Motif ID: Zbtb33_Chd2
Z-value: 2.430
Transcription factors associated with Zbtb33_Chd2:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Chd2 | ENSMUSG00000078671.4 | Chd2 |
| Zbtb33 | ENSMUSG00000048047.3 | Zbtb33 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Chd2 | mm10_v2_chr7_-_73541738_73541758 | 0.24 | 6.5e-02 | Click! |
| Zbtb33 | mm10_v2_chrX_+_38189780_38189826 | 0.20 | 1.3e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.2 | 21.0 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 3.7 | 26.2 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 3.6 | 14.3 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 2.5 | 10.0 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 2.2 | 2.2 | GO:0061324 | canonical Wnt signaling pathway involved in positive regulation of cardiac outflow tract cell proliferation(GO:0061324) regulation of cell proliferation involved in outflow tract morphogenesis(GO:1901963) |
| 2.1 | 6.2 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 1.9 | 7.5 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 1.9 | 5.6 | GO:0072554 | arterial endothelial cell fate commitment(GO:0060844) blood vessel endothelial cell fate commitment(GO:0060846) endothelial cell fate specification(GO:0060847) Notch signaling pathway involved in arterial endothelial cell fate commitment(GO:0060853) blood vessel lumenization(GO:0072554) blood vessel endothelial cell fate specification(GO:0097101) regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901295) positive regulation of heart induction(GO:1901321) regulation of canonical Wnt signaling pathway involved in heart development(GO:1905066) |
| 1.8 | 5.4 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 1.7 | 5.2 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
| 1.7 | 5.0 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 1.6 | 8.2 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 1.6 | 4.8 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
| 1.6 | 9.5 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 1.4 | 20.3 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
| 1.4 | 4.2 | GO:0070844 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 1.4 | 4.1 | GO:2000314 | negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 1.3 | 4.0 | GO:0034476 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 1.3 | 6.6 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 1.3 | 1.3 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 1.3 | 6.4 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 1.2 | 6.0 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) proprioception(GO:0019230) |
| 1.2 | 8.1 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 1.1 | 4.5 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 1.1 | 9.0 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 1.0 | 3.1 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 1.0 | 8.4 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 1.0 | 7.2 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.9 | 2.8 | GO:1903722 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) regulation of centriole elongation(GO:1903722) |
| 0.9 | 8.2 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.9 | 4.4 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.8 | 4.1 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.8 | 19.9 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
| 0.8 | 2.4 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.8 | 5.5 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.8 | 3.0 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 0.7 | 5.2 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.7 | 3.7 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.7 | 2.9 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
| 0.7 | 11.1 | GO:0030953 | astral microtubule organization(GO:0030953) |
| 0.7 | 4.1 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.7 | 2.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.7 | 3.4 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.7 | 8.6 | GO:1904851 | positive regulation of establishment of protein localization to telomere(GO:1904851) |
| 0.6 | 2.6 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
| 0.6 | 1.9 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.6 | 3.9 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.6 | 2.5 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
| 0.6 | 4.4 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.6 | 2.5 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.6 | 4.3 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.6 | 9.6 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.6 | 15.6 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.6 | 2.3 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.6 | 1.1 | GO:0061419 | coronary vein morphogenesis(GO:0003169) positive regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061419) |
| 0.6 | 9.5 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.5 | 5.8 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.5 | 2.0 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.5 | 5.0 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.5 | 4.7 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.5 | 1.4 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 0.5 | 2.8 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.5 | 4.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.4 | 6.2 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.4 | 13.6 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.4 | 2.2 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.4 | 1.3 | GO:0030321 | transepithelial chloride transport(GO:0030321) transepithelial ammonium transport(GO:0070634) |
| 0.4 | 2.9 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.4 | 4.5 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.4 | 1.6 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.4 | 4.9 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.4 | 2.4 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.4 | 4.1 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.4 | 0.8 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
| 0.4 | 0.4 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.4 | 1.9 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.4 | 4.3 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.4 | 1.1 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.4 | 1.9 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.4 | 2.9 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.4 | 1.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.4 | 1.1 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
| 0.3 | 0.7 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.3 | 1.0 | GO:0042505 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.3 | 13.6 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.3 | 1.3 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.3 | 7.8 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
| 0.3 | 7.8 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
| 0.3 | 3.5 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.3 | 2.8 | GO:0002643 | regulation of tolerance induction(GO:0002643) |
| 0.3 | 1.2 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.3 | 0.9 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.3 | 1.2 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.3 | 1.5 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.3 | 2.1 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.3 | 1.8 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.3 | 2.1 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.3 | 2.6 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.3 | 0.9 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.3 | 0.8 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.3 | 0.8 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.3 | 1.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.3 | 3.8 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.3 | 7.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.3 | 2.7 | GO:0006560 | proline metabolic process(GO:0006560) |
| 0.3 | 0.8 | GO:0010814 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.2 | 3.2 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.2 | 1.7 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.2 | 4.3 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
| 0.2 | 4.8 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.2 | 5.4 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.2 | 1.8 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.2 | 2.9 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.2 | 6.7 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.2 | 5.7 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.2 | 0.6 | GO:2000983 | regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.2 | 0.6 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.2 | 1.4 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.2 | 1.6 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
| 0.2 | 1.4 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.2 | 2.4 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
| 0.2 | 14.2 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
| 0.2 | 0.8 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.2 | 0.7 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.2 | 0.9 | GO:1904690 | adenosine to inosine editing(GO:0006382) regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.2 | 0.7 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.2 | 1.1 | GO:0051096 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.2 | 1.7 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.2 | 0.3 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.2 | 1.5 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.2 | 0.8 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.2 | 2.3 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.2 | 3.1 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.2 | 2.1 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.2 | 1.9 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.2 | 1.7 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.2 | 0.8 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.2 | 10.5 | GO:2000179 | positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.2 | 0.8 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
| 0.2 | 1.2 | GO:0051797 | regulation of hair follicle development(GO:0051797) |
| 0.1 | 0.4 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.1 | 1.8 | GO:0031268 | pseudopodium organization(GO:0031268) |
| 0.1 | 0.6 | GO:0072369 | regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 0.1 | 3.5 | GO:0051310 | metaphase plate congression(GO:0051310) |
| 0.1 | 1.0 | GO:0030050 | vesicle transport along actin filament(GO:0030050) positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 | 1.5 | GO:0031498 | nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) protein-DNA complex disassembly(GO:0032986) |
| 0.1 | 0.8 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.1 | 2.4 | GO:0006907 | pinocytosis(GO:0006907) |
| 0.1 | 2.3 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 | 14.3 | GO:0031109 | microtubule polymerization or depolymerization(GO:0031109) |
| 0.1 | 0.4 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
| 0.1 | 0.4 | GO:0042420 | dopamine catabolic process(GO:0042420) |
| 0.1 | 1.6 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.1 | 0.5 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 3.0 | GO:0035886 | vascular smooth muscle cell differentiation(GO:0035886) |
| 0.1 | 2.8 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.1 | 0.3 | GO:0035799 | ureter maturation(GO:0035799) mast cell differentiation(GO:0060374) cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.1 | 3.5 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.1 | 0.4 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 | 4.0 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
| 0.1 | 2.0 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.1 | 0.5 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.1 | 0.9 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
| 0.1 | 1.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.1 | 1.1 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 | 1.6 | GO:0002021 | response to dietary excess(GO:0002021) |
| 0.1 | 1.2 | GO:0032506 | cytokinetic process(GO:0032506) |
| 0.1 | 1.4 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.1 | 0.3 | GO:0071449 | cellular response to lipid hydroperoxide(GO:0071449) |
| 0.1 | 2.1 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
| 0.1 | 1.1 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.1 | 0.5 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.1 | 2.5 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.1 | 11.7 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.1 | 0.6 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
| 0.1 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.1 | 1.6 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.1 | 0.7 | GO:0072395 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
| 0.1 | 1.3 | GO:0030033 | microvillus assembly(GO:0030033) |
| 0.1 | 0.9 | GO:0030238 | male sex determination(GO:0030238) Leydig cell differentiation(GO:0033327) |
| 0.1 | 0.4 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.1 | 1.2 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.1 | 1.3 | GO:0018105 | peptidyl-serine phosphorylation(GO:0018105) |
| 0.1 | 1.2 | GO:0010883 | regulation of lipid storage(GO:0010883) |
| 0.1 | 1.2 | GO:0060416 | response to growth hormone(GO:0060416) |
| 0.1 | 0.6 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.1 | 2.7 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.0 | 0.3 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 5.4 | GO:0098780 | mitophagy in response to mitochondrial depolarization(GO:0098779) response to mitochondrial depolarisation(GO:0098780) |
| 0.0 | 0.7 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 1.2 | GO:0051567 | histone H3-K9 methylation(GO:0051567) |
| 0.0 | 1.7 | GO:0032204 | regulation of telomere maintenance(GO:0032204) |
| 0.0 | 0.4 | GO:0032366 | intracellular sterol transport(GO:0032366) |
| 0.0 | 0.5 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.0 | 1.5 | GO:0032835 | glomerulus development(GO:0032835) |
| 0.0 | 11.8 | GO:0008380 | RNA splicing(GO:0008380) |
| 0.0 | 1.1 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.0 | 0.8 | GO:0006974 | cellular response to DNA damage stimulus(GO:0006974) |
| 0.0 | 9.0 | GO:0006281 | DNA repair(GO:0006281) |
| 0.0 | 0.8 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.0 | 0.3 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.3 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 0.3 | GO:0043537 | negative regulation of blood vessel endothelial cell migration(GO:0043537) |
| 0.0 | 0.1 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.0 | 1.4 | GO:0045860 | positive regulation of protein kinase activity(GO:0045860) |
| 0.0 | 0.2 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 | 0.2 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.2 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.8 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.0 | 0.8 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.0 | 1.9 | GO:0001935 | endothelial cell proliferation(GO:0001935) |
| 0.0 | 1.2 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.0 | 1.0 | GO:0007417 | central nervous system development(GO:0007417) |
| 0.0 | 0.6 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.0 | 5.6 | GO:0007067 | mitotic nuclear division(GO:0007067) |
| 0.0 | 0.1 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 | 1.5 | GO:0021954 | central nervous system neuron development(GO:0021954) |
| 0.0 | 0.8 | GO:0043066 | negative regulation of apoptotic process(GO:0043066) |
| 0.0 | 0.7 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
| 0.0 | 1.1 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
| 0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 2.6 | GO:0007266 | Rho protein signal transduction(GO:0007266) |
| 0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.0 | 0.7 | GO:0048659 | smooth muscle cell proliferation(GO:0048659) |
| 0.0 | 0.4 | GO:0002209 | behavioral fear response(GO:0001662) behavioral defense response(GO:0002209) |
| 0.0 | 2.9 | GO:0007517 | muscle organ development(GO:0007517) |
| 0.0 | 0.1 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 1.2 | GO:0009615 | response to virus(GO:0009615) |
| 0.0 | 0.2 | GO:0005980 | polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.8 | 33.9 | GO:0000796 | condensin complex(GO:0000796) |
| 3.9 | 11.8 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 2.8 | 8.4 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
| 2.1 | 10.7 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 2.0 | 25.7 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 1.5 | 4.4 | GO:1990423 | RZZ complex(GO:1990423) |
| 1.4 | 8.2 | GO:0030870 | Mre11 complex(GO:0030870) |
| 1.3 | 6.7 | GO:0001652 | granular component(GO:0001652) |
| 1.3 | 8.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 1.3 | 7.8 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 1.1 | 5.6 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 1.1 | 4.4 | GO:0090537 | CERF complex(GO:0090537) |
| 1.1 | 33.6 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 1.0 | 10.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.9 | 6.9 | GO:0016589 | NURF complex(GO:0016589) |
| 0.8 | 5.0 | GO:0001740 | Barr body(GO:0001740) |
| 0.8 | 5.4 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.8 | 3.0 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.7 | 2.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.7 | 1.3 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.6 | 2.6 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.6 | 3.9 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.6 | 4.5 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.6 | 16.6 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.6 | 9.5 | GO:0042555 | MCM complex(GO:0042555) |
| 0.6 | 3.1 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 0.6 | 1.9 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.6 | 1.8 | GO:0005940 | septin ring(GO:0005940) |
| 0.6 | 2.3 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.6 | 5.6 | GO:0034709 | methylosome(GO:0034709) |
| 0.5 | 2.2 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.5 | 6.0 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.5 | 9.2 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.5 | 2.7 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.5 | 1.5 | GO:0031417 | NatC complex(GO:0031417) |
| 0.5 | 1.9 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.5 | 2.9 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.5 | 1.4 | GO:0031251 | PAN complex(GO:0031251) |
| 0.4 | 6.0 | GO:0031011 | Ino80 complex(GO:0031011) |
| 0.4 | 2.8 | GO:0090543 | Flemming body(GO:0090543) |
| 0.4 | 2.0 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.4 | 6.6 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.4 | 5.6 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.3 | 8.6 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.3 | 2.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.3 | 3.6 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.3 | 1.8 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.3 | 4.8 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.3 | 3.7 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.3 | 1.4 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.2 | 5.0 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.2 | 4.1 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.2 | 1.4 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.2 | 3.3 | GO:0044447 | axoneme part(GO:0044447) |
| 0.2 | 0.7 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.2 | 0.4 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.2 | 2.4 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.2 | 1.9 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.2 | 1.6 | GO:0098536 | deuterosome(GO:0098536) |
| 0.2 | 5.2 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.2 | 4.6 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.2 | 0.8 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.2 | 0.6 | GO:0060187 | cell pole(GO:0060187) |
| 0.2 | 2.9 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.2 | 0.8 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 10.9 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.1 | 5.0 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.1 | 0.7 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.1 | 3.9 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 1.4 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 6.6 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.1 | 13.4 | GO:0000922 | spindle pole(GO:0000922) |
| 0.1 | 2.6 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.1 | 1.9 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 6.1 | GO:0015935 | small ribosomal subunit(GO:0015935) |
| 0.1 | 0.9 | GO:0036396 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.1 | 1.6 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 1.6 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 0.8 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.1 | 1.2 | GO:0070938 | contractile ring(GO:0070938) |
| 0.1 | 2.6 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.1 | 1.5 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.1 | 1.5 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.1 | 1.0 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
| 0.1 | 0.6 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.1 | 1.0 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 3.6 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.1 | 0.5 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 1.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.1 | 5.7 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.1 | 3.7 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 4.4 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.1 | 1.7 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.1 | 6.5 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.1 | 2.4 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.1 | 9.7 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
| 0.1 | 1.1 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.1 | 1.0 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.1 | 1.4 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.1 | 1.1 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 1.1 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.1 | 4.7 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 0.9 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 2.3 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.1 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.1 | 1.3 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
| 0.1 | 0.7 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 0.7 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.1 | 0.9 | GO:0001527 | microfibril(GO:0001527) |
| 0.1 | 1.9 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.1 | 0.5 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.0 | 0.3 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 12.8 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 19.0 | GO:0005815 | microtubule organizing center(GO:0005815) |
| 0.0 | 1.5 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.4 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.3 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.0 | 1.6 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.8 | GO:0000792 | heterochromatin(GO:0000792) |
| 0.0 | 5.1 | GO:0030426 | growth cone(GO:0030426) |
| 0.0 | 1.9 | GO:0044439 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
| 0.0 | 1.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.2 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 1.2 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.3 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 3.3 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
| 0.0 | 0.4 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.0 | 0.2 | GO:0016234 | inclusion body(GO:0016234) |
| 0.0 | 0.2 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.0 | 1.2 | GO:0005604 | basement membrane(GO:0005604) |
| 0.0 | 0.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.6 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
| 0.0 | 0.2 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 0.7 | GO:0045178 | basal part of cell(GO:0045178) |
| 0.0 | 4.9 | GO:0030424 | axon(GO:0030424) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.3 | 17.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 2.2 | 6.6 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 1.8 | 5.4 | GO:0031208 | POZ domain binding(GO:0031208) |
| 1.7 | 10.0 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 1.6 | 6.4 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 1.5 | 4.5 | GO:0035605 | peptidyl-cysteine S-nitrosylase activity(GO:0035605) |
| 1.5 | 11.8 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 1.4 | 17.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 1.2 | 8.1 | GO:0034452 | dynactin binding(GO:0034452) |
| 1.1 | 6.4 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 1.0 | 4.2 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 1.0 | 5.0 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.9 | 8.5 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.8 | 8.2 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.8 | 3.0 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.6 | 3.7 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.6 | 2.5 | GO:0004104 | cholinesterase activity(GO:0004104) choline binding(GO:0033265) |
| 0.6 | 4.3 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.6 | 4.8 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.6 | 3.6 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.5 | 6.5 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.5 | 2.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.5 | 2.4 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.4 | 8.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.4 | 5.6 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.4 | 2.0 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.4 | 10.7 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.4 | 4.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.4 | 2.8 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.3 | 2.3 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.3 | 7.1 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.3 | 2.9 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.3 | 15.6 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.3 | 4.8 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.3 | 1.5 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
| 0.3 | 3.9 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.3 | 12.7 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.3 | 1.2 | GO:0005093 | Rab GDP-dissociation inhibitor activity(GO:0005093) |
| 0.3 | 1.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.3 | 4.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.3 | 6.2 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.3 | 2.9 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.3 | 47.2 | GO:0004386 | helicase activity(GO:0004386) |
| 0.3 | 2.0 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.2 | 1.0 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.2 | 6.1 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.2 | 1.7 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.2 | 2.9 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.2 | 1.2 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.2 | 2.4 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.2 | 1.6 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.2 | 6.5 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.2 | 2.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.2 | 0.5 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.2 | 3.0 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
| 0.2 | 1.3 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.2 | 2.6 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.2 | 6.5 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.2 | 0.9 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.2 | 8.9 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.2 | 1.7 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.2 | 0.6 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
| 0.2 | 1.3 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.2 | 2.8 | GO:0042556 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.2 | 3.2 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.2 | 0.9 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.2 | 2.7 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.2 | 5.6 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.2 | 3.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.2 | 1.2 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.2 | 8.4 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.2 | 8.4 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.1 | 15.1 | GO:0019905 | syntaxin binding(GO:0019905) |
| 0.1 | 1.7 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.1 | 3.4 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.1 | 4.1 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.1 | 0.8 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.1 | 0.8 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 0.8 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
| 0.1 | 4.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 3.2 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.1 | 0.6 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.1 | 1.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 4.6 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.1 | 6.2 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.1 | 1.3 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.1 | 0.8 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.1 | 2.4 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 1.4 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.1 | 0.3 | GO:0030249 | guanylate cyclase regulator activity(GO:0030249) |
| 0.1 | 0.4 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.1 | 2.1 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
| 0.1 | 5.2 | GO:0008528 | G-protein coupled peptide receptor activity(GO:0008528) |
| 0.1 | 0.8 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 15.8 | GO:0003729 | mRNA binding(GO:0003729) |
| 0.1 | 3.8 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.1 | 3.9 | GO:0070888 | E-box binding(GO:0070888) |
| 0.1 | 1.8 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.1 | 0.4 | GO:0051378 | primary amine oxidase activity(GO:0008131) serotonin binding(GO:0051378) |
| 0.1 | 0.8 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 5.7 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.1 | 1.3 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.1 | 18.1 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
| 0.1 | 1.5 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.1 | 3.0 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.1 | 0.9 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.1 | 1.7 | GO:0071949 | FAD binding(GO:0071949) |
| 0.1 | 1.4 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 3.5 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.1 | 1.5 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.1 | 2.7 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
| 0.1 | 0.4 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.7 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 2.1 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 0.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.0 | 1.0 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.3 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 1.4 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 4.4 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.0 | 2.7 | GO:0019209 | kinase activator activity(GO:0019209) |
| 0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 1.2 | GO:0018602 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
| 0.0 | 0.9 | GO:0016706 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, 2-oxoglutarate as one donor, and incorporation of one atom each of oxygen into both donors(GO:0016706) |
| 0.0 | 0.6 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.0 | 1.2 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.0 | 1.1 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.5 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.0 | 1.1 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.9 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.4 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.3 | GO:0000981 | RNA polymerase II transcription factor activity, sequence-specific DNA binding(GO:0000981) |
| 0.0 | 0.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.7 | GO:0009055 | electron carrier activity(GO:0009055) |
| 0.0 | 1.1 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
| 0.0 | 0.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 2.8 | GO:0008022 | protein C-terminus binding(GO:0008022) |
| 0.0 | 0.0 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 0.3 | GO:0019887 | protein kinase regulator activity(GO:0019887) |
| 0.0 | 11.2 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
| 0.0 | 0.2 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.5 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.0 | 11.0 | GO:0005524 | ATP binding(GO:0005524) |
| 0.0 | 0.2 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
|
|
|