| 3.0 |
8.9 |
GO:0035790 |
platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 2.6 |
10.6 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 2.0 |
13.7 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 1.8 |
9.2 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 1.8 |
9.1 |
GO:0034441 |
plasma lipoprotein particle oxidation(GO:0034441) |
| 1.7 |
13.3 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 1.6 |
4.8 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 1.6 |
6.3 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 1.5 |
5.9 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 1.5 |
1.5 |
GO:0045404 |
positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 1.4 |
1.4 |
GO:0045909 |
positive regulation of vasodilation(GO:0045909) |
| 1.3 |
6.6 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 1.3 |
7.8 |
GO:1902847 |
macrophage proliferation(GO:0061517) microglial cell proliferation(GO:0061518) regulation of neuronal signal transduction(GO:1902847) positive regulation of tau-protein kinase activity(GO:1902949) |
| 1.3 |
1.3 |
GO:0042160 |
lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
| 1.2 |
7.3 |
GO:0032488 |
Cdc42 protein signal transduction(GO:0032488) |
| 1.2 |
3.6 |
GO:0032650 |
regulation of interleukin-1 alpha production(GO:0032650) positive regulation of interleukin-1 alpha production(GO:0032730) interleukin-1 alpha secretion(GO:0050703) |
| 1.2 |
11.6 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 1.1 |
13.5 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 1.1 |
11.1 |
GO:2001214 |
positive regulation of vasculogenesis(GO:2001214) |
| 1.1 |
3.3 |
GO:0006601 |
creatine biosynthetic process(GO:0006601) |
| 1.1 |
5.5 |
GO:2000298 |
regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 1.1 |
4.4 |
GO:0035878 |
nail development(GO:0035878) |
| 1.1 |
3.3 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 1.1 |
3.3 |
GO:0045349 |
interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 1.1 |
1.1 |
GO:0032687 |
negative regulation of interferon-alpha production(GO:0032687) |
| 1.1 |
4.2 |
GO:0002339 |
B cell selection(GO:0002339) |
| 1.1 |
1.1 |
GO:0021593 |
rhombomere morphogenesis(GO:0021593) |
| 1.0 |
3.1 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 1.0 |
4.1 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 1.0 |
4.1 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 1.0 |
5.1 |
GO:0051045 |
negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 1.0 |
3.0 |
GO:0003278 |
apoptotic process involved in heart morphogenesis(GO:0003278) |
| 1.0 |
4.9 |
GO:0070278 |
extracellular matrix constituent secretion(GO:0070278) |
| 1.0 |
4.9 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 1.0 |
2.9 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 1.0 |
1.0 |
GO:0034440 |
lipid oxidation(GO:0034440) |
| 1.0 |
2.9 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 1.0 |
2.9 |
GO:0032918 |
polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.9 |
4.7 |
GO:0070460 |
thyroid-stimulating hormone secretion(GO:0070460) |
| 0.9 |
2.8 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 0.9 |
4.7 |
GO:0033029 |
regulation of neutrophil apoptotic process(GO:0033029) |
| 0.9 |
5.6 |
GO:0021938 |
smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 0.9 |
8.5 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.9 |
1.9 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.9 |
3.7 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.9 |
2.7 |
GO:1903795 |
regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.9 |
9.8 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.9 |
0.9 |
GO:0046544 |
development of secondary male sexual characteristics(GO:0046544) |
| 0.9 |
2.6 |
GO:0021557 |
oculomotor nerve development(GO:0021557) |
| 0.9 |
1.7 |
GO:0006573 |
valine metabolic process(GO:0006573) |
| 0.9 |
3.4 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.8 |
1.7 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 0.8 |
0.8 |
GO:0042663 |
regulation of endodermal cell fate specification(GO:0042663) |
| 0.8 |
2.5 |
GO:0016598 |
protein arginylation(GO:0016598) |
| 0.8 |
4.0 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.8 |
7.2 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.8 |
4.0 |
GO:0021914 |
negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.8 |
2.3 |
GO:2000569 |
T-helper 2 cell activation(GO:0035712) positive regulation of T-helper 17 type immune response(GO:2000318) regulation of T-helper 2 cell activation(GO:2000569) positive regulation of T-helper 2 cell activation(GO:2000570) |
| 0.8 |
3.9 |
GO:0047484 |
regulation of response to osmotic stress(GO:0047484) |
| 0.8 |
2.3 |
GO:0090425 |
hepatocyte cell migration(GO:0002194) pancreas morphogenesis(GO:0061113) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) positive regulation of forebrain neuron differentiation(GO:2000979) |
| 0.8 |
2.3 |
GO:0043988 |
histone H3-S28 phosphorylation(GO:0043988) |
| 0.8 |
3.1 |
GO:0070459 |
prolactin secretion(GO:0070459) |
| 0.8 |
2.3 |
GO:0006590 |
thyroid hormone generation(GO:0006590) |
| 0.7 |
0.7 |
GO:1902837 |
amino acid import into cell(GO:1902837) |
| 0.7 |
4.5 |
GO:0072224 |
metanephric glomerulus development(GO:0072224) |
| 0.7 |
2.2 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.7 |
0.7 |
GO:0072199 |
mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) |
| 0.7 |
1.4 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 0.7 |
0.7 |
GO:0006526 |
arginine biosynthetic process(GO:0006526) |
| 0.7 |
2.8 |
GO:0034384 |
high-density lipoprotein particle clearance(GO:0034384) |
| 0.7 |
1.4 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.7 |
6.8 |
GO:0061032 |
visceral serous pericardium development(GO:0061032) |
| 0.7 |
2.0 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.7 |
0.7 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 0.7 |
2.0 |
GO:0009177 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 0.7 |
2.0 |
GO:0034035 |
purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.7 |
1.3 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.7 |
2.7 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 0.7 |
0.7 |
GO:1903351 |
response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
| 0.7 |
4.6 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.7 |
2.0 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 0.7 |
2.0 |
GO:0090258 |
negative regulation of mitochondrial fission(GO:0090258) |
| 0.7 |
1.3 |
GO:0060414 |
aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.7 |
2.6 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.7 |
2.0 |
GO:1900149 |
positive regulation of Schwann cell migration(GO:1900149) |
| 0.7 |
7.2 |
GO:0071578 |
zinc II ion transmembrane import(GO:0071578) |
| 0.7 |
2.6 |
GO:1902990 |
mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.6 |
2.6 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.6 |
1.9 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.6 |
5.7 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.6 |
1.3 |
GO:0008065 |
establishment of blood-nerve barrier(GO:0008065) |
| 0.6 |
1.9 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 0.6 |
2.5 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.6 |
2.5 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.6 |
3.1 |
GO:0032534 |
regulation of microvillus assembly(GO:0032534) |
| 0.6 |
4.3 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.6 |
1.2 |
GO:0042307 |
positive regulation of protein import into nucleus(GO:0042307) |
| 0.6 |
2.4 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.6 |
2.4 |
GO:0072015 |
glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
| 0.6 |
2.4 |
GO:1903275 |
positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.6 |
3.5 |
GO:0032261 |
purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
| 0.6 |
0.6 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.6 |
1.7 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.6 |
1.2 |
GO:0045617 |
negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.6 |
1.7 |
GO:0072488 |
ammonium transmembrane transport(GO:0072488) |
| 0.6 |
8.6 |
GO:0038065 |
collagen-activated signaling pathway(GO:0038065) |
| 0.6 |
0.6 |
GO:0032224 |
positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.6 |
2.3 |
GO:1904425 |
negative regulation of GTP binding(GO:1904425) |
| 0.6 |
2.3 |
GO:0014012 |
peripheral nervous system axon regeneration(GO:0014012) |
| 0.6 |
5.1 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 0.6 |
1.1 |
GO:0072602 |
interleukin-4 secretion(GO:0072602) |
| 0.6 |
1.7 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.6 |
2.8 |
GO:0042167 |
heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.6 |
6.2 |
GO:0009143 |
nucleoside triphosphate catabolic process(GO:0009143) |
| 0.6 |
1.7 |
GO:1903903 |
striated muscle atrophy(GO:0014891) regulation of establishment of T cell polarity(GO:1903903) |
| 0.6 |
1.7 |
GO:0070103 |
regulation of interleukin-6-mediated signaling pathway(GO:0070103) negative regulation of interleukin-6-mediated signaling pathway(GO:0070104) |
| 0.6 |
1.7 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.6 |
1.7 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.5 |
1.6 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.5 |
1.6 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.5 |
2.7 |
GO:0043402 |
glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.5 |
1.6 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.5 |
1.6 |
GO:0045938 |
positive regulation of circadian sleep/wake cycle, sleep(GO:0045938) |
| 0.5 |
2.2 |
GO:0006842 |
tricarboxylic acid transport(GO:0006842) succinate transport(GO:0015744) citrate transport(GO:0015746) |
| 0.5 |
1.6 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.5 |
1.6 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.5 |
2.1 |
GO:2000054 |
negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 0.5 |
2.1 |
GO:0070305 |
response to cGMP(GO:0070305) cellular response to cGMP(GO:0071321) |
| 0.5 |
1.6 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.5 |
4.6 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.5 |
1.5 |
GO:0048352 |
neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) |
| 0.5 |
2.0 |
GO:0090086 |
negative regulation of protein deubiquitination(GO:0090086) |
| 0.5 |
1.0 |
GO:0046655 |
folic acid metabolic process(GO:0046655) |
| 0.5 |
3.1 |
GO:0009068 |
aspartate family amino acid catabolic process(GO:0009068) |
| 0.5 |
2.5 |
GO:1904721 |
regulation of mRNA cleavage(GO:0031437) negative regulation of mRNA cleavage(GO:0031438) negative regulation of immunoglobulin secretion(GO:0051025) negative regulation of ribonuclease activity(GO:0060701) negative regulation of endoribonuclease activity(GO:0060702) regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904720) negative regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904721) |
| 0.5 |
6.1 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.5 |
2.5 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.5 |
1.5 |
GO:0001951 |
intestinal D-glucose absorption(GO:0001951) terminal web assembly(GO:1902896) |
| 0.5 |
1.0 |
GO:0007494 |
midgut development(GO:0007494) |
| 0.5 |
2.5 |
GO:0046601 |
positive regulation of centriole replication(GO:0046601) |
| 0.5 |
1.5 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.5 |
1.0 |
GO:0036518 |
chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.5 |
3.8 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.5 |
1.4 |
GO:0036388 |
pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.5 |
0.5 |
GO:0072048 |
pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
| 0.5 |
3.3 |
GO:0019254 |
carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.5 |
2.3 |
GO:0045915 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.5 |
0.9 |
GO:0043366 |
beta selection(GO:0043366) |
| 0.5 |
1.4 |
GO:0061743 |
motor learning(GO:0061743) |
| 0.5 |
0.9 |
GO:0051004 |
regulation of lipoprotein lipase activity(GO:0051004) |
| 0.5 |
0.9 |
GO:0016126 |
sterol biosynthetic process(GO:0016126) |
| 0.5 |
0.9 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.5 |
0.5 |
GO:0001867 |
complement activation, lectin pathway(GO:0001867) |
| 0.5 |
12.0 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.5 |
1.4 |
GO:0048686 |
axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) regulation of sprouting of injured axon(GO:0048686) regulation of axon extension involved in regeneration(GO:0048690) |
| 0.5 |
1.4 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.4 |
0.4 |
GO:2001027 |
negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.4 |
1.3 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.4 |
1.8 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 0.4 |
1.3 |
GO:0009812 |
flavonoid metabolic process(GO:0009812) flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.4 |
3.1 |
GO:0033227 |
dsRNA transport(GO:0033227) |
| 0.4 |
1.3 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.4 |
2.6 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.4 |
1.7 |
GO:0043654 |
recognition of apoptotic cell(GO:0043654) |
| 0.4 |
0.4 |
GO:0021913 |
regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.4 |
1.7 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.4 |
3.0 |
GO:0048664 |
neuron fate determination(GO:0048664) |
| 0.4 |
2.1 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.4 |
0.9 |
GO:0050748 |
negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.4 |
6.4 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.4 |
3.8 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.4 |
2.1 |
GO:0034638 |
phosphatidylcholine catabolic process(GO:0034638) |
| 0.4 |
6.0 |
GO:0032291 |
central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
| 0.4 |
1.3 |
GO:0070625 |
zymogen granule exocytosis(GO:0070625) |
| 0.4 |
3.3 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.4 |
1.7 |
GO:2000483 |
negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.4 |
1.7 |
GO:0036493 |
positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.4 |
0.4 |
GO:0072309 |
mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
| 0.4 |
6.5 |
GO:1901841 |
regulation of high voltage-gated calcium channel activity(GO:1901841) |
| 0.4 |
1.2 |
GO:0019343 |
cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 0.4 |
1.2 |
GO:0007525 |
somatic muscle development(GO:0007525) |
| 0.4 |
1.2 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.4 |
1.2 |
GO:0035106 |
operant conditioning(GO:0035106) |
| 0.4 |
0.8 |
GO:2001046 |
positive regulation of integrin-mediated signaling pathway(GO:2001046) |
| 0.4 |
1.2 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.4 |
2.0 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 0.4 |
1.2 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.4 |
2.7 |
GO:0038028 |
insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.4 |
1.6 |
GO:0035934 |
corticosterone secretion(GO:0035934) |
| 0.4 |
4.6 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.4 |
1.2 |
GO:0050904 |
diapedesis(GO:0050904) |
| 0.4 |
0.4 |
GO:2000049 |
positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.4 |
1.1 |
GO:0014834 |
skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 0.4 |
1.9 |
GO:2000255 |
negative regulation of male germ cell proliferation(GO:2000255) |
| 0.4 |
3.4 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.4 |
3.0 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.4 |
0.8 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.4 |
1.9 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.4 |
3.4 |
GO:0006183 |
GTP biosynthetic process(GO:0006183) |
| 0.4 |
3.0 |
GO:0097460 |
ferrous iron import into cell(GO:0097460) |
| 0.4 |
0.4 |
GO:0038165 |
oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.4 |
1.8 |
GO:0002934 |
desmosome organization(GO:0002934) |
| 0.4 |
1.1 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.4 |
1.8 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.4 |
0.4 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.4 |
1.1 |
GO:0048388 |
endosomal lumen acidification(GO:0048388) |
| 0.4 |
2.2 |
GO:0071680 |
response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.4 |
1.8 |
GO:2001170 |
negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.4 |
1.8 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 0.4 |
4.3 |
GO:0044406 |
adhesion of symbiont to host(GO:0044406) |
| 0.4 |
1.4 |
GO:0033024 |
mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
| 0.4 |
1.4 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.4 |
1.1 |
GO:1903896 |
positive regulation of IRE1-mediated unfolded protein response(GO:1903896) positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.4 |
0.4 |
GO:0042492 |
gamma-delta T cell differentiation(GO:0042492) gamma-delta T cell activation(GO:0046629) |
| 0.4 |
0.4 |
GO:0010940 |
positive regulation of necrotic cell death(GO:0010940) |
| 0.4 |
1.1 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.4 |
0.7 |
GO:0071921 |
establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.4 |
1.1 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.4 |
0.7 |
GO:0045014 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.4 |
0.4 |
GO:0046101 |
hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.3 |
0.3 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.3 |
1.4 |
GO:0010273 |
detoxification of copper ion(GO:0010273) detoxification of inorganic compound(GO:0061687) stress response to copper ion(GO:1990169) |
| 0.3 |
0.7 |
GO:1901724 |
positive regulation of cell proliferation involved in kidney development(GO:1901724) |
| 0.3 |
1.0 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.3 |
0.3 |
GO:0010643 |
cell communication by chemical coupling(GO:0010643) |
| 0.3 |
0.3 |
GO:0035910 |
ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
| 0.3 |
1.7 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.3 |
1.4 |
GO:2000587 |
regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.3 |
1.4 |
GO:0071281 |
cellular response to iron ion(GO:0071281) |
| 0.3 |
1.0 |
GO:0008594 |
photoreceptor cell morphogenesis(GO:0008594) |
| 0.3 |
1.0 |
GO:0048014 |
Tie signaling pathway(GO:0048014) |
| 0.3 |
6.4 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.3 |
0.7 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.3 |
1.7 |
GO:0071360 |
cellular response to exogenous dsRNA(GO:0071360) |
| 0.3 |
1.0 |
GO:0048698 |
negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.3 |
1.7 |
GO:0072526 |
pyridine-containing compound catabolic process(GO:0072526) |
| 0.3 |
1.7 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.3 |
0.7 |
GO:0016056 |
rhodopsin mediated signaling pathway(GO:0016056) |
| 0.3 |
9.9 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.3 |
1.0 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.3 |
1.0 |
GO:1902528 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.3 |
1.0 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.3 |
2.9 |
GO:0060712 |
spongiotrophoblast layer development(GO:0060712) |
| 0.3 |
0.6 |
GO:0001803 |
type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
| 0.3 |
0.6 |
GO:0014022 |
neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) convergent extension involved in gastrulation(GO:0060027) |
| 0.3 |
1.9 |
GO:0061365 |
positive regulation of triglyceride lipase activity(GO:0061365) |
| 0.3 |
6.8 |
GO:0002089 |
lens morphogenesis in camera-type eye(GO:0002089) |
| 0.3 |
0.3 |
GO:1902630 |
regulation of membrane hyperpolarization(GO:1902630) |
| 0.3 |
1.0 |
GO:0060217 |
hemangioblast cell differentiation(GO:0060217) |
| 0.3 |
0.3 |
GO:0097178 |
ruffle assembly(GO:0097178) |
| 0.3 |
1.6 |
GO:0072338 |
creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.3 |
1.0 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.3 |
1.9 |
GO:0035330 |
regulation of hippo signaling(GO:0035330) |
| 0.3 |
1.0 |
GO:0030421 |
defecation(GO:0030421) |
| 0.3 |
1.9 |
GO:0036376 |
sodium ion export from cell(GO:0036376) |
| 0.3 |
0.9 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.3 |
2.5 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.3 |
0.6 |
GO:0010701 |
positive regulation of norepinephrine secretion(GO:0010701) |
| 0.3 |
0.3 |
GO:1901856 |
negative regulation of cellular respiration(GO:1901856) |
| 0.3 |
0.3 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.3 |
5.0 |
GO:0035115 |
embryonic forelimb morphogenesis(GO:0035115) |
| 0.3 |
2.5 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.3 |
2.2 |
GO:0042640 |
anagen(GO:0042640) |
| 0.3 |
1.9 |
GO:0010528 |
regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.3 |
0.6 |
GO:0003406 |
retinal pigment epithelium development(GO:0003406) |
| 0.3 |
1.6 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.3 |
0.9 |
GO:2000983 |
regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.3 |
1.9 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.3 |
0.9 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.3 |
1.5 |
GO:0070779 |
D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.3 |
1.2 |
GO:0043116 |
negative regulation of vascular permeability(GO:0043116) |
| 0.3 |
1.5 |
GO:0045347 |
negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.3 |
1.2 |
GO:2000042 |
negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.3 |
1.9 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.3 |
4.3 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.3 |
5.5 |
GO:0000038 |
very long-chain fatty acid metabolic process(GO:0000038) |
| 0.3 |
1.2 |
GO:0060923 |
cardiac muscle cell fate commitment(GO:0060923) |
| 0.3 |
0.9 |
GO:0002765 |
immune response-inhibiting signal transduction(GO:0002765) |
| 0.3 |
0.9 |
GO:0008300 |
isoprenoid catabolic process(GO:0008300) |
| 0.3 |
0.9 |
GO:0035166 |
post-embryonic hemopoiesis(GO:0035166) |
| 0.3 |
2.4 |
GO:0060613 |
fat pad development(GO:0060613) |
| 0.3 |
0.9 |
GO:0046084 |
adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.3 |
2.1 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.3 |
0.9 |
GO:0030208 |
dermatan sulfate biosynthetic process(GO:0030208) |
| 0.3 |
0.9 |
GO:0000050 |
urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 0.3 |
1.5 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.3 |
6.3 |
GO:0006825 |
copper ion transport(GO:0006825) |
| 0.3 |
3.3 |
GO:0060055 |
angiogenesis involved in wound healing(GO:0060055) |
| 0.3 |
1.5 |
GO:0060050 |
positive regulation of protein glycosylation(GO:0060050) |
| 0.3 |
0.9 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 0.3 |
1.5 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.3 |
1.2 |
GO:2000504 |
positive regulation of blood vessel remodeling(GO:2000504) |
| 0.3 |
0.9 |
GO:0030070 |
insulin processing(GO:0030070) |
| 0.3 |
1.2 |
GO:0001955 |
blood vessel maturation(GO:0001955) |
| 0.3 |
0.3 |
GO:1990379 |
lipid transport across blood brain barrier(GO:1990379) |
| 0.3 |
1.2 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.3 |
1.5 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.3 |
1.5 |
GO:0015788 |
UDP-N-acetylglucosamine transport(GO:0015788) |
| 0.3 |
0.6 |
GO:2000314 |
negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.3 |
0.9 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 0.3 |
2.9 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.3 |
0.3 |
GO:0032497 |
detection of lipopolysaccharide(GO:0032497) |
| 0.3 |
1.2 |
GO:0048539 |
bone marrow development(GO:0048539) |
| 0.3 |
2.0 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.3 |
2.0 |
GO:0006532 |
aspartate biosynthetic process(GO:0006532) |
| 0.3 |
0.3 |
GO:0007044 |
cell-substrate junction assembly(GO:0007044) |
| 0.3 |
4.6 |
GO:0060134 |
prepulse inhibition(GO:0060134) |
| 0.3 |
1.1 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.3 |
0.3 |
GO:1905065 |
regulation of vascular smooth muscle cell differentiation(GO:1905063) positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.3 |
0.9 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 0.3 |
1.1 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.3 |
0.9 |
GO:0046168 |
glycerol-3-phosphate catabolic process(GO:0046168) |
| 0.3 |
3.7 |
GO:0033273 |
response to vitamin(GO:0033273) |
| 0.3 |
0.8 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.3 |
0.6 |
GO:0021546 |
rhombomere development(GO:0021546) |
| 0.3 |
0.6 |
GO:1904996 |
positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.3 |
4.2 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.3 |
0.3 |
GO:0070601 |
centromeric sister chromatid cohesion(GO:0070601) |
| 0.3 |
0.8 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.3 |
0.8 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.3 |
3.0 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.3 |
1.4 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.3 |
1.1 |
GO:0010510 |
regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.3 |
3.8 |
GO:0003417 |
growth plate cartilage development(GO:0003417) |
| 0.3 |
1.9 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.3 |
1.1 |
GO:0042985 |
negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.3 |
0.8 |
GO:0090027 |
negative regulation of monocyte chemotaxis(GO:0090027) |
| 0.3 |
1.1 |
GO:0046909 |
intermembrane transport(GO:0046909) |
| 0.3 |
1.1 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.3 |
0.5 |
GO:0060576 |
intestinal epithelial cell development(GO:0060576) |
| 0.3 |
0.8 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.3 |
1.1 |
GO:0051541 |
elastin metabolic process(GO:0051541) |
| 0.3 |
0.8 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.3 |
0.8 |
GO:0046051 |
UTP metabolic process(GO:0046051) |
| 0.3 |
2.2 |
GO:0060294 |
cilium movement involved in cell motility(GO:0060294) |
| 0.3 |
2.7 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.3 |
1.6 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.3 |
1.6 |
GO:0035814 |
negative regulation of renal sodium excretion(GO:0035814) |
| 0.3 |
1.1 |
GO:0032788 |
saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.3 |
0.5 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.3 |
4.0 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 0.3 |
2.7 |
GO:0007042 |
lysosomal lumen acidification(GO:0007042) |
| 0.3 |
1.6 |
GO:0003065 |
positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.3 |
4.0 |
GO:0042178 |
xenobiotic catabolic process(GO:0042178) |
| 0.3 |
0.3 |
GO:0010838 |
positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.3 |
3.1 |
GO:0006309 |
apoptotic DNA fragmentation(GO:0006309) |
| 0.3 |
1.0 |
GO:0019249 |
lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.3 |
4.9 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.3 |
2.6 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.3 |
0.8 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.3 |
1.0 |
GO:0001676 |
long-chain fatty acid metabolic process(GO:0001676) |
| 0.3 |
0.5 |
GO:1900025 |
negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.3 |
1.0 |
GO:0070358 |
actin polymerization-dependent cell motility(GO:0070358) |
| 0.3 |
0.8 |
GO:0043101 |
purine-containing compound salvage(GO:0043101) |
| 0.3 |
1.5 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.3 |
2.8 |
GO:0051307 |
meiotic chromosome separation(GO:0051307) |
| 0.3 |
0.5 |
GO:0050651 |
dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.3 |
1.3 |
GO:0033008 |
positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.3 |
0.5 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.3 |
0.3 |
GO:1901030 |
positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.3 |
0.3 |
GO:0072235 |
distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
| 0.2 |
0.7 |
GO:0072126 |
positive regulation of glomerular mesangial cell proliferation(GO:0072126) |
| 0.2 |
5.0 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.2 |
0.2 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.2 |
5.9 |
GO:0014009 |
glial cell proliferation(GO:0014009) |
| 0.2 |
0.2 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 0.2 |
3.7 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.2 |
1.7 |
GO:0006012 |
galactose metabolic process(GO:0006012) |
| 0.2 |
1.7 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.2 |
1.7 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.2 |
0.2 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.2 |
0.7 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.2 |
0.7 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.2 |
0.5 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.2 |
3.6 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.2 |
0.2 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.2 |
1.2 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.2 |
6.4 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.2 |
0.9 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.2 |
4.7 |
GO:0071398 |
cellular response to fatty acid(GO:0071398) |
| 0.2 |
1.4 |
GO:0071670 |
smooth muscle cell chemotaxis(GO:0071670) |
| 0.2 |
0.2 |
GO:0045900 |
negative regulation of translational elongation(GO:0045900) |
| 0.2 |
0.2 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.2 |
0.9 |
GO:0098763 |
mitotic cell cycle phase(GO:0098763) |
| 0.2 |
0.2 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.2 |
1.6 |
GO:2000348 |
regulation of CD40 signaling pathway(GO:2000348) |
| 0.2 |
0.5 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.2 |
1.6 |
GO:1904667 |
negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.2 |
2.1 |
GO:2000643 |
positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.2 |
1.2 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.2 |
0.7 |
GO:0006027 |
glycosaminoglycan catabolic process(GO:0006027) |
| 0.2 |
0.5 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 0.2 |
0.9 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.2 |
0.7 |
GO:0070166 |
enamel mineralization(GO:0070166) |
| 0.2 |
1.1 |
GO:0009169 |
purine nucleoside monophosphate catabolic process(GO:0009128) ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.2 |
0.5 |
GO:1903054 |
negative regulation of extracellular matrix organization(GO:1903054) |
| 0.2 |
0.9 |
GO:0090272 |
negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.2 |
1.6 |
GO:0009437 |
carnitine metabolic process(GO:0009437) |
| 0.2 |
2.9 |
GO:0070842 |
aggresome assembly(GO:0070842) |
| 0.2 |
0.7 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.2 |
0.9 |
GO:0007158 |
neuron cell-cell adhesion(GO:0007158) |
| 0.2 |
0.4 |
GO:0030210 |
heparin biosynthetic process(GO:0030210) |
| 0.2 |
0.7 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.2 |
0.9 |
GO:0000731 |
DNA synthesis involved in DNA repair(GO:0000731) |
| 0.2 |
0.9 |
GO:1901341 |
activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.2 |
1.3 |
GO:0006730 |
one-carbon metabolic process(GO:0006730) |
| 0.2 |
0.9 |
GO:2001269 |
positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.2 |
0.4 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.2 |
1.1 |
GO:0015669 |
gas transport(GO:0015669) |
| 0.2 |
0.7 |
GO:0009070 |
serine family amino acid biosynthetic process(GO:0009070) |
| 0.2 |
0.2 |
GO:0045040 |
outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) |
| 0.2 |
1.1 |
GO:0048549 |
regulation of pinocytosis(GO:0048548) positive regulation of pinocytosis(GO:0048549) |
| 0.2 |
1.5 |
GO:0032463 |
negative regulation of protein homooligomerization(GO:0032463) |
| 0.2 |
0.9 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 0.2 |
0.6 |
GO:0030862 |
neuroblast division in subventricular zone(GO:0021849) regulation of polarized epithelial cell differentiation(GO:0030860) positive regulation of polarized epithelial cell differentiation(GO:0030862) |
| 0.2 |
1.1 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.2 |
1.1 |
GO:0046135 |
pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.2 |
0.4 |
GO:0032725 |
positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
| 0.2 |
0.6 |
GO:1904139 |
microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
| 0.2 |
0.9 |
GO:0032808 |
lacrimal gland development(GO:0032808) |
| 0.2 |
0.4 |
GO:0034135 |
regulation of toll-like receptor 2 signaling pathway(GO:0034135) |
| 0.2 |
0.6 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.2 |
0.6 |
GO:0016095 |
polyprenol catabolic process(GO:0016095) |
| 0.2 |
0.6 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.2 |
0.8 |
GO:0051771 |
negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.2 |
0.8 |
GO:0001920 |
negative regulation of receptor recycling(GO:0001920) |
| 0.2 |
0.4 |
GO:0019478 |
D-amino acid catabolic process(GO:0019478) |
| 0.2 |
1.3 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.2 |
1.5 |
GO:0034379 |
very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.2 |
6.2 |
GO:0032611 |
interleukin-1 beta production(GO:0032611) |
| 0.2 |
1.2 |
GO:0070092 |
regulation of glucagon secretion(GO:0070092) |
| 0.2 |
2.3 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.2 |
0.6 |
GO:0042196 |
dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
| 0.2 |
0.2 |
GO:1990314 |
cellular response to insulin-like growth factor stimulus(GO:1990314) |
| 0.2 |
1.2 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.2 |
0.4 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 |
0.4 |
GO:2000224 |
testosterone biosynthetic process(GO:0061370) regulation of testosterone biosynthetic process(GO:2000224) |
| 0.2 |
0.6 |
GO:0002331 |
pre-B cell allelic exclusion(GO:0002331) |
| 0.2 |
3.1 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.2 |
0.6 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.2 |
0.8 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.2 |
1.6 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.2 |
0.4 |
GO:0032914 |
positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.2 |
0.8 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.2 |
1.4 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.2 |
2.2 |
GO:0032367 |
intracellular cholesterol transport(GO:0032367) |
| 0.2 |
11.9 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.2 |
0.6 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.2 |
0.6 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.2 |
0.6 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.2 |
0.4 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.2 |
1.2 |
GO:0060665 |
regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.2 |
0.4 |
GO:0042940 |
D-amino acid transport(GO:0042940) |
| 0.2 |
0.8 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.2 |
1.9 |
GO:0019985 |
translesion synthesis(GO:0019985) |
| 0.2 |
1.4 |
GO:0042346 |
positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.2 |
1.6 |
GO:0040036 |
regulation of fibroblast growth factor receptor signaling pathway(GO:0040036) |
| 0.2 |
0.6 |
GO:0045659 |
eosinophil differentiation(GO:0030222) regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.2 |
0.4 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.2 |
0.4 |
GO:0043206 |
extracellular fibril organization(GO:0043206) |
| 0.2 |
1.0 |
GO:0006681 |
galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.2 |
1.1 |
GO:0048227 |
plasma membrane to endosome transport(GO:0048227) |
| 0.2 |
0.6 |
GO:0060075 |
regulation of resting membrane potential(GO:0060075) |
| 0.2 |
0.8 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.2 |
0.8 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.2 |
0.9 |
GO:0042670 |
retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
| 0.2 |
0.6 |
GO:0032755 |
positive regulation of interleukin-6 production(GO:0032755) |
| 0.2 |
1.9 |
GO:0048387 |
negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.2 |
0.2 |
GO:0031590 |
wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
| 0.2 |
0.4 |
GO:0050855 |
regulation of B cell receptor signaling pathway(GO:0050855) |
| 0.2 |
1.5 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.2 |
0.2 |
GO:0060681 |
branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.2 |
0.6 |
GO:0006207 |
'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.2 |
1.7 |
GO:0071801 |
regulation of podosome assembly(GO:0071801) |
| 0.2 |
0.2 |
GO:2000253 |
positive regulation of feeding behavior(GO:2000253) |
| 0.2 |
0.6 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.2 |
0.6 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.2 |
0.6 |
GO:0072139 |
glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.2 |
0.2 |
GO:0090269 |
fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) |
| 0.2 |
0.9 |
GO:0071038 |
nuclear polyadenylation-dependent tRNA catabolic process(GO:0071038) |
| 0.2 |
1.1 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.2 |
1.3 |
GO:0048170 |
positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.2 |
0.7 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.2 |
0.2 |
GO:0033092 |
positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 0.2 |
1.1 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.2 |
0.7 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.2 |
1.4 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.2 |
0.4 |
GO:0045002 |
double-strand break repair via single-strand annealing(GO:0045002) |
| 0.2 |
0.4 |
GO:1905154 |
negative regulation of tumor necrosis factor secretion(GO:1904468) negative regulation of membrane invagination(GO:1905154) |
| 0.2 |
0.9 |
GO:1900086 |
regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.2 |
0.2 |
GO:0000733 |
DNA strand renaturation(GO:0000733) |
| 0.2 |
0.5 |
GO:0019370 |
leukotriene biosynthetic process(GO:0019370) |
| 0.2 |
2.8 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.2 |
2.3 |
GO:0006911 |
phagocytosis, engulfment(GO:0006911) |
| 0.2 |
0.4 |
GO:0035864 |
response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.2 |
0.5 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) |
| 0.2 |
0.7 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.2 |
0.5 |
GO:0034433 |
steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.2 |
1.2 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.2 |
0.7 |
GO:0042511 |
positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
| 0.2 |
0.2 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.2 |
1.0 |
GO:0009134 |
nucleoside diphosphate catabolic process(GO:0009134) ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.2 |
1.4 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.2 |
0.5 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.2 |
0.2 |
GO:0033122 |
regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.2 |
0.3 |
GO:0006265 |
DNA topological change(GO:0006265) |
| 0.2 |
0.3 |
GO:0097105 |
presynaptic membrane assembly(GO:0097105) |
| 0.2 |
0.5 |
GO:2000705 |
regulation of dense core granule biogenesis(GO:2000705) |
| 0.2 |
0.2 |
GO:0070669 |
response to interleukin-2(GO:0070669) |
| 0.2 |
0.7 |
GO:1902514 |
regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.2 |
1.0 |
GO:0070475 |
rRNA base methylation(GO:0070475) |
| 0.2 |
0.2 |
GO:0006689 |
ganglioside catabolic process(GO:0006689) |
| 0.2 |
1.0 |
GO:0001765 |
membrane raft assembly(GO:0001765) |
| 0.2 |
2.2 |
GO:0002063 |
chondrocyte development(GO:0002063) |
| 0.2 |
2.5 |
GO:0019369 |
arachidonic acid metabolic process(GO:0019369) |
| 0.2 |
2.2 |
GO:0048712 |
negative regulation of astrocyte differentiation(GO:0048712) |
| 0.2 |
1.2 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.2 |
2.0 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.2 |
0.3 |
GO:0043312 |
neutrophil degranulation(GO:0043312) |
| 0.2 |
1.0 |
GO:0032713 |
negative regulation of interleukin-4 production(GO:0032713) |
| 0.2 |
0.2 |
GO:0050765 |
negative regulation of phagocytosis(GO:0050765) |
| 0.2 |
0.8 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.2 |
0.7 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.2 |
0.7 |
GO:1901252 |
regulation of intracellular transport of viral material(GO:1901252) |
| 0.2 |
0.7 |
GO:0090244 |
Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.2 |
0.8 |
GO:1990118 |
sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.2 |
0.5 |
GO:0042711 |
maternal behavior(GO:0042711) |
| 0.2 |
3.7 |
GO:2001238 |
positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.2 |
0.2 |
GO:0030321 |
transepithelial chloride transport(GO:0030321) |
| 0.2 |
1.3 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.2 |
3.0 |
GO:0097150 |
neuronal stem cell population maintenance(GO:0097150) |
| 0.2 |
0.2 |
GO:1990564 |
protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.2 |
1.9 |
GO:0045974 |
miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.2 |
0.5 |
GO:0071404 |
cellular response to lipoprotein particle stimulus(GO:0071402) cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
| 0.2 |
0.3 |
GO:0009071 |
serine family amino acid catabolic process(GO:0009071) |
| 0.2 |
0.6 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 0.2 |
0.2 |
GO:0021852 |
pyramidal neuron migration(GO:0021852) |
| 0.2 |
0.3 |
GO:0055089 |
fatty acid homeostasis(GO:0055089) |
| 0.2 |
0.6 |
GO:0034285 |
response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.2 |
0.2 |
GO:0036124 |
histone H3-K9 trimethylation(GO:0036124) |
| 0.2 |
0.2 |
GO:0045627 |
positive regulation of T-helper 1 cell differentiation(GO:0045627) |
| 0.2 |
4.5 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.2 |
0.3 |
GO:0010911 |
regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.2 |
0.6 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.2 |
1.4 |
GO:0034501 |
protein localization to kinetochore(GO:0034501) |
| 0.2 |
0.3 |
GO:0097694 |
establishment of RNA localization to telomere(GO:0097694) |
| 0.2 |
0.6 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) negative regulation of neuron projection regeneration(GO:0070571) |
| 0.2 |
0.5 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.2 |
0.2 |
GO:0030497 |
fatty acid elongation(GO:0030497) |
| 0.2 |
0.5 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.2 |
1.1 |
GO:0006958 |
complement activation, classical pathway(GO:0006958) |
| 0.2 |
0.2 |
GO:0033091 |
positive regulation of immature T cell proliferation(GO:0033091) |
| 0.2 |
0.3 |
GO:0060594 |
mammary gland specification(GO:0060594) |
| 0.2 |
3.8 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.2 |
2.0 |
GO:0032508 |
DNA duplex unwinding(GO:0032508) |
| 0.2 |
1.2 |
GO:0042541 |
hemoglobin biosynthetic process(GO:0042541) |
| 0.2 |
2.0 |
GO:0010883 |
regulation of lipid storage(GO:0010883) |
| 0.2 |
0.8 |
GO:0009313 |
oligosaccharide catabolic process(GO:0009313) |
| 0.2 |
1.8 |
GO:0010866 |
regulation of triglyceride biosynthetic process(GO:0010866) |
| 0.1 |
1.0 |
GO:0061002 |
negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.1 |
0.4 |
GO:1903077 |
negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.1 |
0.4 |
GO:0003349 |
epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.1 |
2.7 |
GO:0042345 |
regulation of NF-kappaB import into nucleus(GO:0042345) NF-kappaB import into nucleus(GO:0042348) |
| 0.1 |
1.9 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.1 |
1.0 |
GO:0036035 |
osteoclast development(GO:0036035) |
| 0.1 |
0.4 |
GO:0090038 |
negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 |
0.9 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.1 |
1.6 |
GO:0002066 |
columnar/cuboidal epithelial cell development(GO:0002066) |
| 0.1 |
1.0 |
GO:0010839 |
negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.1 |
0.4 |
GO:0010633 |
negative regulation of epithelial cell migration(GO:0010633) |
| 0.1 |
1.5 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.1 |
0.9 |
GO:0033089 |
positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
| 0.1 |
0.4 |
GO:0060628 |
regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 |
1.3 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.1 |
0.6 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 |
0.7 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.1 |
0.4 |
GO:0006933 |
negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.1 |
0.3 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.1 |
0.4 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 |
1.6 |
GO:0060394 |
negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.1 |
0.1 |
GO:1903912 |
regulation of translation in response to endoplasmic reticulum stress(GO:0036490) regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.1 |
0.6 |
GO:0014054 |
positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.1 |
0.1 |
GO:0097114 |
NMDA glutamate receptor clustering(GO:0097114) |
| 0.1 |
1.2 |
GO:1900119 |
positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.1 |
0.9 |
GO:0045663 |
positive regulation of myoblast differentiation(GO:0045663) |
| 0.1 |
0.6 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.1 |
0.1 |
GO:0071051 |
polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.1 |
0.4 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.1 |
1.4 |
GO:0046697 |
decidualization(GO:0046697) |
| 0.1 |
0.1 |
GO:2000427 |
regulation of apoptotic cell clearance(GO:2000425) positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.1 |
0.1 |
GO:0097274 |
purine nucleotide transport(GO:0015865) urea homeostasis(GO:0097274) |
| 0.1 |
0.7 |
GO:0051984 |
positive regulation of chromosome segregation(GO:0051984) |
| 0.1 |
0.3 |
GO:1901509 |
regulation of endothelial tube morphogenesis(GO:1901509) negative regulation of myoblast fusion(GO:1901740) |
| 0.1 |
0.7 |
GO:0019695 |
choline metabolic process(GO:0019695) |
| 0.1 |
1.1 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.1 |
1.7 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 |
0.1 |
GO:0032366 |
intracellular sterol transport(GO:0032366) |
| 0.1 |
0.3 |
GO:0051176 |
positive regulation of sulfur metabolic process(GO:0051176) |
| 0.1 |
1.5 |
GO:0018126 |
protein hydroxylation(GO:0018126) |
| 0.1 |
0.8 |
GO:0098789 |
pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.1 |
0.8 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.1 |
0.6 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 |
2.8 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 0.1 |
0.8 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.1 |
1.8 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.1 |
0.4 |
GO:0006999 |
nuclear pore organization(GO:0006999) |
| 0.1 |
0.7 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.1 |
0.7 |
GO:0051231 |
spindle elongation(GO:0051231) spindle midzone assembly(GO:0051255) |
| 0.1 |
0.8 |
GO:1902993 |
positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.1 |
0.3 |
GO:0009125 |
nucleoside monophosphate catabolic process(GO:0009125) |
| 0.1 |
0.4 |
GO:0009410 |
response to xenobiotic stimulus(GO:0009410) |
| 0.1 |
0.1 |
GO:0046599 |
regulation of centriole replication(GO:0046599) |
| 0.1 |
1.0 |
GO:0007016 |
cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.1 |
1.0 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.1 |
0.7 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.1 |
0.8 |
GO:0042866 |
pyruvate biosynthetic process(GO:0042866) |
| 0.1 |
0.5 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 |
0.3 |
GO:0042701 |
progesterone secretion(GO:0042701) |
| 0.1 |
0.4 |
GO:0042270 |
protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.1 |
0.5 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.1 |
1.2 |
GO:0046499 |
S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.1 |
0.1 |
GO:0002523 |
leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.1 |
0.1 |
GO:0033762 |
response to glucagon(GO:0033762) |
| 0.1 |
0.7 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.1 |
0.4 |
GO:0060390 |
regulation of SMAD protein import into nucleus(GO:0060390) |
| 0.1 |
0.4 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.1 |
1.5 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.1 |
1.7 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 |
8.3 |
GO:0010811 |
positive regulation of cell-substrate adhesion(GO:0010811) |
| 0.1 |
0.3 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.1 |
0.8 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.1 |
0.7 |
GO:0010829 |
negative regulation of glucose transport(GO:0010829) negative regulation of glucose import(GO:0046325) |
| 0.1 |
0.8 |
GO:0031145 |
anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 |
0.9 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.1 |
0.4 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 |
0.3 |
GO:0034242 |
negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.1 |
0.5 |
GO:0006624 |
vacuolar protein processing(GO:0006624) |
| 0.1 |
1.5 |
GO:0098751 |
bone cell development(GO:0098751) |
| 0.1 |
0.3 |
GO:0010920 |
negative regulation of inositol phosphate biosynthetic process(GO:0010920) |
| 0.1 |
0.3 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 0.1 |
0.3 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.1 |
0.6 |
GO:0090074 |
negative regulation of protein homodimerization activity(GO:0090074) |
| 0.1 |
0.4 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 |
0.6 |
GO:0042148 |
strand invasion(GO:0042148) |
| 0.1 |
0.6 |
GO:0061436 |
establishment of skin barrier(GO:0061436) |
| 0.1 |
0.7 |
GO:0050965 |
detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.1 |
1.2 |
GO:0045907 |
positive regulation of vasoconstriction(GO:0045907) |
| 0.1 |
0.1 |
GO:0051835 |
positive regulation of synapse structural plasticity(GO:0051835) |
| 0.1 |
1.4 |
GO:0051292 |
nuclear pore complex assembly(GO:0051292) |
| 0.1 |
4.7 |
GO:0006749 |
glutathione metabolic process(GO:0006749) |
| 0.1 |
1.2 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 |
0.1 |
GO:0008272 |
sulfate transport(GO:0008272) |
| 0.1 |
1.2 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.1 |
0.7 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.1 |
0.6 |
GO:1903352 |
ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
| 0.1 |
1.2 |
GO:0070986 |
left/right axis specification(GO:0070986) |
| 0.1 |
0.2 |
GO:0051972 |
regulation of telomerase activity(GO:0051972) |
| 0.1 |
1.7 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 |
0.2 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.1 |
0.2 |
GO:0060352 |
cell adhesion molecule production(GO:0060352) |
| 0.1 |
0.4 |
GO:0007100 |
mitotic centrosome separation(GO:0007100) |
| 0.1 |
0.8 |
GO:0036342 |
post-anal tail morphogenesis(GO:0036342) |
| 0.1 |
0.1 |
GO:0034308 |
primary alcohol metabolic process(GO:0034308) |
| 0.1 |
0.6 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 |
0.1 |
GO:0060161 |
positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.1 |
0.2 |
GO:0090370 |
negative regulation of cholesterol efflux(GO:0090370) |
| 0.1 |
0.7 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 |
2.2 |
GO:0006760 |
folic acid-containing compound metabolic process(GO:0006760) |
| 0.1 |
0.3 |
GO:0010636 |
positive regulation of mitochondrial fusion(GO:0010636) |
| 0.1 |
0.7 |
GO:0042754 |
negative regulation of circadian rhythm(GO:0042754) |
| 0.1 |
0.5 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.1 |
0.2 |
GO:1902513 |
regulation of organelle transport along microtubule(GO:1902513) |
| 0.1 |
0.1 |
GO:0045472 |
response to ether(GO:0045472) |
| 0.1 |
4.9 |
GO:0000725 |
double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.1 |
0.1 |
GO:0014744 |
positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of muscle adaptation(GO:0014744) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.1 |
0.1 |
GO:1990481 |
mRNA pseudouridine synthesis(GO:1990481) |
| 0.1 |
0.5 |
GO:0060398 |
regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.1 |
0.7 |
GO:1902166 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.1 |
0.7 |
GO:0043277 |
apoptotic cell clearance(GO:0043277) |
| 0.1 |
3.3 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.1 |
0.5 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.1 |
0.3 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.1 |
0.3 |
GO:0015840 |
urea transport(GO:0015840) urea transmembrane transport(GO:0071918) |
| 0.1 |
0.5 |
GO:0000103 |
sulfate assimilation(GO:0000103) |
| 0.1 |
0.6 |
GO:0007141 |
male meiosis I(GO:0007141) |
| 0.1 |
0.6 |
GO:0070171 |
negative regulation of odontogenesis(GO:0042483) negative regulation of tooth mineralization(GO:0070171) |
| 0.1 |
1.1 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.1 |
0.2 |
GO:0046077 |
dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate metabolic process(GO:0009138) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.1 |
3.1 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.1 |
2.4 |
GO:0060325 |
face morphogenesis(GO:0060325) |
| 0.1 |
1.7 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.1 |
0.6 |
GO:0045672 |
positive regulation of osteoclast differentiation(GO:0045672) |
| 0.1 |
0.7 |
GO:0042517 |
positive regulation of tyrosine phosphorylation of Stat3 protein(GO:0042517) |
| 0.1 |
0.7 |
GO:0051482 |
positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 0.1 |
0.3 |
GO:0035590 |
purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 |
0.7 |
GO:0032688 |
negative regulation of interferon-beta production(GO:0032688) |
| 0.1 |
2.1 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 |
0.7 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 |
0.2 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.1 |
0.9 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.1 |
0.4 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 |
0.3 |
GO:1901164 |
negative regulation of trophoblast cell migration(GO:1901164) |
| 0.1 |
0.2 |
GO:0060279 |
positive regulation of ovulation(GO:0060279) |
| 0.1 |
0.2 |
GO:2000402 |
negative regulation of lymphocyte migration(GO:2000402) |
| 0.1 |
0.2 |
GO:0003223 |
ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.1 |
0.4 |
GO:0050667 |
homocysteine metabolic process(GO:0050667) |
| 0.1 |
0.5 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.1 |
0.7 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.1 |
2.9 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.1 |
0.2 |
GO:0003273 |
cell migration involved in endocardial cushion formation(GO:0003273) |
| 0.1 |
1.0 |
GO:0010574 |
regulation of vascular endothelial growth factor production(GO:0010574) |
| 0.1 |
1.3 |
GO:1901185 |
negative regulation of ERBB signaling pathway(GO:1901185) |
| 0.1 |
0.1 |
GO:0042776 |
mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.1 |
1.1 |
GO:0048339 |
paraxial mesoderm development(GO:0048339) |
| 0.1 |
0.2 |
GO:0032365 |
intracellular lipid transport(GO:0032365) |
| 0.1 |
0.5 |
GO:0006044 |
N-acetylglucosamine metabolic process(GO:0006044) |
| 0.1 |
0.3 |
GO:0046368 |
GDP-L-fucose metabolic process(GO:0046368) |
| 0.1 |
2.1 |
GO:0001574 |
ganglioside biosynthetic process(GO:0001574) |
| 0.1 |
0.3 |
GO:0045204 |
MAPK export from nucleus(GO:0045204) |
| 0.1 |
1.2 |
GO:0015693 |
magnesium ion transport(GO:0015693) |
| 0.1 |
0.1 |
GO:0000957 |
mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.1 |
0.2 |
GO:0032055 |
negative regulation of translation in response to stress(GO:0032055) |
| 0.1 |
0.4 |
GO:0006693 |
prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.1 |
0.7 |
GO:0006909 |
phagocytosis(GO:0006909) |
| 0.1 |
2.1 |
GO:0046825 |
regulation of protein export from nucleus(GO:0046825) |
| 0.1 |
0.7 |
GO:0051573 |
negative regulation of histone H3-K9 methylation(GO:0051573) |
| 0.1 |
0.2 |
GO:0060746 |
parental behavior(GO:0060746) |
| 0.1 |
0.3 |
GO:0070498 |
interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.1 |
0.3 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.1 |
0.7 |
GO:0050774 |
negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.1 |
0.4 |
GO:0030449 |
regulation of complement activation(GO:0030449) regulation of protein activation cascade(GO:2000257) |
| 0.1 |
0.5 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 0.1 |
0.5 |
GO:0019883 |
antigen processing and presentation of endogenous peptide antigen(GO:0002483) antigen processing and presentation of endogenous antigen(GO:0019883) |
| 0.1 |
0.7 |
GO:0006363 |
termination of RNA polymerase I transcription(GO:0006363) |
| 0.1 |
0.7 |
GO:0046033 |
AMP metabolic process(GO:0046033) |
| 0.1 |
0.2 |
GO:0032933 |
response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.1 |
0.1 |
GO:0010996 |
response to auditory stimulus(GO:0010996) |
| 0.1 |
0.9 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
0.2 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.1 |
0.1 |
GO:0038161 |
prolactin signaling pathway(GO:0038161) |
| 0.1 |
1.3 |
GO:0019915 |
lipid storage(GO:0019915) |
| 0.1 |
0.1 |
GO:1903747 |
regulation of establishment of protein localization to mitochondrion(GO:1903747) |
| 0.1 |
0.6 |
GO:0042558 |
pteridine-containing compound metabolic process(GO:0042558) |
| 0.1 |
0.1 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.1 |
0.4 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 |
0.6 |
GO:0030579 |
ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.1 |
0.2 |
GO:1902237 |
positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.1 |
1.1 |
GO:0001921 |
positive regulation of receptor recycling(GO:0001921) |
| 0.1 |
0.4 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.1 |
0.3 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 |
0.4 |
GO:0007512 |
adult heart development(GO:0007512) |
| 0.1 |
1.3 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.1 |
0.4 |
GO:0016560 |
protein import into peroxisome matrix, docking(GO:0016560) |
| 0.1 |
1.8 |
GO:0008631 |
intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.1 |
0.2 |
GO:0032066 |
nucleolus to nucleoplasm transport(GO:0032066) |
| 0.1 |
1.1 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.1 |
0.2 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 |
0.4 |
GO:0006488 |
dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.1 |
0.6 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 |
0.2 |
GO:0000076 |
DNA replication checkpoint(GO:0000076) |
| 0.1 |
1.1 |
GO:0045540 |
regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.1 |
0.1 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
0.3 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.1 |
0.2 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 |
0.5 |
GO:0070633 |
transepithelial transport(GO:0070633) |
| 0.1 |
0.1 |
GO:0009069 |
serine family amino acid metabolic process(GO:0009069) |
| 0.1 |
0.2 |
GO:0046628 |
positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 0.1 |
13.5 |
GO:0006457 |
protein folding(GO:0006457) |
| 0.1 |
0.1 |
GO:0006189 |
IMP biosynthetic process(GO:0006188) 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.1 |
0.8 |
GO:1900364 |
negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.1 |
0.7 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 |
1.1 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.1 |
0.7 |
GO:0051930 |
regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
| 0.1 |
0.6 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 |
0.6 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 |
0.3 |
GO:0002478 |
antigen processing and presentation of exogenous peptide antigen(GO:0002478) |
| 0.1 |
1.4 |
GO:0006024 |
glycosaminoglycan biosynthetic process(GO:0006024) |
| 0.1 |
0.2 |
GO:0006428 |
isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.1 |
0.5 |
GO:0052646 |
alditol phosphate metabolic process(GO:0052646) |
| 0.1 |
0.2 |
GO:0031666 |
positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.1 |
0.5 |
GO:0009081 |
branched-chain amino acid metabolic process(GO:0009081) branched-chain amino acid catabolic process(GO:0009083) |
| 0.1 |
0.2 |
GO:0018149 |
peptide cross-linking(GO:0018149) |
| 0.1 |
0.2 |
GO:0051182 |
coenzyme transport(GO:0051182) |
| 0.1 |
0.6 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.1 |
2.2 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 0.1 |
0.3 |
GO:0006307 |
DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 |
0.2 |
GO:0019043 |
establishment of viral latency(GO:0019043) |
| 0.1 |
0.2 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 |
0.1 |
GO:0048680 |
positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
| 0.1 |
0.3 |
GO:0046716 |
muscle cell cellular homeostasis(GO:0046716) |
| 0.1 |
0.5 |
GO:0048806 |
genitalia development(GO:0048806) |
| 0.1 |
0.4 |
GO:1900095 |
regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.1 |
0.5 |
GO:0090177 |
establishment of planar polarity involved in neural tube closure(GO:0090177) |
| 0.1 |
0.2 |
GO:0034162 |
toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.1 |
0.4 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.1 |
2.1 |
GO:0007229 |
integrin-mediated signaling pathway(GO:0007229) |
| 0.1 |
0.4 |
GO:0020027 |
hemoglobin metabolic process(GO:0020027) |
| 0.1 |
0.3 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.1 |
1.4 |
GO:0006073 |
glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
| 0.1 |
0.2 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.1 |
0.5 |
GO:0009263 |
deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.1 |
0.3 |
GO:0051220 |
cytoplasmic sequestering of protein(GO:0051220) |
| 0.1 |
1.3 |
GO:0048821 |
erythrocyte development(GO:0048821) |
| 0.1 |
0.2 |
GO:0001732 |
formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.1 |
1.1 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 |
1.9 |
GO:0032728 |
positive regulation of interferon-beta production(GO:0032728) |
| 0.1 |
0.1 |
GO:0006002 |
fructose 6-phosphate metabolic process(GO:0006002) |
| 0.1 |
0.2 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.1 |
0.4 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 |
0.9 |
GO:0019835 |
cytolysis(GO:0019835) |
| 0.1 |
0.2 |
GO:0018377 |
N-terminal protein myristoylation(GO:0006499) protein myristoylation(GO:0018377) |
| 0.1 |
0.1 |
GO:1903960 |
negative regulation of anion transmembrane transport(GO:1903960) |
| 0.1 |
0.3 |
GO:0045903 |
positive regulation of translational fidelity(GO:0045903) |
| 0.1 |
0.1 |
GO:1901658 |
glycosyl compound catabolic process(GO:1901658) |
| 0.1 |
0.5 |
GO:0001562 |
response to protozoan(GO:0001562) |
| 0.1 |
0.3 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.1 |
0.7 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 |
0.1 |
GO:0097500 |
receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.1 |
0.1 |
GO:0003365 |
establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.1 |
0.1 |
GO:0010572 |
positive regulation of platelet activation(GO:0010572) |
| 0.1 |
0.2 |
GO:0071073 |
positive regulation of phospholipid biosynthetic process(GO:0071073) |
| 0.1 |
0.3 |
GO:0010666 |
positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
| 0.1 |
0.1 |
GO:2000807 |
regulation of synaptic vesicle clustering(GO:2000807) |
| 0.1 |
0.4 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.1 |
1.9 |
GO:0016578 |
histone deubiquitination(GO:0016578) |
| 0.1 |
0.7 |
GO:0007189 |
adenylate cyclase-activating G-protein coupled receptor signaling pathway(GO:0007189) |
| 0.1 |
0.3 |
GO:0046459 |
short-chain fatty acid metabolic process(GO:0046459) |
| 0.1 |
0.3 |
GO:0009164 |
nucleoside catabolic process(GO:0009164) ribonucleoside catabolic process(GO:0042454) |
| 0.1 |
0.3 |
GO:0050821 |
protein stabilization(GO:0050821) |
| 0.1 |
1.0 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.1 |
0.9 |
GO:0010388 |
protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
| 0.1 |
0.5 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.1 |
0.3 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 0.1 |
0.1 |
GO:0071034 |
CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.1 |
0.3 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.1 |
0.2 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.1 |
0.1 |
GO:0060706 |
cell differentiation involved in embryonic placenta development(GO:0060706) |
| 0.1 |
0.3 |
GO:0009227 |
UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
| 0.1 |
0.3 |
GO:0038089 |
positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
| 0.1 |
2.5 |
GO:0006633 |
fatty acid biosynthetic process(GO:0006633) |
| 0.1 |
0.6 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.1 |
0.4 |
GO:1902902 |
negative regulation of autophagosome assembly(GO:1902902) |
| 0.1 |
2.9 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.1 |
0.2 |
GO:0046501 |
protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 |
0.4 |
GO:0010712 |
regulation of collagen metabolic process(GO:0010712) regulation of collagen biosynthetic process(GO:0032965) |
| 0.1 |
1.7 |
GO:0042491 |
auditory receptor cell differentiation(GO:0042491) |
| 0.1 |
0.2 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 |
0.2 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.1 |
0.2 |
GO:0015886 |
heme transport(GO:0015886) |
| 0.1 |
0.1 |
GO:0033630 |
positive regulation of cell adhesion mediated by integrin(GO:0033630) |
| 0.1 |
0.5 |
GO:0032516 |
positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.1 |
0.2 |
GO:2000574 |
regulation of microtubule motor activity(GO:2000574) |
| 0.1 |
0.2 |
GO:0090385 |
phagosome-lysosome fusion(GO:0090385) |
| 0.1 |
0.3 |
GO:0019432 |
triglyceride biosynthetic process(GO:0019432) |
| 0.1 |
0.3 |
GO:0043137 |
DNA replication, removal of RNA primer(GO:0043137) |
| 0.1 |
0.1 |
GO:1900452 |
regulation of long term synaptic depression(GO:1900452) |
| 0.1 |
0.1 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 |
0.6 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.1 |
0.2 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 |
1.4 |
GO:0032011 |
ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 |
0.1 |
GO:0097252 |
oligodendrocyte apoptotic process(GO:0097252) |
| 0.1 |
0.3 |
GO:0007498 |
mesoderm development(GO:0007498) |
| 0.1 |
0.2 |
GO:0035751 |
regulation of lysosomal lumen pH(GO:0035751) |
| 0.1 |
0.1 |
GO:0019858 |
cytosine metabolic process(GO:0019858) |
| 0.1 |
0.5 |
GO:0010801 |
negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.1 |
0.1 |
GO:0055076 |
transition metal ion homeostasis(GO:0055076) |
| 0.1 |
0.3 |
GO:0006098 |
pentose-phosphate shunt(GO:0006098) glyceraldehyde-3-phosphate metabolic process(GO:0019682) |
| 0.1 |
1.1 |
GO:0034629 |
cellular protein complex localization(GO:0034629) |
| 0.1 |
0.2 |
GO:0045738 |
negative regulation of DNA repair(GO:0045738) |
| 0.1 |
0.3 |
GO:0070741 |
response to interleukin-6(GO:0070741) |
| 0.1 |
0.2 |
GO:0044314 |
protein K27-linked ubiquitination(GO:0044314) |
| 0.1 |
0.2 |
GO:0031953 |
negative regulation of protein autophosphorylation(GO:0031953) |
| 0.1 |
0.6 |
GO:0033523 |
histone H2B ubiquitination(GO:0033523) |
| 0.1 |
0.4 |
GO:0006662 |
glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) ether lipid metabolic process(GO:0046485) |
| 0.1 |
0.1 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 |
0.3 |
GO:0060765 |
regulation of androgen receptor signaling pathway(GO:0060765) |
| 0.1 |
0.1 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.1 |
0.3 |
GO:0009992 |
cellular water homeostasis(GO:0009992) |
| 0.1 |
2.9 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.1 |
0.1 |
GO:1904851 |
positive regulation of establishment of protein localization to telomere(GO:1904851) |
| 0.1 |
0.2 |
GO:0051775 |
response to redox state(GO:0051775) |
| 0.1 |
0.2 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.1 |
0.3 |
GO:0070933 |
histone H4 deacetylation(GO:0070933) |
| 0.1 |
0.8 |
GO:0031365 |
N-terminal protein amino acid modification(GO:0031365) |
| 0.1 |
0.2 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.1 |
0.2 |
GO:0043687 |
post-translational protein modification(GO:0043687) |
| 0.1 |
0.1 |
GO:0033136 |
serine phosphorylation of STAT3 protein(GO:0033136) |
| 0.1 |
0.1 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.1 |
1.0 |
GO:0048873 |
homeostasis of number of cells within a tissue(GO:0048873) |
| 0.1 |
0.7 |
GO:0030865 |
cortical cytoskeleton organization(GO:0030865) |
| 0.1 |
0.7 |
GO:0071353 |
response to interleukin-4(GO:0070670) cellular response to interleukin-4(GO:0071353) |
| 0.1 |
0.2 |
GO:0045930 |
negative regulation of mitotic cell cycle(GO:0045930) |
| 0.1 |
0.2 |
GO:0001831 |
trophectodermal cellular morphogenesis(GO:0001831) |
| 0.1 |
0.2 |
GO:0035561 |
regulation of chromatin binding(GO:0035561) |
| 0.1 |
1.6 |
GO:0005978 |
glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.1 |
0.2 |
GO:0071494 |
cellular response to UV-C(GO:0071494) |
| 0.1 |
0.7 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.1 |
0.4 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 |
0.3 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 |
0.2 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 0.1 |
0.2 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.1 |
0.5 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 |
0.4 |
GO:0071577 |
zinc II ion transmembrane transport(GO:0071577) |
| 0.1 |
1.6 |
GO:0050728 |
negative regulation of inflammatory response(GO:0050728) |
| 0.0 |
0.4 |
GO:0042994 |
cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.0 |
0.1 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 |
0.7 |
GO:0007638 |
mechanosensory behavior(GO:0007638) |
| 0.0 |
0.4 |
GO:0042182 |
ketone catabolic process(GO:0042182) |
| 0.0 |
0.6 |
GO:0006641 |
triglyceride metabolic process(GO:0006641) |
| 0.0 |
0.2 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.0 |
1.3 |
GO:0070206 |
protein trimerization(GO:0070206) |
| 0.0 |
0.3 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.0 |
0.5 |
GO:0007190 |
activation of adenylate cyclase activity(GO:0007190) |
| 0.0 |
1.1 |
GO:0051384 |
response to glucocorticoid(GO:0051384) |
| 0.0 |
0.0 |
GO:0098528 |
skeletal muscle fiber differentiation(GO:0098528) |
| 0.0 |
1.6 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.0 |
0.1 |
GO:0014866 |
skeletal myofibril assembly(GO:0014866) |
| 0.0 |
0.2 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.0 |
0.2 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 |
0.6 |
GO:0000002 |
mitochondrial genome maintenance(GO:0000002) |
| 0.0 |
2.4 |
GO:0009060 |
aerobic respiration(GO:0009060) |
| 0.0 |
0.2 |
GO:0050766 |
positive regulation of phagocytosis(GO:0050766) |
| 0.0 |
0.1 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.0 |
0.1 |
GO:1904424 |
regulation of GTP binding(GO:1904424) |
| 0.0 |
0.0 |
GO:1903546 |
protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 |
0.5 |
GO:0097006 |
regulation of plasma lipoprotein particle levels(GO:0097006) |
| 0.0 |
0.3 |
GO:0098700 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 |
0.4 |
GO:0010172 |
embryonic body morphogenesis(GO:0010172) |
| 0.0 |
0.3 |
GO:0060579 |
ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 0.0 |
0.0 |
GO:0042977 |
activation of JAK2 kinase activity(GO:0042977) |
| 0.0 |
0.3 |
GO:0061157 |
mRNA destabilization(GO:0061157) |
| 0.0 |
0.3 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 0.0 |
0.5 |
GO:1902653 |
cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
| 0.0 |
0.5 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 |
0.2 |
GO:0006828 |
manganese ion transport(GO:0006828) |
| 0.0 |
0.1 |
GO:0035457 |
cellular response to interferon-alpha(GO:0035457) |
| 0.0 |
0.3 |
GO:0015884 |
folic acid transport(GO:0015884) |
| 0.0 |
0.2 |
GO:0070126 |
mitochondrial translational termination(GO:0070126) |
| 0.0 |
0.1 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.0 |
0.0 |
GO:1903897 |
regulation of PERK-mediated unfolded protein response(GO:1903897) |
| 0.0 |
0.0 |
GO:0060914 |
heart formation(GO:0060914) |
| 0.0 |
0.1 |
GO:0002002 |
regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
| 0.0 |
0.1 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 |
0.2 |
GO:0042997 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.0 |
0.1 |
GO:0060830 |
ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.0 |
0.3 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 |
0.3 |
GO:0007492 |
endoderm development(GO:0007492) |
| 0.0 |
0.3 |
GO:0035383 |
acyl-CoA metabolic process(GO:0006637) thioester metabolic process(GO:0035383) |
| 0.0 |
0.0 |
GO:0009106 |
lipoate metabolic process(GO:0009106) |
| 0.0 |
0.2 |
GO:0035337 |
fatty-acyl-CoA metabolic process(GO:0035337) |
| 0.0 |
0.1 |
GO:0061009 |
common bile duct development(GO:0061009) |
| 0.0 |
0.1 |
GO:0006354 |
DNA-templated transcription, elongation(GO:0006354) |
| 0.0 |
0.1 |
GO:0034244 |
negative regulation of DNA-templated transcription, elongation(GO:0032785) negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 |
0.1 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.0 |
0.2 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.0 |
0.0 |
GO:0015911 |
plasma membrane long-chain fatty acid transport(GO:0015911) fatty acid transmembrane transport(GO:1902001) |
| 0.0 |
0.6 |
GO:0019730 |
antimicrobial humoral response(GO:0019730) |
| 0.0 |
1.1 |
GO:0007029 |
endoplasmic reticulum organization(GO:0007029) |
| 0.0 |
0.3 |
GO:0030199 |
collagen fibril organization(GO:0030199) |
| 0.0 |
0.6 |
GO:0042462 |
eye photoreceptor cell development(GO:0042462) |
| 0.0 |
0.2 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 |
0.2 |
GO:0008334 |
histone mRNA metabolic process(GO:0008334) |
| 0.0 |
0.1 |
GO:0019377 |
glycolipid catabolic process(GO:0019377) |
| 0.0 |
0.1 |
GO:1901020 |
negative regulation of calcium ion transmembrane transporter activity(GO:1901020) negative regulation of calcium ion transmembrane transport(GO:1903170) |
| 0.0 |
0.2 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.0 |
0.1 |
GO:0010833 |
telomere maintenance via telomere lengthening(GO:0010833) |
| 0.0 |
0.1 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.0 |
0.0 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.0 |
0.1 |
GO:0045445 |
myoblast differentiation(GO:0045445) |
| 0.0 |
0.1 |
GO:1904714 |
chaperone-mediated autophagy(GO:0061684) regulation of chaperone-mediated autophagy(GO:1904714) negative regulation of chaperone-mediated autophagy(GO:1904715) |
| 0.0 |
0.3 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.0 |
0.3 |
GO:0042246 |
tissue regeneration(GO:0042246) |
| 0.0 |
0.6 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.0 |
0.1 |
GO:1903298 |
regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.0 |
0.2 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.0 |
0.4 |
GO:0015816 |
glycine transport(GO:0015816) |
| 0.0 |
0.2 |
GO:0051497 |
negative regulation of actin filament bundle assembly(GO:0032232) negative regulation of stress fiber assembly(GO:0051497) |
| 0.0 |
1.1 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.0 |
0.3 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 0.0 |
0.4 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 |
1.0 |
GO:0070373 |
negative regulation of ERK1 and ERK2 cascade(GO:0070373) |
| 0.0 |
0.3 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.0 |
0.5 |
GO:0045943 |
positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 |
0.4 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.0 |
0.1 |
GO:0006547 |
histidine metabolic process(GO:0006547) imidazole-containing compound metabolic process(GO:0052803) |
| 0.0 |
0.6 |
GO:0071359 |
cellular response to dsRNA(GO:0071359) |
| 0.0 |
0.9 |
GO:0033108 |
mitochondrial respiratory chain complex assembly(GO:0033108) |
| 0.0 |
0.1 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 |
0.0 |
GO:0070072 |
vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 |
0.1 |
GO:0010595 |
positive regulation of endothelial cell migration(GO:0010595) |
| 0.0 |
0.1 |
GO:0001553 |
luteinization(GO:0001553) |
| 0.0 |
0.0 |
GO:0030656 |
regulation of vitamin metabolic process(GO:0030656) |
| 0.0 |
0.0 |
GO:0060744 |
thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.0 |
0.1 |
GO:0019919 |
peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine N-methylation(GO:0035246) |
| 0.0 |
0.1 |
GO:0070162 |
adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) |
| 0.0 |
0.0 |
GO:0061502 |
early endosome to recycling endosome transport(GO:0061502) |
| 0.0 |
0.0 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 0.0 |
0.1 |
GO:0000289 |
nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 |
0.1 |
GO:0045200 |
establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.0 |
0.1 |
GO:0061000 |
negative regulation of dendritic spine development(GO:0061000) |
| 0.0 |
0.1 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 |
0.1 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.0 |
0.2 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.0 |
0.1 |
GO:0060716 |
labyrinthine layer blood vessel development(GO:0060716) |
| 0.0 |
0.0 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 0.0 |
0.2 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 |
0.3 |
GO:1901984 |
negative regulation of protein acetylation(GO:1901984) |
| 0.0 |
0.2 |
GO:0060261 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.0 |
0.1 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.0 |
0.1 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 |
0.3 |
GO:0003009 |
skeletal muscle contraction(GO:0003009) |
| 0.0 |
0.1 |
GO:0032608 |
interferon-beta production(GO:0032608) regulation of interferon-beta production(GO:0032648) |
| 0.0 |
0.2 |
GO:0009649 |
entrainment of circadian clock(GO:0009649) |
| 0.0 |
0.0 |
GO:2000189 |
regulation of cholesterol homeostasis(GO:2000188) positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 |
0.2 |
GO:0033327 |
Leydig cell differentiation(GO:0033327) |
| 0.0 |
0.1 |
GO:0010971 |
positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.0 |
0.1 |
GO:0006450 |
regulation of translational fidelity(GO:0006450) |
| 0.0 |
0.5 |
GO:0010389 |
regulation of G2/M transition of mitotic cell cycle(GO:0010389) regulation of cell cycle G2/M phase transition(GO:1902749) |
| 0.0 |
0.1 |
GO:0033299 |
secretion of lysosomal enzymes(GO:0033299) |
| 0.0 |
0.0 |
GO:0070425 |
negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 0.0 |
0.1 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.0 |
0.2 |
GO:0044272 |
sulfur compound biosynthetic process(GO:0044272) |
| 0.0 |
0.0 |
GO:0018343 |
protein farnesylation(GO:0018343) |
| 0.0 |
0.1 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.0 |
0.1 |
GO:0046292 |
formaldehyde metabolic process(GO:0046292) |
| 0.0 |
0.1 |
GO:0014883 |
transition between fast and slow fiber(GO:0014883) |
| 0.0 |
0.1 |
GO:0042275 |
error-free postreplication DNA repair(GO:0042275) |
| 0.0 |
0.1 |
GO:0097502 |
protein mannosylation(GO:0035268) mannosylation(GO:0097502) |
| 0.0 |
0.3 |
GO:0045070 |
positive regulation of viral genome replication(GO:0045070) |
| 0.0 |
1.9 |
GO:0006869 |
lipid transport(GO:0006869) lipid localization(GO:0010876) |
| 0.0 |
0.2 |
GO:0042255 |
ribosome assembly(GO:0042255) |
| 0.0 |
0.2 |
GO:2000480 |
negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 |
0.0 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 |
0.2 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.0 |
0.2 |
GO:0070536 |
protein K63-linked deubiquitination(GO:0070536) |
| 0.0 |
0.0 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 0.0 |
0.1 |
GO:0072599 |
establishment of protein localization to endoplasmic reticulum(GO:0072599) |
| 0.0 |
0.0 |
GO:0008535 |
respiratory chain complex IV assembly(GO:0008535) |
| 0.0 |
0.1 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 |
0.0 |
GO:0070127 |
tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 |
0.1 |
GO:0040018 |
positive regulation of multicellular organism growth(GO:0040018) |
| 0.0 |
0.2 |
GO:0030520 |
intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 |
0.1 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 |
0.3 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.0 |
0.2 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.0 |
0.0 |
GO:0060836 |
lymphatic endothelial cell differentiation(GO:0060836) |
| 0.0 |
0.1 |
GO:0071392 |
cellular response to estradiol stimulus(GO:0071392) |
| 0.0 |
0.7 |
GO:0006664 |
glycolipid metabolic process(GO:0006664) liposaccharide metabolic process(GO:1903509) |
| 0.0 |
0.0 |
GO:0034982 |
mitochondrial protein processing(GO:0034982) |
| 0.0 |
0.0 |
GO:0018364 |
peptidyl-glutamine methylation(GO:0018364) |
| 0.0 |
0.1 |
GO:0017145 |
stem cell division(GO:0017145) |
| 0.0 |
0.0 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.0 |
0.1 |
GO:0035610 |
protein side chain deglutamylation(GO:0035610) |
| 0.0 |
0.0 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.0 |
0.1 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.0 |
0.1 |
GO:0006656 |
phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.0 |
0.0 |
GO:0036093 |
male germ cell proliferation(GO:0002176) germ cell proliferation(GO:0036093) |
| 0.0 |
0.0 |
GO:0061036 |
positive regulation of cartilage development(GO:0061036) |
| 0.0 |
0.1 |
GO:0006301 |
postreplication repair(GO:0006301) |
| 0.0 |
0.1 |
GO:0030330 |
DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
| 0.0 |
0.2 |
GO:0042168 |
heme metabolic process(GO:0042168) |
| 0.0 |
1.2 |
GO:0007059 |
chromosome segregation(GO:0007059) |
| 0.0 |
0.0 |
GO:0055071 |
cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
| 0.0 |
0.0 |
GO:0003360 |
brainstem development(GO:0003360) |
| 0.0 |
0.0 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.0 |
0.0 |
GO:0019482 |
beta-alanine metabolic process(GO:0019482) |
| 0.0 |
0.0 |
GO:0071800 |
podosome assembly(GO:0071800) |
| 0.0 |
0.0 |
GO:0060290 |
transdifferentiation(GO:0060290) |
| 0.0 |
0.0 |
GO:0007346 |
regulation of mitotic cell cycle(GO:0007346) |
| 0.0 |
0.2 |
GO:0045746 |
negative regulation of Notch signaling pathway(GO:0045746) |
