| 7.5 |
22.5 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 6.4 |
25.7 |
GO:0048319 |
axial mesoderm morphogenesis(GO:0048319) |
| 6.2 |
30.8 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 5.9 |
11.9 |
GO:0072138 |
mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
| 5.9 |
17.7 |
GO:0060129 |
thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
| 5.6 |
22.5 |
GO:0086069 |
bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 5.4 |
16.1 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 5.3 |
16.0 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 4.6 |
13.8 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 4.6 |
13.7 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 4.6 |
13.7 |
GO:0043096 |
purine nucleobase salvage(GO:0043096) |
| 4.5 |
13.6 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 4.3 |
21.7 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 4.3 |
4.3 |
GO:0043094 |
cellular metabolic compound salvage(GO:0043094) purine-containing compound salvage(GO:0043101) |
| 4.3 |
21.6 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 4.1 |
16.4 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 4.1 |
12.3 |
GO:0090202 |
transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 3.9 |
11.8 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 3.9 |
11.6 |
GO:2000744 |
anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 3.8 |
11.5 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 3.8 |
19.0 |
GO:0010387 |
COP9 signalosome assembly(GO:0010387) |
| 3.7 |
15.0 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 3.7 |
11.2 |
GO:0060217 |
hemangioblast cell differentiation(GO:0060217) regulation of mast cell differentiation(GO:0060375) |
| 3.5 |
14.1 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 3.5 |
3.5 |
GO:1901492 |
positive regulation of lymphangiogenesis(GO:1901492) |
| 3.5 |
3.5 |
GO:0090035 |
regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 3.3 |
16.5 |
GO:0030091 |
protein repair(GO:0030091) |
| 3.3 |
9.8 |
GO:2001206 |
positive regulation of osteoclast development(GO:2001206) |
| 3.2 |
19.4 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 3.1 |
12.4 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 3.0 |
3.0 |
GO:1903012 |
positive regulation of bone development(GO:1903012) |
| 3.0 |
12.1 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 3.0 |
6.0 |
GO:0033128 |
negative regulation of histone phosphorylation(GO:0033128) |
| 3.0 |
8.9 |
GO:0009177 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 2.9 |
8.8 |
GO:0051902 |
negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 2.9 |
2.9 |
GO:0072204 |
cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 2.9 |
23.4 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 2.9 |
2.9 |
GO:0071374 |
cellular response to parathyroid hormone stimulus(GO:0071374) |
| 2.9 |
8.7 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 2.9 |
8.7 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 2.9 |
20.2 |
GO:0034969 |
histone arginine methylation(GO:0034969) |
| 2.8 |
8.5 |
GO:0030421 |
defecation(GO:0030421) |
| 2.8 |
39.7 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 2.8 |
8.4 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 2.8 |
8.4 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 2.7 |
10.9 |
GO:0051582 |
positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 2.7 |
8.0 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 2.6 |
13.2 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 2.6 |
5.2 |
GO:0071898 |
regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 2.6 |
10.3 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 2.6 |
10.3 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 2.6 |
18.1 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 2.6 |
7.7 |
GO:1902396 |
protein localization to bicellular tight junction(GO:1902396) |
| 2.6 |
10.2 |
GO:0032439 |
endosome localization(GO:0032439) |
| 2.6 |
35.8 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 2.5 |
10.1 |
GO:0010637 |
negative regulation of mitochondrial fusion(GO:0010637) |
| 2.5 |
2.5 |
GO:0060374 |
mast cell differentiation(GO:0060374) |
| 2.5 |
7.5 |
GO:0060364 |
frontal suture morphogenesis(GO:0060364) |
| 2.5 |
2.5 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 2.5 |
7.5 |
GO:0001193 |
maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
| 2.5 |
2.5 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 2.5 |
2.5 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 2.5 |
4.9 |
GO:0002669 |
positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 2.5 |
7.4 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 2.5 |
2.5 |
GO:0014842 |
skeletal muscle satellite cell proliferation(GO:0014841) regulation of skeletal muscle satellite cell proliferation(GO:0014842) skeletal muscle cell proliferation(GO:0014856) regulation of skeletal muscle cell proliferation(GO:0014857) |
| 2.4 |
16.9 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 2.4 |
12.0 |
GO:0019659 |
glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 2.4 |
2.4 |
GO:0071677 |
positive regulation of mononuclear cell migration(GO:0071677) |
| 2.4 |
9.5 |
GO:0032463 |
regulation of protein homooligomerization(GO:0032462) negative regulation of protein homooligomerization(GO:0032463) |
| 2.3 |
9.4 |
GO:2000525 |
regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 2.3 |
2.3 |
GO:0060290 |
transdifferentiation(GO:0060290) |
| 2.3 |
2.3 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) |
| 2.3 |
6.9 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 2.3 |
2.3 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 2.2 |
6.7 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 2.2 |
11.2 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 2.2 |
6.7 |
GO:0097623 |
potassium ion export across plasma membrane(GO:0097623) |
| 2.2 |
20.0 |
GO:0010908 |
regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 2.2 |
8.8 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 2.2 |
4.4 |
GO:0003100 |
regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 2.2 |
6.5 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 2.2 |
43.5 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 2.2 |
10.8 |
GO:0046985 |
positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 2.1 |
6.4 |
GO:0009153 |
purine deoxyribonucleotide biosynthetic process(GO:0009153) |
| 2.1 |
10.7 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 2.1 |
8.6 |
GO:0010288 |
response to lead ion(GO:0010288) |
| 2.1 |
12.8 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 2.1 |
10.7 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 2.1 |
6.3 |
GO:0003360 |
brainstem development(GO:0003360) |
| 2.1 |
6.3 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 2.1 |
6.3 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 2.1 |
14.7 |
GO:0043951 |
negative regulation of cAMP-mediated signaling(GO:0043951) |
| 2.1 |
6.2 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 2.1 |
6.2 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 2.0 |
10.2 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 2.0 |
2.0 |
GO:0046499 |
S-adenosylmethioninamine metabolic process(GO:0046499) |
| 2.0 |
10.2 |
GO:0015705 |
iodide transport(GO:0015705) |
| 2.0 |
14.2 |
GO:0032079 |
positive regulation of endodeoxyribonuclease activity(GO:0032079) |
| 2.0 |
6.0 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 2.0 |
6.0 |
GO:0007521 |
muscle cell fate determination(GO:0007521) |
| 2.0 |
6.0 |
GO:0035771 |
interleukin-4-mediated signaling pathway(GO:0035771) |
| 2.0 |
13.9 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 2.0 |
4.0 |
GO:2000275 |
regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 2.0 |
7.9 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 2.0 |
7.9 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 2.0 |
9.8 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 1.9 |
5.8 |
GO:0070172 |
positive regulation of tooth mineralization(GO:0070172) |
| 1.9 |
7.8 |
GO:0033499 |
galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
| 1.9 |
1.9 |
GO:0001928 |
regulation of exocyst assembly(GO:0001928) |
| 1.9 |
7.8 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 1.9 |
5.8 |
GO:0000710 |
meiotic mismatch repair(GO:0000710) |
| 1.9 |
1.9 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 1.9 |
7.6 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 1.9 |
7.6 |
GO:0072095 |
regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 1.9 |
5.7 |
GO:0002035 |
brain renin-angiotensin system(GO:0002035) |
| 1.9 |
7.6 |
GO:0072369 |
regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 1.9 |
5.7 |
GO:0097278 |
complement-dependent cytotoxicity(GO:0097278) |
| 1.9 |
5.7 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 1.8 |
5.5 |
GO:0042822 |
vitamin B6 metabolic process(GO:0042816) pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 1.8 |
1.8 |
GO:0001922 |
B-1 B cell homeostasis(GO:0001922) |
| 1.8 |
5.5 |
GO:0048819 |
regulation of hair follicle maturation(GO:0048819) regulation of catagen(GO:0051794) |
| 1.8 |
7.3 |
GO:0051295 |
establishment of meiotic spindle localization(GO:0051295) |
| 1.8 |
10.8 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 1.8 |
18.0 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 1.8 |
5.3 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 1.8 |
8.9 |
GO:0030423 |
targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 1.8 |
14.2 |
GO:0038028 |
insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 1.8 |
1.8 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 1.8 |
15.8 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 1.8 |
3.5 |
GO:0010958 |
regulation of amino acid import(GO:0010958) regulation of L-arginine import(GO:0010963) |
| 1.8 |
3.5 |
GO:0010886 |
positive regulation of cholesterol storage(GO:0010886) |
| 1.7 |
5.2 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 1.7 |
3.5 |
GO:0006273 |
lagging strand elongation(GO:0006273) |
| 1.7 |
12.1 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) cellular response to vitamin D(GO:0071305) |
| 1.7 |
29.3 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 1.7 |
6.8 |
GO:0010510 |
regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 1.7 |
6.8 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 1.7 |
11.9 |
GO:0090170 |
regulation of Golgi inheritance(GO:0090170) |
| 1.7 |
3.4 |
GO:0072008 |
glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
| 1.7 |
8.4 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 1.7 |
1.7 |
GO:0036118 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 1.7 |
5.0 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 1.6 |
3.2 |
GO:0072048 |
pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
| 1.6 |
8.0 |
GO:0090666 |
scaRNA localization to Cajal body(GO:0090666) |
| 1.6 |
1.6 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 1.6 |
4.8 |
GO:0060484 |
lung-associated mesenchyme development(GO:0060484) |
| 1.6 |
3.2 |
GO:1902459 |
positive regulation of stem cell population maintenance(GO:1902459) |
| 1.6 |
6.4 |
GO:0031509 |
telomeric heterochromatin assembly(GO:0031509) negative regulation of chromosome condensation(GO:1902340) |
| 1.6 |
14.3 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 1.6 |
9.5 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 1.6 |
4.7 |
GO:1901536 |
regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 1.6 |
1.6 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 1.6 |
9.4 |
GO:0098838 |
reduced folate transmembrane transport(GO:0098838) |
| 1.6 |
6.2 |
GO:0060265 |
positive regulation of respiratory burst involved in inflammatory response(GO:0060265) |
| 1.6 |
4.7 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 1.6 |
6.2 |
GO:1902268 |
negative regulation of polyamine transmembrane transport(GO:1902268) |
| 1.6 |
3.1 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 1.6 |
7.8 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 1.5 |
1.5 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 1.5 |
4.6 |
GO:0050748 |
negative regulation of lipoprotein metabolic process(GO:0050748) |
| 1.5 |
4.6 |
GO:0060084 |
synaptic transmission involved in micturition(GO:0060084) |
| 1.5 |
15.2 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 1.5 |
16.6 |
GO:0006228 |
UTP biosynthetic process(GO:0006228) |
| 1.5 |
6.0 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 1.5 |
13.5 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 1.5 |
4.5 |
GO:0050779 |
RNA destabilization(GO:0050779) |
| 1.5 |
1.5 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 1.5 |
6.0 |
GO:0008295 |
spermidine biosynthetic process(GO:0008295) |
| 1.5 |
10.4 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 1.5 |
1.5 |
GO:0010957 |
negative regulation of vitamin D biosynthetic process(GO:0010957) negative regulation of vitamin metabolic process(GO:0046137) |
| 1.5 |
20.7 |
GO:0060065 |
uterus development(GO:0060065) |
| 1.5 |
4.4 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 1.5 |
7.3 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 1.5 |
7.3 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 1.5 |
11.7 |
GO:0009435 |
NAD biosynthetic process(GO:0009435) |
| 1.5 |
4.4 |
GO:0000087 |
mitotic M phase(GO:0000087) |
| 1.5 |
16.1 |
GO:0021785 |
branchiomotor neuron axon guidance(GO:0021785) |
| 1.5 |
4.4 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 1.4 |
10.0 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 1.4 |
2.9 |
GO:0045110 |
intermediate filament bundle assembly(GO:0045110) |
| 1.4 |
1.4 |
GO:0090305 |
nucleic acid phosphodiester bond hydrolysis(GO:0090305) |
| 1.4 |
8.5 |
GO:0060272 |
embryonic skeletal joint morphogenesis(GO:0060272) |
| 1.4 |
4.2 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 1.4 |
4.2 |
GO:0070889 |
platelet alpha granule organization(GO:0070889) |
| 1.4 |
2.8 |
GO:0045607 |
regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 1.4 |
5.6 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 1.4 |
7.0 |
GO:0072429 |
response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 1.4 |
1.4 |
GO:0046036 |
CTP biosynthetic process(GO:0006241) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) CTP metabolic process(GO:0046036) |
| 1.4 |
4.2 |
GO:0045014 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 1.4 |
4.2 |
GO:0071680 |
response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 1.4 |
5.6 |
GO:0046294 |
formaldehyde catabolic process(GO:0046294) |
| 1.4 |
4.2 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 1.4 |
5.5 |
GO:0072675 |
osteoclast fusion(GO:0072675) |
| 1.4 |
5.5 |
GO:0010808 |
positive regulation of synaptic vesicle priming(GO:0010808) |
| 1.4 |
2.7 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 1.4 |
6.8 |
GO:0031145 |
anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 1.4 |
2.7 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 1.4 |
5.4 |
GO:2000484 |
positive regulation of interleukin-8 secretion(GO:2000484) |
| 1.4 |
4.1 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 1.4 |
2.7 |
GO:0051798 |
positive regulation of hair follicle development(GO:0051798) |
| 1.3 |
13.5 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 1.3 |
16.2 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 1.3 |
4.0 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 1.3 |
6.7 |
GO:0086045 |
membrane depolarization during AV node cell action potential(GO:0086045) |
| 1.3 |
6.7 |
GO:0046598 |
positive regulation of viral entry into host cell(GO:0046598) |
| 1.3 |
5.3 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 1.3 |
18.6 |
GO:0006337 |
nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 1.3 |
8.0 |
GO:0032929 |
negative regulation of superoxide anion generation(GO:0032929) |
| 1.3 |
1.3 |
GO:0072194 |
kidney smooth muscle tissue development(GO:0072194) |
| 1.3 |
2.6 |
GO:2000097 |
regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 1.3 |
1.3 |
GO:0010751 |
negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 1.3 |
2.6 |
GO:0042473 |
outer ear morphogenesis(GO:0042473) |
| 1.3 |
1.3 |
GO:0048631 |
regulation of skeletal muscle tissue growth(GO:0048631) |
| 1.3 |
1.3 |
GO:0060744 |
thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 1.3 |
1.3 |
GO:0002666 |
positive regulation of T cell tolerance induction(GO:0002666) |
| 1.3 |
2.6 |
GO:0060334 |
regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 1.3 |
2.5 |
GO:0060414 |
aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 1.3 |
6.4 |
GO:0006071 |
glycerol metabolic process(GO:0006071) |
| 1.3 |
3.8 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 1.3 |
3.8 |
GO:0045112 |
integrin biosynthetic process(GO:0045112) |
| 1.3 |
12.7 |
GO:0061615 |
glycolytic process through fructose-6-phosphate(GO:0061615) |
| 1.3 |
7.6 |
GO:0034115 |
negative regulation of heterotypic cell-cell adhesion(GO:0034115) cell-cell adhesion involved in gastrulation(GO:0070586) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
| 1.3 |
2.5 |
GO:0009186 |
deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
| 1.3 |
2.5 |
GO:0046668 |
regulation of retinal cell programmed cell death(GO:0046668) |
| 1.3 |
3.8 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 1.2 |
3.7 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 1.2 |
3.7 |
GO:1901731 |
calcium-mediated signaling using extracellular calcium source(GO:0035585) positive regulation of platelet aggregation(GO:1901731) |
| 1.2 |
3.7 |
GO:0043923 |
positive regulation by host of viral transcription(GO:0043923) |
| 1.2 |
6.2 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 1.2 |
1.2 |
GO:0010692 |
regulation of alkaline phosphatase activity(GO:0010692) positive regulation of alkaline phosphatase activity(GO:0010694) |
| 1.2 |
3.7 |
GO:0090285 |
negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 1.2 |
3.7 |
GO:0006106 |
fumarate metabolic process(GO:0006106) |
| 1.2 |
11.1 |
GO:0006977 |
DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 1.2 |
40.6 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 1.2 |
3.7 |
GO:0009106 |
lipoate metabolic process(GO:0009106) |
| 1.2 |
2.4 |
GO:0008626 |
granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 1.2 |
4.9 |
GO:1903416 |
response to glycoside(GO:1903416) |
| 1.2 |
7.3 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 1.2 |
23.2 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 1.2 |
4.9 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 1.2 |
34.0 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 1.2 |
3.6 |
GO:0048821 |
erythrocyte development(GO:0048821) |
| 1.2 |
1.2 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 1.2 |
12.1 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 1.2 |
8.5 |
GO:0015675 |
nickel cation transport(GO:0015675) |
| 1.2 |
4.8 |
GO:2000630 |
positive regulation of miRNA metabolic process(GO:2000630) |
| 1.2 |
2.4 |
GO:1901228 |
positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
| 1.2 |
3.6 |
GO:1900158 |
negative regulation of bone mineralization involved in bone maturation(GO:1900158) |
| 1.2 |
10.9 |
GO:0048617 |
embryonic foregut morphogenesis(GO:0048617) |
| 1.2 |
3.6 |
GO:0006097 |
glyoxylate cycle(GO:0006097) |
| 1.2 |
3.6 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 1.2 |
2.4 |
GO:1904058 |
positive regulation of sensory perception of pain(GO:1904058) |
| 1.2 |
1.2 |
GO:0034349 |
glial cell apoptotic process(GO:0034349) |
| 1.2 |
3.6 |
GO:2001286 |
regulation of caveolin-mediated endocytosis(GO:2001286) |
| 1.2 |
10.7 |
GO:1900025 |
negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 1.2 |
16.6 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 1.2 |
2.4 |
GO:1903243 |
negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) negative regulation of cardiac muscle hypertrophy in response to stress(GO:1903243) |
| 1.2 |
4.7 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 1.2 |
1.2 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 1.2 |
4.7 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 1.2 |
2.3 |
GO:2001012 |
mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
| 1.2 |
3.5 |
GO:0097401 |
synaptic vesicle lumen acidification(GO:0097401) |
| 1.2 |
5.8 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 1.2 |
1.2 |
GO:0006041 |
glucosamine metabolic process(GO:0006041) |
| 1.1 |
2.3 |
GO:0035617 |
stress granule disassembly(GO:0035617) |
| 1.1 |
4.6 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 1.1 |
12.6 |
GO:0034383 |
low-density lipoprotein particle clearance(GO:0034383) |
| 1.1 |
2.3 |
GO:0031033 |
myosin filament organization(GO:0031033) |
| 1.1 |
3.4 |
GO:0048597 |
post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 1.1 |
18.2 |
GO:0035115 |
embryonic forelimb morphogenesis(GO:0035115) |
| 1.1 |
1.1 |
GO:0016264 |
gap junction assembly(GO:0016264) |
| 1.1 |
2.3 |
GO:0000965 |
mitochondrial RNA 3'-end processing(GO:0000965) |
| 1.1 |
1.1 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 1.1 |
2.2 |
GO:0045472 |
response to ether(GO:0045472) |
| 1.1 |
2.2 |
GO:0001866 |
NK T cell proliferation(GO:0001866) |
| 1.1 |
3.3 |
GO:0009838 |
abscission(GO:0009838) |
| 1.1 |
1.1 |
GO:0097167 |
circadian regulation of translation(GO:0097167) |
| 1.1 |
6.7 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 1.1 |
14.4 |
GO:2001241 |
positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 1.1 |
1.1 |
GO:0002295 |
T-helper cell lineage commitment(GO:0002295) CD4-positive, alpha-beta T cell lineage commitment(GO:0043373) |
| 1.1 |
5.5 |
GO:0045918 |
negative regulation of cytolysis(GO:0045918) |
| 1.1 |
6.6 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 1.1 |
5.5 |
GO:0021775 |
smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 1.1 |
4.4 |
GO:0042535 |
positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 1.1 |
2.2 |
GO:0035461 |
vitamin transmembrane transport(GO:0035461) |
| 1.1 |
11.9 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 1.1 |
1.1 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 1.1 |
23.7 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 1.1 |
11.8 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 1.1 |
3.2 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 1.1 |
2.1 |
GO:0048853 |
forebrain morphogenesis(GO:0048853) |
| 1.1 |
3.2 |
GO:0015960 |
diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 1.1 |
4.3 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 1.1 |
4.3 |
GO:0035360 |
positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 1.1 |
4.3 |
GO:0035067 |
negative regulation of histone acetylation(GO:0035067) |
| 1.1 |
7.4 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 1.0 |
2.1 |
GO:0033091 |
positive regulation of immature T cell proliferation(GO:0033091) |
| 1.0 |
5.2 |
GO:0061052 |
negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 1.0 |
9.4 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 1.0 |
4.2 |
GO:0065001 |
negative regulation of histone H3-K36 methylation(GO:0000415) specification of axis polarity(GO:0065001) |
| 1.0 |
13.5 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 1.0 |
9.3 |
GO:0090043 |
regulation of tubulin deacetylation(GO:0090043) |
| 1.0 |
3.1 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 1.0 |
7.1 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 1.0 |
6.1 |
GO:0072610 |
interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) positive regulation of interleukin-12 secretion(GO:2001184) |
| 1.0 |
5.1 |
GO:0009396 |
folic acid-containing compound biosynthetic process(GO:0009396) |
| 1.0 |
10.1 |
GO:0032464 |
positive regulation of protein homooligomerization(GO:0032464) |
| 1.0 |
11.1 |
GO:0048537 |
mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 1.0 |
8.0 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 1.0 |
4.0 |
GO:0070166 |
enamel mineralization(GO:0070166) |
| 1.0 |
6.0 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 1.0 |
4.0 |
GO:1904529 |
regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 1.0 |
4.0 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
| 1.0 |
3.0 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 1.0 |
6.0 |
GO:0032075 |
positive regulation of nuclease activity(GO:0032075) |
| 1.0 |
1.0 |
GO:0072172 |
ureteric bud formation(GO:0060676) mesonephric tubule formation(GO:0072172) |
| 1.0 |
10.9 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 1.0 |
3.0 |
GO:0032066 |
nucleolus to nucleoplasm transport(GO:0032066) |
| 1.0 |
1.9 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 1.0 |
6.8 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 1.0 |
1.9 |
GO:0070202 |
regulation of establishment of protein localization to chromosome(GO:0070202) |
| 1.0 |
1.9 |
GO:1902174 |
positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 1.0 |
3.9 |
GO:0000447 |
endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 1.0 |
3.9 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 1.0 |
1.9 |
GO:1903898 |
negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 1.0 |
7.7 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 1.0 |
1.0 |
GO:2000049 |
positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 1.0 |
1.0 |
GO:0045583 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 1.0 |
1.0 |
GO:0000821 |
regulation of arginine metabolic process(GO:0000821) |
| 1.0 |
1.9 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 1.0 |
1.9 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 1.0 |
4.8 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.9 |
0.9 |
GO:0006271 |
DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.9 |
0.9 |
GO:0086016 |
AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) AV node cell to bundle of His cell communication(GO:0086067) |
| 0.9 |
2.8 |
GO:0051305 |
chromosome movement towards spindle pole(GO:0051305) |
| 0.9 |
4.7 |
GO:0010359 |
regulation of anion channel activity(GO:0010359) |
| 0.9 |
0.9 |
GO:0021678 |
third ventricle development(GO:0021678) |
| 0.9 |
4.7 |
GO:0000060 |
protein import into nucleus, translocation(GO:0000060) |
| 0.9 |
5.6 |
GO:0007253 |
cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.9 |
2.8 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.9 |
5.6 |
GO:0060120 |
auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.9 |
2.8 |
GO:0060623 |
regulation of chromosome condensation(GO:0060623) |
| 0.9 |
17.8 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.9 |
3.7 |
GO:0003430 |
growth plate cartilage chondrocyte growth(GO:0003430) |
| 0.9 |
0.9 |
GO:0060295 |
regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.9 |
3.7 |
GO:0071864 |
positive regulation of cell proliferation in bone marrow(GO:0071864) |
| 0.9 |
4.6 |
GO:0071896 |
protein localization to adherens junction(GO:0071896) |
| 0.9 |
4.6 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.9 |
0.9 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.9 |
2.7 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.9 |
9.1 |
GO:0042790 |
transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
| 0.9 |
11.9 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.9 |
4.6 |
GO:0021993 |
initiation of neural tube closure(GO:0021993) |
| 0.9 |
3.7 |
GO:0045903 |
positive regulation of translational fidelity(GO:0045903) |
| 0.9 |
1.8 |
GO:0003273 |
cell migration involved in endocardial cushion formation(GO:0003273) |
| 0.9 |
9.1 |
GO:0030049 |
muscle filament sliding(GO:0030049) |
| 0.9 |
1.8 |
GO:1904814 |
regulation of protein localization to chromosome, telomeric region(GO:1904814) |
| 0.9 |
1.8 |
GO:0071550 |
death-inducing signaling complex assembly(GO:0071550) |
| 0.9 |
5.4 |
GO:2000767 |
positive regulation of cytoplasmic translation(GO:2000767) |
| 0.9 |
0.9 |
GO:0072498 |
embryonic skeletal joint development(GO:0072498) |
| 0.9 |
1.8 |
GO:0009113 |
purine nucleobase biosynthetic process(GO:0009113) |
| 0.9 |
3.6 |
GO:2000546 |
positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.9 |
3.6 |
GO:0071599 |
otic vesicle development(GO:0071599) |
| 0.9 |
0.9 |
GO:0042482 |
positive regulation of odontogenesis(GO:0042482) |
| 0.9 |
5.4 |
GO:0042866 |
pyruvate biosynthetic process(GO:0042866) |
| 0.9 |
2.7 |
GO:0034476 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 0.9 |
2.7 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.9 |
11.6 |
GO:0042403 |
thyroid hormone metabolic process(GO:0042403) |
| 0.9 |
2.7 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.9 |
0.9 |
GO:0070459 |
prolactin secretion(GO:0070459) |
| 0.9 |
1.8 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.9 |
5.3 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.9 |
14.9 |
GO:0006978 |
DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
| 0.9 |
1.8 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.9 |
9.6 |
GO:1903504 |
regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.9 |
0.9 |
GO:1905206 |
positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.9 |
0.9 |
GO:2000278 |
regulation of DNA biosynthetic process(GO:2000278) |
| 0.9 |
4.3 |
GO:0010764 |
negative regulation of fibroblast migration(GO:0010764) |
| 0.9 |
2.6 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.9 |
4.3 |
GO:0000972 |
transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.9 |
3.5 |
GO:1903204 |
negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.9 |
0.9 |
GO:0000720 |
pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.9 |
6.9 |
GO:0009301 |
snRNA transcription(GO:0009301) |
| 0.9 |
0.9 |
GO:0060712 |
spongiotrophoblast layer development(GO:0060712) |
| 0.9 |
13.7 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.9 |
0.9 |
GO:1905063 |
regulation of vascular smooth muscle cell differentiation(GO:1905063) |
| 0.9 |
2.6 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.9 |
2.6 |
GO:1901552 |
positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.9 |
5.1 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.9 |
0.9 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.9 |
17.9 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.8 |
6.8 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.8 |
0.8 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 0.8 |
0.8 |
GO:0000237 |
leptotene(GO:0000237) |
| 0.8 |
11.8 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.8 |
0.8 |
GO:0044849 |
estrous cycle(GO:0044849) |
| 0.8 |
2.5 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.8 |
4.2 |
GO:0038032 |
termination of G-protein coupled receptor signaling pathway(GO:0038032) |
| 0.8 |
6.7 |
GO:0042104 |
positive regulation of activated T cell proliferation(GO:0042104) |
| 0.8 |
3.4 |
GO:1900533 |
medium-chain fatty-acyl-CoA catabolic process(GO:0036114) fatty-acyl-CoA catabolic process(GO:0036115) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.8 |
1.7 |
GO:0014873 |
response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
| 0.8 |
5.0 |
GO:0060052 |
neurofilament cytoskeleton organization(GO:0060052) |
| 0.8 |
5.9 |
GO:0042559 |
pteridine-containing compound biosynthetic process(GO:0042559) |
| 0.8 |
1.7 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.8 |
4.2 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.8 |
2.5 |
GO:0014012 |
peripheral nervous system axon regeneration(GO:0014012) |
| 0.8 |
0.8 |
GO:2000832 |
negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.8 |
13.2 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.8 |
0.8 |
GO:0033122 |
regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.8 |
8.2 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.8 |
1.6 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.8 |
5.7 |
GO:0045606 |
positive regulation of epidermal cell differentiation(GO:0045606) |
| 0.8 |
22.9 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.8 |
3.3 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.8 |
13.1 |
GO:0002076 |
osteoblast development(GO:0002076) |
| 0.8 |
4.1 |
GO:0060670 |
branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.8 |
1.6 |
GO:0033484 |
nitric oxide homeostasis(GO:0033484) |
| 0.8 |
2.4 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.8 |
3.3 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.8 |
3.3 |
GO:0001834 |
trophectodermal cell proliferation(GO:0001834) |
| 0.8 |
3.2 |
GO:0035814 |
negative regulation of renal sodium excretion(GO:0035814) |
| 0.8 |
2.4 |
GO:0006592 |
ornithine biosynthetic process(GO:0006592) |
| 0.8 |
2.4 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.8 |
0.8 |
GO:0002667 |
lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.8 |
5.6 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.8 |
6.4 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.8 |
5.6 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.8 |
2.4 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.8 |
0.8 |
GO:0002309 |
T cell proliferation involved in immune response(GO:0002309) |
| 0.8 |
4.8 |
GO:0043983 |
histone H4-K12 acetylation(GO:0043983) |
| 0.8 |
4.8 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.8 |
1.6 |
GO:0021631 |
optic nerve morphogenesis(GO:0021631) |
| 0.8 |
1.6 |
GO:1902237 |
positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.8 |
17.4 |
GO:0001706 |
endoderm formation(GO:0001706) |
| 0.8 |
2.4 |
GO:0042364 |
water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.8 |
1.6 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.8 |
4.0 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.8 |
4.0 |
GO:0006012 |
galactose metabolic process(GO:0006012) |
| 0.8 |
3.9 |
GO:0032796 |
uropod organization(GO:0032796) |
| 0.8 |
3.9 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.8 |
2.4 |
GO:0048546 |
digestive tract morphogenesis(GO:0048546) |
| 0.8 |
3.9 |
GO:0045650 |
negative regulation of macrophage differentiation(GO:0045650) |
| 0.8 |
0.8 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 0.8 |
0.8 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.8 |
20.2 |
GO:0003382 |
epithelial cell morphogenesis(GO:0003382) |
| 0.8 |
0.8 |
GO:0002155 |
regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.8 |
1.6 |
GO:0051220 |
cytoplasmic sequestering of protein(GO:0051220) |
| 0.8 |
3.9 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.8 |
3.8 |
GO:0006561 |
proline biosynthetic process(GO:0006561) |
| 0.8 |
0.8 |
GO:0060528 |
secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.8 |
12.1 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 0.8 |
1.5 |
GO:0009162 |
deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.8 |
17.4 |
GO:0070208 |
protein heterotrimerization(GO:0070208) |
| 0.8 |
7.6 |
GO:0072643 |
interferon-gamma secretion(GO:0072643) |
| 0.8 |
1.5 |
GO:0050859 |
negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.8 |
3.0 |
GO:1900028 |
negative regulation of ruffle assembly(GO:1900028) |
| 0.8 |
12.8 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.7 |
11.2 |
GO:0006999 |
nuclear pore organization(GO:0006999) |
| 0.7 |
4.5 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.7 |
2.2 |
GO:0032877 |
negative regulation of cytokinesis(GO:0032466) positive regulation of DNA endoreduplication(GO:0032877) |
| 0.7 |
3.7 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.7 |
3.7 |
GO:0071205 |
protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.7 |
5.9 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.7 |
8.8 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.7 |
2.9 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.7 |
2.9 |
GO:0006002 |
fructose 6-phosphate metabolic process(GO:0006002) |
| 0.7 |
2.9 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.7 |
5.8 |
GO:0031642 |
negative regulation of myelination(GO:0031642) |
| 0.7 |
0.7 |
GO:0090526 |
regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.7 |
5.1 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.7 |
0.7 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.7 |
0.7 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.7 |
5.0 |
GO:0006307 |
DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.7 |
2.9 |
GO:0021798 |
forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.7 |
2.9 |
GO:1900027 |
regulation of ruffle assembly(GO:1900027) |
| 0.7 |
2.2 |
GO:0070307 |
lens fiber cell development(GO:0070307) |
| 0.7 |
0.7 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.7 |
3.6 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.7 |
4.3 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.7 |
1.4 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.7 |
16.3 |
GO:0009299 |
mRNA transcription(GO:0009299) |
| 0.7 |
4.3 |
GO:0001771 |
immunological synapse formation(GO:0001771) |
| 0.7 |
4.3 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.7 |
7.8 |
GO:0050765 |
negative regulation of phagocytosis(GO:0050765) |
| 0.7 |
2.1 |
GO:0080111 |
DNA dealkylation(GO:0035510) DNA demethylation(GO:0080111) |
| 0.7 |
7.0 |
GO:0007008 |
outer mitochondrial membrane organization(GO:0007008) |
| 0.7 |
0.7 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.7 |
3.5 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.7 |
5.6 |
GO:0010586 |
miRNA metabolic process(GO:0010586) |
| 0.7 |
2.8 |
GO:0036438 |
maintenance of lens transparency(GO:0036438) |
| 0.7 |
2.7 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.7 |
10.3 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.7 |
0.7 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.7 |
3.4 |
GO:0072488 |
ammonium transmembrane transport(GO:0072488) |
| 0.7 |
8.2 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.7 |
7.5 |
GO:0060707 |
trophoblast giant cell differentiation(GO:0060707) |
| 0.7 |
0.7 |
GO:0006933 |
negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.7 |
3.4 |
GO:0071107 |
post-embryonic body morphogenesis(GO:0040032) response to parathyroid hormone(GO:0071107) |
| 0.7 |
1.3 |
GO:0042534 |
tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
| 0.7 |
5.4 |
GO:0032332 |
positive regulation of chondrocyte differentiation(GO:0032332) |
| 0.7 |
3.4 |
GO:0071493 |
cellular response to UV-B(GO:0071493) |
| 0.7 |
2.7 |
GO:0070474 |
positive regulation of uterine smooth muscle contraction(GO:0070474) |
| 0.7 |
2.0 |
GO:0032493 |
response to bacterial lipoprotein(GO:0032493) |
| 0.7 |
26.7 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.7 |
2.0 |
GO:0001946 |
lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
| 0.7 |
4.0 |
GO:1902177 |
positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.7 |
6.0 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.7 |
0.7 |
GO:0044340 |
canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.7 |
8.0 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.7 |
0.7 |
GO:0007354 |
zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.7 |
3.3 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.7 |
2.6 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.7 |
0.7 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.7 |
2.6 |
GO:0072584 |
caveolin-mediated endocytosis(GO:0072584) |
| 0.6 |
0.6 |
GO:0001704 |
formation of primary germ layer(GO:0001704) |
| 0.6 |
5.2 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.6 |
12.9 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.6 |
1.9 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 0.6 |
1.3 |
GO:1902915 |
negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.6 |
0.6 |
GO:0007141 |
male meiosis I(GO:0007141) |
| 0.6 |
1.9 |
GO:0072757 |
cellular response to camptothecin(GO:0072757) |
| 0.6 |
1.9 |
GO:0021562 |
vestibulocochlear nerve development(GO:0021562) |
| 0.6 |
16.6 |
GO:0000462 |
maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.6 |
0.6 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.6 |
3.8 |
GO:0036444 |
calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.6 |
0.6 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.6 |
7.0 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.6 |
1.9 |
GO:0002940 |
tRNA N2-guanine methylation(GO:0002940) |
| 0.6 |
1.3 |
GO:0033632 |
regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.6 |
2.5 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.6 |
1.9 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.6 |
5.0 |
GO:0006930 |
substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.6 |
2.5 |
GO:0046726 |
positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.6 |
1.2 |
GO:0070093 |
negative regulation of glucagon secretion(GO:0070093) |
| 0.6 |
4.4 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.6 |
4.4 |
GO:0043982 |
histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.6 |
2.5 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.6 |
1.2 |
GO:0016095 |
polyprenol catabolic process(GO:0016095) |
| 0.6 |
1.9 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.6 |
7.4 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.6 |
1.2 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.6 |
6.2 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.6 |
3.7 |
GO:0006501 |
C-terminal protein lipidation(GO:0006501) |
| 0.6 |
0.6 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.6 |
6.1 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.6 |
1.8 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.6 |
4.3 |
GO:0006048 |
UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.6 |
2.4 |
GO:0042590 |
antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.6 |
15.2 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.6 |
3.6 |
GO:0010917 |
negative regulation of mitochondrial membrane potential(GO:0010917) |
| 0.6 |
4.2 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.6 |
15.6 |
GO:0045747 |
positive regulation of Notch signaling pathway(GO:0045747) |
| 0.6 |
1.2 |
GO:0007182 |
common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.6 |
5.4 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.6 |
1.2 |
GO:0060455 |
regulation of gastric acid secretion(GO:0060453) negative regulation of gastric acid secretion(GO:0060455) |
| 0.6 |
1.8 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.6 |
0.6 |
GO:0046166 |
glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.6 |
2.3 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.6 |
5.3 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.6 |
0.6 |
GO:0070627 |
ferrous iron import(GO:0070627) |
| 0.6 |
1.2 |
GO:0019240 |
citrulline biosynthetic process(GO:0019240) |
| 0.6 |
6.4 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.6 |
2.3 |
GO:0060338 |
regulation of type I interferon-mediated signaling pathway(GO:0060338) |
| 0.6 |
3.5 |
GO:0015015 |
heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.6 |
0.6 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.6 |
1.7 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.6 |
2.3 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.6 |
8.1 |
GO:0035025 |
positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.6 |
1.7 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.6 |
1.2 |
GO:0016246 |
RNA interference(GO:0016246) |
| 0.6 |
4.0 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.6 |
1.7 |
GO:1990928 |
response to amino acid starvation(GO:1990928) |
| 0.6 |
1.7 |
GO:0046416 |
D-amino acid catabolic process(GO:0019478) D-amino acid metabolic process(GO:0046416) |
| 0.6 |
1.7 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.6 |
1.1 |
GO:0090503 |
RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.6 |
4.6 |
GO:0035646 |
endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.6 |
0.6 |
GO:0060586 |
multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.6 |
14.2 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.6 |
2.3 |
GO:0043654 |
recognition of apoptotic cell(GO:0043654) |
| 0.6 |
5.6 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.6 |
7.9 |
GO:1903861 |
regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
| 0.6 |
1.1 |
GO:0002755 |
MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.6 |
1.7 |
GO:2000987 |
positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.6 |
2.8 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.6 |
0.6 |
GO:0051562 |
negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.6 |
1.1 |
GO:0043353 |
enucleate erythrocyte differentiation(GO:0043353) |
| 0.6 |
7.8 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.6 |
0.6 |
GO:0097680 |
double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.6 |
2.2 |
GO:0006788 |
heme oxidation(GO:0006788) |
| 0.6 |
4.4 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.5 |
3.8 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.5 |
0.5 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.5 |
6.6 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.5 |
2.7 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.5 |
0.5 |
GO:1901979 |
regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.5 |
2.2 |
GO:0008298 |
intracellular mRNA localization(GO:0008298) |
| 0.5 |
5.4 |
GO:0071353 |
cellular response to interleukin-4(GO:0071353) |
| 0.5 |
2.7 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.5 |
2.7 |
GO:0098903 |
regulation of membrane repolarization during action potential(GO:0098903) |
| 0.5 |
3.2 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.5 |
1.6 |
GO:0046060 |
dATP metabolic process(GO:0046060) |
| 0.5 |
1.1 |
GO:0048050 |
post-embryonic eye morphogenesis(GO:0048050) |
| 0.5 |
2.2 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.5 |
1.6 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.5 |
1.1 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.5 |
5.3 |
GO:0097034 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.5 |
0.5 |
GO:0010936 |
negative regulation of macrophage cytokine production(GO:0010936) |
| 0.5 |
1.1 |
GO:0090071 |
regulation of ribosome biogenesis(GO:0090069) negative regulation of ribosome biogenesis(GO:0090071) |
| 0.5 |
1.1 |
GO:0048563 |
post-embryonic organ morphogenesis(GO:0048563) |
| 0.5 |
1.6 |
GO:0002566 |
somatic diversification of immune receptors via somatic mutation(GO:0002566) |
| 0.5 |
3.7 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.5 |
5.8 |
GO:0000244 |
spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.5 |
6.8 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.5 |
4.7 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.5 |
11.6 |
GO:0006879 |
cellular iron ion homeostasis(GO:0006879) |
| 0.5 |
1.6 |
GO:0032471 |
negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.5 |
2.6 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.5 |
1.6 |
GO:1990046 |
positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) stress-induced mitochondrial fusion(GO:1990046) |
| 0.5 |
2.6 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.5 |
6.3 |
GO:0033623 |
regulation of integrin activation(GO:0033623) |
| 0.5 |
9.9 |
GO:0048026 |
positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.5 |
5.7 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.5 |
1.6 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.5 |
5.2 |
GO:0010592 |
positive regulation of lamellipodium assembly(GO:0010592) |
| 0.5 |
1.0 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.5 |
2.1 |
GO:0070613 |
regulation of protein processing(GO:0070613) |
| 0.5 |
0.5 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.5 |
1.0 |
GO:0006450 |
regulation of translational fidelity(GO:0006450) |
| 0.5 |
3.1 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.5 |
5.1 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.5 |
1.5 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.5 |
1.0 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.5 |
3.0 |
GO:0007175 |
negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.5 |
4.1 |
GO:0018916 |
nitrobenzene metabolic process(GO:0018916) |
| 0.5 |
1.5 |
GO:0031017 |
exocrine pancreas development(GO:0031017) |
| 0.5 |
1.5 |
GO:0045630 |
positive regulation of T-helper 2 cell differentiation(GO:0045630) |
| 0.5 |
3.0 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.5 |
6.6 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.5 |
1.5 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.5 |
0.5 |
GO:0072224 |
metanephric glomerulus development(GO:0072224) |
| 0.5 |
1.0 |
GO:0016081 |
synaptic vesicle docking(GO:0016081) |
| 0.5 |
2.0 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.5 |
1.0 |
GO:0006560 |
proline metabolic process(GO:0006560) |
| 0.5 |
3.5 |
GO:0055064 |
chloride ion homeostasis(GO:0055064) |
| 0.5 |
2.5 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.5 |
0.5 |
GO:0006702 |
androgen biosynthetic process(GO:0006702) |
| 0.5 |
3.0 |
GO:0034472 |
snRNA 3'-end processing(GO:0034472) |
| 0.5 |
2.5 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.5 |
2.0 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.5 |
0.5 |
GO:1901252 |
regulation of intracellular transport of viral material(GO:1901252) |
| 0.5 |
2.0 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.5 |
2.9 |
GO:0010992 |
ubiquitin homeostasis(GO:0010992) |
| 0.5 |
0.5 |
GO:0072592 |
oxygen metabolic process(GO:0072592) |
| 0.5 |
5.4 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.5 |
2.9 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.5 |
3.9 |
GO:0007530 |
sex determination(GO:0007530) |
| 0.5 |
2.0 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.5 |
1.5 |
GO:0043312 |
neutrophil degranulation(GO:0043312) |
| 0.5 |
3.4 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.5 |
0.5 |
GO:0071609 |
chemokine (C-C motif) ligand 5 production(GO:0071609) |
| 0.5 |
1.0 |
GO:0006513 |
protein monoubiquitination(GO:0006513) |
| 0.5 |
1.5 |
GO:0072553 |
terminal button organization(GO:0072553) |
| 0.5 |
1.9 |
GO:0070314 |
G1 to G0 transition(GO:0070314) |
| 0.5 |
1.5 |
GO:0006591 |
ornithine metabolic process(GO:0006591) |
| 0.5 |
1.0 |
GO:0032513 |
negative regulation of protein phosphatase type 2B activity(GO:0032513) |
| 0.5 |
1.0 |
GO:0046719 |
regulation by virus of viral protein levels in host cell(GO:0046719) |
| 0.5 |
1.0 |
GO:0038003 |
opioid receptor signaling pathway(GO:0038003) regulation of opioid receptor signaling pathway(GO:2000474) |
| 0.5 |
4.8 |
GO:0010388 |
cullin deneddylation(GO:0010388) |
| 0.5 |
1.4 |
GO:0045909 |
positive regulation of vasodilation(GO:0045909) |
| 0.5 |
2.9 |
GO:0006104 |
succinyl-CoA metabolic process(GO:0006104) |
| 0.5 |
1.9 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.5 |
9.1 |
GO:0016578 |
histone deubiquitination(GO:0016578) |
| 0.5 |
0.5 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 0.5 |
3.8 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.5 |
2.4 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.5 |
3.3 |
GO:0048755 |
branching morphogenesis of a nerve(GO:0048755) |
| 0.5 |
0.5 |
GO:0034310 |
primary alcohol catabolic process(GO:0034310) |
| 0.5 |
6.6 |
GO:0050832 |
defense response to fungus(GO:0050832) |
| 0.5 |
1.9 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.5 |
3.8 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.5 |
1.9 |
GO:0045721 |
negative regulation of gluconeogenesis(GO:0045721) |
| 0.5 |
1.4 |
GO:2000774 |
positive regulation of cellular senescence(GO:2000774) |
| 0.5 |
1.4 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.5 |
1.9 |
GO:0007023 |
post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.5 |
0.9 |
GO:0060594 |
mammary gland specification(GO:0060594) |
| 0.5 |
0.5 |
GO:0042505 |
tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.5 |
9.3 |
GO:0034198 |
cellular response to amino acid starvation(GO:0034198) |
| 0.5 |
2.3 |
GO:0090188 |
negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.5 |
2.3 |
GO:0002883 |
hypersensitivity(GO:0002524) regulation of hypersensitivity(GO:0002883) |
| 0.5 |
3.7 |
GO:0051988 |
regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.5 |
12.9 |
GO:0034260 |
negative regulation of GTPase activity(GO:0034260) |
| 0.5 |
0.9 |
GO:0090135 |
actin filament branching(GO:0090135) |
| 0.5 |
4.6 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) |
| 0.5 |
5.0 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 0.5 |
2.3 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.5 |
2.3 |
GO:0042274 |
ribosomal small subunit biogenesis(GO:0042274) |
| 0.5 |
0.5 |
GO:0016479 |
negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.5 |
1.4 |
GO:0048669 |
collateral sprouting in absence of injury(GO:0048669) regulation of collateral sprouting in absence of injury(GO:0048696) negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.5 |
3.6 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 0.5 |
11.3 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.5 |
2.7 |
GO:0033522 |
histone H2A ubiquitination(GO:0033522) |
| 0.5 |
0.5 |
GO:0007403 |
glial cell fate determination(GO:0007403) |
| 0.5 |
1.4 |
GO:0060068 |
vagina development(GO:0060068) |
| 0.5 |
5.4 |
GO:0006825 |
copper ion transport(GO:0006825) |
| 0.5 |
2.3 |
GO:0014883 |
regulation of skeletal muscle adaptation(GO:0014733) transition between fast and slow fiber(GO:0014883) |
| 0.5 |
2.3 |
GO:0032048 |
cardiolipin metabolic process(GO:0032048) |
| 0.4 |
7.2 |
GO:0002931 |
response to ischemia(GO:0002931) |
| 0.4 |
0.4 |
GO:0035898 |
parathyroid hormone secretion(GO:0035898) |
| 0.4 |
1.3 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.4 |
8.5 |
GO:0099517 |
anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.4 |
17.2 |
GO:1903321 |
negative regulation of protein modification by small protein conjugation or removal(GO:1903321) |
| 0.4 |
1.3 |
GO:0042264 |
peptidyl-aspartic acid modification(GO:0018197) peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.4 |
1.3 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.4 |
5.7 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.4 |
5.2 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.4 |
0.9 |
GO:0035356 |
cellular triglyceride homeostasis(GO:0035356) |
| 0.4 |
1.7 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.4 |
0.9 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.4 |
2.2 |
GO:2000623 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.4 |
3.4 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.4 |
2.6 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.4 |
3.9 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.4 |
6.4 |
GO:0032981 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.4 |
0.9 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.4 |
1.7 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.4 |
3.8 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.4 |
3.0 |
GO:0070633 |
transepithelial transport(GO:0070633) |
| 0.4 |
1.7 |
GO:0006787 |
porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
| 0.4 |
0.4 |
GO:0048208 |
vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.4 |
7.9 |
GO:0045746 |
negative regulation of Notch signaling pathway(GO:0045746) |
| 0.4 |
3.8 |
GO:0034644 |
cellular response to UV(GO:0034644) |
| 0.4 |
1.3 |
GO:0009249 |
protein lipoylation(GO:0009249) |
| 0.4 |
0.4 |
GO:0010724 |
regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.4 |
3.3 |
GO:0032625 |
interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 0.4 |
0.4 |
GO:0021692 |
cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
| 0.4 |
2.9 |
GO:1903689 |
regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.4 |
2.0 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.4 |
6.9 |
GO:0003016 |
respiratory system process(GO:0003016) |
| 0.4 |
9.8 |
GO:0045494 |
photoreceptor cell maintenance(GO:0045494) |
| 0.4 |
1.6 |
GO:0090151 |
establishment of protein localization to mitochondrial membrane(GO:0090151) |
| 0.4 |
1.2 |
GO:0007320 |
insemination(GO:0007320) |
| 0.4 |
0.8 |
GO:0006362 |
transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.4 |
1.6 |
GO:0043461 |
proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.4 |
1.2 |
GO:2001185 |
regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.4 |
0.4 |
GO:0032829 |
regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 0.4 |
0.8 |
GO:0060923 |
cardiac muscle cell fate commitment(GO:0060923) |
| 0.4 |
4.0 |
GO:0009048 |
dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.4 |
5.6 |
GO:0048844 |
artery morphogenesis(GO:0048844) |
| 0.4 |
2.4 |
GO:0033327 |
Leydig cell differentiation(GO:0033327) |
| 0.4 |
6.8 |
GO:0042149 |
cellular response to glucose starvation(GO:0042149) |
| 0.4 |
2.4 |
GO:2000601 |
positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.4 |
6.4 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.4 |
0.4 |
GO:0032205 |
negative regulation of telomere maintenance(GO:0032205) |
| 0.4 |
2.8 |
GO:1900745 |
positive regulation of p38MAPK cascade(GO:1900745) |
| 0.4 |
0.4 |
GO:0061055 |
myotome development(GO:0061055) |
| 0.4 |
0.4 |
GO:0033262 |
regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.4 |
1.2 |
GO:0046381 |
CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.4 |
1.2 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.4 |
0.8 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.4 |
14.0 |
GO:0000380 |
alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.4 |
4.7 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.4 |
4.7 |
GO:0034311 |
diol metabolic process(GO:0034311) |
| 0.4 |
3.1 |
GO:0009303 |
rRNA transcription(GO:0009303) ncRNA transcription(GO:0098781) |
| 0.4 |
1.5 |
GO:0032899 |
regulation of neurotrophin production(GO:0032899) |
| 0.4 |
0.8 |
GO:0060054 |
positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.4 |
7.3 |
GO:0070534 |
protein K63-linked ubiquitination(GO:0070534) |
| 0.4 |
1.1 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.4 |
8.0 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.4 |
0.4 |
GO:1902414 |
protein localization to cell junction(GO:1902414) |
| 0.4 |
1.5 |
GO:0010832 |
negative regulation of myotube differentiation(GO:0010832) |
| 0.4 |
3.4 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.4 |
1.5 |
GO:0018107 |
peptidyl-threonine phosphorylation(GO:0018107) |
| 0.4 |
1.5 |
GO:0051866 |
general adaptation syndrome(GO:0051866) |
| 0.4 |
6.0 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.4 |
1.1 |
GO:0016561 |
protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.4 |
5.3 |
GO:0033962 |
cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.4 |
2.6 |
GO:0071451 |
response to superoxide(GO:0000303) cellular response to oxygen radical(GO:0071450) cellular response to superoxide(GO:0071451) |
| 0.4 |
3.0 |
GO:0006706 |
steroid catabolic process(GO:0006706) |
| 0.4 |
0.4 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.4 |
2.2 |
GO:0030263 |
apoptotic chromosome condensation(GO:0030263) |
| 0.4 |
1.5 |
GO:0016114 |
terpenoid biosynthetic process(GO:0016114) |
| 0.4 |
0.7 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.4 |
2.9 |
GO:0061154 |
endothelial tube morphogenesis(GO:0061154) |
| 0.4 |
1.5 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.4 |
4.0 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.4 |
0.4 |
GO:0072567 |
chemokine (C-X-C motif) ligand 2 production(GO:0072567) regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000341) |
| 0.4 |
7.3 |
GO:0051693 |
actin filament capping(GO:0051693) |
| 0.4 |
4.7 |
GO:0008272 |
sulfate transport(GO:0008272) |
| 0.4 |
0.7 |
GO:0090365 |
regulation of mRNA modification(GO:0090365) |
| 0.4 |
2.9 |
GO:0035871 |
protein K11-linked deubiquitination(GO:0035871) |
| 0.4 |
0.7 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.4 |
7.6 |
GO:0002053 |
positive regulation of mesenchymal cell proliferation(GO:0002053) |
| 0.4 |
0.4 |
GO:0048557 |
embryonic digestive tract morphogenesis(GO:0048557) |
| 0.4 |
1.8 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 0.4 |
0.7 |
GO:1902751 |
positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.4 |
9.0 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.4 |
7.1 |
GO:1902808 |
positive regulation of cell cycle G1/S phase transition(GO:1902808) |
| 0.4 |
8.8 |
GO:0034605 |
cellular response to heat(GO:0034605) |
| 0.4 |
1.1 |
GO:1904936 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.4 |
0.4 |
GO:0051958 |
methotrexate transport(GO:0051958) |
| 0.4 |
0.7 |
GO:2000192 |
negative regulation of fatty acid transport(GO:2000192) |
| 0.4 |
2.1 |
GO:0060716 |
labyrinthine layer blood vessel development(GO:0060716) |
| 0.4 |
2.1 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.3 |
1.0 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.3 |
2.4 |
GO:0006972 |
hyperosmotic response(GO:0006972) |
| 0.3 |
12.2 |
GO:0007498 |
mesoderm development(GO:0007498) |
| 0.3 |
2.1 |
GO:0009098 |
branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.3 |
0.3 |
GO:2000170 |
positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.3 |
1.0 |
GO:0060346 |
bone trabecula formation(GO:0060346) |
| 0.3 |
0.3 |
GO:1902897 |
regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.3 |
12.7 |
GO:0006405 |
RNA export from nucleus(GO:0006405) |
| 0.3 |
0.7 |
GO:0036093 |
germ cell proliferation(GO:0036093) |
| 0.3 |
1.7 |
GO:0090049 |
regulation of cell migration involved in sprouting angiogenesis(GO:0090049) |
| 0.3 |
0.7 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.3 |
1.0 |
GO:0016540 |
protein autoprocessing(GO:0016540) |
| 0.3 |
0.3 |
GO:0003289 |
septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
| 0.3 |
0.3 |
GO:0048745 |
smooth muscle tissue development(GO:0048745) |
| 0.3 |
28.4 |
GO:0006364 |
rRNA processing(GO:0006364) |
| 0.3 |
2.4 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.3 |
1.7 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.3 |
1.0 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.3 |
2.7 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.3 |
0.7 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.3 |
1.0 |
GO:0046599 |
regulation of centriole replication(GO:0046599) |
| 0.3 |
0.7 |
GO:0030240 |
skeletal muscle thin filament assembly(GO:0030240) |
| 0.3 |
3.4 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.3 |
2.7 |
GO:0009992 |
cellular water homeostasis(GO:0009992) |
| 0.3 |
0.3 |
GO:0045351 |
type I interferon biosynthetic process(GO:0045351) |
| 0.3 |
1.0 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.3 |
1.3 |
GO:0097178 |
ruffle assembly(GO:0097178) |
| 0.3 |
0.7 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 0.3 |
2.6 |
GO:0002082 |
regulation of oxidative phosphorylation(GO:0002082) |
| 0.3 |
1.3 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.3 |
26.1 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.3 |
8.8 |
GO:0042254 |
ribosome biogenesis(GO:0042254) |
| 0.3 |
3.9 |
GO:0051085 |
chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.3 |
3.2 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.3 |
1.6 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.3 |
1.9 |
GO:0050819 |
negative regulation of coagulation(GO:0050819) |
| 0.3 |
4.4 |
GO:0009880 |
embryonic pattern specification(GO:0009880) |
| 0.3 |
1.3 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.3 |
4.1 |
GO:0007614 |
short-term memory(GO:0007614) |
| 0.3 |
6.6 |
GO:0007020 |
microtubule nucleation(GO:0007020) |
| 0.3 |
3.8 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.3 |
0.6 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.3 |
0.3 |
GO:0061046 |
regulation of branching involved in lung morphogenesis(GO:0061046) |
| 0.3 |
0.6 |
GO:0032275 |
luteinizing hormone secretion(GO:0032275) |
| 0.3 |
1.2 |
GO:0070100 |
negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.3 |
0.3 |
GO:0060353 |
regulation of cell adhesion molecule production(GO:0060353) positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.3 |
0.3 |
GO:0046122 |
purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.3 |
1.5 |
GO:0046329 |
negative regulation of JNK cascade(GO:0046329) |
| 0.3 |
1.2 |
GO:0002190 |
cap-independent translational initiation(GO:0002190) |
| 0.3 |
6.7 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.3 |
0.9 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.3 |
0.6 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 0.3 |
0.9 |
GO:0009129 |
pyrimidine nucleoside monophosphate metabolic process(GO:0009129) |
| 0.3 |
2.4 |
GO:0046085 |
adenosine metabolic process(GO:0046085) |
| 0.3 |
0.3 |
GO:0032760 |
positive regulation of tumor necrosis factor production(GO:0032760) positive regulation of tumor necrosis factor superfamily cytokine production(GO:1903557) |
| 0.3 |
7.2 |
GO:0034724 |
DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.3 |
1.8 |
GO:0007080 |
mitotic metaphase plate congression(GO:0007080) |
| 0.3 |
1.8 |
GO:0006477 |
protein sulfation(GO:0006477) |
| 0.3 |
0.9 |
GO:1904729 |
regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal absorption(GO:1904478) regulation of intestinal lipid absorption(GO:1904729) |
| 0.3 |
0.3 |
GO:1903599 |
positive regulation of mitophagy(GO:1903599) |
| 0.3 |
0.6 |
GO:0033762 |
response to glucagon(GO:0033762) |
| 0.3 |
0.6 |
GO:0002021 |
response to dietary excess(GO:0002021) |
| 0.3 |
0.9 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.3 |
3.2 |
GO:0030574 |
collagen catabolic process(GO:0030574) |
| 0.3 |
2.1 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.3 |
1.8 |
GO:0097341 |
inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.3 |
0.3 |
GO:2000680 |
regulation of rubidium ion transport(GO:2000680) regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.3 |
0.6 |
GO:0061045 |
negative regulation of wound healing(GO:0061045) |
| 0.3 |
5.3 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.3 |
8.5 |
GO:0009060 |
aerobic respiration(GO:0009060) |
| 0.3 |
0.9 |
GO:0039536 |
negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.3 |
1.5 |
GO:0043314 |
negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) negative regulation of neutrophil activation(GO:1902564) |
| 0.3 |
7.5 |
GO:0051568 |
histone H3-K4 methylation(GO:0051568) |
| 0.3 |
0.3 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.3 |
1.2 |
GO:0034379 |
very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.3 |
1.2 |
GO:0006098 |
pentose-phosphate shunt(GO:0006098) |
| 0.3 |
0.9 |
GO:0060294 |
cilium movement involved in cell motility(GO:0060294) |
| 0.3 |
0.3 |
GO:0002385 |
mucosal immune response(GO:0002385) |
| 0.3 |
0.9 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.3 |
1.7 |
GO:0070897 |
DNA-templated transcriptional preinitiation complex assembly(GO:0070897) |
| 0.3 |
0.9 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.3 |
9.9 |
GO:0046660 |
female sex differentiation(GO:0046660) |
| 0.3 |
3.4 |
GO:0030201 |
heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.3 |
0.8 |
GO:0030262 |
cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
| 0.3 |
0.3 |
GO:1900186 |
negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.3 |
1.1 |
GO:0009988 |
cell-cell recognition(GO:0009988) |
| 0.3 |
0.3 |
GO:0030277 |
maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.3 |
0.3 |
GO:0060509 |
Type I pneumocyte differentiation(GO:0060509) |
| 0.3 |
0.8 |
GO:1902036 |
regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.3 |
0.8 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.3 |
0.8 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.3 |
3.5 |
GO:0033006 |
regulation of mast cell activation involved in immune response(GO:0033006) regulation of mast cell degranulation(GO:0043304) |
| 0.3 |
2.2 |
GO:0051974 |
negative regulation of telomerase activity(GO:0051974) |
| 0.3 |
3.2 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.3 |
0.3 |
GO:0002578 |
negative regulation of antigen processing and presentation(GO:0002578) |
| 0.3 |
1.6 |
GO:0001893 |
maternal placenta development(GO:0001893) |
| 0.3 |
0.5 |
GO:0061525 |
hindgut development(GO:0061525) |
| 0.3 |
1.1 |
GO:0043508 |
negative regulation of JUN kinase activity(GO:0043508) |
| 0.3 |
1.1 |
GO:0018202 |
peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.3 |
0.8 |
GO:0048599 |
oocyte development(GO:0048599) |
| 0.3 |
9.6 |
GO:0032543 |
mitochondrial translation(GO:0032543) |
| 0.3 |
0.5 |
GO:0046902 |
regulation of mitochondrial membrane permeability(GO:0046902) |
| 0.3 |
1.1 |
GO:0031047 |
gene silencing by RNA(GO:0031047) |
| 0.3 |
0.5 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 0.3 |
3.2 |
GO:0070207 |
protein homotrimerization(GO:0070207) |
| 0.3 |
5.5 |
GO:0048704 |
embryonic skeletal system morphogenesis(GO:0048704) |
| 0.3 |
0.8 |
GO:0043570 |
maintenance of DNA repeat elements(GO:0043570) |
| 0.3 |
1.6 |
GO:0000291 |
nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.3 |
2.3 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.3 |
2.1 |
GO:0006515 |
misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.3 |
0.8 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.3 |
0.5 |
GO:0043496 |
regulation of protein homodimerization activity(GO:0043496) |
| 0.3 |
0.5 |
GO:0002828 |
regulation of type 2 immune response(GO:0002828) |
| 0.3 |
0.8 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.3 |
1.3 |
GO:0002693 |
positive regulation of cellular extravasation(GO:0002693) |
| 0.3 |
0.3 |
GO:0097067 |
cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.3 |
1.3 |
GO:0048536 |
spleen development(GO:0048536) |
| 0.3 |
6.3 |
GO:0006418 |
tRNA aminoacylation for protein translation(GO:0006418) |
| 0.3 |
2.3 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.3 |
0.3 |
GO:0051124 |
synaptic growth at neuromuscular junction(GO:0051124) |
| 0.3 |
1.0 |
GO:0032695 |
negative regulation of interleukin-12 production(GO:0032695) |
| 0.2 |
3.5 |
GO:0006414 |
translational elongation(GO:0006414) |
| 0.2 |
1.0 |
GO:0045724 |
positive regulation of cilium assembly(GO:0045724) |
| 0.2 |
3.5 |
GO:0046596 |
regulation of viral entry into host cell(GO:0046596) |
| 0.2 |
0.2 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) |
| 0.2 |
0.7 |
GO:0042997 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.2 |
1.9 |
GO:0034770 |
histone H4-K20 methylation(GO:0034770) |
| 0.2 |
1.2 |
GO:0000012 |
single strand break repair(GO:0000012) |
| 0.2 |
13.7 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.2 |
0.5 |
GO:0060830 |
ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.2 |
0.7 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.2 |
3.4 |
GO:0070265 |
necrotic cell death(GO:0070265) |
| 0.2 |
0.5 |
GO:0045023 |
G0 to G1 transition(GO:0045023) regulation of G0 to G1 transition(GO:0070316) negative regulation of G0 to G1 transition(GO:0070317) |
| 0.2 |
0.2 |
GO:0042554 |
superoxide anion generation(GO:0042554) |
| 0.2 |
1.9 |
GO:0048806 |
genitalia development(GO:0048806) |
| 0.2 |
0.7 |
GO:0071787 |
endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.2 |
3.3 |
GO:0030497 |
fatty acid elongation(GO:0030497) |
| 0.2 |
0.7 |
GO:1903846 |
positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.2 |
0.2 |
GO:0034047 |
regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.2 |
2.1 |
GO:0070986 |
left/right axis specification(GO:0070986) |
| 0.2 |
1.4 |
GO:0061299 |
retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.2 |
1.6 |
GO:0090200 |
positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.2 |
0.2 |
GO:0032713 |
negative regulation of interleukin-4 production(GO:0032713) |
| 0.2 |
2.3 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.2 |
2.1 |
GO:0006221 |
pyrimidine nucleotide biosynthetic process(GO:0006221) |
| 0.2 |
0.7 |
GO:0070193 |
synaptonemal complex organization(GO:0070193) |
| 0.2 |
0.2 |
GO:0090031 |
positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.2 |
0.2 |
GO:0050685 |
positive regulation of mRNA processing(GO:0050685) |
| 0.2 |
0.9 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.2 |
0.4 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.2 |
0.2 |
GO:0003197 |
endocardial cushion development(GO:0003197) |
| 0.2 |
1.5 |
GO:0043627 |
response to estrogen(GO:0043627) |
| 0.2 |
0.4 |
GO:0031572 |
G2 DNA damage checkpoint(GO:0031572) |
| 0.2 |
0.2 |
GO:0010873 |
positive regulation of cholesterol esterification(GO:0010873) |
| 0.2 |
6.9 |
GO:0070527 |
platelet aggregation(GO:0070527) |
| 0.2 |
0.6 |
GO:0046016 |
regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) regulation of transcription by glucose(GO:0046015) positive regulation of transcription by glucose(GO:0046016) |
| 0.2 |
1.3 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.2 |
2.6 |
GO:1990126 |
retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.2 |
2.1 |
GO:2000045 |
regulation of G1/S transition of mitotic cell cycle(GO:2000045) |
| 0.2 |
1.5 |
GO:0048227 |
plasma membrane to endosome transport(GO:0048227) |
| 0.2 |
0.2 |
GO:0006046 |
N-acetylglucosamine catabolic process(GO:0006046) |
| 0.2 |
0.4 |
GO:0001973 |
adenosine receptor signaling pathway(GO:0001973) |
| 0.2 |
1.3 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.2 |
0.2 |
GO:2000370 |
positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.2 |
0.6 |
GO:0060044 |
negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.2 |
0.8 |
GO:1901163 |
trophoblast cell migration(GO:0061450) regulation of trophoblast cell migration(GO:1901163) |
| 0.2 |
2.3 |
GO:0071391 |
cellular response to estrogen stimulus(GO:0071391) |
| 0.2 |
2.5 |
GO:0046855 |
phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
| 0.2 |
0.8 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.2 |
3.1 |
GO:0060325 |
face morphogenesis(GO:0060325) |
| 0.2 |
1.8 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.2 |
0.2 |
GO:0010884 |
positive regulation of lipid storage(GO:0010884) |
| 0.2 |
1.4 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.2 |
0.8 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.2 |
0.6 |
GO:0033108 |
mitochondrial respiratory chain complex assembly(GO:0033108) |
| 0.2 |
0.4 |
GO:0002024 |
diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 0.2 |
0.4 |
GO:0060025 |
regulation of synaptic activity(GO:0060025) |
| 0.2 |
2.0 |
GO:0002052 |
positive regulation of neuroblast proliferation(GO:0002052) regulation of neuroblast proliferation(GO:1902692) |
| 0.2 |
1.6 |
GO:0043551 |
regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
| 0.2 |
0.2 |
GO:0030656 |
regulation of vitamin metabolic process(GO:0030656) |
| 0.2 |
45.1 |
GO:0006412 |
translation(GO:0006412) |
| 0.2 |
1.8 |
GO:0048535 |
lymph node development(GO:0048535) |
| 0.2 |
0.6 |
GO:0009644 |
response to high light intensity(GO:0009644) |
| 0.2 |
3.1 |
GO:0032526 |
response to retinoic acid(GO:0032526) |
| 0.2 |
0.4 |
GO:2000279 |
negative regulation of DNA biosynthetic process(GO:2000279) |
| 0.2 |
0.4 |
GO:0072520 |
seminiferous tubule development(GO:0072520) |
| 0.2 |
3.3 |
GO:0048791 |
calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.2 |
0.4 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.2 |
0.8 |
GO:0019673 |
GDP-mannose metabolic process(GO:0019673) |
| 0.2 |
0.6 |
GO:0048730 |
epidermis morphogenesis(GO:0048730) |
| 0.2 |
0.8 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.2 |
0.6 |
GO:0030208 |
dermatan sulfate biosynthetic process(GO:0030208) |
| 0.2 |
1.3 |
GO:0007252 |
I-kappaB phosphorylation(GO:0007252) |
| 0.2 |
0.4 |
GO:0035435 |
phosphate ion transmembrane transport(GO:0035435) |
| 0.2 |
0.7 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.2 |
1.7 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.2 |
0.4 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.2 |
1.1 |
GO:1902894 |
negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.2 |
0.2 |
GO:1902969 |
mitotic DNA replication(GO:1902969) |
| 0.2 |
0.5 |
GO:0032717 |
negative regulation of interleukin-8 production(GO:0032717) |
| 0.2 |
0.5 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.2 |
0.5 |
GO:0019985 |
translesion synthesis(GO:0019985) |
| 0.2 |
0.5 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.2 |
0.5 |
GO:0035372 |
protein localization to microtubule(GO:0035372) |
| 0.2 |
0.9 |
GO:0016560 |
protein import into peroxisome matrix, docking(GO:0016560) |
| 0.2 |
0.3 |
GO:0038180 |
nerve growth factor signaling pathway(GO:0038180) |
| 0.2 |
0.3 |
GO:0042659 |
regulation of cell fate specification(GO:0042659) |
| 0.2 |
0.3 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.2 |
3.8 |
GO:0035458 |
cellular response to interferon-beta(GO:0035458) |
| 0.2 |
0.5 |
GO:0007016 |
cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.2 |
6.9 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.2 |
6.0 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.2 |
0.7 |
GO:0046135 |
pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.2 |
0.5 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.2 |
0.5 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.2 |
1.0 |
GO:0071803 |
positive regulation of podosome assembly(GO:0071803) |
| 0.2 |
2.2 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.2 |
0.7 |
GO:0007224 |
smoothened signaling pathway(GO:0007224) |
| 0.2 |
2.0 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.2 |
0.3 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.2 |
0.3 |
GO:0010726 |
positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.2 |
0.8 |
GO:0006220 |
pyrimidine nucleotide metabolic process(GO:0006220) |
| 0.2 |
0.3 |
GO:0032025 |
response to cobalt ion(GO:0032025) |
| 0.2 |
1.0 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.2 |
4.7 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.2 |
1.1 |
GO:0006661 |
phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.2 |
2.1 |
GO:0045070 |
positive regulation of viral genome replication(GO:0045070) |
| 0.2 |
0.2 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.2 |
1.4 |
GO:0090224 |
regulation of spindle organization(GO:0090224) |
| 0.2 |
0.5 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.2 |
0.5 |
GO:1900060 |
negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.2 |
1.1 |
GO:0050884 |
neuromuscular process controlling posture(GO:0050884) |
| 0.2 |
0.9 |
GO:0060706 |
cell differentiation involved in embryonic placenta development(GO:0060706) |
| 0.2 |
2.0 |
GO:0016486 |
peptide hormone processing(GO:0016486) |
| 0.2 |
0.8 |
GO:0051180 |
vitamin transport(GO:0051180) |
| 0.2 |
0.2 |
GO:0010845 |
positive regulation of reciprocal meiotic recombination(GO:0010845) |
| 0.2 |
1.2 |
GO:0036506 |
maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.2 |
0.9 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.1 |
0.6 |
GO:0035584 |
calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.1 |
0.1 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.1 |
1.7 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 0.1 |
1.3 |
GO:0015937 |
coenzyme A biosynthetic process(GO:0015937) |
| 0.1 |
0.4 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.1 |
8.3 |
GO:0071229 |
cellular response to acid chemical(GO:0071229) |
| 0.1 |
2.4 |
GO:0008214 |
protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
| 0.1 |
0.6 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.1 |
1.0 |
GO:0045907 |
positive regulation of vasoconstriction(GO:0045907) |
| 0.1 |
0.7 |
GO:0031648 |
protein destabilization(GO:0031648) |
| 0.1 |
0.1 |
GO:1900042 |
positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.1 |
0.7 |
GO:0051013 |
microtubule severing(GO:0051013) |
| 0.1 |
0.4 |
GO:0015858 |
nucleoside transport(GO:0015858) |
| 0.1 |
0.6 |
GO:0032480 |
negative regulation of type I interferon production(GO:0032480) negative regulation of interferon-beta production(GO:0032688) |
| 0.1 |
0.4 |
GO:0048211 |
Golgi vesicle docking(GO:0048211) |
| 0.1 |
0.1 |
GO:0021902 |
commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.1 |
0.6 |
GO:1904587 |
glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
| 0.1 |
0.7 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.1 |
2.1 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.1 |
0.4 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.1 |
3.0 |
GO:0032091 |
negative regulation of protein binding(GO:0032091) |
| 0.1 |
0.4 |
GO:2000516 |
positive regulation of CD4-positive, alpha-beta T cell activation(GO:2000516) |
| 0.1 |
0.3 |
GO:1900037 |
regulation of cellular response to hypoxia(GO:1900037) |
| 0.1 |
0.5 |
GO:0006301 |
postreplication repair(GO:0006301) |
| 0.1 |
0.3 |
GO:0070234 |
positive regulation of T cell apoptotic process(GO:0070234) |
| 0.1 |
0.5 |
GO:0010165 |
response to X-ray(GO:0010165) |
| 0.1 |
0.3 |
GO:0002002 |
regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
| 0.1 |
0.3 |
GO:1900747 |
negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.1 |
1.0 |
GO:0031297 |
replication fork processing(GO:0031297) |
| 0.1 |
4.4 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.1 |
0.4 |
GO:0071971 |
extracellular exosome assembly(GO:0071971) regulation of extracellular exosome assembly(GO:1903551) |
| 0.1 |
0.5 |
GO:2000272 |
negative regulation of receptor activity(GO:2000272) |
| 0.1 |
0.5 |
GO:0032204 |
regulation of telomere maintenance(GO:0032204) |
| 0.1 |
0.2 |
GO:0072512 |
ferric iron transport(GO:0015682) trivalent inorganic cation transport(GO:0072512) |
| 0.1 |
1.0 |
GO:0042753 |
positive regulation of circadian rhythm(GO:0042753) |
| 0.1 |
1.1 |
GO:0006654 |
phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
| 0.1 |
0.4 |
GO:0003215 |
cardiac right ventricle morphogenesis(GO:0003215) |
| 0.1 |
0.5 |
GO:0045056 |
transcytosis(GO:0045056) |
| 0.1 |
0.8 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.1 |
1.8 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.1 |
0.2 |
GO:0039532 |
negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
| 0.1 |
0.5 |
GO:0006826 |
iron ion transport(GO:0006826) |
| 0.1 |
0.1 |
GO:0035456 |
response to interferon-beta(GO:0035456) |
| 0.1 |
0.2 |
GO:0090103 |
cochlea morphogenesis(GO:0090103) |
| 0.1 |
0.1 |
GO:0071073 |
positive regulation of phospholipid biosynthetic process(GO:0071073) |
| 0.1 |
2.2 |
GO:0045540 |
regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.1 |
0.6 |
GO:0051534 |
negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.1 |
0.8 |
GO:0015862 |
uridine transport(GO:0015862) |
| 0.1 |
0.3 |
GO:1901385 |
regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.1 |
0.6 |
GO:0031290 |
retinal ganglion cell axon guidance(GO:0031290) |
| 0.1 |
0.2 |
GO:0045943 |
positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.1 |
1.7 |
GO:0045838 |
positive regulation of membrane potential(GO:0045838) |
| 0.1 |
0.6 |
GO:0031507 |
heterochromatin assembly(GO:0031507) |
| 0.1 |
0.7 |
GO:0007093 |
mitotic cell cycle checkpoint(GO:0007093) |
| 0.1 |
0.4 |
GO:0019370 |
leukotriene biosynthetic process(GO:0019370) |
| 0.1 |
0.3 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.1 |
0.4 |
GO:0043552 |
positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.1 |
0.5 |
GO:0016198 |
axon choice point recognition(GO:0016198) |
| 0.1 |
0.6 |
GO:0043550 |
regulation of lipid kinase activity(GO:0043550) |
| 0.1 |
0.2 |
GO:0023019 |
signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.1 |
0.2 |
GO:2000273 |
positive regulation of receptor activity(GO:2000273) |
| 0.1 |
1.1 |
GO:0090022 |
regulation of neutrophil chemotaxis(GO:0090022) |
| 0.1 |
0.9 |
GO:0018230 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 |
0.1 |
GO:0060480 |
lung goblet cell differentiation(GO:0060480) |
| 0.1 |
0.3 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 |
0.2 |
GO:0048742 |
regulation of skeletal muscle fiber development(GO:0048742) |
| 0.1 |
0.5 |
GO:0035635 |
entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.1 |
4.4 |
GO:0006888 |
ER to Golgi vesicle-mediated transport(GO:0006888) |
| 0.1 |
0.2 |
GO:0060385 |
axonogenesis involved in innervation(GO:0060385) |
| 0.1 |
0.4 |
GO:0050892 |
intestinal absorption(GO:0050892) |
| 0.1 |
0.8 |
GO:0010762 |
regulation of fibroblast migration(GO:0010762) |
| 0.1 |
0.3 |
GO:0032366 |
intracellular sterol transport(GO:0032366) |
| 0.1 |
0.4 |
GO:0044861 |
protein transport into plasma membrane raft(GO:0044861) |
| 0.1 |
0.6 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 |
0.5 |
GO:0048147 |
negative regulation of fibroblast proliferation(GO:0048147) |
| 0.1 |
0.3 |
GO:0006144 |
purine nucleobase metabolic process(GO:0006144) |
| 0.1 |
1.8 |
GO:0030317 |
sperm motility(GO:0030317) |
| 0.1 |
2.3 |
GO:1902017 |
regulation of cilium assembly(GO:1902017) |
| 0.1 |
0.2 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.1 |
0.2 |
GO:1902224 |
cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.1 |
0.1 |
GO:0035357 |
peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
| 0.1 |
2.0 |
GO:0015985 |
energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 |
0.3 |
GO:0072318 |
clathrin coat disassembly(GO:0072318) |
| 0.1 |
0.6 |
GO:1900363 |
regulation of mRNA polyadenylation(GO:1900363) |
| 0.1 |
0.3 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.1 |
0.3 |
GO:1902902 |
negative regulation of autophagosome assembly(GO:1902902) |
| 0.1 |
2.0 |
GO:0050830 |
defense response to Gram-positive bacterium(GO:0050830) |
| 0.1 |
0.1 |
GO:0015959 |
diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.1 |
0.3 |
GO:0034390 |
smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
| 0.1 |
0.6 |
GO:0010718 |
positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.1 |
0.1 |
GO:0003174 |
mitral valve development(GO:0003174) mitral valve morphogenesis(GO:0003183) notochord morphogenesis(GO:0048570) |
| 0.1 |
0.1 |
GO:0021800 |
cerebral cortex tangential migration(GO:0021800) |
| 0.1 |
0.1 |
GO:0001990 |
regulation of systemic arterial blood pressure by hormone(GO:0001990) |
| 0.1 |
0.4 |
GO:0006995 |
cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 |
0.1 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.1 |
0.3 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.1 |
0.5 |
GO:0021683 |
cerebellar granular layer morphogenesis(GO:0021683) |
| 0.1 |
0.1 |
GO:0090286 |
cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 |
0.3 |
GO:0001867 |
complement activation, lectin pathway(GO:0001867) |
| 0.1 |
0.7 |
GO:0016082 |
synaptic vesicle priming(GO:0016082) |
| 0.1 |
0.1 |
GO:0061036 |
positive regulation of cartilage development(GO:0061036) |
| 0.1 |
0.1 |
GO:0018023 |
peptidyl-lysine trimethylation(GO:0018023) |
| 0.1 |
1.2 |
GO:0070098 |
chemokine-mediated signaling pathway(GO:0070098) |
| 0.1 |
0.1 |
GO:0060352 |
cell adhesion molecule production(GO:0060352) |
| 0.1 |
0.1 |
GO:1901069 |
guanosine-containing compound catabolic process(GO:1901069) |
| 0.1 |
0.8 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 |
0.3 |
GO:0071425 |
hematopoietic stem cell proliferation(GO:0071425) |
| 0.1 |
0.3 |
GO:0007595 |
lactation(GO:0007595) |
| 0.1 |
0.9 |
GO:0007052 |
mitotic spindle organization(GO:0007052) |
| 0.1 |
0.1 |
GO:0014062 |
serotonin secretion(GO:0001820) regulation of serotonin secretion(GO:0014062) |
| 0.1 |
0.3 |
GO:0043011 |
myeloid dendritic cell differentiation(GO:0043011) |
| 0.1 |
0.1 |
GO:0007184 |
SMAD protein import into nucleus(GO:0007184) |
| 0.1 |
0.1 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.1 |
3.3 |
GO:1903955 |
positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.1 |
0.3 |
GO:0032516 |
positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.1 |
0.6 |
GO:0060271 |
cilium morphogenesis(GO:0060271) |
| 0.1 |
0.7 |
GO:0043407 |
negative regulation of MAP kinase activity(GO:0043407) |
| 0.1 |
0.1 |
GO:0042769 |
DNA damage response, detection of DNA damage(GO:0042769) |
| 0.1 |
0.1 |
GO:0022417 |
protein maturation by protein folding(GO:0022417) regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.1 |
0.8 |
GO:0008156 |
negative regulation of DNA replication(GO:0008156) |
| 0.1 |
0.2 |
GO:0071897 |
DNA biosynthetic process(GO:0071897) |
| 0.1 |
2.5 |
GO:0031338 |
regulation of vesicle fusion(GO:0031338) |
| 0.1 |
0.2 |
GO:1990182 |
exosomal secretion(GO:1990182) |
| 0.1 |
0.2 |
GO:0015936 |
coenzyme A metabolic process(GO:0015936) |
| 0.1 |
0.7 |
GO:0071514 |
genetic imprinting(GO:0071514) |
| 0.1 |
0.2 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.0 |
0.4 |
GO:0008053 |
mitochondrial fusion(GO:0008053) |
| 0.0 |
1.1 |
GO:0033692 |
cellular polysaccharide biosynthetic process(GO:0033692) |
| 0.0 |
0.0 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.0 |
0.1 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.0 |
0.2 |
GO:0006283 |
transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 |
0.1 |
GO:0009438 |
methylglyoxal metabolic process(GO:0009438) |
| 0.0 |
0.0 |
GO:2000036 |
regulation of stem cell population maintenance(GO:2000036) |
| 0.0 |
0.1 |
GO:2000780 |
negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
| 0.0 |
0.1 |
GO:0033136 |
serine phosphorylation of STAT3 protein(GO:0033136) serine phosphorylation of STAT protein(GO:0042501) |
| 0.0 |
0.4 |
GO:0043252 |
sodium-independent organic anion transport(GO:0043252) |
| 0.0 |
0.2 |
GO:0006817 |
phosphate ion transport(GO:0006817) |
| 0.0 |
0.6 |
GO:0000725 |
double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.0 |
0.8 |
GO:0072661 |
protein targeting to plasma membrane(GO:0072661) |
| 0.0 |
0.1 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 |
0.1 |
GO:2000325 |
regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.0 |
0.1 |
GO:0045663 |
positive regulation of myoblast differentiation(GO:0045663) |
| 0.0 |
0.1 |
GO:1901203 |
positive regulation of extracellular matrix assembly(GO:1901203) |
| 0.0 |
0.0 |
GO:0002534 |
cytokine production involved in inflammatory response(GO:0002534) |
| 0.0 |
0.2 |
GO:0097194 |
execution phase of apoptosis(GO:0097194) |
| 0.0 |
0.1 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 |
0.1 |
GO:1902430 |
negative regulation of beta-amyloid formation(GO:1902430) |
| 0.0 |
0.1 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.0 |
0.0 |
GO:0071816 |
protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 |
0.9 |
GO:0042147 |
retrograde transport, endosome to Golgi(GO:0042147) |
| 0.0 |
0.1 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.0 |
0.2 |
GO:0006368 |
transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.0 |
0.0 |
GO:0018199 |
peptidyl-glutamine modification(GO:0018199) |
| 0.0 |
0.2 |
GO:0043536 |
positive regulation of blood vessel endothelial cell migration(GO:0043536) |
| 0.0 |
0.1 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 |
0.1 |
GO:0043649 |
dicarboxylic acid catabolic process(GO:0043649) |
| 0.0 |
0.2 |
GO:0007566 |
embryo implantation(GO:0007566) |
| 0.0 |
0.1 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.0 |
0.0 |
GO:0042168 |
heme metabolic process(GO:0042168) |
| 0.0 |
0.1 |
GO:1901162 |
serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.0 |
0.1 |
GO:0050910 |
detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.0 |
0.1 |
GO:0001895 |
retina homeostasis(GO:0001895) |
| 0.0 |
0.0 |
GO:0008300 |
isoprenoid catabolic process(GO:0008300) |
| 0.0 |
0.1 |
GO:0036233 |
glycine import(GO:0036233) |
| 0.0 |
0.1 |
GO:0006958 |
complement activation, classical pathway(GO:0006958) |
| 0.0 |
0.1 |
GO:0046827 |
positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 |
0.3 |
GO:0070936 |
protein K48-linked ubiquitination(GO:0070936) |
| 0.0 |
0.0 |
GO:0072017 |
distal tubule development(GO:0072017) distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) loop of Henle development(GO:0072070) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric loop of Henle development(GO:0072236) metanephric DCT cell differentiation(GO:0072240) |
| 0.0 |
0.0 |
GO:0044728 |
DNA methylation or demethylation(GO:0044728) |
