Motif ID: Zfp219_Zfp740
Z-value: 0.945
Transcription factors associated with Zfp219_Zfp740:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Zfp219 | ENSMUSG00000049295.10 | Zfp219 |
| Zfp740 | ENSMUSG00000046897.10 | Zfp740 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Zfp740 | mm10_v2_chr15_+_102203639_102203709 | 0.36 | 4.8e-03 | Click! |
| Zfp219 | mm10_v2_chr14_-_52020698_52020737 | 0.13 | 3.4e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 4.6 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 1.1 | 3.3 | GO:0060023 | soft palate development(GO:0060023) |
| 1.1 | 3.2 | GO:1904049 | regulation of spontaneous neurotransmitter secretion(GO:1904048) negative regulation of spontaneous neurotransmitter secretion(GO:1904049) |
| 1.1 | 5.3 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.8 | 2.3 | GO:0097402 | neuroblast migration(GO:0097402) |
| 0.7 | 2.7 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.6 | 1.2 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.6 | 1.7 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.6 | 2.8 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.5 | 2.7 | GO:0021965 | spinal cord ventral commissure morphogenesis(GO:0021965) |
| 0.5 | 1.0 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.5 | 3.0 | GO:1903056 | regulation of lens fiber cell differentiation(GO:1902746) positive regulation of lens fiber cell differentiation(GO:1902748) regulation of melanosome organization(GO:1903056) |
| 0.5 | 2.4 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.5 | 2.3 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.4 | 4.3 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.4 | 1.2 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.4 | 3.3 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.4 | 1.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.4 | 1.4 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.4 | 2.5 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.4 | 1.4 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
| 0.3 | 2.8 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.3 | 3.8 | GO:0060746 | parental behavior(GO:0060746) |
| 0.3 | 1.3 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.3 | 4.0 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.3 | 4.1 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.3 | 0.9 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.3 | 2.6 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.3 | 1.7 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.3 | 0.8 | GO:0021759 | globus pallidus development(GO:0021759) |
| 0.3 | 1.4 | GO:0036337 | Fas signaling pathway(GO:0036337) |
| 0.3 | 1.4 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.3 | 0.8 | GO:0010752 | negative regulation of antigen processing and presentation(GO:0002578) negative regulation of nitric oxide mediated signal transduction(GO:0010751) regulation of cGMP-mediated signaling(GO:0010752) negative regulation of plasminogen activation(GO:0010757) |
| 0.3 | 1.8 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.2 | 1.4 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.2 | 2.4 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.2 | 0.2 | GO:0045608 | inhibition of neuroepithelial cell differentiation(GO:0002085) negative regulation of auditory receptor cell differentiation(GO:0045608) |
| 0.2 | 0.7 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.2 | 0.4 | GO:1904395 | positive regulation of receptor clustering(GO:1903911) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) positive regulation of neuromuscular junction development(GO:1904398) |
| 0.2 | 1.2 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.2 | 0.8 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.2 | 0.8 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.2 | 0.8 | GO:0044268 | multicellular organismal protein metabolic process(GO:0044268) |
| 0.2 | 4.5 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
| 0.2 | 0.8 | GO:0001907 | killing by symbiont of host cells(GO:0001907) induction of programmed cell death(GO:0012502) disruption by symbiont of host cell(GO:0044004) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) apoptotic process involved in embryonic digit morphogenesis(GO:1902263) positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.2 | 1.1 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.2 | 0.5 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.2 | 0.7 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.2 | 0.5 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.2 | 2.1 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.2 | 2.5 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.2 | 0.5 | GO:1903909 | regulation of receptor clustering(GO:1903909) |
| 0.2 | 0.9 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.2 | 0.5 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.2 | 0.8 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 | 1.0 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.1 | 1.3 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 | 1.7 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.1 | 0.4 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.1 | 0.6 | GO:0019230 | proprioception(GO:0019230) sensory neuron axon guidance(GO:0097374) |
| 0.1 | 0.8 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.1 | 0.7 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) regulation of pro-B cell differentiation(GO:2000973) |
| 0.1 | 1.6 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.1 | 0.8 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.1 | 0.4 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.1 | 0.4 | GO:0021830 | substrate-independent telencephalic tangential migration(GO:0021826) interneuron migration from the subpallium to the cortex(GO:0021830) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
| 0.1 | 0.9 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 | 1.5 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.1 | 0.5 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.1 | 0.6 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.1 | 0.4 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 | 1.1 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.6 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.1 | 0.4 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 | 0.9 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
| 0.1 | 0.3 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.1 | 0.5 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.1 | 1.6 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.1 | 0.7 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 | 2.3 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
| 0.1 | 0.7 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.1 | 0.4 | GO:0060982 | coronary artery morphogenesis(GO:0060982) regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.1 | 0.4 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 | 0.3 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 0.5 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
| 0.1 | 0.7 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.1 | 0.8 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
| 0.1 | 0.7 | GO:0032625 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 0.1 | 0.7 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
| 0.1 | 0.2 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.1 | 0.5 | GO:2000324 | positive regulation of female receptivity(GO:0045925) positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 | 0.7 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.1 | 0.3 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.1 | 0.4 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.1 | 0.2 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.1 | 0.3 | GO:0035878 | nail development(GO:0035878) |
| 0.1 | 0.3 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.1 | 0.5 | GO:0043586 | tongue development(GO:0043586) |
| 0.1 | 0.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 2.1 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.1 | 0.8 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 | 0.6 | GO:0007379 | segment specification(GO:0007379) |
| 0.1 | 0.8 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 | 1.3 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.1 | 0.6 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.1 | 0.5 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.1 | 0.4 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 0.1 | 0.2 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.1 | 0.4 | GO:0006402 | mRNA catabolic process(GO:0006402) |
| 0.1 | 0.5 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.1 | 0.5 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.1 | 1.2 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.1 | 1.3 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.1 | 0.5 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.1 | 0.7 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.1 | 0.5 | GO:0002902 | regulation of B cell apoptotic process(GO:0002902) negative regulation of B cell apoptotic process(GO:0002903) |
| 0.1 | 0.4 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.1 | 0.3 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.1 | 0.3 | GO:0090234 | regulation of kinetochore assembly(GO:0090234) |
| 0.1 | 0.2 | GO:0060598 | dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 0.1 | 1.1 | GO:0035909 | aorta morphogenesis(GO:0035909) |
| 0.1 | 0.9 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 | 0.2 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.1 | 0.3 | GO:0042756 | positive regulation of heat generation(GO:0031652) drinking behavior(GO:0042756) |
| 0.1 | 1.5 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 0.9 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.1 | 0.6 | GO:0055090 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.0 | 2.1 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.0 | 0.3 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 | 0.7 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.0 | 0.4 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 0.5 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.0 | 0.1 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.0 | 1.7 | GO:0021591 | ventricular system development(GO:0021591) |
| 0.0 | 0.6 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.0 | 1.6 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
| 0.0 | 0.6 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.0 | 0.4 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.0 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.0 | 0.1 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.0 | 0.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.0 | 0.4 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.0 | 0.7 | GO:0044243 | collagen catabolic process(GO:0030574) multicellular organism catabolic process(GO:0044243) |
| 0.0 | 0.0 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) |
| 0.0 | 0.2 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 | 0.2 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 2.8 | GO:0006446 | regulation of translational initiation(GO:0006446) |
| 0.0 | 1.3 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.8 | GO:0001967 | suckling behavior(GO:0001967) |
| 0.0 | 4.0 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.0 | 0.5 | GO:0033138 | positive regulation of peptidyl-serine phosphorylation(GO:0033138) |
| 0.0 | 0.1 | GO:0010958 | regulation of amino acid import(GO:0010958) regulation of L-arginine import(GO:0010963) |
| 0.0 | 2.1 | GO:0045638 | negative regulation of myeloid cell differentiation(GO:0045638) |
| 0.0 | 0.4 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.3 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.0 | 0.4 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.0 | 0.4 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.0 | 0.1 | GO:0048686 | regulation of sprouting of injured axon(GO:0048686) regulation of axon extension involved in regeneration(GO:0048690) |
| 0.0 | 0.2 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
| 0.0 | 0.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.0 | 0.2 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.8 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 | 1.6 | GO:0007019 | microtubule depolymerization(GO:0007019) |
| 0.0 | 0.2 | GO:0036037 | CD8-positive, alpha-beta T cell activation(GO:0036037) CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 | 0.4 | GO:0048520 | positive regulation of behavior(GO:0048520) |
| 0.0 | 0.5 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
| 0.0 | 0.9 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.4 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
| 0.0 | 0.4 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
| 0.0 | 0.4 | GO:0045740 | positive regulation of DNA replication(GO:0045740) |
| 0.0 | 0.3 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.0 | 0.6 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.0 | 0.1 | GO:0043137 | lagging strand elongation(GO:0006273) DNA replication, Okazaki fragment processing(GO:0033567) DNA replication, removal of RNA primer(GO:0043137) |
| 0.0 | 0.6 | GO:0007143 | female meiotic division(GO:0007143) |
| 0.0 | 1.0 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.0 | 0.1 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.0 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.0 | 0.5 | GO:0043627 | response to estrogen(GO:0043627) |
| 0.0 | 1.1 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
| 0.0 | 0.1 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
| 0.0 | 0.1 | GO:0072610 | interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.0 | 1.0 | GO:0060612 | adipose tissue development(GO:0060612) |
| 0.0 | 0.1 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.0 | 0.2 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.1 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 | 1.0 | GO:0048286 | lung alveolus development(GO:0048286) |
| 0.0 | 0.3 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 | 0.2 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.0 | 0.1 | GO:0045819 | positive regulation of glycogen catabolic process(GO:0045819) |
| 0.0 | 0.3 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.0 | 0.6 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.2 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.1 | GO:0048146 | positive regulation of fibroblast proliferation(GO:0048146) |
| 0.0 | 0.1 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.0 | 0.1 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 | 0.1 | GO:0043154 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic process(GO:0043154) negative regulation of cysteine-type endopeptidase activity(GO:2000117) |
| 0.0 | 0.2 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
| 0.0 | 0.1 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
| 0.0 | 0.1 | GO:0097494 | regulation of vesicle size(GO:0097494) |
| 0.0 | 0.1 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.0 | 0.1 | GO:0014842 | regulation of skeletal muscle satellite cell proliferation(GO:0014842) regulation of skeletal muscle cell proliferation(GO:0014857) |
| 0.0 | 0.3 | GO:0016572 | histone phosphorylation(GO:0016572) |
| 0.0 | 0.3 | GO:0010107 | potassium ion import(GO:0010107) |
| 0.0 | 0.7 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
| 0.0 | 0.0 | GO:0061687 | detoxification of inorganic compound(GO:0061687) |
| 0.0 | 0.3 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.0 | 0.1 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
| 0.0 | 0.4 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.0 | 0.2 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.0 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.0 | 0.1 | GO:2001197 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.2 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.0 | 0.9 | GO:0030218 | erythrocyte differentiation(GO:0030218) |
| 0.0 | 0.2 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
| 0.0 | 0.3 | GO:0031960 | response to corticosteroid(GO:0031960) response to glucocorticoid(GO:0051384) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 4.4 | GO:0090537 | CERF complex(GO:0090537) |
| 0.8 | 2.5 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
| 0.6 | 3.2 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.5 | 2.7 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.3 | 4.2 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.3 | 2.8 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.3 | 1.1 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.3 | 0.8 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.3 | 5.6 | GO:0010369 | chromocenter(GO:0010369) |
| 0.2 | 2.7 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.2 | 0.9 | GO:1990421 | subtelomeric heterochromatin(GO:1990421) nuclear subtelomeric heterochromatin(GO:1990707) |
| 0.2 | 2.8 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.2 | 1.5 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.2 | 1.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.2 | 1.0 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 0.4 | GO:0044299 | C-fiber(GO:0044299) |
| 0.1 | 1.4 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.1 | 0.4 | GO:0072487 | MSL complex(GO:0072487) |
| 0.1 | 1.2 | GO:0031011 | Ino80 complex(GO:0031011) |
| 0.1 | 0.9 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 2.0 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 0.4 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
| 0.1 | 4.1 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.1 | 0.8 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 1.0 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.1 | 2.8 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.1 | 1.7 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 0.4 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.1 | 0.8 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.1 | 0.4 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.4 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 1.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.1 | 0.4 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 0.3 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.1 | 1.6 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.1 | 0.4 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.1 | 1.2 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.1 | 0.4 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.1 | 0.8 | GO:0030057 | desmosome(GO:0030057) |
| 0.1 | 3.1 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 0.7 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 0.6 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.1 | 1.8 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.1 | 0.3 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 1.6 | GO:0016592 | mediator complex(GO:0016592) |
| 0.1 | 2.8 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.1 | 0.4 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.0 | 0.1 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.0 | 2.0 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.8 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 4.8 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
| 0.0 | 2.2 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 16.9 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 0.4 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.7 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.0 | 0.4 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 3.4 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.0 | 0.4 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 1.1 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.8 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 4.3 | GO:0032993 | protein-DNA complex(GO:0032993) |
| 0.0 | 0.4 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 0.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.6 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 0.3 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 1.1 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.0 | 0.2 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.0 | 1.7 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.1 | GO:0031251 | PAN complex(GO:0031251) |
| 0.0 | 0.5 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.0 | 1.0 | GO:0016459 | myosin complex(GO:0016459) |
| 0.0 | 0.5 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 1.1 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.2 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.4 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 0.1 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.3 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.1 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.1 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.3 | GO:0060170 | ciliary membrane(GO:0060170) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 4.2 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.5 | 2.4 | GO:0001093 | TFIIB-class transcription factor binding(GO:0001093) |
| 0.5 | 1.4 | GO:0070615 | nucleosome-dependent ATPase activity(GO:0070615) |
| 0.4 | 2.7 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.4 | 1.2 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.3 | 2.6 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.3 | 3.8 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.3 | 0.8 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.3 | 0.8 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.3 | 1.0 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.2 | 1.4 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.2 | 1.3 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.2 | 1.8 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.2 | 2.0 | GO:0048185 | activin binding(GO:0048185) |
| 0.2 | 0.7 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.2 | 0.8 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
| 0.2 | 0.6 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
| 0.2 | 1.0 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.2 | 2.3 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.2 | 4.0 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.2 | 3.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.2 | 2.6 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.2 | 0.7 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.2 | 0.5 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.2 | 0.9 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
| 0.1 | 0.4 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 0.1 | 2.7 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.4 | GO:0004368 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) |
| 0.1 | 2.5 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.1 | 0.8 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.4 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.5 | GO:0008802 | betaine-aldehyde dehydrogenase activity(GO:0008802) |
| 0.1 | 1.0 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.1 | 0.6 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.1 | 0.8 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 2.6 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.1 | 1.7 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.1 | 0.5 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.1 | 0.3 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 0.9 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
| 0.1 | 0.9 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 0.8 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.1 | 2.3 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.1 | 0.4 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.1 | 0.8 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.1 | 4.0 | GO:0018602 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
| 0.1 | 0.3 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.1 | 0.4 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.1 | 0.5 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 0.6 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.1 | 0.8 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.1 | 0.5 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.1 | 0.4 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 2.9 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.1 | 0.7 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.1 | 2.8 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 1.9 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.1 | 2.2 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 0.3 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 3.1 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.1 | 1.6 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.1 | 1.8 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 1.8 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.1 | 1.4 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.1 | 3.5 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.1 | 0.4 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.1 | 0.7 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.1 | 1.2 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.1 | 0.8 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 2.9 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.1 | 0.2 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.1 | 1.0 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.1 | 1.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.1 | 0.4 | GO:0070699 | activin receptor binding(GO:0070697) type II activin receptor binding(GO:0070699) |
| 0.1 | 0.3 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
| 0.1 | 0.4 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.9 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.1 | 0.4 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.2 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 2.4 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
| 0.0 | 0.7 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.7 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.7 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.0 | 0.6 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.1 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.0 | 0.9 | GO:0017161 | phosphohistidine phosphatase activity(GO:0008969) inositol-1,3,4-trisphosphate 4-phosphatase activity(GO:0017161) NADP phosphatase activity(GO:0019178) 5-amino-6-(5-phosphoribitylamino)uracil phosphatase activity(GO:0043726) phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-3,4-bisphosphate 4-phosphatase activity(GO:0052828) inositol-1,3,4-trisphosphate 1-phosphatase activity(GO:0052829) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) phosphatidylinositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052867) IDP phosphatase activity(GO:1990003) |
| 0.0 | 1.5 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.6 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.0 | 0.5 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 0.6 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 1.6 | GO:0045502 | dynein binding(GO:0045502) |
| 0.0 | 39.4 | GO:0003700 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
| 0.0 | 0.7 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.4 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) interleukin-1 receptor binding(GO:0005149) |
| 0.0 | 1.6 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.4 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.0 | 0.3 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.3 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.0 | 0.5 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.6 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.0 | 2.7 | GO:0043851 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) rRNA (uridine-2'-O-)-methyltransferase activity(GO:0008650) rRNA (adenine-N6-)-methyltransferase activity(GO:0008988) DNA-methyltransferase activity(GO:0009008) rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) selenocysteine methyltransferase activity(GO:0016205) rRNA (adenine) methyltransferase activity(GO:0016433) rRNA (cytosine) methyltransferase activity(GO:0016434) rRNA (guanine) methyltransferase activity(GO:0016435) 1-phenanthrol methyltransferase activity(GO:0018707) protein-arginine N5-methyltransferase activity(GO:0019702) dimethylarsinite methyltransferase activity(GO:0034541) 4,5-dihydroxybenzo(a)pyrene methyltransferase activity(GO:0034807) 1-hydroxypyrene methyltransferase activity(GO:0034931) 1-hydroxy-6-methoxypyrene methyltransferase activity(GO:0034933) demethylmenaquinone methyltransferase activity(GO:0043770) cobalt-precorrin-6B C5-methyltransferase activity(GO:0043776) cobalt-precorrin-7 C15-methyltransferase activity(GO:0043777) cobalt-precorrin-5B C1-methyltransferase activity(GO:0043780) cobalt-precorrin-3 C17-methyltransferase activity(GO:0043782) dimethylamine methyltransferase activity(GO:0043791) hydroxyneurosporene-O-methyltransferase activity(GO:0043803) tRNA (adenine-57, 58-N(1)-) methyltransferase activity(GO:0043827) methylamine-specific methylcobalamin:coenzyme M methyltransferase activity(GO:0043833) trimethylamine methyltransferase activity(GO:0043834) methanol-specific methylcobalamin:coenzyme M methyltransferase activity(GO:0043851) monomethylamine methyltransferase activity(GO:0043852) P-methyltransferase activity(GO:0051994) Se-methyltransferase activity(GO:0051995) 2-phytyl-1,4-naphthoquinone methyltransferase activity(GO:0052624) tRNA (uracil-2'-O-)-methyltransferase activity(GO:0052665) tRNA (cytosine-2'-O-)-methyltransferase activity(GO:0052666) phosphomethylethanolamine N-methyltransferase activity(GO:0052667) tRNA (cytosine-3-)-methyltransferase activity(GO:0052735) rRNA (cytosine-2'-O-)-methyltransferase activity(GO:0070677) rRNA (cytosine-N4-)-methyltransferase activity(GO:0071424) trihydroxyferuloyl spermidine O-methyltransferase activity(GO:0080012) |
| 0.0 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 1.1 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.5 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.0 | 0.6 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 2.6 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.0 | 1.3 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.0 | 1.2 | GO:0003678 | DNA helicase activity(GO:0003678) |
| 0.0 | 0.2 | GO:0035615 | clathrin heavy chain binding(GO:0032050) clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.0 | 0.1 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.0 | 0.9 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.4 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.4 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.4 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.3 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.0 | 0.6 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 0.1 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.0 | 4.9 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.0 | 0.4 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 0.3 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.1 | GO:0000402 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
| 0.0 | 1.6 | GO:0001948 | glycoprotein binding(GO:0001948) |
| 0.0 | 0.7 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 0.0 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.1 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 0.3 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.8 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 1.2 | GO:0004386 | helicase activity(GO:0004386) |
| 0.0 | 0.6 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.0 | 0.2 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.0 | 0.2 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.2 | GO:0004707 | MAP kinase activity(GO:0004707) |
|
|
|