| 7.4 |
22.2 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 3.8 |
11.4 |
GO:0060221 |
retinal rod cell differentiation(GO:0060221) |
| 3.7 |
11.2 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 3.7 |
11.1 |
GO:0048352 |
neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) |
| 3.6 |
21.8 |
GO:0032488 |
Cdc42 protein signal transduction(GO:0032488) |
| 3.5 |
10.6 |
GO:1904395 |
positive regulation of postsynaptic membrane organization(GO:1901628) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 3.3 |
16.4 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 3.2 |
9.5 |
GO:0007354 |
zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 3.1 |
9.2 |
GO:0044849 |
estrous cycle(GO:0044849) |
| 3.0 |
27.3 |
GO:0046499 |
S-adenosylmethioninamine metabolic process(GO:0046499) |
| 3.0 |
11.8 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 2.9 |
8.8 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 2.9 |
8.6 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 2.9 |
2.9 |
GO:0048538 |
thymus development(GO:0048538) |
| 2.8 |
17.0 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 2.8 |
8.4 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 2.7 |
11.0 |
GO:0086069 |
bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 2.7 |
10.8 |
GO:2000313 |
fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 2.6 |
10.4 |
GO:0021764 |
amygdala development(GO:0021764) |
| 2.5 |
7.4 |
GO:0010871 |
negative regulation of receptor biosynthetic process(GO:0010871) |
| 2.5 |
12.4 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 2.5 |
4.9 |
GO:2000977 |
regulation of forebrain neuron differentiation(GO:2000977) |
| 2.5 |
7.4 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 2.4 |
9.6 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 2.3 |
7.0 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 2.3 |
9.1 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 2.3 |
2.3 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 2.3 |
11.3 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 2.2 |
6.5 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 2.1 |
10.7 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 2.1 |
6.3 |
GO:0061153 |
trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 2.0 |
6.1 |
GO:0010940 |
positive regulation of necrotic cell death(GO:0010940) |
| 2.0 |
8.2 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 2.0 |
2.0 |
GO:0003431 |
growth plate cartilage chondrocyte differentiation(GO:0003418) growth plate cartilage chondrocyte development(GO:0003431) |
| 2.0 |
3.9 |
GO:2000053 |
regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 1.9 |
1.9 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 1.9 |
5.8 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 1.9 |
7.8 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 1.9 |
7.8 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 1.9 |
1.9 |
GO:0046605 |
regulation of centrosome cycle(GO:0046605) |
| 1.8 |
12.9 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 1.8 |
5.5 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 1.8 |
5.5 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) |
| 1.8 |
3.7 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 1.8 |
5.4 |
GO:0036388 |
pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 1.8 |
1.8 |
GO:0048382 |
mesendoderm development(GO:0048382) |
| 1.8 |
7.1 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 1.8 |
8.8 |
GO:0046601 |
positive regulation of centriole replication(GO:0046601) |
| 1.7 |
5.2 |
GO:0060489 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 1.7 |
6.9 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 1.7 |
5.2 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 1.7 |
3.4 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 1.7 |
8.6 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 1.7 |
3.4 |
GO:0044332 |
Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
| 1.7 |
5.1 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 1.7 |
1.7 |
GO:0072095 |
regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 1.6 |
9.8 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 1.6 |
6.5 |
GO:0010668 |
ectodermal cell differentiation(GO:0010668) |
| 1.6 |
4.8 |
GO:0030421 |
defecation(GO:0030421) |
| 1.6 |
1.6 |
GO:0043101 |
purine-containing compound salvage(GO:0043101) |
| 1.6 |
6.4 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 1.6 |
14.3 |
GO:0060059 |
embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 1.6 |
6.3 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 1.6 |
11.1 |
GO:0000022 |
mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 1.6 |
1.6 |
GO:0032835 |
glomerulus development(GO:0032835) |
| 1.6 |
10.9 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 1.5 |
4.6 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 1.5 |
6.2 |
GO:1905050 |
positive regulation of metallopeptidase activity(GO:1905050) |
| 1.5 |
6.0 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 1.5 |
9.0 |
GO:1903753 |
negative regulation of p38MAPK cascade(GO:1903753) |
| 1.5 |
4.4 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 1.5 |
1.5 |
GO:0010873 |
positive regulation of cholesterol esterification(GO:0010873) |
| 1.5 |
5.9 |
GO:0045084 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 1.5 |
8.7 |
GO:0003383 |
apical constriction(GO:0003383) |
| 1.4 |
1.4 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 1.4 |
5.7 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 1.4 |
1.4 |
GO:0035878 |
nail development(GO:0035878) |
| 1.4 |
5.7 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 1.4 |
1.4 |
GO:0033278 |
cell proliferation in midbrain(GO:0033278) |
| 1.4 |
4.1 |
GO:0090298 |
negative regulation of mitochondrial DNA replication(GO:0090298) |
| 1.4 |
4.1 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 1.4 |
5.5 |
GO:0010510 |
regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 1.3 |
1.3 |
GO:0033122 |
regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 1.3 |
1.3 |
GO:0010389 |
regulation of G2/M transition of mitotic cell cycle(GO:0010389) |
| 1.3 |
4.0 |
GO:0021893 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) |
| 1.3 |
1.3 |
GO:0060449 |
bud elongation involved in lung branching(GO:0060449) |
| 1.3 |
4.0 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 1.3 |
6.6 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 1.3 |
2.6 |
GO:0014028 |
notochord formation(GO:0014028) |
| 1.3 |
2.6 |
GO:0030208 |
dermatan sulfate biosynthetic process(GO:0030208) |
| 1.3 |
3.9 |
GO:0003180 |
aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
| 1.3 |
3.9 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 1.3 |
3.9 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 1.3 |
13.0 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 1.3 |
3.9 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 1.3 |
10.3 |
GO:1903689 |
regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 1.3 |
5.1 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 1.3 |
5.1 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 1.3 |
3.8 |
GO:2000983 |
regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 1.3 |
5.1 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 1.3 |
3.8 |
GO:0035604 |
fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) coronal suture morphogenesis(GO:0060365) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) |
| 1.3 |
1.3 |
GO:0072282 |
metanephric nephron tubule morphogenesis(GO:0072282) |
| 1.3 |
5.0 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 1.3 |
2.5 |
GO:1903011 |
negative regulation of bone development(GO:1903011) |
| 1.3 |
3.8 |
GO:0010838 |
positive regulation of keratinocyte proliferation(GO:0010838) |
| 1.2 |
12.4 |
GO:0030538 |
embryonic genitalia morphogenesis(GO:0030538) |
| 1.2 |
6.2 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 1.2 |
1.2 |
GO:1903960 |
negative regulation of anion transmembrane transport(GO:1903960) |
| 1.2 |
3.7 |
GO:0072356 |
chromosome passenger complex localization to kinetochore(GO:0072356) |
| 1.2 |
3.6 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 1.2 |
7.2 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 1.2 |
2.4 |
GO:0036518 |
chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 1.2 |
1.2 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 1.2 |
5.9 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 1.2 |
5.9 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 1.2 |
3.5 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 1.2 |
3.5 |
GO:0035313 |
wound healing, spreading of epidermal cells(GO:0035313) |
| 1.2 |
5.8 |
GO:0015705 |
iodide transport(GO:0015705) |
| 1.1 |
1.1 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) regulation of activation of JAK2 kinase activity(GO:0010534) |
| 1.1 |
4.5 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 1.1 |
10.2 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 1.1 |
4.5 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 1.1 |
8.9 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 1.1 |
3.3 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 1.1 |
3.3 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 1.1 |
7.7 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 1.1 |
9.8 |
GO:0002043 |
blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 1.1 |
4.4 |
GO:0072385 |
minus-end-directed organelle transport along microtubule(GO:0072385) |
| 1.1 |
3.3 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 1.1 |
1.1 |
GO:0035743 |
CD4-positive, alpha-beta T cell cytokine production(GO:0035743) T-helper 2 cell cytokine production(GO:0035745) |
| 1.1 |
3.2 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 1.1 |
3.2 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 1.1 |
4.3 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 1.1 |
6.4 |
GO:0060836 |
lymphatic endothelial cell differentiation(GO:0060836) |
| 1.1 |
6.4 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 1.1 |
3.2 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 1.1 |
2.1 |
GO:0061344 |
arterial endothelial cell fate commitment(GO:0060844) blood vessel endothelial cell fate commitment(GO:0060846) endothelial cell fate specification(GO:0060847) Notch signaling pathway involved in arterial endothelial cell fate commitment(GO:0060853) regulation of cell adhesion involved in heart morphogenesis(GO:0061344) blood vessel endothelial cell fate specification(GO:0097101) positive regulation of ephrin receptor signaling pathway(GO:1901189) |
| 1.1 |
3.2 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 1.1 |
3.2 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 1.1 |
5.3 |
GO:0060528 |
secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 1.1 |
3.2 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 1.1 |
4.2 |
GO:0071104 |
response to interleukin-9(GO:0071104) |
| 1.0 |
4.2 |
GO:0048696 |
regulation of collateral sprouting in absence of injury(GO:0048696) |
| 1.0 |
2.1 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 1.0 |
6.2 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 1.0 |
1.0 |
GO:0003223 |
ventricular compact myocardium morphogenesis(GO:0003223) |
| 1.0 |
1.0 |
GO:0035561 |
regulation of chromatin binding(GO:0035561) negative regulation of chromatin binding(GO:0035562) |
| 1.0 |
4.1 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 1.0 |
7.2 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 1.0 |
2.1 |
GO:0044413 |
evasion or tolerance of host defenses by virus(GO:0019049) avoidance of host defenses(GO:0044413) evasion or tolerance of host defenses(GO:0044415) avoidance of defenses of other organism involved in symbiotic interaction(GO:0051832) evasion or tolerance of defenses of other organism involved in symbiotic interaction(GO:0051834) |
| 1.0 |
5.1 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 1.0 |
2.0 |
GO:0006273 |
lagging strand elongation(GO:0006273) |
| 1.0 |
5.1 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 1.0 |
6.1 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 1.0 |
1.0 |
GO:0042505 |
tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 1.0 |
2.0 |
GO:0036289 |
peptidyl-serine autophosphorylation(GO:0036289) |
| 1.0 |
9.0 |
GO:0030206 |
chondroitin sulfate biosynthetic process(GO:0030206) |
| 1.0 |
1.0 |
GO:0038091 |
VEGF-activated platelet-derived growth factor receptor signaling pathway(GO:0038086) positive regulation of cell proliferation by VEGF-activated platelet derived growth factor receptor signaling pathway(GO:0038091) glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 1.0 |
4.0 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 1.0 |
3.0 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 1.0 |
5.0 |
GO:2000042 |
negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 1.0 |
5.0 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 1.0 |
2.0 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 1.0 |
4.9 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 1.0 |
1.0 |
GO:0031657 |
regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
| 1.0 |
4.9 |
GO:0042535 |
positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 1.0 |
2.9 |
GO:0045659 |
eosinophil differentiation(GO:0030222) regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 1.0 |
1.0 |
GO:0060423 |
foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 1.0 |
2.9 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 1.0 |
1.0 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 1.0 |
2.9 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 1.0 |
4.8 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 1.0 |
8.6 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 1.0 |
2.9 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 1.0 |
8.6 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.9 |
8.5 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.9 |
3.8 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.9 |
0.9 |
GO:0098908 |
regulation of neuronal action potential(GO:0098908) |
| 0.9 |
4.7 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.9 |
2.8 |
GO:0010835 |
regulation of protein ADP-ribosylation(GO:0010835) |
| 0.9 |
13.0 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.9 |
2.8 |
GO:0051608 |
histamine transport(GO:0051608) |
| 0.9 |
1.9 |
GO:0035020 |
regulation of Rac protein signal transduction(GO:0035020) |
| 0.9 |
3.7 |
GO:1903416 |
response to glycoside(GO:1903416) |
| 0.9 |
3.7 |
GO:0061188 |
regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.9 |
3.7 |
GO:0014835 |
myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.9 |
0.9 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.9 |
2.7 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.9 |
2.7 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.9 |
0.9 |
GO:0090467 |
L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
| 0.9 |
2.7 |
GO:0072429 |
response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.9 |
4.5 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.9 |
7.1 |
GO:0030174 |
regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.9 |
0.9 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.9 |
8.9 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.9 |
0.9 |
GO:0060298 |
positive regulation of sarcomere organization(GO:0060298) |
| 0.9 |
6.2 |
GO:0061032 |
visceral serous pericardium development(GO:0061032) |
| 0.9 |
2.7 |
GO:1903896 |
positive regulation of IRE1-mediated unfolded protein response(GO:1903896) |
| 0.9 |
1.8 |
GO:0006760 |
folic acid-containing compound metabolic process(GO:0006760) |
| 0.9 |
2.6 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.9 |
2.6 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 0.9 |
2.6 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.9 |
3.5 |
GO:0015744 |
succinate transport(GO:0015744) |
| 0.9 |
2.6 |
GO:0021984 |
adenohypophysis development(GO:0021984) |
| 0.9 |
0.9 |
GO:0032760 |
positive regulation of tumor necrosis factor production(GO:0032760) positive regulation of tumor necrosis factor superfamily cytokine production(GO:1903557) |
| 0.9 |
2.6 |
GO:0038165 |
oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.9 |
4.3 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.9 |
3.4 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.8 |
8.5 |
GO:0040037 |
negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.8 |
2.5 |
GO:0072137 |
condensed mesenchymal cell proliferation(GO:0072137) |
| 0.8 |
2.5 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) |
| 0.8 |
2.5 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.8 |
5.9 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.8 |
2.5 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.8 |
3.3 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 0.8 |
4.2 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.8 |
3.3 |
GO:0090336 |
positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.8 |
0.8 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.8 |
1.7 |
GO:1902219 |
regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.8 |
1.7 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.8 |
4.1 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.8 |
9.1 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 0.8 |
6.6 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.8 |
7.4 |
GO:0010766 |
negative regulation of sodium ion transport(GO:0010766) |
| 0.8 |
6.5 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.8 |
4.1 |
GO:0060623 |
regulation of chromosome condensation(GO:0060623) |
| 0.8 |
3.2 |
GO:1900145 |
regulation of nodal signaling pathway involved in determination of left/right asymmetry(GO:1900145) regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900175) positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) positive regulation of mesoderm development(GO:2000382) |
| 0.8 |
4.0 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.8 |
4.0 |
GO:0042997 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.8 |
1.6 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.8 |
4.8 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.8 |
0.8 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.8 |
3.2 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 0.8 |
6.3 |
GO:0033631 |
cell-cell adhesion mediated by integrin(GO:0033631) |
| 0.8 |
4.7 |
GO:0046909 |
intermembrane transport(GO:0046909) |
| 0.8 |
5.5 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.8 |
1.6 |
GO:1903378 |
positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.8 |
4.7 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.8 |
1.6 |
GO:0002088 |
lens development in camera-type eye(GO:0002088) |
| 0.8 |
7.8 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.8 |
7.8 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.8 |
3.1 |
GO:0060161 |
positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.8 |
2.3 |
GO:0097278 |
complement-dependent cytotoxicity(GO:0097278) |
| 0.8 |
1.5 |
GO:0060166 |
olfactory pit development(GO:0060166) |
| 0.8 |
4.6 |
GO:0002072 |
optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.8 |
0.8 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 0.8 |
1.5 |
GO:0000087 |
mitotic M phase(GO:0000087) |
| 0.8 |
0.8 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.8 |
1.5 |
GO:0071680 |
response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.8 |
9.9 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.8 |
2.3 |
GO:0019343 |
cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 0.8 |
2.3 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.7 |
3.0 |
GO:0045053 |
protein retention in Golgi apparatus(GO:0045053) |
| 0.7 |
7.5 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.7 |
11.2 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.7 |
0.7 |
GO:1902947 |
regulation of tau-protein kinase activity(GO:1902947) |
| 0.7 |
2.2 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.7 |
17.1 |
GO:0071539 |
protein localization to centrosome(GO:0071539) |
| 0.7 |
5.2 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.7 |
1.5 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 0.7 |
3.7 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.7 |
2.2 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.7 |
3.6 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.7 |
2.2 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.7 |
5.7 |
GO:0006477 |
protein sulfation(GO:0006477) |
| 0.7 |
2.1 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.7 |
2.1 |
GO:0045404 |
positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.7 |
2.1 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.7 |
1.4 |
GO:0003419 |
growth plate cartilage chondrocyte proliferation(GO:0003419) |
| 0.7 |
7.8 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.7 |
2.1 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.7 |
15.5 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.7 |
1.4 |
GO:0071599 |
otic vesicle development(GO:0071599) |
| 0.7 |
0.7 |
GO:2000823 |
regulation of androgen receptor activity(GO:2000823) |
| 0.7 |
4.1 |
GO:0009786 |
regulation of asymmetric cell division(GO:0009786) |
| 0.7 |
2.1 |
GO:0061687 |
detoxification of inorganic compound(GO:0061687) |
| 0.7 |
2.1 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.7 |
6.9 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.7 |
2.7 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.7 |
1.4 |
GO:0034372 |
very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.7 |
2.0 |
GO:1902528 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.7 |
1.4 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.7 |
3.4 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.7 |
4.1 |
GO:0090244 |
Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.7 |
3.4 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.7 |
6.8 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.7 |
2.0 |
GO:0010899 |
regulation of phosphatidylcholine catabolic process(GO:0010899) |
| 0.7 |
8.7 |
GO:0002089 |
lens morphogenesis in camera-type eye(GO:0002089) |
| 0.7 |
3.3 |
GO:0015871 |
choline transport(GO:0015871) |
| 0.7 |
1.3 |
GO:0051295 |
establishment of meiotic spindle localization(GO:0051295) |
| 0.7 |
8.6 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.7 |
0.7 |
GO:0006681 |
galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.7 |
2.0 |
GO:0043201 |
response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.7 |
3.3 |
GO:0015788 |
UDP-N-acetylglucosamine transport(GO:0015788) |
| 0.7 |
2.0 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.7 |
3.3 |
GO:0045724 |
positive regulation of cilium assembly(GO:0045724) |
| 0.7 |
1.3 |
GO:0014842 |
regulation of skeletal muscle satellite cell proliferation(GO:0014842) |
| 0.6 |
3.9 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.6 |
9.7 |
GO:0060236 |
regulation of mitotic spindle organization(GO:0060236) |
| 0.6 |
4.5 |
GO:0035459 |
cargo loading into vesicle(GO:0035459) |
| 0.6 |
3.2 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.6 |
0.6 |
GO:0061502 |
early endosome to recycling endosome transport(GO:0061502) |
| 0.6 |
2.6 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.6 |
3.2 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.6 |
1.9 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.6 |
1.9 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.6 |
1.3 |
GO:0002842 |
T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) positive regulation of T cell mediated immune response to tumor cell(GO:0002842) |
| 0.6 |
3.2 |
GO:0071168 |
protein localization to chromatin(GO:0071168) |
| 0.6 |
3.2 |
GO:0006207 |
'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.6 |
6.9 |
GO:0071459 |
protein localization to chromosome, centromeric region(GO:0071459) |
| 0.6 |
1.9 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 0.6 |
2.5 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.6 |
1.3 |
GO:0007351 |
tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.6 |
1.9 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.6 |
1.9 |
GO:0072223 |
metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
| 0.6 |
1.2 |
GO:0018027 |
peptidyl-lysine dimethylation(GO:0018027) |
| 0.6 |
2.5 |
GO:0060032 |
smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) notochord regression(GO:0060032) |
| 0.6 |
1.9 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.6 |
3.7 |
GO:0046060 |
dATP metabolic process(GO:0046060) |
| 0.6 |
0.6 |
GO:0060385 |
axonogenesis involved in innervation(GO:0060385) |
| 0.6 |
1.2 |
GO:0002069 |
columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.6 |
3.1 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.6 |
3.1 |
GO:2000780 |
negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
| 0.6 |
3.1 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.6 |
3.1 |
GO:0046666 |
retinal cell programmed cell death(GO:0046666) |
| 0.6 |
0.6 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.6 |
1.2 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 0.6 |
2.4 |
GO:0070425 |
regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 0.6 |
1.2 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.6 |
0.6 |
GO:0039536 |
negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.6 |
3.0 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.6 |
1.8 |
GO:0033860 |
regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.6 |
2.4 |
GO:0043974 |
histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.6 |
2.9 |
GO:0032460 |
negative regulation of protein oligomerization(GO:0032460) negative regulation of protein homooligomerization(GO:0032463) |
| 0.6 |
1.8 |
GO:2000416 |
regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
| 0.6 |
3.5 |
GO:0042590 |
antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.6 |
4.7 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.6 |
5.3 |
GO:0060068 |
vagina development(GO:0060068) |
| 0.6 |
1.8 |
GO:0033030 |
negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.6 |
1.8 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.6 |
2.9 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.6 |
2.3 |
GO:0048853 |
forebrain morphogenesis(GO:0048853) |
| 0.6 |
7.6 |
GO:0035751 |
regulation of lysosomal lumen pH(GO:0035751) |
| 0.6 |
2.9 |
GO:1902916 |
positive regulation of protein polyubiquitination(GO:1902916) |
| 0.6 |
2.9 |
GO:0019254 |
carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.6 |
1.2 |
GO:0043696 |
dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.6 |
3.4 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.6 |
2.3 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 0.6 |
0.6 |
GO:2001046 |
positive regulation of integrin-mediated signaling pathway(GO:2001046) |
| 0.6 |
6.8 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.6 |
2.8 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.6 |
17.6 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.6 |
1.7 |
GO:1901552 |
positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.6 |
1.1 |
GO:0070936 |
protein K48-linked ubiquitination(GO:0070936) |
| 0.6 |
1.7 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.6 |
0.6 |
GO:0046476 |
glycosylceramide biosynthetic process(GO:0046476) |
| 0.6 |
1.1 |
GO:2000427 |
regulation of apoptotic cell clearance(GO:2000425) positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.6 |
1.7 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.6 |
0.6 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.6 |
1.1 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.6 |
3.3 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.6 |
2.2 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.6 |
3.3 |
GO:0000733 |
DNA strand renaturation(GO:0000733) |
| 0.5 |
1.1 |
GO:0060971 |
embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.5 |
3.3 |
GO:0002467 |
germinal center formation(GO:0002467) |
| 0.5 |
1.1 |
GO:1905154 |
negative regulation of tumor necrosis factor secretion(GO:1904468) negative regulation of membrane invagination(GO:1905154) |
| 0.5 |
7.6 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.5 |
0.5 |
GO:0070172 |
positive regulation of tooth mineralization(GO:0070172) |
| 0.5 |
3.3 |
GO:0040036 |
regulation of fibroblast growth factor receptor signaling pathway(GO:0040036) |
| 0.5 |
1.6 |
GO:0072675 |
osteoclast fusion(GO:0072675) |
| 0.5 |
3.8 |
GO:0045830 |
positive regulation of isotype switching(GO:0045830) |
| 0.5 |
5.9 |
GO:0009191 |
ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.5 |
1.6 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.5 |
1.6 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.5 |
1.1 |
GO:0070427 |
nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.5 |
2.1 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.5 |
1.1 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.5 |
2.7 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.5 |
2.7 |
GO:2000680 |
regulation of rubidium ion transport(GO:2000680) |
| 0.5 |
11.2 |
GO:0009065 |
glutamine family amino acid catabolic process(GO:0009065) |
| 0.5 |
7.9 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.5 |
2.1 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.5 |
1.6 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 0.5 |
4.7 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.5 |
3.2 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.5 |
1.0 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.5 |
1.0 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.5 |
2.1 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.5 |
4.2 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.5 |
4.7 |
GO:0039529 |
RIG-I signaling pathway(GO:0039529) |
| 0.5 |
1.0 |
GO:0045656 |
negative regulation of monocyte differentiation(GO:0045656) |
| 0.5 |
15.1 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.5 |
2.6 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.5 |
3.1 |
GO:0098700 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.5 |
1.0 |
GO:1904569 |
regulation of selenocysteine incorporation(GO:1904569) |
| 0.5 |
1.5 |
GO:0009812 |
flavonoid metabolic process(GO:0009812) flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.5 |
0.5 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.5 |
2.5 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.5 |
2.0 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.5 |
2.5 |
GO:0051292 |
nuclear pore complex assembly(GO:0051292) |
| 0.5 |
1.5 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.5 |
0.5 |
GO:0071635 |
negative regulation of transforming growth factor beta1 production(GO:0032911) negative regulation of transforming growth factor beta production(GO:0071635) |
| 0.5 |
2.5 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.5 |
3.0 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) |
| 0.5 |
2.5 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.5 |
1.0 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.5 |
1.0 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.5 |
3.5 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.5 |
1.5 |
GO:1900147 |
Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.5 |
2.0 |
GO:0022027 |
interkinetic nuclear migration(GO:0022027) |
| 0.5 |
2.0 |
GO:1902965 |
regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.5 |
1.0 |
GO:0051660 |
cortical microtubule organization(GO:0043622) establishment of centrosome localization(GO:0051660) |
| 0.5 |
1.0 |
GO:0051036 |
regulation of endosome size(GO:0051036) |
| 0.5 |
2.5 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.5 |
3.9 |
GO:0006977 |
DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.5 |
1.5 |
GO:0006507 |
GPI anchor release(GO:0006507) |
| 0.5 |
1.5 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.5 |
2.4 |
GO:0097341 |
inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.5 |
0.5 |
GO:0072235 |
distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
| 0.5 |
5.3 |
GO:0018342 |
protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.5 |
3.4 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.5 |
9.6 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.5 |
1.0 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.5 |
3.8 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.5 |
1.4 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.5 |
3.3 |
GO:0051382 |
kinetochore assembly(GO:0051382) |
| 0.5 |
5.6 |
GO:0090005 |
negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.5 |
2.8 |
GO:0033601 |
positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.5 |
1.4 |
GO:0000059 |
protein import into nucleus, docking(GO:0000059) |
| 0.5 |
3.7 |
GO:0003062 |
regulation of heart rate by chemical signal(GO:0003062) |
| 0.5 |
4.2 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.5 |
0.9 |
GO:0060158 |
phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.5 |
1.4 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.5 |
0.9 |
GO:0046835 |
carbohydrate phosphorylation(GO:0046835) |
| 0.5 |
0.5 |
GO:0071910 |
determination of liver left/right asymmetry(GO:0071910) |
| 0.5 |
1.8 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.5 |
10.5 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.5 |
1.4 |
GO:0032962 |
positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 0.5 |
1.4 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.5 |
0.9 |
GO:0043619 |
regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.5 |
0.9 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.5 |
1.8 |
GO:0006338 |
chromatin remodeling(GO:0006338) |
| 0.5 |
1.4 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.5 |
0.5 |
GO:0010666 |
positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.4 |
2.7 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.4 |
2.2 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.4 |
7.1 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.4 |
1.8 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 0.4 |
4.4 |
GO:0045040 |
protein import into mitochondrial outer membrane(GO:0045040) |
| 0.4 |
0.9 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.4 |
0.4 |
GO:0035050 |
embryonic heart tube development(GO:0035050) |
| 0.4 |
0.9 |
GO:0006590 |
thyroid hormone generation(GO:0006590) |
| 0.4 |
5.3 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.4 |
1.3 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.4 |
0.9 |
GO:0050847 |
progesterone receptor signaling pathway(GO:0050847) |
| 0.4 |
0.9 |
GO:0046622 |
positive regulation of organ growth(GO:0046622) |
| 0.4 |
1.3 |
GO:0032058 |
positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.4 |
0.9 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.4 |
1.7 |
GO:0007039 |
protein catabolic process in the vacuole(GO:0007039) |
| 0.4 |
3.9 |
GO:0061085 |
regulation of histone H3-K27 methylation(GO:0061085) |
| 0.4 |
1.3 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.4 |
0.4 |
GO:0002538 |
arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 0.4 |
0.9 |
GO:0097094 |
craniofacial suture morphogenesis(GO:0097094) |
| 0.4 |
1.3 |
GO:0035511 |
oxidative DNA demethylation(GO:0035511) |
| 0.4 |
3.4 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.4 |
3.8 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.4 |
0.4 |
GO:0002309 |
T cell proliferation involved in immune response(GO:0002309) |
| 0.4 |
3.4 |
GO:0009125 |
nucleoside monophosphate catabolic process(GO:0009125) |
| 0.4 |
0.8 |
GO:0060455 |
regulation of gastric acid secretion(GO:0060453) negative regulation of gastric acid secretion(GO:0060455) positive regulation of somatostatin secretion(GO:0090274) |
| 0.4 |
1.3 |
GO:0070120 |
brainstem development(GO:0003360) ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.4 |
2.9 |
GO:0090103 |
cochlea morphogenesis(GO:0090103) |
| 0.4 |
1.3 |
GO:0051031 |
tRNA transport(GO:0051031) |
| 0.4 |
1.3 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.4 |
2.1 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.4 |
13.7 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.4 |
2.5 |
GO:0006152 |
purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.4 |
5.0 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.4 |
3.3 |
GO:0030238 |
male sex determination(GO:0030238) |
| 0.4 |
1.6 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.4 |
0.8 |
GO:0043366 |
beta selection(GO:0043366) |
| 0.4 |
5.7 |
GO:0033687 |
osteoblast proliferation(GO:0033687) |
| 0.4 |
4.1 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.4 |
1.2 |
GO:0090199 |
regulation of release of cytochrome c from mitochondria(GO:0090199) |
| 0.4 |
2.9 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) |
| 0.4 |
0.4 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.4 |
0.8 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.4 |
0.8 |
GO:0007342 |
fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.4 |
0.4 |
GO:0035405 |
histone-threonine phosphorylation(GO:0035405) |
| 0.4 |
6.4 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.4 |
1.2 |
GO:0019372 |
lipoxygenase pathway(GO:0019372) |
| 0.4 |
4.0 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.4 |
0.8 |
GO:0010455 |
positive regulation of cell fate commitment(GO:0010455) |
| 0.4 |
1.2 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.4 |
5.5 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.4 |
4.3 |
GO:0060712 |
spongiotrophoblast layer development(GO:0060712) |
| 0.4 |
20.9 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.4 |
1.2 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.4 |
2.4 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.4 |
2.0 |
GO:1904721 |
regulation of mRNA cleavage(GO:0031437) negative regulation of mRNA cleavage(GO:0031438) negative regulation of immunoglobulin secretion(GO:0051025) negative regulation of ribonuclease activity(GO:0060701) negative regulation of endoribonuclease activity(GO:0060702) regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904720) negative regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904721) |
| 0.4 |
2.3 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.4 |
0.8 |
GO:1902065 |
response to L-glutamate(GO:1902065) |
| 0.4 |
4.3 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.4 |
2.7 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.4 |
1.2 |
GO:2000768 |
glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.4 |
1.5 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.4 |
1.2 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.4 |
0.4 |
GO:0051541 |
elastin metabolic process(GO:0051541) |
| 0.4 |
1.9 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.4 |
2.3 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.4 |
0.8 |
GO:0090335 |
regulation of brown fat cell differentiation(GO:0090335) |
| 0.4 |
0.8 |
GO:0002176 |
male germ cell proliferation(GO:0002176) |
| 0.4 |
7.2 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.4 |
2.3 |
GO:0090205 |
positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.4 |
1.5 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.4 |
1.9 |
GO:0036120 |
cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.4 |
0.4 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.4 |
1.5 |
GO:0051790 |
short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.4 |
6.0 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.4 |
1.9 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.4 |
0.4 |
GO:0043173 |
nucleotide salvage(GO:0043173) |
| 0.4 |
5.2 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.4 |
0.4 |
GO:0045618 |
positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.4 |
1.1 |
GO:0070889 |
platelet alpha granule organization(GO:0070889) |
| 0.4 |
1.1 |
GO:0006428 |
isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.4 |
2.6 |
GO:0061436 |
establishment of skin barrier(GO:0061436) |
| 0.4 |
10.0 |
GO:0035329 |
hippo signaling(GO:0035329) |
| 0.4 |
0.4 |
GO:0048539 |
bone marrow development(GO:0048539) |
| 0.4 |
1.5 |
GO:0035188 |
blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.4 |
0.7 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.4 |
1.8 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.4 |
0.7 |
GO:0000050 |
urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 0.4 |
1.5 |
GO:0071047 |
nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.4 |
5.5 |
GO:0042178 |
xenobiotic catabolic process(GO:0042178) |
| 0.4 |
2.5 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.4 |
0.7 |
GO:0061029 |
eyelid development in camera-type eye(GO:0061029) |
| 0.4 |
4.3 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.4 |
0.7 |
GO:0051770 |
positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.4 |
1.1 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.4 |
1.1 |
GO:0097461 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.4 |
0.7 |
GO:0070474 |
positive regulation of uterine smooth muscle contraction(GO:0070474) |
| 0.4 |
2.5 |
GO:0018126 |
protein hydroxylation(GO:0018126) |
| 0.4 |
4.6 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.4 |
0.4 |
GO:0035337 |
fatty-acyl-CoA metabolic process(GO:0035337) |
| 0.4 |
0.4 |
GO:0006702 |
androgen biosynthetic process(GO:0006702) |
| 0.4 |
3.5 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 0.4 |
1.8 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.4 |
1.1 |
GO:0070166 |
enamel mineralization(GO:0070166) |
| 0.4 |
1.4 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.3 |
2.4 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.3 |
0.3 |
GO:0070365 |
hepatocyte differentiation(GO:0070365) |
| 0.3 |
0.7 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.3 |
0.7 |
GO:0021794 |
thalamus development(GO:0021794) |
| 0.3 |
0.7 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.3 |
0.3 |
GO:1903779 |
regulation of cardiac conduction(GO:1903779) |
| 0.3 |
0.7 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.3 |
2.1 |
GO:0036035 |
osteoclast development(GO:0036035) |
| 0.3 |
5.5 |
GO:1900087 |
positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.3 |
1.4 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.3 |
1.7 |
GO:0006699 |
bile acid biosynthetic process(GO:0006699) |
| 0.3 |
1.0 |
GO:0035973 |
aggrephagy(GO:0035973) |
| 0.3 |
2.4 |
GO:2000124 |
regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.3 |
2.7 |
GO:0019471 |
4-hydroxyproline metabolic process(GO:0019471) |
| 0.3 |
3.0 |
GO:0006085 |
acetyl-CoA biosynthetic process(GO:0006085) |
| 0.3 |
2.4 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.3 |
1.0 |
GO:0032066 |
nucleolus to nucleoplasm transport(GO:0032066) |
| 0.3 |
0.3 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.3 |
0.3 |
GO:0006999 |
nuclear pore organization(GO:0006999) |
| 0.3 |
1.3 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.3 |
1.0 |
GO:0032918 |
polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.3 |
0.3 |
GO:0090086 |
negative regulation of protein deubiquitination(GO:0090086) |
| 0.3 |
1.0 |
GO:0030210 |
heparin biosynthetic process(GO:0030210) |
| 0.3 |
2.0 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.3 |
2.0 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.3 |
1.0 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.3 |
0.3 |
GO:0001928 |
regulation of exocyst assembly(GO:0001928) |
| 0.3 |
2.0 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.3 |
1.6 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.3 |
1.3 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.3 |
6.5 |
GO:0000303 |
response to superoxide(GO:0000303) |
| 0.3 |
2.6 |
GO:0048706 |
embryonic skeletal system development(GO:0048706) |
| 0.3 |
0.3 |
GO:1903750 |
regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.3 |
1.6 |
GO:0002667 |
lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.3 |
2.6 |
GO:0061084 |
regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) regulation of protein folding(GO:1903332) negative regulation of protein folding(GO:1903333) |
| 0.3 |
1.6 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.3 |
1.3 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.3 |
2.2 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.3 |
1.6 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.3 |
1.9 |
GO:0008334 |
histone mRNA metabolic process(GO:0008334) |
| 0.3 |
3.2 |
GO:0048385 |
regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 0.3 |
9.5 |
GO:0034314 |
Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.3 |
1.0 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.3 |
0.9 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.3 |
2.5 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.3 |
0.9 |
GO:0070213 |
protein auto-ADP-ribosylation(GO:0070213) |
| 0.3 |
3.4 |
GO:0045943 |
positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.3 |
0.3 |
GO:0090403 |
oxidative stress-induced premature senescence(GO:0090403) positive regulation of skeletal muscle cell differentiation(GO:2001016) |
| 0.3 |
2.2 |
GO:0000055 |
ribosomal large subunit export from nucleus(GO:0000055) |
| 0.3 |
0.3 |
GO:0071865 |
regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.3 |
0.9 |
GO:0072205 |
metanephric collecting duct development(GO:0072205) |
| 0.3 |
0.6 |
GO:0071542 |
dopaminergic neuron differentiation(GO:0071542) |
| 0.3 |
2.1 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.3 |
3.4 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.3 |
3.3 |
GO:0070571 |
negative regulation of neuron projection regeneration(GO:0070571) |
| 0.3 |
1.8 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.3 |
0.6 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.3 |
0.9 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.3 |
1.2 |
GO:0002901 |
mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.3 |
0.3 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.3 |
2.1 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.3 |
0.9 |
GO:0031590 |
wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
| 0.3 |
3.6 |
GO:0000244 |
spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.3 |
0.9 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.3 |
5.7 |
GO:0046596 |
regulation of viral entry into host cell(GO:0046596) |
| 0.3 |
0.6 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.3 |
0.9 |
GO:0016598 |
protein arginylation(GO:0016598) |
| 0.3 |
0.6 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 0.3 |
0.9 |
GO:0043967 |
histone H4 acetylation(GO:0043967) |
| 0.3 |
0.6 |
GO:0002678 |
positive regulation of chronic inflammatory response(GO:0002678) |
| 0.3 |
0.3 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 0.3 |
0.6 |
GO:1902166 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.3 |
2.6 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.3 |
2.1 |
GO:0007263 |
nitric oxide mediated signal transduction(GO:0007263) |
| 0.3 |
2.9 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.3 |
0.9 |
GO:0010814 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.3 |
1.8 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.3 |
0.6 |
GO:0050872 |
white fat cell differentiation(GO:0050872) |
| 0.3 |
1.2 |
GO:0034383 |
low-density lipoprotein particle clearance(GO:0034383) |
| 0.3 |
1.2 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.3 |
0.9 |
GO:0042822 |
vitamin B6 metabolic process(GO:0042816) pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.3 |
0.6 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.3 |
0.9 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.3 |
0.9 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.3 |
8.7 |
GO:0000470 |
maturation of LSU-rRNA(GO:0000470) |
| 0.3 |
2.6 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.3 |
3.4 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.3 |
0.9 |
GO:0060050 |
positive regulation of protein glycosylation(GO:0060050) |
| 0.3 |
6.3 |
GO:0042633 |
molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.3 |
1.1 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.3 |
2.6 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.3 |
1.7 |
GO:0036066 |
protein O-linked fucosylation(GO:0036066) |
| 0.3 |
0.3 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.3 |
0.3 |
GO:2000832 |
negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.3 |
0.8 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.3 |
0.8 |
GO:0080111 |
DNA demethylation(GO:0080111) |
| 0.3 |
0.3 |
GO:0070989 |
oxidative demethylation(GO:0070989) |
| 0.3 |
1.1 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.3 |
2.8 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.3 |
1.9 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.3 |
0.6 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.3 |
5.5 |
GO:0034724 |
DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.3 |
2.5 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.3 |
7.6 |
GO:0008156 |
negative regulation of DNA replication(GO:0008156) |
| 0.3 |
3.3 |
GO:0031297 |
replication fork processing(GO:0031297) DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.3 |
2.4 |
GO:0097150 |
neuronal stem cell population maintenance(GO:0097150) |
| 0.3 |
4.1 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.3 |
1.1 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.3 |
0.5 |
GO:1901896 |
positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.3 |
1.1 |
GO:1902224 |
cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.3 |
3.8 |
GO:0006298 |
mismatch repair(GO:0006298) |
| 0.3 |
0.5 |
GO:0060252 |
positive regulation of glial cell proliferation(GO:0060252) |
| 0.3 |
1.1 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.3 |
7.5 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.3 |
0.8 |
GO:0060903 |
regulation of meiosis I(GO:0060631) positive regulation of meiosis I(GO:0060903) |
| 0.3 |
0.8 |
GO:0006030 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.3 |
6.4 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.3 |
2.9 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.3 |
1.3 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.3 |
4.2 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.3 |
7.4 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.3 |
0.3 |
GO:0010829 |
negative regulation of glucose transport(GO:0010829) negative regulation of glucose import(GO:0046325) |
| 0.3 |
1.1 |
GO:0032508 |
DNA duplex unwinding(GO:0032508) |
| 0.3 |
0.8 |
GO:0016540 |
protein autoprocessing(GO:0016540) |
| 0.3 |
1.3 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.3 |
2.1 |
GO:0006309 |
DNA catabolic process, endonucleolytic(GO:0000737) apoptotic DNA fragmentation(GO:0006309) |
| 0.3 |
3.4 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.3 |
0.3 |
GO:0051599 |
response to hydrostatic pressure(GO:0051599) |
| 0.3 |
5.2 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.3 |
0.5 |
GO:0060462 |
lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
| 0.3 |
0.5 |
GO:0003203 |
endocardial cushion morphogenesis(GO:0003203) |
| 0.3 |
0.8 |
GO:0015014 |
heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.3 |
0.8 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.3 |
1.3 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.3 |
1.8 |
GO:0051895 |
negative regulation of focal adhesion assembly(GO:0051895) |
| 0.3 |
1.5 |
GO:0060457 |
negative regulation of digestive system process(GO:0060457) |
| 0.3 |
0.8 |
GO:1905049 |
negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
| 0.3 |
10.5 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.3 |
1.0 |
GO:0002063 |
chondrocyte development(GO:0002063) |
| 0.3 |
8.3 |
GO:0005978 |
glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.3 |
0.3 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 0.3 |
0.3 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.3 |
0.8 |
GO:0045974 |
miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.3 |
2.5 |
GO:0050860 |
negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.3 |
2.5 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.3 |
1.5 |
GO:2000678 |
negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.2 |
6.5 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.2 |
0.5 |
GO:0034238 |
macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) |
| 0.2 |
0.7 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.2 |
24.4 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.2 |
0.5 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.2 |
1.2 |
GO:0007100 |
mitotic centrosome separation(GO:0007100) |
| 0.2 |
0.5 |
GO:0016078 |
tRNA catabolic process(GO:0016078) |
| 0.2 |
1.0 |
GO:0035584 |
calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.2 |
1.0 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.2 |
3.2 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.2 |
2.7 |
GO:0045663 |
positive regulation of myoblast differentiation(GO:0045663) |
| 0.2 |
0.5 |
GO:0060192 |
negative regulation of lipase activity(GO:0060192) |
| 0.2 |
0.2 |
GO:0040019 |
positive regulation of embryonic development(GO:0040019) |
| 0.2 |
1.2 |
GO:0006930 |
substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.2 |
0.5 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.2 |
0.7 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.2 |
1.5 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.2 |
1.7 |
GO:0032332 |
positive regulation of chondrocyte differentiation(GO:0032332) |
| 0.2 |
5.1 |
GO:0035567 |
non-canonical Wnt signaling pathway(GO:0035567) |
| 0.2 |
0.2 |
GO:1901976 |
regulation of cell cycle checkpoint(GO:1901976) |
| 0.2 |
1.0 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.2 |
1.0 |
GO:0044565 |
dendritic cell proliferation(GO:0044565) |
| 0.2 |
1.2 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.2 |
2.4 |
GO:2000009 |
negative regulation of protein localization to cell surface(GO:2000009) |
| 0.2 |
1.0 |
GO:1904714 |
chaperone-mediated autophagy(GO:0061684) regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.2 |
0.5 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.2 |
7.7 |
GO:0031016 |
pancreas development(GO:0031016) |
| 0.2 |
0.2 |
GO:0042518 |
negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.2 |
0.7 |
GO:0000098 |
sulfur amino acid catabolic process(GO:0000098) |
| 0.2 |
1.0 |
GO:0010288 |
response to lead ion(GO:0010288) |
| 0.2 |
3.8 |
GO:0061371 |
determination of heart left/right asymmetry(GO:0061371) |
| 0.2 |
4.5 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.2 |
0.9 |
GO:0032788 |
saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.2 |
0.5 |
GO:0035106 |
operant conditioning(GO:0035106) |
| 0.2 |
0.7 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.2 |
0.9 |
GO:1904031 |
positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.2 |
0.2 |
GO:1903337 |
positive regulation of vacuolar transport(GO:1903337) |
| 0.2 |
0.5 |
GO:0031397 |
negative regulation of protein ubiquitination(GO:0031397) |
| 0.2 |
5.4 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.2 |
0.5 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.2 |
1.2 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.2 |
2.1 |
GO:0034377 |
plasma lipoprotein particle assembly(GO:0034377) |
| 0.2 |
2.8 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.2 |
2.3 |
GO:2000191 |
regulation of fatty acid transport(GO:2000191) |
| 0.2 |
2.8 |
GO:0006654 |
phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
| 0.2 |
3.0 |
GO:0051881 |
regulation of mitochondrial membrane potential(GO:0051881) |
| 0.2 |
2.5 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.2 |
0.5 |
GO:0006558 |
L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
| 0.2 |
0.5 |
GO:0046077 |
dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate metabolic process(GO:0009138) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.2 |
0.5 |
GO:0097186 |
amelogenesis(GO:0097186) |
| 0.2 |
2.7 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.2 |
0.9 |
GO:0061002 |
negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.2 |
0.4 |
GO:0000966 |
RNA 5'-end processing(GO:0000966) |
| 0.2 |
1.1 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.2 |
1.1 |
GO:0046885 |
regulation of hormone biosynthetic process(GO:0046885) |
| 0.2 |
1.8 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.2 |
2.9 |
GO:0046033 |
AMP metabolic process(GO:0046033) |
| 0.2 |
1.5 |
GO:0060297 |
regulation of sarcomere organization(GO:0060297) |
| 0.2 |
2.0 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.2 |
3.3 |
GO:0019432 |
triglyceride biosynthetic process(GO:0019432) |
| 0.2 |
0.4 |
GO:0007143 |
female meiotic division(GO:0007143) |
| 0.2 |
0.4 |
GO:0042760 |
very long-chain fatty acid catabolic process(GO:0042760) |
| 0.2 |
0.7 |
GO:0048680 |
positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
| 0.2 |
5.8 |
GO:0006493 |
protein O-linked glycosylation(GO:0006493) |
| 0.2 |
2.6 |
GO:0015825 |
L-serine transport(GO:0015825) |
| 0.2 |
0.4 |
GO:0030321 |
transepithelial chloride transport(GO:0030321) |
| 0.2 |
0.6 |
GO:0007341 |
penetration of zona pellucida(GO:0007341) |
| 0.2 |
1.1 |
GO:1900027 |
regulation of ruffle assembly(GO:1900027) |
| 0.2 |
3.6 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.2 |
1.7 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.2 |
0.6 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.2 |
1.5 |
GO:0071166 |
ribonucleoprotein complex localization(GO:0071166) |
| 0.2 |
1.9 |
GO:0048665 |
neuron fate specification(GO:0048665) |
| 0.2 |
0.2 |
GO:0097067 |
cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.2 |
0.4 |
GO:0002572 |
pro-T cell differentiation(GO:0002572) |
| 0.2 |
0.6 |
GO:0010944 |
negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.2 |
3.6 |
GO:0001658 |
branching involved in ureteric bud morphogenesis(GO:0001658) |
| 0.2 |
0.6 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.2 |
0.6 |
GO:0001732 |
formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.2 |
2.9 |
GO:0035136 |
forelimb morphogenesis(GO:0035136) |
| 0.2 |
0.4 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.2 |
1.0 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.2 |
2.1 |
GO:0006048 |
UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.2 |
0.8 |
GO:0045541 |
negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.2 |
0.6 |
GO:2000674 |
regulation of type B pancreatic cell apoptotic process(GO:2000674) |
| 0.2 |
8.6 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.2 |
0.8 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.2 |
0.2 |
GO:0060718 |
chorionic trophoblast cell differentiation(GO:0060718) |
| 0.2 |
0.2 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.2 |
1.6 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.2 |
1.0 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.2 |
4.3 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.2 |
2.0 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.2 |
0.2 |
GO:2000668 |
dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
| 0.2 |
0.6 |
GO:0003338 |
metanephros morphogenesis(GO:0003338) |
| 0.2 |
0.8 |
GO:1903288 |
regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
| 0.2 |
0.6 |
GO:0050747 |
positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.2 |
0.6 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.2 |
1.2 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.2 |
1.0 |
GO:0070102 |
interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.2 |
2.0 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.2 |
2.4 |
GO:1904293 |
negative regulation of ERAD pathway(GO:1904293) |
| 0.2 |
0.4 |
GO:1904738 |
vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.2 |
2.2 |
GO:0001967 |
suckling behavior(GO:0001967) |
| 0.2 |
1.0 |
GO:0015810 |
C4-dicarboxylate transport(GO:0015740) aspartate transport(GO:0015810) |
| 0.2 |
0.2 |
GO:0080182 |
histone H3-K4 trimethylation(GO:0080182) |
| 0.2 |
0.6 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.2 |
0.8 |
GO:0019348 |
dolichol metabolic process(GO:0019348) |
| 0.2 |
0.8 |
GO:0070070 |
proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 |
0.8 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.2 |
3.5 |
GO:0007566 |
embryo implantation(GO:0007566) |
| 0.2 |
1.0 |
GO:0002121 |
inter-male aggressive behavior(GO:0002121) |
| 0.2 |
1.5 |
GO:0070884 |
regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.2 |
0.6 |
GO:1903215 |
negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.2 |
0.6 |
GO:0032049 |
cardiolipin biosynthetic process(GO:0032049) |
| 0.2 |
1.5 |
GO:0031065 |
positive regulation of histone deacetylation(GO:0031065) |
| 0.2 |
1.7 |
GO:2000779 |
regulation of double-strand break repair(GO:2000779) |
| 0.2 |
1.5 |
GO:0071801 |
regulation of podosome assembly(GO:0071801) |
| 0.2 |
1.9 |
GO:0043982 |
histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.2 |
0.8 |
GO:0072344 |
rescue of stalled ribosome(GO:0072344) |
| 0.2 |
4.5 |
GO:0035307 |
positive regulation of protein dephosphorylation(GO:0035307) |
| 0.2 |
0.9 |
GO:2000270 |
negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.2 |
0.6 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.2 |
1.3 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.2 |
2.1 |
GO:0006693 |
prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.2 |
3.4 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.2 |
0.9 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.2 |
0.9 |
GO:0006104 |
succinyl-CoA metabolic process(GO:0006104) |
| 0.2 |
0.6 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.2 |
2.6 |
GO:0044819 |
mitotic G1/S transition checkpoint(GO:0044819) |
| 0.2 |
1.9 |
GO:0032967 |
positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.2 |
2.0 |
GO:0008272 |
sulfate transport(GO:0008272) |
| 0.2 |
0.4 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.2 |
5.7 |
GO:0016126 |
sterol biosynthetic process(GO:0016126) |
| 0.2 |
2.2 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.2 |
0.2 |
GO:0006501 |
C-terminal protein lipidation(GO:0006501) |
| 0.2 |
0.4 |
GO:0006312 |
mitotic recombination(GO:0006312) |
| 0.2 |
5.4 |
GO:0071230 |
cellular response to amino acid stimulus(GO:0071230) |
| 0.2 |
0.4 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.2 |
0.4 |
GO:0071879 |
positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.2 |
0.9 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 |
0.5 |
GO:0048211 |
Golgi vesicle docking(GO:0048211) |
| 0.2 |
1.4 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.2 |
0.5 |
GO:0031086 |
nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.2 |
1.7 |
GO:0006661 |
phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.2 |
2.4 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.2 |
0.3 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 0.2 |
2.2 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.2 |
0.7 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.2 |
0.3 |
GO:0009146 |
purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.2 |
0.5 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.2 |
0.7 |
GO:0006534 |
cysteine metabolic process(GO:0006534) |
| 0.2 |
0.7 |
GO:0042182 |
ketone catabolic process(GO:0042182) |
| 0.2 |
3.1 |
GO:0045445 |
myoblast differentiation(GO:0045445) |
| 0.2 |
2.0 |
GO:0007588 |
excretion(GO:0007588) |
| 0.2 |
1.9 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.2 |
0.5 |
GO:1904467 |
regulation of tumor necrosis factor secretion(GO:1904467) positive regulation of tumor necrosis factor secretion(GO:1904469) tumor necrosis factor secretion(GO:1990774) |
| 0.2 |
0.2 |
GO:0045358 |
negative regulation of interferon-beta biosynthetic process(GO:0045358) |
| 0.2 |
0.7 |
GO:1904426 |
positive regulation of GTP binding(GO:1904426) regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
| 0.2 |
3.2 |
GO:0045739 |
positive regulation of DNA repair(GO:0045739) |
| 0.2 |
0.2 |
GO:0051775 |
response to redox state(GO:0051775) |
| 0.2 |
1.0 |
GO:0003170 |
heart valve development(GO:0003170) |
| 0.2 |
1.8 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.2 |
0.7 |
GO:0006573 |
valine metabolic process(GO:0006573) |
| 0.2 |
2.0 |
GO:0030514 |
negative regulation of BMP signaling pathway(GO:0030514) |
| 0.2 |
1.5 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.2 |
0.5 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) collagen-activated signaling pathway(GO:0038065) |
| 0.2 |
0.5 |
GO:0019395 |
fatty acid oxidation(GO:0019395) lipid oxidation(GO:0034440) |
| 0.2 |
0.8 |
GO:0000271 |
polysaccharide biosynthetic process(GO:0000271) |
| 0.2 |
4.3 |
GO:0006289 |
nucleotide-excision repair(GO:0006289) |
| 0.2 |
0.6 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.2 |
0.6 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.2 |
0.3 |
GO:0009106 |
lipoate metabolic process(GO:0009106) |
| 0.2 |
1.7 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.2 |
0.3 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.2 |
0.9 |
GO:0071364 |
cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.2 |
0.8 |
GO:0010862 |
positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.2 |
1.6 |
GO:0032435 |
negative regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032435) |
| 0.2 |
0.6 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.2 |
0.3 |
GO:0090069 |
regulation of ribosome biogenesis(GO:0090069) |
| 0.2 |
1.7 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.2 |
0.3 |
GO:0032202 |
telomere assembly(GO:0032202) |
| 0.2 |
1.1 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.2 |
0.3 |
GO:0035826 |
hypotonic response(GO:0006971) rubidium ion transport(GO:0035826) cellular hypotonic response(GO:0071476) |
| 0.2 |
1.9 |
GO:0015693 |
magnesium ion transport(GO:0015693) |
| 0.2 |
6.1 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.2 |
1.2 |
GO:0046716 |
muscle cell cellular homeostasis(GO:0046716) |
| 0.2 |
0.5 |
GO:0015819 |
lysine transport(GO:0015819) |
| 0.2 |
0.2 |
GO:2000298 |
regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.2 |
0.5 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.2 |
0.6 |
GO:0030850 |
prostate gland development(GO:0030850) |
| 0.2 |
0.3 |
GO:0007512 |
adult heart development(GO:0007512) |
| 0.2 |
0.5 |
GO:0090160 |
positive regulation of natural killer cell degranulation(GO:0043323) Golgi to lysosome transport(GO:0090160) |
| 0.2 |
0.6 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.2 |
0.2 |
GO:0098534 |
centriole replication(GO:0007099) centriole assembly(GO:0098534) |
| 0.2 |
1.2 |
GO:0042753 |
positive regulation of circadian rhythm(GO:0042753) |
| 0.1 |
0.6 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 0.1 |
0.7 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.1 |
0.6 |
GO:0065001 |
negative regulation of histone H3-K36 methylation(GO:0000415) specification of axis polarity(GO:0065001) |
| 0.1 |
0.9 |
GO:0032757 |
positive regulation of interleukin-8 production(GO:0032757) |
| 0.1 |
2.5 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.1 |
0.6 |
GO:0032287 |
peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 |
0.6 |
GO:0045646 |
regulation of erythrocyte differentiation(GO:0045646) |
| 0.1 |
2.3 |
GO:0070206 |
protein trimerization(GO:0070206) |
| 0.1 |
1.3 |
GO:0051561 |
positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.1 |
0.6 |
GO:0010452 |
histone H3-K36 methylation(GO:0010452) |
| 0.1 |
0.1 |
GO:0034134 |
toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.1 |
0.1 |
GO:0046621 |
negative regulation of organ growth(GO:0046621) |
| 0.1 |
0.4 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.1 |
0.8 |
GO:0070475 |
rRNA base methylation(GO:0070475) |
| 0.1 |
3.4 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.1 |
0.4 |
GO:0031663 |
lipopolysaccharide-mediated signaling pathway(GO:0031663) |
| 0.1 |
0.4 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.1 |
6.2 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.1 |
1.0 |
GO:0050965 |
detection of temperature stimulus(GO:0016048) detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.1 |
0.4 |
GO:0090201 |
negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.1 |
0.1 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.1 |
0.1 |
GO:2001012 |
mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
| 0.1 |
0.7 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.1 |
0.9 |
GO:0010662 |
regulation of striated muscle cell apoptotic process(GO:0010662) |
| 0.1 |
0.4 |
GO:2000973 |
regulation of pro-B cell differentiation(GO:2000973) |
| 0.1 |
0.4 |
GO:0061299 |
retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.1 |
0.5 |
GO:1902165 |
regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902165) |
| 0.1 |
0.8 |
GO:0000012 |
single strand break repair(GO:0000012) |
| 0.1 |
0.4 |
GO:0046368 |
GDP-L-fucose metabolic process(GO:0046368) |
| 0.1 |
0.1 |
GO:0010612 |
regulation of cardiac muscle adaptation(GO:0010612) |
| 0.1 |
0.3 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.1 |
0.3 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.1 |
1.3 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.1 |
2.0 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.1 |
0.8 |
GO:0051016 |
barbed-end actin filament capping(GO:0051016) |
| 0.1 |
0.4 |
GO:0021986 |
epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.1 |
1.8 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.1 |
2.0 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 |
0.4 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) mitochondrial protein processing(GO:0034982) |
| 0.1 |
0.1 |
GO:0002719 |
negative regulation of cytokine production involved in immune response(GO:0002719) |
| 0.1 |
0.9 |
GO:0043011 |
myeloid dendritic cell differentiation(GO:0043011) |
| 0.1 |
0.9 |
GO:0019985 |
translesion synthesis(GO:0019985) |
| 0.1 |
0.4 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 |
0.4 |
GO:2000049 |
positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.1 |
0.4 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.1 |
1.2 |
GO:0033865 |
coenzyme A metabolic process(GO:0015936) nucleoside bisphosphate metabolic process(GO:0033865) ribonucleoside bisphosphate metabolic process(GO:0033875) purine nucleoside bisphosphate metabolic process(GO:0034032) |
| 0.1 |
0.1 |
GO:1900744 |
regulation of p38MAPK cascade(GO:1900744) |
| 0.1 |
0.1 |
GO:0034113 |
heterotypic cell-cell adhesion(GO:0034113) |
| 0.1 |
2.3 |
GO:0035886 |
vascular smooth muscle cell differentiation(GO:0035886) |
| 0.1 |
0.5 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.1 |
0.1 |
GO:0048050 |
post-embryonic eye morphogenesis(GO:0048050) |
| 0.1 |
2.0 |
GO:0002066 |
columnar/cuboidal epithelial cell development(GO:0002066) |
| 0.1 |
0.5 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 |
0.6 |
GO:0060055 |
angiogenesis involved in wound healing(GO:0060055) |
| 0.1 |
1.4 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 |
0.2 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.1 |
0.8 |
GO:0046697 |
decidualization(GO:0046697) |
| 0.1 |
0.9 |
GO:0045600 |
positive regulation of fat cell differentiation(GO:0045600) |
| 0.1 |
0.7 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.1 |
0.1 |
GO:0060579 |
ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 0.1 |
1.0 |
GO:0050982 |
detection of mechanical stimulus(GO:0050982) |
| 0.1 |
0.5 |
GO:0071260 |
cellular response to mechanical stimulus(GO:0071260) |
| 0.1 |
1.5 |
GO:0031122 |
cytoplasmic microtubule organization(GO:0031122) |
| 0.1 |
0.2 |
GO:0050667 |
homocysteine metabolic process(GO:0050667) |
| 0.1 |
0.8 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.1 |
3.6 |
GO:0035914 |
skeletal muscle cell differentiation(GO:0035914) |
| 0.1 |
1.3 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.1 |
0.8 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.1 |
1.6 |
GO:0043297 |
apical junction assembly(GO:0043297) |
| 0.1 |
0.1 |
GO:0002262 |
myeloid cell homeostasis(GO:0002262) |
| 0.1 |
0.7 |
GO:0006541 |
glutamine metabolic process(GO:0006541) |
| 0.1 |
0.1 |
GO:0045945 |
positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.1 |
0.2 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.1 |
1.9 |
GO:0048844 |
artery morphogenesis(GO:0048844) |
| 0.1 |
0.6 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 0.1 |
0.7 |
GO:0051657 |
maintenance of organelle location(GO:0051657) |
| 0.1 |
0.3 |
GO:1900016 |
negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.1 |
4.4 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.1 |
0.3 |
GO:0021747 |
cochlear nucleus development(GO:0021747) |
| 0.1 |
1.1 |
GO:0051084 |
'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.1 |
2.5 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.1 |
0.4 |
GO:0046501 |
protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 |
0.4 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.1 |
0.2 |
GO:0006672 |
ceramide metabolic process(GO:0006672) |
| 0.1 |
1.2 |
GO:0036260 |
7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.1 |
0.2 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.1 |
0.3 |
GO:0034035 |
purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.1 |
0.4 |
GO:0009227 |
UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
| 0.1 |
0.5 |
GO:0048701 |
embryonic cranial skeleton morphogenesis(GO:0048701) |
| 0.1 |
1.7 |
GO:0009410 |
response to xenobiotic stimulus(GO:0009410) |
| 0.1 |
0.5 |
GO:0015909 |
long-chain fatty acid transport(GO:0015909) |
| 0.1 |
6.0 |
GO:0007601 |
visual perception(GO:0007601) |
| 0.1 |
0.6 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 0.1 |
0.7 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 |
1.0 |
GO:0001569 |
patterning of blood vessels(GO:0001569) |
| 0.1 |
0.4 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.1 |
0.4 |
GO:0009650 |
UV protection(GO:0009650) |
| 0.1 |
0.3 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 |
0.4 |
GO:0046931 |
pore complex assembly(GO:0046931) |
| 0.1 |
0.3 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.1 |
0.9 |
GO:0042632 |
cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
| 0.1 |
0.3 |
GO:2001237 |
negative regulation of extrinsic apoptotic signaling pathway(GO:2001237) |
| 0.1 |
0.4 |
GO:0007168 |
receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.1 |
0.7 |
GO:0045947 |
negative regulation of translational initiation(GO:0045947) |
| 0.1 |
0.3 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.1 |
2.2 |
GO:0010761 |
fibroblast migration(GO:0010761) |
| 0.1 |
0.5 |
GO:2000380 |
regulation of mesoderm development(GO:2000380) |
| 0.1 |
0.8 |
GO:0060261 |
positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.1 |
0.4 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.1 |
0.2 |
GO:0032933 |
response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.1 |
0.1 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.1 |
0.3 |
GO:0097502 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) protein mannosylation(GO:0035268) mannosylation(GO:0097502) |
| 0.1 |
0.4 |
GO:0070193 |
synaptonemal complex organization(GO:0070193) |
| 0.1 |
1.2 |
GO:0032801 |
receptor catabolic process(GO:0032801) |
| 0.1 |
0.2 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.1 |
0.6 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 |
0.2 |
GO:0019852 |
L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 |
0.1 |
GO:0003094 |
glomerular filtration(GO:0003094) renal filtration(GO:0097205) |
| 0.1 |
0.1 |
GO:0051492 |
regulation of stress fiber assembly(GO:0051492) |
| 0.1 |
0.6 |
GO:0002313 |
mature B cell differentiation involved in immune response(GO:0002313) |
| 0.1 |
0.2 |
GO:0090181 |
regulation of cholesterol metabolic process(GO:0090181) |
| 0.1 |
0.2 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 |
0.7 |
GO:0010718 |
positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.1 |
0.4 |
GO:0051503 |
adenine nucleotide transport(GO:0051503) |
| 0.1 |
0.2 |
GO:2000574 |
regulation of microtubule motor activity(GO:2000574) |
| 0.1 |
0.6 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.1 |
0.8 |
GO:0009299 |
mRNA transcription(GO:0009299) |
| 0.1 |
0.2 |
GO:0033169 |
histone H3-K9 demethylation(GO:0033169) |
| 0.1 |
0.2 |
GO:0006544 |
glycine metabolic process(GO:0006544) |
| 0.1 |
0.3 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 |
0.4 |
GO:0060510 |
Type II pneumocyte differentiation(GO:0060510) |
| 0.1 |
0.4 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.1 |
0.6 |
GO:0036506 |
maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.1 |
1.2 |
GO:0045740 |
positive regulation of DNA replication(GO:0045740) |
| 0.1 |
0.4 |
GO:0045948 |
positive regulation of translational initiation(GO:0045948) |
| 0.1 |
0.1 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.1 |
0.1 |
GO:0010025 |
wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.1 |
0.3 |
GO:0042148 |
strand invasion(GO:0042148) |
| 0.1 |
0.7 |
GO:0051497 |
negative regulation of stress fiber assembly(GO:0051497) |
| 0.1 |
0.1 |
GO:1903336 |
negative regulation of vacuolar transport(GO:1903336) |
| 0.1 |
0.1 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.1 |
0.2 |
GO:0015960 |
diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.1 |
2.5 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
0.3 |
GO:0035493 |
SNARE complex assembly(GO:0035493) |
| 0.1 |
0.1 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.1 |
0.7 |
GO:0032781 |
positive regulation of ATPase activity(GO:0032781) |
| 0.1 |
0.3 |
GO:0031342 |
negative regulation of cell killing(GO:0031342) |
| 0.1 |
0.3 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 |
0.1 |
GO:0033092 |
positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 0.1 |
0.3 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.1 |
1.6 |
GO:0005976 |
polysaccharide metabolic process(GO:0005976) |
| 0.1 |
0.9 |
GO:0030497 |
fatty acid elongation(GO:0030497) |
| 0.1 |
0.2 |
GO:0000469 |
cleavage involved in rRNA processing(GO:0000469) |
| 0.1 |
0.1 |
GO:0043465 |
regulation of fermentation(GO:0043465) negative regulation of fermentation(GO:1901003) |
| 0.1 |
0.2 |
GO:0006817 |
phosphate ion transport(GO:0006817) |
| 0.1 |
0.1 |
GO:0045076 |
regulation of interleukin-2 biosynthetic process(GO:0045076) |
| 0.1 |
0.4 |
GO:0031047 |
gene silencing by RNA(GO:0031047) |
| 0.1 |
0.2 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.1 |
0.2 |
GO:0070162 |
adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 |
0.2 |
GO:0030838 |
positive regulation of actin filament polymerization(GO:0030838) |
| 0.1 |
0.6 |
GO:0034142 |
toll-like receptor 4 signaling pathway(GO:0034142) |
| 0.1 |
1.5 |
GO:0032648 |
regulation of interferon-beta production(GO:0032648) |
| 0.1 |
0.2 |
GO:0010592 |
positive regulation of lamellipodium assembly(GO:0010592) |
| 0.1 |
0.2 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.1 |
1.1 |
GO:0016575 |
histone deacetylation(GO:0016575) |
| 0.1 |
0.1 |
GO:0048388 |
endosomal lumen acidification(GO:0048388) |
| 0.1 |
0.1 |
GO:2000059 |
negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.1 |
0.3 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 |
0.4 |
GO:0051250 |
negative regulation of lymphocyte activation(GO:0051250) |
| 0.1 |
0.8 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.1 |
0.6 |
GO:0009994 |
oocyte differentiation(GO:0009994) |
| 0.1 |
1.4 |
GO:0048286 |
lung alveolus development(GO:0048286) |
| 0.1 |
0.6 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 |
0.4 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.1 |
0.1 |
GO:0071340 |
skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.1 |
0.1 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.1 |
0.1 |
GO:0045132 |
meiotic chromosome segregation(GO:0045132) |
| 0.0 |
0.6 |
GO:0015804 |
neutral amino acid transport(GO:0015804) |
| 0.0 |
0.2 |
GO:0009143 |
nucleoside triphosphate catabolic process(GO:0009143) |
| 0.0 |
0.2 |
GO:0061640 |
cytoskeleton-dependent cytokinesis(GO:0061640) |
| 0.0 |
0.0 |
GO:0032481 |
positive regulation of type I interferon production(GO:0032481) |
| 0.0 |
0.0 |
GO:0051560 |
mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.0 |
0.3 |
GO:0032204 |
regulation of telomere maintenance(GO:0032204) |
| 0.0 |
0.3 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 |
0.0 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 |
0.1 |
GO:0070126 |
mitochondrial translational termination(GO:0070126) |
| 0.0 |
0.4 |
GO:0033209 |
tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.0 |
0.1 |
GO:0019074 |
viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.0 |
0.0 |
GO:0010890 |
positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 |
1.2 |
GO:0001824 |
blastocyst development(GO:0001824) |
| 0.0 |
0.4 |
GO:0007140 |
male meiosis(GO:0007140) |
| 0.0 |
0.1 |
GO:0090148 |
membrane fission(GO:0090148) |
| 0.0 |
0.1 |
GO:0042769 |
DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 |
0.6 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.0 |
0.0 |
GO:2000286 |
receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.0 |
0.1 |
GO:2000195 |
negative regulation of female gonad development(GO:2000195) |
| 0.0 |
1.8 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.0 |
0.1 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.0 |
0.5 |
GO:0010907 |
positive regulation of glucose metabolic process(GO:0010907) |
| 0.0 |
1.0 |
GO:0007229 |
integrin-mediated signaling pathway(GO:0007229) |
| 0.0 |
0.2 |
GO:0072010 |
renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
| 0.0 |
8.9 |
GO:0008380 |
RNA splicing(GO:0008380) |
| 0.0 |
0.1 |
GO:0042790 |
transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
| 0.0 |
0.5 |
GO:0006354 |
DNA-templated transcription, elongation(GO:0006354) |
| 0.0 |
0.5 |
GO:0010388 |
cullin deneddylation(GO:0010388) |
| 0.0 |
0.1 |
GO:0006002 |
fructose 6-phosphate metabolic process(GO:0006002) |
| 0.0 |
0.4 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 |
0.1 |
GO:0033144 |
negative regulation of intracellular steroid hormone receptor signaling pathway(GO:0033144) |
| 0.0 |
0.1 |
GO:0030240 |
skeletal muscle thin filament assembly(GO:0030240) |
| 0.0 |
1.0 |
GO:0007281 |
germ cell development(GO:0007281) |
| 0.0 |
0.1 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 |
0.1 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.0 |
0.1 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 |
0.5 |
GO:2000179 |
positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.0 |
0.1 |
GO:1902309 |
regulation of peptidyl-serine dephosphorylation(GO:1902308) negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.0 |
0.2 |
GO:0030330 |
DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
| 0.0 |
0.2 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.0 |
0.4 |
GO:0010591 |
regulation of lamellipodium assembly(GO:0010591) |
| 0.0 |
0.3 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.0 |
0.2 |
GO:0097237 |
cellular response to toxic substance(GO:0097237) |
| 0.0 |
0.1 |
GO:0043649 |
dicarboxylic acid catabolic process(GO:0043649) |
| 0.0 |
0.3 |
GO:0014068 |
positive regulation of phosphatidylinositol 3-kinase signaling(GO:0014068) |
| 0.0 |
0.6 |
GO:0000725 |
double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.0 |
0.2 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.0 |
0.0 |
GO:0006404 |
RNA import into nucleus(GO:0006404) |
| 0.0 |
0.2 |
GO:0006636 |
unsaturated fatty acid biosynthetic process(GO:0006636) |
| 0.0 |
0.1 |
GO:0007202 |
activation of phospholipase C activity(GO:0007202) |
| 0.0 |
0.2 |
GO:0006465 |
signal peptide processing(GO:0006465) |
| 0.0 |
0.1 |
GO:0033563 |
dorsal/ventral axon guidance(GO:0033563) |
| 0.0 |
0.1 |
GO:0071435 |
potassium ion export(GO:0071435) |
| 0.0 |
0.2 |
GO:0050892 |
intestinal absorption(GO:0050892) |
| 0.0 |
0.0 |
GO:0000289 |
nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 |
0.1 |
GO:0038032 |
termination of G-protein coupled receptor signaling pathway(GO:0038032) |
| 0.0 |
0.1 |
GO:1901739 |
regulation of myoblast fusion(GO:1901739) positive regulation of myoblast fusion(GO:1901741) |
| 0.0 |
0.2 |
GO:0018230 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 |
0.4 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.0 |
0.1 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.0 |
0.3 |
GO:0030177 |
positive regulation of Wnt signaling pathway(GO:0030177) |
| 0.0 |
0.2 |
GO:0006448 |
regulation of translational elongation(GO:0006448) |
| 0.0 |
0.2 |
GO:0030520 |
intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 |
0.4 |
GO:0019731 |
antimicrobial humoral response(GO:0019730) antibacterial humoral response(GO:0019731) |
| 0.0 |
0.9 |
GO:0042552 |
myelination(GO:0042552) |
| 0.0 |
0.1 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.0 |
0.2 |
GO:0055078 |
sodium ion homeostasis(GO:0055078) |
| 0.0 |
0.1 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 |
0.1 |
GO:0007131 |
reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 |
0.3 |
GO:0071425 |
hematopoietic stem cell proliferation(GO:0071425) |
| 0.0 |
3.4 |
GO:0007067 |
mitotic nuclear division(GO:0007067) |
| 0.0 |
0.1 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 |
1.1 |
GO:0032259 |
methylation(GO:0032259) |
| 0.0 |
0.1 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.0 |
0.0 |
GO:0070863 |
positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.0 |
0.1 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.0 |
0.0 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 |
0.8 |
GO:0006334 |
nucleosome assembly(GO:0006334) |
| 0.0 |
0.2 |
GO:0001885 |
endothelial cell development(GO:0001885) |
| 0.0 |
0.0 |
GO:0009405 |
pathogenesis(GO:0009405) |
| 0.0 |
0.3 |
GO:0043267 |
negative regulation of potassium ion transport(GO:0043267) |
| 0.0 |
0.1 |
GO:0055072 |
iron ion homeostasis(GO:0055072) |
| 0.0 |
0.1 |
GO:0043276 |
anoikis(GO:0043276) |
| 0.0 |
0.2 |
GO:0001841 |
neural tube formation(GO:0001841) |
| 0.0 |
0.1 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 |
0.3 |
GO:0007257 |
activation of JUN kinase activity(GO:0007257) |
| 0.0 |
0.1 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.0 |
0.8 |
GO:0006397 |
mRNA processing(GO:0006397) |
| 0.0 |
0.1 |
GO:0034770 |
histone H4-K20 methylation(GO:0034770) |
| 0.0 |
0.0 |
GO:0016338 |
calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 |
0.1 |
GO:0042136 |
neurotransmitter biosynthetic process(GO:0042136) |
| 0.0 |
0.1 |
GO:0016568 |
chromatin modification(GO:0016568) |
| 0.0 |
0.1 |
GO:0008053 |
mitochondrial fusion(GO:0008053) |
| 0.0 |
0.0 |
GO:1903071 |
positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.0 |
0.0 |
GO:0007220 |
Notch receptor processing(GO:0007220) |
| 0.0 |
0.2 |
GO:0072337 |
modified amino acid transport(GO:0072337) |
