1 | 1.0 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 1.4 | GO:0032274 | gonadotropin secretion(GO:0032274) |
| 0.1 | 1.0 | GO:0051461 | protein import into peroxisome matrix, docking(GO:0016560) regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.1 | 1.1 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.1 | 1.7 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.1 | 1.0 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.1 | 0.7 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.1 | 0.6 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.1 | 0.2 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.1 | 2.3 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.1 | 0.7 | GO:0070494 | regulation of thrombin receptor signaling pathway(GO:0070494) negative regulation of thrombin receptor signaling pathway(GO:0070495) |
| 0.1 | 0.4 | GO:0015825 | L-serine transport(GO:0015825) |
| 0.1 | 0.5 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 1.4 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.1 | 0.3 | GO:0071313 | cellular response to caffeine(GO:0071313) |
| 0.1 | 0.5 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 | 1.9 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.1 | 17.8 | GO:0008360 | regulation of cell shape(GO:0008360) |
| 0.1 | 0.4 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 | 0.3 | GO:1904154 | trimming of terminal mannose on B branch(GO:0036509) positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 | 2.2 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.1 | 0.6 | GO:0032570 | response to progesterone(GO:0032570) |
| 0.1 | 0.1 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.1 | 1.5 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.1 | 0.2 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.1 | 1.0 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.1 | 1.7 | GO:0022401 | desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) |
| 0.1 | 4.2 | GO:0032410 | negative regulation of transporter activity(GO:0032410) |
| 0.1 | 0.8 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.1 | 1.7 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.1 | 3.7 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.1 | 0.5 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
| 0.1 | 1.3 | GO:0007097 | nuclear migration(GO:0007097) establishment of nucleus localization(GO:0040023) |
| 0.1 | 0.3 | GO:0006868 | glutamine transport(GO:0006868) |
| 0.1 | 0.6 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.1 | 1.3 | GO:0032288 | myelin assembly(GO:0032288) |
| 0.1 | 0.4 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.1 | 0.5 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.1 | 1.2 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.1 | 3.8 | GO:0030032 | lamellipodium assembly(GO:0030032) |
| 0.1 | 1.2 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.1 | 3.3 | GO:1900181 | negative regulation of protein localization to nucleus(GO:1900181) |
| 0.1 | 3.3 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.1 | 0.6 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 1.9 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
| 0.0 | 1.2 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.2 | GO:0050912 | detection of chemical stimulus involved in sensory perception(GO:0050907) detection of chemical stimulus involved in sensory perception of taste(GO:0050912) |
| 0.0 | 1.7 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.0 | 1.4 | GO:0006839 | mitochondrial transport(GO:0006839) |
| 0.0 | 6.0 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.0 | 6.1 | GO:0007416 | synapse assembly(GO:0007416) |
| 0.0 | 1.7 | GO:2001244 | positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
| 0.0 | 0.3 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 | 0.7 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.0 | 0.2 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.0 | 1.5 | GO:0001541 | ovarian follicle development(GO:0001541) |
| 0.0 | 0.8 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.0 | 0.6 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.0 | 1.0 | GO:0043113 | receptor clustering(GO:0043113) |
| 0.0 | 0.9 | GO:0010506 | regulation of autophagy(GO:0010506) |
| 0.0 | 1.0 | GO:0030317 | sperm motility(GO:0030317) |
| 0.0 | 0.8 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
| 0.0 | 0.3 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
| 0.0 | 3.3 | GO:0043547 | positive regulation of GTPase activity(GO:0043547) |
| 0.0 | 0.1 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.0 | 2.9 | GO:0006906 | vesicle fusion(GO:0006906) |
| 0.0 | 0.2 | GO:0043488 | regulation of mRNA stability(GO:0043488) |
| 0.0 | 0.6 | GO:0043029 | T cell homeostasis(GO:0043029) |
| 0.0 | 0.5 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 | 0.6 | GO:0061512 | protein localization to cilium(GO:0061512) |
| 0.0 | 1.4 | GO:0048675 | axon extension(GO:0048675) |
| 0.0 | 2.6 | GO:0019221 | cytokine-mediated signaling pathway(GO:0019221) |
| 0.0 | 0.3 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.0 | 0.7 | GO:1902653 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
| 0.0 | 0.4 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.4 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.0 | 0.4 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.0 | 0.5 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.4 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.0 | 0.6 | GO:0070613 | regulation of protein processing(GO:0070613) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.3 | 5.0 | GO:0043259 | laminin-1 complex(GO:0005606) laminin-10 complex(GO:0043259) |
| 0.8 | 0.8 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.4 | 1.1 | GO:0097637 | intrinsic component of autophagosome membrane(GO:0097636) integral component of autophagosome membrane(GO:0097637) |
| 0.3 | 1.0 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.3 | 1.0 | GO:0031533 | mRNA cap methyltransferase complex(GO:0031533) |
| 0.2 | 1.0 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.2 | 2.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.2 | 2.5 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.2 | 3.5 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.2 | 2.7 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.2 | 2.2 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.2 | 1.2 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.2 | 4.6 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.2 | 1.9 | GO:0016342 | catenin complex(GO:0016342) |
| 0.2 | 1.2 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.1 | 0.9 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.1 | 1.9 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 3.1 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
| 0.1 | 4.8 | GO:0043034 | costamere(GO:0043034) |
| 0.1 | 1.5 | GO:0070938 | contractile ring(GO:0070938) |
| 0.1 | 1.3 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.8 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 17.0 | GO:0005884 | actin filament(GO:0005884) |
| 0.1 | 1.0 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 2.1 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.1 | 0.6 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.1 | 0.7 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.3 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.1 | 0.6 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 2.2 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.1 | 8.6 | GO:0043204 | perikaryon(GO:0043204) |
| 0.1 | 6.1 | GO:0042641 | actomyosin(GO:0042641) |
| 0.1 | 1.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 2.3 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 0.3 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 3.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 1.1 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.5 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.0 | 0.4 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 1.2 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 3.2 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 1.9 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.0 | 0.2 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 2.0 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.6 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 3.6 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.0 | 5.5 | GO:0014069 | postsynaptic density(GO:0014069) |
| 0.0 | 0.6 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.5 | GO:0097610 | cell division site(GO:0032153) cleavage furrow(GO:0032154) cell division site part(GO:0032155) cell surface furrow(GO:0097610) |
| 0.0 | 1.7 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.0 | 1.4 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 3.5 | GO:0015629 | actin cytoskeleton(GO:0015629) |
| 0.0 | 0.8 | GO:0001726 | ruffle(GO:0001726) |
| 0.0 | 1.0 | GO:0031252 | cell leading edge(GO:0031252) |
| 0.0 | 0.7 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 1.4 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.4 | 4.3 | GO:0016155 | formyltetrahydrofolate dehydrogenase activity(GO:0016155) |
| 0.6 | 5.0 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.6 | 1.9 | GO:0070890 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 0.6 | 3.1 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.5 | 2.6 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.5 | 1.4 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.5 | 4.2 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.4 | 4.8 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.4 | 1.7 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.4 | 1.9 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
| 0.4 | 2.3 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.4 | 1.5 | GO:0033883 | pyridoxal phosphatase activity(GO:0033883) |
| 0.3 | 1.0 | GO:0004482 | mRNA (guanine-N7-)-methyltransferase activity(GO:0004482) |
| 0.3 | 5.9 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.3 | 0.9 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.3 | 1.2 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
| 0.3 | 1.5 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
| 0.3 | 0.9 | GO:0003692 | left-handed Z-DNA binding(GO:0003692) |
| 0.3 | 0.9 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.3 | 0.9 | GO:0098973 | structural constituent of synapse(GO:0098918) structural constituent of postsynaptic actin cytoskeleton(GO:0098973) |
| 0.3 | 2.2 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.3 | 1.0 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.2 | 2.7 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.2 | 2.0 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.2 | 3.5 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.2 | 1.0 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.2 | 2.8 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.2 | 1.0 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.2 | 0.5 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
| 0.2 | 2.1 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
| 0.2 | 1.3 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.2 | 0.3 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.2 | 1.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.1 | 1.0 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 4.3 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 4.6 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.1 | 3.5 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.1 | 0.3 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.1 | 0.4 | GO:0004816 | asparagine-tRNA ligase activity(GO:0004816) |
| 0.1 | 0.6 | GO:0005113 | patched binding(GO:0005113) |
| 0.1 | 1.2 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.1 | 11.7 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.1 | 4.3 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.1 | 1.1 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.1 | 0.8 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.1 | 12.8 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.1 | 0.2 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.1 | 2.4 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.1 | 0.5 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.1 | 5.0 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.1 | 0.3 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.1 | 3.3 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.1 | 0.6 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.1 | 0.9 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
| 0.1 | 1.2 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.1 | 2.2 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.1 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.1 | 1.7 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.1 | 0.6 | GO:0005522 | profilin binding(GO:0005522) |
| 0.1 | 0.7 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 0.6 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.1 | 0.4 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) L-proline transmembrane transporter activity(GO:0015193) alanine transmembrane transporter activity(GO:0022858) |
| 0.0 | 0.5 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 2.5 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 0.8 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.6 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.6 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.0 | 10.5 | GO:0003779 | actin binding(GO:0003779) |
| 0.0 | 2.9 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.0 | 0.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 1.1 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 3.1 | GO:0005249 | voltage-gated potassium channel activity(GO:0005249) |
| 0.0 | 0.6 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 1.1 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 2.7 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 10.0 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
| 0.0 | 0.7 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.0 | 1.6 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.0 | 0.3 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.7 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.0 | 1.9 | GO:0008013 | beta-catenin binding(GO:0008013) |
| 0.0 | 1.3 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 0.6 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
| 0.0 | 0.6 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.0 | 4.9 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
| 0.0 | 0.8 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.0 | 0.4 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 1.0 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 2.5 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.0 | 0.3 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 1.1 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.0 | 0.9 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.1 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 1.0 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 5.0 | PID_INTEGRIN4_PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.2 | 8.8 | PID_CDC42_REG_PATHWAY | Regulation of CDC42 activity |
| 0.1 | 2.5 | SIG_IL4RECEPTOR_IN_B_LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 3.9 | SA_PTEN_PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 4.4 | PID_RAC1_REG_PATHWAY | Regulation of RAC1 activity |
| 0.1 | 2.6 | ST_ERK1_ERK2_MAPK_PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.1 | 2.7 | PID_CD40_PATHWAY | CD40/CD40L signaling |
| 0.1 | 2.1 | PID_NETRIN_PATHWAY | Netrin-mediated signaling events |
| 0.1 | 0.7 | PID_INTEGRIN_A4B1_PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.0 | 0.7 | PID_P38_GAMMA_DELTA_PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 1.1 | PID_TOLL_ENDOGENOUS_PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.6 | PID_KIT_PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.5 | PID_ARF6_DOWNSTREAM_PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.9 | ST_TUMOR_NECROSIS_FACTOR_PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 2.8 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 4.1 | NABA_ECM_AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.6 | PID_HEDGEHOG_2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 1.1 | PID_ATR_PATHWAY | ATR signaling pathway |
| 0.0 | 2.5 | WNT_SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.2 | PID_INTEGRIN2_PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 1.0 | PID_TGFBR_PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.6 | PID_IL4_2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.6 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 0.3 | ST_MYOCYTE_AD_PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 4.2 | REACTOME_CRMPS_IN_SEMA3A_SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.2 | 5.6 | REACTOME_OTHER_SEMAPHORIN_INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.2 | 7.3 | REACTOME_DARPP_32_EVENTS | Genes involved in DARPP-32 events |
| 0.2 | 4.0 | REACTOME_DCC_MEDIATED_ATTRACTIVE_SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.2 | 2.5 | REACTOME_POST_CHAPERONIN_TUBULIN_FOLDING_PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.1 | 1.8 | REACTOME_IRAK1_RECRUITS_IKK_COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 3.7 | REACTOME_ANTIGEN_ACTIVATES_B_CELL_RECEPTOR_LEADING_TO_GENERATION_OF_SECOND_MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 2.5 | REACTOME_INSULIN_SYNTHESIS_AND_PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 1.0 | REACTOME_TERMINATION_OF_O_GLYCAN_BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.1 | 3.5 | REACTOME_ION_TRANSPORT_BY_P_TYPE_ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 1.3 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_EARLY_ENDOSOME_MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 0.9 | REACTOME_FACILITATIVE_NA_INDEPENDENT_GLUCOSE_TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 3.5 | REACTOME_VOLTAGE_GATED_POTASSIUM_CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 1.9 | REACTOME_SYNTHESIS_OF_PC | Genes involved in Synthesis of PC |
| 0.1 | 1.1 | REACTOME_CS_DS_DEGRADATION | Genes involved in CS/DS degradation |
| 0.1 | 0.7 | REACTOME_BILE_SALT_AND_ORGANIC_ANION_SLC_TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 1.0 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 1.0 | REACTOME_GABA_A_RECEPTOR_ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 3.0 | REACTOME_AMINO_ACID_AND_OLIGOPEPTIDE_SLC_TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.1 | 2.0 | REACTOME_GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 1.0 | REACTOME_KERATAN_SULFATE_BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 1.1 | REACTOME_SYNTHESIS_AND_INTERCONVERSION_OF_NUCLEOTIDE_DI_AND_TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.6 | REACTOME_GENERATION_OF_SECOND_MESSENGER_MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.0 | 5.0 | REACTOME_L1CAM_INTERACTIONS | Genes involved in L1CAM interactions |
| 0.0 | 0.9 | REACTOME_PREFOLDIN_MEDIATED_TRANSFER_OF_SUBSTRATE_TO_CCT_TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 0.9 | REACTOME_SIGNALING_BY_FGFR1_FUSION_MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 1.9 | REACTOME_METABOLISM_OF_VITAMINS_AND_COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 1.0 | REACTOME_MRNA_CAPPING | Genes involved in mRNA Capping |
| 0.0 | 0.7 | REACTOME_CHOLESTEROL_BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 2.4 | REACTOME_RESPONSE_TO_ELEVATED_PLATELET_CYTOSOLIC_CA2_ | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.0 | 2.0 | REACTOME_NRAGE_SIGNALS_DEATH_THROUGH_JNK | Genes involved in NRAGE signals death through JNK |
| 0.0 | 0.5 | REACTOME_ABCA_TRANSPORTERS_IN_LIPID_HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.6 | REACTOME_CHEMOKINE_RECEPTORS_BIND_CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.5 | REACTOME_ALPHA_LINOLENIC_ACID_ALA_METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 1.0 | REACTOME_INTERFERON_ALPHA_BETA_SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.4 | REACTOME_PROCESSING_OF_INTRONLESS_PRE_MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.6 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_PLASMA_MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.5 | REACTOME_DEADENYLATION_OF_MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.7 | REACTOME_TRANSPORT_OF_VITAMINS_NUCLEOSIDES_AND_RELATED_MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.2 | REACTOME_CLASS_C_3_METABOTROPIC_GLUTAMATE_PHEROMONE_RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.2 | REACTOME_CALNEXIN_CALRETICULIN_CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.0 | 0.3 | REACTOME_SIGNALING_BY_ROBO_RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.4 | REACTOME_MRNA_3_END_PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 0.5 | REACTOME_NCAM1_INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.8 | REACTOME_GENERIC_TRANSCRIPTION_PATHWAY | Genes involved in Generic Transcription Pathway |
| 0.0 | 0.1 | REACTOME_CHYLOMICRON_MEDIATED_LIPID_TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |


