| 6.0 |
6.0 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 5.4 |
16.2 |
GO:0097402 |
neuroblast migration(GO:0097402) |
| 3.9 |
11.7 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 3.5 |
10.6 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 3.5 |
10.5 |
GO:0071898 |
regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 3.4 |
17.2 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 3.4 |
10.3 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 3.4 |
10.1 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 3.3 |
9.9 |
GO:0048352 |
neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) |
| 3.3 |
6.5 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 3.2 |
9.5 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 3.1 |
3.1 |
GO:0090194 |
negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
| 3.1 |
3.1 |
GO:0048382 |
mesendoderm development(GO:0048382) |
| 3.0 |
9.1 |
GO:0030421 |
defecation(GO:0030421) |
| 3.0 |
11.9 |
GO:0060032 |
notochord regression(GO:0060032) |
| 2.7 |
13.6 |
GO:0015705 |
iodide transport(GO:0015705) |
| 2.6 |
2.6 |
GO:1900025 |
negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 2.6 |
2.6 |
GO:1902913 |
positive regulation of melanocyte differentiation(GO:0045636) positive regulation of developmental pigmentation(GO:0048087) positive regulation of pigment cell differentiation(GO:0050942) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 2.5 |
12.5 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 2.5 |
5.0 |
GO:0021938 |
smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 2.4 |
7.2 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 2.4 |
7.2 |
GO:0010248 |
B cell negative selection(GO:0002352) establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 2.1 |
4.3 |
GO:0014028 |
notochord formation(GO:0014028) |
| 2.1 |
2.1 |
GO:0045404 |
positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 2.1 |
6.2 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 2.0 |
18.0 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 2.0 |
9.8 |
GO:0003199 |
endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 2.0 |
17.6 |
GO:0046499 |
S-adenosylmethioninamine metabolic process(GO:0046499) |
| 1.9 |
7.7 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 1.9 |
9.5 |
GO:2000981 |
negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
| 1.9 |
11.4 |
GO:0021798 |
forebrain dorsal/ventral pattern formation(GO:0021798) |
| 1.8 |
7.4 |
GO:2000525 |
regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 1.8 |
11.1 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 1.8 |
5.5 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 1.8 |
16.2 |
GO:0032825 |
positive regulation of natural killer cell differentiation(GO:0032825) |
| 1.8 |
1.8 |
GO:0045590 |
negative regulation of regulatory T cell differentiation(GO:0045590) |
| 1.8 |
17.6 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 1.8 |
5.3 |
GO:0003360 |
brainstem development(GO:0003360) |
| 1.7 |
3.5 |
GO:0072197 |
ureter morphogenesis(GO:0072197) |
| 1.7 |
3.4 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 1.7 |
1.7 |
GO:0048739 |
cardiac muscle fiber development(GO:0048739) |
| 1.7 |
1.7 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 1.7 |
3.4 |
GO:0072095 |
regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 1.7 |
15.0 |
GO:0097421 |
liver regeneration(GO:0097421) |
| 1.7 |
6.6 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 1.7 |
5.0 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 1.7 |
14.9 |
GO:0060613 |
fat pad development(GO:0060613) |
| 1.6 |
4.9 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 1.6 |
1.6 |
GO:0032817 |
regulation of natural killer cell proliferation(GO:0032817) positive regulation of natural killer cell proliferation(GO:0032819) |
| 1.6 |
6.5 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 1.6 |
4.9 |
GO:0009177 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 1.6 |
4.9 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 1.6 |
4.8 |
GO:0086017 |
Purkinje myocyte action potential(GO:0086017) |
| 1.6 |
6.4 |
GO:1900145 |
regulation of nodal signaling pathway involved in determination of left/right asymmetry(GO:1900145) regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900175) positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 1.6 |
4.8 |
GO:1902528 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 1.6 |
7.9 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 1.6 |
3.1 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 1.5 |
4.6 |
GO:0009812 |
flavonoid metabolic process(GO:0009812) flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 1.5 |
3.0 |
GO:0072103 |
glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 1.5 |
1.5 |
GO:0030916 |
otic vesicle formation(GO:0030916) |
| 1.5 |
7.5 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 1.5 |
5.9 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 1.5 |
11.7 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 1.5 |
7.3 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 1.4 |
5.8 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 1.4 |
10.0 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 1.4 |
7.1 |
GO:1900170 |
negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 1.4 |
1.4 |
GO:0008582 |
regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 1.4 |
4.2 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 1.4 |
4.2 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 1.4 |
5.5 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 1.4 |
4.1 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 1.4 |
1.4 |
GO:0090500 |
endocardial cushion to mesenchymal transition(GO:0090500) |
| 1.4 |
8.2 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 1.4 |
8.1 |
GO:0072539 |
T-helper 17 cell differentiation(GO:0072539) |
| 1.3 |
2.7 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 1.3 |
5.3 |
GO:0035989 |
tendon development(GO:0035989) |
| 1.3 |
21.3 |
GO:0048385 |
regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 1.3 |
2.7 |
GO:0090594 |
wound healing involved in inflammatory response(GO:0002246) connective tissue replacement involved in inflammatory response wound healing(GO:0002248) inflammatory response to wounding(GO:0090594) connective tissue replacement(GO:0097709) |
| 1.3 |
4.0 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 1.3 |
1.3 |
GO:0043267 |
negative regulation of potassium ion transport(GO:0043267) |
| 1.3 |
1.3 |
GO:0042660 |
positive regulation of cell fate specification(GO:0042660) |
| 1.3 |
3.9 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 1.3 |
2.6 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 1.3 |
1.3 |
GO:0032438 |
melanosome organization(GO:0032438) positive regulation of melanin biosynthetic process(GO:0048023) pigment granule organization(GO:0048753) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
| 1.3 |
3.8 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 1.3 |
2.5 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) |
| 1.3 |
2.5 |
GO:0010873 |
positive regulation of cholesterol esterification(GO:0010873) |
| 1.3 |
8.9 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 1.3 |
3.8 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 1.3 |
1.3 |
GO:1904030 |
negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 1.3 |
5.0 |
GO:0035878 |
nail development(GO:0035878) |
| 1.2 |
8.7 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 1.2 |
6.2 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 1.2 |
6.2 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 1.2 |
1.2 |
GO:0048611 |
ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
| 1.2 |
6.2 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 1.2 |
1.2 |
GO:0072076 |
nephrogenic mesenchyme development(GO:0072076) |
| 1.2 |
1.2 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 1.2 |
2.4 |
GO:0003404 |
optic vesicle morphogenesis(GO:0003404) |
| 1.2 |
1.2 |
GO:0070172 |
positive regulation of tooth mineralization(GO:0070172) |
| 1.2 |
3.6 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 1.2 |
1.2 |
GO:0070633 |
transepithelial transport(GO:0070633) |
| 1.2 |
4.7 |
GO:0071699 |
olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 1.2 |
1.2 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 1.2 |
3.5 |
GO:0034241 |
positive regulation of macrophage fusion(GO:0034241) |
| 1.2 |
1.2 |
GO:0072038 |
mesenchymal stem cell maintenance involved in nephron morphogenesis(GO:0072038) |
| 1.2 |
4.7 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 1.2 |
3.5 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 1.2 |
5.8 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 1.2 |
4.6 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 1.2 |
4.6 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 1.2 |
5.8 |
GO:2000065 |
negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 1.2 |
5.8 |
GO:0015867 |
ATP transport(GO:0015867) |
| 1.1 |
3.4 |
GO:0014891 |
striated muscle atrophy(GO:0014891) |
| 1.1 |
3.4 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 1.1 |
3.4 |
GO:0003273 |
cell migration involved in endocardial cushion formation(GO:0003273) |
| 1.1 |
5.7 |
GO:0072224 |
metanephric glomerulus development(GO:0072224) |
| 1.1 |
1.1 |
GO:2000054 |
negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 1.1 |
3.4 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 1.1 |
5.7 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 1.1 |
10.2 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 1.1 |
28.3 |
GO:0006978 |
DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
| 1.1 |
3.4 |
GO:0072234 |
metanephric nephron tubule development(GO:0072234) |
| 1.1 |
3.4 |
GO:0019659 |
glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 1.1 |
3.3 |
GO:1901420 |
negative regulation of response to alcohol(GO:1901420) |
| 1.1 |
2.2 |
GO:2000191 |
regulation of fatty acid transport(GO:2000191) |
| 1.1 |
4.4 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 1.1 |
3.3 |
GO:0030222 |
eosinophil differentiation(GO:0030222) |
| 1.1 |
3.3 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 1.1 |
3.3 |
GO:2000977 |
regulation of forebrain neuron differentiation(GO:2000977) |
| 1.1 |
1.1 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 1.1 |
3.3 |
GO:0072356 |
chromosome passenger complex localization to kinetochore(GO:0072356) |
| 1.1 |
1.1 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 1.1 |
6.5 |
GO:0051660 |
cortical microtubule organization(GO:0043622) establishment of centrosome localization(GO:0051660) |
| 1.1 |
9.7 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 1.1 |
4.3 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 1.1 |
3.2 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 1.1 |
4.3 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 1.1 |
1.1 |
GO:0071166 |
ribonucleoprotein complex localization(GO:0071166) ribonucleoprotein complex export from nucleus(GO:0071426) |
| 1.1 |
2.1 |
GO:0007494 |
midgut development(GO:0007494) |
| 1.0 |
5.2 |
GO:0030091 |
protein repair(GO:0030091) |
| 1.0 |
7.3 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 1.0 |
1.0 |
GO:0098908 |
regulation of neuronal action potential(GO:0098908) |
| 1.0 |
3.1 |
GO:1902915 |
negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 1.0 |
6.2 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 1.0 |
1.0 |
GO:0010899 |
regulation of phosphatidylcholine catabolic process(GO:0010899) |
| 1.0 |
10.3 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 1.0 |
3.1 |
GO:0048661 |
positive regulation of smooth muscle cell proliferation(GO:0048661) |
| 1.0 |
3.1 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 1.0 |
1.0 |
GO:0002339 |
B cell selection(GO:0002339) |
| 1.0 |
4.1 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 1.0 |
3.0 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 1.0 |
3.0 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 1.0 |
5.1 |
GO:0010668 |
ectodermal cell differentiation(GO:0010668) |
| 1.0 |
3.0 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 1.0 |
2.0 |
GO:0032332 |
positive regulation of chondrocyte differentiation(GO:0032332) |
| 1.0 |
5.0 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 1.0 |
1.0 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 1.0 |
10.9 |
GO:0014841 |
skeletal muscle satellite cell proliferation(GO:0014841) |
| 1.0 |
1.0 |
GO:0072070 |
loop of Henle development(GO:0072070) metanephric loop of Henle development(GO:0072236) |
| 1.0 |
7.9 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 1.0 |
3.0 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 1.0 |
5.9 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 1.0 |
2.9 |
GO:0032488 |
Cdc42 protein signal transduction(GO:0032488) |
| 1.0 |
2.0 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 1.0 |
2.9 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 1.0 |
10.8 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 1.0 |
2.9 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 1.0 |
12.7 |
GO:0001779 |
natural killer cell differentiation(GO:0001779) |
| 1.0 |
2.9 |
GO:0097461 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 1.0 |
2.9 |
GO:0051971 |
positive regulation of transmission of nerve impulse(GO:0051971) |
| 1.0 |
2.9 |
GO:0048208 |
vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 1.0 |
5.7 |
GO:1900246 |
positive regulation of RIG-I signaling pathway(GO:1900246) |
| 1.0 |
4.8 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.9 |
2.8 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) |
| 0.9 |
7.6 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.9 |
8.5 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 0.9 |
1.9 |
GO:0010757 |
negative regulation of plasminogen activation(GO:0010757) |
| 0.9 |
3.7 |
GO:0010633 |
negative regulation of epithelial cell migration(GO:0010633) |
| 0.9 |
0.9 |
GO:2000053 |
regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.9 |
3.7 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.9 |
4.6 |
GO:0090132 |
epithelial cell migration(GO:0010631) tissue migration(GO:0090130) epithelium migration(GO:0090132) |
| 0.9 |
2.7 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.9 |
2.7 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.9 |
6.3 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 0.9 |
5.3 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.9 |
0.9 |
GO:0031944 |
negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
| 0.9 |
6.2 |
GO:0000022 |
mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.9 |
5.3 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.9 |
15.0 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.9 |
3.5 |
GO:0006344 |
maintenance of chromatin silencing(GO:0006344) |
| 0.9 |
3.4 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.9 |
2.6 |
GO:2000224 |
testosterone biosynthetic process(GO:0061370) regulation of testosterone biosynthetic process(GO:2000224) |
| 0.9 |
2.6 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.9 |
2.6 |
GO:0002636 |
positive regulation of germinal center formation(GO:0002636) |
| 0.8 |
3.4 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 0.8 |
1.7 |
GO:0032353 |
negative regulation of hormone metabolic process(GO:0032351) negative regulation of hormone biosynthetic process(GO:0032353) |
| 0.8 |
4.2 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.8 |
3.4 |
GO:0060272 |
embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.8 |
0.8 |
GO:0061054 |
dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
| 0.8 |
5.0 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.8 |
3.3 |
GO:0070425 |
negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 0.8 |
3.3 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 0.8 |
6.6 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.8 |
5.0 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.8 |
4.9 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.8 |
2.5 |
GO:0060217 |
hemangioblast cell differentiation(GO:0060217) |
| 0.8 |
0.8 |
GO:0036118 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.8 |
0.8 |
GO:1902947 |
regulation of tau-protein kinase activity(GO:1902947) |
| 0.8 |
6.5 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.8 |
3.2 |
GO:2000483 |
negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.8 |
4.0 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.8 |
4.0 |
GO:0034372 |
very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.8 |
3.2 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.8 |
3.2 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.8 |
2.4 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.8 |
3.1 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.8 |
2.3 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.8 |
1.6 |
GO:0071673 |
positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.8 |
3.9 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.8 |
2.3 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.8 |
3.1 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.8 |
3.1 |
GO:1904667 |
negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.8 |
4.6 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.8 |
3.1 |
GO:2001137 |
positive regulation of endocytic recycling(GO:2001137) |
| 0.8 |
3.1 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.8 |
0.8 |
GO:0021957 |
corticospinal tract morphogenesis(GO:0021957) |
| 0.8 |
5.3 |
GO:1903689 |
regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.8 |
2.3 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 0.7 |
3.0 |
GO:2001185 |
regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.7 |
4.4 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.7 |
0.7 |
GO:0014719 |
skeletal muscle satellite cell activation(GO:0014719) |
| 0.7 |
2.9 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 0.7 |
6.6 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) |
| 0.7 |
2.2 |
GO:0021893 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) |
| 0.7 |
4.4 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.7 |
6.6 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.7 |
2.2 |
GO:0070837 |
dehydroascorbic acid transport(GO:0070837) |
| 0.7 |
2.9 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.7 |
0.7 |
GO:0033091 |
positive regulation of immature T cell proliferation(GO:0033091) |
| 0.7 |
2.2 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.7 |
2.1 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 0.7 |
5.7 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.7 |
0.7 |
GO:1905050 |
positive regulation of metallopeptidase activity(GO:1905050) |
| 0.7 |
4.3 |
GO:0045583 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.7 |
5.0 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.7 |
0.7 |
GO:0046476 |
glycosylceramide biosynthetic process(GO:0046476) |
| 0.7 |
4.2 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 0.7 |
7.0 |
GO:0060252 |
positive regulation of glial cell proliferation(GO:0060252) |
| 0.7 |
8.4 |
GO:0021542 |
dentate gyrus development(GO:0021542) |
| 0.7 |
1.4 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.7 |
6.2 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.7 |
0.7 |
GO:0030538 |
embryonic genitalia morphogenesis(GO:0030538) |
| 0.7 |
3.4 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.7 |
1.4 |
GO:0051124 |
synaptic growth at neuromuscular junction(GO:0051124) |
| 0.7 |
5.4 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.7 |
4.8 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.7 |
15.6 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.7 |
0.7 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.7 |
1.3 |
GO:0007290 |
spermatid nucleus elongation(GO:0007290) |
| 0.7 |
0.7 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.7 |
0.7 |
GO:0090274 |
positive regulation of somatostatin secretion(GO:0090274) |
| 0.7 |
1.3 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.7 |
2.0 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.7 |
2.6 |
GO:0003376 |
sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.7 |
2.6 |
GO:0071139 |
resolution of recombination intermediates(GO:0071139) |
| 0.7 |
0.7 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 0.7 |
4.6 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.7 |
1.3 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.7 |
13.1 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.7 |
3.3 |
GO:0071305 |
cellular response to vitamin D(GO:0071305) |
| 0.7 |
2.0 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.6 |
3.9 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.6 |
0.6 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.6 |
3.2 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.6 |
2.6 |
GO:0021914 |
smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021910) negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.6 |
2.6 |
GO:0030539 |
male genitalia development(GO:0030539) |
| 0.6 |
5.1 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.6 |
1.3 |
GO:0046641 |
positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.6 |
1.9 |
GO:2001206 |
positive regulation of osteoclast development(GO:2001206) |
| 0.6 |
0.6 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.6 |
0.6 |
GO:0090080 |
positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.6 |
1.9 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.6 |
2.5 |
GO:0072675 |
multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.6 |
1.3 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.6 |
6.3 |
GO:0097067 |
cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.6 |
3.1 |
GO:0034374 |
low-density lipoprotein particle remodeling(GO:0034374) |
| 0.6 |
5.6 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.6 |
3.7 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.6 |
1.9 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 0.6 |
8.1 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.6 |
0.6 |
GO:0036228 |
protein targeting to nuclear inner membrane(GO:0036228) |
| 0.6 |
1.9 |
GO:0032066 |
nucleolus to nucleoplasm transport(GO:0032066) |
| 0.6 |
2.5 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.6 |
6.8 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.6 |
1.8 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.6 |
3.1 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.6 |
3.1 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.6 |
1.2 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.6 |
2.4 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 0.6 |
1.2 |
GO:0033484 |
nitric oxide homeostasis(GO:0033484) |
| 0.6 |
0.6 |
GO:0035630 |
bone mineralization involved in bone maturation(GO:0035630) |
| 0.6 |
1.2 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.6 |
2.4 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 0.6 |
1.8 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.6 |
1.2 |
GO:2000637 |
positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.6 |
1.2 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.6 |
2.4 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.6 |
3.0 |
GO:0060836 |
lymphatic endothelial cell differentiation(GO:0060836) |
| 0.6 |
2.4 |
GO:0051305 |
chromosome movement towards spindle pole(GO:0051305) |
| 0.6 |
7.9 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 0.6 |
5.4 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.6 |
1.8 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.6 |
1.2 |
GO:0060399 |
positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.6 |
6.0 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.6 |
1.8 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.6 |
4.2 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.6 |
2.4 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.6 |
3.5 |
GO:0006570 |
tyrosine metabolic process(GO:0006570) |
| 0.6 |
1.2 |
GO:0060732 |
positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.6 |
1.2 |
GO:0007056 |
spindle assembly involved in female meiosis(GO:0007056) |
| 0.6 |
1.8 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.6 |
0.6 |
GO:0060536 |
cartilage morphogenesis(GO:0060536) |
| 0.6 |
2.4 |
GO:1902990 |
telomere maintenance via semi-conservative replication(GO:0032201) mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.6 |
4.1 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.6 |
1.2 |
GO:2001204 |
regulation of osteoclast development(GO:2001204) |
| 0.6 |
2.3 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 0.6 |
2.3 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.6 |
11.6 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.6 |
1.7 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 0.6 |
3.5 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.6 |
1.7 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.6 |
2.3 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.6 |
1.1 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.6 |
2.3 |
GO:0060903 |
positive regulation of meiosis I(GO:0060903) |
| 0.6 |
0.6 |
GO:0000963 |
mitochondrial RNA processing(GO:0000963) |
| 0.6 |
2.2 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.6 |
0.6 |
GO:0060693 |
regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.6 |
1.7 |
GO:0061743 |
motor learning(GO:0061743) |
| 0.6 |
0.6 |
GO:0009880 |
embryonic pattern specification(GO:0009880) |
| 0.6 |
2.2 |
GO:0051216 |
cartilage development(GO:0051216) |
| 0.6 |
10.6 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.6 |
10.6 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.6 |
1.1 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.6 |
0.6 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.6 |
1.7 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.6 |
1.1 |
GO:0046084 |
adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.6 |
3.3 |
GO:0010747 |
positive regulation of plasma membrane long-chain fatty acid transport(GO:0010747) |
| 0.6 |
1.7 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.5 |
3.8 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.5 |
1.6 |
GO:1903279 |
regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.5 |
3.8 |
GO:0010766 |
negative regulation of sodium ion transport(GO:0010766) |
| 0.5 |
2.7 |
GO:0006971 |
hypotonic response(GO:0006971) |
| 0.5 |
0.5 |
GO:0032000 |
positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.5 |
2.7 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.5 |
5.4 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.5 |
1.6 |
GO:0046878 |
regulation of saliva secretion(GO:0046877) positive regulation of saliva secretion(GO:0046878) |
| 0.5 |
2.7 |
GO:0046666 |
retinal cell programmed cell death(GO:0046666) |
| 0.5 |
1.1 |
GO:0002741 |
positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.5 |
0.5 |
GO:0002331 |
pre-B cell allelic exclusion(GO:0002331) |
| 0.5 |
1.6 |
GO:0003177 |
pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
| 0.5 |
2.7 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
| 0.5 |
1.6 |
GO:2001240 |
negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
| 0.5 |
1.6 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 0.5 |
7.4 |
GO:0031987 |
locomotion involved in locomotory behavior(GO:0031987) |
| 0.5 |
1.1 |
GO:2000323 |
negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.5 |
1.0 |
GO:0046874 |
quinolinate metabolic process(GO:0046874) |
| 0.5 |
2.1 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.5 |
2.6 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.5 |
3.7 |
GO:0035358 |
regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035358) |
| 0.5 |
1.5 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.5 |
2.6 |
GO:0044314 |
protein K27-linked ubiquitination(GO:0044314) |
| 0.5 |
2.1 |
GO:0003365 |
establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.5 |
0.5 |
GO:0015677 |
copper ion import(GO:0015677) |
| 0.5 |
3.6 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.5 |
1.5 |
GO:0030202 |
heparin metabolic process(GO:0030202) |
| 0.5 |
3.6 |
GO:0001890 |
placenta development(GO:0001890) |
| 0.5 |
1.5 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.5 |
4.0 |
GO:0060746 |
parental behavior(GO:0060746) |
| 0.5 |
1.5 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.5 |
2.5 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.5 |
2.0 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.5 |
2.5 |
GO:0090312 |
positive regulation of histone deacetylation(GO:0031065) positive regulation of protein deacetylation(GO:0090312) |
| 0.5 |
1.0 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.5 |
4.0 |
GO:0030206 |
chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.5 |
1.0 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.5 |
1.5 |
GO:0010694 |
positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.5 |
0.5 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.5 |
1.0 |
GO:0042403 |
thyroid hormone metabolic process(GO:0042403) |
| 0.5 |
0.5 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.5 |
2.9 |
GO:0031100 |
organ regeneration(GO:0031100) |
| 0.5 |
4.4 |
GO:0046548 |
retinal rod cell development(GO:0046548) |
| 0.5 |
2.9 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) |
| 0.5 |
1.5 |
GO:1903519 |
apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.5 |
1.5 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 0.5 |
1.9 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) collagen-activated signaling pathway(GO:0038065) |
| 0.5 |
1.9 |
GO:0015819 |
lysine transport(GO:0015819) |
| 0.5 |
2.9 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.5 |
1.9 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.5 |
1.4 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.5 |
3.8 |
GO:0036289 |
peptidyl-serine autophosphorylation(GO:0036289) |
| 0.5 |
3.3 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.5 |
1.9 |
GO:0035562 |
negative regulation of chromatin binding(GO:0035562) |
| 0.5 |
1.0 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.5 |
2.4 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.5 |
2.3 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.5 |
0.9 |
GO:2000467 |
positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.5 |
5.1 |
GO:0035115 |
embryonic forelimb morphogenesis(GO:0035115) |
| 0.5 |
2.3 |
GO:0051315 |
attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.5 |
0.9 |
GO:1905065 |
regulation of vascular smooth muscle cell differentiation(GO:1905063) positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.5 |
1.4 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.5 |
0.5 |
GO:0072498 |
embryonic skeletal joint development(GO:0072498) |
| 0.5 |
0.5 |
GO:0014826 |
vein smooth muscle contraction(GO:0014826) |
| 0.5 |
1.8 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.5 |
0.5 |
GO:0043173 |
nucleotide salvage(GO:0043173) |
| 0.5 |
1.4 |
GO:0032808 |
lacrimal gland development(GO:0032808) |
| 0.5 |
0.9 |
GO:0006103 |
2-oxoglutarate metabolic process(GO:0006103) |
| 0.5 |
2.3 |
GO:0046598 |
positive regulation of viral entry into host cell(GO:0046598) |
| 0.5 |
2.3 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.5 |
14.9 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.4 |
3.1 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.4 |
0.4 |
GO:1903026 |
negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.4 |
0.4 |
GO:0045617 |
negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.4 |
1.3 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) aromatic amino acid family catabolic process(GO:0009074) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.4 |
12.4 |
GO:0046039 |
GTP metabolic process(GO:0046039) |
| 0.4 |
0.4 |
GO:0048296 |
isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.4 |
2.7 |
GO:0015670 |
carbon dioxide transport(GO:0015670) |
| 0.4 |
4.0 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.4 |
1.3 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 0.4 |
1.3 |
GO:0010944 |
negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.4 |
1.8 |
GO:0034638 |
phosphatidylcholine catabolic process(GO:0034638) |
| 0.4 |
2.2 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.4 |
2.6 |
GO:0043501 |
regulation of skeletal muscle adaptation(GO:0014733) skeletal muscle adaptation(GO:0043501) |
| 0.4 |
4.3 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.4 |
3.8 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.4 |
1.3 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.4 |
3.8 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) |
| 0.4 |
1.3 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.4 |
0.8 |
GO:2000416 |
regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
| 0.4 |
2.5 |
GO:2000258 |
negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
| 0.4 |
0.4 |
GO:0048853 |
forebrain morphogenesis(GO:0048853) |
| 0.4 |
0.4 |
GO:0006693 |
prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.4 |
1.2 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.4 |
2.1 |
GO:0043101 |
purine-containing compound salvage(GO:0043101) |
| 0.4 |
0.8 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.4 |
0.8 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.4 |
1.2 |
GO:0046655 |
folic acid metabolic process(GO:0046655) |
| 0.4 |
3.3 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.4 |
1.2 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.4 |
1.2 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.4 |
1.2 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.4 |
1.6 |
GO:0048706 |
embryonic skeletal system development(GO:0048706) |
| 0.4 |
2.4 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.4 |
0.4 |
GO:0048711 |
positive regulation of astrocyte differentiation(GO:0048711) |
| 0.4 |
0.4 |
GO:0010764 |
negative regulation of fibroblast migration(GO:0010764) |
| 0.4 |
3.2 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.4 |
1.2 |
GO:0033689 |
negative regulation of osteoblast proliferation(GO:0033689) |
| 0.4 |
1.2 |
GO:1902415 |
regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
| 0.4 |
1.6 |
GO:0003203 |
endocardial cushion morphogenesis(GO:0003203) |
| 0.4 |
1.2 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.4 |
4.7 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.4 |
1.6 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.4 |
7.9 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.4 |
5.8 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.4 |
0.8 |
GO:0006507 |
GPI anchor release(GO:0006507) |
| 0.4 |
0.8 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 0.4 |
0.8 |
GO:0021937 |
cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.4 |
2.3 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.4 |
3.1 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.4 |
1.1 |
GO:1990046 |
positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) positive regulation of mitochondrial DNA metabolic process(GO:1901860) stress-induced mitochondrial fusion(GO:1990046) |
| 0.4 |
1.1 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 0.4 |
1.5 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.4 |
1.9 |
GO:0061687 |
detoxification of inorganic compound(GO:0061687) |
| 0.4 |
4.2 |
GO:0090103 |
cochlea morphogenesis(GO:0090103) |
| 0.4 |
1.9 |
GO:0061436 |
establishment of skin barrier(GO:0061436) |
| 0.4 |
1.1 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.4 |
2.6 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.4 |
1.5 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.4 |
5.3 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.4 |
0.8 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.4 |
0.4 |
GO:0033173 |
calcineurin-NFAT signaling cascade(GO:0033173) |
| 0.4 |
0.7 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.4 |
0.4 |
GO:0014744 |
positive regulation of muscle adaptation(GO:0014744) |
| 0.4 |
0.7 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.4 |
1.5 |
GO:0060266 |
negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
| 0.4 |
0.7 |
GO:0043584 |
nose development(GO:0043584) |
| 0.4 |
1.8 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.4 |
5.9 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.4 |
0.7 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.4 |
1.8 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 0.4 |
1.5 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.4 |
2.6 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.4 |
1.1 |
GO:0018199 |
peptidyl-glutamine modification(GO:0018199) |
| 0.4 |
0.4 |
GO:0061458 |
reproductive system development(GO:0061458) |
| 0.4 |
0.7 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 0.4 |
1.1 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.4 |
0.7 |
GO:0000712 |
resolution of meiotic recombination intermediates(GO:0000712) |
| 0.4 |
1.1 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.4 |
1.1 |
GO:0030208 |
dermatan sulfate biosynthetic process(GO:0030208) |
| 0.4 |
0.4 |
GO:0002092 |
positive regulation of receptor internalization(GO:0002092) |
| 0.4 |
1.8 |
GO:0048368 |
lateral mesoderm development(GO:0048368) |
| 0.4 |
2.1 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.4 |
1.1 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.4 |
1.1 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.4 |
1.1 |
GO:0046596 |
regulation of viral entry into host cell(GO:0046596) |
| 0.4 |
1.1 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 0.4 |
0.7 |
GO:0007063 |
regulation of sister chromatid cohesion(GO:0007063) |
| 0.4 |
0.4 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.4 |
2.8 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.4 |
0.7 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.4 |
0.7 |
GO:0060594 |
mammary gland specification(GO:0060594) |
| 0.3 |
13.6 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.3 |
1.7 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.3 |
2.4 |
GO:0071285 |
cellular response to lithium ion(GO:0071285) |
| 0.3 |
2.4 |
GO:0071168 |
protein localization to chromatin(GO:0071168) |
| 0.3 |
4.5 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.3 |
0.7 |
GO:0019731 |
antimicrobial humoral response(GO:0019730) antibacterial humoral response(GO:0019731) |
| 0.3 |
1.7 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.3 |
13.0 |
GO:0043297 |
apical junction assembly(GO:0043297) |
| 0.3 |
1.0 |
GO:0097411 |
hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.3 |
0.7 |
GO:0014009 |
glial cell proliferation(GO:0014009) |
| 0.3 |
1.0 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.3 |
1.7 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.3 |
4.0 |
GO:0003416 |
endochondral bone growth(GO:0003416) |
| 0.3 |
1.3 |
GO:0001831 |
trophectodermal cellular morphogenesis(GO:0001831) |
| 0.3 |
0.3 |
GO:0045915 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.3 |
1.0 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.3 |
1.0 |
GO:0032782 |
bile acid secretion(GO:0032782) |
| 0.3 |
2.3 |
GO:0007498 |
mesoderm development(GO:0007498) |
| 0.3 |
0.7 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.3 |
3.6 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.3 |
1.3 |
GO:0055009 |
atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.3 |
2.6 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.3 |
1.0 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.3 |
1.9 |
GO:2001198 |
regulation of dendritic cell differentiation(GO:2001198) negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.3 |
1.9 |
GO:0034379 |
very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.3 |
2.6 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.3 |
1.0 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.3 |
1.9 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.3 |
1.3 |
GO:0021983 |
pituitary gland development(GO:0021983) |
| 0.3 |
3.2 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.3 |
1.6 |
GO:0090234 |
regulation of kinetochore assembly(GO:0090234) |
| 0.3 |
0.3 |
GO:0002538 |
arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 0.3 |
2.2 |
GO:0006260 |
DNA replication(GO:0006260) |
| 0.3 |
1.0 |
GO:1904154 |
protein localization to endoplasmic reticulum exit site(GO:0070973) positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.3 |
1.6 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.3 |
1.3 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.3 |
7.6 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.3 |
7.6 |
GO:0030514 |
negative regulation of BMP signaling pathway(GO:0030514) |
| 0.3 |
10.4 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.3 |
7.9 |
GO:0009649 |
entrainment of circadian clock(GO:0009649) |
| 0.3 |
2.2 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.3 |
0.6 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.3 |
0.6 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.3 |
4.7 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.3 |
0.3 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.3 |
1.9 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.3 |
0.3 |
GO:0002922 |
positive regulation of humoral immune response(GO:0002922) positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.3 |
1.9 |
GO:0032516 |
positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.3 |
0.6 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.3 |
0.6 |
GO:0002643 |
regulation of tolerance induction(GO:0002643) |
| 0.3 |
5.5 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.3 |
0.6 |
GO:0002182 |
cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.3 |
2.7 |
GO:0034770 |
histone H4-K20 methylation(GO:0034770) |
| 0.3 |
0.9 |
GO:0047484 |
regulation of response to osmotic stress(GO:0047484) |
| 0.3 |
0.9 |
GO:0009071 |
serine family amino acid catabolic process(GO:0009071) |
| 0.3 |
1.5 |
GO:2001214 |
positive regulation of vasculogenesis(GO:2001214) |
| 0.3 |
0.9 |
GO:0048570 |
notochord morphogenesis(GO:0048570) |
| 0.3 |
0.6 |
GO:0002069 |
columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.3 |
1.8 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.3 |
0.9 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.3 |
0.3 |
GO:1901896 |
positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.3 |
0.9 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.3 |
0.3 |
GO:0048631 |
regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.3 |
0.3 |
GO:0002363 |
alpha-beta T cell lineage commitment(GO:0002363) |
| 0.3 |
4.4 |
GO:2000144 |
positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.3 |
0.9 |
GO:0071391 |
cellular response to estrogen stimulus(GO:0071391) |
| 0.3 |
0.9 |
GO:0015793 |
renal water transport(GO:0003097) glycerol transport(GO:0015793) renal water absorption(GO:0070295) |
| 0.3 |
1.4 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.3 |
0.9 |
GO:0032914 |
positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.3 |
0.9 |
GO:1903061 |
regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.3 |
1.4 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.3 |
4.3 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.3 |
2.0 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.3 |
8.5 |
GO:0006493 |
protein O-linked glycosylation(GO:0006493) |
| 0.3 |
0.9 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.3 |
0.3 |
GO:1901534 |
positive regulation of hematopoietic progenitor cell differentiation(GO:1901534) |
| 0.3 |
6.2 |
GO:0048025 |
negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.3 |
0.8 |
GO:0001781 |
neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) |
| 0.3 |
0.3 |
GO:0030050 |
vesicle transport along actin filament(GO:0030050) |
| 0.3 |
1.1 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.3 |
1.1 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.3 |
0.6 |
GO:0050748 |
negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.3 |
3.9 |
GO:0032392 |
DNA geometric change(GO:0032392) DNA duplex unwinding(GO:0032508) |
| 0.3 |
1.4 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.3 |
2.7 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.3 |
2.7 |
GO:0001516 |
prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.3 |
1.1 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.3 |
0.8 |
GO:2000766 |
negative regulation of cytoplasmic translation(GO:2000766) |
| 0.3 |
2.2 |
GO:0032695 |
negative regulation of interleukin-12 production(GO:0032695) |
| 0.3 |
5.2 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 0.3 |
1.4 |
GO:0009169 |
purine nucleoside monophosphate catabolic process(GO:0009128) ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.3 |
1.9 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.3 |
3.8 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.3 |
0.5 |
GO:0070601 |
centromeric sister chromatid cohesion(GO:0070601) |
| 0.3 |
1.6 |
GO:0019985 |
translesion synthesis(GO:0019985) |
| 0.3 |
0.3 |
GO:0045901 |
positive regulation of translational elongation(GO:0045901) |
| 0.3 |
1.6 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.3 |
3.0 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.3 |
1.6 |
GO:0089711 |
L-glutamate transmembrane transport(GO:0089711) |
| 0.3 |
2.7 |
GO:0015884 |
folic acid transport(GO:0015884) |
| 0.3 |
0.5 |
GO:0071865 |
regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.3 |
0.3 |
GO:0060971 |
embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.3 |
1.9 |
GO:1902459 |
positive regulation of stem cell population maintenance(GO:1902459) |
| 0.3 |
1.3 |
GO:1900225 |
NLRP3 inflammasome complex assembly(GO:0044546) regulation of NLRP3 inflammasome complex assembly(GO:1900225) |
| 0.3 |
1.3 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.3 |
0.5 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.3 |
0.8 |
GO:1902414 |
protein localization to cell junction(GO:1902414) |
| 0.3 |
0.5 |
GO:1903961 |
positive regulation of anion transmembrane transport(GO:1903961) |
| 0.3 |
0.3 |
GO:2000275 |
regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.3 |
0.5 |
GO:1903035 |
negative regulation of response to wounding(GO:1903035) |
| 0.3 |
1.8 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.3 |
0.8 |
GO:0051798 |
positive regulation of hair follicle development(GO:0051798) |
| 0.3 |
2.1 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.3 |
3.9 |
GO:0097150 |
neuronal stem cell population maintenance(GO:0097150) |
| 0.3 |
2.1 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.3 |
8.9 |
GO:0070206 |
protein trimerization(GO:0070206) |
| 0.3 |
0.8 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.3 |
1.6 |
GO:0032534 |
regulation of microvillus assembly(GO:0032534) |
| 0.3 |
0.5 |
GO:0001951 |
intestinal D-glucose absorption(GO:0001951) terminal web assembly(GO:1902896) |
| 0.3 |
1.3 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.3 |
3.1 |
GO:0045445 |
myoblast differentiation(GO:0045445) |
| 0.3 |
1.3 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.3 |
1.5 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.3 |
0.5 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.3 |
5.1 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.3 |
0.8 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.3 |
0.3 |
GO:1990379 |
lipid transport across blood brain barrier(GO:1990379) |
| 0.3 |
0.8 |
GO:0045579 |
positive regulation of B cell differentiation(GO:0045579) |
| 0.3 |
0.3 |
GO:1903960 |
negative regulation of anion transmembrane transport(GO:1903960) |
| 0.3 |
0.5 |
GO:0097186 |
amelogenesis(GO:0097186) |
| 0.3 |
1.0 |
GO:0010288 |
response to lead ion(GO:0010288) |
| 0.3 |
2.5 |
GO:0048535 |
lymph node development(GO:0048535) |
| 0.3 |
1.8 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.2 |
0.5 |
GO:0061042 |
vascular wound healing(GO:0061042) |
| 0.2 |
0.2 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.2 |
23.7 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.2 |
0.2 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.2 |
1.5 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.2 |
6.5 |
GO:0034314 |
Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.2 |
1.0 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.2 |
0.7 |
GO:0016102 |
retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
| 0.2 |
2.5 |
GO:0071803 |
positive regulation of podosome assembly(GO:0071803) |
| 0.2 |
0.5 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.2 |
0.2 |
GO:0006273 |
lagging strand elongation(GO:0006273) |
| 0.2 |
0.5 |
GO:0035166 |
nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) post-embryonic hemopoiesis(GO:0035166) |
| 0.2 |
0.2 |
GO:0032687 |
negative regulation of interferon-alpha production(GO:0032687) |
| 0.2 |
1.0 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.2 |
2.2 |
GO:0042219 |
cellular modified amino acid catabolic process(GO:0042219) |
| 0.2 |
1.4 |
GO:0010867 |
positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.2 |
1.0 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.2 |
1.7 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.2 |
0.7 |
GO:2000768 |
glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.2 |
2.9 |
GO:0002063 |
chondrocyte development(GO:0002063) |
| 0.2 |
1.2 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.2 |
4.3 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.2 |
0.7 |
GO:0045723 |
positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.2 |
1.4 |
GO:0032460 |
negative regulation of protein oligomerization(GO:0032460) negative regulation of protein homooligomerization(GO:0032463) |
| 0.2 |
0.9 |
GO:0032486 |
Rap protein signal transduction(GO:0032486) |
| 0.2 |
0.7 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.2 |
1.9 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.2 |
1.6 |
GO:0021846 |
cell proliferation in forebrain(GO:0021846) |
| 0.2 |
0.2 |
GO:0060718 |
chorionic trophoblast cell differentiation(GO:0060718) |
| 0.2 |
1.2 |
GO:0045907 |
positive regulation of vasoconstriction(GO:0045907) |
| 0.2 |
0.7 |
GO:0006338 |
chromatin remodeling(GO:0006338) |
| 0.2 |
0.7 |
GO:0034476 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.2 |
1.8 |
GO:0071459 |
protein localization to chromosome, centromeric region(GO:0071459) |
| 0.2 |
0.5 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 0.2 |
0.5 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 0.2 |
2.9 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.2 |
2.7 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.2 |
1.4 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.2 |
1.8 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.2 |
0.9 |
GO:1902224 |
cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.2 |
6.3 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.2 |
1.4 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.2 |
0.9 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.2 |
0.2 |
GO:2001269 |
positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.2 |
0.2 |
GO:0070873 |
regulation of glycogen metabolic process(GO:0070873) |
| 0.2 |
3.1 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.2 |
0.4 |
GO:0003091 |
renal water homeostasis(GO:0003091) |
| 0.2 |
0.7 |
GO:0033119 |
negative regulation of RNA splicing(GO:0033119) |
| 0.2 |
0.2 |
GO:1903707 |
negative regulation of hemopoiesis(GO:1903707) |
| 0.2 |
2.7 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.2 |
0.7 |
GO:0045668 |
negative regulation of osteoblast differentiation(GO:0045668) |
| 0.2 |
1.1 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.2 |
1.1 |
GO:0098700 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.2 |
0.2 |
GO:1902255 |
positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 0.2 |
2.2 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.2 |
2.6 |
GO:0008272 |
sulfate transport(GO:0008272) |
| 0.2 |
2.6 |
GO:0071392 |
cellular response to estradiol stimulus(GO:0071392) |
| 0.2 |
0.2 |
GO:0070233 |
negative regulation of T cell apoptotic process(GO:0070233) |
| 0.2 |
0.6 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.2 |
2.7 |
GO:1904293 |
negative regulation of ERAD pathway(GO:1904293) |
| 0.2 |
1.1 |
GO:0046133 |
pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.2 |
0.4 |
GO:0043486 |
histone exchange(GO:0043486) |
| 0.2 |
0.2 |
GO:0030950 |
establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.2 |
0.4 |
GO:0097501 |
stress response to metal ion(GO:0097501) |
| 0.2 |
0.6 |
GO:1902109 |
negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.2 |
0.2 |
GO:0061153 |
trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.2 |
0.8 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.2 |
0.4 |
GO:2000286 |
receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.2 |
1.0 |
GO:0003009 |
skeletal muscle contraction(GO:0003009) |
| 0.2 |
3.3 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.2 |
0.6 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.2 |
0.6 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.2 |
0.6 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.2 |
2.7 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.2 |
3.3 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.2 |
1.0 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.2 |
0.6 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.2 |
0.6 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.2 |
1.0 |
GO:0060767 |
epithelial cell proliferation involved in prostate gland development(GO:0060767) |
| 0.2 |
0.4 |
GO:0030859 |
polarized epithelial cell differentiation(GO:0030859) |
| 0.2 |
1.4 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.2 |
1.0 |
GO:0021978 |
telencephalon regionalization(GO:0021978) |
| 0.2 |
1.8 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.2 |
1.0 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.2 |
0.4 |
GO:0046885 |
regulation of hormone biosynthetic process(GO:0046885) |
| 0.2 |
1.4 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.2 |
2.2 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.2 |
1.0 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.2 |
4.8 |
GO:0006730 |
one-carbon metabolic process(GO:0006730) |
| 0.2 |
0.8 |
GO:0065001 |
specification of axis polarity(GO:0065001) |
| 0.2 |
0.4 |
GO:0042693 |
muscle cell fate commitment(GO:0042693) |
| 0.2 |
4.8 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.2 |
0.6 |
GO:0070307 |
lens fiber cell development(GO:0070307) |
| 0.2 |
0.6 |
GO:0036233 |
glycine import(GO:0036233) |
| 0.2 |
0.2 |
GO:0043619 |
regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.2 |
2.6 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.2 |
0.6 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.2 |
0.6 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.2 |
0.4 |
GO:0071044 |
histone mRNA catabolic process(GO:0071044) |
| 0.2 |
1.6 |
GO:0031498 |
chromatin disassembly(GO:0031498) |
| 0.2 |
2.7 |
GO:0001658 |
branching involved in ureteric bud morphogenesis(GO:0001658) |
| 0.2 |
1.6 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.2 |
1.0 |
GO:0071850 |
mitotic cell cycle arrest(GO:0071850) |
| 0.2 |
0.2 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.2 |
0.4 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.2 |
2.1 |
GO:0030201 |
heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.2 |
0.8 |
GO:0031441 |
negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.2 |
0.2 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.2 |
4.6 |
GO:0045600 |
positive regulation of fat cell differentiation(GO:0045600) |
| 0.2 |
0.8 |
GO:0007257 |
activation of JUN kinase activity(GO:0007257) |
| 0.2 |
1.2 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.2 |
1.3 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.2 |
1.0 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.2 |
0.8 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.2 |
1.0 |
GO:0034383 |
low-density lipoprotein particle clearance(GO:0034383) |
| 0.2 |
0.4 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.2 |
0.4 |
GO:1901550 |
regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.2 |
0.2 |
GO:0033122 |
regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.2 |
1.9 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.2 |
4.5 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.2 |
1.9 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.2 |
0.4 |
GO:0032375 |
negative regulation of sterol transport(GO:0032372) negative regulation of cholesterol transport(GO:0032375) |
| 0.2 |
0.6 |
GO:0002089 |
lens morphogenesis in camera-type eye(GO:0002089) |
| 0.2 |
0.7 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.2 |
1.7 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.2 |
0.6 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.2 |
0.6 |
GO:0051775 |
response to redox state(GO:0051775) |
| 0.2 |
1.3 |
GO:0035437 |
maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.2 |
0.4 |
GO:0070459 |
prolactin secretion(GO:0070459) |
| 0.2 |
1.7 |
GO:0071578 |
zinc II ion transmembrane import(GO:0071578) |
| 0.2 |
6.4 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.2 |
0.4 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.2 |
0.5 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.2 |
1.1 |
GO:2001014 |
regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.2 |
0.5 |
GO:1901072 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) glucosamine-containing compound catabolic process(GO:1901072) |
| 0.2 |
0.7 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.2 |
0.7 |
GO:0010593 |
negative regulation of lamellipodium assembly(GO:0010593) |
| 0.2 |
1.1 |
GO:0071577 |
zinc II ion transmembrane transport(GO:0071577) |
| 0.2 |
0.5 |
GO:1901673 |
regulation of mitotic spindle assembly(GO:1901673) |
| 0.2 |
0.9 |
GO:0045930 |
negative regulation of mitotic cell cycle(GO:0045930) |
| 0.2 |
1.8 |
GO:0014823 |
response to activity(GO:0014823) |
| 0.2 |
0.7 |
GO:1902410 |
mitotic cytokinetic process(GO:1902410) |
| 0.2 |
0.5 |
GO:2000616 |
negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.2 |
0.4 |
GO:0051893 |
regulation of focal adhesion assembly(GO:0051893) regulation of cell-substrate junction assembly(GO:0090109) |
| 0.2 |
0.7 |
GO:0046909 |
intermembrane transport(GO:0046909) |
| 0.2 |
1.9 |
GO:0014911 |
positive regulation of smooth muscle cell migration(GO:0014911) |
| 0.2 |
1.6 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.2 |
0.9 |
GO:0003085 |
negative regulation of systemic arterial blood pressure(GO:0003085) |
| 0.2 |
1.0 |
GO:0001996 |
regulation of systemic arterial blood pressure by norepinephrine-epinephrine(GO:0001993) positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) positive regulation of blood pressure by epinephrine-norepinephrine(GO:0003321) |
| 0.2 |
0.3 |
GO:0045601 |
regulation of endothelial cell differentiation(GO:0045601) |
| 0.2 |
1.9 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.2 |
0.7 |
GO:0033194 |
response to hydroperoxide(GO:0033194) |
| 0.2 |
0.5 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.2 |
0.2 |
GO:2000544 |
cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of endothelial tube morphogenesis(GO:1901509) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
| 0.2 |
0.2 |
GO:0061428 |
negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.2 |
0.2 |
GO:0071034 |
CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.2 |
0.7 |
GO:1904426 |
positive regulation of GTP binding(GO:1904426) regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
| 0.2 |
2.2 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.2 |
0.7 |
GO:0034142 |
toll-like receptor 4 signaling pathway(GO:0034142) |
| 0.2 |
0.7 |
GO:0048144 |
fibroblast proliferation(GO:0048144) |
| 0.2 |
0.5 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.2 |
0.3 |
GO:0060235 |
lens induction in camera-type eye(GO:0060235) |
| 0.2 |
2.7 |
GO:0071539 |
protein localization to centrosome(GO:0071539) |
| 0.2 |
1.8 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.2 |
0.3 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.2 |
0.3 |
GO:0086016 |
AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) AV node cell to bundle of His cell communication(GO:0086067) |
| 0.2 |
0.5 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.2 |
0.5 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.2 |
0.5 |
GO:0006573 |
valine metabolic process(GO:0006573) |
| 0.2 |
1.5 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.2 |
0.5 |
GO:0071479 |
cellular response to ionizing radiation(GO:0071479) |
| 0.2 |
0.8 |
GO:1902916 |
positive regulation of protein polyubiquitination(GO:1902916) |
| 0.2 |
1.3 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.2 |
1.8 |
GO:0010664 |
negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.2 |
0.5 |
GO:0070836 |
caveola assembly(GO:0070836) |
| 0.2 |
0.2 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.2 |
2.1 |
GO:0007062 |
sister chromatid cohesion(GO:0007062) |
| 0.2 |
0.5 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.2 |
1.3 |
GO:0071364 |
cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.2 |
0.6 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.2 |
0.5 |
GO:0006526 |
arginine biosynthetic process(GO:0006526) |
| 0.2 |
0.3 |
GO:0016095 |
polyprenol catabolic process(GO:0016095) |
| 0.2 |
0.3 |
GO:0000966 |
RNA 5'-end processing(GO:0000966) |
| 0.2 |
0.3 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.2 |
0.5 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.2 |
0.5 |
GO:0048211 |
Golgi vesicle docking(GO:0048211) |
| 0.2 |
1.4 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.2 |
0.6 |
GO:0061448 |
connective tissue development(GO:0061448) |
| 0.2 |
0.5 |
GO:0042518 |
negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.2 |
0.5 |
GO:0000350 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.2 |
0.3 |
GO:0001954 |
positive regulation of cell-matrix adhesion(GO:0001954) |
| 0.2 |
1.1 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.2 |
0.3 |
GO:0019748 |
secondary metabolic process(GO:0019748) |
| 0.2 |
0.6 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.2 |
0.2 |
GO:1901838 |
positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.2 |
1.4 |
GO:1904031 |
positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.2 |
3.8 |
GO:0051304 |
chromosome separation(GO:0051304) |
| 0.2 |
0.8 |
GO:0036337 |
Fas signaling pathway(GO:0036337) |
| 0.2 |
0.2 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.2 |
1.1 |
GO:0015697 |
quaternary ammonium group transport(GO:0015697) |
| 0.2 |
1.7 |
GO:0033327 |
Leydig cell differentiation(GO:0033327) |
| 0.2 |
0.3 |
GO:1905208 |
negative regulation of cardiocyte differentiation(GO:1905208) |
| 0.2 |
0.5 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 |
1.5 |
GO:0018126 |
protein hydroxylation(GO:0018126) |
| 0.1 |
0.1 |
GO:0046325 |
negative regulation of glucose import(GO:0046325) |
| 0.1 |
1.3 |
GO:0060324 |
face development(GO:0060324) |
| 0.1 |
0.4 |
GO:0036342 |
post-anal tail morphogenesis(GO:0036342) |
| 0.1 |
1.2 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.1 |
0.1 |
GO:0043651 |
linoleic acid metabolic process(GO:0043651) |
| 0.1 |
0.6 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 |
0.1 |
GO:1903546 |
protein localization to photoreceptor outer segment(GO:1903546) |
| 0.1 |
0.4 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) chloride ion homeostasis(GO:0055064) |
| 0.1 |
0.7 |
GO:0000076 |
DNA replication checkpoint(GO:0000076) |
| 0.1 |
0.3 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.1 |
0.6 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 |
1.2 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.1 |
1.9 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.1 |
0.3 |
GO:0071649 |
chemokine (C-C motif) ligand 5 production(GO:0071609) regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.1 |
0.1 |
GO:2000983 |
regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.1 |
0.8 |
GO:2000193 |
positive regulation of fatty acid transport(GO:2000193) |
| 0.1 |
0.4 |
GO:0010572 |
positive regulation of platelet activation(GO:0010572) |
| 0.1 |
0.7 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 |
1.1 |
GO:0006490 |
oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.1 |
0.3 |
GO:1903215 |
negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 |
4.6 |
GO:0071230 |
cellular response to amino acid stimulus(GO:0071230) |
| 0.1 |
0.1 |
GO:0042249 |
establishment of planar polarity of embryonic epithelium(GO:0042249) |
| 0.1 |
0.3 |
GO:0043696 |
dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.1 |
0.5 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.1 |
0.5 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.1 |
0.7 |
GO:0046459 |
short-chain fatty acid metabolic process(GO:0046459) |
| 0.1 |
0.9 |
GO:0016575 |
histone deacetylation(GO:0016575) |
| 0.1 |
4.7 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.1 |
0.4 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.1 |
1.3 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.1 |
0.7 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.1 |
0.1 |
GO:0045091 |
single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
| 0.1 |
0.5 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.1 |
0.3 |
GO:1901796 |
regulation of signal transduction by p53 class mediator(GO:1901796) |
| 0.1 |
1.6 |
GO:0009437 |
amino-acid betaine metabolic process(GO:0006577) carnitine metabolic process(GO:0009437) |
| 0.1 |
0.4 |
GO:0006435 |
threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 |
0.5 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 |
0.3 |
GO:0071594 |
T cell differentiation in thymus(GO:0033077) thymocyte aggregation(GO:0071594) |
| 0.1 |
0.1 |
GO:0050819 |
negative regulation of coagulation(GO:0050819) |
| 0.1 |
0.8 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 |
0.5 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 |
0.4 |
GO:0060947 |
cardiac vascular smooth muscle cell differentiation(GO:0060947) |
| 0.1 |
0.9 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 |
0.6 |
GO:0000467 |
exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.1 |
0.4 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.1 |
0.9 |
GO:0035510 |
DNA dealkylation(GO:0035510) |
| 0.1 |
2.0 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.1 |
1.6 |
GO:0010388 |
protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
| 0.1 |
0.1 |
GO:0070170 |
regulation of tooth mineralization(GO:0070170) |
| 0.1 |
0.4 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.1 |
0.5 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.1 |
2.8 |
GO:0021591 |
ventricular system development(GO:0021591) |
| 0.1 |
5.4 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.1 |
0.4 |
GO:1902837 |
amino acid import into cell(GO:1902837) |
| 0.1 |
0.1 |
GO:1901252 |
regulation of intracellular transport of viral material(GO:1901252) |
| 0.1 |
3.9 |
GO:0070303 |
negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
| 0.1 |
0.4 |
GO:0090394 |
negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.1 |
0.7 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.1 |
0.1 |
GO:2000392 |
regulation of lamellipodium morphogenesis(GO:2000392) |
| 0.1 |
1.2 |
GO:0051156 |
glucose 6-phosphate metabolic process(GO:0051156) |
| 0.1 |
3.2 |
GO:0033692 |
cellular polysaccharide biosynthetic process(GO:0033692) |
| 0.1 |
0.4 |
GO:1903896 |
positive regulation of IRE1-mediated unfolded protein response(GO:1903896) |
| 0.1 |
0.4 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.1 |
0.4 |
GO:0001827 |
inner cell mass cell fate commitment(GO:0001827) |
| 0.1 |
3.4 |
GO:0031016 |
pancreas development(GO:0031016) |
| 0.1 |
1.3 |
GO:0045580 |
regulation of T cell differentiation(GO:0045580) |
| 0.1 |
1.1 |
GO:0016568 |
chromatin modification(GO:0016568) |
| 0.1 |
0.3 |
GO:0003215 |
cardiac right ventricle morphogenesis(GO:0003215) |
| 0.1 |
0.8 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.1 |
1.3 |
GO:0000394 |
RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) |
| 0.1 |
0.3 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.1 |
0.3 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.1 |
0.1 |
GO:0002904 |
positive regulation of B cell apoptotic process(GO:0002904) |
| 0.1 |
0.3 |
GO:0045911 |
positive regulation of DNA recombination(GO:0045911) |
| 0.1 |
0.6 |
GO:0006681 |
galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.1 |
1.0 |
GO:2000009 |
negative regulation of protein localization to cell surface(GO:2000009) |
| 0.1 |
0.4 |
GO:1903624 |
regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
| 0.1 |
0.2 |
GO:0090501 |
RNA phosphodiester bond hydrolysis(GO:0090501) |
| 0.1 |
1.3 |
GO:0000154 |
rRNA modification(GO:0000154) |
| 0.1 |
0.4 |
GO:0090503 |
RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.1 |
0.3 |
GO:0090283 |
regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.1 |
0.2 |
GO:0032725 |
positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
| 0.1 |
0.2 |
GO:0043029 |
T cell homeostasis(GO:0043029) |
| 0.1 |
0.2 |
GO:0042511 |
positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
| 0.1 |
0.3 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.1 |
0.3 |
GO:0072520 |
seminiferous tubule development(GO:0072520) |
| 0.1 |
0.7 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 0.1 |
1.2 |
GO:0010390 |
histone monoubiquitination(GO:0010390) |
| 0.1 |
0.4 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
0.8 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.1 |
0.4 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.1 |
0.9 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.1 |
0.4 |
GO:2000209 |
regulation of anoikis(GO:2000209) |
| 0.1 |
0.6 |
GO:0045040 |
protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 |
0.2 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 |
0.5 |
GO:0051303 |
establishment of chromosome localization(GO:0051303) |
| 0.1 |
0.3 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.1 |
0.2 |
GO:0048539 |
bone marrow development(GO:0048539) |
| 0.1 |
0.2 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.1 |
0.3 |
GO:0006742 |
NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) pyridine-containing compound catabolic process(GO:0072526) |
| 0.1 |
0.4 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.1 |
2.8 |
GO:0000470 |
maturation of LSU-rRNA(GO:0000470) |
| 0.1 |
0.6 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.1 |
0.3 |
GO:0051973 |
positive regulation of telomerase activity(GO:0051973) |
| 0.1 |
0.3 |
GO:0051043 |
regulation of membrane protein ectodomain proteolysis(GO:0051043) |
| 0.1 |
0.3 |
GO:0060315 |
negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
| 0.1 |
0.8 |
GO:0046605 |
regulation of centrosome cycle(GO:0046605) |
| 0.1 |
0.2 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.1 |
0.1 |
GO:0038028 |
insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.1 |
0.1 |
GO:2000484 |
positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.1 |
1.3 |
GO:0043631 |
RNA polyadenylation(GO:0043631) |
| 0.1 |
1.0 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.1 |
0.5 |
GO:0001946 |
lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
| 0.1 |
0.4 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.1 |
0.7 |
GO:0046475 |
glycerophospholipid catabolic process(GO:0046475) |
| 0.1 |
0.9 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.1 |
0.4 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.1 |
0.2 |
GO:0070093 |
negative regulation of glucagon secretion(GO:0070093) |
| 0.1 |
3.5 |
GO:0006446 |
regulation of translational initiation(GO:0006446) |
| 0.1 |
0.1 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.1 |
0.5 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.1 |
0.3 |
GO:0009644 |
response to high light intensity(GO:0009644) |
| 0.1 |
0.3 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 |
0.7 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.1 |
0.1 |
GO:0034370 |
triglyceride-rich lipoprotein particle remodeling(GO:0034370) |
| 0.1 |
0.1 |
GO:0019074 |
viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.1 |
0.2 |
GO:0051771 |
negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.1 |
0.3 |
GO:0014832 |
urinary bladder smooth muscle contraction(GO:0014832) |
| 0.1 |
1.3 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.1 |
0.5 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.1 |
0.2 |
GO:0030183 |
B cell differentiation(GO:0030183) |
| 0.1 |
0.5 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.1 |
2.5 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.1 |
0.9 |
GO:0010883 |
regulation of lipid storage(GO:0010883) |
| 0.1 |
0.2 |
GO:0009211 |
pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
| 0.1 |
1.0 |
GO:0001947 |
heart looping(GO:0001947) |
| 0.1 |
0.4 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.1 |
0.4 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 |
0.1 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.1 |
0.5 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.1 |
1.8 |
GO:0000184 |
nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.1 |
2.0 |
GO:0009855 |
determination of bilateral symmetry(GO:0009855) |
| 0.1 |
0.4 |
GO:0006998 |
nuclear envelope organization(GO:0006998) |
| 0.1 |
0.1 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.1 |
0.4 |
GO:0006997 |
nucleus organization(GO:0006997) |
| 0.1 |
1.0 |
GO:1904814 |
regulation of protein localization to chromosome, telomeric region(GO:1904814) |
| 0.1 |
0.6 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.1 |
0.9 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 |
0.3 |
GO:0031666 |
positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.1 |
0.9 |
GO:1903077 |
negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.1 |
0.5 |
GO:0042789 |
mRNA transcription from RNA polymerase II promoter(GO:0042789) |
| 0.1 |
0.3 |
GO:0006309 |
apoptotic DNA fragmentation(GO:0006309) |
| 0.1 |
0.2 |
GO:0070863 |
positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.1 |
0.1 |
GO:0046077 |
dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate metabolic process(GO:0009138) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine ribonucleoside diphosphate metabolic process(GO:0009193) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) pyrimidine deoxyribonucleotide biosynthetic process(GO:0009221) UDP metabolic process(GO:0046048) dUDP metabolic process(GO:0046077) |
| 0.1 |
0.2 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 |
0.6 |
GO:0033572 |
transferrin transport(GO:0033572) |
| 0.1 |
0.6 |
GO:0036037 |
CD8-positive, alpha-beta T cell activation(GO:0036037) |
| 0.1 |
0.3 |
GO:0042940 |
D-amino acid transport(GO:0042940) |
| 0.1 |
0.3 |
GO:0006278 |
RNA-dependent DNA biosynthetic process(GO:0006278) telomere maintenance via telomerase(GO:0007004) |
| 0.1 |
2.0 |
GO:0015985 |
energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 |
0.2 |
GO:0042482 |
positive regulation of odontogenesis(GO:0042482) |
| 0.1 |
0.5 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.1 |
0.2 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.1 |
0.4 |
GO:0045724 |
positive regulation of cilium assembly(GO:0045724) |
| 0.1 |
0.2 |
GO:0010155 |
regulation of proton transport(GO:0010155) |
| 0.1 |
1.2 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.1 |
0.6 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.1 |
0.3 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.1 |
0.2 |
GO:0006290 |
pyrimidine dimer repair(GO:0006290) |
| 0.1 |
0.6 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 |
0.1 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.1 |
2.5 |
GO:0045727 |
positive regulation of translation(GO:0045727) |
| 0.1 |
0.1 |
GO:0002361 |
CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.1 |
0.1 |
GO:0043278 |
response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.1 |
0.3 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 |
0.2 |
GO:0035790 |
platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.1 |
0.2 |
GO:0061029 |
eyelid development in camera-type eye(GO:0061029) |
| 0.1 |
0.1 |
GO:0070423 |
nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.1 |
0.2 |
GO:0016322 |
neuron remodeling(GO:0016322) |
| 0.1 |
0.2 |
GO:0006538 |
glutamate catabolic process(GO:0006538) |
| 0.1 |
0.5 |
GO:0070458 |
detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.1 |
0.3 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.1 |
0.2 |
GO:0030049 |
muscle filament sliding(GO:0030049) |
| 0.1 |
3.6 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.1 |
0.2 |
GO:0015871 |
choline transport(GO:0015871) |
| 0.1 |
0.2 |
GO:1901341 |
positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.1 |
0.2 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.1 |
0.5 |
GO:0050892 |
intestinal absorption(GO:0050892) |
| 0.1 |
0.2 |
GO:0048747 |
muscle fiber development(GO:0048747) |
| 0.1 |
0.1 |
GO:0061032 |
visceral serous pericardium development(GO:0061032) |
| 0.1 |
17.4 |
GO:0008380 |
RNA splicing(GO:0008380) |
| 0.1 |
0.3 |
GO:0060294 |
cilium movement involved in cell motility(GO:0060294) |
| 0.1 |
0.1 |
GO:0060264 |
regulation of respiratory burst involved in inflammatory response(GO:0060264) |
| 0.1 |
6.5 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.1 |
0.5 |
GO:1902743 |
regulation of lamellipodium organization(GO:1902743) |
| 0.1 |
0.4 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 0.1 |
2.2 |
GO:0001892 |
embryonic placenta development(GO:0001892) |
| 0.1 |
0.1 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 0.1 |
1.5 |
GO:0006513 |
protein monoubiquitination(GO:0006513) |
| 0.1 |
0.2 |
GO:0046460 |
triglyceride biosynthetic process(GO:0019432) neutral lipid biosynthetic process(GO:0046460) acylglycerol biosynthetic process(GO:0046463) |
| 0.1 |
0.3 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.1 |
0.8 |
GO:0030520 |
intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.1 |
0.1 |
GO:0001711 |
endodermal cell fate commitment(GO:0001711) |
| 0.1 |
0.3 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.1 |
0.1 |
GO:0035067 |
negative regulation of histone acetylation(GO:0035067) |
| 0.1 |
0.1 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.1 |
0.2 |
GO:0003345 |
proepicardium cell migration involved in pericardium morphogenesis(GO:0003345) |
| 0.1 |
0.2 |
GO:0014066 |
regulation of phosphatidylinositol 3-kinase signaling(GO:0014066) |
| 0.1 |
0.5 |
GO:0006825 |
copper ion transport(GO:0006825) |
| 0.1 |
1.0 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.1 |
0.6 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 0.1 |
0.2 |
GO:1904469 |
positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.1 |
0.5 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.1 |
0.1 |
GO:0014068 |
positive regulation of phosphatidylinositol 3-kinase signaling(GO:0014068) |
| 0.1 |
0.1 |
GO:0060385 |
axonogenesis involved in innervation(GO:0060385) |
| 0.1 |
0.9 |
GO:0032755 |
positive regulation of interleukin-6 production(GO:0032755) |
| 0.1 |
0.1 |
GO:0006027 |
glycosaminoglycan catabolic process(GO:0006027) |
| 0.1 |
0.1 |
GO:0000059 |
protein import into nucleus, docking(GO:0000059) |
| 0.1 |
0.6 |
GO:0051084 |
'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.1 |
0.2 |
GO:0045672 |
positive regulation of osteoclast differentiation(GO:0045672) |
| 0.1 |
1.5 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
0.4 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.1 |
0.2 |
GO:0044346 |
fibroblast apoptotic process(GO:0044346) |
| 0.1 |
0.2 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 |
0.1 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 |
2.1 |
GO:0016126 |
sterol biosynthetic process(GO:0016126) |
| 0.1 |
1.1 |
GO:0051497 |
negative regulation of stress fiber assembly(GO:0051497) |
| 0.1 |
0.1 |
GO:1901660 |
calcium ion export(GO:1901660) |
| 0.1 |
0.1 |
GO:0010560 |
positive regulation of glycoprotein biosynthetic process(GO:0010560) |
| 0.1 |
0.2 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.1 |
1.9 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 0.1 |
0.6 |
GO:0007569 |
cell aging(GO:0007569) |
| 0.1 |
0.1 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 |
0.1 |
GO:1901857 |
positive regulation of cellular respiration(GO:1901857) |
| 0.1 |
0.2 |
GO:0035188 |
blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.1 |
0.1 |
GO:0051031 |
tRNA transport(GO:0051031) |
| 0.1 |
0.1 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.1 |
0.1 |
GO:0021523 |
somatic motor neuron differentiation(GO:0021523) |
| 0.1 |
0.5 |
GO:0044406 |
adhesion of symbiont to host(GO:0044406) |
| 0.1 |
0.4 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.1 |
0.3 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.1 |
0.4 |
GO:0060628 |
regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 |
0.8 |
GO:0033209 |
tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.1 |
0.8 |
GO:0032922 |
circadian regulation of gene expression(GO:0032922) |
| 0.1 |
0.2 |
GO:0036506 |
maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.1 |
0.6 |
GO:0019369 |
arachidonic acid metabolic process(GO:0019369) |
| 0.1 |
2.1 |
GO:0006364 |
rRNA processing(GO:0006364) |
| 0.1 |
0.3 |
GO:0007095 |
mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.1 |
0.2 |
GO:0032400 |
melanosome localization(GO:0032400) |
| 0.1 |
0.8 |
GO:0033233 |
regulation of protein sumoylation(GO:0033233) |
| 0.1 |
0.2 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 |
0.1 |
GO:0051132 |
NK T cell activation(GO:0051132) |
| 0.1 |
0.5 |
GO:0045070 |
positive regulation of viral genome replication(GO:0045070) |
| 0.0 |
0.3 |
GO:0046040 |
IMP metabolic process(GO:0046040) |
| 0.0 |
0.2 |
GO:0006448 |
regulation of translational elongation(GO:0006448) |
| 0.0 |
1.7 |
GO:0006505 |
GPI anchor metabolic process(GO:0006505) GPI anchor biosynthetic process(GO:0006506) |
| 0.0 |
0.1 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.0 |
1.5 |
GO:0002244 |
hematopoietic progenitor cell differentiation(GO:0002244) |
| 0.0 |
0.1 |
GO:0035826 |
rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.0 |
0.1 |
GO:2000036 |
regulation of stem cell population maintenance(GO:2000036) |
| 0.0 |
0.3 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.0 |
0.5 |
GO:0043489 |
RNA stabilization(GO:0043489) |
| 0.0 |
0.0 |
GO:1903012 |
positive regulation of osteoblast proliferation(GO:0033690) positive regulation of bone development(GO:1903012) |
| 0.0 |
0.6 |
GO:0048240 |
sperm capacitation(GO:0048240) |
| 0.0 |
0.4 |
GO:0006301 |
postreplication repair(GO:0006301) |
| 0.0 |
0.1 |
GO:0007320 |
insemination(GO:0007320) |
| 0.0 |
0.2 |
GO:0034308 |
primary alcohol metabolic process(GO:0034308) |
| 0.0 |
1.8 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.0 |
0.2 |
GO:0009650 |
UV protection(GO:0009650) |
| 0.0 |
0.1 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.0 |
0.4 |
GO:0006359 |
regulation of transcription from RNA polymerase III promoter(GO:0006359) |
| 0.0 |
0.6 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.0 |
1.2 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.0 |
0.3 |
GO:0036344 |
platelet morphogenesis(GO:0036344) |
| 0.0 |
0.9 |
GO:0034724 |
DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 |
0.3 |
GO:0016486 |
peptide hormone processing(GO:0016486) |
| 0.0 |
0.3 |
GO:1903975 |
regulation of glial cell migration(GO:1903975) |
| 0.0 |
0.2 |
GO:0007016 |
cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 |
0.0 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.0 |
0.0 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.0 |
0.2 |
GO:0018202 |
peptidyl-histidine modification(GO:0018202) |
| 0.0 |
0.1 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.0 |
0.1 |
GO:0006002 |
fructose 6-phosphate metabolic process(GO:0006002) |
| 0.0 |
0.2 |
GO:0008630 |
intrinsic apoptotic signaling pathway in response to DNA damage(GO:0008630) |
| 0.0 |
0.1 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 |
0.2 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 |
0.2 |
GO:0090151 |
establishment of protein localization to mitochondrial membrane(GO:0090151) |
| 0.0 |
0.3 |
GO:0042255 |
ribosome assembly(GO:0042255) |
| 0.0 |
0.1 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.0 |
0.1 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.0 |
0.1 |
GO:1902774 |
late endosome to lysosome transport(GO:1902774) |
| 0.0 |
0.1 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.0 |
0.7 |
GO:0046856 |
phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 |
1.0 |
GO:0007229 |
integrin-mediated signaling pathway(GO:0007229) |
| 0.0 |
0.4 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.0 |
0.4 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.0 |
0.2 |
GO:0030316 |
osteoclast differentiation(GO:0030316) |
| 0.0 |
0.1 |
GO:0002534 |
cytokine production involved in inflammatory response(GO:0002534) |
| 0.0 |
0.3 |
GO:0034312 |
diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.0 |
0.2 |
GO:0018027 |
peptidyl-lysine dimethylation(GO:0018027) |
| 0.0 |
0.0 |
GO:0001575 |
globoside metabolic process(GO:0001575) |
| 0.0 |
0.1 |
GO:0051289 |
protein homotetramerization(GO:0051289) |
| 0.0 |
0.1 |
GO:0050904 |
diapedesis(GO:0050904) |
| 0.0 |
0.4 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.0 |
0.1 |
GO:0010528 |
regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 |
0.0 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 |
0.4 |
GO:0010907 |
positive regulation of glucose metabolic process(GO:0010907) |
| 0.0 |
0.1 |
GO:0042149 |
cellular response to glucose starvation(GO:0042149) |
| 0.0 |
0.2 |
GO:2001241 |
positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 |
0.2 |
GO:0046485 |
ether lipid metabolic process(GO:0046485) |
| 0.0 |
0.1 |
GO:0019614 |
catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.0 |
0.1 |
GO:0048736 |
appendage development(GO:0048736) limb development(GO:0060173) |
| 0.0 |
0.2 |
GO:0035493 |
SNARE complex assembly(GO:0035493) |
| 0.0 |
0.5 |
GO:0071108 |
protein K48-linked deubiquitination(GO:0071108) |
| 0.0 |
0.4 |
GO:2001238 |
positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.0 |
0.2 |
GO:0016525 |
negative regulation of angiogenesis(GO:0016525) negative regulation of blood vessel morphogenesis(GO:2000181) |
| 0.0 |
0.2 |
GO:0030330 |
DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
| 0.0 |
0.0 |
GO:0033578 |
protein glycosylation in Golgi(GO:0033578) |
| 0.0 |
0.6 |
GO:0071300 |
cellular response to retinoic acid(GO:0071300) |
| 0.0 |
0.2 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 0.0 |
0.3 |
GO:0017145 |
stem cell division(GO:0017145) |
| 0.0 |
0.1 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 |
0.1 |
GO:0060135 |
maternal process involved in female pregnancy(GO:0060135) |
| 0.0 |
0.1 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.0 |
0.1 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 |
0.1 |
GO:0010761 |
fibroblast migration(GO:0010761) |
| 0.0 |
0.0 |
GO:0060753 |
regulation of mast cell chemotaxis(GO:0060753) |
| 0.0 |
0.5 |
GO:0030838 |
positive regulation of actin filament polymerization(GO:0030838) |
| 0.0 |
0.1 |
GO:0052646 |
alditol phosphate metabolic process(GO:0052646) |
| 0.0 |
0.1 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.0 |
0.0 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.0 |
0.1 |
GO:0006641 |
triglyceride metabolic process(GO:0006641) |
| 0.0 |
0.2 |
GO:0051016 |
barbed-end actin filament capping(GO:0051016) |
| 0.0 |
0.0 |
GO:1903336 |
negative regulation of vacuolar transport(GO:1903336) |
| 0.0 |
0.1 |
GO:0006108 |
malate metabolic process(GO:0006108) |
| 0.0 |
0.1 |
GO:0001580 |
detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.0 |
0.2 |
GO:0006661 |
phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.0 |
0.1 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.0 |
0.1 |
GO:0097369 |
sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 |
0.1 |
GO:1904407 |
positive regulation of nitric oxide biosynthetic process(GO:0045429) positive regulation of nitric oxide metabolic process(GO:1904407) |
| 0.0 |
0.2 |
GO:0009191 |
ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.0 |
0.1 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.0 |
0.0 |
GO:1903364 |
positive regulation of cellular protein catabolic process(GO:1903364) |
| 0.0 |
0.2 |
GO:0009083 |
branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 |
0.1 |
GO:0009263 |
deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.0 |
0.7 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.0 |
0.1 |
GO:2001244 |
positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
| 0.0 |
0.0 |
GO:0090148 |
membrane fission(GO:0090148) |
| 0.0 |
0.1 |
GO:0034162 |
toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.0 |
0.5 |
GO:0007032 |
endosome organization(GO:0007032) |
| 0.0 |
0.1 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.0 |
0.3 |
GO:0006767 |
water-soluble vitamin metabolic process(GO:0006767) |
| 0.0 |
0.1 |
GO:0043588 |
skin development(GO:0043588) |
| 0.0 |
0.0 |
GO:0032715 |
negative regulation of interleukin-6 production(GO:0032715) |
| 0.0 |
0.2 |
GO:0002227 |
innate immune response in mucosa(GO:0002227) |
| 0.0 |
0.5 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.0 |
0.0 |
GO:0016137 |
glycoside metabolic process(GO:0016137) |
| 0.0 |
0.0 |
GO:0032958 |
inositol phosphate biosynthetic process(GO:0032958) |
| 0.0 |
0.2 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.0 |
0.2 |
GO:0032526 |
response to retinoic acid(GO:0032526) |
| 0.0 |
0.1 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.0 |
0.0 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.0 |
0.1 |
GO:0015788 |
UDP-N-acetylglucosamine transport(GO:0015788) |
| 0.0 |
0.1 |
GO:0042832 |
response to protozoan(GO:0001562) defense response to protozoan(GO:0042832) |
| 0.0 |
0.0 |
GO:0050667 |
homocysteine metabolic process(GO:0050667) |
| 0.0 |
0.1 |
GO:0080182 |
histone H3-K4 trimethylation(GO:0080182) |
| 0.0 |
0.1 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.0 |
0.1 |
GO:0010763 |
positive regulation of fibroblast migration(GO:0010763) |
| 0.0 |
0.1 |
GO:0035994 |
response to muscle stretch(GO:0035994) |
| 0.0 |
0.1 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 |
0.0 |
GO:0051608 |
histamine transport(GO:0051608) |
| 0.0 |
0.0 |
GO:1904749 |
regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.0 |
0.0 |
GO:1902608 |
regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.0 |
0.1 |
GO:0006362 |
transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 |
0.1 |
GO:0060969 |
negative regulation of gene silencing(GO:0060969) |
