| 7.8 |
46.8 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 5.0 |
15.1 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 3.4 |
17.0 |
GO:0021905 |
pancreatic A cell development(GO:0003322) forebrain-midbrain boundary formation(GO:0021905) somatic motor neuron fate commitment(GO:0021917) regulation of transcription from RNA polymerase II promoter involved in somatic motor neuron fate commitment(GO:0021918) |
| 3.1 |
6.3 |
GO:1903416 |
response to glycoside(GO:1903416) |
| 3.1 |
9.4 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) axial mesoderm morphogenesis(GO:0048319) |
| 3.0 |
11.8 |
GO:0010957 |
negative regulation of vitamin D biosynthetic process(GO:0010957) negative regulation of vitamin metabolic process(GO:0046137) |
| 2.8 |
8.4 |
GO:0035696 |
monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 2.7 |
10.8 |
GO:0051311 |
spindle assembly involved in female meiosis(GO:0007056) meiotic metaphase plate congression(GO:0051311) |
| 2.7 |
8.0 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 2.6 |
15.7 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 2.5 |
10.0 |
GO:0032439 |
endosome localization(GO:0032439) |
| 2.4 |
7.2 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 2.3 |
9.3 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 2.2 |
9.0 |
GO:0045608 |
inhibition of neuroepithelial cell differentiation(GO:0002085) negative regulation of auditory receptor cell differentiation(GO:0045608) |
| 2.1 |
6.3 |
GO:0034135 |
regulation of toll-like receptor 2 signaling pathway(GO:0034135) |
| 2.1 |
6.3 |
GO:0061153 |
trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) odontoblast differentiation(GO:0071895) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 2.1 |
4.2 |
GO:0072223 |
metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
| 2.0 |
6.1 |
GO:0044849 |
estrous cycle(GO:0044849) |
| 2.0 |
33.7 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 1.9 |
5.6 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 1.8 |
3.7 |
GO:0031052 |
programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
| 1.8 |
7.4 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 1.8 |
5.5 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 1.8 |
7.3 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 1.8 |
5.4 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 1.8 |
10.8 |
GO:0046645 |
positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
| 1.8 |
9.0 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 1.7 |
1.7 |
GO:2001027 |
negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 1.6 |
6.6 |
GO:0003376 |
sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 1.6 |
4.9 |
GO:1900041 |
negative regulation of interleukin-2 secretion(GO:1900041) |
| 1.6 |
4.9 |
GO:0003273 |
cell migration involved in endocardial cushion formation(GO:0003273) |
| 1.6 |
12.6 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 1.6 |
6.3 |
GO:0071105 |
response to interleukin-11(GO:0071105) |
| 1.5 |
4.6 |
GO:0072429 |
response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 1.5 |
1.5 |
GO:0002586 |
regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
| 1.5 |
3.0 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 1.5 |
7.5 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 1.5 |
1.5 |
GO:0034285 |
response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 1.5 |
4.4 |
GO:1990046 |
positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) stress-induced mitochondrial fusion(GO:1990046) |
| 1.5 |
5.9 |
GO:0060032 |
notochord regression(GO:0060032) |
| 1.4 |
5.8 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 1.4 |
8.5 |
GO:0071883 |
activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 1.4 |
2.8 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 1.4 |
12.4 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 1.4 |
2.7 |
GO:0043654 |
recognition of apoptotic cell(GO:0043654) |
| 1.4 |
11.0 |
GO:0015670 |
carbon dioxide transport(GO:0015670) |
| 1.4 |
2.7 |
GO:0071205 |
protein localization to juxtaparanode region of axon(GO:0071205) protein localization to axon(GO:0099612) |
| 1.3 |
5.4 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 1.3 |
4.0 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 1.3 |
4.0 |
GO:0032066 |
nucleolus to nucleoplasm transport(GO:0032066) |
| 1.3 |
14.7 |
GO:0033572 |
transferrin transport(GO:0033572) |
| 1.3 |
4.0 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 1.3 |
6.4 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 1.3 |
5.0 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 1.2 |
2.5 |
GO:0002309 |
T cell proliferation involved in immune response(GO:0002309) |
| 1.2 |
12.3 |
GO:0033631 |
cell-cell adhesion mediated by integrin(GO:0033631) |
| 1.2 |
4.9 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 1.2 |
8.5 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 1.2 |
7.2 |
GO:0032929 |
negative regulation of superoxide anion generation(GO:0032929) |
| 1.2 |
6.0 |
GO:0060690 |
epithelial cell differentiation involved in salivary gland development(GO:0060690) |
| 1.2 |
3.6 |
GO:0002322 |
B cell proliferation involved in immune response(GO:0002322) |
| 1.2 |
3.5 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 1.2 |
1.2 |
GO:1903984 |
positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 1.2 |
2.3 |
GO:0050859 |
negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 1.2 |
2.3 |
GO:0003406 |
retinal pigment epithelium development(GO:0003406) |
| 1.1 |
3.4 |
GO:1903054 |
negative regulation of extracellular matrix organization(GO:1903054) |
| 1.1 |
3.3 |
GO:1904569 |
regulation of selenocysteine incorporation(GO:1904569) |
| 1.1 |
9.8 |
GO:2001214 |
positive regulation of vasculogenesis(GO:2001214) |
| 1.1 |
4.3 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 1.1 |
4.3 |
GO:1902202 |
regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 1.1 |
3.2 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 1.0 |
3.1 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 1.0 |
4.1 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 1.0 |
3.1 |
GO:0010248 |
B cell negative selection(GO:0002352) establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 1.0 |
3.0 |
GO:0045014 |
detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) detection of glucose(GO:0051594) |
| 1.0 |
3.0 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 1.0 |
3.0 |
GO:0033030 |
negative regulation of neutrophil apoptotic process(GO:0033030) |
| 1.0 |
2.0 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 1.0 |
4.9 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 1.0 |
2.9 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 1.0 |
5.8 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 1.0 |
1.0 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 0.9 |
2.8 |
GO:0060437 |
lung growth(GO:0060437) |
| 0.9 |
5.7 |
GO:0003065 |
positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.9 |
3.8 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.9 |
2.8 |
GO:0048611 |
ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
| 0.9 |
3.7 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 0.9 |
7.4 |
GO:0032490 |
detection of molecule of bacterial origin(GO:0032490) |
| 0.9 |
2.8 |
GO:0003278 |
apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.9 |
2.8 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.9 |
0.9 |
GO:0010666 |
positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.9 |
3.7 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.9 |
2.7 |
GO:0071921 |
establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.9 |
3.6 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) thrombopoietin-mediated signaling pathway(GO:0038163) positive regulation of male germ cell proliferation(GO:2000256) |
| 0.9 |
3.6 |
GO:0048539 |
bone marrow development(GO:0048539) |
| 0.9 |
7.2 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.9 |
2.7 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.9 |
2.7 |
GO:0002447 |
eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) regulation of eosinophil activation(GO:1902566) |
| 0.9 |
2.7 |
GO:0010986 |
positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.9 |
0.9 |
GO:0045410 |
positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
| 0.9 |
1.8 |
GO:0010911 |
regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.9 |
1.7 |
GO:0035021 |
negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.9 |
4.3 |
GO:0051045 |
negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.9 |
2.6 |
GO:0042320 |
regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) circadian sleep/wake cycle, REM sleep(GO:0042747) positive regulation of circadian sleep/wake cycle, sleep(GO:0045938) |
| 0.9 |
4.3 |
GO:0015669 |
gas transport(GO:0015669) |
| 0.8 |
6.8 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.8 |
1.7 |
GO:0060923 |
cardiac cell fate commitment(GO:0060911) cardiac muscle cell fate commitment(GO:0060923) |
| 0.8 |
2.5 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.8 |
2.5 |
GO:0036388 |
pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.8 |
2.5 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.8 |
1.6 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.8 |
2.4 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.8 |
1.6 |
GO:0002578 |
negative regulation of antigen processing and presentation(GO:0002578) |
| 0.8 |
2.4 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.8 |
8.0 |
GO:0006977 |
DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.8 |
4.8 |
GO:0006207 |
'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.8 |
2.4 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.8 |
3.9 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.8 |
3.1 |
GO:2000407 |
positive regulation of necrotic cell death(GO:0010940) regulation of T cell extravasation(GO:2000407) |
| 0.8 |
3.9 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.8 |
1.5 |
GO:1904425 |
negative regulation of GTP binding(GO:1904425) |
| 0.8 |
3.0 |
GO:0002741 |
positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.8 |
6.1 |
GO:0033601 |
positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.8 |
2.3 |
GO:0002331 |
pre-B cell allelic exclusion(GO:0002331) |
| 0.8 |
2.3 |
GO:0001732 |
formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.8 |
1.5 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 0.8 |
1.5 |
GO:0048680 |
positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
| 0.7 |
8.2 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.7 |
3.7 |
GO:0032298 |
positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.7 |
5.2 |
GO:0000103 |
sulfate assimilation(GO:0000103) |
| 0.7 |
2.2 |
GO:0019405 |
alditol catabolic process(GO:0019405) glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.7 |
3.7 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.7 |
2.9 |
GO:0014012 |
peripheral nervous system axon regeneration(GO:0014012) |
| 0.7 |
0.7 |
GO:2001015 |
negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.7 |
7.3 |
GO:0044026 |
DNA hypermethylation(GO:0044026) |
| 0.7 |
2.9 |
GO:2000705 |
regulation of dense core granule biogenesis(GO:2000705) |
| 0.7 |
2.2 |
GO:0045659 |
regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.7 |
4.3 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.7 |
2.9 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.7 |
1.4 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.7 |
7.8 |
GO:0050765 |
negative regulation of phagocytosis(GO:0050765) |
| 0.7 |
2.8 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 0.7 |
5.6 |
GO:0071285 |
cellular response to lithium ion(GO:0071285) |
| 0.7 |
2.8 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.7 |
5.6 |
GO:0032463 |
negative regulation of protein homooligomerization(GO:0032463) |
| 0.7 |
3.5 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
| 0.7 |
6.9 |
GO:0032211 |
negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.7 |
12.8 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.7 |
1.3 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.7 |
2.0 |
GO:0035574 |
histone H4-K20 demethylation(GO:0035574) |
| 0.7 |
2.0 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.7 |
2.7 |
GO:0019372 |
lipoxygenase pathway(GO:0019372) |
| 0.7 |
2.7 |
GO:0046909 |
intermembrane transport(GO:0046909) |
| 0.7 |
4.0 |
GO:0007016 |
cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.7 |
7.3 |
GO:0072498 |
embryonic skeletal joint development(GO:0072498) |
| 0.7 |
2.0 |
GO:0042264 |
peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.7 |
2.0 |
GO:0086017 |
renin secretion into blood stream(GO:0002001) cell communication by chemical coupling(GO:0010643) Purkinje myocyte action potential(GO:0086017) regulation of renin secretion into blood stream(GO:1900133) |
| 0.7 |
1.3 |
GO:0040009 |
regulation of growth rate(GO:0040009) |
| 0.6 |
0.6 |
GO:0060706 |
cell differentiation involved in embryonic placenta development(GO:0060706) |
| 0.6 |
3.2 |
GO:2001185 |
regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.6 |
5.8 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.6 |
0.6 |
GO:0000060 |
protein import into nucleus, translocation(GO:0000060) |
| 0.6 |
5.1 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.6 |
5.1 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.6 |
5.7 |
GO:0032808 |
lacrimal gland development(GO:0032808) |
| 0.6 |
1.9 |
GO:1903896 |
positive regulation of IRE1-mediated unfolded protein response(GO:1903896) positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.6 |
3.1 |
GO:0016560 |
protein import into peroxisome matrix, docking(GO:0016560) |
| 0.6 |
1.3 |
GO:0002457 |
T cell antigen processing and presentation(GO:0002457) |
| 0.6 |
2.5 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.6 |
2.5 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.6 |
4.3 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.6 |
1.8 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.6 |
1.2 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.6 |
7.8 |
GO:1900027 |
regulation of ruffle assembly(GO:1900027) |
| 0.6 |
1.8 |
GO:0018199 |
peptidyl-glutamine modification(GO:0018199) |
| 0.6 |
1.8 |
GO:0034162 |
toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.6 |
1.2 |
GO:2000338 |
chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
| 0.6 |
7.1 |
GO:0000244 |
spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.6 |
2.3 |
GO:0010792 |
DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.6 |
1.8 |
GO:0015960 |
diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.6 |
3.5 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.6 |
2.3 |
GO:0007351 |
tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.6 |
5.2 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.6 |
2.8 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 0.6 |
2.3 |
GO:0010920 |
negative regulation of inositol phosphate biosynthetic process(GO:0010920) |
| 0.6 |
7.4 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.6 |
2.3 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.6 |
0.6 |
GO:1900368 |
regulation of RNA interference(GO:1900368) |
| 0.6 |
3.4 |
GO:0098700 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.6 |
5.0 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.6 |
0.6 |
GO:0060018 |
astrocyte fate commitment(GO:0060018) |
| 0.6 |
1.1 |
GO:0014735 |
regulation of muscle atrophy(GO:0014735) |
| 0.6 |
2.8 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.6 |
2.2 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.5 |
7.1 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.5 |
3.8 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.5 |
4.4 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.5 |
1.6 |
GO:0002678 |
positive regulation of chronic inflammatory response(GO:0002678) |
| 0.5 |
3.7 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 0.5 |
2.1 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.5 |
1.6 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 0.5 |
2.1 |
GO:0010890 |
positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.5 |
0.5 |
GO:0071726 |
response to diacyl bacterial lipopeptide(GO:0071724) cellular response to diacyl bacterial lipopeptide(GO:0071726) |
| 0.5 |
3.6 |
GO:1902166 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.5 |
2.6 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.5 |
2.1 |
GO:0045651 |
positive regulation of macrophage differentiation(GO:0045651) |
| 0.5 |
0.5 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.5 |
2.0 |
GO:0042905 |
9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.5 |
2.0 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.5 |
4.5 |
GO:0043011 |
myeloid dendritic cell differentiation(GO:0043011) |
| 0.5 |
7.0 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.5 |
3.5 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.5 |
1.5 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.5 |
0.5 |
GO:0070488 |
neutrophil aggregation(GO:0070488) |
| 0.5 |
0.5 |
GO:0038161 |
prolactin signaling pathway(GO:0038161) |
| 0.5 |
2.0 |
GO:0007369 |
gastrulation(GO:0007369) |
| 0.5 |
1.9 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.5 |
0.5 |
GO:2000484 |
positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.5 |
2.9 |
GO:0016081 |
synaptic vesicle docking(GO:0016081) |
| 0.5 |
9.7 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.5 |
1.9 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 0.5 |
4.8 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.5 |
1.0 |
GO:0045472 |
response to ether(GO:0045472) |
| 0.5 |
3.3 |
GO:0042482 |
positive regulation of odontogenesis(GO:0042482) |
| 0.5 |
0.5 |
GO:0032829 |
regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 0.5 |
13.8 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.5 |
2.4 |
GO:2000348 |
regulation of CD40 signaling pathway(GO:2000348) |
| 0.5 |
2.4 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.5 |
2.4 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) |
| 0.5 |
0.9 |
GO:2000819 |
regulation of nucleotide-excision repair(GO:2000819) |
| 0.5 |
11.3 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.5 |
0.9 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.5 |
2.3 |
GO:0071476 |
cellular hypotonic response(GO:0071476) |
| 0.5 |
3.6 |
GO:0034501 |
protein localization to kinetochore(GO:0034501) |
| 0.5 |
2.3 |
GO:0002693 |
positive regulation of cellular extravasation(GO:0002693) |
| 0.5 |
3.6 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.5 |
1.4 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.4 |
3.6 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.4 |
0.9 |
GO:2000138 |
positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.4 |
3.6 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.4 |
1.8 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 0.4 |
0.4 |
GO:0001773 |
myeloid dendritic cell activation(GO:0001773) |
| 0.4 |
2.7 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.4 |
1.3 |
GO:1901164 |
negative regulation of trophoblast cell migration(GO:1901164) |
| 0.4 |
1.3 |
GO:0030853 |
negative regulation of granulocyte differentiation(GO:0030853) |
| 0.4 |
1.8 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.4 |
0.9 |
GO:0060594 |
mammary gland specification(GO:0060594) |
| 0.4 |
1.3 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.4 |
3.0 |
GO:0032534 |
regulation of microvillus assembly(GO:0032534) |
| 0.4 |
4.3 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.4 |
0.9 |
GO:1900745 |
positive regulation of p38MAPK cascade(GO:1900745) |
| 0.4 |
0.9 |
GO:0021546 |
rhombomere development(GO:0021546) |
| 0.4 |
0.9 |
GO:0031627 |
telomeric loop formation(GO:0031627) |
| 0.4 |
1.3 |
GO:0001928 |
regulation of exocyst assembly(GO:0001928) |
| 0.4 |
3.8 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.4 |
1.3 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 0.4 |
1.3 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.4 |
1.7 |
GO:0032713 |
negative regulation of interleukin-4 production(GO:0032713) |
| 0.4 |
0.8 |
GO:0090370 |
negative regulation of cholesterol efflux(GO:0090370) |
| 0.4 |
3.8 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 0.4 |
1.7 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.4 |
0.4 |
GO:0001996 |
regulation of systemic arterial blood pressure by norepinephrine-epinephrine(GO:0001993) positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) positive regulation of blood pressure by epinephrine-norepinephrine(GO:0003321) |
| 0.4 |
1.2 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.4 |
2.5 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.4 |
1.2 |
GO:0010878 |
cholesterol storage(GO:0010878) |
| 0.4 |
1.6 |
GO:1990414 |
replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.4 |
2.8 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.4 |
0.8 |
GO:0060399 |
positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.4 |
1.6 |
GO:0052646 |
alditol phosphate metabolic process(GO:0052646) |
| 0.4 |
2.0 |
GO:0034397 |
telomere localization(GO:0034397) |
| 0.4 |
1.2 |
GO:0035106 |
operant conditioning(GO:0035106) |
| 0.4 |
2.0 |
GO:0006072 |
glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.4 |
2.3 |
GO:0031111 |
negative regulation of microtubule depolymerization(GO:0007026) negative regulation of microtubule polymerization or depolymerization(GO:0031111) regulation of microtubule depolymerization(GO:0031114) |
| 0.4 |
0.8 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.4 |
3.5 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.4 |
3.9 |
GO:0030238 |
male sex determination(GO:0030238) |
| 0.4 |
6.5 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.4 |
1.5 |
GO:0010700 |
negative regulation of norepinephrine secretion(GO:0010700) |
| 0.4 |
4.9 |
GO:0001779 |
natural killer cell differentiation(GO:0001779) |
| 0.4 |
1.1 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.4 |
1.1 |
GO:1902950 |
regulation of dendritic spine maintenance(GO:1902950) positive regulation of dendritic spine maintenance(GO:1902952) |
| 0.4 |
1.5 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.4 |
3.3 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.4 |
2.6 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 0.4 |
7.3 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.4 |
1.1 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.4 |
0.4 |
GO:0010040 |
response to iron(II) ion(GO:0010040) |
| 0.4 |
1.1 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) patterning of lymph vessels(GO:0060854) |
| 0.4 |
2.9 |
GO:0038028 |
exocrine pancreas development(GO:0031017) insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.4 |
1.4 |
GO:0018343 |
protein farnesylation(GO:0018343) |
| 0.4 |
5.4 |
GO:0060707 |
trophoblast giant cell differentiation(GO:0060707) |
| 0.4 |
3.6 |
GO:0061299 |
retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.4 |
2.1 |
GO:0032488 |
Cdc42 protein signal transduction(GO:0032488) |
| 0.4 |
0.4 |
GO:0031118 |
snoRNA guided rRNA pseudouridine synthesis(GO:0000454) rRNA pseudouridine synthesis(GO:0031118) |
| 0.4 |
1.4 |
GO:0035752 |
lysosomal lumen pH elevation(GO:0035752) |
| 0.4 |
1.1 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.3 |
2.8 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.3 |
1.4 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.3 |
3.8 |
GO:0018126 |
protein hydroxylation(GO:0018126) |
| 0.3 |
1.7 |
GO:0019388 |
galactose catabolic process(GO:0019388) |
| 0.3 |
0.3 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.3 |
0.3 |
GO:0071047 |
nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.3 |
6.8 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 0.3 |
2.0 |
GO:1903624 |
regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
| 0.3 |
1.7 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.3 |
0.7 |
GO:1901069 |
guanosine-containing compound catabolic process(GO:1901069) |
| 0.3 |
0.7 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.3 |
10.2 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.3 |
1.0 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.3 |
4.0 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.3 |
5.0 |
GO:0009191 |
ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.3 |
1.0 |
GO:1900060 |
negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.3 |
3.9 |
GO:0043277 |
apoptotic cell clearance(GO:0043277) |
| 0.3 |
0.6 |
GO:0003032 |
detection of oxygen(GO:0003032) regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
| 0.3 |
1.6 |
GO:0014807 |
regulation of somitogenesis(GO:0014807) |
| 0.3 |
1.6 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.3 |
1.3 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.3 |
3.8 |
GO:0042346 |
positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.3 |
0.9 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.3 |
0.3 |
GO:0050931 |
pigment cell differentiation(GO:0050931) |
| 0.3 |
6.3 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.3 |
2.2 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.3 |
1.6 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.3 |
2.8 |
GO:0009396 |
folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.3 |
0.9 |
GO:2000152 |
regulation of ubiquitin-specific protease activity(GO:2000152) |
| 0.3 |
0.6 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.3 |
2.8 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.3 |
2.2 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) |
| 0.3 |
3.7 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.3 |
1.8 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.3 |
0.6 |
GO:0002839 |
positive regulation of response to tumor cell(GO:0002836) positive regulation of immune response to tumor cell(GO:0002839) |
| 0.3 |
2.8 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.3 |
1.5 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.3 |
1.5 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 0.3 |
1.2 |
GO:0060075 |
regulation of resting membrane potential(GO:0060075) |
| 0.3 |
3.1 |
GO:0014842 |
skeletal muscle satellite cell proliferation(GO:0014841) regulation of skeletal muscle satellite cell proliferation(GO:0014842) skeletal muscle cell proliferation(GO:0014856) regulation of skeletal muscle cell proliferation(GO:0014857) |
| 0.3 |
5.2 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.3 |
1.8 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.3 |
8.3 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.3 |
2.4 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.3 |
1.8 |
GO:1903427 |
negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
| 0.3 |
1.2 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.3 |
0.6 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 0.3 |
1.2 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.3 |
3.2 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.3 |
1.7 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.3 |
1.1 |
GO:0070127 |
tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.3 |
4.0 |
GO:0060013 |
righting reflex(GO:0060013) |
| 0.3 |
1.1 |
GO:0060373 |
regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.3 |
0.9 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.3 |
4.0 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.3 |
1.1 |
GO:0006742 |
NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.3 |
0.3 |
GO:0021520 |
spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.3 |
3.4 |
GO:0090503 |
RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.3 |
1.4 |
GO:0097421 |
liver regeneration(GO:0097421) |
| 0.3 |
0.6 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) |
| 0.3 |
1.1 |
GO:0070236 |
regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.3 |
1.1 |
GO:0002053 |
positive regulation of mesenchymal cell proliferation(GO:0002053) |
| 0.3 |
1.7 |
GO:0098789 |
pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.3 |
0.8 |
GO:0008594 |
photoreceptor cell morphogenesis(GO:0008594) |
| 0.3 |
0.5 |
GO:0050904 |
diapedesis(GO:0050904) |
| 0.3 |
0.3 |
GO:0034384 |
high-density lipoprotein particle clearance(GO:0034384) |
| 0.3 |
1.1 |
GO:0014068 |
positive regulation of phosphatidylinositol 3-kinase signaling(GO:0014068) |
| 0.3 |
0.3 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.3 |
3.2 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.3 |
7.1 |
GO:0001921 |
positive regulation of receptor recycling(GO:0001921) |
| 0.3 |
4.2 |
GO:0071800 |
podosome assembly(GO:0071800) |
| 0.3 |
1.0 |
GO:0050855 |
regulation of B cell receptor signaling pathway(GO:0050855) |
| 0.3 |
1.0 |
GO:0007039 |
protein catabolic process in the vacuole(GO:0007039) |
| 0.3 |
3.4 |
GO:0035024 |
negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.3 |
1.5 |
GO:0046459 |
short-chain fatty acid metabolic process(GO:0046459) |
| 0.3 |
2.6 |
GO:0036035 |
osteoclast development(GO:0036035) |
| 0.3 |
0.5 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.3 |
1.0 |
GO:2000504 |
positive regulation of blood vessel remodeling(GO:2000504) |
| 0.3 |
0.8 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.3 |
2.0 |
GO:0003417 |
growth plate cartilage development(GO:0003417) |
| 0.3 |
1.3 |
GO:0033683 |
nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.2 |
1.2 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.2 |
3.5 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.2 |
3.2 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.2 |
1.0 |
GO:0021847 |
ventricular zone neuroblast division(GO:0021847) |
| 0.2 |
2.2 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.2 |
1.5 |
GO:0033147 |
negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.2 |
3.2 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.2 |
0.7 |
GO:0034310 |
primary alcohol catabolic process(GO:0034310) |
| 0.2 |
2.9 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.2 |
0.2 |
GO:0001798 |
type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) positive regulation of hypersensitivity(GO:0002885) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.2 |
0.7 |
GO:0045629 |
negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.2 |
7.5 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.2 |
2.9 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.2 |
1.0 |
GO:0018202 |
peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.2 |
1.4 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.2 |
0.5 |
GO:0035026 |
leading edge cell differentiation(GO:0035026) |
| 0.2 |
0.2 |
GO:0032530 |
regulation of microvillus organization(GO:0032530) |
| 0.2 |
5.4 |
GO:0010718 |
positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.2 |
1.4 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.2 |
0.5 |
GO:0045343 |
MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.2 |
2.6 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.2 |
0.5 |
GO:0060913 |
cardiac cell fate determination(GO:0060913) |
| 0.2 |
0.7 |
GO:0060352 |
cell adhesion molecule production(GO:0060352) |
| 0.2 |
2.8 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.2 |
0.5 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 0.2 |
0.9 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.2 |
0.5 |
GO:0044650 |
virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
| 0.2 |
3.3 |
GO:0090205 |
positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.2 |
0.2 |
GO:2000343 |
positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
| 0.2 |
2.3 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.2 |
1.1 |
GO:1902775 |
mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.2 |
8.2 |
GO:0070206 |
protein trimerization(GO:0070206) |
| 0.2 |
2.9 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.2 |
6.5 |
GO:0032612 |
interleukin-1 production(GO:0032612) |
| 0.2 |
0.7 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 0.2 |
0.4 |
GO:1903012 |
positive regulation of bone development(GO:1903012) |
| 0.2 |
2.7 |
GO:0045907 |
positive regulation of vasoconstriction(GO:0045907) |
| 0.2 |
0.7 |
GO:0097623 |
potassium ion export across plasma membrane(GO:0097623) regulation of potassium ion export(GO:1902302) |
| 0.2 |
0.9 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.2 |
1.3 |
GO:0043137 |
DNA replication, removal of RNA primer(GO:0043137) |
| 0.2 |
1.1 |
GO:0070933 |
histone H4 deacetylation(GO:0070933) |
| 0.2 |
5.3 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.2 |
0.2 |
GO:0060971 |
embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.2 |
3.1 |
GO:0033866 |
coenzyme A biosynthetic process(GO:0015937) nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.2 |
0.4 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.2 |
0.6 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.2 |
0.2 |
GO:0043206 |
extracellular fibril organization(GO:0043206) fibril organization(GO:0097435) |
| 0.2 |
1.1 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.2 |
1.7 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.2 |
0.6 |
GO:0001580 |
detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.2 |
1.9 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.2 |
1.1 |
GO:0045618 |
positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.2 |
2.1 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 0.2 |
4.0 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.2 |
3.2 |
GO:0033622 |
integrin activation(GO:0033622) |
| 0.2 |
1.1 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 0.2 |
3.7 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.2 |
1.7 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.2 |
0.8 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.2 |
0.6 |
GO:1904357 |
negative regulation of telomere maintenance via telomere lengthening(GO:1904357) |
| 0.2 |
2.0 |
GO:0006490 |
oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.2 |
0.6 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.2 |
2.2 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.2 |
1.6 |
GO:0019835 |
cytolysis(GO:0019835) |
| 0.2 |
1.4 |
GO:0010764 |
negative regulation of fibroblast migration(GO:0010764) |
| 0.2 |
1.2 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 |
0.6 |
GO:0018008 |
N-terminal peptidyl-glycine N-myristoylation(GO:0018008) peptidyl-glycine modification(GO:0018201) |
| 0.2 |
1.0 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.2 |
1.5 |
GO:0033299 |
secretion of lysosomal enzymes(GO:0033299) |
| 0.2 |
0.6 |
GO:0045759 |
negative regulation of action potential(GO:0045759) |
| 0.2 |
2.1 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.2 |
8.4 |
GO:0030512 |
negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
| 0.2 |
0.2 |
GO:0008582 |
regulation of synaptic growth at neuromuscular junction(GO:0008582) regulation of sodium:potassium-exchanging ATPase activity(GO:1903406) |
| 0.2 |
0.8 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.2 |
1.5 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.2 |
2.6 |
GO:1900087 |
positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.2 |
0.9 |
GO:0060872 |
semicircular canal morphogenesis(GO:0048752) semicircular canal development(GO:0060872) |
| 0.2 |
1.3 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.2 |
1.1 |
GO:0090244 |
Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.2 |
0.9 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.2 |
4.6 |
GO:0000462 |
maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.2 |
0.7 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.2 |
3.7 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.2 |
0.5 |
GO:0046368 |
GDP-L-fucose metabolic process(GO:0046368) |
| 0.2 |
0.5 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.2 |
2.6 |
GO:0021542 |
dentate gyrus development(GO:0021542) |
| 0.2 |
0.4 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) positive regulation of centriole replication(GO:0046601) |
| 0.2 |
1.6 |
GO:0035020 |
regulation of Rac protein signal transduction(GO:0035020) |
| 0.2 |
1.6 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.2 |
2.5 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.2 |
1.2 |
GO:0031293 |
membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.2 |
0.9 |
GO:0033005 |
positive regulation of mast cell activation(GO:0033005) positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.2 |
2.3 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.2 |
0.7 |
GO:0045838 |
positive regulation of membrane potential(GO:0045838) |
| 0.2 |
1.2 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.2 |
1.6 |
GO:0032462 |
regulation of protein homooligomerization(GO:0032462) |
| 0.2 |
2.2 |
GO:0008340 |
determination of adult lifespan(GO:0008340) |
| 0.2 |
0.5 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.2 |
5.0 |
GO:0042274 |
ribosomal small subunit biogenesis(GO:0042274) |
| 0.2 |
0.9 |
GO:0044314 |
protein K27-linked ubiquitination(GO:0044314) |
| 0.2 |
0.3 |
GO:0070365 |
hepatocyte differentiation(GO:0070365) |
| 0.2 |
0.7 |
GO:0000737 |
DNA catabolic process, endonucleolytic(GO:0000737) |
| 0.2 |
1.4 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.2 |
1.2 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.2 |
2.9 |
GO:0006825 |
copper ion transport(GO:0006825) |
| 0.2 |
3.0 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.2 |
3.5 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.2 |
0.7 |
GO:1902224 |
cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.2 |
0.7 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.2 |
0.5 |
GO:0061002 |
negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.2 |
6.5 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.2 |
1.1 |
GO:0071168 |
protein localization to chromatin(GO:0071168) |
| 0.2 |
2.5 |
GO:0000184 |
nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.2 |
1.0 |
GO:0071360 |
cellular response to exogenous dsRNA(GO:0071360) |
| 0.2 |
1.0 |
GO:0006172 |
ADP biosynthetic process(GO:0006172) |
| 0.2 |
1.1 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.2 |
1.6 |
GO:0032876 |
regulation of DNA endoreduplication(GO:0032875) negative regulation of DNA endoreduplication(GO:0032876) DNA endoreduplication(GO:0042023) |
| 0.2 |
1.2 |
GO:0072673 |
lamellipodium morphogenesis(GO:0072673) |
| 0.2 |
1.4 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.2 |
1.1 |
GO:0070102 |
interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.2 |
0.8 |
GO:0006450 |
regulation of translational fidelity(GO:0006450) |
| 0.2 |
2.7 |
GO:0071320 |
cellular response to cAMP(GO:0071320) |
| 0.2 |
0.6 |
GO:0036481 |
intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
| 0.2 |
0.5 |
GO:0006788 |
heme oxidation(GO:0006788) |
| 0.2 |
0.8 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.2 |
0.8 |
GO:0051770 |
positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.1 |
0.4 |
GO:0032471 |
negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.1 |
1.5 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.1 |
1.6 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.1 |
0.6 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 |
1.8 |
GO:0006693 |
prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.1 |
0.6 |
GO:0042780 |
tRNA 3'-end processing(GO:0042780) |
| 0.1 |
1.2 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 |
0.4 |
GO:0033280 |
response to vitamin D(GO:0033280) |
| 0.1 |
0.6 |
GO:2000726 |
negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) negative regulation of cardiac muscle cell differentiation(GO:2000726) |
| 0.1 |
0.1 |
GO:1990564 |
protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 |
4.9 |
GO:0007091 |
metaphase/anaphase transition of mitotic cell cycle(GO:0007091) metaphase/anaphase transition of cell cycle(GO:0044784) |
| 0.1 |
8.6 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.1 |
0.6 |
GO:0048302 |
isotype switching to IgG isotypes(GO:0048291) regulation of isotype switching to IgG isotypes(GO:0048302) positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 |
2.3 |
GO:0050819 |
negative regulation of coagulation(GO:0050819) |
| 0.1 |
2.1 |
GO:0016973 |
poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.1 |
0.6 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.1 |
2.3 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.1 |
3.1 |
GO:0046825 |
regulation of protein export from nucleus(GO:0046825) |
| 0.1 |
0.6 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.1 |
0.3 |
GO:0048008 |
platelet-derived growth factor receptor signaling pathway(GO:0048008) |
| 0.1 |
0.7 |
GO:0060259 |
regulation of feeding behavior(GO:0060259) |
| 0.1 |
1.0 |
GO:1902065 |
response to L-glutamate(GO:1902065) |
| 0.1 |
1.0 |
GO:0032261 |
purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
| 0.1 |
1.4 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.1 |
0.5 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 |
0.7 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 |
0.5 |
GO:0048747 |
muscle fiber development(GO:0048747) |
| 0.1 |
1.3 |
GO:0045040 |
protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 |
1.2 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 |
1.7 |
GO:0071577 |
zinc II ion transmembrane transport(GO:0071577) |
| 0.1 |
0.4 |
GO:0070166 |
enamel mineralization(GO:0070166) |
| 0.1 |
1.7 |
GO:0045672 |
positive regulation of osteoclast differentiation(GO:0045672) |
| 0.1 |
2.0 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.1 |
1.2 |
GO:0071229 |
cellular response to acid chemical(GO:0071229) |
| 0.1 |
1.2 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 |
0.5 |
GO:0006681 |
galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.1 |
2.5 |
GO:0045026 |
plasma membrane fusion(GO:0045026) |
| 0.1 |
0.3 |
GO:0002924 |
negative regulation of B cell mediated immunity(GO:0002713) negative regulation of immunoglobulin mediated immune response(GO:0002890) negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.1 |
1.2 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 |
2.3 |
GO:0030201 |
heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.1 |
0.5 |
GO:0035743 |
CD4-positive, alpha-beta T cell cytokine production(GO:0035743) T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 |
0.8 |
GO:0051534 |
negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.1 |
0.8 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.1 |
2.0 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.1 |
1.1 |
GO:0006349 |
regulation of gene expression by genetic imprinting(GO:0006349) |
| 0.1 |
1.0 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 |
1.0 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 |
0.6 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.1 |
3.6 |
GO:0034605 |
cellular response to heat(GO:0034605) |
| 0.1 |
2.6 |
GO:0043123 |
positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
| 0.1 |
1.5 |
GO:0060219 |
camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.1 |
1.2 |
GO:0051591 |
response to cAMP(GO:0051591) |
| 0.1 |
0.9 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.1 |
4.3 |
GO:0001895 |
retina homeostasis(GO:0001895) |
| 0.1 |
1.0 |
GO:0050858 |
negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 |
0.4 |
GO:0007213 |
G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.1 |
1.1 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.1 |
0.4 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.1 |
7.7 |
GO:0043484 |
regulation of RNA splicing(GO:0043484) |
| 0.1 |
1.4 |
GO:0048255 |
mRNA stabilization(GO:0048255) |
| 0.1 |
0.4 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) |
| 0.1 |
2.7 |
GO:0002244 |
hematopoietic progenitor cell differentiation(GO:0002244) |
| 0.1 |
1.5 |
GO:0032801 |
receptor catabolic process(GO:0032801) |
| 0.1 |
0.6 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 |
0.4 |
GO:0043970 |
histone H3-K9 acetylation(GO:0043970) |
| 0.1 |
5.3 |
GO:2000045 |
regulation of G1/S transition of mitotic cell cycle(GO:2000045) |
| 0.1 |
1.2 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.1 |
1.7 |
GO:0045722 |
positive regulation of gluconeogenesis(GO:0045722) |
| 0.1 |
4.0 |
GO:1902653 |
cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
| 0.1 |
0.9 |
GO:0043923 |
positive regulation by host of viral transcription(GO:0043923) |
| 0.1 |
0.8 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.1 |
3.4 |
GO:0006220 |
pyrimidine nucleotide metabolic process(GO:0006220) |
| 0.1 |
0.8 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 |
3.7 |
GO:0000038 |
very long-chain fatty acid metabolic process(GO:0000038) |
| 0.1 |
2.2 |
GO:0046856 |
phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 |
0.5 |
GO:0045089 |
positive regulation of innate immune response(GO:0045089) |
| 0.1 |
0.4 |
GO:0048678 |
response to axon injury(GO:0048678) |
| 0.1 |
1.1 |
GO:0006828 |
manganese ion transport(GO:0006828) |
| 0.1 |
1.4 |
GO:0044243 |
collagen catabolic process(GO:0030574) multicellular organism catabolic process(GO:0044243) |
| 0.1 |
0.6 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.1 |
1.4 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.1 |
0.3 |
GO:0032042 |
mitochondrial DNA metabolic process(GO:0032042) |
| 0.1 |
1.0 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.1 |
0.7 |
GO:0031584 |
activation of phospholipase D activity(GO:0031584) |
| 0.1 |
0.3 |
GO:0032415 |
renal sodium ion transport(GO:0003096) regulation of sodium:proton antiporter activity(GO:0032415) glutathione transport(GO:0034635) tripeptide transport(GO:0042939) phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.1 |
0.2 |
GO:1902808 |
positive regulation of cell cycle G1/S phase transition(GO:1902808) |
| 0.1 |
1.4 |
GO:0006940 |
regulation of smooth muscle contraction(GO:0006940) |
| 0.1 |
2.7 |
GO:0001658 |
branching involved in ureteric bud morphogenesis(GO:0001658) |
| 0.1 |
0.1 |
GO:1904996 |
positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.1 |
0.3 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.1 |
1.5 |
GO:0030518 |
intracellular steroid hormone receptor signaling pathway(GO:0030518) |
| 0.1 |
1.0 |
GO:0010867 |
positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.1 |
0.3 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.1 |
1.2 |
GO:0016486 |
peptide hormone processing(GO:0016486) |
| 0.1 |
0.3 |
GO:0031282 |
regulation of guanylate cyclase activity(GO:0031282) |
| 0.1 |
0.5 |
GO:0090400 |
stress-induced premature senescence(GO:0090400) |
| 0.1 |
0.4 |
GO:0006308 |
DNA catabolic process(GO:0006308) |
| 0.1 |
0.4 |
GO:0033689 |
negative regulation of osteoblast proliferation(GO:0033689) semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 |
1.4 |
GO:0040018 |
positive regulation of multicellular organism growth(GO:0040018) |
| 0.1 |
0.7 |
GO:0009109 |
coenzyme catabolic process(GO:0009109) |
| 0.1 |
1.5 |
GO:0009649 |
entrainment of circadian clock(GO:0009649) |
| 0.1 |
1.1 |
GO:0000305 |
response to oxygen radical(GO:0000305) |
| 0.1 |
3.7 |
GO:0007229 |
integrin-mediated signaling pathway(GO:0007229) |
| 0.1 |
3.7 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.1 |
0.3 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 |
1.0 |
GO:0021683 |
cerebellar granular layer morphogenesis(GO:0021683) |
| 0.1 |
0.3 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.1 |
0.9 |
GO:2000678 |
negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.1 |
0.4 |
GO:1900246 |
positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.1 |
0.9 |
GO:0006465 |
signal peptide processing(GO:0006465) |
| 0.1 |
0.2 |
GO:0007182 |
common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.1 |
0.8 |
GO:0070498 |
interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.1 |
0.3 |
GO:0001830 |
trophectodermal cell fate commitment(GO:0001830) |
| 0.1 |
0.3 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.1 |
1.8 |
GO:0008214 |
protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
| 0.1 |
1.2 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.1 |
0.2 |
GO:0006532 |
aspartate biosynthetic process(GO:0006532) |
| 0.1 |
0.7 |
GO:1904153 |
negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 |
0.6 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 |
0.4 |
GO:0030259 |
lipid glycosylation(GO:0030259) |
| 0.1 |
0.2 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.1 |
0.2 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 0.1 |
0.8 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.1 |
0.4 |
GO:0032196 |
transposition(GO:0032196) |
| 0.1 |
0.5 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.1 |
1.8 |
GO:0006406 |
mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
| 0.1 |
0.5 |
GO:2000192 |
regulation of plasma membrane long-chain fatty acid transport(GO:0010746) negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) plasma membrane long-chain fatty acid transport(GO:0015911) fatty acid transmembrane transport(GO:1902001) negative regulation of fatty acid transport(GO:2000192) |
| 0.1 |
0.5 |
GO:0005513 |
detection of calcium ion(GO:0005513) |
| 0.1 |
0.6 |
GO:0007168 |
receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.1 |
0.5 |
GO:0006265 |
DNA topological change(GO:0006265) |
| 0.1 |
0.3 |
GO:0042219 |
cellular modified amino acid catabolic process(GO:0042219) |
| 0.1 |
3.6 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.1 |
1.1 |
GO:0032781 |
positive regulation of ATPase activity(GO:0032781) |
| 0.1 |
0.7 |
GO:0045947 |
negative regulation of translational initiation(GO:0045947) |
| 0.1 |
0.2 |
GO:0002566 |
somatic diversification of immune receptors via somatic mutation(GO:0002566) |
| 0.1 |
2.6 |
GO:0042633 |
molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.1 |
0.5 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.1 |
0.6 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.1 |
0.2 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.1 |
2.2 |
GO:1902017 |
regulation of cilium assembly(GO:1902017) |
| 0.1 |
1.1 |
GO:0033235 |
positive regulation of protein sumoylation(GO:0033235) |
| 0.1 |
0.1 |
GO:2000758 |
positive regulation of histone acetylation(GO:0035066) positive regulation of peptidyl-lysine acetylation(GO:2000758) |
| 0.1 |
2.9 |
GO:0000380 |
alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.1 |
0.3 |
GO:0006677 |
glycosylceramide metabolic process(GO:0006677) |
| 0.1 |
1.7 |
GO:0051693 |
actin filament capping(GO:0051693) |
| 0.1 |
0.9 |
GO:0051496 |
positive regulation of stress fiber assembly(GO:0051496) |
| 0.1 |
2.5 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.1 |
2.5 |
GO:0006493 |
protein O-linked glycosylation(GO:0006493) |
| 0.1 |
0.9 |
GO:0060325 |
face morphogenesis(GO:0060325) |
| 0.1 |
1.4 |
GO:0051592 |
response to calcium ion(GO:0051592) |
| 0.1 |
0.3 |
GO:0002921 |
negative regulation of humoral immune response(GO:0002921) |
| 0.1 |
0.8 |
GO:0042491 |
auditory receptor cell differentiation(GO:0042491) |
| 0.1 |
0.5 |
GO:0060479 |
lung epithelium development(GO:0060428) lung cell differentiation(GO:0060479) lung epithelial cell differentiation(GO:0060487) |
| 0.1 |
1.1 |
GO:0000186 |
activation of MAPKK activity(GO:0000186) |
| 0.1 |
0.1 |
GO:0032733 |
positive regulation of interleukin-10 production(GO:0032733) |
| 0.1 |
0.1 |
GO:2000416 |
regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
| 0.1 |
0.5 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.1 |
0.3 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.1 |
0.2 |
GO:0019673 |
GDP-mannose metabolic process(GO:0019673) |
| 0.1 |
0.6 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 0.1 |
0.1 |
GO:0035864 |
response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.1 |
0.5 |
GO:0033006 |
regulation of mast cell activation involved in immune response(GO:0033006) regulation of mast cell degranulation(GO:0043304) |
| 0.1 |
0.3 |
GO:0032869 |
cellular response to insulin stimulus(GO:0032869) |
| 0.1 |
0.2 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 |
1.9 |
GO:0008589 |
regulation of smoothened signaling pathway(GO:0008589) |
| 0.1 |
0.8 |
GO:0000154 |
rRNA modification(GO:0000154) |
| 0.1 |
0.9 |
GO:1902230 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.1 |
1.2 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.1 |
2.8 |
GO:0008584 |
male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) |
| 0.1 |
0.2 |
GO:0036260 |
7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.1 |
0.4 |
GO:2001238 |
positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.1 |
0.4 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 |
0.3 |
GO:0006878 |
cellular copper ion homeostasis(GO:0006878) |
| 0.1 |
0.6 |
GO:2000480 |
regulation of cAMP-dependent protein kinase activity(GO:2000479) negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 |
0.9 |
GO:0033209 |
tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.1 |
0.5 |
GO:0045646 |
regulation of erythrocyte differentiation(GO:0045646) |
| 0.1 |
1.3 |
GO:0032011 |
ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 |
0.7 |
GO:1901184 |
regulation of ERBB signaling pathway(GO:1901184) |
| 0.1 |
0.1 |
GO:0061036 |
positive regulation of cartilage development(GO:0061036) |
| 0.1 |
1.0 |
GO:0032008 |
positive regulation of TOR signaling(GO:0032008) |
| 0.1 |
1.7 |
GO:0016574 |
histone ubiquitination(GO:0016574) |
| 0.1 |
0.2 |
GO:0006706 |
steroid catabolic process(GO:0006706) |
| 0.1 |
0.5 |
GO:0009143 |
nucleoside triphosphate catabolic process(GO:0009143) |
| 0.1 |
0.1 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.1 |
1.4 |
GO:0017145 |
stem cell division(GO:0017145) |
| 0.1 |
0.7 |
GO:1904894 |
positive regulation of JAK-STAT cascade(GO:0046427) positive regulation of STAT cascade(GO:1904894) |
| 0.1 |
1.9 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.1 |
0.2 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.0 |
0.1 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.0 |
2.0 |
GO:0007224 |
smoothened signaling pathway(GO:0007224) |
| 0.0 |
0.2 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.0 |
0.2 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.0 |
0.7 |
GO:0061647 |
histone H3-K9 modification(GO:0061647) |
| 0.0 |
0.1 |
GO:0043323 |
regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.0 |
1.4 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.0 |
0.5 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.0 |
0.4 |
GO:0030947 |
regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030947) |
| 0.0 |
0.2 |
GO:0071447 |
response to hydroperoxide(GO:0033194) cellular response to hydroperoxide(GO:0071447) |
| 0.0 |
1.0 |
GO:0070534 |
protein K63-linked ubiquitination(GO:0070534) |
| 0.0 |
0.7 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.0 |
0.1 |
GO:0097066 |
response to thyroid hormone(GO:0097066) |
| 0.0 |
0.9 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 0.0 |
0.8 |
GO:0060348 |
bone development(GO:0060348) |
| 0.0 |
0.3 |
GO:0034312 |
diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.0 |
0.5 |
GO:0046676 |
negative regulation of insulin secretion(GO:0046676) |
| 0.0 |
0.3 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 |
0.2 |
GO:1990928 |
response to amino acid starvation(GO:1990928) |
| 0.0 |
0.4 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.0 |
0.1 |
GO:0034379 |
very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.0 |
0.3 |
GO:0006801 |
superoxide metabolic process(GO:0006801) |
| 0.0 |
0.3 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 |
0.5 |
GO:0006760 |
folic acid-containing compound metabolic process(GO:0006760) |
| 0.0 |
0.5 |
GO:0051156 |
glucose 6-phosphate metabolic process(GO:0051156) |
| 0.0 |
0.1 |
GO:0046456 |
icosanoid biosynthetic process(GO:0046456) fatty acid derivative biosynthetic process(GO:1901570) |
| 0.0 |
0.3 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 |
0.4 |
GO:0006817 |
phosphate ion transport(GO:0006817) |
| 0.0 |
1.3 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.0 |
0.2 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 |
0.4 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.0 |
0.3 |
GO:0015858 |
nucleoside transport(GO:0015858) |
| 0.0 |
0.7 |
GO:0002066 |
columnar/cuboidal epithelial cell development(GO:0002066) |
| 0.0 |
0.2 |
GO:1901070 |
guanosine-containing compound biosynthetic process(GO:1901070) |
| 0.0 |
0.7 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.0 |
0.1 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.0 |
0.3 |
GO:0031295 |
lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
| 0.0 |
0.9 |
GO:0002088 |
lens development in camera-type eye(GO:0002088) |
| 0.0 |
0.4 |
GO:0010388 |
cullin deneddylation(GO:0010388) |
| 0.0 |
0.1 |
GO:0099587 |
sodium ion import(GO:0097369) inorganic cation import into cell(GO:0098659) sodium ion import across plasma membrane(GO:0098719) inorganic ion import into cell(GO:0099587) sodium ion import into cell(GO:1990118) |
| 0.0 |
0.1 |
GO:0035928 |
rRNA import into mitochondrion(GO:0035928) |
| 0.0 |
0.5 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.0 |
1.7 |
GO:0007059 |
chromosome segregation(GO:0007059) |
| 0.0 |
0.7 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.0 |
0.2 |
GO:0031047 |
gene silencing by RNA(GO:0031047) |
| 0.0 |
0.1 |
GO:0032485 |
regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 |
0.1 |
GO:0010592 |
positive regulation of lamellipodium assembly(GO:0010592) |
| 0.0 |
0.1 |
GO:0008300 |
isoprenoid catabolic process(GO:0008300) |
| 0.0 |
0.7 |
GO:0006418 |
tRNA aminoacylation for protein translation(GO:0006418) |
| 0.0 |
0.1 |
GO:0042255 |
ribosome assembly(GO:0042255) |
| 0.0 |
0.1 |
GO:0002507 |
tolerance induction(GO:0002507) |
| 0.0 |
0.2 |
GO:0002082 |
regulation of oxidative phosphorylation(GO:0002082) |
| 0.0 |
0.2 |
GO:0051057 |
positive regulation of small GTPase mediated signal transduction(GO:0051057) |
| 0.0 |
0.1 |
GO:0038032 |
termination of G-protein coupled receptor signaling pathway(GO:0038032) |
| 0.0 |
0.1 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.0 |
0.1 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.0 |
0.2 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 |
0.3 |
GO:0051443 |
positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 0.0 |
0.1 |
GO:0019985 |
translesion synthesis(GO:0019985) |
| 0.0 |
0.1 |
GO:0070141 |
response to UV-A(GO:0070141) cellular response to UV-A(GO:0071492) |
| 0.0 |
0.4 |
GO:0010508 |
positive regulation of autophagy(GO:0010508) |
| 0.0 |
0.8 |
GO:0006633 |
fatty acid biosynthetic process(GO:0006633) |
| 0.0 |
0.1 |
GO:0032673 |
regulation of interleukin-4 production(GO:0032673) |
| 0.0 |
0.8 |
GO:0030032 |
lamellipodium assembly(GO:0030032) |
| 0.0 |
0.2 |
GO:0006103 |
2-oxoglutarate metabolic process(GO:0006103) |
| 0.0 |
0.0 |
GO:0001923 |
B-1 B cell differentiation(GO:0001923) |
| 0.0 |
0.4 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 |
0.1 |
GO:2000398 |
regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
| 0.0 |
0.1 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.0 |
0.1 |
GO:1901409 |
regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.0 |
0.1 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 |
0.0 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.0 |
0.1 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.0 |
1.4 |
GO:0000398 |
RNA splicing, via transesterification reactions with bulged adenosine as nucleophile(GO:0000377) mRNA splicing, via spliceosome(GO:0000398) |
| 0.0 |
0.1 |
GO:0034315 |
regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.0 |
0.3 |
GO:0006970 |
response to osmotic stress(GO:0006970) |
| 0.0 |
0.1 |
GO:0001963 |
synaptic transmission, dopaminergic(GO:0001963) |
| 0.0 |
0.2 |
GO:0007588 |
excretion(GO:0007588) |
| 0.0 |
0.2 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.0 |
0.2 |
GO:0072337 |
modified amino acid transport(GO:0072337) |
| 0.0 |
0.2 |
GO:0007614 |
short-term memory(GO:0007614) |
| 0.0 |
0.0 |
GO:0061000 |
negative regulation of dendritic spine development(GO:0061000) |
| 0.0 |
0.0 |
GO:0071318 |
cellular response to ATP(GO:0071318) |
| 0.0 |
0.2 |
GO:0031333 |
negative regulation of protein complex assembly(GO:0031333) |
| 0.0 |
0.0 |
GO:1900740 |
regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.0 |
0.3 |
GO:0000070 |
mitotic sister chromatid segregation(GO:0000070) |
| 0.0 |
0.0 |
GO:0034390 |
smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
