Motif ID: Twist1
Z-value: 1.498
Transcription factors associated with Twist1:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Twist1 | ENSMUSG00000035799.5 | Twist1 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Twist1 | mm10_v2_chr12_+_33957645_33957671 | -0.13 | 3.3e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 9.9 | 9.9 | GO:1902460 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 7.7 | 30.9 | GO:0060032 | notochord regression(GO:0060032) |
| 6.7 | 20.0 | GO:0002302 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
| 5.0 | 20.0 | GO:0051311 | spindle assembly involved in female meiosis(GO:0007056) meiotic metaphase plate congression(GO:0051311) |
| 3.6 | 10.8 | GO:0072076 | hyaluranon cable assembly(GO:0036118) nephrogenic mesenchyme development(GO:0072076) negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 2.7 | 8.2 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) DNA replication preinitiation complex assembly(GO:0071163) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 2.5 | 10.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 2.4 | 21.4 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 1.9 | 5.6 | GO:0051892 | negative regulation of cardioblast differentiation(GO:0051892) dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) negative regulation of dopaminergic neuron differentiation(GO:1904339) regulation of cardiac cell fate specification(GO:2000043) |
| 1.6 | 4.9 | GO:1904395 | positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 1.5 | 13.4 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 1.5 | 7.4 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 1.4 | 10.1 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 1.2 | 3.5 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) regulation of interleukin-6-mediated signaling pathway(GO:0070103) negative regulation of interleukin-6-mediated signaling pathway(GO:0070104) |
| 1.1 | 3.3 | GO:0019405 | alditol catabolic process(GO:0019405) glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 1.0 | 1.0 | GO:1904412 | regulation of cardiac ventricle development(GO:1904412) |
| 1.0 | 5.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 1.0 | 17.4 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.9 | 4.4 | GO:0060849 | regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 0.9 | 5.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.8 | 2.4 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.7 | 2.2 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.7 | 5.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.7 | 2.1 | GO:0030070 | insulin processing(GO:0030070) |
| 0.6 | 8.4 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.6 | 1.9 | GO:0060023 | soft palate development(GO:0060023) |
| 0.6 | 5.7 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.6 | 13.9 | GO:0048368 | lateral mesoderm development(GO:0048368) |
| 0.6 | 8.1 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.6 | 18.9 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.6 | 6.6 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
| 0.5 | 3.8 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.4 | 1.2 | GO:2001160 | regulation of histone H3-K79 methylation(GO:2001160) |
| 0.4 | 14.3 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
| 0.4 | 4.9 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.4 | 1.1 | GO:2000564 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) negative regulation of regulatory T cell differentiation(GO:0045590) regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
| 0.3 | 3.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.3 | 1.0 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.3 | 1.4 | GO:0019230 | protein autoprocessing(GO:0016540) proprioception(GO:0019230) |
| 0.2 | 0.9 | GO:0090472 | dibasic protein processing(GO:0090472) |
| 0.2 | 2.4 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.2 | 9.6 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
| 0.2 | 1.2 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.2 | 1.3 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
| 0.1 | 2.1 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.1 | 7.8 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
| 0.1 | 3.5 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.1 | 3.0 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 1.0 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.1 | 2.3 | GO:0007520 | myoblast fusion(GO:0007520) |
| 0.1 | 1.0 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.1 | 0.7 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.1 | 2.2 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.1 | 0.6 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 | 1.4 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.8 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.6 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 0.1 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.0 | 7.4 | GO:0045444 | fat cell differentiation(GO:0045444) |
| 0.0 | 0.8 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 5.6 | GO:0006909 | phagocytosis(GO:0006909) |
| 0.0 | 3.8 | GO:0016579 | protein deubiquitination(GO:0016579) |
| 0.0 | 3.3 | GO:0045740 | positive regulation of DNA replication(GO:0045740) |
| 0.0 | 0.6 | GO:0014898 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle hypertrophy in response to stress(GO:0014898) |
| 0.0 | 0.8 | GO:0048255 | mRNA stabilization(GO:0048255) |
| 0.0 | 4.5 | GO:0030308 | negative regulation of cell growth(GO:0030308) |
| 0.0 | 0.1 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.0 | 1.2 | GO:0033209 | tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.0 | 0.5 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 | 0.4 | GO:0099500 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.0 | 0.2 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
| 0.0 | 0.6 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 5.0 | 15.1 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 4.6 | 13.9 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 4.3 | 17.4 | GO:0043293 | apoptosome(GO:0043293) |
| 3.9 | 15.6 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 2.7 | 8.2 | GO:0036387 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 2.4 | 30.9 | GO:0097542 | ciliary tip(GO:0097542) |
| 2.2 | 13.4 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 2.2 | 20.0 | GO:0072687 | meiotic spindle(GO:0072687) |
| 2.2 | 6.6 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.8 | 3.3 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
| 0.4 | 8.1 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.4 | 5.0 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.4 | 2.5 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.2 | 4.9 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.2 | 3.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.1 | 2.1 | GO:0031045 | dense core granule(GO:0031045) |
| 0.1 | 1.0 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.1 | 0.3 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.1 | 2.2 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 14.3 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.1 | 0.6 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 1.0 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 18.2 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
| 0.1 | 0.9 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
| 0.1 | 3.5 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 0.8 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 8.7 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 6.6 | GO:0000793 | condensed chromosome(GO:0000793) |
| 0.0 | 0.4 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 1.3 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 8.0 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 4.4 | GO:0005884 | actin filament(GO:0005884) |
| 0.0 | 0.7 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.0 | 2.2 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 0.5 | GO:0031902 | late endosome membrane(GO:0031902) |
| 0.0 | 1.0 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 1.0 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.6 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 1.7 | GO:0034399 | nuclear periphery(GO:0034399) |
| 0.0 | 16.1 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
| 0.0 | 0.6 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 10.6 | GO:0005615 | extracellular space(GO:0005615) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.5 | 13.4 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 3.8 | 15.1 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 2.0 | 5.9 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
| 1.9 | 5.6 | GO:0005110 | frizzled-2 binding(GO:0005110) |
| 1.3 | 14.3 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 1.2 | 3.5 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 1.1 | 6.6 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 1.1 | 10.8 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.9 | 7.4 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.9 | 6.8 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.9 | 5.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.8 | 7.4 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.7 | 25.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.7 | 13.9 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.7 | 10.1 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.7 | 5.7 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.6 | 8.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.4 | 1.3 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.4 | 6.1 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.4 | 10.1 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.4 | 9.9 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.4 | 3.1 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.3 | 4.4 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.3 | 20.0 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.3 | 3.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.3 | 1.4 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.2 | 1.2 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.2 | 8.5 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.2 | 2.2 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
| 0.2 | 2.1 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.2 | 1.4 | GO:0035326 | enhancer binding(GO:0035326) |
| 0.2 | 0.5 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.2 | 3.8 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 1.0 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.1 | 5.0 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.1 | 15.6 | GO:0005178 | integrin binding(GO:0005178) |
| 0.1 | 5.1 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 2.2 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.1 | 4.9 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.1 | 4.4 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.1 | 3.0 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.1 | 1.9 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.1 | 2.4 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 1.0 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.1 | 0.9 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.1 | 3.4 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.1 | 7.9 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.1 | 20.0 | GO:0005525 | GTP binding(GO:0005525) |
| 0.0 | 2.1 | GO:0004879 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
| 0.0 | 2.3 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.7 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 1.0 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.6 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 2.2 | GO:0008201 | heparin binding(GO:0008201) |
| 0.0 | 0.9 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.6 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 4.1 | GO:0044822 | mRNA binding(GO:0003729) poly(A) RNA binding(GO:0044822) |
| 0.0 | 13.6 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
| 0.0 | 0.1 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 0.4 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.0 | 15.6 | PID_INTEGRIN4_PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 1.0 | 10.8 | PID_ALK2_PATHWAY | ALK2 signaling events |
| 0.8 | 26.5 | PID_HEDGEHOG_2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.4 | 20.0 | PID_AURORA_B_PATHWAY | Aurora B signaling |
| 0.4 | 11.5 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
| 0.3 | 18.9 | PID_IL12_2PATHWAY | IL12-mediated signaling events |
| 0.2 | 2.1 | PID_IL12_STAT4_PATHWAY | IL12 signaling mediated by STAT4 |
| 0.2 | 6.6 | PID_ARF6_PATHWAY | Arf6 signaling events |
| 0.1 | 10.6 | WNT_SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.1 | 3.5 | PID_IFNG_PATHWAY | IFN-gamma pathway |
| 0.1 | 4.4 | PID_HNF3A_PATHWAY | FOXA1 transcription factor network |
| 0.1 | 12.8 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.1 | 5.1 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.1 | 4.3 | PID_HEDGEHOG_GLI_PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.1 | 3.3 | ST_P38_MAPK_PATHWAY | p38 MAPK Pathway |
| 0.1 | 2.2 | ST_WNT_BETA_CATENIN_PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 1.9 | NABA_COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 1.4 | PID_HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 2.1 | PID_ARF6_TRAFFICKING_PATHWAY | Arf6 trafficking events |
| 0.0 | 0.8 | PID_HIF1_TFPATHWAY | HIF-1-alpha transcription factor network |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 5.1 | REACTOME_SYNTHESIS_OF_BILE_ACIDS_AND_BILE_SALTS_VIA_24_HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.6 | 13.4 | REACTOME_CITRIC_ACID_CYCLE_TCA_CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.5 | 8.2 | REACTOME_UNWINDING_OF_DNA | Genes involved in Unwinding of DNA |
| 0.5 | 5.1 | REACTOME_RECEPTOR_LIGAND_BINDING_INITIATES_THE_SECOND_PROTEOLYTIC_CLEAVAGE_OF_NOTCH_RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.5 | 3.7 | REACTOME_THE_ACTIVATION_OF_ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.4 | 13.9 | REACTOME_YAP1_AND_WWTR1_TAZ_STIMULATED_GENE_EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.4 | 5.4 | REACTOME_NOTCH_HLH_TRANSCRIPTION_PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.3 | 6.6 | REACTOME_METABOLISM_OF_PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.3 | 3.5 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.2 | 5.0 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.2 | 14.0 | REACTOME_CLASS_B_2_SECRETIN_FAMILY_RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.2 | 14.2 | REACTOME_INTEGRIN_CELL_SURFACE_INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.1 | 2.4 | REACTOME_DESTABILIZATION_OF_MRNA_BY_TRISTETRAPROLIN_TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 2.2 | REACTOME_CONVERSION_FROM_APC_C_CDC20_TO_APC_C_CDH1_IN_LATE_ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 2.4 | REACTOME_HS_GAG_DEGRADATION | Genes involved in HS-GAG degradation |
| 0.1 | 0.9 | REACTOME_GAMMA_CARBOXYLATION_TRANSPORT_AND_AMINO_TERMINAL_CLEAVAGE_OF_PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.1 | 3.3 | REACTOME_NUCLEAR_EVENTS_KINASE_AND_TRANSCRIPTION_FACTOR_ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 0.1 | 2.1 | REACTOME_INSULIN_SYNTHESIS_AND_PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 3.3 | REACTOME_GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 2.2 | REACTOME_SIGNALING_BY_BMP | Genes involved in Signaling by BMP |
| 0.1 | 4.4 | REACTOME_TRANSCRIPTIONAL_REGULATION_OF_WHITE_ADIPOCYTE_DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.1 | 1.1 | REACTOME_TRAF6_MEDIATED_IRF7_ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.1 | 2.2 | REACTOME_GLUCOSE_TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.5 | REACTOME_HYALURONAN_METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.0 | 1.9 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
| 0.0 | 2.1 | REACTOME_NUCLEAR_RECEPTOR_TRANSCRIPTION_PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 1.3 | REACTOME_TRANSPORT_OF_VITAMINS_NUCLEOSIDES_AND_RELATED_MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 1.4 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.1 | REACTOME_TANDEM_PORE_DOMAIN_POTASSIUM_CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 1.0 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 2.9 | REACTOME_SIGNALING_BY_RHO_GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.6 | REACTOME_FORMATION_OF_THE_TERNARY_COMPLEX_AND_SUBSEQUENTLY_THE_43S_COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |


