Motif ID: Ybx1_Nfya_Nfyb_Nfyc_Cebpz
Z-value: 8.140
Transcription factors associated with Ybx1_Nfya_Nfyb_Nfyc_Cebpz:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Cebpz | ENSMUSG00000024081.8 | Cebpz |
| Nfya | ENSMUSG00000023994.7 | Nfya |
| Nfyb | ENSMUSG00000020248.12 | Nfyb |
| Nfyc | ENSMUSG00000032897.11 | Nfyc |
| Ybx1 | ENSMUSG00000028639.8 | Ybx1 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Nfyb | mm10_v2_chr10_-_82764088_82764144 | -0.40 | 2.4e-03 | Click! |
| Nfyc | mm10_v2_chr4_-_120815703_120815761 | 0.34 | 1.2e-02 | Click! |
| Cebpz | mm10_v2_chr17_-_78937031_78937074 | -0.27 | 4.6e-02 | Click! |
| Nfya | mm10_v2_chr17_-_48409729_48409906 | -0.19 | 1.6e-01 | Click! |
| Ybx1 | mm10_v2_chr4_-_119294520_119294604 | 0.19 | 1.8e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 41.7 | 125.0 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 41.6 | 124.9 | GO:0002302 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
| 34.7 | 138.7 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
| 27.4 | 164.7 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 23.8 | 429.2 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 22.7 | 136.5 | GO:0072049 | comma-shaped body morphogenesis(GO:0072049) |
| 22.7 | 68.0 | GO:0072382 | minus-end-directed vesicle transport along microtubule(GO:0072382) |
| 21.4 | 42.7 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 20.8 | 62.4 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 20.5 | 41.1 | GO:0072190 | ureter urothelium development(GO:0072190) ureter morphogenesis(GO:0072197) |
| 19.6 | 58.9 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 18.9 | 132.1 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
| 18.8 | 94.0 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 18.0 | 53.9 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) DNA replication preinitiation complex assembly(GO:0071163) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 15.8 | 110.8 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 15.3 | 199.1 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
| 14.4 | 28.8 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 13.2 | 39.6 | GO:0030862 | neuroblast division in subventricular zone(GO:0021849) positive regulation of polarized epithelial cell differentiation(GO:0030862) |
| 12.4 | 12.4 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
| 12.4 | 37.1 | GO:0021577 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) |
| 12.0 | 36.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 11.7 | 186.8 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
| 11.5 | 69.0 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 11.3 | 45.2 | GO:0021648 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) cranial nerve formation(GO:0021603) vestibulocochlear nerve morphogenesis(GO:0021648) |
| 11.2 | 156.5 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 11.1 | 44.5 | GO:1903463 | regulation of mitotic cell cycle DNA replication(GO:1903463) |
| 11.0 | 66.2 | GO:0000279 | M phase(GO:0000279) |
| 11.0 | 33.0 | GO:0061075 | cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 11.0 | 32.9 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 10.2 | 30.7 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 10.1 | 70.6 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 10.1 | 50.3 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 10.0 | 90.2 | GO:0033504 | floor plate development(GO:0033504) |
| 9.9 | 29.7 | GO:0021759 | globus pallidus development(GO:0021759) |
| 9.9 | 306.1 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 9.7 | 38.8 | GO:1902724 | positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 9.6 | 48.1 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 9.6 | 9.6 | GO:0060364 | frontal suture morphogenesis(GO:0060364) |
| 9.6 | 28.7 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 9.5 | 28.6 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 9.3 | 65.0 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 9.2 | 18.4 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 9.2 | 27.5 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 9.1 | 27.3 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
| 8.9 | 62.1 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 8.8 | 8.8 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
| 8.4 | 42.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 8.4 | 25.3 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 8.2 | 24.6 | GO:2000040 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
| 7.9 | 103.3 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 7.8 | 78.2 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 7.7 | 23.1 | GO:0032650 | regulation of interleukin-1 alpha production(GO:0032650) positive regulation of interleukin-1 alpha production(GO:0032730) cardiac cell fate determination(GO:0060913) |
| 7.6 | 22.7 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 7.4 | 44.4 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 7.0 | 28.1 | GO:0006272 | leading strand elongation(GO:0006272) |
| 6.7 | 20.2 | GO:2000620 | positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 6.7 | 39.9 | GO:0060022 | hard palate development(GO:0060022) |
| 6.6 | 19.9 | GO:0019343 | cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 6.5 | 32.5 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 6.5 | 19.4 | GO:1904760 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 6.4 | 12.8 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
| 6.4 | 51.1 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 6.3 | 18.9 | GO:0002014 | vasoconstriction of artery involved in ischemic response to lowering of systemic arterial blood pressure(GO:0002014) |
| 6.2 | 18.7 | GO:0010814 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 6.2 | 80.5 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 6.0 | 198.5 | GO:0051310 | metaphase plate congression(GO:0051310) |
| 5.9 | 17.8 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 5.9 | 147.7 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
| 5.9 | 17.6 | GO:0061198 | fungiform papilla development(GO:0061196) fungiform papilla morphogenesis(GO:0061197) fungiform papilla formation(GO:0061198) |
| 5.7 | 45.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 5.6 | 56.5 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 5.6 | 11.1 | GO:0071649 | regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 5.5 | 11.1 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 5.5 | 27.5 | GO:1990839 | response to endothelin(GO:1990839) |
| 5.5 | 38.4 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 5.4 | 32.5 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 5.4 | 26.9 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 5.4 | 43.0 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 5.3 | 90.9 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 5.3 | 21.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 5.3 | 15.8 | GO:0003195 | tricuspid valve formation(GO:0003195) |
| 5.2 | 26.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 5.1 | 20.4 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 5.0 | 15.0 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 5.0 | 10.0 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 4.9 | 59.1 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 4.9 | 43.9 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 4.9 | 126.9 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 4.8 | 23.9 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 4.7 | 18.9 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
| 4.7 | 41.9 | GO:0042095 | interferon-gamma biosynthetic process(GO:0042095) |
| 4.6 | 13.8 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 4.6 | 13.8 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 4.6 | 13.7 | GO:0002645 | positive regulation of tolerance induction(GO:0002645) |
| 4.5 | 9.1 | GO:0072180 | mesonephric duct development(GO:0072177) mesonephric duct morphogenesis(GO:0072180) |
| 4.4 | 13.3 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 4.3 | 21.4 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 4.3 | 59.9 | GO:0043486 | histone exchange(GO:0043486) |
| 4.2 | 12.7 | GO:0045819 | plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
| 4.1 | 16.3 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 4.1 | 32.5 | GO:0070874 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 4.0 | 16.1 | GO:0070859 | positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
| 4.0 | 4.0 | GO:0002200 | somatic diversification of immune receptors(GO:0002200) |
| 4.0 | 27.8 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 3.8 | 15.3 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
| 3.8 | 11.5 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
| 3.8 | 34.3 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
| 3.8 | 18.9 | GO:2000427 | apolipoprotein A-I-mediated signaling pathway(GO:0038027) positive regulation of apoptotic cell clearance(GO:2000427) |
| 3.8 | 41.3 | GO:0070986 | left/right axis specification(GO:0070986) |
| 3.7 | 11.0 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
| 3.7 | 21.9 | GO:0046490 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
| 3.6 | 21.7 | GO:0045005 | DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 3.6 | 10.7 | GO:0036292 | DNA rewinding(GO:0036292) |
| 3.6 | 10.7 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 3.5 | 7.1 | GO:0021506 | anterior neuropore closure(GO:0021506) neuropore closure(GO:0021995) |
| 3.5 | 24.8 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 3.5 | 7.1 | GO:0051135 | positive regulation of NK T cell activation(GO:0051135) |
| 3.5 | 45.7 | GO:0001675 | acrosome assembly(GO:0001675) |
| 3.5 | 10.5 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 3.5 | 42.0 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 3.5 | 3.5 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 3.5 | 27.7 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 3.4 | 17.1 | GO:0006868 | glutamine transport(GO:0006868) |
| 3.4 | 57.8 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 3.4 | 13.4 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
| 3.4 | 10.1 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 3.4 | 47.0 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 3.3 | 6.6 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 3.3 | 3.3 | GO:0051299 | centrosome separation(GO:0051299) |
| 3.3 | 13.2 | GO:0001887 | selenium compound metabolic process(GO:0001887) selenocysteine metabolic process(GO:0016259) |
| 3.3 | 16.4 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 3.3 | 6.5 | GO:0030222 | eosinophil differentiation(GO:0030222) |
| 3.3 | 3.3 | GO:0032796 | uropod organization(GO:0032796) |
| 3.2 | 22.7 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 3.2 | 9.7 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 3.2 | 19.2 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 3.2 | 28.6 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 3.2 | 85.1 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 3.1 | 21.7 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 3.1 | 9.3 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 3.1 | 12.3 | GO:0002484 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 3.0 | 36.6 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
| 3.0 | 12.1 | GO:0051595 | response to methylglyoxal(GO:0051595) |
| 3.0 | 135.7 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 3.0 | 21.0 | GO:0072615 | interleukin-17 secretion(GO:0072615) |
| 2.9 | 5.9 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
| 2.9 | 14.6 | GO:0034214 | protein hexamerization(GO:0034214) |
| 2.9 | 31.9 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 2.9 | 11.6 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 2.9 | 42.9 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 2.9 | 34.3 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 2.9 | 245.2 | GO:0006342 | chromatin silencing(GO:0006342) |
| 2.8 | 5.7 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 2.8 | 8.3 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 2.8 | 5.5 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 2.7 | 5.5 | GO:0071211 | protein targeting to vacuole involved in autophagy(GO:0071211) |
| 2.7 | 5.5 | GO:0009136 | ADP biosynthetic process(GO:0006172) purine nucleoside diphosphate biosynthetic process(GO:0009136) purine ribonucleoside diphosphate biosynthetic process(GO:0009180) |
| 2.7 | 51.0 | GO:0007099 | centriole replication(GO:0007099) |
| 2.7 | 16.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 2.6 | 2.6 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 2.6 | 26.3 | GO:0051307 | meiotic chromosome separation(GO:0051307) |
| 2.6 | 15.7 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
| 2.6 | 47.1 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 2.6 | 7.8 | GO:1903406 | regulation of sodium:potassium-exchanging ATPase activity(GO:1903406) |
| 2.6 | 10.4 | GO:0060290 | transdifferentiation(GO:0060290) |
| 2.6 | 7.8 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 2.6 | 5.2 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 2.6 | 15.4 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 2.5 | 12.6 | GO:0090669 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) telomerase RNA stabilization(GO:0090669) |
| 2.5 | 7.5 | GO:0019323 | pentose catabolic process(GO:0019323) |
| 2.5 | 9.9 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 2.5 | 29.7 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 2.5 | 12.3 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 2.4 | 24.5 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 2.4 | 124.5 | GO:0008156 | negative regulation of DNA replication(GO:0008156) |
| 2.4 | 7.1 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 2.4 | 4.7 | GO:0051026 | chiasma assembly(GO:0051026) |
| 2.4 | 21.2 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 2.4 | 7.1 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 2.3 | 44.5 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 2.3 | 16.3 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 2.3 | 7.0 | GO:0046671 | negative regulation of retinal cell programmed cell death(GO:0046671) |
| 2.3 | 32.4 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 2.3 | 13.8 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 2.3 | 9.2 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 2.3 | 2.3 | GO:0034239 | regulation of macrophage fusion(GO:0034239) |
| 2.3 | 6.8 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 2.2 | 2.2 | GO:0019230 | proprioception(GO:0019230) |
| 2.1 | 8.5 | GO:0060426 | lung vasculature development(GO:0060426) |
| 2.1 | 14.8 | GO:0006551 | leucine metabolic process(GO:0006551) |
| 2.1 | 18.7 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
| 2.1 | 18.6 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) |
| 2.1 | 12.4 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 2.1 | 2.1 | GO:0002481 | antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) |
| 2.1 | 2.1 | GO:0060382 | regulation of DNA strand elongation(GO:0060382) |
| 2.1 | 6.2 | GO:0009202 | purine deoxyribonucleotide biosynthetic process(GO:0009153) deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
| 2.0 | 22.5 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 2.0 | 6.1 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
| 2.0 | 4.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 2.0 | 21.9 | GO:0060539 | diaphragm development(GO:0060539) |
| 2.0 | 98.9 | GO:0035307 | positive regulation of protein dephosphorylation(GO:0035307) |
| 2.0 | 5.9 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
| 2.0 | 58.8 | GO:0000725 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 1.9 | 9.5 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
| 1.9 | 7.6 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
| 1.9 | 11.4 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 1.9 | 11.3 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 1.9 | 16.9 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 1.9 | 9.4 | GO:1903232 | melanosome assembly(GO:1903232) |
| 1.9 | 11.2 | GO:2000969 | positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
| 1.8 | 11.1 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 1.8 | 3.7 | GO:0046666 | retinal cell programmed cell death(GO:0046666) |
| 1.8 | 40.2 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 1.8 | 3.7 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
| 1.8 | 18.0 | GO:0045187 | regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 1.8 | 5.3 | GO:1903984 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 1.8 | 5.3 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 1.8 | 37.0 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 1.7 | 5.2 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 1.7 | 5.2 | GO:0006563 | L-serine metabolic process(GO:0006563) |
| 1.7 | 12.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 1.7 | 6.9 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 1.7 | 10.2 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 1.7 | 5.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 1.7 | 35.6 | GO:0001709 | cell fate determination(GO:0001709) |
| 1.7 | 23.7 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 1.7 | 11.8 | GO:2001053 | regulation of mesenchymal cell apoptotic process(GO:2001053) |
| 1.7 | 5.0 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 1.7 | 5.0 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 1.6 | 9.9 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 1.6 | 4.9 | GO:0072172 | ureteric bud formation(GO:0060676) mesonephric tubule formation(GO:0072172) |
| 1.6 | 6.6 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 1.6 | 9.7 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 1.6 | 6.5 | GO:0015888 | thiamine transport(GO:0015888) |
| 1.6 | 65.6 | GO:0043029 | T cell homeostasis(GO:0043029) |
| 1.6 | 9.5 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 1.6 | 11.0 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 1.6 | 9.4 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 1.6 | 4.7 | GO:0042637 | catagen(GO:0042637) |
| 1.6 | 9.4 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 1.5 | 7.6 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 1.5 | 6.1 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 1.5 | 6.1 | GO:0036506 | maintenance of unfolded protein(GO:0036506) tail-anchored membrane protein insertion into ER membrane(GO:0071816) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 1.5 | 4.5 | GO:0032415 | regulation of sodium:proton antiporter activity(GO:0032415) positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 1.5 | 6.0 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 1.5 | 15.1 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 1.5 | 3.0 | GO:1903719 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 1.5 | 1.5 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 1.5 | 5.9 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 1.5 | 5.9 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 1.5 | 26.3 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
| 1.5 | 14.6 | GO:0051451 | myoblast migration(GO:0051451) |
| 1.4 | 15.9 | GO:0070836 | caveola assembly(GO:0070836) |
| 1.4 | 154.9 | GO:0007050 | cell cycle arrest(GO:0007050) |
| 1.4 | 1.4 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 1.4 | 15.5 | GO:0060736 | prostate gland growth(GO:0060736) |
| 1.4 | 14.1 | GO:0031295 | T cell costimulation(GO:0031295) |
| 1.4 | 12.6 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 1.4 | 8.3 | GO:1904627 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 1.4 | 8.2 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
| 1.4 | 2.7 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 1.4 | 4.1 | GO:0060056 | mammary gland involution(GO:0060056) |
| 1.3 | 10.8 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 1.3 | 10.8 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
| 1.3 | 4.0 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 1.3 | 6.6 | GO:0032472 | Golgi calcium ion transport(GO:0032472) |
| 1.3 | 4.0 | GO:0030049 | muscle filament sliding(GO:0030049) |
| 1.3 | 184.8 | GO:0007059 | chromosome segregation(GO:0007059) |
| 1.3 | 10.6 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
| 1.3 | 10.5 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 1.3 | 9.2 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 1.3 | 2.6 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 1.3 | 7.7 | GO:0060536 | cartilage morphogenesis(GO:0060536) |
| 1.3 | 5.1 | GO:0010808 | positive regulation of synaptic vesicle priming(GO:0010808) |
| 1.3 | 5.1 | GO:0006776 | vitamin A metabolic process(GO:0006776) positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 1.3 | 1.3 | GO:0072431 | signal transduction involved in mitotic G1 DNA damage checkpoint(GO:0072431) intracellular signal transduction involved in G1 DNA damage checkpoint(GO:1902400) |
| 1.3 | 6.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 1.3 | 5.1 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 1.3 | 20.2 | GO:0050687 | negative regulation of defense response to virus(GO:0050687) |
| 1.3 | 8.8 | GO:0048102 | autophagic cell death(GO:0048102) |
| 1.3 | 78.2 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 1.2 | 6.2 | GO:0072189 | ureter development(GO:0072189) |
| 1.2 | 1.2 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 1.2 | 7.4 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 1.2 | 6.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 1.2 | 3.5 | GO:0060534 | trachea cartilage development(GO:0060534) |
| 1.2 | 4.7 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
| 1.2 | 4.6 | GO:0002467 | germinal center formation(GO:0002467) |
| 1.1 | 2.3 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 1.1 | 2.3 | GO:1904245 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 1.1 | 17.1 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 1.1 | 2.3 | GO:1904684 | negative regulation of metalloendopeptidase activity(GO:1904684) |
| 1.1 | 27.9 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
| 1.1 | 3.3 | GO:0001978 | regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 1.1 | 7.7 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 1.1 | 12.0 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 1.1 | 10.9 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 1.1 | 15.1 | GO:0044381 | glucose import in response to insulin stimulus(GO:0044381) |
| 1.1 | 19.3 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 1.1 | 5.3 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 1.1 | 6.3 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 1.1 | 15.8 | GO:0060009 | Sertoli cell development(GO:0060009) |
| 1.0 | 1.0 | GO:0032875 | regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
| 1.0 | 3.1 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
| 1.0 | 4.2 | GO:0030091 | protein repair(GO:0030091) |
| 1.0 | 5.1 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) |
| 1.0 | 8.1 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 1.0 | 2.0 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 1.0 | 2.0 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 1.0 | 6.0 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 1.0 | 8.9 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 1.0 | 5.9 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 1.0 | 5.8 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 1.0 | 7.7 | GO:0030220 | platelet formation(GO:0030220) |
| 0.9 | 2.8 | GO:0001928 | regulation of exocyst assembly(GO:0001928) |
| 0.9 | 7.5 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.9 | 2.8 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
| 0.9 | 3.7 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.9 | 2.8 | GO:0015870 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
| 0.9 | 13.1 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.9 | 2.8 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
| 0.9 | 6.3 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.9 | 1.8 | GO:0046110 | xanthine metabolic process(GO:0046110) |
| 0.9 | 6.1 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.9 | 6.1 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.9 | 2.6 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.9 | 18.8 | GO:2000178 | negative regulation of neural precursor cell proliferation(GO:2000178) |
| 0.9 | 1.7 | GO:2000744 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.8 | 4.2 | GO:0046208 | spermine catabolic process(GO:0046208) |
| 0.8 | 5.0 | GO:0060323 | head morphogenesis(GO:0060323) |
| 0.8 | 3.4 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.8 | 8.3 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.8 | 41.5 | GO:0021510 | spinal cord development(GO:0021510) |
| 0.8 | 6.5 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.8 | 4.1 | GO:0046645 | positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
| 0.8 | 1.6 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.8 | 1.6 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
| 0.8 | 6.4 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.8 | 12.8 | GO:0046653 | tetrahydrofolate metabolic process(GO:0046653) |
| 0.8 | 6.4 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.8 | 1.6 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.8 | 11.8 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.8 | 7.1 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
| 0.8 | 11.7 | GO:0061371 | determination of heart left/right asymmetry(GO:0061371) |
| 0.8 | 3.1 | GO:0045414 | regulation of interleukin-8 biosynthetic process(GO:0045414) |
| 0.8 | 8.4 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.8 | 3.8 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.8 | 2.3 | GO:1905244 | fasciculation of sensory neuron axon(GO:0097155) positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) regulation of modification of synaptic structure(GO:1905244) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.8 | 3.8 | GO:0061436 | establishment of skin barrier(GO:0061436) |
| 0.7 | 19.5 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
| 0.7 | 3.0 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.7 | 1.5 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.7 | 20.0 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.7 | 3.0 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.7 | 2.2 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.7 | 1.5 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.7 | 5.0 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.7 | 3.6 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.7 | 2.2 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.7 | 10.0 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
| 0.7 | 12.1 | GO:0006301 | postreplication repair(GO:0006301) |
| 0.7 | 5.0 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.7 | 2.1 | GO:1902913 | positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.7 | 2.1 | GO:1903286 | regulation of potassium ion import(GO:1903286) |
| 0.7 | 5.4 | GO:0031639 | plasminogen activation(GO:0031639) |
| 0.7 | 2.0 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.7 | 7.4 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.7 | 6.0 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.7 | 8.6 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
| 0.7 | 2.0 | GO:0071579 | regulation of zinc ion transport(GO:0071579) |
| 0.7 | 8.5 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.7 | 15.6 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.7 | 0.7 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.6 | 7.1 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.6 | 7.7 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
| 0.6 | 3.2 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.6 | 6.4 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
| 0.6 | 0.6 | GO:0021678 | third ventricle development(GO:0021678) |
| 0.6 | 2.5 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.6 | 1.2 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.6 | 5.0 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.6 | 3.7 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
| 0.6 | 1.9 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.6 | 3.1 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.6 | 4.9 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.6 | 1.2 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.6 | 1.2 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
| 0.6 | 1.2 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.6 | 7.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.6 | 2.4 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
| 0.6 | 4.1 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.6 | 1.2 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.6 | 2.3 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.6 | 1.1 | GO:1904429 | regulation of t-circle formation(GO:1904429) positive regulation of t-circle formation(GO:1904431) |
| 0.6 | 5.7 | GO:0042501 | serine phosphorylation of STAT protein(GO:0042501) |
| 0.6 | 1.1 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.6 | 1.7 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.6 | 1.7 | GO:1903896 | positive regulation of IRE1-mediated unfolded protein response(GO:1903896) |
| 0.6 | 2.3 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.6 | 6.8 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.6 | 5.0 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.5 | 7.6 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.5 | 2.2 | GO:0002339 | B cell selection(GO:0002339) |
| 0.5 | 1.1 | GO:0036490 | regulation of translation in response to endoplasmic reticulum stress(GO:0036490) |
| 0.5 | 3.7 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.5 | 2.6 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.5 | 15.9 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.5 | 1.5 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.5 | 10.8 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.5 | 6.5 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.5 | 7.0 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.5 | 1.0 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.5 | 4.9 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.5 | 1.5 | GO:0009174 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.5 | 15.4 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
| 0.5 | 1.4 | GO:0003342 | proepicardium development(GO:0003342) septum transversum development(GO:0003343) epicardium morphogenesis(GO:1905223) |
| 0.5 | 8.1 | GO:0042531 | positive regulation of tyrosine phosphorylation of STAT protein(GO:0042531) |
| 0.5 | 2.4 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.5 | 1.4 | GO:0031120 | snRNA pseudouridine synthesis(GO:0031120) |
| 0.5 | 1.4 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.5 | 1.4 | GO:0006011 | UDP-glucose metabolic process(GO:0006011) |
| 0.5 | 0.5 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.5 | 0.5 | GO:0072719 | cellular response to cisplatin(GO:0072719) |
| 0.5 | 3.7 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.5 | 31.4 | GO:0001843 | neural tube closure(GO:0001843) tube closure(GO:0060606) |
| 0.5 | 2.3 | GO:0048665 | neuron fate specification(GO:0048665) |
| 0.5 | 5.0 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.4 | 7.2 | GO:0006415 | translational termination(GO:0006415) |
| 0.4 | 5.3 | GO:0006582 | melanin metabolic process(GO:0006582) melanin biosynthetic process(GO:0042438) |
| 0.4 | 2.2 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.4 | 1.3 | GO:0019441 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.4 | 2.6 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.4 | 6.0 | GO:0045672 | positive regulation of osteoclast differentiation(GO:0045672) |
| 0.4 | 7.3 | GO:1900048 | positive regulation of blood coagulation(GO:0030194) positive regulation of hemostasis(GO:1900048) |
| 0.4 | 16.4 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.4 | 5.0 | GO:0043277 | apoptotic cell clearance(GO:0043277) |
| 0.4 | 14.7 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.4 | 2.5 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
| 0.4 | 128.4 | GO:0051301 | cell division(GO:0051301) |
| 0.4 | 1.2 | GO:0071166 | ribonucleoprotein complex localization(GO:0071166) |
| 0.4 | 2.7 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.4 | 2.0 | GO:0034766 | negative regulation of ion transmembrane transport(GO:0034766) |
| 0.4 | 16.2 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.4 | 4.2 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.4 | 2.3 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.4 | 1.5 | GO:0003177 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
| 0.4 | 0.7 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.4 | 0.7 | GO:2000779 | regulation of double-strand break repair(GO:2000779) |
| 0.4 | 6.6 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 0.4 | 4.4 | GO:0051298 | centrosome duplication(GO:0051298) |
| 0.4 | 6.1 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.4 | 1.4 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.4 | 4.3 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.4 | 11.3 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.3 | 0.7 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.3 | 5.2 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.3 | 7.2 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.3 | 3.8 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.3 | 12.9 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
| 0.3 | 1.3 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.3 | 3.9 | GO:0007398 | ectoderm development(GO:0007398) |
| 0.3 | 1.6 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.3 | 2.8 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.3 | 0.3 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) positive regulation of androgen receptor activity(GO:2000825) |
| 0.3 | 0.3 | GO:0006404 | RNA import into nucleus(GO:0006404) |
| 0.3 | 0.6 | GO:2000399 | negative regulation of thymocyte aggregation(GO:2000399) |
| 0.3 | 2.4 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.3 | 7.3 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.3 | 2.4 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.3 | 1.5 | GO:2000273 | positive regulation of receptor activity(GO:2000273) |
| 0.3 | 2.1 | GO:0071549 | response to dexamethasone(GO:0071548) cellular response to dexamethasone stimulus(GO:0071549) |
| 0.3 | 5.9 | GO:1902807 | negative regulation of cell cycle G1/S phase transition(GO:1902807) negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.3 | 5.2 | GO:0044243 | multicellular organism catabolic process(GO:0044243) |
| 0.3 | 3.2 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
| 0.3 | 0.9 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.3 | 5.8 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.3 | 1.2 | GO:0002839 | positive regulation of response to tumor cell(GO:0002836) positive regulation of immune response to tumor cell(GO:0002839) |
| 0.3 | 16.7 | GO:0000187 | activation of MAPK activity(GO:0000187) |
| 0.3 | 5.5 | GO:0030901 | midbrain development(GO:0030901) |
| 0.3 | 1.7 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
| 0.3 | 1.7 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.3 | 3.1 | GO:0006972 | hyperosmotic response(GO:0006972) |
| 0.3 | 5.0 | GO:0060425 | lung morphogenesis(GO:0060425) |
| 0.3 | 3.9 | GO:0009409 | response to cold(GO:0009409) |
| 0.3 | 1.1 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.3 | 0.5 | GO:0061743 | motor learning(GO:0061743) |
| 0.3 | 5.8 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.3 | 0.8 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.3 | 5.0 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.3 | 0.3 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.3 | 0.5 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.3 | 5.3 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.3 | 2.0 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
| 0.2 | 8.0 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
| 0.2 | 1.0 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 | 2.9 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.2 | 0.7 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.2 | 2.4 | GO:0001841 | neural tube formation(GO:0001841) |
| 0.2 | 1.9 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.2 | 2.6 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.2 | 5.6 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.2 | 18.3 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
| 0.2 | 0.2 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
| 0.2 | 4.2 | GO:0045668 | negative regulation of osteoblast differentiation(GO:0045668) |
| 0.2 | 1.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.2 | 0.9 | GO:0072272 | proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
| 0.2 | 7.3 | GO:0045667 | regulation of osteoblast differentiation(GO:0045667) |
| 0.2 | 2.5 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.2 | 8.7 | GO:0030512 | negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
| 0.2 | 2.5 | GO:0051350 | negative regulation of lyase activity(GO:0051350) |
| 0.2 | 1.2 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
| 0.2 | 1.0 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.2 | 3.6 | GO:0042113 | B cell activation(GO:0042113) |
| 0.2 | 2.2 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
| 0.2 | 0.4 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.2 | 0.8 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.2 | 3.8 | GO:0006801 | superoxide metabolic process(GO:0006801) |
| 0.2 | 1.3 | GO:0010833 | telomere maintenance via telomere lengthening(GO:0010833) |
| 0.2 | 1.3 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.2 | 3.9 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
| 0.2 | 1.4 | GO:0045040 | outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) |
| 0.2 | 1.9 | GO:0032366 | intracellular sterol transport(GO:0032366) intracellular cholesterol transport(GO:0032367) |
| 0.2 | 0.9 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.2 | 2.6 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.2 | 1.2 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.2 | 1.2 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
| 0.2 | 1.5 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.2 | 1.5 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.2 | 0.2 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
| 0.2 | 2.3 | GO:0050832 | response to fungus(GO:0009620) defense response to fungus(GO:0050832) |
| 0.2 | 0.9 | GO:0032196 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) transposition(GO:0032196) |
| 0.2 | 3.0 | GO:1903432 | regulation of TORC1 signaling(GO:1903432) |
| 0.2 | 4.5 | GO:0016925 | protein sumoylation(GO:0016925) |
| 0.2 | 0.6 | GO:0052695 | cellular glucuronidation(GO:0052695) |
| 0.2 | 0.3 | GO:0070508 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.2 | 2.0 | GO:0015780 | nucleotide-sugar transport(GO:0015780) |
| 0.1 | 2.8 | GO:0030500 | regulation of bone mineralization(GO:0030500) |
| 0.1 | 1.3 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.1 | 0.4 | GO:0031643 | positive regulation of myelination(GO:0031643) |
| 0.1 | 6.4 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
| 0.1 | 0.4 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.1 | 1.7 | GO:0014002 | astrocyte development(GO:0014002) |
| 0.1 | 5.6 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.1 | 2.7 | GO:0051930 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
| 0.1 | 6.4 | GO:0001676 | long-chain fatty acid metabolic process(GO:0001676) |
| 0.1 | 4.1 | GO:1901880 | negative regulation of protein depolymerization(GO:1901880) |
| 0.1 | 0.3 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 | 0.1 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
| 0.1 | 0.8 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.1 | 1.0 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
| 0.1 | 0.5 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.1 | 0.3 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.1 | 0.1 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.1 | 4.9 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 2.4 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 | 0.4 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 | 0.6 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.1 | 0.3 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.1 | 1.5 | GO:0007052 | mitotic spindle organization(GO:0007052) |
| 0.1 | 1.2 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.1 | 0.8 | GO:0016559 | peroxisome fission(GO:0016559) |
| 0.1 | 0.6 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.1 | 2.0 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.1 | 2.6 | GO:0014003 | oligodendrocyte development(GO:0014003) |
| 0.1 | 1.2 | GO:0006907 | pinocytosis(GO:0006907) |
| 0.1 | 4.8 | GO:0006414 | translational elongation(GO:0006414) |
| 0.1 | 1.4 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.1 | 2.5 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.1 | 0.8 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.1 | 2.6 | GO:1901998 | toxin transport(GO:1901998) |
| 0.1 | 0.3 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.1 | 0.5 | GO:1903564 | regulation of protein localization to cilium(GO:1903564) |
| 0.1 | 0.3 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
| 0.1 | 3.8 | GO:0007187 | G-protein coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger(GO:0007187) |
| 0.1 | 0.9 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.1 | 0.9 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.1 | 1.7 | GO:0010259 | multicellular organism aging(GO:0010259) |
| 0.1 | 0.1 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.1 | 2.6 | GO:0032526 | response to retinoic acid(GO:0032526) |
| 0.1 | 1.2 | GO:0048144 | fibroblast proliferation(GO:0048144) |
| 0.1 | 0.7 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.1 | 1.8 | GO:0046039 | GTP metabolic process(GO:0046039) |
| 0.1 | 0.3 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.1 | 0.5 | GO:0003170 | heart valve development(GO:0003170) |
| 0.1 | 0.4 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.1 | 4.5 | GO:0006457 | protein folding(GO:0006457) |
| 0.1 | 1.4 | GO:0006625 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.1 | 0.1 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.1 | 0.2 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 0.7 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.1 | 0.4 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.5 | GO:0010667 | negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
| 0.0 | 0.1 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.0 | 0.4 | GO:0022401 | desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) |
| 0.0 | 0.1 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.0 | 0.5 | GO:0046856 | phospholipid dephosphorylation(GO:0046839) phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 | 0.8 | GO:0048477 | oogenesis(GO:0048477) |
| 0.0 | 0.2 | GO:0045931 | positive regulation of mitotic cell cycle(GO:0045931) |
| 0.0 | 0.8 | GO:0070527 | platelet aggregation(GO:0070527) |
| 0.0 | 0.2 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.0 | 0.4 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.0 | 0.1 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
| 0.0 | 0.6 | GO:2000045 | regulation of G1/S transition of mitotic cell cycle(GO:2000045) |
| 0.0 | 0.0 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
| 0.0 | 0.2 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.0 | 0.1 | GO:0019363 | pyridine nucleotide biosynthetic process(GO:0019363) |
| 0.0 | 0.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.0 | 0.0 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.1 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
| 0.0 | 0.5 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.0 | 0.3 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.0 | 0.3 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.1 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 67.8 | 339.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 37.2 | 186.2 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 33.0 | 132.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 25.0 | 100.0 | GO:0002111 | BRCA2-BRAF35 complex(GO:0002111) |
| 22.4 | 157.1 | GO:0005818 | aster(GO:0005818) |
| 21.1 | 105.6 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 20.2 | 100.8 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 18.0 | 53.9 | GO:0036387 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 15.8 | 47.5 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 15.2 | 60.8 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 13.9 | 41.7 | GO:0000801 | central element(GO:0000801) |
| 13.0 | 39.0 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 12.7 | 216.6 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 11.8 | 58.9 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 11.3 | 101.6 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 8.9 | 44.4 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 7.2 | 93.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 7.1 | 21.3 | GO:1990423 | RZZ complex(GO:1990423) |
| 6.9 | 6.9 | GO:0042585 | germinal vesicle(GO:0042585) |
| 6.8 | 27.3 | GO:0035339 | SPOTS complex(GO:0035339) |
| 6.5 | 13.0 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
| 5.9 | 11.8 | GO:0043224 | nuclear SCF ubiquitin ligase complex(GO:0043224) |
| 5.9 | 147.0 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 5.8 | 407.5 | GO:0000786 | nucleosome(GO:0000786) |
| 5.6 | 27.8 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 5.4 | 21.7 | GO:0043293 | apoptosome(GO:0043293) |
| 5.0 | 201.2 | GO:0005876 | spindle microtubule(GO:0005876) |
| 5.0 | 15.1 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 4.8 | 14.5 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 4.7 | 32.6 | GO:0001940 | male pronucleus(GO:0001940) |
| 4.6 | 73.7 | GO:0010369 | chromocenter(GO:0010369) |
| 4.5 | 17.8 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 4.2 | 63.5 | GO:0042555 | MCM complex(GO:0042555) |
| 4.1 | 20.5 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 4.1 | 61.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 3.9 | 19.5 | GO:0072687 | meiotic spindle(GO:0072687) |
| 3.9 | 54.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 3.8 | 15.2 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 3.8 | 11.4 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 3.7 | 18.7 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 3.7 | 188.2 | GO:0005657 | replication fork(GO:0005657) |
| 3.6 | 14.4 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 3.5 | 14.0 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 3.5 | 51.8 | GO:0031011 | Ino80 complex(GO:0031011) |
| 3.4 | 3.4 | GO:0001739 | sex chromatin(GO:0001739) |
| 3.4 | 13.6 | GO:0071942 | XPC complex(GO:0071942) |
| 3.3 | 19.5 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 3.2 | 12.8 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 3.1 | 37.8 | GO:0045120 | pronucleus(GO:0045120) |
| 3.1 | 151.0 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 3.1 | 304.4 | GO:0000793 | condensed chromosome(GO:0000793) |
| 3.1 | 30.8 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 3.0 | 6.0 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 3.0 | 3.0 | GO:0035061 | interchromatin granule(GO:0035061) |
| 2.9 | 37.8 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 2.8 | 25.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 2.8 | 143.7 | GO:0005871 | kinesin complex(GO:0005871) |
| 2.8 | 11.1 | GO:0043219 | lateral loop(GO:0043219) |
| 2.8 | 280.0 | GO:0000776 | kinetochore(GO:0000776) |
| 2.8 | 33.1 | GO:0016580 | Sin3 complex(GO:0016580) |
| 2.7 | 19.0 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 2.7 | 2.7 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 2.5 | 7.5 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 2.5 | 34.6 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 2.4 | 7.1 | GO:0071914 | prominosome(GO:0071914) |
| 2.3 | 16.4 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 2.3 | 15.9 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 2.2 | 13.5 | GO:0034448 | EGO complex(GO:0034448) |
| 2.2 | 2.2 | GO:0000811 | GINS complex(GO:0000811) |
| 2.2 | 8.8 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 2.2 | 21.9 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 2.1 | 8.5 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 2.1 | 12.6 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 1.9 | 40.8 | GO:0005682 | U5 snRNP(GO:0005682) |
| 1.9 | 1.9 | GO:0005687 | U4 snRNP(GO:0005687) |
| 1.9 | 9.3 | GO:0016589 | NURF complex(GO:0016589) |
| 1.8 | 14.5 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 1.8 | 190.2 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 1.7 | 10.5 | GO:0070187 | telosome(GO:0070187) |
| 1.7 | 20.8 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 1.7 | 14.9 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 1.7 | 29.8 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 1.6 | 6.6 | GO:0033269 | internode region of axon(GO:0033269) |
| 1.6 | 22.7 | GO:0031528 | microvillus membrane(GO:0031528) |
| 1.6 | 9.5 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 1.6 | 148.3 | GO:0005814 | centriole(GO:0005814) |
| 1.5 | 12.3 | GO:0042382 | paraspeckles(GO:0042382) |
| 1.5 | 12.1 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 1.4 | 21.7 | GO:0000242 | pericentriolar material(GO:0000242) |
| 1.4 | 20.2 | GO:0030008 | TRAPP complex(GO:0030008) |
| 1.4 | 19.8 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 1.4 | 5.6 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
| 1.4 | 4.2 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
| 1.4 | 5.5 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 1.4 | 92.3 | GO:0005643 | nuclear pore(GO:0005643) |
| 1.3 | 2.5 | GO:0034715 | U7 snRNP(GO:0005683) pICln-Sm protein complex(GO:0034715) |
| 1.2 | 10.0 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 1.2 | 3.7 | GO:0031251 | PAN complex(GO:0031251) |
| 1.2 | 18.5 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 1.2 | 13.5 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 1.2 | 29.2 | GO:0001891 | phagocytic cup(GO:0001891) |
| 1.2 | 3.6 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 1.2 | 4.8 | GO:0032437 | cuticular plate(GO:0032437) |
| 1.2 | 21.5 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
| 1.2 | 365.5 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 1.1 | 76.1 | GO:0016605 | PML body(GO:0016605) |
| 1.1 | 3.4 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 1.1 | 12.1 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 1.1 | 8.8 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 1.1 | 4.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 1.1 | 5.5 | GO:0097226 | sperm mitochondrial sheath(GO:0097226) |
| 1.1 | 6.4 | GO:0097452 | GAIT complex(GO:0097452) |
| 1.0 | 4.1 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
| 1.0 | 5.0 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 1.0 | 3.0 | GO:1990597 | TRAF2-GSTP1 complex(GO:0097057) AIP1-IRE1 complex(GO:1990597) |
| 1.0 | 14.4 | GO:0000346 | transcription export complex(GO:0000346) |
| 1.0 | 7.6 | GO:0005883 | neurofilament(GO:0005883) |
| 0.9 | 10.4 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.9 | 7.5 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.9 | 2.8 | GO:0038045 | large latent transforming growth factor-beta complex(GO:0038045) |
| 0.9 | 2.8 | GO:0034657 | GID complex(GO:0034657) |
| 0.9 | 10.6 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.9 | 1.8 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.9 | 7.0 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.9 | 0.9 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.9 | 8.7 | GO:0097449 | astrocyte projection(GO:0097449) |
| 0.9 | 6.1 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.9 | 5.1 | GO:0044305 | calyx of Held(GO:0044305) |
| 0.9 | 14.5 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.8 | 12.7 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.8 | 5.0 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.8 | 2.5 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
| 0.8 | 10.6 | GO:0045180 | basal cortex(GO:0045180) |
| 0.8 | 12.9 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.8 | 242.0 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.8 | 1.6 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.8 | 4.6 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.8 | 32.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.7 | 2.2 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.7 | 2.9 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.7 | 4.3 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.7 | 2.8 | GO:0098888 | extrinsic component of presynaptic membrane(GO:0098888) |
| 0.7 | 7.7 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.7 | 32.0 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.7 | 7.6 | GO:0032039 | integrator complex(GO:0032039) |
| 0.7 | 4.1 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.7 | 9.4 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.7 | 4.0 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.7 | 4.6 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.6 | 3.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.6 | 34.9 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.6 | 1.8 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.6 | 5.4 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.6 | 13.2 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.6 | 2.4 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.6 | 154.3 | GO:0016607 | nuclear speck(GO:0016607) |
| 0.6 | 8.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.6 | 78.5 | GO:0005813 | centrosome(GO:0005813) |
| 0.6 | 2.2 | GO:0097447 | dendritic tree(GO:0097447) |
| 0.6 | 1.1 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.5 | 6.6 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.5 | 6.5 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.5 | 15.6 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.5 | 0.5 | GO:0044301 | climbing fiber(GO:0044301) |
| 0.5 | 3.7 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.5 | 118.3 | GO:0005694 | chromosome(GO:0005694) |
| 0.5 | 32.1 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.5 | 4.1 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.5 | 3.6 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.5 | 9.7 | GO:0005605 | basal lamina(GO:0005605) |
| 0.5 | 2.0 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.5 | 5.4 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.5 | 22.9 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.5 | 7.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.5 | 8.7 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.5 | 11.0 | GO:0005875 | microtubule associated complex(GO:0005875) |
| 0.5 | 23.9 | GO:0005844 | polysome(GO:0005844) |
| 0.4 | 2.6 | GO:0031415 | NatA complex(GO:0031415) |
| 0.4 | 3.9 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.4 | 2.6 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.4 | 5.1 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.4 | 0.4 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.4 | 24.1 | GO:0016234 | inclusion body(GO:0016234) |
| 0.4 | 2.0 | GO:0097443 | sorting endosome(GO:0097443) cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.4 | 2.4 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.4 | 9.2 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.4 | 19.3 | GO:0016459 | myosin complex(GO:0016459) |
| 0.4 | 3.8 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.4 | 1.5 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.4 | 10.4 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.4 | 1.1 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.4 | 26.1 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.3 | 18.8 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.3 | 8.7 | GO:0097546 | ciliary base(GO:0097546) |
| 0.3 | 5.1 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.3 | 1.9 | GO:0044308 | axonal spine(GO:0044308) |
| 0.3 | 1.3 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.3 | 18.8 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.3 | 4.6 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.3 | 4.2 | GO:0030663 | COPI vesicle coat(GO:0030126) COPI-coated vesicle membrane(GO:0030663) |
| 0.3 | 3.0 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.3 | 1.7 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.3 | 3.2 | GO:0044754 | autolysosome(GO:0044754) |
| 0.3 | 19.3 | GO:0015934 | large ribosomal subunit(GO:0015934) |
| 0.3 | 16.2 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.3 | 4.1 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.3 | 25.7 | GO:0043204 | perikaryon(GO:0043204) |
| 0.2 | 1.9 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.2 | 18.2 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.2 | 1.7 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.2 | 5.8 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.2 | 4.0 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.2 | 3.0 | GO:0036038 | MKS complex(GO:0036038) |
| 0.2 | 9.0 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.2 | 3.0 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.2 | 36.1 | GO:0016604 | nuclear body(GO:0016604) |
| 0.2 | 1.0 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.2 | 1.4 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.2 | 8.7 | GO:0005815 | microtubule organizing center(GO:0005815) |
| 0.2 | 3.9 | GO:0016592 | mediator complex(GO:0016592) |
| 0.2 | 1.3 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.2 | 1.3 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.2 | 1.3 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.2 | 1.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.2 | 1.0 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.2 | 5.9 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.2 | 18.1 | GO:0005874 | microtubule(GO:0005874) |
| 0.2 | 6.0 | GO:0070469 | respiratory chain(GO:0070469) |
| 0.2 | 0.6 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.2 | 0.5 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.2 | 3.8 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.2 | 1.1 | GO:1904949 | ATPase dependent transmembrane transport complex(GO:0098533) ATPase complex(GO:1904949) |
| 0.1 | 3.2 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.1 | 0.6 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.1 | 633.5 | GO:0005634 | nucleus(GO:0005634) |
| 0.1 | 2.0 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 1.4 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
| 0.1 | 0.6 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.5 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.1 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.0 | 0.3 | GO:0005776 | autophagosome(GO:0005776) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 41.1 | 164.2 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 35.5 | 142.0 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 26.9 | 80.7 | GO:0035939 | microsatellite binding(GO:0035939) |
| 25.9 | 129.5 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 25.8 | 103.3 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 21.6 | 21.6 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 20.7 | 62.1 | GO:0033680 | ATP-dependent DNA/RNA helicase activity(GO:0033680) |
| 19.5 | 117.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 18.7 | 112.1 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 16.4 | 82.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 13.9 | 13.9 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 11.3 | 90.5 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 10.3 | 92.3 | GO:0035173 | histone kinase activity(GO:0035173) |
| 9.2 | 27.5 | GO:0000700 | mismatch base pair DNA N-glycosylase activity(GO:0000700) |
| 9.0 | 26.9 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 8.2 | 32.9 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 8.1 | 398.8 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 7.6 | 30.2 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 7.0 | 42.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 6.9 | 27.5 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 6.7 | 47.1 | GO:0070840 | dynein complex binding(GO:0070840) |
| 6.3 | 44.4 | GO:0000150 | recombinase activity(GO:0000150) |
| 6.3 | 18.9 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
| 6.2 | 61.8 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 6.2 | 24.7 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 5.9 | 94.1 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 5.8 | 81.3 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 5.5 | 16.4 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
| 5.3 | 21.2 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 5.2 | 20.7 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 5.0 | 15.1 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
| 4.9 | 68.0 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 4.8 | 53.1 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 4.8 | 52.7 | GO:0008430 | selenium binding(GO:0008430) |
| 4.6 | 13.8 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 4.6 | 41.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 4.5 | 72.5 | GO:0003680 | AT DNA binding(GO:0003680) |
| 4.5 | 18.0 | GO:0046790 | virion binding(GO:0046790) |
| 4.5 | 17.8 | GO:1990254 | keratin filament binding(GO:1990254) |
| 4.4 | 48.1 | GO:0070888 | E-box binding(GO:0070888) |
| 4.3 | 12.9 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 4.2 | 54.6 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 4.1 | 16.3 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 4.0 | 281.3 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 3.9 | 35.0 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 3.9 | 15.5 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 3.7 | 15.0 | GO:0008142 | oxysterol binding(GO:0008142) |
| 3.6 | 18.0 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 3.5 | 87.6 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 3.5 | 20.8 | GO:0070728 | leucine binding(GO:0070728) |
| 3.5 | 31.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 3.4 | 26.8 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 3.3 | 9.9 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 3.3 | 26.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 3.2 | 9.6 | GO:0098809 | nitrite reductase activity(GO:0098809) |
| 3.2 | 9.6 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 3.1 | 12.5 | GO:0070279 | vitamin B6 binding(GO:0070279) |
| 3.1 | 3.1 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 3.1 | 12.3 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 3.0 | 30.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 3.0 | 12.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 3.0 | 15.0 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 3.0 | 8.9 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 3.0 | 14.9 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
| 2.9 | 11.6 | GO:0004096 | aminoacylase activity(GO:0004046) catalase activity(GO:0004096) |
| 2.9 | 11.6 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 2.8 | 11.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 2.8 | 71.7 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 2.6 | 153.6 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 2.6 | 121.8 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 2.6 | 51.7 | GO:0008483 | transaminase activity(GO:0008483) |
| 2.6 | 7.7 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 2.6 | 20.5 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 2.5 | 27.8 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 2.5 | 9.9 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 2.5 | 34.4 | GO:0035198 | miRNA binding(GO:0035198) |
| 2.4 | 7.2 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 2.4 | 16.8 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 2.4 | 14.3 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 2.4 | 283.6 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 2.3 | 53.2 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 2.3 | 25.2 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 2.3 | 6.8 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
| 2.3 | 9.0 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 2.2 | 40.4 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 2.2 | 13.4 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 2.2 | 11.1 | GO:0050700 | CARD domain binding(GO:0050700) |
| 2.2 | 13.2 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 2.2 | 6.5 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
| 2.1 | 75.2 | GO:0050699 | WW domain binding(GO:0050699) |
| 2.1 | 25.8 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 2.1 | 93.8 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 2.1 | 14.9 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 2.1 | 12.4 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 2.0 | 34.5 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 2.0 | 20.3 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 2.0 | 2.0 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) type 2A serotonin receptor binding(GO:0031826) |
| 2.0 | 142.3 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 2.0 | 14.0 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 2.0 | 4.0 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 2.0 | 8.0 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 2.0 | 13.9 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 2.0 | 11.9 | GO:0042731 | PH domain binding(GO:0042731) |
| 2.0 | 21.8 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 2.0 | 5.9 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
| 2.0 | 11.7 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 1.9 | 13.5 | GO:0050733 | RS domain binding(GO:0050733) |
| 1.9 | 9.6 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 1.9 | 11.3 | GO:0097016 | L27 domain binding(GO:0097016) |
| 1.9 | 9.4 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 1.9 | 20.7 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 1.9 | 7.5 | GO:0036435 | deubiquitinase activator activity(GO:0035800) K48-linked polyubiquitin binding(GO:0036435) |
| 1.8 | 5.5 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 1.8 | 5.5 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 1.8 | 19.9 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 1.8 | 7.1 | GO:0047134 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) protein-disulfide reductase activity(GO:0047134) |
| 1.8 | 5.3 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 1.7 | 5.2 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) serine binding(GO:0070905) |
| 1.7 | 10.4 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 1.7 | 5.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 1.7 | 34.4 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 1.7 | 8.6 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 1.7 | 5.1 | GO:0001565 | phorbol ester receptor activity(GO:0001565) non-kinase phorbol ester receptor activity(GO:0001566) |
| 1.7 | 5.1 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
| 1.7 | 304.0 | GO:0001047 | core promoter binding(GO:0001047) |
| 1.7 | 11.7 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 1.7 | 14.9 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 1.6 | 9.9 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 1.6 | 4.9 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 1.6 | 20.6 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 1.6 | 9.5 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 1.5 | 3.1 | GO:0015925 | galactosidase activity(GO:0015925) |
| 1.5 | 6.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 1.5 | 6.0 | GO:0036468 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
| 1.5 | 6.0 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) |
| 1.5 | 4.5 | GO:0047710 | bis(5'-adenosyl)-triphosphatase activity(GO:0047710) |
| 1.5 | 5.9 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 1.5 | 5.9 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 1.5 | 4.4 | GO:0030984 | kininogen binding(GO:0030984) |
| 1.5 | 7.3 | GO:0005534 | galactose binding(GO:0005534) |
| 1.4 | 5.8 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 1.4 | 21.7 | GO:0046977 | TAP binding(GO:0046977) |
| 1.4 | 7.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 1.4 | 7.0 | GO:0043532 | angiostatin binding(GO:0043532) |
| 1.4 | 8.4 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 1.4 | 18.1 | GO:0031386 | protein tag(GO:0031386) |
| 1.3 | 26.6 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 1.3 | 20.8 | GO:0016594 | glycine binding(GO:0016594) |
| 1.3 | 43.5 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 1.2 | 1.2 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 1.2 | 208.1 | GO:0042393 | histone binding(GO:0042393) |
| 1.2 | 30.7 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 1.2 | 21.3 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 1.2 | 5.8 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 1.2 | 12.7 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 1.2 | 1.2 | GO:0003681 | bent DNA binding(GO:0003681) |
| 1.1 | 3.4 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 1.1 | 7.7 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 1.1 | 8.8 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 1.1 | 226.5 | GO:0008017 | microtubule binding(GO:0008017) |
| 1.1 | 16.0 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 1.1 | 4.2 | GO:0019808 | polyamine binding(GO:0019808) |
| 1.0 | 27.6 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 1.0 | 5.0 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.9 | 6.6 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) lysophosphatidic acid receptor activity(GO:0070915) |
| 0.9 | 3.8 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.9 | 3.7 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.9 | 59.4 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
| 0.9 | 4.6 | GO:0070404 | NADH binding(GO:0070404) |
| 0.9 | 2.7 | GO:0004637 | phosphoribosylamine-glycine ligase activity(GO:0004637) |
| 0.9 | 13.7 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.9 | 9.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.9 | 1.8 | GO:0016725 | oxidoreductase activity, acting on CH or CH2 groups(GO:0016725) |
| 0.9 | 12.4 | GO:0000981 | RNA polymerase II transcription factor activity, sequence-specific DNA binding(GO:0000981) |
| 0.9 | 1.8 | GO:0005113 | patched binding(GO:0005113) |
| 0.9 | 17.5 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.8 | 12.6 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.8 | 11.7 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.8 | 1.6 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.8 | 3.2 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.8 | 4.7 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.8 | 34.1 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
| 0.8 | 8.4 | GO:0070990 | snRNP binding(GO:0070990) |
| 0.8 | 7.6 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.8 | 6.8 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.8 | 6.8 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.8 | 1.5 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.7 | 3.0 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.7 | 3.6 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.7 | 5.0 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.7 | 14.3 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.7 | 43.1 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.7 | 4.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.7 | 2.8 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.7 | 5.5 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.7 | 3.3 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.7 | 2.0 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.7 | 2.0 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.7 | 2.0 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.7 | 228.2 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
| 0.7 | 34.1 | GO:0003774 | motor activity(GO:0003774) |
| 0.6 | 7.6 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.6 | 3.8 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.6 | 4.4 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.6 | 2.5 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.6 | 17.1 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.6 | 2.4 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.6 | 3.6 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.6 | 16.8 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.6 | 6.5 | GO:0055103 | ligase regulator activity(GO:0055103) ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.6 | 13.0 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.6 | 1.8 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.6 | 2.4 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.6 | 1.7 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.6 | 36.9 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.6 | 2.2 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.6 | 12.7 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.5 | 2.2 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.5 | 10.3 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.5 | 3.2 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.5 | 2.6 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.5 | 11.5 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.5 | 1.6 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.5 | 1.5 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.5 | 1.5 | GO:0004658 | propionyl-CoA carboxylase activity(GO:0004658) |
| 0.5 | 2.0 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.5 | 3.5 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.5 | 3.5 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.5 | 9.0 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.5 | 46.1 | GO:0004386 | helicase activity(GO:0004386) |
| 0.5 | 2.4 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.5 | 6.3 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.5 | 10.2 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.5 | 16.9 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.5 | 2.3 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.5 | 1.8 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.4 | 2.2 | GO:0031628 | opioid receptor binding(GO:0031628) |
| 0.4 | 8.0 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.4 | 2.2 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.4 | 7.5 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.4 | 1.3 | GO:0030249 | cyclase regulator activity(GO:0010851) guanylate cyclase regulator activity(GO:0030249) |
| 0.4 | 2.6 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.4 | 1.3 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.4 | 5.5 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.4 | 2.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.4 | 2.4 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.4 | 2.0 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.4 | 32.7 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.4 | 10.1 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.4 | 98.0 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.4 | 2.0 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.4 | 27.0 | GO:0097110 | scaffold protein binding(GO:0097110) |
| 0.4 | 3.5 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.4 | 1.1 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.4 | 1.9 | GO:0042301 | phosphate ion binding(GO:0042301) |
| 0.4 | 1.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.4 | 13.6 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.4 | 1.5 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.4 | 1.1 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.4 | 8.7 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.4 | 2.9 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.4 | 6.1 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.4 | 1.1 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.4 | 8.6 | GO:0005504 | fatty acid binding(GO:0005504) |
| 0.4 | 3.2 | GO:0035326 | enhancer binding(GO:0035326) |
| 0.4 | 2.8 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.4 | 11.2 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.3 | 3.4 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.3 | 3.8 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.3 | 3.0 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.3 | 1.0 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.3 | 14.3 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.3 | 4.0 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.3 | 3.0 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.3 | 3.6 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.3 | 1.0 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.3 | 3.9 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.3 | 2.9 | GO:0016004 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
| 0.3 | 6.0 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
| 0.3 | 7.8 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.3 | 2.7 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.3 | 3.3 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.3 | 3.9 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.3 | 0.9 | GO:0004454 | ketohexokinase activity(GO:0004454) |
| 0.3 | 1.4 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.3 | 1.7 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.3 | 5.1 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.3 | 31.7 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.3 | 1.7 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.3 | 5.3 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.3 | 1.1 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.3 | 34.8 | GO:0005516 | calmodulin binding(GO:0005516) |
| 0.3 | 0.8 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.3 | 2.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.3 | 0.8 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.2 | 1.2 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.2 | 2.0 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.2 | 1.2 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.2 | 7.4 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.2 | 4.8 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.2 | 0.9 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.2 | 1.6 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
| 0.2 | 1.4 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.2 | 0.9 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.2 | 70.0 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.2 | 2.1 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.2 | 12.5 | GO:0005179 | hormone activity(GO:0005179) |
| 0.2 | 4.6 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.2 | 0.9 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.2 | 1.9 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.2 | 2.8 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) RNA polymerase activity(GO:0034062) |
| 0.2 | 1.6 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.2 | 13.5 | GO:0008083 | growth factor activity(GO:0008083) |
| 0.2 | 168.6 | GO:0003677 | DNA binding(GO:0003677) |
| 0.2 | 6.7 | GO:0009055 | electron carrier activity(GO:0009055) |
| 0.2 | 0.7 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.2 | 6.5 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.2 | 17.6 | GO:0004713 | protein tyrosine kinase activity(GO:0004713) |
| 0.2 | 1.9 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.2 | 1.0 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.2 | 2.2 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.2 | 12.9 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.2 | 0.5 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.2 | 1.5 | GO:0051861 | glycolipid binding(GO:0051861) |
| 0.1 | 3.6 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.1 | 0.6 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.1 | 22.3 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.1 | 0.4 | GO:0001094 | RNA polymerase II basal transcription factor binding(GO:0001091) TFIID-class transcription factor binding(GO:0001094) |
| 0.1 | 2.8 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.3 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
| 0.1 | 0.6 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.1 | 1.5 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.1 | 4.6 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.4 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.1 | 1.4 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.1 | 0.2 | GO:0008227 | G-protein coupled amine receptor activity(GO:0008227) |
| 0.1 | 0.5 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.1 | 3.2 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.1 | 2.7 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.1 | 0.4 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.1 | 2.3 | GO:0043621 | protein self-association(GO:0043621) |
| 0.1 | 1.1 | GO:0052744 | phosphatidylinositol-3-phosphatase activity(GO:0004438) phosphatidylinositol monophosphate phosphatase activity(GO:0052744) |
| 0.1 | 2.8 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.1 | 0.4 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.1 | 0.6 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
| 0.1 | 7.8 | GO:0031625 | ubiquitin protein ligase binding(GO:0031625) |
| 0.1 | 4.3 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.1 | 1.7 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.1 | 13.2 | GO:0061659 | ubiquitin-like protein ligase activity(GO:0061659) |
| 0.1 | 1.3 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 0.2 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
| 0.1 | 0.2 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.1 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.1 | 1.0 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.1 | 0.3 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.0 | 0.4 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.5 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.0 | 0.4 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.0 | 0.1 | GO:0046997 | sarcosine dehydrogenase activity(GO:0008480) oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
| 0.0 | 0.2 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.4 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.1 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.2 | GO:0051536 | iron-sulfur cluster binding(GO:0051536) metal cluster binding(GO:0051540) |
| 0.0 | 0.8 | GO:0019905 | syntaxin binding(GO:0019905) |
| 0.0 | 0.1 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 16.3 | 1030.0 | PID_PLK1_PATHWAY | PLK1 signaling events |
| 11.0 | 153.7 | SA_REG_CASCADE_OF_CYCLIN_EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 10.2 | 376.1 | PID_FOXM1_PATHWAY | FOXM1 transcription factor network |
| 5.1 | 167.2 | PID_AURORA_A_PATHWAY | Aurora A signaling |
| 4.1 | 193.6 | PID_FANCONI_PATHWAY | Fanconi anemia pathway |
| 3.9 | 145.4 | PID_DELTA_NP63_PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 3.8 | 127.0 | PID_AURORA_B_PATHWAY | Aurora B signaling |
| 3.5 | 95.6 | PID_HEDGEHOG_2PATHWAY | Signaling events mediated by the Hedgehog family |
| 2.9 | 167.4 | PID_IL12_2PATHWAY | IL12-mediated signaling events |
| 2.9 | 84.6 | PID_SMAD2_3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 2.8 | 27.5 | PID_RANBP2_PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 2.7 | 50.9 | PID_MYC_PATHWAY | C-MYC pathway |
| 2.3 | 145.3 | PID_TELOMERASE_PATHWAY | Regulation of Telomerase |
| 2.1 | 105.4 | PID_HES_HEY_PATHWAY | Notch-mediated HES/HEY network |
| 1.8 | 21.3 | PID_S1P_S1P4_PATHWAY | S1P4 pathway |
| 1.7 | 98.8 | PID_E2F_PATHWAY | E2F transcription factor network |
| 1.3 | 20.2 | PID_EPHA2_FWD_PATHWAY | EPHA2 forward signaling |
| 1.2 | 7.2 | PID_ERBB1_RECEPTOR_PROXIMAL_PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 1.2 | 3.6 | PID_SYNDECAN_1_PATHWAY | Syndecan-1-mediated signaling events |
| 1.2 | 28.2 | PID_P38_ALPHA_BETA_PATHWAY | Regulation of p38-alpha and p38-beta |
| 1.1 | 13.7 | PID_BARD1_PATHWAY | BARD1 signaling events |
| 1.1 | 38.2 | PID_RAS_PATHWAY | Regulation of Ras family activation |
| 1.0 | 34.5 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
| 1.0 | 28.7 | PID_ERBB2_ERBB3_PATHWAY | ErbB2/ErbB3 signaling events |
| 1.0 | 1.9 | PID_IL3_PATHWAY | IL3-mediated signaling events |
| 0.9 | 39.1 | PID_BETA_CATENIN_NUC_PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.9 | 60.8 | PID_CMYB_PATHWAY | C-MYB transcription factor network |
| 0.9 | 27.7 | PID_RHOA_PATHWAY | RhoA signaling pathway |
| 0.9 | 74.9 | WNT_SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.9 | 24.1 | PID_SYNDECAN_4_PATHWAY | Syndecan-4-mediated signaling events |
| 0.9 | 23.2 | PID_INSULIN_GLUCOSE_PATHWAY | Insulin-mediated glucose transport |
| 0.8 | 39.0 | PID_MET_PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.8 | 12.0 | PID_RAC1_PATHWAY | RAC1 signaling pathway |
| 0.7 | 47.3 | PID_CDC42_PATHWAY | CDC42 signaling events |
| 0.7 | 7.8 | PID_FRA_PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.7 | 4.2 | PID_INTEGRIN_A9B1_PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.6 | 6.4 | PID_HDAC_CLASSIII_PATHWAY | Signaling events mediated by HDAC Class III |
| 0.5 | 30.2 | PID_AR_PATHWAY | Coregulation of Androgen receptor activity |
| 0.5 | 13.3 | PID_TOLL_ENDOGENOUS_PATHWAY | Endogenous TLR signaling |
| 0.5 | 2.5 | PID_THROMBIN_PAR1_PATHWAY | PAR1-mediated thrombin signaling events |
| 0.5 | 2.3 | SA_FAS_SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.5 | 13.7 | PID_RXR_VDR_PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.4 | 9.6 | PID_FOXO_PATHWAY | FoxO family signaling |
| 0.4 | 22.3 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.4 | 16.8 | PID_HDAC_CLASSI_PATHWAY | Signaling events mediated by HDAC Class I |
| 0.4 | 4.0 | PID_TCR_CALCIUM_PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.4 | 9.6 | PID_ERBB4_PATHWAY | ErbB4 signaling events |
| 0.3 | 7.0 | PID_HEDGEHOG_GLI_PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.3 | 1.6 | PID_IL23_PATHWAY | IL23-mediated signaling events |
| 0.3 | 3.0 | PID_TRAIL_PATHWAY | TRAIL signaling pathway |
| 0.3 | 2.6 | PID_IL1_PATHWAY | IL1-mediated signaling events |
| 0.3 | 10.3 | PID_MTOR_4PATHWAY | mTOR signaling pathway |
| 0.3 | 2.3 | PID_ATM_PATHWAY | ATM pathway |
| 0.2 | 2.5 | ST_PHOSPHOINOSITIDE_3_KINASE_PATHWAY | PI3K Pathway |
| 0.2 | 3.1 | PID_HDAC_CLASSII_PATHWAY | Signaling events mediated by HDAC Class II |
| 0.2 | 11.4 | PID_MYC_ACTIV_PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.2 | 2.8 | PID_INTEGRIN5_PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.2 | 11.3 | PID_RHOA_REG_PATHWAY | Regulation of RhoA activity |
| 0.2 | 1.0 | PID_AVB3_INTEGRIN_PATHWAY | Integrins in angiogenesis |
| 0.2 | 6.1 | PID_CASPASE_PATHWAY | Caspase cascade in apoptosis |
| 0.1 | 2.1 | PID_P38_MK2_PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 1.1 | PID_NECTIN_PATHWAY | Nectin adhesion pathway |
| 0.1 | 2.1 | PID_RET_PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.1 | 3.5 | PID_BMP_PATHWAY | BMP receptor signaling |
| 0.1 | 0.4 | PID_CXCR4_PATHWAY | CXCR4-mediated signaling events |
| 0.1 | 4.0 | PID_HIF1_TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 2.5 | PID_RAC1_REG_PATHWAY | Regulation of RAC1 activity |
| 0.1 | 2.3 | PID_HNF3B_PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 1.5 | PID_ILK_PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 1.6 | PID_ECADHERIN_STABILIZATION_PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.1 | 0.6 | PID_ATF2_PATHWAY | ATF-2 transcription factor network |
| 0.1 | 0.7 | PID_ATR_PATHWAY | ATR signaling pathway |
| 0.0 | 0.2 | PID_ERBB1_INTERNALIZATION_PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.1 | PID_SYNDECAN_2_PATHWAY | Syndecan-2-mediated signaling events |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 18.4 | 312.5 | REACTOME_CYCLIN_A_B1_ASSOCIATED_EVENTS_DURING_G2_M_TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 13.8 | 220.6 | REACTOME_ASSOCIATION_OF_LICENSING_FACTORS_WITH_THE_PRE_REPLICATIVE_COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 13.2 | 39.7 | REACTOME_G2_M_DNA_DAMAGE_CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 9.5 | 151.7 | REACTOME_APOPTOSIS_INDUCED_DNA_FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 9.0 | 198.6 | REACTOME_APC_CDC20_MEDIATED_DEGRADATION_OF_NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 8.9 | 239.9 | REACTOME_KINESINS | Genes involved in Kinesins |
| 8.0 | 231.1 | REACTOME_ACTIVATION_OF_THE_PRE_REPLICATIVE_COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 7.9 | 198.7 | REACTOME_DEPOSITION_OF_NEW_CENPA_CONTAINING_NUCLEOSOMES_AT_THE_CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 7.8 | 407.6 | REACTOME_RNA_POL_I_PROMOTER_OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 7.1 | 63.7 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_ATF6_ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 6.7 | 94.0 | REACTOME_SYNTHESIS_SECRETION_AND_INACTIVATION_OF_GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 6.1 | 505.8 | REACTOME_MITOTIC_PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 4.7 | 32.9 | REACTOME_ENDOGENOUS_STEROLS | Genes involved in Endogenous sterols |
| 4.0 | 40.3 | REACTOME_HYALURONAN_UPTAKE_AND_DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 3.5 | 31.9 | REACTOME_G1_S_SPECIFIC_TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 3.3 | 271.3 | REACTOME_NRAGE_SIGNALS_DEATH_THROUGH_JNK | Genes involved in NRAGE signals death through JNK |
| 3.2 | 67.2 | REACTOME_FANCONI_ANEMIA_PATHWAY | Genes involved in Fanconi Anemia pathway |
| 2.9 | 35.4 | REACTOME_IL_6_SIGNALING | Genes involved in Interleukin-6 signaling |
| 2.9 | 75.9 | REACTOME_G1_PHASE | Genes involved in G1 Phase |
| 2.6 | 36.2 | REACTOME_G0_AND_EARLY_G1 | Genes involved in G0 and Early G1 |
| 2.3 | 47.0 | REACTOME_ABCA_TRANSPORTERS_IN_LIPID_HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 2.1 | 61.2 | REACTOME_REGULATION_OF_BETA_CELL_DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 2.1 | 10.5 | REACTOME_PACKAGING_OF_TELOMERE_ENDS | Genes involved in Packaging Of Telomere Ends |
| 2.0 | 2.0 | REACTOME_SEMA3A_PLEXIN_REPULSION_SIGNALING_BY_INHIBITING_INTEGRIN_ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 1.7 | 18.9 | REACTOME_PURINE_CATABOLISM | Genes involved in Purine catabolism |
| 1.6 | 84.9 | REACTOME_APC_C_CDH1_MEDIATED_DEGRADATION_OF_CDC20_AND_OTHER_APC_C_CDH1_TARGETED_PROTEINS_IN_LATE_MITOSIS_EARLY_G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 1.6 | 25.3 | REACTOME_TRAF6_MEDIATED_IRF7_ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 1.5 | 51.5 | REACTOME_GLUCOSE_TRANSPORT | Genes involved in Glucose transport |
| 1.5 | 19.2 | REACTOME_N_GLYCAN_TRIMMING_IN_THE_ER_AND_CALNEXIN_CALRETICULIN_CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 1.4 | 37.4 | REACTOME_AMINO_ACID_SYNTHESIS_AND_INTERCONVERSION_TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 1.4 | 16.8 | REACTOME_SLBP_DEPENDENT_PROCESSING_OF_REPLICATION_DEPENDENT_HISTONE_PRE_MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 1.4 | 58.7 | REACTOME_ANTIVIRAL_MECHANISM_BY_IFN_STIMULATED_GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 1.4 | 73.0 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 1.3 | 14.6 | REACTOME_BASE_FREE_SUGAR_PHOSPHATE_REMOVAL_VIA_THE_SINGLE_NUCLEOTIDE_REPLACEMENT_PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 1.3 | 88.7 | REACTOME_NOTCH1_INTRACELLULAR_DOMAIN_REGULATES_TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 1.3 | 15.4 | REACTOME_STEROID_HORMONES | Genes involved in Steroid hormones |
| 1.2 | 11.9 | REACTOME_HOMOLOGOUS_RECOMBINATION_REPAIR_OF_REPLICATION_INDEPENDENT_DOUBLE_STRAND_BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 1.2 | 13.8 | REACTOME_MEIOTIC_RECOMBINATION | Genes involved in Meiotic Recombination |
| 1.1 | 40.2 | REACTOME_GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 1.1 | 83.7 | REACTOME_FACTORS_INVOLVED_IN_MEGAKARYOCYTE_DEVELOPMENT_AND_PLATELET_PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 1.1 | 20.1 | REACTOME_CASPASE_MEDIATED_CLEAVAGE_OF_CYTOSKELETAL_PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 1.0 | 3.0 | REACTOME_UNWINDING_OF_DNA | Genes involved in Unwinding of DNA |
| 1.0 | 6.8 | REACTOME_REGULATION_OF_ORNITHINE_DECARBOXYLASE_ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 1.0 | 14.3 | REACTOME_ADENYLATE_CYCLASE_INHIBITORY_PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.9 | 13.0 | REACTOME_OXYGEN_DEPENDENT_PROLINE_HYDROXYLATION_OF_HYPOXIA_INDUCIBLE_FACTOR_ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.9 | 12.6 | REACTOME_ACTIVATION_OF_BH3_ONLY_PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.9 | 11.3 | REACTOME_EXTENSION_OF_TELOMERES | Genes involved in Extension of Telomeres |
| 0.8 | 11.2 | REACTOME_VITAMIN_B5_PANTOTHENATE_METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.8 | 22.3 | REACTOME_SIGNALING_BY_HIPPO | Genes involved in Signaling by Hippo |
| 0.8 | 11.4 | REACTOME_PROCESSING_OF_INTRONLESS_PRE_MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.8 | 5.3 | REACTOME_DESTABILIZATION_OF_MRNA_BY_AUF1_HNRNP_D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.7 | 2.2 | REACTOME_G_PROTEIN_ACTIVATION | Genes involved in G-protein activation |
| 0.7 | 20.1 | REACTOME_CLEAVAGE_OF_GROWING_TRANSCRIPT_IN_THE_TERMINATION_REGION_ | Genes involved in Cleavage of Growing Transcript in the Termination Region |
| 0.7 | 10.4 | REACTOME_IONOTROPIC_ACTIVITY_OF_KAINATE_RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.7 | 6.6 | REACTOME_P2Y_RECEPTORS | Genes involved in P2Y receptors |
| 0.7 | 17.0 | REACTOME_SULFUR_AMINO_ACID_METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.7 | 5.9 | REACTOME_ACTIVATION_OF_ATR_IN_RESPONSE_TO_REPLICATION_STRESS | Genes involved in Activation of ATR in response to replication stress |
| 0.7 | 12.1 | REACTOME_MRNA_DECAY_BY_5_TO_3_EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.7 | 2.1 | REACTOME_ENDOSOMAL_VACUOLAR_PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.7 | 4.1 | REACTOME_TRANSLOCATION_OF_ZAP_70_TO_IMMUNOLOGICAL_SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.7 | 3.4 | REACTOME_CELL_DEATH_SIGNALLING_VIA_NRAGE_NRIF_AND_NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.7 | 23.7 | REACTOME_SIGNALING_BY_NOTCH1 | Genes involved in Signaling by NOTCH1 |
| 0.6 | 4.9 | REACTOME_RAF_MAP_KINASE_CASCADE | Genes involved in RAF/MAP kinase cascade |
| 0.6 | 23.0 | REACTOME_GLUCOSE_METABOLISM | Genes involved in Glucose metabolism |
| 0.5 | 6.0 | REACTOME_AMINE_DERIVED_HORMONES | Genes involved in Amine-derived hormones |
| 0.5 | 2.2 | REACTOME_ETHANOL_OXIDATION | Genes involved in Ethanol oxidation |
| 0.5 | 12.5 | REACTOME_ACTIVATED_AMPK_STIMULATES_FATTY_ACID_OXIDATION_IN_MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.5 | 14.6 | REACTOME_NEPHRIN_INTERACTIONS | Genes involved in Nephrin interactions |
| 0.5 | 25.3 | REACTOME_FORMATION_OF_THE_TERNARY_COMPLEX_AND_SUBSEQUENTLY_THE_43S_COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.5 | 12.7 | REACTOME_SYNTHESIS_OF_GLYCOSYLPHOSPHATIDYLINOSITOL_GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.4 | 6.2 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.4 | 9.7 | REACTOME_ENOS_ACTIVATION_AND_REGULATION | Genes involved in eNOS activation and regulation |
| 0.4 | 2.5 | REACTOME_THROMBIN_SIGNALLING_THROUGH_PROTEINASE_ACTIVATED_RECEPTORS_PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.4 | 2.9 | REACTOME_CTLA4_INHIBITORY_SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.4 | 2.8 | REACTOME_P38MAPK_EVENTS | Genes involved in p38MAPK events |
| 0.4 | 21.8 | REACTOME_LOSS_OF_NLP_FROM_MITOTIC_CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.4 | 34.9 | REACTOME_MRNA_SPLICING | Genes involved in mRNA Splicing |
| 0.4 | 3.5 | REACTOME_INTERACTIONS_OF_VPR_WITH_HOST_CELLULAR_PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.4 | 6.2 | REACTOME_PURINE_SALVAGE | Genes involved in Purine salvage |
| 0.4 | 3.4 | REACTOME_MRNA_CAPPING | Genes involved in mRNA Capping |
| 0.4 | 3.8 | REACTOME_COPI_MEDIATED_TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.4 | 27.4 | REACTOME_METABOLISM_OF_AMINO_ACIDS_AND_DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.3 | 9.9 | REACTOME_REGULATION_OF_MRNA_STABILITY_BY_PROTEINS_THAT_BIND_AU_RICH_ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.3 | 24.8 | REACTOME_NONSENSE_MEDIATED_DECAY_ENHANCED_BY_THE_EXON_JUNCTION_COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.3 | 14.3 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.3 | 24.4 | REACTOME_CLASS_B_2_SECRETIN_FAMILY_RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.3 | 2.9 | REACTOME_DOWNSTREAM_TCR_SIGNALING | Genes involved in Downstream TCR signaling |
| 0.3 | 2.6 | REACTOME_POST_TRANSLATIONAL_MODIFICATION_SYNTHESIS_OF_GPI_ANCHORED_PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.3 | 0.3 | REACTOME_APOBEC3G_MEDIATED_RESISTANCE_TO_HIV1_INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.2 | 1.0 | REACTOME_REGULATION_OF_HYPOXIA_INDUCIBLE_FACTOR_HIF_BY_OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.2 | 22.6 | REACTOME_RESPIRATORY_ELECTRON_TRANSPORT_ATP_SYNTHESIS_BY_CHEMIOSMOTIC_COUPLING_AND_HEAT_PRODUCTION_BY_UNCOUPLING_PROTEINS_ | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.2 | 5.5 | REACTOME_SYNTHESIS_AND_INTERCONVERSION_OF_NUCLEOTIDE_DI_AND_TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.2 | 3.4 | REACTOME_ACTIVATED_TAK1_MEDIATES_P38_MAPK_ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.2 | 1.1 | REACTOME_ELEVATION_OF_CYTOSOLIC_CA2_LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.2 | 1.5 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.2 | 1.3 | REACTOME_REGULATION_OF_INSULIN_SECRETION_BY_ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.2 | 3.8 | REACTOME_METABOLISM_OF_PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.2 | 5.5 | REACTOME_SMOOTH_MUSCLE_CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.2 | 1.0 | REACTOME_DOWNREGULATION_OF_ERBB2_ERBB3_SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 2.5 | REACTOME_PYRIMIDINE_METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.1 | 8.2 | REACTOME_NUCLEAR_RECEPTOR_TRANSCRIPTION_PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 4.4 | REACTOME_HS_GAG_BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.1 | 1.5 | REACTOME_MITOCHONDRIAL_FATTY_ACID_BETA_OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 2.3 | REACTOME_CHEMOKINE_RECEPTORS_BIND_CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 0.6 | REACTOME_GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.1 | 1.7 | REACTOME_AMINE_COMPOUND_SLC_TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.1 | 1.4 | REACTOME_YAP1_AND_WWTR1_TAZ_STIMULATED_GENE_EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 0.2 | REACTOME_ACTIVATION_OF_GENES_BY_ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.1 | 0.8 | REACTOME_BILE_ACID_AND_BILE_SALT_METABOLISM | Genes involved in Bile acid and bile salt metabolism |
| 0.1 | 5.0 | REACTOME_METABOLISM_OF_CARBOHYDRATES | Genes involved in Metabolism of carbohydrates |
| 0.1 | 1.5 | REACTOME_SIGNALING_BY_BMP | Genes involved in Signaling by BMP |
| 0.1 | 0.9 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
| 0.1 | 0.5 | REACTOME_METAL_ION_SLC_TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.6 | REACTOME_IMMUNOREGULATORY_INTERACTIONS_BETWEEN_A_LYMPHOID_AND_A_NON_LYMPHOID_CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 0.4 | REACTOME_NUCLEAR_SIGNALING_BY_ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 1.2 | REACTOME_METABOLISM_OF_VITAMINS_AND_COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.1 | REACTOME_P75NTR_SIGNALS_VIA_NFKB | Genes involved in p75NTR signals via NF-kB |
| 0.0 | 0.9 | REACTOME_ASSOCIATION_OF_TRIC_CCT_WITH_TARGET_PROTEINS_DURING_BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.4 | REACTOME_RNA_POL_II_TRANSCRIPTION_PRE_INITIATION_AND_PROMOTER_OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.2 | REACTOME_EXTRINSIC_PATHWAY_FOR_APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.5 | REACTOME_O_LINKED_GLYCOSYLATION_OF_MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 0.1 | REACTOME_SEMA3A_PAK_DEPENDENT_AXON_REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
|
|
|