| 3.7 |
11.1 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 3.3 |
10.0 |
GO:0060364 |
frontal suture morphogenesis(GO:0060364) |
| 3.0 |
8.9 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 2.4 |
24.5 |
GO:0060059 |
embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 2.4 |
7.2 |
GO:0060489 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 2.3 |
6.8 |
GO:0014877 |
response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 2.2 |
11.1 |
GO:2000382 |
positive regulation of mesoderm development(GO:2000382) |
| 2.2 |
8.8 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 2.1 |
8.6 |
GO:0003360 |
brainstem development(GO:0003360) |
| 2.1 |
2.1 |
GO:0033278 |
cell proliferation in midbrain(GO:0033278) |
| 2.0 |
6.0 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 1.9 |
9.6 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 1.9 |
9.3 |
GO:0021965 |
spinal cord ventral commissure morphogenesis(GO:0021965) |
| 1.9 |
5.6 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 1.9 |
3.7 |
GO:0034377 |
plasma lipoprotein particle assembly(GO:0034377) |
| 1.9 |
5.6 |
GO:0003150 |
muscular septum morphogenesis(GO:0003150) |
| 1.8 |
5.5 |
GO:0048352 |
neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) |
| 1.8 |
5.4 |
GO:0035604 |
fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) coronal suture morphogenesis(GO:0060365) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) |
| 1.8 |
1.8 |
GO:0048382 |
mesendoderm development(GO:0048382) |
| 1.7 |
15.6 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 1.7 |
1.7 |
GO:0003431 |
growth plate cartilage chondrocyte development(GO:0003431) |
| 1.7 |
6.7 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 1.7 |
5.0 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 1.6 |
6.5 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 1.6 |
4.8 |
GO:0035878 |
nail development(GO:0035878) |
| 1.5 |
1.5 |
GO:0032916 |
positive regulation of transforming growth factor beta3 production(GO:0032916) |
| 1.5 |
10.4 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 1.5 |
5.9 |
GO:0048319 |
axial mesoderm morphogenesis(GO:0048319) |
| 1.5 |
10.2 |
GO:0060842 |
arterial endothelial cell differentiation(GO:0060842) |
| 1.4 |
1.4 |
GO:0046628 |
positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 1.4 |
4.3 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 1.4 |
5.6 |
GO:0060022 |
hard palate development(GO:0060022) |
| 1.4 |
9.6 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 1.3 |
3.9 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 1.3 |
1.3 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 1.3 |
1.3 |
GO:2000170 |
positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 1.3 |
1.3 |
GO:0060423 |
foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
| 1.3 |
11.3 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 1.3 |
5.0 |
GO:0000415 |
negative regulation of histone H3-K36 methylation(GO:0000415) |
| 1.2 |
6.2 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 1.2 |
5.0 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 1.2 |
7.4 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 1.2 |
10.5 |
GO:0046499 |
S-adenosylmethioninamine metabolic process(GO:0046499) |
| 1.2 |
8.2 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 1.2 |
18.6 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 1.1 |
2.3 |
GO:0072138 |
mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
| 1.1 |
4.4 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 1.1 |
3.3 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 1.1 |
5.5 |
GO:2000065 |
negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 1.1 |
6.5 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 1.1 |
3.3 |
GO:1904395 |
positive regulation of receptor clustering(GO:1903911) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 1.1 |
1.1 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 1.1 |
3.2 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 1.1 |
4.3 |
GO:0044268 |
multicellular organismal protein metabolic process(GO:0044268) |
| 1.0 |
2.1 |
GO:1902255 |
positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 1.0 |
2.1 |
GO:1902915 |
negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 1.0 |
2.0 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 1.0 |
2.0 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 1.0 |
5.0 |
GO:0060054 |
positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 1.0 |
8.9 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 1.0 |
2.0 |
GO:2000974 |
negative regulation of pro-B cell differentiation(GO:2000974) |
| 1.0 |
1.0 |
GO:0009786 |
regulation of asymmetric cell division(GO:0009786) |
| 1.0 |
2.9 |
GO:0007354 |
zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 1.0 |
4.8 |
GO:0046601 |
positive regulation of centriole replication(GO:0046601) |
| 1.0 |
8.7 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 1.0 |
3.9 |
GO:0051643 |
endoplasmic reticulum localization(GO:0051643) |
| 1.0 |
1.0 |
GO:0072194 |
kidney smooth muscle tissue development(GO:0072194) |
| 1.0 |
3.8 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 1.0 |
2.9 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.9 |
2.8 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 0.9 |
8.5 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) |
| 0.9 |
5.6 |
GO:0060486 |
Clara cell differentiation(GO:0060486) |
| 0.9 |
0.9 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 0.9 |
2.8 |
GO:0003349 |
epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.9 |
2.8 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.9 |
3.7 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.9 |
4.6 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.9 |
5.5 |
GO:0003383 |
apical constriction(GO:0003383) |
| 0.9 |
2.7 |
GO:0007290 |
spermatid nucleus elongation(GO:0007290) |
| 0.9 |
4.5 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 0.9 |
0.9 |
GO:0061511 |
centriole elongation(GO:0061511) |
| 0.9 |
0.9 |
GO:2000780 |
negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
| 0.9 |
0.9 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.9 |
8.9 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.9 |
0.9 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.9 |
2.6 |
GO:0009177 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 0.9 |
0.9 |
GO:0043974 |
histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.9 |
2.6 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.9 |
4.3 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.9 |
0.9 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.9 |
2.6 |
GO:0014809 |
regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.9 |
0.9 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.9 |
3.4 |
GO:2000053 |
regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 0.8 |
1.7 |
GO:0061343 |
cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.8 |
5.9 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.8 |
1.7 |
GO:0002069 |
columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.8 |
1.7 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.8 |
0.8 |
GO:0097694 |
establishment of RNA localization to telomere(GO:0097694) |
| 0.8 |
4.1 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.8 |
7.4 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.8 |
2.5 |
GO:0030916 |
otic vesicle formation(GO:0030916) |
| 0.8 |
4.9 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 0.8 |
2.5 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.8 |
3.3 |
GO:2001271 |
negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.8 |
4.0 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.8 |
2.4 |
GO:0001827 |
inner cell mass cell fate commitment(GO:0001827) |
| 0.8 |
2.3 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.8 |
3.9 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.8 |
1.5 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 0.8 |
1.5 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.8 |
0.8 |
GO:0061198 |
fungiform papilla formation(GO:0061198) |
| 0.8 |
1.5 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.8 |
2.3 |
GO:0000059 |
protein import into nucleus, docking(GO:0000059) |
| 0.8 |
3.8 |
GO:0060528 |
secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.8 |
0.8 |
GO:2000338 |
chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
| 0.8 |
5.3 |
GO:0000320 |
re-entry into mitotic cell cycle(GO:0000320) |
| 0.8 |
3.0 |
GO:0007056 |
spindle assembly involved in female meiosis(GO:0007056) |
| 0.7 |
4.5 |
GO:0071699 |
olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.7 |
5.2 |
GO:1902715 |
positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.7 |
2.2 |
GO:0021893 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) |
| 0.7 |
2.2 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.7 |
6.6 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 0.7 |
6.6 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.7 |
0.7 |
GO:0021510 |
spinal cord development(GO:0021510) |
| 0.7 |
1.5 |
GO:0072131 |
kidney mesenchyme morphogenesis(GO:0072131) metanephric mesenchyme morphogenesis(GO:0072133) |
| 0.7 |
6.6 |
GO:0060613 |
fat pad development(GO:0060613) |
| 0.7 |
5.8 |
GO:0006930 |
substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.7 |
2.2 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.7 |
2.2 |
GO:0097477 |
lateral motor column neuron migration(GO:0097477) |
| 0.7 |
2.2 |
GO:0003263 |
cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) regulation of secondary heart field cardioblast proliferation(GO:0003266) |
| 0.7 |
2.9 |
GO:0010668 |
ectodermal cell differentiation(GO:0010668) |
| 0.7 |
2.9 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.7 |
2.1 |
GO:0072356 |
chromosome passenger complex localization to kinetochore(GO:0072356) |
| 0.7 |
1.4 |
GO:0002572 |
pro-T cell differentiation(GO:0002572) |
| 0.7 |
0.7 |
GO:1904192 |
cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.7 |
1.4 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.7 |
2.1 |
GO:0070212 |
protein poly-ADP-ribosylation(GO:0070212) |
| 0.7 |
2.1 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.7 |
2.8 |
GO:0014835 |
myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.7 |
2.8 |
GO:0061188 |
regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.7 |
2.8 |
GO:0072675 |
osteoclast fusion(GO:0072675) |
| 0.7 |
2.1 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 0.7 |
3.4 |
GO:0021798 |
forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.7 |
0.7 |
GO:0060527 |
prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
| 0.7 |
2.7 |
GO:0061643 |
chemorepulsion of axon(GO:0061643) |
| 0.7 |
2.7 |
GO:0072137 |
condensed mesenchymal cell proliferation(GO:0072137) |
| 0.7 |
2.0 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.7 |
0.7 |
GO:0010571 |
positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.7 |
2.0 |
GO:0042998 |
positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.7 |
5.9 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.7 |
2.6 |
GO:2000774 |
positive regulation of cellular senescence(GO:2000774) |
| 0.7 |
2.0 |
GO:1901420 |
negative regulation of response to alcohol(GO:1901420) |
| 0.7 |
3.3 |
GO:1902894 |
negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.7 |
2.6 |
GO:0021764 |
amygdala development(GO:0021764) |
| 0.6 |
3.9 |
GO:0045583 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.6 |
1.9 |
GO:1902965 |
regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.6 |
1.9 |
GO:0000087 |
mitotic M phase(GO:0000087) |
| 0.6 |
2.6 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 0.6 |
1.9 |
GO:0042505 |
tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.6 |
3.2 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.6 |
1.3 |
GO:0060166 |
olfactory pit development(GO:0060166) |
| 0.6 |
5.1 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.6 |
4.3 |
GO:0007440 |
foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
| 0.6 |
1.9 |
GO:2000819 |
regulation of nucleotide-excision repair(GO:2000819) |
| 0.6 |
3.7 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.6 |
4.3 |
GO:0021747 |
cochlear nucleus development(GO:0021747) |
| 0.6 |
2.4 |
GO:0071139 |
resolution of recombination intermediates(GO:0071139) |
| 0.6 |
4.9 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.6 |
0.6 |
GO:2000832 |
negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.6 |
7.3 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.6 |
1.8 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 0.6 |
1.8 |
GO:0090298 |
negative regulation of mitochondrial DNA replication(GO:0090298) |
| 0.6 |
1.8 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.6 |
3.6 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.6 |
3.0 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.6 |
2.4 |
GO:0006207 |
'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.6 |
0.6 |
GO:0040037 |
negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.6 |
0.6 |
GO:0070571 |
negative regulation of neuron projection regeneration(GO:0070571) |
| 0.6 |
13.6 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.6 |
1.8 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 0.6 |
1.8 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 0.6 |
4.1 |
GO:0000022 |
mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.6 |
2.9 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.6 |
3.5 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 0.6 |
2.3 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.6 |
2.3 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 0.6 |
1.7 |
GO:0032817 |
regulation of natural killer cell proliferation(GO:0032817) positive regulation of natural killer cell proliferation(GO:0032819) |
| 0.6 |
1.7 |
GO:1903753 |
negative regulation of p38MAPK cascade(GO:1903753) |
| 0.6 |
0.6 |
GO:0072368 |
regulation of lipid transport by negative regulation of transcription from RNA polymerase II promoter(GO:0072368) |
| 0.6 |
3.4 |
GO:0061029 |
eyelid development in camera-type eye(GO:0061029) |
| 0.6 |
1.1 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.6 |
2.9 |
GO:0015871 |
choline transport(GO:0015871) |
| 0.6 |
1.7 |
GO:0046101 |
hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.6 |
0.6 |
GO:0010519 |
negative regulation of phospholipase activity(GO:0010519) |
| 0.6 |
1.7 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.6 |
0.6 |
GO:0051983 |
regulation of chromosome segregation(GO:0051983) |
| 0.6 |
2.8 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.6 |
1.7 |
GO:0009174 |
UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.6 |
17.9 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.6 |
0.6 |
GO:0032058 |
positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.6 |
1.7 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.6 |
0.6 |
GO:0003289 |
atrial septum primum morphogenesis(GO:0003289) |
| 0.6 |
1.1 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.6 |
1.7 |
GO:0071865 |
regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.5 |
6.0 |
GO:0007100 |
mitotic centrosome separation(GO:0007100) |
| 0.5 |
0.5 |
GO:0071679 |
commissural neuron axon guidance(GO:0071679) |
| 0.5 |
2.7 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.5 |
1.6 |
GO:0097401 |
synaptic vesicle lumen acidification(GO:0097401) |
| 0.5 |
5.4 |
GO:0061470 |
T follicular helper cell differentiation(GO:0061470) |
| 0.5 |
4.3 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.5 |
2.7 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.5 |
2.1 |
GO:0030050 |
vesicle transport along actin filament(GO:0030050) |
| 0.5 |
2.1 |
GO:0097411 |
hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.5 |
1.1 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.5 |
3.2 |
GO:0006344 |
maintenance of chromatin silencing(GO:0006344) |
| 0.5 |
1.6 |
GO:0019858 |
cytosine metabolic process(GO:0019858) |
| 0.5 |
1.6 |
GO:0045472 |
response to ether(GO:0045472) |
| 0.5 |
2.1 |
GO:1903416 |
response to glycoside(GO:1903416) |
| 0.5 |
2.1 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.5 |
1.6 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 0.5 |
3.2 |
GO:0090091 |
positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.5 |
1.6 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.5 |
1.0 |
GO:0021852 |
pyramidal neuron migration(GO:0021852) |
| 0.5 |
3.6 |
GO:0042487 |
regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.5 |
3.1 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.5 |
4.1 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 0.5 |
2.1 |
GO:0045414 |
regulation of interleukin-8 biosynthetic process(GO:0045414) |
| 0.5 |
2.6 |
GO:0060295 |
regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.5 |
1.5 |
GO:0001840 |
neural plate development(GO:0001840) |
| 0.5 |
2.0 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.5 |
3.6 |
GO:0045200 |
establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.5 |
4.6 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.5 |
3.0 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) |
| 0.5 |
1.0 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.5 |
2.0 |
GO:0002681 |
somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
| 0.5 |
1.5 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.5 |
2.0 |
GO:1903690 |
negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.5 |
0.5 |
GO:0042117 |
monocyte activation(GO:0042117) |
| 0.5 |
0.5 |
GO:0021960 |
anterior commissure morphogenesis(GO:0021960) |
| 0.5 |
3.4 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.5 |
3.9 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.5 |
1.9 |
GO:0002667 |
lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.5 |
0.5 |
GO:1904749 |
protein localization to nucleolus(GO:1902570) regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.5 |
1.4 |
GO:0000414 |
regulation of histone H3-K36 methylation(GO:0000414) |
| 0.5 |
0.5 |
GO:0098763 |
mitotic cell cycle phase(GO:0098763) |
| 0.5 |
1.4 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.5 |
3.4 |
GO:1904017 |
response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.5 |
1.4 |
GO:0060809 |
mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 0.5 |
2.4 |
GO:0000212 |
meiotic spindle organization(GO:0000212) |
| 0.5 |
1.0 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.5 |
5.7 |
GO:0043517 |
positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.5 |
0.5 |
GO:0035561 |
regulation of chromatin binding(GO:0035561) negative regulation of chromatin binding(GO:0035562) |
| 0.5 |
3.3 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.5 |
1.4 |
GO:0018008 |
N-terminal peptidyl-glycine N-myristoylation(GO:0018008) peptidyl-glycine modification(GO:0018201) |
| 0.5 |
0.5 |
GO:0007435 |
salivary gland morphogenesis(GO:0007435) |
| 0.5 |
5.2 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.5 |
1.4 |
GO:0046370 |
fructose biosynthetic process(GO:0046370) |
| 0.5 |
1.9 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) cellular response to vitamin D(GO:0071305) |
| 0.5 |
1.4 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.5 |
1.4 |
GO:2000620 |
positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.5 |
7.5 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.5 |
0.5 |
GO:0032747 |
positive regulation of interleukin-23 production(GO:0032747) |
| 0.5 |
1.4 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.5 |
0.9 |
GO:0071896 |
protein localization to adherens junction(GO:0071896) |
| 0.5 |
1.4 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.5 |
0.9 |
GO:2000744 |
anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.5 |
6.8 |
GO:0007252 |
I-kappaB phosphorylation(GO:0007252) |
| 0.5 |
1.4 |
GO:0060430 |
lung saccule development(GO:0060430) |
| 0.5 |
3.7 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.5 |
1.4 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 0.5 |
1.4 |
GO:0060912 |
cardiac cell fate specification(GO:0060912) |
| 0.5 |
1.4 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.4 |
0.9 |
GO:0007063 |
regulation of sister chromatid cohesion(GO:0007063) |
| 0.4 |
1.3 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.4 |
0.4 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.4 |
3.1 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.4 |
1.8 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 0.4 |
2.6 |
GO:0046599 |
regulation of centriole replication(GO:0046599) |
| 0.4 |
1.8 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.4 |
0.9 |
GO:0070601 |
centromeric sister chromatid cohesion(GO:0070601) |
| 0.4 |
2.2 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.4 |
5.7 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.4 |
4.8 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.4 |
2.2 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.4 |
0.9 |
GO:0060399 |
positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.4 |
1.7 |
GO:0097680 |
double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.4 |
1.3 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.4 |
2.2 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.4 |
2.6 |
GO:1900246 |
positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.4 |
3.9 |
GO:0022027 |
interkinetic nuclear migration(GO:0022027) |
| 0.4 |
2.1 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.4 |
3.0 |
GO:0071168 |
protein localization to chromatin(GO:0071168) |
| 0.4 |
1.7 |
GO:0006338 |
chromatin remodeling(GO:0006338) |
| 0.4 |
5.1 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.4 |
3.0 |
GO:0030853 |
negative regulation of granulocyte differentiation(GO:0030853) |
| 0.4 |
0.8 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.4 |
5.9 |
GO:0006999 |
nuclear pore organization(GO:0006999) |
| 0.4 |
2.9 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.4 |
2.9 |
GO:0000055 |
ribosomal large subunit export from nucleus(GO:0000055) |
| 0.4 |
3.7 |
GO:1902913 |
positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.4 |
2.1 |
GO:0086045 |
membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.4 |
2.1 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.4 |
1.2 |
GO:0060763 |
mammary duct terminal end bud growth(GO:0060763) |
| 0.4 |
1.6 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.4 |
2.5 |
GO:1901563 |
response to camptothecin(GO:1901563) |
| 0.4 |
3.7 |
GO:0045974 |
miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.4 |
0.8 |
GO:0060221 |
retinal rod cell differentiation(GO:0060221) |
| 0.4 |
2.8 |
GO:0060666 |
dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.4 |
9.3 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.4 |
1.6 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.4 |
2.4 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.4 |
1.6 |
GO:0015705 |
iodide transport(GO:0015705) |
| 0.4 |
1.2 |
GO:0030421 |
defecation(GO:0030421) |
| 0.4 |
1.6 |
GO:0072385 |
minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.4 |
2.0 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.4 |
2.8 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.4 |
0.8 |
GO:0072176 |
nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
| 0.4 |
6.4 |
GO:0071539 |
protein localization to centrosome(GO:0071539) |
| 0.4 |
0.4 |
GO:0016078 |
tRNA catabolic process(GO:0016078) |
| 0.4 |
1.2 |
GO:0045091 |
regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
| 0.4 |
4.4 |
GO:0043923 |
positive regulation by host of viral transcription(GO:0043923) |
| 0.4 |
1.6 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.4 |
1.2 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.4 |
0.8 |
GO:1903689 |
regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.4 |
1.2 |
GO:0060148 |
positive regulation of posttranscriptional gene silencing(GO:0060148) |
| 0.4 |
0.8 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.4 |
0.4 |
GO:1904173 |
regulation of histone demethylase activity (H3-K4 specific)(GO:1904173) |
| 0.4 |
1.2 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.4 |
2.3 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.4 |
1.5 |
GO:0070425 |
negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 0.4 |
1.5 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.4 |
0.8 |
GO:0001569 |
patterning of blood vessels(GO:0001569) |
| 0.4 |
1.1 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.4 |
8.0 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 0.4 |
1.5 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.4 |
0.4 |
GO:1990379 |
lipid transport across blood brain barrier(GO:1990379) |
| 0.4 |
0.4 |
GO:2000049 |
positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.4 |
1.1 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.4 |
1.1 |
GO:0000710 |
meiotic mismatch repair(GO:0000710) |
| 0.4 |
3.0 |
GO:0007263 |
nitric oxide mediated signal transduction(GO:0007263) |
| 0.4 |
1.1 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.4 |
1.9 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.4 |
0.4 |
GO:0003161 |
cardiac conduction system development(GO:0003161) |
| 0.4 |
1.9 |
GO:0060178 |
regulation of exocyst localization(GO:0060178) |
| 0.4 |
16.3 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.4 |
5.9 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.4 |
0.4 |
GO:0010847 |
regulation of chromatin assembly(GO:0010847) |
| 0.4 |
1.1 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.4 |
1.1 |
GO:0060026 |
convergent extension(GO:0060026) |
| 0.4 |
1.4 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.4 |
0.7 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.4 |
0.4 |
GO:0072204 |
cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.4 |
1.8 |
GO:0038031 |
non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.4 |
3.2 |
GO:0006337 |
nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.4 |
0.4 |
GO:0090365 |
regulation of mRNA modification(GO:0090365) |
| 0.4 |
0.7 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.4 |
0.7 |
GO:0042518 |
negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.3 |
1.0 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.3 |
5.9 |
GO:0007216 |
G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.3 |
1.0 |
GO:0021986 |
epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.3 |
1.4 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.3 |
0.7 |
GO:0070213 |
protein auto-ADP-ribosylation(GO:0070213) |
| 0.3 |
2.4 |
GO:0072698 |
protein localization to microtubule cytoskeleton(GO:0072698) |
| 0.3 |
2.7 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.3 |
1.0 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.3 |
2.0 |
GO:0014842 |
regulation of skeletal muscle satellite cell proliferation(GO:0014842) |
| 0.3 |
1.0 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.3 |
0.3 |
GO:0071599 |
otic vesicle development(GO:0071599) |
| 0.3 |
1.3 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.3 |
1.3 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.3 |
0.7 |
GO:0043323 |
positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.3 |
1.7 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 0.3 |
3.3 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.3 |
5.3 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.3 |
1.0 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.3 |
2.3 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.3 |
1.3 |
GO:0033563 |
dorsal/ventral axon guidance(GO:0033563) |
| 0.3 |
1.6 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.3 |
1.0 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.3 |
0.3 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.3 |
0.3 |
GO:0090086 |
regulation of protein deubiquitination(GO:0090085) negative regulation of protein deubiquitination(GO:0090086) |
| 0.3 |
1.0 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.3 |
0.6 |
GO:0030397 |
membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.3 |
1.3 |
GO:1904694 |
negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.3 |
2.2 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.3 |
1.0 |
GO:0048698 |
negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.3 |
1.0 |
GO:0043696 |
dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.3 |
1.6 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.3 |
1.6 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.3 |
1.6 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.3 |
1.0 |
GO:0048537 |
mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 0.3 |
1.0 |
GO:0035973 |
aggrephagy(GO:0035973) |
| 0.3 |
0.6 |
GO:0006271 |
DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.3 |
0.9 |
GO:0038165 |
oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.3 |
0.9 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.3 |
2.5 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.3 |
0.9 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.3 |
2.8 |
GO:0048680 |
positive regulation of axon regeneration(GO:0048680) |
| 0.3 |
2.2 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.3 |
1.2 |
GO:0045053 |
protein retention in Golgi apparatus(GO:0045053) |
| 0.3 |
0.9 |
GO:0000350 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.3 |
1.8 |
GO:0098700 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.3 |
1.8 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.3 |
0.6 |
GO:0048549 |
positive regulation of pinocytosis(GO:0048549) |
| 0.3 |
1.2 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.3 |
0.9 |
GO:0019659 |
fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.3 |
1.8 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.3 |
0.9 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.3 |
0.6 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.3 |
8.2 |
GO:0040015 |
negative regulation of multicellular organism growth(GO:0040015) |
| 0.3 |
0.9 |
GO:0018103 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.3 |
0.6 |
GO:0002337 |
B-1 B cell differentiation(GO:0001923) B-1a B cell differentiation(GO:0002337) |
| 0.3 |
1.5 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.3 |
3.9 |
GO:0021871 |
forebrain regionalization(GO:0021871) |
| 0.3 |
0.6 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.3 |
7.2 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.3 |
0.6 |
GO:0071470 |
cellular response to osmotic stress(GO:0071470) |
| 0.3 |
0.3 |
GO:0042640 |
anagen(GO:0042640) |
| 0.3 |
0.9 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.3 |
0.3 |
GO:0010838 |
positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.3 |
2.4 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.3 |
0.9 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.3 |
0.6 |
GO:0071034 |
CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.3 |
1.2 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.3 |
0.9 |
GO:1903061 |
regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.3 |
6.2 |
GO:0042059 |
negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.3 |
1.2 |
GO:0097494 |
regulation of vesicle size(GO:0097494) |
| 0.3 |
1.7 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.3 |
0.3 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.3 |
0.3 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.3 |
1.1 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.3 |
4.0 |
GO:0034629 |
cellular protein complex localization(GO:0034629) |
| 0.3 |
0.9 |
GO:0048211 |
Golgi vesicle docking(GO:0048211) |
| 0.3 |
4.0 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.3 |
0.9 |
GO:0010814 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.3 |
0.8 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.3 |
2.8 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.3 |
0.8 |
GO:0009812 |
flavonoid metabolic process(GO:0009812) flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.3 |
0.3 |
GO:0033122 |
regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.3 |
0.8 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.3 |
1.1 |
GO:0003338 |
metanephros morphogenesis(GO:0003338) |
| 0.3 |
7.8 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.3 |
1.7 |
GO:0002043 |
blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.3 |
4.1 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.3 |
8.3 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.3 |
0.3 |
GO:1905050 |
positive regulation of metallopeptidase activity(GO:1905050) |
| 0.3 |
0.8 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.3 |
2.2 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.3 |
0.8 |
GO:1904049 |
regulation of spontaneous neurotransmitter secretion(GO:1904048) negative regulation of spontaneous neurotransmitter secretion(GO:1904049) |
| 0.3 |
0.8 |
GO:0030202 |
heparin metabolic process(GO:0030202) |
| 0.3 |
0.3 |
GO:0045404 |
positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.3 |
1.3 |
GO:0051571 |
positive regulation of histone H3-K4 methylation(GO:0051571) |
| 0.3 |
3.0 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.3 |
0.8 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.3 |
1.1 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.3 |
1.9 |
GO:0016479 |
negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.3 |
0.5 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.3 |
1.1 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.3 |
0.8 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.3 |
0.5 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.3 |
0.8 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.3 |
0.5 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 0.3 |
1.0 |
GO:0090224 |
regulation of spindle organization(GO:0090224) |
| 0.3 |
0.3 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.3 |
3.0 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.3 |
0.3 |
GO:0019343 |
cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 0.3 |
1.5 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.3 |
0.5 |
GO:0042726 |
flavin-containing compound metabolic process(GO:0042726) |
| 0.3 |
1.5 |
GO:0036066 |
protein O-linked fucosylation(GO:0036066) |
| 0.3 |
1.0 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.3 |
1.3 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.3 |
0.8 |
GO:0021691 |
cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.3 |
0.8 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.2 |
0.7 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.2 |
1.2 |
GO:0045943 |
positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.2 |
1.5 |
GO:0007020 |
microtubule nucleation(GO:0007020) |
| 0.2 |
1.2 |
GO:0048840 |
otolith development(GO:0048840) |
| 0.2 |
1.7 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.2 |
0.7 |
GO:0001547 |
antral ovarian follicle growth(GO:0001547) |
| 0.2 |
0.7 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.2 |
0.5 |
GO:0071787 |
endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.2 |
0.5 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.2 |
0.5 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.2 |
0.2 |
GO:0060339 |
negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.2 |
0.7 |
GO:0042822 |
vitamin B6 metabolic process(GO:0042816) pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.2 |
1.0 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.2 |
1.2 |
GO:0045599 |
negative regulation of fat cell differentiation(GO:0045599) |
| 0.2 |
0.7 |
GO:0033326 |
cerebrospinal fluid secretion(GO:0033326) |
| 0.2 |
0.7 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.2 |
0.7 |
GO:0010835 |
regulation of protein ADP-ribosylation(GO:0010835) |
| 0.2 |
0.7 |
GO:0006435 |
threonyl-tRNA aminoacylation(GO:0006435) |
| 0.2 |
0.7 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.2 |
1.4 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.2 |
0.9 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.2 |
1.4 |
GO:0035405 |
histone-threonine phosphorylation(GO:0035405) |
| 0.2 |
1.6 |
GO:0010971 |
positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.2 |
0.7 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.2 |
0.7 |
GO:0097278 |
complement-dependent cytotoxicity(GO:0097278) |
| 0.2 |
2.1 |
GO:0048385 |
regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 0.2 |
0.9 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.2 |
0.7 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 0.2 |
2.1 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.2 |
0.7 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.2 |
0.2 |
GO:0033523 |
histone H2B ubiquitination(GO:0033523) |
| 0.2 |
0.2 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 |
0.5 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.2 |
0.5 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.2 |
0.7 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.2 |
1.4 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.2 |
0.7 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.2 |
0.5 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 |
0.7 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.2 |
0.2 |
GO:0072393 |
microtubule anchoring at microtubule organizing center(GO:0072393) |
| 0.2 |
1.6 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.2 |
0.7 |
GO:0016446 |
somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.2 |
0.2 |
GO:0042307 |
positive regulation of protein import into nucleus(GO:0042307) |
| 0.2 |
0.7 |
GO:0031086 |
nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.2 |
0.9 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.2 |
0.4 |
GO:0061550 |
cranial ganglion development(GO:0061550) dorsal root ganglion development(GO:1990791) |
| 0.2 |
0.7 |
GO:0071472 |
cellular response to salt stress(GO:0071472) |
| 0.2 |
1.5 |
GO:0070314 |
G1 to G0 transition(GO:0070314) |
| 0.2 |
1.8 |
GO:2000381 |
negative regulation of mesoderm development(GO:2000381) |
| 0.2 |
0.9 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.2 |
4.6 |
GO:0046856 |
phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.2 |
0.7 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.2 |
0.4 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 0.2 |
1.1 |
GO:0045671 |
negative regulation of osteoclast differentiation(GO:0045671) |
| 0.2 |
0.9 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.2 |
1.9 |
GO:0006972 |
hyperosmotic response(GO:0006972) |
| 0.2 |
4.3 |
GO:0034724 |
DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.2 |
0.9 |
GO:0090244 |
Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.2 |
2.8 |
GO:0032392 |
DNA geometric change(GO:0032392) |
| 0.2 |
0.6 |
GO:0071649 |
regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.2 |
1.7 |
GO:0036289 |
peptidyl-serine autophosphorylation(GO:0036289) |
| 0.2 |
0.9 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.2 |
0.4 |
GO:0060591 |
chondroblast differentiation(GO:0060591) |
| 0.2 |
0.2 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.2 |
0.6 |
GO:0044861 |
protein transport into plasma membrane raft(GO:0044861) |
| 0.2 |
0.8 |
GO:0008333 |
endosome to lysosome transport(GO:0008333) |
| 0.2 |
0.4 |
GO:0021775 |
smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.2 |
0.6 |
GO:0030718 |
germ-line stem cell population maintenance(GO:0030718) |
| 0.2 |
0.2 |
GO:0003094 |
glomerular filtration(GO:0003094) renal filtration(GO:0097205) |
| 0.2 |
1.9 |
GO:0030238 |
male sex determination(GO:0030238) |
| 0.2 |
0.8 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.2 |
0.6 |
GO:0097461 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.2 |
0.4 |
GO:0008626 |
granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.2 |
0.2 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.2 |
0.6 |
GO:1990046 |
positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) stress-induced mitochondrial fusion(GO:1990046) |
| 0.2 |
0.2 |
GO:1902276 |
pancreatic amylase secretion(GO:0036395) regulation of pancreatic amylase secretion(GO:1902276) |
| 0.2 |
2.7 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.2 |
1.0 |
GO:0033148 |
positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.2 |
0.6 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.2 |
1.8 |
GO:0009263 |
deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.2 |
1.0 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.2 |
1.0 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.2 |
2.0 |
GO:0080182 |
histone H3-K4 trimethylation(GO:0080182) |
| 0.2 |
0.8 |
GO:0010603 |
regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.2 |
1.4 |
GO:0061299 |
retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.2 |
1.2 |
GO:0061000 |
negative regulation of dendritic spine development(GO:0061000) |
| 0.2 |
0.8 |
GO:0055071 |
cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
| 0.2 |
1.4 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.2 |
0.6 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.2 |
0.6 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.2 |
13.9 |
GO:0006334 |
nucleosome assembly(GO:0006334) |
| 0.2 |
0.6 |
GO:0002467 |
germinal center formation(GO:0002467) |
| 0.2 |
0.6 |
GO:0001732 |
formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.2 |
1.0 |
GO:0070102 |
interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.2 |
0.4 |
GO:0050000 |
chromosome localization(GO:0050000) establishment of chromosome localization(GO:0051303) |
| 0.2 |
2.2 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.2 |
0.2 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.2 |
0.4 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 0.2 |
1.7 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.2 |
0.6 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.2 |
1.5 |
GO:0019359 |
NAD biosynthetic process(GO:0009435) nicotinamide nucleotide biosynthetic process(GO:0019359) |
| 0.2 |
6.2 |
GO:0060612 |
adipose tissue development(GO:0060612) |
| 0.2 |
1.0 |
GO:0098789 |
pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.2 |
2.5 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.2 |
1.5 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.2 |
0.6 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.2 |
1.3 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.2 |
0.6 |
GO:1902358 |
sulfate transmembrane transport(GO:1902358) |
| 0.2 |
5.2 |
GO:0007026 |
negative regulation of microtubule depolymerization(GO:0007026) |
| 0.2 |
2.3 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.2 |
0.8 |
GO:0010890 |
positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.2 |
1.1 |
GO:0099515 |
actin filament-based transport(GO:0099515) |
| 0.2 |
1.0 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.2 |
0.2 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.2 |
1.7 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.2 |
0.9 |
GO:0060297 |
regulation of sarcomere organization(GO:0060297) |
| 0.2 |
0.6 |
GO:0048208 |
vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.2 |
1.3 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.2 |
0.9 |
GO:0061298 |
retina vasculature development in camera-type eye(GO:0061298) |
| 0.2 |
1.7 |
GO:0033962 |
cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.2 |
0.9 |
GO:0006680 |
glucosylceramide catabolic process(GO:0006680) |
| 0.2 |
0.4 |
GO:2000651 |
positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.2 |
3.2 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.2 |
0.9 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.2 |
4.6 |
GO:0002088 |
lens development in camera-type eye(GO:0002088) |
| 0.2 |
1.8 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.2 |
0.7 |
GO:0072520 |
seminiferous tubule development(GO:0072520) |
| 0.2 |
1.8 |
GO:0032933 |
response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.2 |
2.9 |
GO:0035329 |
hippo signaling(GO:0035329) |
| 0.2 |
0.9 |
GO:0034501 |
protein localization to kinetochore(GO:0034501) |
| 0.2 |
3.6 |
GO:0046033 |
AMP metabolic process(GO:0046033) |
| 0.2 |
1.6 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.2 |
1.1 |
GO:0060445 |
branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.2 |
0.2 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.2 |
0.9 |
GO:0098734 |
protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.2 |
4.5 |
GO:0048025 |
negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.2 |
8.9 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.2 |
0.5 |
GO:0042414 |
epinephrine metabolic process(GO:0042414) |
| 0.2 |
0.7 |
GO:0045638 |
negative regulation of myeloid cell differentiation(GO:0045638) |
| 0.2 |
0.7 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.2 |
0.4 |
GO:1904738 |
vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.2 |
0.7 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.2 |
1.2 |
GO:1990118 |
sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.2 |
4.1 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.2 |
2.5 |
GO:0009303 |
rRNA transcription(GO:0009303) |
| 0.2 |
0.5 |
GO:0030300 |
regulation of intestinal cholesterol absorption(GO:0030300) |
| 0.2 |
0.5 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.2 |
1.2 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.2 |
0.7 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.2 |
0.3 |
GO:0001711 |
endodermal cell fate commitment(GO:0001711) |
| 0.2 |
1.6 |
GO:0018230 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.2 |
0.5 |
GO:0007530 |
sex determination(GO:0007530) |
| 0.2 |
2.2 |
GO:1904293 |
negative regulation of ERAD pathway(GO:1904293) |
| 0.2 |
3.6 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.2 |
0.2 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.2 |
0.7 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.2 |
1.9 |
GO:0035020 |
regulation of Rac protein signal transduction(GO:0035020) |
| 0.2 |
0.2 |
GO:0060231 |
mesenchymal to epithelial transition(GO:0060231) |
| 0.2 |
1.5 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.2 |
0.7 |
GO:2001256 |
regulation of store-operated calcium entry(GO:2001256) |
| 0.2 |
1.7 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.2 |
0.3 |
GO:0010700 |
negative regulation of norepinephrine secretion(GO:0010700) |
| 0.2 |
1.3 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.2 |
0.2 |
GO:0090083 |
regulation of inclusion body assembly(GO:0090083) |
| 0.2 |
0.3 |
GO:0072053 |
renal inner medulla development(GO:0072053) renal outer medulla development(GO:0072054) |
| 0.2 |
1.0 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.2 |
1.0 |
GO:2000601 |
positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.2 |
0.2 |
GO:0080111 |
DNA dealkylation(GO:0035510) DNA demethylation(GO:0080111) |
| 0.2 |
3.4 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.2 |
0.5 |
GO:0030540 |
female genitalia development(GO:0030540) |
| 0.2 |
0.6 |
GO:0035459 |
cargo loading into vesicle(GO:0035459) |
| 0.2 |
1.3 |
GO:0061084 |
regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
| 0.2 |
0.3 |
GO:0070889 |
platelet alpha granule organization(GO:0070889) |
| 0.2 |
0.3 |
GO:0060084 |
synaptic transmission involved in micturition(GO:0060084) |
| 0.2 |
0.8 |
GO:0042769 |
DNA damage response, detection of DNA damage(GO:0042769) |
| 0.2 |
1.9 |
GO:0045663 |
positive regulation of myoblast differentiation(GO:0045663) |
| 0.2 |
0.3 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 0.2 |
0.6 |
GO:1902895 |
positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
| 0.2 |
0.3 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.2 |
0.8 |
GO:0050860 |
negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.2 |
2.5 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.2 |
0.8 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.2 |
0.3 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.2 |
0.9 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.2 |
1.7 |
GO:0021987 |
cerebral cortex development(GO:0021987) |
| 0.2 |
1.2 |
GO:0060628 |
regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.2 |
0.3 |
GO:0045915 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.2 |
1.7 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.2 |
0.8 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.2 |
0.5 |
GO:0016256 |
N-glycan processing to lysosome(GO:0016256) |
| 0.2 |
1.1 |
GO:0015862 |
uridine transport(GO:0015862) |
| 0.2 |
1.1 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.2 |
0.6 |
GO:1901016 |
regulation of potassium ion transmembrane transporter activity(GO:1901016) |
| 0.2 |
0.2 |
GO:0098501 |
polynucleotide dephosphorylation(GO:0098501) |
| 0.2 |
0.2 |
GO:0033091 |
positive regulation of immature T cell proliferation(GO:0033091) |
| 0.2 |
0.9 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.2 |
6.6 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.2 |
1.1 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.2 |
0.6 |
GO:0032204 |
regulation of telomere maintenance(GO:0032204) |
| 0.2 |
0.2 |
GO:0051346 |
negative regulation of hydrolase activity(GO:0051346) |
| 0.2 |
0.8 |
GO:0006678 |
glucosylceramide metabolic process(GO:0006678) |
| 0.2 |
1.5 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.2 |
0.9 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.2 |
0.5 |
GO:0046501 |
protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.2 |
3.2 |
GO:0010591 |
regulation of lamellipodium assembly(GO:0010591) |
| 0.2 |
14.3 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.2 |
1.1 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.2 |
0.6 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 |
3.9 |
GO:1902749 |
regulation of cell cycle G2/M phase transition(GO:1902749) |
| 0.1 |
0.3 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.1 |
0.6 |
GO:0071205 |
protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.1 |
1.8 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.1 |
2.4 |
GO:0090090 |
negative regulation of canonical Wnt signaling pathway(GO:0090090) |
| 0.1 |
0.1 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.1 |
0.7 |
GO:0006702 |
androgen biosynthetic process(GO:0006702) |
| 0.1 |
0.1 |
GO:0034239 |
regulation of macrophage fusion(GO:0034239) |
| 0.1 |
1.9 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 |
1.3 |
GO:0097094 |
craniofacial suture morphogenesis(GO:0097094) |
| 0.1 |
0.3 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.1 |
0.7 |
GO:0009396 |
folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.1 |
0.4 |
GO:0035881 |
amacrine cell differentiation(GO:0035881) |
| 0.1 |
1.5 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 |
1.5 |
GO:0006984 |
ER-nucleus signaling pathway(GO:0006984) |
| 0.1 |
0.1 |
GO:0048631 |
regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.1 |
0.4 |
GO:0006106 |
fumarate metabolic process(GO:0006106) |
| 0.1 |
0.3 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.1 |
1.0 |
GO:0006620 |
posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 |
0.3 |
GO:0001736 |
establishment of planar polarity(GO:0001736) establishment of tissue polarity(GO:0007164) |
| 0.1 |
1.5 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 |
0.7 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.1 |
0.4 |
GO:0006855 |
drug transmembrane transport(GO:0006855) |
| 0.1 |
1.6 |
GO:0060055 |
angiogenesis involved in wound healing(GO:0060055) |
| 0.1 |
0.6 |
GO:0006370 |
7-methylguanosine mRNA capping(GO:0006370) |
| 0.1 |
0.9 |
GO:0016081 |
synaptic vesicle docking(GO:0016081) |
| 0.1 |
3.4 |
GO:0021591 |
ventricular system development(GO:0021591) |
| 0.1 |
0.6 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.1 |
0.6 |
GO:0007028 |
cytoplasm organization(GO:0007028) |
| 0.1 |
1.0 |
GO:1901741 |
positive regulation of myoblast fusion(GO:1901741) |
| 0.1 |
0.4 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.1 |
0.3 |
GO:0045041 |
protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.1 |
0.1 |
GO:0000375 |
RNA splicing, via transesterification reactions(GO:0000375) |
| 0.1 |
0.4 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.1 |
1.3 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.1 |
0.1 |
GO:0030812 |
negative regulation of nucleotide catabolic process(GO:0030812) negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.1 |
0.1 |
GO:0045840 |
positive regulation of mitotic nuclear division(GO:0045840) |
| 0.1 |
0.8 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 0.1 |
1.5 |
GO:0071578 |
zinc II ion transmembrane import(GO:0071578) |
| 0.1 |
0.4 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.1 |
0.3 |
GO:0090148 |
membrane fission(GO:0090148) |
| 0.1 |
3.3 |
GO:0006073 |
glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
| 0.1 |
0.8 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.1 |
0.5 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 0.1 |
0.1 |
GO:0060742 |
epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.1 |
0.7 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.1 |
0.7 |
GO:0038032 |
termination of G-protein coupled receptor signaling pathway(GO:0038032) |
| 0.1 |
0.9 |
GO:0046855 |
phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
| 0.1 |
0.1 |
GO:2000286 |
receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.1 |
4.0 |
GO:0007093 |
mitotic cell cycle checkpoint(GO:0007093) |
| 0.1 |
0.3 |
GO:0010637 |
negative regulation of mitochondrial fusion(GO:0010637) |
| 0.1 |
1.3 |
GO:0045672 |
positive regulation of osteoclast differentiation(GO:0045672) |
| 0.1 |
1.1 |
GO:0015781 |
nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.1 |
0.4 |
GO:0006097 |
glyoxylate cycle(GO:0006097) |
| 0.1 |
0.8 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.1 |
0.3 |
GO:2001014 |
regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.1 |
0.7 |
GO:0042149 |
cellular response to glucose starvation(GO:0042149) |
| 0.1 |
0.7 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.1 |
1.0 |
GO:0060712 |
spongiotrophoblast layer development(GO:0060712) |
| 0.1 |
1.8 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 |
0.4 |
GO:0046726 |
positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 |
2.1 |
GO:0071391 |
cellular response to estrogen stimulus(GO:0071391) |
| 0.1 |
0.5 |
GO:0090283 |
regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.1 |
0.1 |
GO:1903336 |
negative regulation of vacuolar transport(GO:1903336) |
| 0.1 |
0.5 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.1 |
1.0 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.1 |
1.4 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.1 |
0.3 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) determination of liver left/right asymmetry(GO:0071910) |
| 0.1 |
0.4 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 |
0.4 |
GO:0019400 |
glycerol metabolic process(GO:0006071) alditol metabolic process(GO:0019400) |
| 0.1 |
1.8 |
GO:0031122 |
cytoplasmic microtubule organization(GO:0031122) |
| 0.1 |
0.3 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.1 |
0.1 |
GO:0060323 |
head morphogenesis(GO:0060323) |
| 0.1 |
0.3 |
GO:0046477 |
glycosylceramide catabolic process(GO:0046477) |
| 0.1 |
1.9 |
GO:0015693 |
magnesium ion transport(GO:0015693) |
| 0.1 |
0.4 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.1 |
0.3 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 0.1 |
0.3 |
GO:0034390 |
smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.1 |
0.3 |
GO:0001865 |
NK T cell differentiation(GO:0001865) antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.1 |
2.0 |
GO:0016601 |
Rac protein signal transduction(GO:0016601) |
| 0.1 |
0.6 |
GO:0044381 |
glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.1 |
0.1 |
GO:0021937 |
cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.1 |
0.7 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 |
0.4 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 |
0.5 |
GO:2000772 |
regulation of cellular senescence(GO:2000772) |
| 0.1 |
0.1 |
GO:0031100 |
organ regeneration(GO:0031100) |
| 0.1 |
4.4 |
GO:0060976 |
coronary vasculature development(GO:0060976) |
| 0.1 |
0.6 |
GO:0010359 |
regulation of anion channel activity(GO:0010359) |
| 0.1 |
0.4 |
GO:0070535 |
histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.1 |
0.5 |
GO:0034067 |
protein localization to Golgi apparatus(GO:0034067) |
| 0.1 |
1.5 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 |
0.6 |
GO:0045948 |
positive regulation of translational initiation(GO:0045948) |
| 0.1 |
0.5 |
GO:1900025 |
negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.1 |
0.5 |
GO:0030178 |
negative regulation of Wnt signaling pathway(GO:0030178) |
| 0.1 |
0.6 |
GO:1900016 |
negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.1 |
0.4 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 |
1.0 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.1 |
0.7 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 |
1.2 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 |
3.3 |
GO:0033120 |
positive regulation of RNA splicing(GO:0033120) |
| 0.1 |
3.8 |
GO:0006446 |
regulation of translational initiation(GO:0006446) |
| 0.1 |
0.9 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.1 |
0.8 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.1 |
0.4 |
GO:2000036 |
regulation of stem cell population maintenance(GO:2000036) |
| 0.1 |
2.7 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.1 |
2.9 |
GO:0045022 |
early endosome to late endosome transport(GO:0045022) |
| 0.1 |
0.1 |
GO:0032527 |
protein exit from endoplasmic reticulum(GO:0032527) |
| 0.1 |
0.7 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.1 |
0.7 |
GO:0071044 |
histone mRNA catabolic process(GO:0071044) |
| 0.1 |
1.6 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.1 |
1.2 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 |
0.8 |
GO:0036120 |
response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.1 |
0.3 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.1 |
0.3 |
GO:0072429 |
response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 |
0.2 |
GO:0021694 |
cerebellar Purkinje cell layer formation(GO:0021694) |
| 0.1 |
0.2 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 |
0.5 |
GO:2000179 |
positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.1 |
0.3 |
GO:0045204 |
MAPK export from nucleus(GO:0045204) |
| 0.1 |
0.1 |
GO:0001542 |
ovulation from ovarian follicle(GO:0001542) |
| 0.1 |
0.3 |
GO:0006706 |
steroid catabolic process(GO:0006706) |
| 0.1 |
0.3 |
GO:2001241 |
positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.1 |
0.7 |
GO:0010664 |
negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.1 |
0.2 |
GO:1903333 |
regulation of protein folding(GO:1903332) negative regulation of protein folding(GO:1903333) |
| 0.1 |
0.1 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.1 |
0.2 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) collagen-activated signaling pathway(GO:0038065) |
| 0.1 |
0.7 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
0.4 |
GO:0090188 |
negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.1 |
0.9 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
1.2 |
GO:0036093 |
germ cell proliferation(GO:0036093) |
| 0.1 |
0.1 |
GO:0001306 |
age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.1 |
0.9 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.1 |
1.4 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.1 |
1.5 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.1 |
0.3 |
GO:0051352 |
negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.1 |
0.5 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.1 |
0.1 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.1 |
0.1 |
GO:2000812 |
regulation of barbed-end actin filament capping(GO:2000812) |
| 0.1 |
0.6 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.1 |
0.7 |
GO:1990144 |
intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.1 |
0.2 |
GO:0010694 |
positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.1 |
0.7 |
GO:0050892 |
intestinal absorption(GO:0050892) |
| 0.1 |
0.2 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.1 |
0.4 |
GO:0070836 |
caveola assembly(GO:0070836) |
| 0.1 |
0.6 |
GO:0015817 |
histidine transport(GO:0015817) |
| 0.1 |
0.8 |
GO:0036506 |
maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.1 |
1.1 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.1 |
1.3 |
GO:0010390 |
histone monoubiquitination(GO:0010390) |
| 0.1 |
0.3 |
GO:0097502 |
protein mannosylation(GO:0035268) mannosylation(GO:0097502) |
| 0.1 |
0.1 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 0.1 |
1.4 |
GO:0000070 |
mitotic sister chromatid segregation(GO:0000070) |
| 0.1 |
0.3 |
GO:0090005 |
negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.1 |
0.1 |
GO:0061141 |
lung ciliated cell differentiation(GO:0061141) |
| 0.1 |
1.2 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.1 |
0.7 |
GO:0000103 |
sulfate assimilation(GO:0000103) |
| 0.1 |
0.6 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.1 |
0.9 |
GO:0046349 |
amino sugar biosynthetic process(GO:0046349) |
| 0.1 |
0.1 |
GO:0001656 |
metanephros development(GO:0001656) |
| 0.1 |
0.7 |
GO:0031954 |
positive regulation of protein autophosphorylation(GO:0031954) |
| 0.1 |
0.2 |
GO:0060510 |
Type II pneumocyte differentiation(GO:0060510) |
| 0.1 |
0.3 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.1 |
2.5 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.1 |
0.5 |
GO:0032494 |
response to peptidoglycan(GO:0032494) |
| 0.1 |
4.0 |
GO:0000245 |
spliceosomal complex assembly(GO:0000245) |
| 0.1 |
0.2 |
GO:1904354 |
negative regulation of telomere capping(GO:1904354) |
| 0.1 |
1.0 |
GO:0006415 |
translational termination(GO:0006415) |
| 0.1 |
0.6 |
GO:0035025 |
positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.1 |
0.4 |
GO:0032485 |
regulation of Ral protein signal transduction(GO:0032485) |
| 0.1 |
0.4 |
GO:0021891 |
olfactory bulb interneuron development(GO:0021891) |
| 0.1 |
0.1 |
GO:0071371 |
cellular response to gonadotropin stimulus(GO:0071371) |
| 0.1 |
2.1 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 |
0.1 |
GO:0008611 |
ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.1 |
1.1 |
GO:0051443 |
positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 0.1 |
0.3 |
GO:0019430 |
removal of superoxide radicals(GO:0019430) cellular oxidant detoxification(GO:0098869) |
| 0.1 |
0.2 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 |
0.2 |
GO:0015014 |
heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 |
0.1 |
GO:1902187 |
negative regulation of viral release from host cell(GO:1902187) |
| 0.1 |
0.2 |
GO:0072093 |
metanephric renal vesicle formation(GO:0072093) |
| 0.1 |
1.8 |
GO:0033194 |
response to hydroperoxide(GO:0033194) |
| 0.1 |
0.3 |
GO:2000144 |
positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.1 |
0.2 |
GO:0036337 |
Fas signaling pathway(GO:0036337) |
| 0.1 |
1.8 |
GO:0051973 |
positive regulation of telomerase activity(GO:0051973) |
| 0.1 |
2.5 |
GO:0006493 |
protein O-linked glycosylation(GO:0006493) |
| 0.1 |
0.2 |
GO:0016259 |
selenocysteine metabolic process(GO:0016259) |
| 0.1 |
0.7 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.1 |
0.2 |
GO:0032926 |
negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.1 |
0.6 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.1 |
1.4 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.1 |
0.1 |
GO:0009162 |
deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.1 |
0.2 |
GO:0051769 |
nitric-oxide synthase biosynthetic process(GO:0051767) regulation of nitric-oxide synthase biosynthetic process(GO:0051769) positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.1 |
0.1 |
GO:0035701 |
hematopoietic stem cell migration(GO:0035701) |
| 0.1 |
1.4 |
GO:0018345 |
protein palmitoylation(GO:0018345) |
| 0.1 |
0.8 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 0.1 |
0.5 |
GO:0070474 |
positive regulation of uterine smooth muscle contraction(GO:0070474) |
| 0.1 |
0.2 |
GO:1900745 |
positive regulation of p38MAPK cascade(GO:1900745) |
| 0.1 |
0.8 |
GO:0070828 |
heterochromatin organization(GO:0070828) |
| 0.1 |
0.1 |
GO:0003419 |
growth plate cartilage chondrocyte proliferation(GO:0003419) |
| 0.1 |
0.2 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.1 |
0.1 |
GO:0032509 |
endosome transport via multivesicular body sorting pathway(GO:0032509) |
| 0.1 |
0.4 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.1 |
0.2 |
GO:0034379 |
very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.1 |
0.3 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 |
0.5 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.1 |
0.7 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.1 |
0.8 |
GO:0045722 |
positive regulation of gluconeogenesis(GO:0045722) |
| 0.1 |
0.5 |
GO:0000186 |
activation of MAPKK activity(GO:0000186) |
| 0.1 |
0.3 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.1 |
0.3 |
GO:0030539 |
male genitalia development(GO:0030539) |
| 0.1 |
0.6 |
GO:0006309 |
apoptotic DNA fragmentation(GO:0006309) |
| 0.1 |
0.8 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 |
0.1 |
GO:0006399 |
tRNA metabolic process(GO:0006399) |
| 0.1 |
0.1 |
GO:0070266 |
necroptotic process(GO:0070266) |
| 0.1 |
0.2 |
GO:1900042 |
positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.1 |
0.2 |
GO:0006592 |
ornithine biosynthetic process(GO:0006592) |
| 0.1 |
0.3 |
GO:0046950 |
cellular ketone body metabolic process(GO:0046950) |
| 0.1 |
0.3 |
GO:0071670 |
smooth muscle cell chemotaxis(GO:0071670) |
| 0.1 |
0.3 |
GO:0044565 |
dendritic cell proliferation(GO:0044565) |
| 0.1 |
0.4 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.1 |
0.2 |
GO:0032328 |
alanine transport(GO:0032328) |
| 0.1 |
0.2 |
GO:0061032 |
visceral serous pericardium development(GO:0061032) |
| 0.1 |
1.0 |
GO:0030521 |
androgen receptor signaling pathway(GO:0030521) |
| 0.1 |
0.4 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.1 |
0.7 |
GO:0009220 |
pyrimidine ribonucleotide biosynthetic process(GO:0009220) pyrimidine ribonucleoside biosynthetic process(GO:0046132) |
| 0.1 |
0.1 |
GO:1904469 |
positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.1 |
0.4 |
GO:0043507 |
positive regulation of JUN kinase activity(GO:0043507) |
| 0.1 |
0.2 |
GO:2000973 |
regulation of pro-B cell differentiation(GO:2000973) |
| 0.1 |
0.2 |
GO:0033762 |
response to glucagon(GO:0033762) |
| 0.1 |
0.6 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.1 |
0.4 |
GO:0006699 |
bile acid biosynthetic process(GO:0006699) |
| 0.1 |
0.8 |
GO:0071364 |
cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.1 |
0.5 |
GO:0006104 |
succinyl-CoA metabolic process(GO:0006104) |
| 0.1 |
3.4 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.1 |
0.3 |
GO:0045930 |
negative regulation of mitotic cell cycle(GO:0045930) |
| 0.1 |
12.8 |
GO:0006281 |
DNA repair(GO:0006281) |
| 0.1 |
1.2 |
GO:0000154 |
rRNA modification(GO:0000154) |
| 0.1 |
0.3 |
GO:1902775 |
mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.1 |
0.4 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.1 |
0.4 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 0.1 |
0.8 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.1 |
0.2 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.1 |
0.8 |
GO:0001990 |
regulation of systemic arterial blood pressure by hormone(GO:0001990) |
| 0.1 |
0.1 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 |
0.1 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.1 |
0.9 |
GO:0008156 |
negative regulation of DNA replication(GO:0008156) |
| 0.1 |
0.1 |
GO:1904380 |
endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.1 |
0.1 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.1 |
0.4 |
GO:0009249 |
protein lipoylation(GO:0009249) |
| 0.1 |
0.1 |
GO:1900122 |
positive regulation of receptor binding(GO:1900122) |
| 0.1 |
0.1 |
GO:0060065 |
uterus development(GO:0060065) |
| 0.1 |
0.1 |
GO:0050942 |
positive regulation of pigment cell differentiation(GO:0050942) |
| 0.1 |
0.1 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 |
0.9 |
GO:0046460 |
triglyceride biosynthetic process(GO:0019432) neutral lipid biosynthetic process(GO:0046460) acylglycerol biosynthetic process(GO:0046463) |
| 0.1 |
0.1 |
GO:0050882 |
voluntary musculoskeletal movement(GO:0050882) |
| 0.1 |
1.0 |
GO:0070884 |
regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.1 |
1.4 |
GO:0006006 |
glucose metabolic process(GO:0006006) |
| 0.1 |
3.5 |
GO:0001841 |
neural tube formation(GO:0001841) |
| 0.1 |
0.3 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 |
0.2 |
GO:0016598 |
protein arginylation(GO:0016598) |
| 0.1 |
0.3 |
GO:0050716 |
regulation of interleukin-1 beta secretion(GO:0050706) positive regulation of interleukin-1 secretion(GO:0050716) positive regulation of interleukin-1 beta secretion(GO:0050718) |
| 0.1 |
0.3 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.1 |
0.2 |
GO:0034115 |
negative regulation of heterotypic cell-cell adhesion(GO:0034115) cell-cell adhesion involved in gastrulation(GO:0070586) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
| 0.1 |
0.3 |
GO:0070162 |
adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 |
0.5 |
GO:0034315 |
regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.1 |
0.2 |
GO:0000467 |
exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.1 |
0.1 |
GO:0040019 |
positive regulation of embryonic development(GO:0040019) |
| 0.1 |
0.2 |
GO:0051897 |
positive regulation of protein kinase B signaling(GO:0051897) |
| 0.1 |
0.2 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 |
1.0 |
GO:0048599 |
oocyte development(GO:0048599) |
| 0.1 |
0.1 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.1 |
0.1 |
GO:0046166 |
glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.1 |
0.5 |
GO:0006084 |
acetyl-CoA metabolic process(GO:0006084) |
| 0.1 |
0.3 |
GO:0016574 |
histone ubiquitination(GO:0016574) |
| 0.1 |
0.3 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.1 |
0.3 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.1 |
0.5 |
GO:0035871 |
protein K11-linked deubiquitination(GO:0035871) |
| 0.1 |
0.2 |
GO:0097264 |
self proteolysis(GO:0097264) |
| 0.1 |
0.4 |
GO:0046688 |
response to copper ion(GO:0046688) |
| 0.1 |
0.1 |
GO:0019255 |
glucose 1-phosphate metabolic process(GO:0019255) |
| 0.1 |
0.2 |
GO:1901201 |
regulation of extracellular matrix assembly(GO:1901201) positive regulation of extracellular matrix assembly(GO:1901203) |
| 0.1 |
0.3 |
GO:0045721 |
negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 |
0.3 |
GO:0090103 |
cochlea morphogenesis(GO:0090103) |
| 0.1 |
0.9 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.1 |
0.4 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.1 |
0.7 |
GO:0045780 |
positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.1 |
0.2 |
GO:0006428 |
isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.1 |
0.1 |
GO:0034124 |
regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.1 |
0.1 |
GO:0021943 |
formation of radial glial scaffolds(GO:0021943) |
| 0.1 |
0.2 |
GO:0090331 |
negative regulation of platelet aggregation(GO:0090331) |
| 0.1 |
0.3 |
GO:1901070 |
GMP biosynthetic process(GO:0006177) guanosine-containing compound biosynthetic process(GO:1901070) |
| 0.1 |
0.4 |
GO:0048103 |
somatic stem cell division(GO:0048103) |
| 0.1 |
0.1 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 0.1 |
1.6 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.1 |
0.2 |
GO:0035507 |
regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.1 |
0.7 |
GO:0018342 |
protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.1 |
0.1 |
GO:0000821 |
regulation of arginine metabolic process(GO:0000821) |
| 0.1 |
0.1 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.1 |
0.3 |
GO:0034047 |
regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.1 |
0.2 |
GO:0031033 |
myosin filament organization(GO:0031033) |
| 0.1 |
0.1 |
GO:1900377 |
negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.1 |
0.4 |
GO:0006817 |
phosphate ion transport(GO:0006817) |
| 0.1 |
13.1 |
GO:0006397 |
mRNA processing(GO:0006397) |
| 0.1 |
0.2 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.1 |
0.1 |
GO:0046103 |
adenosine catabolic process(GO:0006154) inosine metabolic process(GO:0046102) inosine biosynthetic process(GO:0046103) |
| 0.1 |
0.4 |
GO:0061088 |
sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.1 |
0.2 |
GO:0035845 |
photoreceptor cell outer segment organization(GO:0035845) |
| 0.1 |
0.2 |
GO:0046381 |
CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.1 |
0.5 |
GO:0031016 |
pancreas development(GO:0031016) |
| 0.1 |
0.3 |
GO:2000573 |
positive regulation of DNA biosynthetic process(GO:2000573) |
| 0.1 |
0.1 |
GO:0021540 |
corpus callosum morphogenesis(GO:0021540) |
| 0.1 |
0.2 |
GO:0006582 |
melanin metabolic process(GO:0006582) |
| 0.1 |
0.2 |
GO:0036260 |
7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.1 |
0.1 |
GO:0033147 |
negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.1 |
0.1 |
GO:0019919 |
peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine N-methylation(GO:0035246) peptidyl-arginine omega-N-methylation(GO:0035247) |
| 0.1 |
0.2 |
GO:0015960 |
diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.1 |
0.6 |
GO:0007052 |
mitotic spindle organization(GO:0007052) |
| 0.1 |
0.5 |
GO:0051642 |
centrosome localization(GO:0051642) |
| 0.1 |
0.2 |
GO:2001170 |
negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.1 |
0.4 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.1 |
1.0 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.1 |
0.1 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
| 0.1 |
0.3 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 |
0.1 |
GO:0046060 |
dATP metabolic process(GO:0046060) |
| 0.1 |
0.1 |
GO:0090503 |
RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.1 |
0.2 |
GO:0090292 |
nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.1 |
1.2 |
GO:0034605 |
cellular response to heat(GO:0034605) |
| 0.1 |
0.2 |
GO:0051790 |
short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.1 |
0.2 |
GO:0035067 |
negative regulation of histone acetylation(GO:0035067) |
| 0.1 |
0.8 |
GO:0035335 |
peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.1 |
0.2 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.1 |
0.1 |
GO:0010614 |
negative regulation of cardiac muscle hypertrophy(GO:0010614) |
| 0.1 |
0.2 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 0.1 |
0.2 |
GO:0003215 |
cardiac right ventricle morphogenesis(GO:0003215) |
| 0.1 |
0.2 |
GO:0046398 |
UDP-glucuronate biosynthetic process(GO:0006065) UDP-glucuronate metabolic process(GO:0046398) |
| 0.1 |
0.1 |
GO:0032066 |
nucleolus to nucleoplasm transport(GO:0032066) |
| 0.1 |
0.9 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.1 |
1.3 |
GO:0006911 |
phagocytosis, engulfment(GO:0006911) |
| 0.1 |
0.3 |
GO:1903352 |
ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
| 0.1 |
0.3 |
GO:0017145 |
stem cell division(GO:0017145) |
| 0.1 |
0.2 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.1 |
1.1 |
GO:0070303 |
negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
| 0.1 |
0.4 |
GO:0000002 |
mitochondrial genome maintenance(GO:0000002) |
| 0.1 |
0.2 |
GO:0006221 |
pyrimidine nucleotide biosynthetic process(GO:0006221) |
| 0.1 |
0.5 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 |
0.4 |
GO:0061732 |
mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.1 |
0.1 |
GO:0009405 |
pathogenesis(GO:0009405) |
| 0.0 |
0.1 |
GO:0060478 |
acrosomal vesicle exocytosis(GO:0060478) |
| 0.0 |
0.7 |
GO:0043550 |
regulation of lipid kinase activity(GO:0043550) |
| 0.0 |
0.1 |
GO:1904251 |
regulation of bile acid metabolic process(GO:1904251) |
| 0.0 |
0.7 |
GO:0045670 |
regulation of osteoclast differentiation(GO:0045670) |
| 0.0 |
0.5 |
GO:0033235 |
positive regulation of protein sumoylation(GO:0033235) |
| 0.0 |
0.4 |
GO:0071257 |
cellular response to electrical stimulus(GO:0071257) |
| 0.0 |
0.3 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.0 |
0.7 |
GO:0000470 |
maturation of LSU-rRNA(GO:0000470) |
| 0.0 |
0.2 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.0 |
0.6 |
GO:0035567 |
non-canonical Wnt signaling pathway(GO:0035567) |
| 0.0 |
0.0 |
GO:0016080 |
synaptic vesicle targeting(GO:0016080) |
| 0.0 |
0.3 |
GO:0005980 |
polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.0 |
0.4 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.0 |
0.2 |
GO:0005981 |
regulation of glycogen catabolic process(GO:0005981) |
| 0.0 |
0.3 |
GO:0046716 |
muscle cell cellular homeostasis(GO:0046716) |
| 0.0 |
0.2 |
GO:0001867 |
complement activation, lectin pathway(GO:0001867) |
| 0.0 |
0.2 |
GO:0034204 |
lipid translocation(GO:0034204) |
| 0.0 |
0.7 |
GO:0000281 |
mitotic cytokinesis(GO:0000281) |
| 0.0 |
0.8 |
GO:0032611 |
interleukin-1 beta production(GO:0032611) |
| 0.0 |
0.2 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 |
0.2 |
GO:2000270 |
negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 |
0.3 |
GO:0007249 |
I-kappaB kinase/NF-kappaB signaling(GO:0007249) |
| 0.0 |
0.1 |
GO:0030317 |
sperm motility(GO:0030317) |
| 0.0 |
0.5 |
GO:0043627 |
response to estrogen(GO:0043627) |
| 0.0 |
0.2 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.0 |
0.1 |
GO:1901989 |
positive regulation of cell cycle phase transition(GO:1901989) |
| 0.0 |
0.3 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.0 |
0.1 |
GO:0046850 |
regulation of bone remodeling(GO:0046850) |
| 0.0 |
0.2 |
GO:0007184 |
SMAD protein import into nucleus(GO:0007184) |
| 0.0 |
0.3 |
GO:0048747 |
muscle fiber development(GO:0048747) |
| 0.0 |
0.2 |
GO:0050908 |
detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 |
0.1 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 |
0.2 |
GO:0060416 |
response to growth hormone(GO:0060416) |
| 0.0 |
0.1 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.0 |
0.1 |
GO:0007289 |
spermatid nucleus differentiation(GO:0007289) |
| 0.0 |
0.3 |
GO:0043277 |
apoptotic cell clearance(GO:0043277) |
| 0.0 |
2.4 |
GO:0016125 |
sterol metabolic process(GO:0016125) |
| 0.0 |
0.2 |
GO:0030813 |
positive regulation of nucleotide catabolic process(GO:0030813) positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.0 |
0.1 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 |
0.1 |
GO:0033007 |
negative regulation of mast cell activation involved in immune response(GO:0033007) negative regulation of mast cell degranulation(GO:0043305) |
| 0.0 |
0.1 |
GO:0015882 |
L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.0 |
0.3 |
GO:0008053 |
mitochondrial fusion(GO:0008053) |
| 0.0 |
0.1 |
GO:0050910 |
detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.0 |
0.2 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.0 |
0.3 |
GO:0032008 |
positive regulation of TOR signaling(GO:0032008) |
| 0.0 |
0.1 |
GO:0051031 |
tRNA transport(GO:0051031) |
| 0.0 |
0.1 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.0 |
0.1 |
GO:0001927 |
exocyst assembly(GO:0001927) |
| 0.0 |
0.1 |
GO:0006003 |
fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 |
0.1 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 |
0.1 |
GO:1900153 |
regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 |
0.4 |
GO:0045740 |
positive regulation of DNA replication(GO:0045740) |
| 0.0 |
0.2 |
GO:0006560 |
proline metabolic process(GO:0006560) |
| 0.0 |
0.1 |
GO:0002200 |
somatic diversification of immune receptors(GO:0002200) |
| 0.0 |
0.1 |
GO:1904037 |
positive regulation of epithelial cell apoptotic process(GO:1904037) |
| 0.0 |
0.2 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.0 |
0.2 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.0 |
0.1 |
GO:0031585 |
regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
| 0.0 |
0.1 |
GO:2000983 |
regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.0 |
0.1 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.0 |
0.4 |
GO:0043252 |
sodium-independent organic anion transport(GO:0043252) |
| 0.0 |
0.1 |
GO:0030220 |
platelet formation(GO:0030220) platelet morphogenesis(GO:0036344) |
| 0.0 |
0.1 |
GO:0072318 |
clathrin coat disassembly(GO:0072318) |
| 0.0 |
0.1 |
GO:1990253 |
cellular response to leucine starvation(GO:1990253) |
| 0.0 |
0.2 |
GO:2000009 |
negative regulation of protein localization to cell surface(GO:2000009) |
| 0.0 |
0.1 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.0 |
0.2 |
GO:0043276 |
anoikis(GO:0043276) |
| 0.0 |
0.3 |
GO:0043488 |
regulation of mRNA stability(GO:0043488) |
| 0.0 |
0.2 |
GO:0019254 |
carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.0 |
0.1 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.0 |
0.1 |
GO:1900186 |
negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.0 |
0.1 |
GO:0010935 |
regulation of macrophage cytokine production(GO:0010935) |
| 0.0 |
0.1 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 |
0.1 |
GO:0048012 |
hepatocyte growth factor receptor signaling pathway(GO:0048012) |
| 0.0 |
0.2 |
GO:0035455 |
response to interferon-alpha(GO:0035455) |
| 0.0 |
0.0 |
GO:1903960 |
negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) negative regulation of anion transmembrane transport(GO:1903960) negative regulation of fatty acid transport(GO:2000192) |
| 0.0 |
0.1 |
GO:0009048 |
dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 |
0.1 |
GO:0034219 |
carbohydrate transmembrane transport(GO:0034219) |
| 0.0 |
0.1 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 |
0.1 |
GO:0045668 |
negative regulation of osteoblast differentiation(GO:0045668) |
| 0.0 |
0.0 |
GO:0070813 |
hydrogen sulfide metabolic process(GO:0070813) |
| 0.0 |
0.1 |
GO:0007220 |
Notch receptor processing(GO:0007220) |
| 0.0 |
0.3 |
GO:0032760 |
positive regulation of tumor necrosis factor production(GO:0032760) positive regulation of tumor necrosis factor superfamily cytokine production(GO:1903557) |
| 0.0 |
1.3 |
GO:0090630 |
activation of GTPase activity(GO:0090630) |
| 0.0 |
0.7 |
GO:0070613 |
regulation of protein processing(GO:0070613) |
| 0.0 |
0.2 |
GO:0060324 |
face development(GO:0060324) |
| 0.0 |
0.1 |
GO:0051294 |
establishment of spindle orientation(GO:0051294) |
| 0.0 |
0.1 |
GO:0050820 |
positive regulation of coagulation(GO:0050820) |
| 0.0 |
0.1 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 |
0.6 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 0.0 |
0.1 |
GO:0002361 |
CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.0 |
0.1 |
GO:1901419 |
regulation of response to alcohol(GO:1901419) |
| 0.0 |
0.1 |
GO:0044829 |
positive regulation by host of viral genome replication(GO:0044829) |
| 0.0 |
0.0 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.0 |
0.1 |
GO:0031643 |
positive regulation of myelination(GO:0031643) |
| 0.0 |
0.0 |
GO:2000790 |
regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) |
| 0.0 |
0.1 |
GO:0051568 |
histone H3-K4 methylation(GO:0051568) |
| 0.0 |
0.7 |
GO:0048286 |
lung alveolus development(GO:0048286) |
| 0.0 |
0.2 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.0 |
0.0 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 |
0.1 |
GO:0007603 |
phototransduction, visible light(GO:0007603) |
| 0.0 |
0.1 |
GO:0007588 |
excretion(GO:0007588) |
| 0.0 |
0.1 |
GO:0070584 |
mitochondrion morphogenesis(GO:0070584) |
| 0.0 |
0.1 |
GO:0032515 |
negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.0 |
0.2 |
GO:1903779 |
regulation of cardiac conduction(GO:1903779) |
| 0.0 |
0.1 |
GO:0032000 |
positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.0 |
0.1 |
GO:0060768 |
epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) |
| 0.0 |
0.1 |
GO:1990776 |
cellular response to angiotensin(GO:1904385) response to angiotensin(GO:1990776) |
| 0.0 |
0.0 |
GO:0007614 |
short-term memory(GO:0007614) |
| 0.0 |
0.1 |
GO:0039531 |
regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039531) |
| 0.0 |
0.0 |
GO:0033119 |
negative regulation of RNA splicing(GO:0033119) |
| 0.0 |
0.1 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.0 |
0.0 |
GO:0071549 |
cellular response to dexamethasone stimulus(GO:0071549) |
| 0.0 |
0.0 |
GO:1903599 |
positive regulation of mitophagy(GO:1903599) |
| 0.0 |
0.0 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 |
0.1 |
GO:0051457 |
maintenance of protein location in nucleus(GO:0051457) |
| 0.0 |
0.4 |
GO:0007029 |
endoplasmic reticulum organization(GO:0007029) |
| 0.0 |
0.2 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.0 |
0.7 |
GO:0001578 |
microtubule bundle formation(GO:0001578) |
| 0.0 |
0.1 |
GO:0035635 |
entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.0 |
0.1 |
GO:0006739 |
NADP metabolic process(GO:0006739) |
| 0.0 |
0.0 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.0 |
0.1 |
GO:0006970 |
response to osmotic stress(GO:0006970) |
| 0.0 |
0.1 |
GO:2000109 |
macrophage apoptotic process(GO:0071888) regulation of macrophage apoptotic process(GO:2000109) negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.0 |
0.1 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.0 |
0.1 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 0.0 |
0.4 |
GO:0000266 |
mitochondrial fission(GO:0000266) |
| 0.0 |
0.0 |
GO:0051582 |
positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.0 |
0.1 |
GO:0061368 |
behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.0 |
0.0 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.0 |
0.0 |
GO:2000407 |
T cell extravasation(GO:0072683) regulation of T cell extravasation(GO:2000407) positive regulation of T cell extravasation(GO:2000409) |
| 0.0 |
0.3 |
GO:0035458 |
cellular response to interferon-beta(GO:0035458) |
| 0.0 |
0.6 |
GO:0045089 |
positive regulation of innate immune response(GO:0045089) |
| 0.0 |
0.3 |
GO:0071346 |
cellular response to interferon-gamma(GO:0071346) |
| 0.0 |
0.0 |
GO:0060688 |
regulation of morphogenesis of a branching structure(GO:0060688) |
| 0.0 |
0.1 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 |
0.3 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.0 |
0.0 |
GO:0060218 |
hematopoietic stem cell differentiation(GO:0060218) |
| 0.0 |
0.0 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.0 |
0.1 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 |
0.0 |
GO:0048146 |
positive regulation of fibroblast proliferation(GO:0048146) |
| 0.0 |
0.6 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.0 |
0.0 |
GO:0042416 |
dopamine biosynthetic process(GO:0042416) |
| 0.0 |
0.1 |
GO:0048041 |
cell-substrate adherens junction assembly(GO:0007045) focal adhesion assembly(GO:0048041) |
| 0.0 |
0.0 |
GO:0006591 |
ornithine metabolic process(GO:0006591) |
| 0.0 |
0.1 |
GO:0006744 |
ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.0 |
0.0 |
GO:0009583 |
detection of light stimulus(GO:0009583) |
| 0.0 |
0.1 |
GO:0006515 |
misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.0 |
0.4 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.0 |
0.1 |
GO:0006103 |
2-oxoglutarate metabolic process(GO:0006103) |
| 0.0 |
0.1 |
GO:0043392 |
negative regulation of DNA binding(GO:0043392) |
| 0.0 |
0.9 |
GO:0042254 |
ribosome biogenesis(GO:0042254) |
| 0.0 |
0.1 |
GO:0098838 |
reduced folate transmembrane transport(GO:0098838) |
| 0.0 |
0.1 |
GO:0030970 |
retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.0 |
0.0 |
GO:0042053 |
regulation of dopamine metabolic process(GO:0042053) regulation of catecholamine metabolic process(GO:0042069) |
| 0.0 |
0.1 |
GO:0043484 |
regulation of RNA splicing(GO:0043484) |
| 0.0 |
0.0 |
GO:0032200 |
telomere maintenance(GO:0000723) telomere organization(GO:0032200) |
| 0.0 |
0.0 |
GO:0050667 |
homocysteine metabolic process(GO:0050667) |
| 0.0 |
0.0 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.0 |
0.9 |
GO:0006417 |
regulation of translation(GO:0006417) |
| 0.0 |
0.6 |
GO:0042147 |
retrograde transport, endosome to Golgi(GO:0042147) |
| 0.0 |
0.2 |
GO:0008089 |
anterograde axonal transport(GO:0008089) |
| 0.0 |
0.0 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 |
0.1 |
GO:0060070 |
canonical Wnt signaling pathway(GO:0060070) |
