| 1.3 |
3.8 |
GO:1902460 |
regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.8 |
15.4 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.6 |
3.2 |
GO:0060838 |
lymphatic endothelial cell fate commitment(GO:0060838) regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 0.5 |
1.5 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.5 |
1.9 |
GO:2000313 |
fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.3 |
1.5 |
GO:0035093 |
spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.3 |
1.4 |
GO:0045657 |
positive regulation of monocyte differentiation(GO:0045657) cellular response to potassium ion starvation(GO:0051365) |
| 0.3 |
1.4 |
GO:0003223 |
ventricular compact myocardium morphogenesis(GO:0003223) proprioception(GO:0019230) |
| 0.3 |
1.9 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.3 |
1.3 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.3 |
1.6 |
GO:0043654 |
recognition of apoptotic cell(GO:0043654) |
| 0.3 |
1.3 |
GO:0010991 |
negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.2 |
0.7 |
GO:0003219 |
cardiac right ventricle formation(GO:0003219) |
| 0.2 |
0.9 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.2 |
1.1 |
GO:0021764 |
amygdala development(GO:0021764) |
| 0.2 |
0.4 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.2 |
0.6 |
GO:1901896 |
positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.2 |
1.0 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.2 |
1.1 |
GO:0051964 |
negative regulation of synapse assembly(GO:0051964) |
| 0.2 |
0.9 |
GO:1903026 |
negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.2 |
0.6 |
GO:0070885 |
negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.2 |
3.2 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.1 |
2.7 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.1 |
1.0 |
GO:0019370 |
leukotriene biosynthetic process(GO:0019370) |
| 0.1 |
3.0 |
GO:0032967 |
positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.1 |
0.4 |
GO:0097709 |
connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
| 0.1 |
1.1 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) |
| 0.1 |
1.5 |
GO:0033690 |
positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 |
0.5 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 0.1 |
1.4 |
GO:0060481 |
lobar bronchus epithelium development(GO:0060481) |
| 0.1 |
0.6 |
GO:0006172 |
ADP biosynthetic process(GO:0006172) |
| 0.1 |
0.3 |
GO:0032241 |
positive regulation of nucleobase-containing compound transport(GO:0032241) |
| 0.1 |
0.8 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.1 |
0.7 |
GO:2000809 |
positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.1 |
0.4 |
GO:1902309 |
negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.1 |
0.3 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.1 |
0.3 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.1 |
0.4 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.1 |
8.5 |
GO:0006342 |
chromatin silencing(GO:0006342) |
| 0.1 |
0.7 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 |
0.2 |
GO:0034476 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 0.1 |
0.2 |
GO:1903351 |
response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) regulation of sodium:potassium-exchanging ATPase activity(GO:1903406) |
| 0.1 |
0.2 |
GO:0046122 |
purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.1 |
1.0 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.1 |
0.6 |
GO:0071225 |
cellular response to muramyl dipeptide(GO:0071225) |
| 0.1 |
0.6 |
GO:0002227 |
innate immune response in mucosa(GO:0002227) |
| 0.1 |
0.2 |
GO:0033159 |
negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.1 |
1.8 |
GO:0051491 |
positive regulation of filopodium assembly(GO:0051491) |
| 0.1 |
1.6 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 |
0.8 |
GO:0048387 |
negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 |
1.6 |
GO:0010972 |
negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
| 0.0 |
0.8 |
GO:0031295 |
lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
| 0.0 |
1.5 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.0 |
0.2 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 |
0.2 |
GO:0033631 |
cell-cell adhesion mediated by integrin(GO:0033631) |
| 0.0 |
1.1 |
GO:0007157 |
heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 |
0.7 |
GO:0031572 |
G2 DNA damage checkpoint(GO:0031572) |
| 0.0 |
0.2 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.0 |
0.5 |
GO:0033622 |
integrin activation(GO:0033622) |
| 0.0 |
0.1 |
GO:0055071 |
cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
| 0.0 |
2.0 |
GO:0006334 |
nucleosome assembly(GO:0006334) |
| 0.0 |
1.0 |
GO:1901998 |
toxin transport(GO:1901998) |
| 0.0 |
0.1 |
GO:0002934 |
desmosome organization(GO:0002934) |
| 0.0 |
2.3 |
GO:0021954 |
central nervous system neuron development(GO:0021954) |
| 0.0 |
0.4 |
GO:0031115 |
negative regulation of microtubule polymerization(GO:0031115) |
| 0.0 |
0.2 |
GO:0033572 |
transferrin transport(GO:0033572) |
| 0.0 |
0.1 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.0 |
0.5 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 |
1.0 |
GO:0045600 |
positive regulation of fat cell differentiation(GO:0045600) |
| 0.0 |
0.4 |
GO:0034063 |
stress granule assembly(GO:0034063) |
| 0.0 |
0.8 |
GO:0021766 |
hippocampus development(GO:0021766) |
| 0.0 |
0.6 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.0 |
2.8 |
GO:0043062 |
extracellular matrix organization(GO:0030198) extracellular structure organization(GO:0043062) |
| 0.0 |
0.1 |
GO:2000623 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 |
0.2 |
GO:0010758 |
regulation of macrophage chemotaxis(GO:0010758) |
| 0.0 |
0.1 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.0 |
0.2 |
GO:0070498 |
interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.0 |
0.4 |
GO:0060074 |
synapse maturation(GO:0060074) |
| 0.0 |
0.5 |
GO:1900046 |
regulation of blood coagulation(GO:0030193) regulation of hemostasis(GO:1900046) |
| 0.0 |
0.2 |
GO:0043551 |
regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
