| 4.1 |
12.2 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 3.1 |
12.4 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 3.1 |
12.3 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 2.9 |
20.0 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 2.7 |
8.0 |
GO:0061743 |
motor learning(GO:0061743) |
| 2.6 |
7.9 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 2.6 |
7.8 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 2.5 |
10.1 |
GO:0048382 |
mesendoderm development(GO:0048382) |
| 2.4 |
7.2 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 2.4 |
11.8 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 2.3 |
2.3 |
GO:1902913 |
regulation of melanocyte differentiation(GO:0045634) positive regulation of melanocyte differentiation(GO:0045636) positive regulation of developmental pigmentation(GO:0048087) regulation of pigment cell differentiation(GO:0050932) positive regulation of pigment cell differentiation(GO:0050942) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 2.3 |
9.2 |
GO:0060032 |
notochord regression(GO:0060032) |
| 2.3 |
6.9 |
GO:1901420 |
negative regulation of response to alcohol(GO:1901420) |
| 2.2 |
6.7 |
GO:0086017 |
Purkinje myocyte action potential(GO:0086017) |
| 2.2 |
11.2 |
GO:0003199 |
endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 2.2 |
6.5 |
GO:0061153 |
trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 2.1 |
6.4 |
GO:0009177 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 2.1 |
6.3 |
GO:0060364 |
frontal suture morphogenesis(GO:0060364) |
| 2.1 |
6.2 |
GO:0030421 |
defecation(GO:0030421) |
| 2.0 |
10.1 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 2.0 |
8.1 |
GO:0003360 |
brainstem development(GO:0003360) |
| 2.0 |
2.0 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 1.9 |
3.9 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 1.9 |
9.7 |
GO:0015705 |
iodide transport(GO:0015705) |
| 1.9 |
9.6 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 1.9 |
15.3 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 1.9 |
9.5 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 1.9 |
5.7 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 1.9 |
5.6 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 1.9 |
7.5 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 1.9 |
9.3 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 1.8 |
3.6 |
GO:0072076 |
nephrogenic mesenchyme development(GO:0072076) |
| 1.8 |
5.3 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 1.7 |
5.1 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 1.7 |
6.8 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 1.7 |
5.1 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 1.7 |
10.1 |
GO:0060718 |
chorionic trophoblast cell differentiation(GO:0060718) |
| 1.7 |
1.7 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 1.6 |
4.8 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 1.6 |
4.8 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 1.6 |
4.8 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 1.6 |
4.7 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 1.5 |
18.4 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 1.5 |
6.1 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 1.5 |
6.1 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 1.5 |
5.9 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 1.5 |
5.8 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 1.4 |
1.4 |
GO:0006282 |
regulation of DNA repair(GO:0006282) |
| 1.4 |
7.2 |
GO:2000065 |
negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 1.4 |
5.7 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 1.4 |
5.7 |
GO:0010046 |
response to mycotoxin(GO:0010046) |
| 1.4 |
4.2 |
GO:0060217 |
hemangioblast cell differentiation(GO:0060217) |
| 1.4 |
2.8 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 1.4 |
2.8 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 1.4 |
5.5 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 1.4 |
2.7 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 1.4 |
4.1 |
GO:0035604 |
fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) coronal suture morphogenesis(GO:0060365) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) |
| 1.4 |
6.8 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 1.4 |
4.1 |
GO:0002636 |
positive regulation of germinal center formation(GO:0002636) |
| 1.3 |
4.0 |
GO:0034241 |
positive regulation of macrophage fusion(GO:0034241) |
| 1.3 |
6.7 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 1.3 |
1.3 |
GO:1903960 |
negative regulation of anion transmembrane transport(GO:1903960) |
| 1.3 |
1.3 |
GO:1904339 |
negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 1.3 |
1.3 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 1.3 |
6.7 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 1.3 |
5.3 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 1.3 |
3.9 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 1.3 |
3.9 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 1.3 |
5.2 |
GO:1904398 |
positive regulation of neuromuscular junction development(GO:1904398) |
| 1.3 |
5.2 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 1.3 |
3.9 |
GO:0045590 |
negative regulation of regulatory T cell differentiation(GO:0045590) |
| 1.3 |
9.0 |
GO:0000320 |
re-entry into mitotic cell cycle(GO:0000320) |
| 1.3 |
3.8 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 1.3 |
3.8 |
GO:0072204 |
cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 1.3 |
7.6 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 1.3 |
1.3 |
GO:1903011 |
negative regulation of bone development(GO:1903011) |
| 1.3 |
3.8 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 1.3 |
1.3 |
GO:0002339 |
B cell selection(GO:0002339) |
| 1.3 |
2.5 |
GO:0014028 |
notochord formation(GO:0014028) |
| 1.2 |
3.7 |
GO:0046655 |
glycine biosynthetic process(GO:0006545) folic acid metabolic process(GO:0046655) |
| 1.2 |
6.2 |
GO:0034372 |
very-low-density lipoprotein particle remodeling(GO:0034372) |
| 1.2 |
3.7 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 1.2 |
7.3 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 1.2 |
2.4 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 1.2 |
8.5 |
GO:0071699 |
olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 1.2 |
4.9 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) |
| 1.2 |
3.6 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 1.2 |
6.0 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 1.2 |
10.9 |
GO:0032825 |
positive regulation of natural killer cell differentiation(GO:0032825) |
| 1.2 |
3.6 |
GO:0009812 |
flavonoid metabolic process(GO:0009812) flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 1.2 |
3.6 |
GO:0060676 |
ureteric bud formation(GO:0060676) |
| 1.2 |
3.6 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 1.2 |
3.6 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 1.2 |
1.2 |
GO:0038165 |
oncostatin-M-mediated signaling pathway(GO:0038165) |
| 1.2 |
5.9 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 1.2 |
4.7 |
GO:0019372 |
lipoxygenase pathway(GO:0019372) |
| 1.2 |
1.2 |
GO:0046628 |
positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 1.2 |
1.2 |
GO:0035878 |
nail development(GO:0035878) |
| 1.2 |
5.8 |
GO:0034441 |
plasma lipoprotein particle oxidation(GO:0034441) |
| 1.2 |
9.3 |
GO:1901724 |
positive regulation of cell proliferation involved in kidney development(GO:1901724) |
| 1.2 |
1.2 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 1.1 |
12.6 |
GO:0060252 |
positive regulation of glial cell proliferation(GO:0060252) |
| 1.1 |
5.7 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 1.1 |
2.3 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 1.1 |
4.4 |
GO:0071139 |
resolution of recombination intermediates(GO:0071139) |
| 1.1 |
4.4 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 1.1 |
3.3 |
GO:0014009 |
glial cell proliferation(GO:0014009) |
| 1.1 |
4.4 |
GO:1903288 |
regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
| 1.1 |
2.2 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 1.1 |
1.1 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 1.1 |
3.3 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 1.1 |
27.2 |
GO:0048385 |
regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 1.1 |
1.1 |
GO:0035330 |
regulation of hippo signaling(GO:0035330) |
| 1.1 |
4.3 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 1.1 |
1.1 |
GO:0015677 |
copper ion import(GO:0015677) |
| 1.1 |
5.3 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 1.1 |
2.1 |
GO:0003100 |
regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 1.1 |
1.1 |
GO:0045137 |
development of primary sexual characteristics(GO:0045137) |
| 1.0 |
8.3 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 1.0 |
1.0 |
GO:0007354 |
zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 1.0 |
6.2 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 1.0 |
3.1 |
GO:0003273 |
cell migration involved in endocardial cushion formation(GO:0003273) |
| 1.0 |
16.5 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 1.0 |
6.2 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 1.0 |
5.1 |
GO:0010668 |
ectodermal cell differentiation(GO:0010668) |
| 1.0 |
10.2 |
GO:0061299 |
retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 1.0 |
7.1 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 1.0 |
3.0 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 1.0 |
2.0 |
GO:2000009 |
negative regulation of protein localization to cell surface(GO:2000009) |
| 1.0 |
4.0 |
GO:0035624 |
receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 1.0 |
2.0 |
GO:0048619 |
embryonic hindgut morphogenesis(GO:0048619) |
| 1.0 |
2.0 |
GO:0001705 |
ectoderm formation(GO:0001705) |
| 1.0 |
1.0 |
GO:1900157 |
regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 1.0 |
2.0 |
GO:0015669 |
gas transport(GO:0015669) oxygen transport(GO:0015671) |
| 1.0 |
2.9 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 1.0 |
3.9 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 1.0 |
3.9 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 1.0 |
4.9 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 1.0 |
1.9 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 1.0 |
7.7 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.9 |
1.9 |
GO:0002678 |
positive regulation of chronic inflammatory response(GO:0002678) |
| 0.9 |
2.8 |
GO:0010835 |
regulation of protein ADP-ribosylation(GO:0010835) |
| 0.9 |
6.6 |
GO:1904667 |
negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.9 |
2.8 |
GO:0006507 |
GPI anchor release(GO:0006507) |
| 0.9 |
0.9 |
GO:0031944 |
negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
| 0.9 |
2.8 |
GO:0032058 |
positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.9 |
1.9 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 0.9 |
2.8 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.9 |
2.8 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.9 |
3.7 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.9 |
4.6 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.9 |
2.8 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 0.9 |
0.9 |
GO:0043101 |
purine-containing compound salvage(GO:0043101) |
| 0.9 |
1.8 |
GO:0048319 |
axial mesoderm morphogenesis(GO:0048319) |
| 0.9 |
2.7 |
GO:2000402 |
negative regulation of lymphocyte migration(GO:2000402) |
| 0.9 |
12.6 |
GO:0060579 |
ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 0.9 |
0.9 |
GO:0048680 |
positive regulation of axon regeneration(GO:0048680) |
| 0.9 |
3.6 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.9 |
0.9 |
GO:0060279 |
positive regulation of ovulation(GO:0060279) |
| 0.9 |
2.7 |
GO:0007341 |
penetration of zona pellucida(GO:0007341) |
| 0.9 |
2.7 |
GO:0014891 |
striated muscle atrophy(GO:0014891) |
| 0.9 |
2.6 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.9 |
6.1 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.9 |
5.2 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.9 |
7.8 |
GO:0046499 |
S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.9 |
0.9 |
GO:0097709 |
connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
| 0.9 |
0.9 |
GO:0010899 |
regulation of phosphatidylcholine catabolic process(GO:0010899) |
| 0.9 |
4.3 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.9 |
1.7 |
GO:0003223 |
ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.9 |
1.7 |
GO:0035188 |
blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.9 |
0.9 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.9 |
2.6 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.9 |
2.6 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.9 |
3.4 |
GO:0071883 |
activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.9 |
2.6 |
GO:0070103 |
regulation of interleukin-6-mediated signaling pathway(GO:0070103) negative regulation of interleukin-6-mediated signaling pathway(GO:0070104) |
| 0.8 |
2.5 |
GO:0045656 |
negative regulation of monocyte differentiation(GO:0045656) |
| 0.8 |
11.9 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.8 |
3.3 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 0.8 |
3.3 |
GO:0072385 |
minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.8 |
3.3 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.8 |
2.5 |
GO:0019659 |
glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.8 |
4.9 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 0.8 |
2.5 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 0.8 |
4.1 |
GO:0031946 |
regulation of glucocorticoid biosynthetic process(GO:0031946) |
| 0.8 |
2.4 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.8 |
0.8 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.8 |
3.2 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.8 |
2.4 |
GO:0030214 |
hyaluronan catabolic process(GO:0030214) |
| 0.8 |
4.0 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.8 |
2.4 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.8 |
1.6 |
GO:0007290 |
spermatid nucleus elongation(GO:0007290) |
| 0.8 |
2.4 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.8 |
10.4 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.8 |
11.2 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 0.8 |
4.0 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.8 |
3.2 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.8 |
2.4 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.8 |
0.8 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.8 |
3.1 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.8 |
3.1 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.8 |
7.0 |
GO:0001977 |
renal system process involved in regulation of blood volume(GO:0001977) |
| 0.8 |
3.1 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.8 |
2.3 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.8 |
5.4 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.8 |
1.5 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.8 |
0.8 |
GO:0097049 |
motor neuron apoptotic process(GO:0097049) regulation of motor neuron apoptotic process(GO:2000671) |
| 0.8 |
0.8 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 0.8 |
0.8 |
GO:0051695 |
actin filament uncapping(GO:0051695) |
| 0.8 |
3.8 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.8 |
1.5 |
GO:0007351 |
tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.8 |
2.3 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 0.8 |
0.8 |
GO:1901796 |
regulation of signal transduction by p53 class mediator(GO:1901796) |
| 0.8 |
1.5 |
GO:0003256 |
regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003256) |
| 0.7 |
1.5 |
GO:0038091 |
VEGF-activated platelet-derived growth factor receptor signaling pathway(GO:0038086) positive regulation of cell proliferation by VEGF-activated platelet derived growth factor receptor signaling pathway(GO:0038091) |
| 0.7 |
5.2 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 0.7 |
5.2 |
GO:1902459 |
positive regulation of stem cell population maintenance(GO:1902459) |
| 0.7 |
2.2 |
GO:0003177 |
pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
| 0.7 |
2.2 |
GO:0030222 |
eosinophil differentiation(GO:0030222) |
| 0.7 |
3.0 |
GO:0061298 |
retina vasculature development in camera-type eye(GO:0061298) |
| 0.7 |
1.5 |
GO:0060686 |
regulation of prostatic bud formation(GO:0060685) negative regulation of prostatic bud formation(GO:0060686) |
| 0.7 |
2.2 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.7 |
14.8 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.7 |
2.2 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.7 |
3.7 |
GO:2001185 |
regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.7 |
5.1 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.7 |
1.5 |
GO:0002765 |
immune response-inhibiting signal transduction(GO:0002765) |
| 0.7 |
2.9 |
GO:0034638 |
phosphatidylcholine catabolic process(GO:0034638) |
| 0.7 |
0.7 |
GO:0042321 |
negative regulation of circadian sleep/wake cycle, sleep(GO:0042321) |
| 0.7 |
1.4 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 0.7 |
5.0 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.7 |
0.7 |
GO:0006590 |
thyroid hormone generation(GO:0006590) |
| 0.7 |
2.9 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.7 |
1.4 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.7 |
0.7 |
GO:0010878 |
cholesterol storage(GO:0010878) |
| 0.7 |
0.7 |
GO:0051024 |
positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.7 |
0.7 |
GO:0060455 |
negative regulation of gastric acid secretion(GO:0060455) |
| 0.7 |
2.1 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 0.7 |
2.1 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.7 |
7.0 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.7 |
2.1 |
GO:0060066 |
oviduct development(GO:0060066) |
| 0.7 |
5.6 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.7 |
2.1 |
GO:1901563 |
response to camptothecin(GO:1901563) |
| 0.7 |
4.2 |
GO:0060272 |
embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.7 |
2.1 |
GO:0045404 |
positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.7 |
20.8 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.7 |
7.6 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.7 |
2.1 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.7 |
4.1 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.7 |
15.8 |
GO:0042772 |
DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.7 |
1.4 |
GO:0045472 |
response to ether(GO:0045472) |
| 0.7 |
6.8 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.7 |
0.7 |
GO:0035025 |
positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.7 |
2.0 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.7 |
3.4 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.7 |
0.7 |
GO:1901068 |
guanosine-containing compound metabolic process(GO:1901068) |
| 0.7 |
2.0 |
GO:0090467 |
L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
| 0.7 |
1.3 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.7 |
2.7 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 0.7 |
4.7 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.7 |
3.3 |
GO:0031652 |
positive regulation of heat generation(GO:0031652) |
| 0.7 |
3.3 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.7 |
2.0 |
GO:0002088 |
lens development in camera-type eye(GO:0002088) |
| 0.7 |
1.3 |
GO:0061209 |
cell proliferation involved in mesonephros development(GO:0061209) mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) mesonephric duct development(GO:0072177) mesonephric duct morphogenesis(GO:0072180) |
| 0.7 |
2.0 |
GO:0070301 |
cellular response to hydrogen peroxide(GO:0070301) |
| 0.7 |
2.0 |
GO:0000050 |
urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 0.7 |
0.7 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.7 |
2.6 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.7 |
1.3 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.7 |
2.6 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) |
| 0.7 |
0.7 |
GO:0060414 |
aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.7 |
2.6 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.7 |
2.0 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 0.6 |
1.9 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.6 |
1.9 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.6 |
0.6 |
GO:0072498 |
embryonic skeletal joint development(GO:0072498) |
| 0.6 |
1.9 |
GO:0046104 |
thymidine metabolic process(GO:0046104) |
| 0.6 |
1.9 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.6 |
5.1 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.6 |
2.5 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.6 |
6.4 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.6 |
1.3 |
GO:0061643 |
chemorepulsion of axon(GO:0061643) |
| 0.6 |
0.6 |
GO:0046544 |
development of secondary male sexual characteristics(GO:0046544) |
| 0.6 |
4.4 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.6 |
1.3 |
GO:0072137 |
condensed mesenchymal cell proliferation(GO:0072137) |
| 0.6 |
0.6 |
GO:0002741 |
positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.6 |
1.9 |
GO:0046874 |
quinolinate metabolic process(GO:0046874) |
| 0.6 |
2.5 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.6 |
0.6 |
GO:0060681 |
branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.6 |
1.3 |
GO:0010560 |
positive regulation of glycoprotein biosynthetic process(GO:0010560) |
| 0.6 |
3.1 |
GO:0051971 |
positive regulation of transmission of nerve impulse(GO:0051971) |
| 0.6 |
1.9 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.6 |
1.9 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.6 |
4.3 |
GO:1900107 |
regulation of nodal signaling pathway(GO:1900107) |
| 0.6 |
3.1 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.6 |
4.9 |
GO:0003197 |
endocardial cushion development(GO:0003197) |
| 0.6 |
0.6 |
GO:0032782 |
bile acid secretion(GO:0032782) |
| 0.6 |
1.2 |
GO:0010757 |
negative regulation of plasminogen activation(GO:0010757) |
| 0.6 |
1.2 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.6 |
6.1 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 0.6 |
1.8 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.6 |
1.2 |
GO:2000138 |
positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.6 |
3.6 |
GO:1902166 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.6 |
2.4 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.6 |
2.4 |
GO:0042795 |
snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.6 |
1.8 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.6 |
6.0 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.6 |
1.2 |
GO:0050673 |
epithelial cell proliferation(GO:0050673) |
| 0.6 |
3.0 |
GO:0044829 |
positive regulation by host of viral genome replication(GO:0044829) |
| 0.6 |
1.2 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.6 |
1.8 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 0.6 |
3.0 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.6 |
2.4 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.6 |
13.0 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.6 |
4.7 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.6 |
0.6 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.6 |
1.8 |
GO:0070836 |
caveola assembly(GO:0070836) |
| 0.6 |
2.9 |
GO:0032515 |
negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.6 |
4.1 |
GO:0060068 |
vagina development(GO:0060068) |
| 0.6 |
1.8 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.6 |
3.5 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.6 |
0.6 |
GO:0090370 |
negative regulation of cholesterol efflux(GO:0090370) |
| 0.6 |
1.7 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.6 |
1.2 |
GO:0032000 |
positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.6 |
1.2 |
GO:0042637 |
catagen(GO:0042637) |
| 0.6 |
2.9 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.6 |
16.2 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 0.6 |
1.7 |
GO:0032962 |
positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.6 |
4.0 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.6 |
2.9 |
GO:2000676 |
regulation of type B pancreatic cell apoptotic process(GO:2000674) positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.6 |
1.7 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 0.6 |
2.3 |
GO:0060266 |
negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
| 0.6 |
1.7 |
GO:0000087 |
mitotic M phase(GO:0000087) mitotic cell cycle phase(GO:0098763) |
| 0.6 |
2.3 |
GO:0007039 |
protein catabolic process in the vacuole(GO:0007039) |
| 0.6 |
2.3 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.6 |
0.6 |
GO:0002901 |
mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.6 |
4.0 |
GO:0045830 |
positive regulation of isotype switching(GO:0045830) |
| 0.6 |
3.4 |
GO:0006108 |
malate metabolic process(GO:0006108) |
| 0.6 |
0.6 |
GO:0034728 |
nucleosome organization(GO:0034728) |
| 0.6 |
1.7 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.6 |
1.1 |
GO:0046084 |
adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.6 |
1.1 |
GO:0072079 |
nephron tubule formation(GO:0072079) |
| 0.6 |
2.8 |
GO:0071896 |
protein localization to adherens junction(GO:0071896) |
| 0.6 |
2.2 |
GO:0019740 |
nitrogen utilization(GO:0019740) |
| 0.6 |
2.2 |
GO:0043921 |
modulation by host of viral transcription(GO:0043921) positive regulation by host of viral transcription(GO:0043923) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
| 0.6 |
2.8 |
GO:0060161 |
positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.6 |
4.5 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.6 |
0.6 |
GO:0070571 |
negative regulation of neuron projection regeneration(GO:0070571) |
| 0.6 |
7.2 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.6 |
5.0 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.6 |
16.6 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.6 |
1.7 |
GO:0034162 |
toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.6 |
2.8 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.6 |
2.8 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.6 |
1.1 |
GO:0072539 |
T-helper 17 cell differentiation(GO:0072539) |
| 0.6 |
2.8 |
GO:0006534 |
cysteine metabolic process(GO:0006534) |
| 0.5 |
1.1 |
GO:0007494 |
midgut development(GO:0007494) vein smooth muscle contraction(GO:0014826) |
| 0.5 |
2.2 |
GO:1903984 |
regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.5 |
2.7 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.5 |
1.1 |
GO:2001206 |
positive regulation of osteoclast development(GO:2001206) |
| 0.5 |
4.3 |
GO:0032310 |
prostaglandin secretion(GO:0032310) |
| 0.5 |
2.2 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.5 |
4.3 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.5 |
2.2 |
GO:0061325 |
extraocular skeletal muscle development(GO:0002074) cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) pulmonary myocardium development(GO:0003350) subthalamus development(GO:0021539) subthalamic nucleus development(GO:0021763) left lung development(GO:0060459) left lung morphogenesis(GO:0060460) pulmonary vein morphogenesis(GO:0060577) superior vena cava morphogenesis(GO:0060578) cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
| 0.5 |
0.5 |
GO:0021520 |
spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.5 |
0.5 |
GO:1902237 |
positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.5 |
2.1 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 0.5 |
1.1 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.5 |
0.5 |
GO:0007520 |
syncytium formation by plasma membrane fusion(GO:0000768) syncytium formation(GO:0006949) myoblast fusion(GO:0007520) |
| 0.5 |
11.8 |
GO:0007140 |
male meiosis(GO:0007140) |
| 0.5 |
3.2 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.5 |
1.1 |
GO:0090114 |
cargo loading into COPII-coated vesicle(GO:0090110) COPII-coated vesicle budding(GO:0090114) regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.5 |
2.7 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.5 |
2.1 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.5 |
2.1 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.5 |
1.6 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.5 |
2.1 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.5 |
5.3 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.5 |
0.5 |
GO:0048739 |
cardiac muscle fiber development(GO:0048739) |
| 0.5 |
1.0 |
GO:0014068 |
positive regulation of phosphatidylinositol 3-kinase signaling(GO:0014068) |
| 0.5 |
4.2 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.5 |
0.5 |
GO:2000253 |
positive regulation of feeding behavior(GO:2000253) |
| 0.5 |
1.6 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.5 |
0.5 |
GO:1902861 |
copper ion import into cell(GO:1902861) |
| 0.5 |
2.6 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.5 |
1.5 |
GO:0071649 |
regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.5 |
2.0 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.5 |
0.5 |
GO:0071166 |
ribonucleoprotein complex localization(GO:0071166) ribonucleoprotein complex export from nucleus(GO:0071426) |
| 0.5 |
2.0 |
GO:0035360 |
positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.5 |
2.5 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.5 |
1.5 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.5 |
7.6 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.5 |
2.0 |
GO:0043277 |
apoptotic cell clearance(GO:0043277) |
| 0.5 |
2.5 |
GO:0042167 |
heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.5 |
2.5 |
GO:0043584 |
nose development(GO:0043584) |
| 0.5 |
1.5 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.5 |
1.0 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.5 |
2.0 |
GO:0051305 |
chromosome movement towards spindle pole(GO:0051305) |
| 0.5 |
3.0 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.5 |
1.0 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.5 |
4.5 |
GO:0075522 |
IRES-dependent viral translational initiation(GO:0075522) |
| 0.5 |
3.0 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.5 |
0.5 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.5 |
3.0 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.5 |
2.0 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.5 |
1.5 |
GO:0060923 |
cardiac muscle cell fate commitment(GO:0060923) |
| 0.5 |
2.0 |
GO:0098908 |
regulation of neuronal action potential(GO:0098908) |
| 0.5 |
2.0 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.5 |
1.5 |
GO:0032493 |
response to bacterial lipoprotein(GO:0032493) |
| 0.5 |
2.9 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.5 |
3.9 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) |
| 0.5 |
2.0 |
GO:2001271 |
negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.5 |
1.0 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.5 |
3.4 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.5 |
1.0 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.5 |
3.4 |
GO:0070814 |
hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.5 |
5.8 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.5 |
0.5 |
GO:1902235 |
regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
| 0.5 |
0.5 |
GO:0060028 |
convergent extension involved in axis elongation(GO:0060028) |
| 0.5 |
1.9 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.5 |
1.0 |
GO:1901550 |
regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.5 |
2.9 |
GO:0010571 |
positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.5 |
4.3 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.5 |
2.9 |
GO:0001831 |
trophectodermal cellular morphogenesis(GO:0001831) |
| 0.5 |
2.4 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.5 |
0.5 |
GO:0086016 |
AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) AV node cell to bundle of His cell communication(GO:0086067) |
| 0.5 |
0.5 |
GO:0001553 |
luteinization(GO:0001553) |
| 0.5 |
1.9 |
GO:0048549 |
positive regulation of pinocytosis(GO:0048549) |
| 0.5 |
0.5 |
GO:0042939 |
glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 0.5 |
0.5 |
GO:0045778 |
positive regulation of ossification(GO:0045778) |
| 0.5 |
1.4 |
GO:0000076 |
DNA replication checkpoint(GO:0000076) |
| 0.5 |
3.7 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.5 |
0.9 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.5 |
2.3 |
GO:0042754 |
negative regulation of circadian rhythm(GO:0042754) |
| 0.5 |
1.9 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.5 |
0.9 |
GO:0045799 |
positive regulation of chromatin assembly or disassembly(GO:0045799) |
| 0.5 |
0.9 |
GO:0060623 |
regulation of chromosome condensation(GO:0060623) |
| 0.5 |
0.5 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.5 |
12.9 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.5 |
0.9 |
GO:0071603 |
endothelial cell-cell adhesion(GO:0071603) |
| 0.5 |
1.4 |
GO:0032066 |
nucleolus to nucleoplasm transport(GO:0032066) |
| 0.5 |
0.5 |
GO:2000637 |
positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.5 |
2.8 |
GO:1904666 |
regulation of ubiquitin protein ligase activity(GO:1904666) |
| 0.5 |
1.8 |
GO:0090272 |
negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.5 |
5.5 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.5 |
6.4 |
GO:0060236 |
regulation of mitotic spindle organization(GO:0060236) regulation of spindle organization(GO:0090224) |
| 0.5 |
7.3 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.5 |
3.2 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.5 |
0.9 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.5 |
1.8 |
GO:0015744 |
succinate transport(GO:0015744) |
| 0.5 |
0.5 |
GO:0072376 |
protein activation cascade(GO:0072376) |
| 0.5 |
1.8 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.5 |
3.6 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.5 |
0.5 |
GO:0036480 |
neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.5 |
0.9 |
GO:0001935 |
endothelial cell proliferation(GO:0001935) |
| 0.5 |
4.1 |
GO:0046697 |
decidualization(GO:0046697) |
| 0.4 |
1.8 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.4 |
2.7 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) |
| 0.4 |
3.6 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.4 |
12.0 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.4 |
2.7 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.4 |
1.3 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.4 |
1.3 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.4 |
0.9 |
GO:0060591 |
chondroblast differentiation(GO:0060591) |
| 0.4 |
1.3 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.4 |
3.1 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 0.4 |
1.3 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.4 |
0.9 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.4 |
1.7 |
GO:0071673 |
positive regulation of smooth muscle cell chemotaxis(GO:0071673) response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.4 |
1.3 |
GO:0046368 |
GDP-L-fucose metabolic process(GO:0046368) |
| 0.4 |
1.7 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 0.4 |
0.9 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.4 |
0.9 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.4 |
1.7 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.4 |
1.3 |
GO:1902915 |
negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.4 |
1.3 |
GO:0097461 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.4 |
1.7 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.4 |
2.1 |
GO:0009396 |
folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.4 |
1.7 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.4 |
8.0 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.4 |
2.1 |
GO:0046601 |
positive regulation of centriole replication(GO:0046601) |
| 0.4 |
0.4 |
GO:0090035 |
regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.4 |
1.3 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.4 |
0.8 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.4 |
2.5 |
GO:0046459 |
short-chain fatty acid metabolic process(GO:0046459) |
| 0.4 |
2.5 |
GO:0035999 |
tetrahydrofolate interconversion(GO:0035999) |
| 0.4 |
0.8 |
GO:0090296 |
regulation of mitochondrial DNA replication(GO:0090296) negative regulation of mitochondrial DNA replication(GO:0090298) |
| 0.4 |
0.4 |
GO:0002538 |
arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 0.4 |
0.8 |
GO:1904430 |
negative regulation of t-circle formation(GO:1904430) |
| 0.4 |
1.2 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.4 |
2.1 |
GO:0046135 |
pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.4 |
1.2 |
GO:0033689 |
negative regulation of osteoblast proliferation(GO:0033689) |
| 0.4 |
1.2 |
GO:0031627 |
telomeric loop formation(GO:0031627) |
| 0.4 |
0.8 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.4 |
1.2 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.4 |
2.1 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.4 |
2.9 |
GO:0001946 |
lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
| 0.4 |
2.0 |
GO:0038031 |
non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.4 |
3.7 |
GO:0060712 |
spongiotrophoblast layer development(GO:0060712) |
| 0.4 |
9.8 |
GO:0072698 |
protein localization to microtubule cytoskeleton(GO:0072698) |
| 0.4 |
2.4 |
GO:0035881 |
amacrine cell differentiation(GO:0035881) |
| 0.4 |
2.8 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.4 |
0.4 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 0.4 |
0.4 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.4 |
4.4 |
GO:0033327 |
Leydig cell differentiation(GO:0033327) |
| 0.4 |
2.0 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.4 |
0.8 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.4 |
2.4 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 0.4 |
0.4 |
GO:0044253 |
positive regulation of collagen metabolic process(GO:0010714) positive regulation of multicellular organismal metabolic process(GO:0044253) |
| 0.4 |
1.2 |
GO:0035934 |
corticosterone secretion(GO:0035934) |
| 0.4 |
2.4 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.4 |
2.4 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.4 |
1.2 |
GO:0034476 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.4 |
2.7 |
GO:0072202 |
cell differentiation involved in metanephros development(GO:0072202) |
| 0.4 |
5.5 |
GO:0035115 |
embryonic forelimb morphogenesis(GO:0035115) |
| 0.4 |
0.4 |
GO:2001015 |
negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.4 |
0.4 |
GO:2000322 |
regulation of glucocorticoid receptor signaling pathway(GO:2000322) |
| 0.4 |
3.1 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.4 |
1.6 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.4 |
4.3 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.4 |
1.2 |
GO:0048698 |
regulation of collateral sprouting in absence of injury(GO:0048696) negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.4 |
0.4 |
GO:0042311 |
vasodilation(GO:0042311) regulation of vasodilation(GO:0042312) |
| 0.4 |
0.4 |
GO:0009084 |
glutamine family amino acid biosynthetic process(GO:0009084) |
| 0.4 |
0.4 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.4 |
0.8 |
GO:1901858 |
regulation of mitochondrial DNA metabolic process(GO:1901858) |
| 0.4 |
0.8 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.4 |
0.8 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.4 |
1.1 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 0.4 |
1.1 |
GO:0045723 |
positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.4 |
4.9 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.4 |
0.4 |
GO:2000505 |
regulation of energy homeostasis(GO:2000505) |
| 0.4 |
1.5 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.4 |
0.4 |
GO:0042663 |
regulation of endodermal cell fate specification(GO:0042663) |
| 0.4 |
2.2 |
GO:0045987 |
positive regulation of smooth muscle contraction(GO:0045987) |
| 0.4 |
2.2 |
GO:0042135 |
neurotransmitter catabolic process(GO:0042135) |
| 0.4 |
1.1 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.4 |
0.7 |
GO:0060324 |
face development(GO:0060324) |
| 0.4 |
4.4 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.4 |
0.4 |
GO:0048597 |
post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.4 |
2.6 |
GO:0045005 |
DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.4 |
1.1 |
GO:0090177 |
establishment of planar polarity involved in neural tube closure(GO:0090177) |
| 0.4 |
0.4 |
GO:0060135 |
maternal process involved in female pregnancy(GO:0060135) |
| 0.4 |
1.1 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.4 |
0.4 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.4 |
1.8 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.4 |
1.4 |
GO:0046689 |
response to mercury ion(GO:0046689) |
| 0.4 |
3.2 |
GO:0090205 |
positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.4 |
16.9 |
GO:0071230 |
cellular response to amino acid stimulus(GO:0071230) |
| 0.4 |
2.1 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 0.4 |
3.6 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.4 |
1.4 |
GO:0036342 |
post-anal tail morphogenesis(GO:0036342) |
| 0.4 |
1.8 |
GO:0097501 |
stress response to metal ion(GO:0097501) |
| 0.4 |
2.1 |
GO:0006344 |
maintenance of chromatin silencing(GO:0006344) |
| 0.4 |
2.8 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.4 |
2.1 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.4 |
0.7 |
GO:0044793 |
negative regulation by host of viral process(GO:0044793) |
| 0.4 |
0.7 |
GO:0015675 |
nickel cation transport(GO:0015675) |
| 0.4 |
4.9 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.4 |
1.8 |
GO:0006477 |
protein sulfation(GO:0006477) |
| 0.4 |
1.4 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.3 |
0.3 |
GO:0046476 |
glycosylceramide biosynthetic process(GO:0046476) |
| 0.3 |
18.1 |
GO:0050830 |
defense response to Gram-positive bacterium(GO:0050830) |
| 0.3 |
0.3 |
GO:0042505 |
tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.3 |
1.0 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.3 |
4.9 |
GO:0010388 |
cullin deneddylation(GO:0010388) |
| 0.3 |
4.1 |
GO:0014823 |
response to activity(GO:0014823) |
| 0.3 |
5.5 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.3 |
2.1 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.3 |
1.7 |
GO:0051365 |
cellular response to potassium ion starvation(GO:0051365) |
| 0.3 |
1.4 |
GO:0060613 |
fat pad development(GO:0060613) |
| 0.3 |
2.1 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.3 |
1.7 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.3 |
1.0 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.3 |
2.4 |
GO:0009435 |
NAD biosynthetic process(GO:0009435) |
| 0.3 |
1.4 |
GO:0046909 |
intermembrane transport(GO:0046909) |
| 0.3 |
1.0 |
GO:0072675 |
multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.3 |
9.5 |
GO:0034605 |
cellular response to heat(GO:0034605) |
| 0.3 |
1.0 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.3 |
1.3 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.3 |
6.7 |
GO:0000303 |
response to superoxide(GO:0000303) |
| 0.3 |
9.4 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.3 |
0.3 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.3 |
1.3 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.3 |
1.7 |
GO:2000258 |
negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
| 0.3 |
4.0 |
GO:0034383 |
low-density lipoprotein particle clearance(GO:0034383) |
| 0.3 |
2.7 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.3 |
7.3 |
GO:0006730 |
one-carbon metabolic process(GO:0006730) |
| 0.3 |
2.6 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.3 |
0.3 |
GO:0071599 |
otic vesicle development(GO:0071599) |
| 0.3 |
2.0 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.3 |
1.0 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.3 |
1.0 |
GO:0061042 |
vascular wound healing(GO:0061042) |
| 0.3 |
0.3 |
GO:0048239 |
negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.3 |
1.0 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.3 |
2.9 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.3 |
10.1 |
GO:0038061 |
NIK/NF-kappaB signaling(GO:0038061) |
| 0.3 |
1.3 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.3 |
3.6 |
GO:0045672 |
positive regulation of osteoclast differentiation(GO:0045672) |
| 0.3 |
1.6 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.3 |
0.3 |
GO:0007044 |
cell-substrate junction assembly(GO:0007044) |
| 0.3 |
4.2 |
GO:0032465 |
regulation of cytokinesis(GO:0032465) |
| 0.3 |
2.6 |
GO:0045738 |
negative regulation of DNA repair(GO:0045738) |
| 0.3 |
0.6 |
GO:0014719 |
skeletal muscle satellite cell activation(GO:0014719) |
| 0.3 |
1.0 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.3 |
2.2 |
GO:0045907 |
positive regulation of vasoconstriction(GO:0045907) |
| 0.3 |
2.6 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.3 |
0.6 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.3 |
1.0 |
GO:0097623 |
potassium ion export across plasma membrane(GO:0097623) regulation of potassium ion export(GO:1902302) |
| 0.3 |
2.9 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.3 |
0.3 |
GO:0000731 |
DNA synthesis involved in DNA repair(GO:0000731) |
| 0.3 |
3.5 |
GO:0010664 |
negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.3 |
0.6 |
GO:0090503 |
RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.3 |
0.6 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.3 |
0.3 |
GO:0021523 |
somatic motor neuron differentiation(GO:0021523) |
| 0.3 |
1.3 |
GO:0006641 |
triglyceride metabolic process(GO:0006641) |
| 0.3 |
0.9 |
GO:1904894 |
positive regulation of JAK-STAT cascade(GO:0046427) positive regulation of STAT cascade(GO:1904894) |
| 0.3 |
0.9 |
GO:0042822 |
vitamin B6 metabolic process(GO:0042816) pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.3 |
3.1 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.3 |
3.7 |
GO:0009437 |
amino-acid betaine metabolic process(GO:0006577) carnitine metabolic process(GO:0009437) |
| 0.3 |
2.5 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.3 |
1.5 |
GO:0035561 |
regulation of chromatin binding(GO:0035561) |
| 0.3 |
0.9 |
GO:0006702 |
androgen biosynthetic process(GO:0006702) |
| 0.3 |
1.2 |
GO:0050812 |
regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.3 |
0.9 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.3 |
0.9 |
GO:0009414 |
response to water deprivation(GO:0009414) |
| 0.3 |
0.3 |
GO:0006041 |
glucosamine metabolic process(GO:0006041) |
| 0.3 |
7.0 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.3 |
1.2 |
GO:0070167 |
regulation of biomineral tissue development(GO:0070167) |
| 0.3 |
2.4 |
GO:0035437 |
maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.3 |
0.9 |
GO:0060903 |
positive regulation of meiosis I(GO:0060903) |
| 0.3 |
2.1 |
GO:0070458 |
detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.3 |
0.3 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 0.3 |
6.0 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.3 |
1.8 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.3 |
14.6 |
GO:0005978 |
glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.3 |
1.2 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.3 |
0.9 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 0.3 |
0.3 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.3 |
0.3 |
GO:1902475 |
L-glutamate transmembrane transport(GO:0089711) L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.3 |
6.2 |
GO:0034724 |
DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.3 |
6.2 |
GO:0030199 |
collagen fibril organization(GO:0030199) |
| 0.3 |
0.6 |
GO:1904030 |
negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.3 |
5.9 |
GO:0048844 |
artery morphogenesis(GO:0048844) |
| 0.3 |
5.0 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.3 |
2.6 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.3 |
3.5 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.3 |
0.9 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.3 |
0.6 |
GO:2000286 |
receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.3 |
0.3 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.3 |
0.3 |
GO:0009193 |
pyrimidine ribonucleoside diphosphate metabolic process(GO:0009193) UDP metabolic process(GO:0046048) |
| 0.3 |
1.4 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.3 |
0.6 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.3 |
1.7 |
GO:0032463 |
negative regulation of protein homooligomerization(GO:0032463) |
| 0.3 |
1.1 |
GO:0045606 |
positive regulation of epidermal cell differentiation(GO:0045606) |
| 0.3 |
2.3 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.3 |
1.1 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.3 |
0.6 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.3 |
0.6 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.3 |
0.8 |
GO:0042264 |
peptidyl-aspartic acid modification(GO:0018197) peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.3 |
0.6 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.3 |
1.1 |
GO:0010839 |
negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.3 |
0.8 |
GO:0030202 |
heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.3 |
0.6 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.3 |
0.6 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.3 |
0.3 |
GO:0003016 |
respiratory system process(GO:0003016) |
| 0.3 |
0.8 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.3 |
0.3 |
GO:1904749 |
protein localization to nucleolus(GO:1902570) regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.3 |
4.4 |
GO:0060325 |
face morphogenesis(GO:0060325) |
| 0.3 |
0.5 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.3 |
3.5 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.3 |
0.5 |
GO:0051001 |
negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.3 |
1.4 |
GO:0071236 |
cellular response to antibiotic(GO:0071236) |
| 0.3 |
0.5 |
GO:1903273 |
regulation of sodium ion export(GO:1903273) positive regulation of sodium ion export(GO:1903275) regulation of sodium ion export from cell(GO:1903276) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.3 |
0.3 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.3 |
0.5 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 0.3 |
0.8 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.3 |
0.3 |
GO:0035441 |
cell migration involved in vasculogenesis(GO:0035441) |
| 0.3 |
2.4 |
GO:0006560 |
proline metabolic process(GO:0006560) |
| 0.3 |
1.1 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.3 |
2.1 |
GO:2000194 |
regulation of female gonad development(GO:2000194) |
| 0.3 |
0.3 |
GO:1901252 |
regulation of intracellular transport of viral material(GO:1901252) |
| 0.3 |
0.8 |
GO:2000768 |
glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.3 |
2.4 |
GO:1901409 |
regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.3 |
0.8 |
GO:0019695 |
choline metabolic process(GO:0019695) |
| 0.3 |
4.7 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.3 |
1.1 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 0.3 |
0.3 |
GO:0048730 |
epidermis morphogenesis(GO:0048730) |
| 0.3 |
0.8 |
GO:0021854 |
hypothalamus development(GO:0021854) |
| 0.3 |
0.8 |
GO:0006030 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.3 |
3.1 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.3 |
0.5 |
GO:0010718 |
positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.3 |
1.0 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.3 |
0.5 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 0.3 |
0.5 |
GO:1903519 |
apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.3 |
0.3 |
GO:2000646 |
positive regulation of receptor catabolic process(GO:2000646) |
| 0.3 |
2.3 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.3 |
3.1 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.3 |
1.0 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.3 |
0.3 |
GO:0021937 |
cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.3 |
1.3 |
GO:0000972 |
transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.3 |
2.0 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.3 |
1.5 |
GO:0043200 |
response to amino acid(GO:0043200) |
| 0.3 |
0.3 |
GO:0043619 |
regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.3 |
1.0 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.3 |
1.0 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.3 |
2.0 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.2 |
0.5 |
GO:0035106 |
operant conditioning(GO:0035106) |
| 0.2 |
1.0 |
GO:0071376 |
response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.2 |
0.7 |
GO:0015819 |
lysine transport(GO:0015819) |
| 0.2 |
0.2 |
GO:0071898 |
regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.2 |
0.5 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.2 |
3.7 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.2 |
2.2 |
GO:0006309 |
apoptotic DNA fragmentation(GO:0006309) |
| 0.2 |
0.7 |
GO:1900147 |
Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.2 |
0.2 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.2 |
0.5 |
GO:0000720 |
pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.2 |
1.4 |
GO:0014733 |
regulation of skeletal muscle adaptation(GO:0014733) |
| 0.2 |
2.6 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.2 |
1.9 |
GO:0036120 |
response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.2 |
1.4 |
GO:0032796 |
uropod organization(GO:0032796) |
| 0.2 |
0.5 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.2 |
1.2 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.2 |
1.0 |
GO:0045616 |
regulation of keratinocyte differentiation(GO:0045616) |
| 0.2 |
0.9 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.2 |
0.9 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.2 |
0.2 |
GO:0070813 |
hydrogen sulfide metabolic process(GO:0070813) |
| 0.2 |
1.7 |
GO:2000779 |
regulation of double-strand break repair(GO:2000779) |
| 0.2 |
0.5 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.2 |
0.7 |
GO:0071360 |
cellular response to exogenous dsRNA(GO:0071360) |
| 0.2 |
3.3 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.2 |
0.9 |
GO:0060192 |
negative regulation of lipase activity(GO:0060192) |
| 0.2 |
0.2 |
GO:0030656 |
regulation of vitamin metabolic process(GO:0030656) |
| 0.2 |
0.5 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.2 |
1.9 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.2 |
1.4 |
GO:0001996 |
regulation of systemic arterial blood pressure by norepinephrine-epinephrine(GO:0001993) positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) regulation of heart rate by chemical signal(GO:0003062) positive regulation of heart rate by epinephrine(GO:0003065) positive regulation of blood pressure by epinephrine-norepinephrine(GO:0003321) |
| 0.2 |
1.6 |
GO:0009125 |
nucleoside monophosphate catabolic process(GO:0009125) |
| 0.2 |
0.5 |
GO:0070307 |
lens fiber cell development(GO:0070307) |
| 0.2 |
1.9 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.2 |
0.7 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.2 |
5.3 |
GO:0006073 |
glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
| 0.2 |
1.8 |
GO:1903298 |
regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.2 |
1.2 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.2 |
0.9 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.2 |
0.5 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.2 |
0.2 |
GO:1903204 |
negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.2 |
0.7 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.2 |
0.2 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.2 |
3.2 |
GO:0048240 |
sperm capacitation(GO:0048240) |
| 0.2 |
0.7 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.2 |
0.2 |
GO:0010764 |
negative regulation of fibroblast migration(GO:0010764) |
| 0.2 |
0.5 |
GO:0030183 |
B cell differentiation(GO:0030183) |
| 0.2 |
0.2 |
GO:0033262 |
regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.2 |
0.2 |
GO:0034392 |
negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.2 |
0.5 |
GO:0070601 |
centromeric sister chromatid cohesion(GO:0070601) |
| 0.2 |
0.7 |
GO:0071034 |
CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.2 |
7.0 |
GO:0007498 |
mesoderm development(GO:0007498) |
| 0.2 |
0.4 |
GO:0071670 |
smooth muscle cell chemotaxis(GO:0071670) |
| 0.2 |
1.6 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.2 |
0.9 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.2 |
1.1 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.2 |
0.9 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.2 |
0.9 |
GO:0044243 |
collagen catabolic process(GO:0030574) multicellular organism catabolic process(GO:0044243) |
| 0.2 |
0.2 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.2 |
0.4 |
GO:0098912 |
membrane depolarization during atrial cardiac muscle cell action potential(GO:0098912) positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.2 |
2.0 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.2 |
0.2 |
GO:1901660 |
calcium ion export(GO:1901660) |
| 0.2 |
0.9 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.2 |
2.6 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.2 |
1.9 |
GO:0022027 |
interkinetic nuclear migration(GO:0022027) |
| 0.2 |
0.4 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.2 |
2.6 |
GO:0030514 |
negative regulation of BMP signaling pathway(GO:0030514) |
| 0.2 |
0.9 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.2 |
1.1 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.2 |
0.6 |
GO:0048211 |
Golgi vesicle docking(GO:0048211) |
| 0.2 |
1.5 |
GO:0060261 |
positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.2 |
1.3 |
GO:0045930 |
negative regulation of mitotic cell cycle(GO:0045930) |
| 0.2 |
0.8 |
GO:0051292 |
nuclear pore organization(GO:0006999) pore complex assembly(GO:0046931) nuclear pore complex assembly(GO:0051292) |
| 0.2 |
0.4 |
GO:0010837 |
regulation of keratinocyte proliferation(GO:0010837) |
| 0.2 |
1.1 |
GO:0021983 |
pituitary gland development(GO:0021983) |
| 0.2 |
1.5 |
GO:0034773 |
histone H4-K20 methylation(GO:0034770) histone H4-K20 trimethylation(GO:0034773) |
| 0.2 |
0.6 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.2 |
0.6 |
GO:0000350 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.2 |
2.1 |
GO:0048538 |
thymus development(GO:0048538) |
| 0.2 |
0.4 |
GO:0035020 |
regulation of Rac protein signal transduction(GO:0035020) |
| 0.2 |
0.8 |
GO:0019731 |
antibacterial humoral response(GO:0019731) |
| 0.2 |
2.3 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.2 |
5.0 |
GO:0098773 |
skin epidermis development(GO:0098773) |
| 0.2 |
1.5 |
GO:0042149 |
cellular response to glucose starvation(GO:0042149) |
| 0.2 |
1.0 |
GO:0035947 |
regulation of gluconeogenesis by regulation of transcription from RNA polymerase II promoter(GO:0035947) |
| 0.2 |
0.6 |
GO:0060012 |
synaptic transmission, glycinergic(GO:0060012) |
| 0.2 |
0.2 |
GO:0099624 |
regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
| 0.2 |
2.5 |
GO:0008272 |
sulfate transport(GO:0008272) |
| 0.2 |
2.1 |
GO:0031954 |
positive regulation of protein autophosphorylation(GO:0031954) |
| 0.2 |
0.2 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.2 |
0.2 |
GO:0007135 |
female meiosis sister chromatid cohesion(GO:0007066) meiosis II(GO:0007135) female meiosis chromosome segregation(GO:0016321) meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
| 0.2 |
0.8 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.2 |
0.2 |
GO:0045579 |
positive regulation of B cell differentiation(GO:0045579) |
| 0.2 |
0.2 |
GO:0031440 |
regulation of mRNA 3'-end processing(GO:0031440) |
| 0.2 |
2.0 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.2 |
2.6 |
GO:0045540 |
regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.2 |
0.4 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.2 |
0.2 |
GO:0090403 |
oxidative stress-induced premature senescence(GO:0090403) positive regulation of skeletal muscle cell differentiation(GO:2001016) |
| 0.2 |
0.2 |
GO:0002923 |
regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002923) |
| 0.2 |
0.4 |
GO:0051031 |
tRNA transport(GO:0051031) |
| 0.2 |
1.2 |
GO:0030728 |
ovulation(GO:0030728) |
| 0.2 |
0.2 |
GO:0099515 |
actin filament-based transport(GO:0099515) |
| 0.2 |
0.2 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 0.2 |
2.4 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.2 |
0.8 |
GO:0071476 |
cellular hypotonic response(GO:0071476) |
| 0.2 |
0.6 |
GO:1901970 |
positive regulation of mitotic sister chromatid separation(GO:1901970) |
| 0.2 |
2.4 |
GO:0035493 |
SNARE complex assembly(GO:0035493) |
| 0.2 |
0.6 |
GO:0036506 |
maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.2 |
6.7 |
GO:0008584 |
male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) |
| 0.2 |
0.4 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.2 |
0.4 |
GO:0002385 |
organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
| 0.2 |
3.1 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.2 |
2.3 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.2 |
8.9 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.2 |
0.8 |
GO:1903975 |
regulation of glial cell migration(GO:1903975) |
| 0.2 |
1.0 |
GO:0033005 |
positive regulation of mast cell activation(GO:0033005) positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.2 |
0.6 |
GO:1904685 |
positive regulation of metalloendopeptidase activity(GO:1904685) |
| 0.2 |
1.1 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.2 |
0.9 |
GO:0045040 |
protein import into mitochondrial outer membrane(GO:0045040) |
| 0.2 |
1.5 |
GO:0043631 |
RNA polyadenylation(GO:0043631) |
| 0.2 |
0.6 |
GO:1900364 |
negative regulation of mRNA 3'-end processing(GO:0031441) regulation of mRNA polyadenylation(GO:1900363) negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.2 |
0.6 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.2 |
1.9 |
GO:0007062 |
sister chromatid cohesion(GO:0007062) |
| 0.2 |
0.7 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.2 |
1.3 |
GO:0097084 |
vascular smooth muscle cell development(GO:0097084) |
| 0.2 |
0.6 |
GO:1902528 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.2 |
1.1 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.2 |
0.9 |
GO:0055088 |
lipid homeostasis(GO:0055088) |
| 0.2 |
0.9 |
GO:0042346 |
positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.2 |
0.4 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.2 |
0.7 |
GO:0042790 |
transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
| 0.2 |
0.7 |
GO:0060075 |
regulation of resting membrane potential(GO:0060075) |
| 0.2 |
0.2 |
GO:0021847 |
ventricular zone neuroblast division(GO:0021847) |
| 0.2 |
6.2 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.2 |
1.3 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.2 |
0.7 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.2 |
4.0 |
GO:0046596 |
regulation of viral entry into host cell(GO:0046596) |
| 0.2 |
2.9 |
GO:1902653 |
cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
| 0.2 |
1.3 |
GO:2000124 |
regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.2 |
0.4 |
GO:0009301 |
snRNA transcription(GO:0009301) |
| 0.2 |
1.8 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.2 |
0.4 |
GO:0006549 |
isoleucine metabolic process(GO:0006549) |
| 0.2 |
0.9 |
GO:0009068 |
aspartate family amino acid catabolic process(GO:0009068) |
| 0.2 |
2.1 |
GO:0032392 |
DNA geometric change(GO:0032392) |
| 0.2 |
0.7 |
GO:0070425 |
negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 0.2 |
1.0 |
GO:0030330 |
DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
| 0.2 |
0.7 |
GO:1902916 |
positive regulation of protein polyubiquitination(GO:1902916) |
| 0.2 |
0.2 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.2 |
0.3 |
GO:0006368 |
transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.2 |
0.3 |
GO:0034382 |
chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.2 |
1.2 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.2 |
1.4 |
GO:0010862 |
positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.2 |
0.7 |
GO:0010593 |
negative regulation of lamellipodium assembly(GO:0010593) |
| 0.2 |
1.7 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.2 |
0.9 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.2 |
0.8 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 0.2 |
1.4 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.2 |
1.0 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.2 |
0.7 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.2 |
0.5 |
GO:0001306 |
age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.2 |
0.5 |
GO:0018343 |
protein farnesylation(GO:0018343) |
| 0.2 |
1.7 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.2 |
0.5 |
GO:0032760 |
positive regulation of tumor necrosis factor production(GO:0032760) positive regulation of tumor necrosis factor superfamily cytokine production(GO:1903557) |
| 0.2 |
1.2 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.2 |
1.0 |
GO:0045948 |
positive regulation of translational initiation(GO:0045948) |
| 0.2 |
3.6 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 0.2 |
1.5 |
GO:0007080 |
mitotic metaphase plate congression(GO:0007080) |
| 0.2 |
1.5 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.2 |
0.8 |
GO:0080111 |
DNA demethylation(GO:0080111) |
| 0.2 |
0.7 |
GO:0034501 |
protein localization to kinetochore(GO:0034501) |
| 0.2 |
1.9 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.2 |
0.8 |
GO:1900246 |
positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.2 |
2.9 |
GO:0006493 |
protein O-linked glycosylation(GO:0006493) |
| 0.2 |
1.9 |
GO:0033194 |
response to hydroperoxide(GO:0033194) |
| 0.2 |
0.2 |
GO:1903546 |
protein localization to photoreceptor outer segment(GO:1903546) |
| 0.2 |
0.5 |
GO:1900016 |
negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.2 |
0.6 |
GO:0034260 |
negative regulation of GTPase activity(GO:0034260) |
| 0.2 |
1.3 |
GO:0044782 |
cilium organization(GO:0044782) |
| 0.2 |
0.3 |
GO:0061635 |
regulation of protein complex stability(GO:0061635) |
| 0.2 |
1.0 |
GO:0032875 |
regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
| 0.2 |
0.2 |
GO:0016540 |
protein autoprocessing(GO:0016540) |
| 0.2 |
1.6 |
GO:0090005 |
negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.2 |
0.3 |
GO:0042537 |
benzene-containing compound metabolic process(GO:0042537) |
| 0.2 |
3.0 |
GO:0070206 |
protein trimerization(GO:0070206) |
| 0.2 |
0.5 |
GO:0015793 |
glycerol transport(GO:0015793) |
| 0.2 |
1.6 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.2 |
0.2 |
GO:0090526 |
regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.2 |
0.9 |
GO:1903077 |
negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.2 |
0.5 |
GO:0016126 |
sterol biosynthetic process(GO:0016126) |
| 0.2 |
0.6 |
GO:0042633 |
molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.2 |
1.2 |
GO:0006450 |
regulation of translational fidelity(GO:0006450) |
| 0.2 |
0.9 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.2 |
0.5 |
GO:0031666 |
positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.2 |
13.5 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.2 |
2.1 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.1 |
3.1 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.1 |
2.1 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.1 |
0.4 |
GO:0048661 |
positive regulation of smooth muscle cell proliferation(GO:0048661) |
| 0.1 |
0.3 |
GO:0002021 |
response to dietary excess(GO:0002021) |
| 0.1 |
0.4 |
GO:0034377 |
plasma lipoprotein particle assembly(GO:0034377) |
| 0.1 |
1.2 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.1 |
1.5 |
GO:0030201 |
heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.1 |
1.0 |
GO:0018027 |
peptidyl-lysine dimethylation(GO:0018027) |
| 0.1 |
3.8 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.1 |
0.3 |
GO:1903887 |
motile primary cilium assembly(GO:1903887) |
| 0.1 |
0.3 |
GO:0071168 |
protein localization to chromatin(GO:0071168) |
| 0.1 |
1.7 |
GO:0032922 |
circadian regulation of gene expression(GO:0032922) |
| 0.1 |
2.4 |
GO:0001825 |
blastocyst formation(GO:0001825) |
| 0.1 |
1.0 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 |
1.9 |
GO:1900046 |
regulation of blood coagulation(GO:0030193) regulation of hemostasis(GO:1900046) |
| 0.1 |
0.4 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.1 |
1.0 |
GO:0046349 |
amino sugar biosynthetic process(GO:0046349) |
| 0.1 |
0.3 |
GO:0097494 |
regulation of vesicle size(GO:0097494) |
| 0.1 |
0.7 |
GO:0061684 |
chaperone-mediated autophagy(GO:0061684) |
| 0.1 |
0.4 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.1 |
1.1 |
GO:0031274 |
regulation of pseudopodium assembly(GO:0031272) positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 |
0.4 |
GO:0031953 |
negative regulation of protein autophosphorylation(GO:0031953) |
| 0.1 |
1.1 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 0.1 |
0.1 |
GO:0050689 |
negative regulation of defense response to virus by host(GO:0050689) |
| 0.1 |
0.7 |
GO:1904469 |
positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.1 |
0.6 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.1 |
1.1 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.1 |
0.3 |
GO:0006103 |
2-oxoglutarate metabolic process(GO:0006103) |
| 0.1 |
0.4 |
GO:0090269 |
fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) |
| 0.1 |
0.3 |
GO:0043654 |
recognition of apoptotic cell(GO:0043654) |
| 0.1 |
0.3 |
GO:0036337 |
Fas signaling pathway(GO:0036337) |
| 0.1 |
2.1 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.1 |
0.5 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.1 |
1.2 |
GO:0045445 |
myoblast differentiation(GO:0045445) |
| 0.1 |
0.4 |
GO:0009109 |
coenzyme catabolic process(GO:0009109) |
| 0.1 |
1.5 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.1 |
0.1 |
GO:0002922 |
positive regulation of humoral immune response(GO:0002922) positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.1 |
0.8 |
GO:0046470 |
phosphatidylcholine metabolic process(GO:0046470) |
| 0.1 |
0.1 |
GO:0001732 |
formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.1 |
0.4 |
GO:2000983 |
regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.1 |
0.3 |
GO:0098543 |
detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.1 |
0.4 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.1 |
4.7 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.1 |
1.5 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.1 |
2.4 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.1 |
0.1 |
GO:0035434 |
copper ion transmembrane transport(GO:0035434) |
| 0.1 |
0.9 |
GO:0042219 |
cellular modified amino acid catabolic process(GO:0042219) |
| 0.1 |
0.9 |
GO:0009048 |
dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 |
0.4 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.1 |
0.4 |
GO:0046666 |
retinal cell programmed cell death(GO:0046666) |
| 0.1 |
0.5 |
GO:0050747 |
positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.1 |
2.2 |
GO:1900087 |
positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.1 |
1.1 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.1 |
0.3 |
GO:0033240 |
positive regulation of cellular amine metabolic process(GO:0033240) |
| 0.1 |
0.5 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 |
0.4 |
GO:0070192 |
chromosome organization involved in meiotic cell cycle(GO:0070192) |
| 0.1 |
0.1 |
GO:0045933 |
positive regulation of muscle contraction(GO:0045933) |
| 0.1 |
0.3 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 |
0.5 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.1 |
0.9 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 |
0.3 |
GO:0034115 |
negative regulation of heterotypic cell-cell adhesion(GO:0034115) cell-cell adhesion involved in gastrulation(GO:0070586) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
| 0.1 |
0.2 |
GO:0002865 |
negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
| 0.1 |
1.0 |
GO:0045722 |
positive regulation of gluconeogenesis(GO:0045722) |
| 0.1 |
1.1 |
GO:0050892 |
intestinal absorption(GO:0050892) |
| 0.1 |
0.6 |
GO:1903961 |
positive regulation of anion transmembrane transport(GO:1903961) |
| 0.1 |
3.1 |
GO:0051304 |
chromosome separation(GO:0051304) |
| 0.1 |
5.3 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.1 |
1.1 |
GO:0006337 |
nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.1 |
0.2 |
GO:0048875 |
chemical homeostasis within a tissue(GO:0048875) |
| 0.1 |
0.2 |
GO:0010829 |
negative regulation of glucose transport(GO:0010829) |
| 0.1 |
0.1 |
GO:0033762 |
response to glucagon(GO:0033762) |
| 0.1 |
0.1 |
GO:0039692 |
single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.1 |
0.1 |
GO:0060333 |
interferon-gamma-mediated signaling pathway(GO:0060333) |
| 0.1 |
0.6 |
GO:0002523 |
leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.1 |
0.1 |
GO:1902608 |
regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.1 |
0.3 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.1 |
1.4 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.1 |
0.8 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 |
0.2 |
GO:0072413 |
signal transduction involved in mitotic cell cycle checkpoint(GO:0072413) signal transduction involved in mitotic DNA damage checkpoint(GO:1902402) signal transduction involved in mitotic DNA integrity checkpoint(GO:1902403) |
| 0.1 |
0.9 |
GO:0001658 |
branching involved in ureteric bud morphogenesis(GO:0001658) |
| 0.1 |
0.1 |
GO:0071863 |
regulation of cell proliferation in bone marrow(GO:0071863) |
| 0.1 |
0.2 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.1 |
0.2 |
GO:0042416 |
dopamine biosynthetic process(GO:0042416) |
| 0.1 |
0.6 |
GO:0010172 |
embryonic body morphogenesis(GO:0010172) |
| 0.1 |
0.7 |
GO:0007588 |
excretion(GO:0007588) |
| 0.1 |
0.3 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.1 |
0.1 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.1 |
0.3 |
GO:0030825 |
positive regulation of cGMP metabolic process(GO:0030825) positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.1 |
0.3 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 |
0.2 |
GO:0035814 |
negative regulation of renal sodium excretion(GO:0035814) |
| 0.1 |
0.9 |
GO:0006094 |
gluconeogenesis(GO:0006094) |
| 0.1 |
0.7 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.1 |
0.3 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.1 |
1.6 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 0.1 |
0.5 |
GO:0070286 |
axonemal dynein complex assembly(GO:0070286) |
| 0.1 |
0.4 |
GO:1904031 |
positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.1 |
0.8 |
GO:0003417 |
growth plate cartilage development(GO:0003417) |
| 0.1 |
0.3 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.1 |
2.3 |
GO:0034314 |
Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.1 |
0.1 |
GO:0060753 |
regulation of mast cell chemotaxis(GO:0060753) |
| 0.1 |
0.1 |
GO:0002200 |
somatic diversification of immune receptors(GO:0002200) |
| 0.1 |
0.9 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 |
1.3 |
GO:1904293 |
negative regulation of ERAD pathway(GO:1904293) |
| 0.1 |
1.2 |
GO:0045747 |
positive regulation of Notch signaling pathway(GO:0045747) |
| 0.1 |
0.2 |
GO:0051923 |
sulfation(GO:0051923) |
| 0.1 |
0.2 |
GO:0003351 |
epithelial cilium movement(GO:0003351) |
| 0.1 |
1.4 |
GO:0090161 |
Golgi ribbon formation(GO:0090161) |
| 0.1 |
1.5 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.1 |
0.1 |
GO:0050819 |
negative regulation of coagulation(GO:0050819) |
| 0.1 |
0.9 |
GO:0006490 |
oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.1 |
0.1 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.1 |
0.7 |
GO:0050686 |
negative regulation of mRNA processing(GO:0050686) |
| 0.1 |
0.8 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.1 |
0.4 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.1 |
0.6 |
GO:0098838 |
reduced folate transmembrane transport(GO:0098838) |
| 0.1 |
4.4 |
GO:0001578 |
microtubule bundle formation(GO:0001578) |
| 0.1 |
0.3 |
GO:0000070 |
mitotic sister chromatid segregation(GO:0000070) |
| 0.1 |
0.9 |
GO:0046051 |
UTP metabolic process(GO:0046051) |
| 0.1 |
0.1 |
GO:0071267 |
amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.1 |
0.9 |
GO:0031065 |
positive regulation of histone deacetylation(GO:0031065) |
| 0.1 |
0.3 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.1 |
0.5 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.1 |
0.3 |
GO:1990564 |
protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 |
0.2 |
GO:0006027 |
glycosaminoglycan catabolic process(GO:0006027) |
| 0.1 |
0.4 |
GO:0033138 |
positive regulation of peptidyl-serine phosphorylation(GO:0033138) |
| 0.1 |
0.3 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.1 |
0.3 |
GO:0001193 |
maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
| 0.1 |
0.3 |
GO:0002940 |
tRNA N2-guanine methylation(GO:0002940) |
| 0.1 |
0.1 |
GO:0042249 |
establishment of planar polarity of embryonic epithelium(GO:0042249) |
| 0.1 |
0.5 |
GO:0070171 |
negative regulation of tooth mineralization(GO:0070171) |
| 0.1 |
0.2 |
GO:0044030 |
regulation of DNA methylation(GO:0044030) |
| 0.1 |
3.6 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
0.1 |
GO:0006842 |
tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.1 |
0.6 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 |
0.1 |
GO:2000807 |
regulation of synaptic vesicle clustering(GO:2000807) |
| 0.1 |
0.5 |
GO:0002063 |
chondrocyte development(GO:0002063) |
| 0.1 |
0.2 |
GO:0044034 |
negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 |
0.2 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 |
1.1 |
GO:0051084 |
'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.1 |
0.1 |
GO:0090365 |
regulation of mRNA modification(GO:0090365) |
| 0.1 |
0.4 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.1 |
0.3 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 0.1 |
0.2 |
GO:0019673 |
GDP-mannose metabolic process(GO:0019673) |
| 0.1 |
0.4 |
GO:0006681 |
galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.1 |
0.2 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 |
7.2 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.1 |
0.5 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 |
3.4 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.1 |
0.4 |
GO:0051461 |
corticotropin secretion(GO:0051458) regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.1 |
0.1 |
GO:0043278 |
response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.1 |
0.9 |
GO:0001676 |
long-chain fatty acid metabolic process(GO:0001676) |
| 0.1 |
0.4 |
GO:0005976 |
polysaccharide metabolic process(GO:0005976) |
| 0.1 |
0.4 |
GO:1900027 |
regulation of ruffle assembly(GO:1900027) |
| 0.1 |
0.3 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.1 |
0.4 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.1 |
0.2 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.1 |
0.2 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.1 |
1.7 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 0.1 |
0.7 |
GO:0071281 |
cellular response to iron ion(GO:0071281) |
| 0.1 |
0.2 |
GO:0002361 |
CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.1 |
1.7 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.1 |
0.2 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 0.1 |
0.3 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.1 |
0.5 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
0.3 |
GO:0046040 |
IMP metabolic process(GO:0046040) |
| 0.1 |
0.1 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.1 |
0.6 |
GO:0045187 |
regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.1 |
0.1 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 |
0.1 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 |
0.1 |
GO:0010867 |
positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.1 |
0.1 |
GO:0097341 |
inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.1 |
0.2 |
GO:0009130 |
pyrimidine nucleoside monophosphate metabolic process(GO:0009129) pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) |
| 0.1 |
2.9 |
GO:0009636 |
response to toxic substance(GO:0009636) |
| 0.1 |
5.4 |
GO:0007030 |
Golgi organization(GO:0007030) |
| 0.1 |
0.1 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.1 |
0.4 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.1 |
0.2 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.1 |
0.3 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.1 |
1.1 |
GO:0016073 |
snRNA metabolic process(GO:0016073) |
| 0.1 |
0.3 |
GO:0051189 |
Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 |
0.3 |
GO:2000641 |
regulation of early endosome to late endosome transport(GO:2000641) |
| 0.1 |
0.8 |
GO:0006366 |
transcription from RNA polymerase II promoter(GO:0006366) |
| 0.1 |
0.3 |
GO:0006801 |
superoxide metabolic process(GO:0006801) |
| 0.1 |
0.2 |
GO:1900424 |
regulation of defense response to bacterium(GO:1900424) |
| 0.1 |
0.3 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 0.1 |
0.1 |
GO:0071340 |
skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.1 |
0.1 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 |
0.4 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.1 |
0.1 |
GO:0035280 |
miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
| 0.1 |
0.3 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 |
0.4 |
GO:0046718 |
viral entry into host cell(GO:0046718) |
| 0.1 |
0.7 |
GO:0042462 |
eye photoreceptor cell development(GO:0042462) |
| 0.1 |
0.7 |
GO:0046039 |
GTP metabolic process(GO:0046039) |
| 0.1 |
0.2 |
GO:0006428 |
isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.1 |
0.1 |
GO:0033860 |
regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.1 |
1.7 |
GO:0006376 |
mRNA splice site selection(GO:0006376) |
| 0.1 |
0.1 |
GO:0035356 |
cellular triglyceride homeostasis(GO:0035356) |
| 0.1 |
0.1 |
GO:0061615 |
glycolytic process through fructose-6-phosphate(GO:0061615) |
| 0.1 |
0.1 |
GO:0033119 |
negative regulation of RNA splicing(GO:0033119) |
| 0.1 |
0.1 |
GO:0090344 |
negative regulation of cell aging(GO:0090344) |
| 0.1 |
0.9 |
GO:0071300 |
cellular response to retinoic acid(GO:0071300) |
| 0.1 |
0.1 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.1 |
0.1 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 |
1.0 |
GO:0071594 |
T cell differentiation in thymus(GO:0033077) thymocyte aggregation(GO:0071594) |
| 0.1 |
0.7 |
GO:0030032 |
lamellipodium assembly(GO:0030032) |
| 0.1 |
0.2 |
GO:0046460 |
triglyceride biosynthetic process(GO:0019432) neutral lipid biosynthetic process(GO:0046460) acylglycerol biosynthetic process(GO:0046463) |
| 0.1 |
0.4 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 |
0.2 |
GO:1902188 |
positive regulation of viral release from host cell(GO:1902188) |
| 0.1 |
0.1 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 |
0.1 |
GO:0021957 |
corticospinal tract morphogenesis(GO:0021957) |
| 0.1 |
0.1 |
GO:0002069 |
columnar/cuboidal epithelial cell maturation(GO:0002069) epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.1 |
1.2 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.1 |
0.2 |
GO:0036294 |
cellular response to decreased oxygen levels(GO:0036294) |
| 0.1 |
1.0 |
GO:0031648 |
protein destabilization(GO:0031648) |
| 0.1 |
0.3 |
GO:0071318 |
cellular response to ATP(GO:0071318) |
| 0.1 |
0.2 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.1 |
0.1 |
GO:0060399 |
positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.1 |
0.7 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 |
0.1 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.1 |
0.2 |
GO:1902224 |
cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.1 |
0.2 |
GO:0090181 |
regulation of cholesterol metabolic process(GO:0090181) |
| 0.1 |
0.3 |
GO:0033235 |
positive regulation of protein sumoylation(GO:0033235) |
| 0.1 |
0.4 |
GO:0009143 |
nucleoside triphosphate catabolic process(GO:0009143) |
| 0.1 |
0.3 |
GO:0061085 |
regulation of histone H3-K27 methylation(GO:0061085) |
| 0.1 |
0.4 |
GO:0009262 |
deoxyribonucleotide metabolic process(GO:0009262) |
| 0.1 |
0.1 |
GO:1901857 |
positive regulation of cellular respiration(GO:1901857) |
| 0.1 |
0.6 |
GO:0045071 |
negative regulation of viral genome replication(GO:0045071) |
| 0.1 |
0.4 |
GO:0018195 |
peptidyl-arginine modification(GO:0018195) |
| 0.1 |
1.1 |
GO:0000245 |
spliceosomal complex assembly(GO:0000245) |
| 0.1 |
0.8 |
GO:0046855 |
phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
| 0.1 |
1.5 |
GO:0002224 |
toll-like receptor signaling pathway(GO:0002224) |
| 0.1 |
0.1 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.1 |
0.1 |
GO:0035928 |
RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) |
| 0.1 |
0.1 |
GO:0000059 |
protein import into nucleus, docking(GO:0000059) |
| 0.1 |
0.2 |
GO:0060768 |
epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 |
0.1 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.1 |
0.5 |
GO:0030575 |
nuclear body organization(GO:0030575) |
| 0.1 |
1.3 |
GO:0018345 |
protein palmitoylation(GO:0018345) |
| 0.1 |
0.3 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.1 |
0.2 |
GO:0035067 |
negative regulation of histone acetylation(GO:0035067) |
| 0.1 |
0.3 |
GO:0006573 |
valine metabolic process(GO:0006573) |
| 0.0 |
0.3 |
GO:0018196 |
peptidyl-asparagine modification(GO:0018196) |
| 0.0 |
0.7 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.0 |
0.3 |
GO:0006895 |
Golgi to endosome transport(GO:0006895) |
| 0.0 |
0.1 |
GO:0000291 |
nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.0 |
0.1 |
GO:0002176 |
male germ cell proliferation(GO:0002176) regulation of male germ cell proliferation(GO:2000254) |
| 0.0 |
0.6 |
GO:0032781 |
positive regulation of ATPase activity(GO:0032781) |
| 0.0 |
2.7 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.0 |
0.2 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.0 |
0.3 |
GO:0031643 |
positive regulation of myelination(GO:0031643) |
| 0.0 |
0.2 |
GO:0071218 |
cellular response to misfolded protein(GO:0071218) |
| 0.0 |
0.0 |
GO:2000189 |
regulation of cholesterol homeostasis(GO:2000188) positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 |
0.1 |
GO:0001516 |
prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.0 |
0.0 |
GO:0090148 |
membrane fission(GO:0090148) |
| 0.0 |
0.1 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 0.0 |
0.2 |
GO:0006501 |
C-terminal protein lipidation(GO:0006501) |
| 0.0 |
0.4 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.0 |
1.0 |
GO:0007368 |
determination of left/right symmetry(GO:0007368) |
| 0.0 |
0.0 |
GO:1903020 |
positive regulation of glycoprotein metabolic process(GO:1903020) |
| 0.0 |
0.2 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.0 |
0.1 |
GO:0032532 |
regulation of microvillus length(GO:0032532) |
| 0.0 |
0.9 |
GO:0001889 |
liver development(GO:0001889) |
| 0.0 |
0.2 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.0 |
0.9 |
GO:0016575 |
histone deacetylation(GO:0016575) |
| 0.0 |
0.2 |
GO:0042274 |
ribosomal small subunit biogenesis(GO:0042274) |
| 0.0 |
0.2 |
GO:0070126 |
mitochondrial translational termination(GO:0070126) |
| 0.0 |
0.3 |
GO:0051973 |
positive regulation of telomerase activity(GO:0051973) |
| 0.0 |
0.1 |
GO:0065004 |
protein-DNA complex assembly(GO:0065004) |
| 0.0 |
0.6 |
GO:0001824 |
blastocyst development(GO:0001824) |
| 0.0 |
0.1 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.0 |
0.0 |
GO:0030070 |
insulin processing(GO:0030070) |
| 0.0 |
0.5 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.0 |
0.5 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 |
0.0 |
GO:0033523 |
histone H2B ubiquitination(GO:0033523) |
| 0.0 |
0.1 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 |
0.1 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.0 |
0.8 |
GO:0006959 |
humoral immune response(GO:0006959) |
| 0.0 |
0.1 |
GO:0033632 |
regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.0 |
0.2 |
GO:0090132 |
epithelial cell migration(GO:0010631) tissue migration(GO:0090130) epithelium migration(GO:0090132) |
| 0.0 |
0.6 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.0 |
2.0 |
GO:0043123 |
positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
| 0.0 |
0.2 |
GO:1901522 |
positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
| 0.0 |
0.4 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.0 |
0.1 |
GO:0042255 |
ribosome assembly(GO:0042255) |
| 0.0 |
0.1 |
GO:0090151 |
establishment of protein localization to mitochondrial membrane(GO:0090151) |
| 0.0 |
0.2 |
GO:0030520 |
intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 |
4.0 |
GO:0007067 |
mitotic nuclear division(GO:0007067) |
| 0.0 |
0.2 |
GO:0044381 |
glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.0 |
0.1 |
GO:0007006 |
mitochondrial membrane organization(GO:0007006) |
| 0.0 |
0.1 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 |
0.0 |
GO:0048069 |
eye pigmentation(GO:0048069) |
| 0.0 |
0.1 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.0 |
0.8 |
GO:0022900 |
electron transport chain(GO:0022900) |
| 0.0 |
0.1 |
GO:0042246 |
tissue regeneration(GO:0042246) |
| 0.0 |
0.1 |
GO:0003365 |
establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.0 |
0.3 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 |
0.1 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.0 |
0.2 |
GO:0043330 |
response to exogenous dsRNA(GO:0043330) |
| 0.0 |
0.1 |
GO:0032204 |
regulation of telomere maintenance(GO:0032204) |
| 0.0 |
0.5 |
GO:0033962 |
cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.0 |
0.0 |
GO:0070233 |
negative regulation of T cell apoptotic process(GO:0070233) |
| 0.0 |
0.1 |
GO:0001866 |
NK T cell proliferation(GO:0001866) NK T cell activation(GO:0051132) |
| 0.0 |
0.4 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 |
0.1 |
GO:0001562 |
response to protozoan(GO:0001562) |
| 0.0 |
0.2 |
GO:0002089 |
lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 |
0.4 |
GO:0043550 |
regulation of lipid kinase activity(GO:0043550) |
| 0.0 |
0.1 |
GO:0015788 |
UDP-N-acetylglucosamine transport(GO:0015788) |
| 0.0 |
0.2 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 |
0.1 |
GO:0046835 |
carbohydrate phosphorylation(GO:0046835) |
| 0.0 |
0.3 |
GO:0010633 |
negative regulation of epithelial cell migration(GO:0010633) |
| 0.0 |
0.2 |
GO:0032784 |
regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.0 |
0.1 |
GO:1902950 |
regulation of dendritic spine maintenance(GO:1902950) positive regulation of dendritic spine maintenance(GO:1902952) |
| 0.0 |
0.0 |
GO:0031670 |
cellular response to nutrient(GO:0031670) |
| 0.0 |
0.1 |
GO:0048747 |
muscle fiber development(GO:0048747) |
| 0.0 |
0.1 |
GO:0010592 |
positive regulation of lamellipodium assembly(GO:0010592) |
| 0.0 |
0.1 |
GO:0019369 |
arachidonic acid metabolic process(GO:0019369) |
| 0.0 |
0.0 |
GO:0050904 |
diapedesis(GO:0050904) |
| 0.0 |
0.0 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.0 |
0.0 |
GO:0060693 |
regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.0 |
0.2 |
GO:0045063 |
T-helper 1 cell differentiation(GO:0045063) |
| 0.0 |
0.1 |
GO:1903427 |
negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
| 0.0 |
0.1 |
GO:0042178 |
xenobiotic catabolic process(GO:0042178) |
| 0.0 |
0.5 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.0 |
0.1 |
GO:0071025 |
RNA surveillance(GO:0071025) |
| 0.0 |
0.7 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.0 |
0.0 |
GO:0045065 |
cytotoxic T cell differentiation(GO:0045065) |
| 0.0 |
0.1 |
GO:2001244 |
positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
| 0.0 |
0.1 |
GO:0045646 |
regulation of erythrocyte differentiation(GO:0045646) |
| 0.0 |
0.0 |
GO:1901642 |
purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
| 0.0 |
0.0 |
GO:0035790 |
platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.0 |
0.1 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.0 |
0.1 |
GO:0009181 |
purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.0 |
0.1 |
GO:0043508 |
negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 |
0.3 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.0 |
0.0 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.0 |
0.1 |
GO:0031529 |
ruffle organization(GO:0031529) |
| 0.0 |
0.0 |
GO:0019249 |
lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.0 |
0.0 |
GO:0034035 |
purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.0 |
0.0 |
GO:0045815 |
positive regulation of gene expression, epigenetic(GO:0045815) |
| 0.0 |
0.0 |
GO:0009644 |
response to light intensity(GO:0009642) response to high light intensity(GO:0009644) |
| 0.0 |
0.2 |
GO:0001895 |
retina homeostasis(GO:0001895) |
| 0.0 |
0.1 |
GO:0042035 |
regulation of cytokine biosynthetic process(GO:0042035) |
| 0.0 |
0.2 |
GO:0006352 |
DNA-templated transcription, initiation(GO:0006352) |
| 0.0 |
0.3 |
GO:0009206 |
purine ribonucleoside triphosphate biosynthetic process(GO:0009206) |
| 0.0 |
0.0 |
GO:0033690 |
positive regulation of osteoblast proliferation(GO:0033690) |
