PRJNA375882: Comprehensive Mouse Transcriptomic BodyMap
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Foxi1
|
ENSMUSG00000047861.3 | Foxi1 |
|
Foxo1
|
ENSMUSG00000044167.7 | Foxo1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Foxi1 | mm39_v1_chr11_-_34158085_34158092 | 0.11 | 3.4e-01 | Click! |
| Foxo1 | mm39_v1_chr3_+_52175757_52175827 | 0.07 | 5.4e-01 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr14_-_54651442 | 11.84 |
ENSMUST00000227334.2
|
Slc7a7
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 7 |
| chr19_-_43974990 | 11.71 |
ENSMUST00000026210.5
|
Cpn1
|
carboxypeptidase N, polypeptide 1 |
| chr5_-_18093739 | 11.52 |
ENSMUST00000169095.6
ENSMUST00000197574.2 |
Cd36
|
CD36 molecule |
| chr19_+_31846154 | 11.27 |
ENSMUST00000224564.2
ENSMUST00000224304.2 ENSMUST00000075838.8 ENSMUST00000224400.2 |
A1cf
|
APOBEC1 complementation factor |
| chr13_+_4241149 | 10.52 |
ENSMUST00000021634.4
|
Akr1c13
|
aldo-keto reductase family 1, member C13 |
| chr4_-_49549489 | 9.93 |
ENSMUST00000029987.10
|
Aldob
|
aldolase B, fructose-bisphosphate |
| chr5_-_87716882 | 9.79 |
ENSMUST00000113314.3
|
Sult1d1
|
sulfotransferase family 1D, member 1 |
| chr10_+_115653152 | 9.48 |
ENSMUST00000080630.11
ENSMUST00000179196.3 ENSMUST00000035563.15 |
Tspan8
|
tetraspanin 8 |
| chr4_+_32238950 | 9.25 |
ENSMUST00000037416.13
|
Bach2
|
BTB and CNC homology, basic leucine zipper transcription factor 2 |
| chr17_-_71158703 | 9.12 |
ENSMUST00000166395.9
|
Tgif1
|
TGFB-induced factor homeobox 1 |
| chr1_-_45542442 | 9.01 |
ENSMUST00000086430.5
|
Col5a2
|
collagen, type V, alpha 2 |
| chr10_-_89369432 | 8.88 |
ENSMUST00000105297.2
|
Nr1h4
|
nuclear receptor subfamily 1, group H, member 4 |
| chr1_-_162726234 | 8.85 |
ENSMUST00000111510.8
ENSMUST00000045902.13 |
Fmo2
|
flavin containing monooxygenase 2 |
| chr3_+_137983250 | 8.79 |
ENSMUST00000004232.10
|
Adh1
|
alcohol dehydrogenase 1 (class I) |
| chr6_+_15185202 | 8.57 |
ENSMUST00000154448.2
|
Foxp2
|
forkhead box P2 |
| chr8_-_33374282 | 8.53 |
ENSMUST00000209107.4
ENSMUST00000209022.3 |
Nrg1
|
neuregulin 1 |
| chr12_+_112645237 | 8.22 |
ENSMUST00000174780.2
ENSMUST00000169593.2 ENSMUST00000173942.2 |
Zbtb42
|
zinc finger and BTB domain containing 42 |
| chr7_-_37472979 | 8.16 |
ENSMUST00000176534.8
|
Zfp536
|
zinc finger protein 536 |
| chr4_+_134042423 | 8.04 |
ENSMUST00000105875.8
ENSMUST00000030638.7 |
Trim63
|
tripartite motif-containing 63 |
| chr8_-_46747629 | 8.04 |
ENSMUST00000058636.9
|
Helt
|
helt bHLH transcription factor |
| chr2_+_4722956 | 8.02 |
ENSMUST00000056914.7
|
Bend7
|
BEN domain containing 7 |
| chr6_+_117883783 | 7.81 |
ENSMUST00000177918.8
ENSMUST00000163168.9 |
Hnrnpf
|
heterogeneous nuclear ribonucleoprotein F |
| chr1_-_162726053 | 7.67 |
ENSMUST00000143123.3
|
Fmo2
|
flavin containing monooxygenase 2 |
| chr6_+_117883732 | 7.59 |
ENSMUST00000179224.8
ENSMUST00000035493.14 |
Hnrnpf
|
heterogeneous nuclear ribonucleoprotein F |
| chr11_+_96820220 | 7.44 |
ENSMUST00000062172.6
|
Prr15l
|
proline rich 15-like |
| chr10_+_96452860 | 7.43 |
ENSMUST00000038377.9
|
Btg1
|
BTG anti-proliferation factor 1 |
| chr11_-_102255999 | 7.34 |
ENSMUST00000006749.10
|
Slc4a1
|
solute carrier family 4 (anion exchanger), member 1 |
| chr12_-_32000169 | 7.30 |
ENSMUST00000176520.8
|
Hbp1
|
high mobility group box transcription factor 1 |
| chr19_+_56414114 | 7.28 |
ENSMUST00000238892.2
|
Casp7
|
caspase 7 |
| chr3_+_96465265 | 7.09 |
ENSMUST00000074519.13
ENSMUST00000049093.8 |
Txnip
|
thioredoxin interacting protein |
| chr12_-_32000534 | 7.01 |
ENSMUST00000172314.9
|
Hbp1
|
high mobility group box transcription factor 1 |
| chr1_-_184543367 | 7.00 |
ENSMUST00000048462.13
ENSMUST00000110992.9 |
Mtarc1
|
mitochondrial amidoxime reducing component 1 |
| chr11_+_114742619 | 6.91 |
ENSMUST00000053361.12
ENSMUST00000021071.14 ENSMUST00000136785.2 |
Gprc5c
|
G protein-coupled receptor, family C, group 5, member C |
| chr6_-_39702127 | 6.80 |
ENSMUST00000101497.4
|
Braf
|
Braf transforming gene |
| chr11_+_96820091 | 6.77 |
ENSMUST00000054311.6
ENSMUST00000107636.4 |
Prr15l
|
proline rich 15-like |
| chr14_-_31362909 | 6.67 |
ENSMUST00000022437.16
|
Hacl1
|
2-hydroxyacyl-CoA lyase 1 |
| chr10_-_21036792 | 6.65 |
ENSMUST00000188495.8
|
Myb
|
myeloblastosis oncogene |
| chr4_-_59549243 | 6.65 |
ENSMUST00000173699.8
ENSMUST00000173884.8 ENSMUST00000102883.11 ENSMUST00000174586.8 |
Ptbp3
|
polypyrimidine tract binding protein 3 |
| chr6_+_116627567 | 6.59 |
ENSMUST00000067354.10
ENSMUST00000178241.4 |
Depp1
|
DEPP1 autophagy regulator |
| chr14_+_73475335 | 6.52 |
ENSMUST00000044405.8
|
Lpar6
|
lysophosphatidic acid receptor 6 |
| chr14_-_31362835 | 6.44 |
ENSMUST00000167066.8
ENSMUST00000127204.9 |
Hacl1
|
2-hydroxyacyl-CoA lyase 1 |
| chr2_+_153334710 | 6.38 |
ENSMUST00000109783.2
|
4930404H24Rik
|
RIKEN cDNA 4930404H24 gene |
| chr15_+_35296237 | 6.38 |
ENSMUST00000022952.6
|
Osr2
|
odd-skipped related 2 |
| chr11_+_118913788 | 6.37 |
ENSMUST00000026662.8
|
Cbx2
|
chromobox 2 |
| chr10_+_87695352 | 6.35 |
ENSMUST00000121952.8
ENSMUST00000126490.8 |
Igf1
|
insulin-like growth factor 1 |
| chr5_-_147244074 | 6.33 |
ENSMUST00000031650.4
|
Cdx2
|
caudal type homeobox 2 |
| chr15_-_78352801 | 6.33 |
ENSMUST00000229124.2
ENSMUST00000230226.2 ENSMUST00000017086.5 |
Tmprss6
|
transmembrane serine protease 6 |
| chr9_-_44714263 | 6.30 |
ENSMUST00000044694.8
|
Ttc36
|
tetratricopeptide repeat domain 36 |
| chr12_-_113223839 | 6.30 |
ENSMUST00000194738.6
ENSMUST00000178282.3 |
Igha
|
immunoglobulin heavy constant alpha |
| chr14_+_31363004 | 6.13 |
ENSMUST00000090147.7
|
Btd
|
biotinidase |
| chr16_-_21980200 | 6.09 |
ENSMUST00000115379.2
|
Igf2bp2
|
insulin-like growth factor 2 mRNA binding protein 2 |
| chr12_-_32000209 | 6.08 |
ENSMUST00000176084.2
ENSMUST00000176103.8 ENSMUST00000167458.9 |
Hbp1
|
high mobility group box transcription factor 1 |
| chr15_+_79231720 | 6.05 |
ENSMUST00000096350.11
|
Maff
|
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein F (avian) |
| chr5_-_115109118 | 6.05 |
ENSMUST00000031535.12
|
Hnf1a
|
HNF1 homeobox A |
| chr11_+_114742331 | 6.05 |
ENSMUST00000177952.8
|
Gprc5c
|
G protein-coupled receptor, family C, group 5, member C |
| chr4_+_144619397 | 6.03 |
ENSMUST00000105744.8
ENSMUST00000171001.8 |
Dhrs3
|
dehydrogenase/reductase (SDR family) member 3 |
| chr2_+_127967951 | 5.85 |
ENSMUST00000089634.12
ENSMUST00000019281.14 ENSMUST00000110341.9 ENSMUST00000103211.8 ENSMUST00000103210.2 |
Bcl2l11
|
BCL2-like 11 (apoptosis facilitator) |
| chr14_-_52252318 | 5.83 |
ENSMUST00000228051.2
|
Zfp219
|
zinc finger protein 219 |
| chr18_-_80751327 | 5.81 |
ENSMUST00000236310.2
ENSMUST00000167977.8 ENSMUST00000035800.8 |
Nfatc1
|
nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 1 |
| chr8_-_45747883 | 5.78 |
ENSMUST00000026907.6
|
Klkb1
|
kallikrein B, plasma 1 |
| chr4_+_94627513 | 5.73 |
ENSMUST00000073939.13
ENSMUST00000102798.8 |
Tek
|
TEK receptor tyrosine kinase |
| chr2_+_34764408 | 5.67 |
ENSMUST00000113068.9
ENSMUST00000047447.13 |
Cutal
|
cutA divalent cation tolerance homolog-like |
| chr10_-_21036824 | 5.65 |
ENSMUST00000020158.9
|
Myb
|
myeloblastosis oncogene |
| chr7_-_80052491 | 5.61 |
ENSMUST00000122232.8
|
Furin
|
furin (paired basic amino acid cleaving enzyme) |
| chr10_+_128089965 | 5.52 |
ENSMUST00000060782.5
ENSMUST00000218722.2 |
Apon
|
apolipoprotein N |
| chr10_-_93146937 | 5.52 |
ENSMUST00000008542.12
|
Elk3
|
ELK3, member of ETS oncogene family |
| chr17_+_35413415 | 5.49 |
ENSMUST00000025262.6
ENSMUST00000173600.2 |
Ltb
|
lymphotoxin B |
| chr6_+_53550349 | 5.40 |
ENSMUST00000203641.2
|
Creb5
|
cAMP responsive element binding protein 5 |
| chr4_-_15945359 | 5.40 |
ENSMUST00000029877.9
|
Decr1
|
2,4-dienoyl CoA reductase 1, mitochondrial |
| chr19_+_5927821 | 5.39 |
ENSMUST00000145200.8
ENSMUST00000025732.14 ENSMUST00000125114.8 ENSMUST00000155697.8 |
Slc25a45
|
solute carrier family 25, member 45 |
| chr7_+_140343652 | 5.39 |
ENSMUST00000026552.9
ENSMUST00000209253.2 ENSMUST00000210235.2 |
Cyp2e1
|
cytochrome P450, family 2, subfamily e, polypeptide 1 |
| chr13_+_49697919 | 5.39 |
ENSMUST00000177948.2
ENSMUST00000021820.14 |
Aspn
|
asporin |
| chr15_+_79232137 | 5.38 |
ENSMUST00000163691.3
|
Maff
|
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein F (avian) |
| chr6_-_3487369 | 5.36 |
ENSMUST00000201607.4
|
Hepacam2
|
HEPACAM family member 2 |
| chr2_+_4887015 | 5.32 |
ENSMUST00000115019.2
|
Sephs1
|
selenophosphate synthetase 1 |
| chr14_+_14210932 | 5.30 |
ENSMUST00000022271.14
|
Acox2
|
acyl-Coenzyme A oxidase 2, branched chain |
| chrX_-_7547273 | 5.29 |
ENSMUST00000115695.4
|
Magix
|
MAGI family member, X-linked |
| chr6_+_135339929 | 5.28 |
ENSMUST00000032330.16
|
Emp1
|
epithelial membrane protein 1 |
| chr16_-_4377640 | 5.26 |
ENSMUST00000005862.9
|
Tfap4
|
transcription factor AP4 |
| chr19_-_34856853 | 5.18 |
ENSMUST00000036584.13
|
Pank1
|
pantothenate kinase 1 |
| chr8_+_47193275 | 5.17 |
ENSMUST00000207571.3
|
Irf2
|
interferon regulatory factor 2 |
| chr10_-_93146825 | 5.17 |
ENSMUST00000151153.2
|
Elk3
|
ELK3, member of ETS oncogene family |
| chr2_+_34764496 | 5.16 |
ENSMUST00000028228.6
|
Cutal
|
cutA divalent cation tolerance homolog-like |
| chr2_-_91025492 | 5.14 |
ENSMUST00000111354.2
|
Nr1h3
|
nuclear receptor subfamily 1, group H, member 3 |
| chr1_+_88030951 | 5.09 |
ENSMUST00000113135.6
ENSMUST00000113138.8 |
Ugt1a7c
Ugt1a6b
|
UDP glucuronosyltransferase 1 family, polypeptide A7C UDP glucuronosyltransferase 1 family, polypeptide A6B |
| chr3_+_52175757 | 5.08 |
ENSMUST00000053764.7
|
Foxo1
|
forkhead box O1 |
| chr4_-_96552349 | 5.08 |
ENSMUST00000030299.8
|
Cyp2j5
|
cytochrome P450, family 2, subfamily j, polypeptide 5 |
| chr4_-_19922599 | 5.07 |
ENSMUST00000029900.6
|
Atp6v0d2
|
ATPase, H+ transporting, lysosomal V0 subunit D2 |
| chr16_-_4376471 | 5.05 |
ENSMUST00000230875.2
|
Tfap4
|
transcription factor AP4 |
| chr8_+_93553901 | 5.04 |
ENSMUST00000034187.9
|
Mmp2
|
matrix metallopeptidase 2 |
| chr14_-_68819544 | 4.98 |
ENSMUST00000022641.9
|
Adamdec1
|
ADAM-like, decysin 1 |
| chr5_-_66309244 | 4.93 |
ENSMUST00000167950.8
|
Rbm47
|
RNA binding motif protein 47 |
| chr5_-_90788323 | 4.89 |
ENSMUST00000202784.4
ENSMUST00000031317.10 ENSMUST00000201370.2 |
Rassf6
|
Ras association (RalGDS/AF-6) domain family member 6 |
| chr5_-_83502966 | 4.89 |
ENSMUST00000053543.11
|
Tecrl
|
trans-2,3-enoyl-CoA reductase-like |
| chr12_+_71063431 | 4.89 |
ENSMUST00000125125.2
|
Arid4a
|
AT rich interactive domain 4A (RBP1-like) |
| chr10_+_96453408 | 4.88 |
ENSMUST00000218953.2
|
Btg1
|
BTG anti-proliferation factor 1 |
| chr3_-_51248032 | 4.85 |
ENSMUST00000062009.14
ENSMUST00000194641.6 |
Elf2
|
E74-like factor 2 |
| chr15_+_102875229 | 4.85 |
ENSMUST00000001699.8
|
Hoxc10
|
homeobox C10 |
| chr8_+_47192911 | 4.82 |
ENSMUST00000208433.2
|
Irf2
|
interferon regulatory factor 2 |
| chr15_+_59520493 | 4.80 |
ENSMUST00000118228.2
|
Trib1
|
tribbles pseudokinase 1 |
| chr4_-_116024788 | 4.80 |
ENSMUST00000030465.10
ENSMUST00000143426.2 |
Tspan1
|
tetraspanin 1 |
| chr14_+_75368939 | 4.79 |
ENSMUST00000125833.8
ENSMUST00000124499.8 |
Lcp1
|
lymphocyte cytosolic protein 1 |
| chr5_-_73789764 | 4.79 |
ENSMUST00000087177.4
|
Lrrc66
|
leucine rich repeat containing 66 |
| chr6_-_48685108 | 4.78 |
ENSMUST00000126422.3
ENSMUST00000119315.2 ENSMUST00000053661.7 |
Gimap6
|
GTPase, IMAP family member 6 |
| chr15_+_59520199 | 4.78 |
ENSMUST00000067543.8
|
Trib1
|
tribbles pseudokinase 1 |
| chr5_-_87682972 | 4.75 |
ENSMUST00000120150.2
|
Sult1b1
|
sulfotransferase family 1B, member 1 |
| chr4_+_65042411 | 4.73 |
ENSMUST00000084501.4
|
Pappa
|
pregnancy-associated plasma protein A |
| chr11_-_106605772 | 4.71 |
ENSMUST00000124958.3
|
Pecam1
|
platelet/endothelial cell adhesion molecule 1 |
| chr17_-_84990360 | 4.68 |
ENSMUST00000066175.10
|
Abcg5
|
ATP binding cassette subfamily G member 5 |
| chr14_-_54646917 | 4.68 |
ENSMUST00000000984.9
|
Slc7a7
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 7 |
| chrX_+_138701544 | 4.65 |
ENSMUST00000054889.4
|
Cldn2
|
claudin 2 |
| chr15_+_61857390 | 4.64 |
ENSMUST00000159327.2
ENSMUST00000167731.8 |
Myc
|
myelocytomatosis oncogene |
| chr3_+_146302832 | 4.63 |
ENSMUST00000029837.14
ENSMUST00000147409.2 ENSMUST00000121133.2 |
Uox
|
urate oxidase |
| chr2_-_27365633 | 4.62 |
ENSMUST00000138693.8
ENSMUST00000113941.9 ENSMUST00000077737.13 |
Brd3
|
bromodomain containing 3 |
| chr18_-_66155651 | 4.62 |
ENSMUST00000143990.2
|
Lman1
|
lectin, mannose-binding, 1 |
| chr2_+_167380112 | 4.60 |
ENSMUST00000052631.8
|
Snai1
|
snail family zinc finger 1 |
| chr1_-_90897329 | 4.59 |
ENSMUST00000130042.2
ENSMUST00000027529.12 |
Rab17
|
RAB17, member RAS oncogene family |
| chr4_+_119494901 | 4.58 |
ENSMUST00000024015.3
|
Guca2a
|
guanylate cyclase activator 2a (guanylin) |
| chr15_-_58187556 | 4.55 |
ENSMUST00000022985.2
|
Klhl38
|
kelch-like 38 |
| chr6_+_34840057 | 4.55 |
ENSMUST00000074949.4
|
Tmem140
|
transmembrane protein 140 |
| chr2_-_69036489 | 4.48 |
ENSMUST00000127243.8
ENSMUST00000149643.2 ENSMUST00000167875.9 ENSMUST00000005365.15 |
Spc25
|
SPC25, NDC80 kinetochore complex component, homolog (S. cerevisiae) |
| chr9_+_44951075 | 4.47 |
ENSMUST00000217097.2
|
Mpzl2
|
myelin protein zero-like 2 |
| chr5_+_31079177 | 4.47 |
ENSMUST00000031053.15
ENSMUST00000202752.2 |
Khk
|
ketohexokinase |
| chr11_+_114741948 | 4.45 |
ENSMUST00000133245.2
ENSMUST00000122967.3 |
Gprc5c
|
G protein-coupled receptor, family C, group 5, member C |
| chr3_-_30067537 | 4.45 |
ENSMUST00000108270.10
|
Mecom
|
MDS1 and EVI1 complex locus |
| chr19_+_29078765 | 4.45 |
ENSMUST00000064393.6
ENSMUST00000235900.2 |
Rcl1
|
RNA terminal phosphate cyclase-like 1 |
| chr6_-_16898440 | 4.42 |
ENSMUST00000031533.11
|
Tfec
|
transcription factor EC |
| chr11_+_85723377 | 4.42 |
ENSMUST00000000095.7
|
Tbx2
|
T-box 2 |
| chr11_+_69856222 | 4.38 |
ENSMUST00000018713.13
|
Cldn7
|
claudin 7 |
| chr8_+_106785434 | 4.38 |
ENSMUST00000212742.2
ENSMUST00000211991.2 |
Nfatc3
|
nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 3 |
| chr5_+_28370687 | 4.37 |
ENSMUST00000036177.9
|
En2
|
engrailed 2 |
| chr17_-_57535003 | 4.31 |
ENSMUST00000177046.2
ENSMUST00000024988.15 |
C3
|
complement component 3 |
| chr11_-_106606076 | 4.30 |
ENSMUST00000080853.11
ENSMUST00000183610.8 ENSMUST00000103069.10 ENSMUST00000106796.9 |
Pecam1
|
platelet/endothelial cell adhesion molecule 1 |
| chr11_-_106811185 | 4.29 |
ENSMUST00000167787.2
ENSMUST00000092517.9 |
Smurf2
|
SMAD specific E3 ubiquitin protein ligase 2 |
| chr11_+_114743044 | 4.24 |
ENSMUST00000142262.2
|
Gprc5c
|
G protein-coupled receptor, family C, group 5, member C |
| chr6_-_67919524 | 4.22 |
ENSMUST00000196768.2
|
Igkv9-124
|
immunoglobulin kappa chain variable 9-124 |
| chr13_-_63006176 | 4.21 |
ENSMUST00000021907.9
|
Fbp2
|
fructose bisphosphatase 2 |
| chr8_+_73072877 | 4.21 |
ENSMUST00000067912.8
|
Klf2
|
Kruppel-like factor 2 (lung) |
| chr19_+_5927876 | 4.20 |
ENSMUST00000235340.2
|
Slc25a45
|
solute carrier family 25, member 45 |
| chr6_+_17491231 | 4.19 |
ENSMUST00000080469.12
|
Met
|
met proto-oncogene |
| chr8_+_121854566 | 4.19 |
ENSMUST00000181609.2
|
Foxl1
|
forkhead box L1 |
| chr16_+_22739028 | 4.19 |
ENSMUST00000232097.2
|
Fetub
|
fetuin beta |
| chr19_+_30210320 | 4.19 |
ENSMUST00000025797.7
|
Mbl2
|
mannose-binding lectin (protein C) 2 |
| chr3_+_51568625 | 4.17 |
ENSMUST00000159554.7
ENSMUST00000161590.4 |
Mgst2
|
microsomal glutathione S-transferase 2 |
| chr6_+_135339543 | 4.16 |
ENSMUST00000205156.3
|
Emp1
|
epithelial membrane protein 1 |
| chr5_-_87054796 | 4.15 |
ENSMUST00000031181.16
ENSMUST00000113333.2 |
Ugt2b34
|
UDP glucuronosyltransferase 2 family, polypeptide B34 |
| chr4_+_144619696 | 4.15 |
ENSMUST00000142808.8
|
Dhrs3
|
dehydrogenase/reductase (SDR family) member 3 |
| chr11_+_108286114 | 4.13 |
ENSMUST00000000049.6
|
Apoh
|
apolipoprotein H |
| chr1_-_69726384 | 4.13 |
ENSMUST00000187184.7
|
Ikzf2
|
IKAROS family zinc finger 2 |
| chr15_-_82678490 | 4.12 |
ENSMUST00000006094.6
|
Cyp2d26
|
cytochrome P450, family 2, subfamily d, polypeptide 26 |
| chr11_-_100288566 | 4.11 |
ENSMUST00000001592.15
ENSMUST00000107403.2 |
Jup
|
junction plakoglobin |
| chr3_+_85878376 | 4.11 |
ENSMUST00000238443.2
|
Sh3d19
|
SH3 domain protein D19 |
| chr4_+_144619647 | 4.07 |
ENSMUST00000154208.8
|
Dhrs3
|
dehydrogenase/reductase (SDR family) member 3 |
| chr6_+_34840151 | 4.06 |
ENSMUST00000202010.2
|
Tmem140
|
transmembrane protein 140 |
| chr16_-_48232770 | 4.06 |
ENSMUST00000212197.2
|
Gm5485
|
predicted gene 5485 |
| chr3_-_27207993 | 4.04 |
ENSMUST00000176242.9
ENSMUST00000176780.8 |
Ect2
|
ect2 oncogene |
| chr5_-_145946408 | 4.02 |
ENSMUST00000138870.2
ENSMUST00000068317.13 |
Cyp3a25
|
cytochrome P450, family 3, subfamily a, polypeptide 25 |
| chr6_+_15184630 | 4.01 |
ENSMUST00000115470.3
|
Foxp2
|
forkhead box P2 |
| chr9_-_45866468 | 4.01 |
ENSMUST00000162072.8
|
Sidt2
|
SID1 transmembrane family, member 2 |
| chr11_-_75329726 | 4.00 |
ENSMUST00000108437.8
|
Serpinf2
|
serine (or cysteine) peptidase inhibitor, clade F, member 2 |
| chr1_-_180023467 | 3.99 |
ENSMUST00000161746.2
ENSMUST00000160879.7 |
Coq8a
|
coenzyme Q8A |
| chr4_-_115353326 | 3.96 |
ENSMUST00000030487.3
|
Cyp4a14
|
cytochrome P450, family 4, subfamily a, polypeptide 14 |
| chr15_-_96947963 | 3.96 |
ENSMUST00000230907.2
|
Slc38a4
|
solute carrier family 38, member 4 |
| chr6_+_121323577 | 3.95 |
ENSMUST00000032200.16
|
Slc6a12
|
solute carrier family 6 (neurotransmitter transporter, betaine/GABA), member 12 |
| chr14_-_52252432 | 3.95 |
ENSMUST00000226527.2
|
Zfp219
|
zinc finger protein 219 |
| chr5_+_90708962 | 3.95 |
ENSMUST00000094615.8
ENSMUST00000200765.2 |
Albfm1
|
albumin superfamily member 1 |
| chr10_+_100428212 | 3.94 |
ENSMUST00000187119.7
ENSMUST00000188736.7 ENSMUST00000191336.7 |
1700017N19Rik
|
RIKEN cDNA 1700017N19 gene |
| chr2_-_163486998 | 3.94 |
ENSMUST00000017851.4
|
Serinc3
|
serine incorporator 3 |
| chr9_-_45866264 | 3.93 |
ENSMUST00000114573.9
|
Sidt2
|
SID1 transmembrane family, member 2 |
| chr1_-_130589349 | 3.92 |
ENSMUST00000027657.14
|
C4bp
|
complement component 4 binding protein |
| chr5_-_142803135 | 3.92 |
ENSMUST00000198181.2
|
Tnrc18
|
trinucleotide repeat containing 18 |
| chr12_-_114487525 | 3.92 |
ENSMUST00000103495.3
|
Ighv10-3
|
immunoglobulin heavy variable V10-3 |
| chr15_-_53209513 | 3.91 |
ENSMUST00000077273.9
|
Ext1
|
exostosin glycosyltransferase 1 |
| chr7_-_25176959 | 3.89 |
ENSMUST00000098668.3
ENSMUST00000206687.2 ENSMUST00000206676.2 ENSMUST00000205308.2 ENSMUST00000098669.8 ENSMUST00000206171.2 ENSMUST00000098666.9 |
Ceacam1
|
carcinoembryonic antigen-related cell adhesion molecule 1 |
| chr1_-_139487951 | 3.88 |
ENSMUST00000023965.8
|
Cfhr1
|
complement factor H-related 1 |
| chr7_+_125151292 | 3.87 |
ENSMUST00000033004.8
|
Il4ra
|
interleukin 4 receptor, alpha |
| chr4_-_155013002 | 3.86 |
ENSMUST00000152687.8
ENSMUST00000137803.8 ENSMUST00000145296.2 |
Tnfrsf14
|
tumor necrosis factor receptor superfamily, member 14 (herpesvirus entry mediator) |
| chr8_-_40095706 | 3.86 |
ENSMUST00000210525.2
ENSMUST00000170091.3 |
Msr1
|
macrophage scavenger receptor 1 |
| chr2_+_24970327 | 3.85 |
ENSMUST00000044078.10
ENSMUST00000114380.9 |
Entpd8
|
ectonucleoside triphosphate diphosphohydrolase 8 |
| chr17_+_47816042 | 3.84 |
ENSMUST00000183044.8
ENSMUST00000037333.17 |
Ccnd3
|
cyclin D3 |
| chr2_-_60552980 | 3.82 |
ENSMUST00000028348.9
ENSMUST00000112517.8 |
Itgb6
|
integrin beta 6 |
| chrX_+_111221031 | 3.82 |
ENSMUST00000026599.10
ENSMUST00000113415.2 |
Apool
|
apolipoprotein O-like |
| chr1_-_130589321 | 3.82 |
ENSMUST00000137276.3
|
C4bp
|
complement component 4 binding protein |
| chr4_-_109013807 | 3.81 |
ENSMUST00000161363.2
|
Osbpl9
|
oxysterol binding protein-like 9 |
| chr6_-_52181393 | 3.79 |
ENSMUST00000048794.7
|
Hoxa5
|
homeobox A5 |
| chr4_+_94627755 | 3.79 |
ENSMUST00000071168.6
|
Tek
|
TEK receptor tyrosine kinase |
| chr19_-_34855242 | 3.78 |
ENSMUST00000238065.2
|
Pank1
|
pantothenate kinase 1 |
| chr17_+_41121979 | 3.77 |
ENSMUST00000024721.8
ENSMUST00000233740.2 |
Rhag
|
Rhesus blood group-associated A glycoprotein |
| chr3_-_27208010 | 3.77 |
ENSMUST00000108300.8
ENSMUST00000108298.9 |
Ect2
|
ect2 oncogene |
| chr5_-_83502793 | 3.75 |
ENSMUST00000146669.2
|
Tecrl
|
trans-2,3-enoyl-CoA reductase-like |
| chr3_+_59939175 | 3.75 |
ENSMUST00000029325.5
|
Aadac
|
arylacetamide deacetylase |
| chr7_+_141056305 | 3.75 |
ENSMUST00000117634.2
|
Tspan4
|
tetraspanin 4 |
| chr15_+_3300249 | 3.74 |
ENSMUST00000082424.12
ENSMUST00000159158.9 ENSMUST00000159216.10 ENSMUST00000160311.3 |
Selenop
|
selenoprotein P |
| chr17_+_34482183 | 3.74 |
ENSMUST00000040828.7
ENSMUST00000237342.2 ENSMUST00000237866.2 |
H2-Ab1
|
histocompatibility 2, class II antigen A, beta 1 |
| chrX_+_149330371 | 3.74 |
ENSMUST00000066337.13
ENSMUST00000112715.2 |
Alas2
|
aminolevulinic acid synthase 2, erythroid |
| chr5_-_90788460 | 3.73 |
ENSMUST00000202704.4
|
Rassf6
|
Ras association (RalGDS/AF-6) domain family member 6 |
| chr6_-_14755249 | 3.72 |
ENSMUST00000045096.6
|
Ppp1r3a
|
protein phosphatase 1, regulatory subunit 3A |
| chr4_+_135413593 | 3.72 |
ENSMUST00000074408.7
|
Ifnlr1
|
interferon lambda receptor 1 |
| chr8_-_24928953 | 3.72 |
ENSMUST00000052622.6
|
Tcim
|
transcriptional and immune response regulator |
| chr6_+_142244145 | 3.72 |
ENSMUST00000041993.3
|
Iapp
|
islet amyloid polypeptide |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.1 | 16.3 | GO:0006069 | ethanol oxidation(GO:0006069) |
| 3.9 | 11.7 | GO:0030070 | insulin processing(GO:0030070) |
| 3.2 | 9.6 | GO:0045645 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
| 3.0 | 9.0 | GO:0090673 | endothelial cell-matrix adhesion(GO:0090673) |
| 3.0 | 14.9 | GO:0070543 | response to linoleic acid(GO:0070543) |
| 2.8 | 11.3 | GO:0010609 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) |
| 2.8 | 13.9 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
| 2.8 | 16.5 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 2.6 | 7.9 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 2.6 | 13.2 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 2.6 | 10.3 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 2.4 | 9.6 | GO:0060932 | His-Purkinje system cell differentiation(GO:0060932) |
| 2.4 | 4.8 | GO:0006068 | ethanol metabolic process(GO:0006067) ethanol catabolic process(GO:0006068) |
| 2.3 | 16.3 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 2.3 | 6.8 | GO:0030887 | positive regulation of myeloid dendritic cell activation(GO:0030887) |
| 2.3 | 9.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 2.2 | 6.6 | GO:0097037 | heme export(GO:0097037) |
| 2.2 | 6.5 | GO:0019442 | tryptophan catabolic process to acetyl-CoA(GO:0019442) |
| 2.2 | 19.4 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 2.1 | 8.3 | GO:0090096 | lactic acid secretion(GO:0046722) regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 2.1 | 14.4 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 2.1 | 14.4 | GO:1904073 | regulation of trophectodermal cell proliferation(GO:1904073) positive regulation of trophectodermal cell proliferation(GO:1904075) |
| 2.0 | 10.2 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 2.0 | 8.0 | GO:0046356 | coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) acetyl-CoA catabolic process(GO:0046356) |
| 1.9 | 5.8 | GO:0021570 | rhombomere 4 development(GO:0021570) |
| 1.9 | 5.8 | GO:0060854 | patterning of lymph vessels(GO:0060854) |
| 1.7 | 6.9 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 1.7 | 13.6 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
| 1.7 | 5.1 | GO:0006711 | estrogen catabolic process(GO:0006711) |
| 1.7 | 5.1 | GO:2000863 | positive regulation of estrogen secretion(GO:2000863) |
| 1.7 | 5.0 | GO:0034240 | negative regulation of macrophage fusion(GO:0034240) |
| 1.7 | 6.6 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 1.7 | 3.3 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 1.6 | 1.6 | GO:0002649 | regulation of tolerance induction to self antigen(GO:0002649) |
| 1.6 | 8.0 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 1.5 | 35.3 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 1.5 | 4.6 | GO:0002414 | immune response in mucosal-associated lymphoid tissue(GO:0002386) immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 1.5 | 6.0 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 1.5 | 6.0 | GO:2000563 | positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 1.5 | 4.5 | GO:0042495 | detection of triacyl bacterial lipopeptide(GO:0042495) |
| 1.5 | 4.4 | GO:0060596 | mammary placode formation(GO:0060596) |
| 1.5 | 7.3 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 1.4 | 10.0 | GO:1900170 | negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 1.4 | 5.6 | GO:0090472 | dibasic protein processing(GO:0090472) |
| 1.4 | 9.8 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 1.3 | 1.3 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 1.3 | 20.7 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 1.3 | 7.8 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 1.3 | 5.1 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
| 1.3 | 3.8 | GO:0060574 | intestinal epithelial cell maturation(GO:0060574) |
| 1.2 | 3.7 | GO:0002343 | peripheral B cell selection(GO:0002343) B cell affinity maturation(GO:0002344) |
| 1.2 | 3.7 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 1.2 | 8.1 | GO:0051917 | regulation of fibrinolysis(GO:0051917) negative regulation of fibrinolysis(GO:0051918) |
| 1.2 | 24.4 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 1.2 | 8.1 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 1.1 | 4.6 | GO:0036367 | adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 1.1 | 3.4 | GO:0042977 | regulation of activation of JAK2 kinase activity(GO:0010534) activation of JAK2 kinase activity(GO:0042977) negative regulation of activation of JAK2 kinase activity(GO:1902569) |
| 1.1 | 2.2 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 1.1 | 3.3 | GO:0034443 | negative regulation of lipoprotein oxidation(GO:0034443) |
| 1.1 | 4.3 | GO:0001970 | positive regulation of activation of membrane attack complex(GO:0001970) |
| 1.1 | 4.2 | GO:1902080 | regulation of calcium ion import into sarcoplasmic reticulum(GO:1902080) negative regulation of calcium ion import into sarcoplasmic reticulum(GO:1902081) |
| 1.1 | 3.2 | GO:1903173 | phytol metabolic process(GO:0033306) fatty alcohol metabolic process(GO:1903173) |
| 1.1 | 4.2 | GO:0046351 | disaccharide biosynthetic process(GO:0046351) |
| 1.0 | 15.7 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 1.0 | 4.2 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 1.0 | 3.1 | GO:0021759 | globus pallidus development(GO:0021759) |
| 1.0 | 4.1 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 1.0 | 9.1 | GO:0021842 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 1.0 | 2.0 | GO:0031448 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 1.0 | 5.0 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 1.0 | 14.6 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 1.0 | 2.9 | GO:0006713 | glucocorticoid catabolic process(GO:0006713) |
| 0.9 | 4.7 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.9 | 3.8 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.9 | 2.8 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
| 0.9 | 2.8 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.9 | 2.8 | GO:0031104 | dendrite regeneration(GO:0031104) |
| 0.9 | 2.8 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.9 | 1.8 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
| 0.9 | 7.2 | GO:0072615 | interleukin-17 secretion(GO:0072615) |
| 0.9 | 1.8 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
| 0.9 | 4.4 | GO:1904720 | regulation of mRNA cleavage(GO:0031437) negative regulation of mRNA cleavage(GO:0031438) regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904720) negative regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904721) |
| 0.9 | 4.4 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.9 | 5.3 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.9 | 6.1 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.9 | 4.4 | GO:0009597 | detection of virus(GO:0009597) |
| 0.9 | 2.6 | GO:2000978 | trochlear nerve development(GO:0021558) auditory receptor cell fate determination(GO:0042668) negative regulation of forebrain neuron differentiation(GO:2000978) |
| 0.9 | 2.6 | GO:0070839 | divalent metal ion export(GO:0070839) |
| 0.9 | 0.9 | GO:0032240 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.9 | 0.9 | GO:1904173 | regulation of histone demethylase activity (H3-K4 specific)(GO:1904173) |
| 0.8 | 3.4 | GO:0015801 | aromatic amino acid transport(GO:0015801) tryptophan transport(GO:0015827) |
| 0.8 | 7.5 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
| 0.8 | 3.3 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.8 | 1.7 | GO:1903487 | regulation of lactation(GO:1903487) |
| 0.8 | 3.3 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.8 | 4.1 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.8 | 2.4 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.8 | 1.6 | GO:0002353 | plasma kallikrein-kinin cascade(GO:0002353) |
| 0.8 | 2.4 | GO:1990535 | neuron projection maintenance(GO:1990535) |
| 0.8 | 10.3 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.8 | 3.2 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
| 0.8 | 2.4 | GO:0019230 | proprioception(GO:0019230) |
| 0.8 | 3.1 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.8 | 8.6 | GO:0071455 | cellular response to hyperoxia(GO:0071455) |
| 0.8 | 2.3 | GO:0009087 | methionine catabolic process(GO:0009087) |
| 0.7 | 6.7 | GO:0061709 | reticulophagy(GO:0061709) |
| 0.7 | 3.0 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.7 | 7.4 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
| 0.7 | 3.0 | GO:0090327 | negative regulation of locomotion involved in locomotory behavior(GO:0090327) |
| 0.7 | 2.2 | GO:0046087 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.7 | 2.2 | GO:0086097 | phospholipase C-activating angiotensin-activated signaling pathway(GO:0086097) |
| 0.7 | 2.2 | GO:0046619 | optic placode formation involved in camera-type eye formation(GO:0046619) regulation of forebrain neuron differentiation(GO:2000977) |
| 0.7 | 2.9 | GO:0015855 | nucleobase transport(GO:0015851) pyrimidine nucleobase transport(GO:0015855) |
| 0.7 | 3.6 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.7 | 0.7 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.7 | 2.9 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.7 | 7.9 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.7 | 2.8 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
| 0.7 | 2.1 | GO:0002270 | plasmacytoid dendritic cell activation(GO:0002270) |
| 0.7 | 3.5 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.7 | 2.1 | GO:0055130 | D-serine catabolic process(GO:0036088) D-alanine family amino acid metabolic process(GO:0046144) D-alanine metabolic process(GO:0046436) D-alanine catabolic process(GO:0055130) |
| 0.7 | 2.1 | GO:0097277 | creatinine homeostasis(GO:0097273) cellular ammonia homeostasis(GO:0097275) cellular creatinine homeostasis(GO:0097276) cellular urea homeostasis(GO:0097277) |
| 0.7 | 2.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.7 | 4.2 | GO:0034616 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
| 0.7 | 2.1 | GO:0051659 | maintenance of mitochondrion location(GO:0051659) |
| 0.7 | 3.5 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.7 | 6.9 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.7 | 11.0 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.7 | 6.8 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
| 0.7 | 6.1 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.7 | 2.0 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 0.7 | 5.4 | GO:0097647 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.7 | 5.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.7 | 1.3 | GO:0035666 | TRIF-dependent toll-like receptor signaling pathway(GO:0035666) |
| 0.7 | 3.3 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.7 | 4.0 | GO:0009992 | cellular water homeostasis(GO:0009992) |
| 0.7 | 2.0 | GO:1903537 | meiotic cell cycle process involved in oocyte maturation(GO:1903537) regulation of meiotic cell cycle process involved in oocyte maturation(GO:1903538) |
| 0.6 | 11.6 | GO:0001865 | NK T cell differentiation(GO:0001865) |
| 0.6 | 0.6 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.6 | 4.5 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.6 | 3.8 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) |
| 0.6 | 6.3 | GO:0042730 | fibrinolysis(GO:0042730) |
| 0.6 | 1.3 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.6 | 6.8 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.6 | 5.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.6 | 1.8 | GO:0071460 | cellular response to cell-matrix adhesion(GO:0071460) |
| 0.6 | 7.4 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 0.6 | 4.3 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.6 | 2.4 | GO:0097350 | neutrophil clearance(GO:0097350) |
| 0.6 | 2.4 | GO:2000521 | negative regulation of immunological synapse formation(GO:2000521) regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001188) negative regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001189) |
| 0.6 | 4.2 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.6 | 1.8 | GO:1902524 | positive regulation of protein K48-linked ubiquitination(GO:1902524) |
| 0.6 | 1.8 | GO:0003218 | cardiac left ventricle formation(GO:0003218) |
| 0.6 | 15.3 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.6 | 2.4 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.6 | 2.9 | GO:0035026 | leading edge cell differentiation(GO:0035026) |
| 0.6 | 1.7 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.6 | 2.3 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.6 | 2.3 | GO:0043091 | L-arginine import(GO:0043091) arginine import(GO:0090467) |
| 0.6 | 7.4 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.6 | 7.4 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.6 | 10.7 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.6 | 3.3 | GO:0043696 | dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.6 | 1.7 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.5 | 0.5 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.5 | 2.2 | GO:1990839 | response to endothelin(GO:1990839) |
| 0.5 | 2.7 | GO:0000117 | regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.5 | 2.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.5 | 2.6 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.5 | 9.3 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
| 0.5 | 2.6 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.5 | 78.3 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.5 | 3.6 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.5 | 5.1 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.5 | 3.1 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 0.5 | 9.1 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.5 | 7.0 | GO:0010226 | response to lithium ion(GO:0010226) |
| 0.5 | 2.0 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.5 | 16.2 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.5 | 4.9 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.5 | 3.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.5 | 1.5 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.5 | 4.8 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.5 | 3.4 | GO:0006526 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) arginine biosynthetic process(GO:0006526) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.5 | 1.4 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.5 | 1.0 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
| 0.5 | 0.5 | GO:2000410 | regulation of thymocyte migration(GO:2000410) |
| 0.5 | 1.9 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
| 0.5 | 2.4 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.5 | 1.4 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
| 0.5 | 2.8 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.5 | 3.8 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.5 | 0.9 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.5 | 1.4 | GO:2000850 | negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.5 | 1.9 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.5 | 1.4 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.5 | 1.4 | GO:0021934 | hindbrain tangential cell migration(GO:0021934) sensory system development(GO:0048880) |
| 0.5 | 1.4 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
| 0.5 | 1.8 | GO:1900158 | negative regulation of bone mineralization involved in bone maturation(GO:1900158) |
| 0.5 | 1.4 | GO:0090285 | negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.5 | 2.3 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.5 | 10.9 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.5 | 3.2 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.4 | 6.7 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.4 | 0.4 | GO:2000386 | positive regulation of ovarian follicle development(GO:2000386) regulation of antral ovarian follicle growth(GO:2000387) positive regulation of antral ovarian follicle growth(GO:2000388) |
| 0.4 | 1.8 | GO:2000373 | regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.4 | 1.3 | GO:0002780 | antimicrobial peptide biosynthetic process(GO:0002777) antibacterial peptide biosynthetic process(GO:0002780) |
| 0.4 | 3.0 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.4 | 8.2 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.4 | 7.7 | GO:0034030 | coenzyme A biosynthetic process(GO:0015937) nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.4 | 3.0 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.4 | 0.4 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.4 | 1.2 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
| 0.4 | 2.1 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.4 | 1.2 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.4 | 4.9 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.4 | 2.5 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.4 | 5.7 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
| 0.4 | 2.4 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 0.4 | 6.0 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.4 | 2.4 | GO:0071486 | cellular response to light intensity(GO:0071484) cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
| 0.4 | 7.4 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.4 | 2.0 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.4 | 3.1 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.4 | 1.5 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.4 | 3.1 | GO:0046884 | follicle-stimulating hormone secretion(GO:0046884) |
| 0.4 | 1.5 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.4 | 11.1 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 0.4 | 6.1 | GO:0051132 | NK T cell activation(GO:0051132) |
| 0.4 | 8.3 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.4 | 4.4 | GO:0051197 | positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.4 | 0.7 | GO:0060921 | sinoatrial node cell differentiation(GO:0060921) sinoatrial node cell development(GO:0060931) |
| 0.4 | 1.1 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.4 | 16.1 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
| 0.4 | 4.0 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
| 0.4 | 2.5 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.4 | 1.1 | GO:0033189 | response to vitamin A(GO:0033189) |
| 0.4 | 1.1 | GO:0010841 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) circadian sleep/wake cycle, wakefulness(GO:0042746) |
| 0.4 | 0.7 | GO:0032627 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) positive regulation of interleukin-23 production(GO:0032747) |
| 0.4 | 1.1 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
| 0.4 | 1.4 | GO:0002554 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
| 0.4 | 6.0 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.4 | 1.8 | GO:1904180 | negative regulation of membrane depolarization(GO:1904180) |
| 0.3 | 1.7 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.3 | 3.1 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.3 | 10.4 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.3 | 1.4 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.3 | 1.4 | GO:0071988 | regulation of spindle elongation(GO:0032887) regulation of mitotic spindle elongation(GO:0032888) anastral spindle assembly(GO:0055048) protein localization to spindle pole body(GO:0071988) regulation of protein localization to spindle pole body(GO:1902363) positive regulation of protein localization to spindle pole body(GO:1902365) positive regulation of mitotic spindle elongation(GO:1902846) |
| 0.3 | 0.3 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 0.3 | 11.3 | GO:0006767 | water-soluble vitamin metabolic process(GO:0006767) |
| 0.3 | 0.7 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
| 0.3 | 1.0 | GO:1903413 | response to bile acid(GO:1903412) cellular response to bile acid(GO:1903413) |
| 0.3 | 2.3 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.3 | 1.0 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.3 | 3.3 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
| 0.3 | 1.6 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.3 | 3.3 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.3 | 3.6 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.3 | 0.7 | GO:0002304 | gamma-delta intraepithelial T cell differentiation(GO:0002304) CD8-positive, gamma-delta intraepithelial T cell differentiation(GO:0002305) |
| 0.3 | 1.0 | GO:0045402 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
| 0.3 | 1.3 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.3 | 0.6 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.3 | 3.9 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
| 0.3 | 1.9 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.3 | 3.2 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.3 | 8.6 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
| 0.3 | 10.8 | GO:0050819 | negative regulation of coagulation(GO:0050819) |
| 0.3 | 7.9 | GO:1901663 | quinone biosynthetic process(GO:1901663) |
| 0.3 | 3.5 | GO:0006228 | UTP biosynthetic process(GO:0006228) UTP metabolic process(GO:0046051) |
| 0.3 | 19.9 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
| 0.3 | 2.2 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.3 | 0.9 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.3 | 0.9 | GO:0008628 | hormone-mediated apoptotic signaling pathway(GO:0008628) |
| 0.3 | 1.2 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.3 | 2.8 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.3 | 3.6 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.3 | 0.9 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.3 | 0.3 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.3 | 2.4 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.3 | 1.5 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.3 | 2.1 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.3 | 5.6 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.3 | 4.1 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
| 0.3 | 0.3 | GO:0044330 | canonical Wnt signaling pathway involved in positive regulation of wound healing(GO:0044330) |
| 0.3 | 1.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.3 | 0.9 | GO:0045004 | DNA replication proofreading(GO:0045004) |
| 0.3 | 15.4 | GO:0045604 | regulation of epidermal cell differentiation(GO:0045604) |
| 0.3 | 2.3 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.3 | 5.4 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.3 | 2.5 | GO:0006544 | glycine metabolic process(GO:0006544) |
| 0.3 | 0.6 | GO:0070425 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 0.3 | 0.8 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) DNA replication preinitiation complex assembly(GO:0071163) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.3 | 1.1 | GO:1901675 | negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.3 | 1.4 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.3 | 1.9 | GO:0060309 | elastin catabolic process(GO:0060309) |
| 0.3 | 2.2 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.3 | 2.4 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.3 | 1.9 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.3 | 5.3 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.3 | 2.1 | GO:0045759 | negative regulation of action potential(GO:0045759) |
| 0.3 | 1.1 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.3 | 1.1 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 0.3 | 1.6 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.3 | 0.5 | GO:0010511 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) regulation of phosphatidylinositol biosynthetic process(GO:0010511) positive regulation of phosphatidylinositol biosynthetic process(GO:0010513) |
| 0.3 | 1.0 | GO:0033580 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.3 | 4.9 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
| 0.3 | 1.5 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.3 | 1.0 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.3 | 4.8 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.3 | 1.3 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
| 0.3 | 1.0 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.3 | 1.3 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.3 | 0.8 | GO:1903722 | regulation of centriole elongation(GO:1903722) |
| 0.3 | 1.8 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.3 | 7.1 | GO:0055090 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.3 | 1.5 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.3 | 1.0 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.3 | 4.0 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.2 | 1.2 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.2 | 1.7 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.2 | 4.2 | GO:0042407 | cristae formation(GO:0042407) |
| 0.2 | 1.2 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.2 | 4.2 | GO:0002385 | mucosal immune response(GO:0002385) |
| 0.2 | 1.2 | GO:1990743 | protein sialylation(GO:1990743) |
| 0.2 | 1.0 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
| 0.2 | 1.4 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.2 | 1.9 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.2 | 1.4 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.2 | 1.9 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
| 0.2 | 0.5 | GO:0051455 | attachment of spindle microtubules to kinetochore involved in homologous chromosome segregation(GO:0051455) microtubule cytoskeleton organization involved in homologous chromosome segregation(GO:0090172) |
| 0.2 | 0.5 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
| 0.2 | 1.2 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.2 | 1.9 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.2 | 1.6 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.2 | 2.6 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.2 | 4.0 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) |
| 0.2 | 1.4 | GO:0003383 | apical constriction(GO:0003383) |
| 0.2 | 0.9 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.2 | 5.9 | GO:0048535 | lymph node development(GO:0048535) |
| 0.2 | 1.1 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 0.2 | 4.5 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.2 | 1.8 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
| 0.2 | 6.6 | GO:0070229 | negative regulation of lymphocyte apoptotic process(GO:0070229) |
| 0.2 | 1.3 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.2 | 3.3 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.2 | 1.3 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.2 | 1.1 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.2 | 1.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.2 | 0.9 | GO:0015793 | glycerol transport(GO:0015793) renal water absorption(GO:0070295) |
| 0.2 | 1.3 | GO:0001980 | regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.2 | 4.6 | GO:0097435 | fibril organization(GO:0097435) |
| 0.2 | 1.3 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.2 | 2.1 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.2 | 0.2 | GO:0060459 | left lung development(GO:0060459) left lung morphogenesis(GO:0060460) |
| 0.2 | 1.5 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.2 | 2.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.2 | 1.0 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.2 | 2.1 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.2 | 4.1 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
| 0.2 | 1.4 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.2 | 0.8 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.2 | 7.8 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.2 | 0.2 | GO:0033624 | negative regulation of integrin activation(GO:0033624) |
| 0.2 | 45.5 | GO:0002377 | immunoglobulin production(GO:0002377) |
| 0.2 | 0.4 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.2 | 0.2 | GO:1902943 | regulation of voltage-gated chloride channel activity(GO:1902941) positive regulation of voltage-gated chloride channel activity(GO:1902943) |
| 0.2 | 1.6 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
| 0.2 | 1.2 | GO:0070162 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) |
| 0.2 | 1.4 | GO:0060768 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.2 | 0.4 | GO:0038096 | immune response-regulating cell surface receptor signaling pathway involved in phagocytosis(GO:0002433) Fc-gamma receptor signaling pathway involved in phagocytosis(GO:0038096) |
| 0.2 | 1.4 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.2 | 1.1 | GO:1902966 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.2 | 4.4 | GO:0008209 | androgen metabolic process(GO:0008209) |
| 0.2 | 1.7 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.2 | 3.0 | GO:1900117 | regulation of execution phase of apoptosis(GO:1900117) |
| 0.2 | 3.6 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
| 0.2 | 4.7 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
| 0.2 | 6.4 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.2 | 0.7 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.2 | 0.9 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 0.2 | 9.2 | GO:0015909 | long-chain fatty acid transport(GO:0015909) |
| 0.2 | 1.8 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.2 | 0.9 | GO:0021557 | oculomotor nerve development(GO:0021557) |
| 0.2 | 2.9 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.2 | 0.9 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.2 | 12.5 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
| 0.2 | 2.0 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.2 | 1.1 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
| 0.2 | 0.7 | GO:0035574 | histone H4-K20 demethylation(GO:0035574) |
| 0.2 | 1.1 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.2 | 0.5 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.2 | 12.4 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.2 | 0.5 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.2 | 5.9 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.2 | 0.5 | GO:0036079 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
| 0.2 | 6.4 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.2 | 1.5 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.2 | 0.7 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
| 0.2 | 1.5 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
| 0.2 | 3.1 | GO:0043584 | nose development(GO:0043584) forebrain morphogenesis(GO:0048853) |
| 0.2 | 0.8 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.2 | 1.6 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.2 | 1.3 | GO:0071028 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.2 | 0.6 | GO:1902269 | positive regulation of polyamine transmembrane transport(GO:1902269) |
| 0.2 | 0.6 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.2 | 1.0 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.2 | 1.0 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.2 | 1.0 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.2 | 1.0 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.2 | 0.5 | GO:0051436 | negative regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051436) regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051439) |
| 0.2 | 1.4 | GO:0008228 | opsonization(GO:0008228) |
| 0.2 | 1.6 | GO:0015747 | urate transport(GO:0015747) |
| 0.2 | 0.6 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.2 | 2.7 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
| 0.2 | 5.5 | GO:0046326 | positive regulation of glucose import(GO:0046326) |
| 0.2 | 2.0 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
| 0.2 | 3.7 | GO:0014823 | response to activity(GO:0014823) |
| 0.2 | 4.3 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.2 | 2.3 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.2 | 1.7 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.2 | 1.5 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
| 0.2 | 0.9 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.2 | 0.5 | GO:0034505 | tooth mineralization(GO:0034505) |
| 0.2 | 6.0 | GO:0010324 | membrane invagination(GO:0010324) |
| 0.1 | 0.9 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.1 | 1.0 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
| 0.1 | 1.8 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 0.1 | 0.6 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
| 0.1 | 1.8 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.1 | 1.2 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.1 | 6.4 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.1 | 4.7 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.1 | 1.7 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 1.7 | GO:0050702 | interleukin-1 beta secretion(GO:0050702) |
| 0.1 | 1.1 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.1 | 1.1 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
| 0.1 | 2.1 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.1 | 1.1 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.1 | 1.1 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 0.1 | 0.4 | GO:0035544 | negative regulation of SNARE complex assembly(GO:0035544) |
| 0.1 | 0.5 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 | 0.7 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
| 0.1 | 0.9 | GO:0060022 | hard palate development(GO:0060022) |
| 0.1 | 1.5 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 | 1.5 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.1 | 2.3 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.1 | 0.5 | GO:0050912 | detection of chemical stimulus involved in sensory perception of taste(GO:0050912) |
| 0.1 | 2.2 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.1 | 5.7 | GO:0071346 | cellular response to interferon-gamma(GO:0071346) |
| 0.1 | 2.2 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
| 0.1 | 0.4 | GO:0043323 | regulation of natural killer cell degranulation(GO:0043321) positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.1 | 0.4 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.1 | 2.1 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
| 0.1 | 0.9 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.1 | 1.4 | GO:0036035 | osteoclast development(GO:0036035) |
| 0.1 | 2.2 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
| 0.1 | 0.5 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.1 | 0.6 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.1 | 0.6 | GO:1903860 | negative regulation of dendrite extension(GO:1903860) |
| 0.1 | 0.1 | GO:1901859 | regulation of mitochondrial DNA replication(GO:0090296) negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.1 | 7.3 | GO:0055088 | lipid homeostasis(GO:0055088) |
| 0.1 | 1.4 | GO:0006213 | pyrimidine nucleoside metabolic process(GO:0006213) |
| 0.1 | 3.1 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
| 0.1 | 0.9 | GO:0007527 | adult somatic muscle development(GO:0007527) |
| 0.1 | 0.6 | GO:0021506 | anterior neuropore closure(GO:0021506) neuropore closure(GO:0021995) |
| 0.1 | 0.4 | GO:0009629 | response to gravity(GO:0009629) |
| 0.1 | 2.7 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.1 | 1.0 | GO:0046520 | sphingoid biosynthetic process(GO:0046520) |
| 0.1 | 0.8 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 | 0.2 | GO:0097503 | sialylation(GO:0097503) |
| 0.1 | 0.3 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.1 | 2.0 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 | 0.9 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.1 | 0.7 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.1 | 1.0 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 | 1.5 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.1 | 0.3 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.1 | 0.2 | GO:1902739 | type I interferon secretion(GO:0072641) interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.1 | 2.5 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
| 0.1 | 1.0 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 | 0.8 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 2.6 | GO:0035634 | response to stilbenoid(GO:0035634) |
| 0.1 | 0.5 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
| 0.1 | 0.6 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.1 | 0.5 | GO:0071718 | sodium-independent icosanoid transport(GO:0071718) |
| 0.1 | 0.7 | GO:0036451 | cap mRNA methylation(GO:0036451) |
| 0.1 | 3.7 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.1 | 0.5 | GO:2001106 | regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.1 | 2.8 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.1 | 1.2 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.1 | 0.3 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.1 | 2.6 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
| 0.1 | 2.5 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.1 | 1.9 | GO:0031295 | T cell costimulation(GO:0031295) |
| 0.1 | 1.1 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.1 | 1.7 | GO:0050892 | intestinal absorption(GO:0050892) |
| 0.1 | 0.8 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.1 | 1.5 | GO:0035455 | response to interferon-alpha(GO:0035455) |
| 0.1 | 6.1 | GO:0015807 | L-amino acid transport(GO:0015807) |
| 0.1 | 1.6 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.1 | 0.3 | GO:0030221 | basophil differentiation(GO:0030221) eosinophil fate commitment(GO:0035854) |
| 0.1 | 0.2 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 | 0.2 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.1 | 0.7 | GO:0070168 | negative regulation of biomineral tissue development(GO:0070168) |
| 0.1 | 0.8 | GO:1901163 | regulation of trophoblast cell migration(GO:1901163) negative regulation of trophoblast cell migration(GO:1901164) |
| 0.1 | 0.5 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.1 | 0.6 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) positive regulation of autophagosome maturation(GO:1901098) |
| 0.1 | 1.4 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.1 | 2.0 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 | 0.2 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.1 | 1.2 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.1 | 0.2 | GO:0035768 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
| 0.1 | 1.6 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.1 | 1.0 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.1 | 0.5 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
| 0.1 | 1.7 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.1 | 3.8 | GO:0030071 | regulation of mitotic metaphase/anaphase transition(GO:0030071) |
| 0.1 | 0.4 | GO:0015669 | gas transport(GO:0015669) |
| 0.1 | 1.8 | GO:0071398 | cellular response to fatty acid(GO:0071398) |
| 0.1 | 0.8 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.1 | 1.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 | 0.3 | GO:0072719 | cellular response to cisplatin(GO:0072719) response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.1 | 0.5 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.1 | 0.7 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.1 | 2.3 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.1 | 1.5 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.3 | GO:1902045 | regulation of Fas signaling pathway(GO:1902044) negative regulation of Fas signaling pathway(GO:1902045) |
| 0.1 | 1.2 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.1 | 0.9 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.1 | 0.4 | GO:0032917 | polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.1 | 0.3 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.1 | 0.6 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 | 0.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 0.7 | GO:0032462 | regulation of protein homooligomerization(GO:0032462) |
| 0.1 | 1.0 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.1 | 1.1 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.1 | 0.5 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 0.1 | 1.0 | GO:0040033 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.1 | 1.4 | GO:0002716 | negative regulation of natural killer cell mediated immunity(GO:0002716) negative regulation of natural killer cell mediated cytotoxicity(GO:0045953) |
| 0.1 | 0.4 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.1 | 0.9 | GO:0060065 | uterus development(GO:0060065) |
| 0.1 | 0.5 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.1 | 0.2 | GO:0034553 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.1 | 0.2 | GO:0038001 | autocrine signaling(GO:0035425) paracrine signaling(GO:0038001) |
| 0.1 | 2.1 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
| 0.1 | 1.9 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.1 | 1.3 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.4 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.1 | 0.3 | GO:0033364 | mast cell secretory granule organization(GO:0033364) protein localization to secretory granule(GO:0033366) protein localization to mast cell secretory granule(GO:0033367) protease localization to mast cell secretory granule(GO:0033368) maintenance of protein location in mast cell secretory granule(GO:0033370) T cell secretory granule organization(GO:0033371) maintenance of protease location in mast cell secretory granule(GO:0033373) protein localization to T cell secretory granule(GO:0033374) protease localization to T cell secretory granule(GO:0033375) maintenance of protein location in T cell secretory granule(GO:0033377) maintenance of protease location in T cell secretory granule(GO:0033379) granzyme B localization to T cell secretory granule(GO:0033380) maintenance of granzyme B location in T cell secretory granule(GO:0033382) |
| 0.1 | 0.8 | GO:0051043 | regulation of membrane protein ectodomain proteolysis(GO:0051043) |
| 0.1 | 1.3 | GO:0019835 | cytolysis(GO:0019835) |
| 0.1 | 0.9 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.1 | 0.8 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.1 | 0.4 | GO:2000124 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.1 | 2.0 | GO:0042130 | negative regulation of T cell proliferation(GO:0042130) |
| 0.1 | 0.4 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.1 | 1.2 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.1 | 0.5 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.1 | 0.3 | GO:2000983 | regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.1 | 2.0 | GO:0035137 | hindlimb morphogenesis(GO:0035137) |
| 0.1 | 1.5 | GO:0022617 | extracellular matrix disassembly(GO:0022617) |
| 0.1 | 0.5 | GO:0006525 | arginine metabolic process(GO:0006525) |
| 0.1 | 0.9 | GO:0030033 | microvillus assembly(GO:0030033) |
| 0.1 | 0.6 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
| 0.1 | 0.7 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 1.1 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
| 0.1 | 0.2 | GO:0060023 | soft palate development(GO:0060023) |
| 0.1 | 1.5 | GO:0051567 | histone H3-K9 methylation(GO:0051567) |
| 0.1 | 0.6 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.1 | 1.8 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.1 | 1.6 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.1 | 0.4 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.1 | 0.4 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.1 | 1.1 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 | 1.2 | GO:0040036 | regulation of fibroblast growth factor receptor signaling pathway(GO:0040036) |
| 0.1 | 4.5 | GO:0006261 | DNA-dependent DNA replication(GO:0006261) |
| 0.1 | 0.2 | GO:0070508 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.1 | 0.2 | GO:0070268 | cornification(GO:0070268) |
| 0.1 | 0.6 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 | 0.8 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.1 | 2.3 | GO:0061028 | establishment of endothelial barrier(GO:0061028) |
| 0.1 | 1.2 | GO:1902175 | regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902175) |
| 0.1 | 2.1 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.1 | 5.8 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
| 0.1 | 0.4 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.1 | 3.3 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
| 0.1 | 0.5 | GO:0045684 | positive regulation of epidermis development(GO:0045684) |
| 0.1 | 0.8 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) |
| 0.1 | 3.4 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.1 | 2.5 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.5 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.1 | 0.2 | GO:1904395 | regulation of synaptic growth at neuromuscular junction(GO:0008582) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 0.1 | 1.1 | GO:0006907 | pinocytosis(GO:0006907) |
| 0.1 | 1.1 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 | 0.5 | GO:0043589 | skin morphogenesis(GO:0043589) |
| 0.1 | 0.4 | GO:0072189 | ureter development(GO:0072189) |
| 0.1 | 0.3 | GO:0016064 | immunoglobulin mediated immune response(GO:0016064) |
| 0.1 | 0.1 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.1 | 0.1 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.1 | 0.8 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.1 | 0.7 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 | 1.1 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.1 | 0.4 | GO:0006833 | water transport(GO:0006833) |
| 0.1 | 0.9 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 | 0.4 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.0 | 0.9 | GO:0006695 | cholesterol biosynthetic process(GO:0006695) |
| 0.0 | 2.8 | GO:0045576 | mast cell activation(GO:0045576) |
| 0.0 | 0.4 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
| 0.0 | 0.3 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.0 | 0.2 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.0 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.0 | 0.3 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 0.4 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
| 0.0 | 0.7 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.0 | 0.4 | GO:0071569 | protein ufmylation(GO:0071569) |
| 0.0 | 1.1 | GO:0043276 | anoikis(GO:0043276) |
| 0.0 | 1.9 | GO:0050810 | regulation of steroid biosynthetic process(GO:0050810) |
| 0.0 | 1.3 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.5 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
| 0.0 | 0.4 | GO:0001516 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.0 | 0.2 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.0 | 0.2 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.0 | 0.9 | GO:0097286 | iron ion import(GO:0097286) |
| 0.0 | 0.7 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 | 2.1 | GO:0045851 | pH reduction(GO:0045851) |
| 0.0 | 0.1 | GO:1990167 | protein K27-linked deubiquitination(GO:1990167) protein K33-linked deubiquitination(GO:1990168) |
| 0.0 | 0.2 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.0 | 7.3 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.0 | 1.3 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.0 | 1.2 | GO:0001938 | positive regulation of endothelial cell proliferation(GO:0001938) |
| 0.0 | 5.0 | GO:0042742 | defense response to bacterium(GO:0042742) |
| 0.0 | 0.3 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.0 | 0.9 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 | 0.4 | GO:1902402 | signal transduction involved in mitotic cell cycle checkpoint(GO:0072413) signal transduction involved in mitotic G1 DNA damage checkpoint(GO:0072431) intracellular signal transduction involved in G1 DNA damage checkpoint(GO:1902400) signal transduction involved in mitotic DNA damage checkpoint(GO:1902402) signal transduction involved in mitotic DNA integrity checkpoint(GO:1902403) |
| 0.0 | 0.0 | GO:2000156 | regulation of retrograde vesicle-mediated transport, Golgi to ER(GO:2000156) |
| 0.0 | 0.2 | GO:0044857 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
| 0.0 | 0.2 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.0 | 0.6 | GO:0030901 | midbrain development(GO:0030901) |
| 0.0 | 0.7 | GO:0010259 | multicellular organism aging(GO:0010259) |
| 0.0 | 0.2 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.0 | 0.1 | GO:0035036 | sperm-egg recognition(GO:0035036) |
| 0.0 | 2.4 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 0.3 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 1.2 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.0 | 0.4 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.0 | 1.3 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
| 0.0 | 0.6 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
| 0.0 | 0.5 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.2 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
| 0.0 | 0.2 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 | 0.6 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
| 0.0 | 0.3 | GO:0006826 | iron ion transport(GO:0006826) |
| 0.0 | 0.3 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.0 | 0.7 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
| 0.0 | 0.1 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
| 0.0 | 0.2 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.4 | GO:0045776 | negative regulation of blood pressure(GO:0045776) |
| 0.0 | 0.2 | GO:0019321 | pentose metabolic process(GO:0019321) |
| 0.0 | 0.6 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.0 | 0.6 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
| 0.0 | 2.4 | GO:0051607 | defense response to virus(GO:0051607) |
| 0.0 | 0.3 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.1 | GO:0015904 | tetracycline transport(GO:0015904) |
| 0.0 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) negative regulation of interleukin-12 secretion(GO:2001183) |
| 0.0 | 0.2 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.2 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.6 | GO:0051384 | response to glucocorticoid(GO:0051384) |
| 0.0 | 0.0 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
| 0.0 | 0.1 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.0 | 0.1 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
| 0.0 | 0.3 | GO:0010596 | negative regulation of endothelial cell migration(GO:0010596) |
| 0.0 | 0.1 | GO:0070894 | transposon integration(GO:0070893) regulation of transposon integration(GO:0070894) negative regulation of transposon integration(GO:0070895) |
| 0.0 | 0.2 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 | 0.8 | GO:0008630 | intrinsic apoptotic signaling pathway in response to DNA damage(GO:0008630) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.3 | GO:0048661 | positive regulation of smooth muscle cell proliferation(GO:0048661) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.3 | 9.9 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 2.4 | 7.2 | GO:0036398 | TCR signalosome(GO:0036398) |
| 2.3 | 6.9 | GO:0061474 | phagolysosome membrane(GO:0061474) |
| 2.0 | 9.9 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 1.8 | 11.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 1.8 | 17.9 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 1.7 | 6.9 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
| 1.7 | 6.6 | GO:0098833 | presynaptic endocytic zone(GO:0098833) presynaptic endocytic zone membrane(GO:0098835) |
| 1.5 | 6.1 | GO:0008623 | CHRAC(GO:0008623) |
| 1.5 | 4.5 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
| 1.5 | 1.5 | GO:0042585 | germinal vesicle(GO:0042585) |
| 1.3 | 10.4 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 1.2 | 14.7 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 1.0 | 9.0 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.9 | 5.5 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.9 | 9.5 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.8 | 2.4 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.8 | 4.0 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.8 | 7.7 | GO:0030478 | actin cap(GO:0030478) |
| 0.8 | 3.8 | GO:0034685 | integrin alphav-beta6 complex(GO:0034685) |
| 0.7 | 2.2 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 0.7 | 9.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.7 | 6.2 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.7 | 4.0 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.7 | 7.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.6 | 3.2 | GO:0034657 | GID complex(GO:0034657) |
| 0.6 | 3.2 | GO:0044307 | dendritic branch(GO:0044307) |
| 0.6 | 2.9 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.6 | 2.9 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.6 | 2.3 | GO:0045273 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.6 | 10.2 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
| 0.6 | 3.3 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.5 | 1.6 | GO:0032998 | Fc receptor complex(GO:0032997) Fc-epsilon receptor I complex(GO:0032998) |
| 0.5 | 5.4 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.5 | 4.8 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.5 | 1.5 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.5 | 2.5 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.5 | 3.8 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.5 | 3.3 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 0.5 | 6.9 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
| 0.5 | 5.4 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.4 | 4.0 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.4 | 1.3 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.4 | 1.3 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.4 | 54.0 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
| 0.4 | 8.7 | GO:0030430 | host cell cytoplasm(GO:0030430) host cell cytoplasm part(GO:0033655) |
| 0.4 | 1.7 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
| 0.4 | 19.9 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.4 | 1.6 | GO:0070722 | Tle3-Aes complex(GO:0070722) |
| 0.4 | 8.4 | GO:0000791 | euchromatin(GO:0000791) |
| 0.4 | 2.8 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.4 | 7.6 | GO:0042627 | chylomicron(GO:0042627) |
| 0.4 | 2.4 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.4 | 1.6 | GO:0035101 | FACT complex(GO:0035101) |
| 0.4 | 1.1 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
| 0.3 | 0.7 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.3 | 3.7 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.3 | 2.8 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.3 | 0.9 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.3 | 2.7 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.3 | 2.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.3 | 0.9 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 0.3 | 1.8 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.3 | 1.5 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.3 | 0.8 | GO:0036387 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.3 | 1.4 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 0.3 | 1.6 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.3 | 0.8 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.3 | 10.7 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.3 | 1.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.2 | 1.2 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.2 | 4.1 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.2 | 4.6 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.2 | 4.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.2 | 0.7 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.2 | 30.8 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.2 | 1.5 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.2 | 2.4 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.2 | 7.0 | GO:0045120 | pronucleus(GO:0045120) |
| 0.2 | 1.1 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.2 | 5.3 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.2 | 0.6 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.2 | 2.2 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.2 | 25.9 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.2 | 42.5 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.2 | 0.6 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.2 | 1.0 | GO:0002142 | stereocilia ankle link complex(GO:0002142) USH2 complex(GO:1990696) |
| 0.2 | 0.6 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.2 | 13.3 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.2 | 1.3 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.2 | 1.8 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.2 | 23.4 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.2 | 10.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.2 | 2.3 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.2 | 5.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.2 | 2.1 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.2 | 1.2 | GO:0098553 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
| 0.2 | 5.1 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.2 | 0.5 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.2 | 1.5 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.2 | 2.6 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.2 | 2.4 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.2 | 1.4 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.2 | 2.4 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.2 | 1.1 | GO:0072487 | MSL complex(GO:0072487) |
| 0.2 | 1.2 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.2 | 5.0 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.2 | 1.4 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.2 | 1.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.1 | 15.7 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.1 | 2.7 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.1 | 9.5 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 0.9 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.1 | 2.3 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.1 | 0.7 | GO:0031429 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
| 0.1 | 1.4 | GO:0043219 | lateral loop(GO:0043219) |
| 0.1 | 1.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 24.6 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
| 0.1 | 0.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.1 | 1.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.1 | 0.8 | GO:0000235 | astral microtubule(GO:0000235) |
| 0.1 | 4.6 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.1 | 5.0 | GO:0043034 | costamere(GO:0043034) |
| 0.1 | 1.9 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 1.5 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.1 | 0.6 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.1 | 6.5 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 1.0 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 5.8 | GO:0002102 | podosome(GO:0002102) |
| 0.1 | 0.5 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 2.6 | GO:0005605 | basal lamina(GO:0005605) |
| 0.1 | 1.5 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.1 | 7.9 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.1 | 9.9 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.1 | 1.9 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.1 | 0.7 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.1 | 21.3 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.1 | 1.0 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.1 | 1.2 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.1 | 0.8 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 0.5 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 1.9 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.1 | 3.7 | GO:0005901 | caveola(GO:0005901) |
| 0.1 | 3.0 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.1 | 1.0 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.1 | 1.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 38.2 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.1 | 6.0 | GO:0030118 | clathrin coat(GO:0030118) |
| 0.1 | 7.4 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.1 | 1.3 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 3.0 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.1 | 1.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.1 | 0.5 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 0.5 | GO:0005655 | ribonuclease MRP complex(GO:0000172) nucleolar ribonuclease P complex(GO:0005655) |
| 0.1 | 1.2 | GO:0090543 | Flemming body(GO:0090543) |
| 0.1 | 0.5 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 5.5 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 0.3 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 0.8 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.1 | 1.5 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 1.1 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.1 | 2.0 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.1 | 0.9 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 2.6 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.1 | 1.8 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.1 | 4.5 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.1 | 2.3 | GO:0005604 | basement membrane(GO:0005604) |
| 0.1 | 2.3 | GO:0031312 | extrinsic component of organelle membrane(GO:0031312) |
| 0.1 | 7.2 | GO:0005811 | lipid particle(GO:0005811) |
| 0.1 | 0.6 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 1.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 0.6 | GO:0071010 | prespliceosome(GO:0071010) |
| 0.1 | 2.0 | GO:0030057 | desmosome(GO:0030057) |
| 0.1 | 1.1 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.1 | 7.0 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.1 | 0.6 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.1 | 2.5 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 1.5 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.1 | 4.3 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.1 | 1.8 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.1 | 1.1 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.1 | 0.5 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 3.9 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.1 | 4.7 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.1 | 0.4 | GO:0000796 | condensin complex(GO:0000796) |
| 0.1 | 9.5 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
| 0.1 | 3.0 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.1 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.1 | GO:0044753 | amphisome(GO:0044753) |
| 0.1 | 4.2 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.1 | 0.8 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 2.6 | GO:0005776 | autophagosome(GO:0005776) |
| 0.1 | 2.0 | GO:0031430 | M band(GO:0031430) |
| 0.1 | 2.4 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 0.9 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.0 | 0.2 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.0 | 0.4 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.5 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 15.0 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.6 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.0 | 13.1 | GO:0016607 | nuclear speck(GO:0016607) |
| 0.0 | 0.2 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 17.0 | GO:0030055 | cell-substrate junction(GO:0030055) |
| 0.0 | 1.1 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.4 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.7 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.0 | 0.4 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 0.3 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.0 | 0.5 | GO:0043218 | compact myelin(GO:0043218) |
| 0.0 | 0.4 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 55.8 | GO:0005615 | extracellular space(GO:0005615) |
| 0.0 | 0.4 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.2 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.4 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.2 | GO:0030666 | endocytic vesicle membrane(GO:0030666) |
| 0.0 | 0.5 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.0 | 2.7 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 38.5 | GO:0005739 | mitochondrion(GO:0005739) |
| 0.0 | 0.5 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 1.7 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 1.2 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.0 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.0 | 0.6 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.6 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
| 0.0 | 0.2 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 20.4 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
| 0.0 | 0.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.0 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.0 | 0.2 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.0 | 0.4 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
| 0.0 | 3.9 | GO:0009986 | cell surface(GO:0009986) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 5.4 | 21.7 | GO:0005118 | sevenless binding(GO:0005118) |
| 4.4 | 13.3 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 3.0 | 14.9 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
| 2.9 | 14.5 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 2.7 | 10.7 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 2.5 | 12.3 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 2.3 | 6.8 | GO:0032394 | MHC class Ib receptor activity(GO:0032394) |
| 2.2 | 11.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 2.2 | 6.5 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 2.1 | 12.6 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 2.1 | 10.3 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 2.0 | 10.1 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
| 1.7 | 12.1 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 1.7 | 6.6 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
| 1.6 | 4.8 | GO:0045030 | UTP-activated nucleotide receptor activity(GO:0045030) |
| 1.6 | 9.5 | GO:0004883 | glucocorticoid receptor activity(GO:0004883) transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 1.6 | 1.6 | GO:1902121 | lithocholic acid binding(GO:1902121) |
| 1.5 | 18.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 1.5 | 4.5 | GO:0042497 | triacyl lipopeptide binding(GO:0042497) |
| 1.5 | 4.5 | GO:0004454 | ketohexokinase activity(GO:0004454) |
| 1.5 | 4.4 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 1.4 | 5.5 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 1.3 | 7.9 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 1.3 | 3.9 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 1.3 | 3.8 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
| 1.2 | 3.7 | GO:0016749 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 1.2 | 9.4 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 1.2 | 5.8 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 1.1 | 3.4 | GO:0070540 | stearic acid binding(GO:0070540) |
| 1.1 | 3.4 | GO:0004087 | carbamoyl-phosphate synthase (ammonia) activity(GO:0004087) carbamoyl-phosphate synthase (glutamine-hydrolyzing) activity(GO:0004088) |
| 1.1 | 7.9 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 1.1 | 13.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 1.0 | 12.6 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 1.0 | 4.2 | GO:0005008 | hepatocyte growth factor-activated receptor activity(GO:0005008) |
| 1.0 | 4.1 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 1.0 | 3.0 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 1.0 | 9.9 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 1.0 | 4.8 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 1.0 | 2.9 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 1.0 | 4.8 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 1.0 | 5.7 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.9 | 4.7 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.9 | 2.8 | GO:0004326 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) |
| 0.9 | 2.8 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.9 | 3.6 | GO:0004058 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
| 0.9 | 6.2 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.9 | 14.9 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.9 | 3.5 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.9 | 2.6 | GO:0071820 | N-box binding(GO:0071820) |
| 0.9 | 5.1 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.8 | 6.8 | GO:0005534 | galactose binding(GO:0005534) |
| 0.8 | 2.4 | GO:0050785 | disaccharide binding(GO:0048030) advanced glycation end-product receptor activity(GO:0050785) |
| 0.8 | 2.4 | GO:0005009 | insulin-activated receptor activity(GO:0005009) |
| 0.8 | 3.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.8 | 4.6 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.8 | 3.0 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.8 | 2.3 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
| 0.8 | 3.8 | GO:0015254 | glycerol channel activity(GO:0015254) |
| 0.7 | 3.0 | GO:0031699 | beta-3 adrenergic receptor binding(GO:0031699) |
| 0.7 | 4.4 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
| 0.7 | 8.9 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.7 | 5.2 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 0.7 | 2.2 | GO:0001596 | angiotensin type I receptor activity(GO:0001596) |
| 0.7 | 2.9 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
| 0.7 | 3.6 | GO:0004925 | prolactin receptor activity(GO:0004925) |
| 0.7 | 3.6 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
| 0.7 | 2.1 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
| 0.7 | 2.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.7 | 2.1 | GO:0000402 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
| 0.7 | 23.5 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
| 0.7 | 9.7 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.7 | 4.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.7 | 13.7 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.7 | 7.5 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.7 | 2.0 | GO:0005171 | hepatocyte growth factor receptor binding(GO:0005171) |
| 0.7 | 6.5 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.6 | 2.6 | GO:0070905 | serine binding(GO:0070905) |
| 0.6 | 9.0 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.6 | 3.2 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.6 | 1.3 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.6 | 1.9 | GO:0004968 | gonadotropin-releasing hormone receptor activity(GO:0004968) |
| 0.6 | 7.3 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.6 | 4.2 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.6 | 1.8 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.6 | 1.8 | GO:0019002 | GMP binding(GO:0019002) |
| 0.6 | 22.9 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.6 | 2.4 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.6 | 3.5 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 0.6 | 2.3 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.6 | 2.3 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.6 | 2.3 | GO:0004478 | methionine adenosyltransferase activity(GO:0004478) |
| 0.6 | 11.0 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.6 | 3.4 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
| 0.6 | 4.0 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.6 | 1.7 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.6 | 8.4 | GO:0031432 | titin binding(GO:0031432) |
| 0.6 | 1.7 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.6 | 9.9 | GO:0008430 | selenium binding(GO:0008430) |
| 0.6 | 3.3 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.5 | 7.5 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.5 | 1.6 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.5 | 2.1 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
| 0.5 | 2.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.5 | 2.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.5 | 9.1 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.5 | 2.5 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.5 | 1.5 | GO:0035500 | MH2 domain binding(GO:0035500) |
| 0.5 | 1.9 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.5 | 2.4 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.5 | 5.7 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.5 | 2.4 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
| 0.5 | 1.4 | GO:0016211 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) |
| 0.5 | 3.2 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.4 | 0.9 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.4 | 1.8 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.4 | 2.6 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.4 | 1.3 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
| 0.4 | 1.3 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.4 | 2.6 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.4 | 2.1 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.4 | 109.0 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.4 | 9.2 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.4 | 54.0 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.4 | 3.7 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.4 | 5.3 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.4 | 2.0 | GO:0070287 | ferritin receptor activity(GO:0070287) |
| 0.4 | 1.2 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
| 0.4 | 4.8 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.4 | 2.0 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.4 | 1.2 | GO:0004658 | propionyl-CoA carboxylase activity(GO:0004658) |
| 0.4 | 1.2 | GO:0047057 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.4 | 3.5 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.4 | 2.3 | GO:0032450 | maltose alpha-glucosidase activity(GO:0032450) |
| 0.4 | 1.5 | GO:0047016 | cholest-5-ene-3-beta,7-alpha-diol 3-beta-dehydrogenase activity(GO:0047016) |
| 0.4 | 3.7 | GO:0004579 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.4 | 1.1 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.4 | 16.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.4 | 2.5 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.4 | 2.5 | GO:0001851 | complement component C3b binding(GO:0001851) |
| 0.4 | 5.7 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.4 | 1.1 | GO:0002113 | interleukin-33 binding(GO:0002113) |
| 0.4 | 2.8 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.3 | 2.8 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.3 | 1.7 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 0.3 | 4.8 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.3 | 10.3 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
| 0.3 | 0.7 | GO:0004372 | glycine hydroxymethyltransferase activity(GO:0004372) |
| 0.3 | 5.4 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
| 0.3 | 4.4 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.3 | 4.0 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
| 0.3 | 4.0 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.3 | 1.6 | GO:0019767 | IgE receptor activity(GO:0019767) |
| 0.3 | 8.5 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.3 | 1.9 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.3 | 1.9 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.3 | 1.0 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.3 | 2.9 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.3 | 0.9 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) |
| 0.3 | 7.5 | GO:0005537 | mannose binding(GO:0005537) |
| 0.3 | 6.2 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.3 | 1.8 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.3 | 5.8 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.3 | 0.9 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.3 | 1.5 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.3 | 1.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.3 | 3.2 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.3 | 12.3 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.3 | 1.4 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.3 | 3.4 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.3 | 5.6 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.3 | 4.4 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.3 | 2.2 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.3 | 1.6 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.3 | 1.1 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.3 | 10.0 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.3 | 1.9 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.3 | 2.2 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.3 | 0.3 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.3 | 1.6 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.3 | 1.8 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 0.3 | 5.0 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.3 | 3.7 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.3 | 0.8 | GO:0043426 | MRF binding(GO:0043426) |
| 0.3 | 0.5 | GO:0005457 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.3 | 1.0 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.3 | 15.6 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
| 0.3 | 1.0 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.3 | 4.1 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.3 | 1.8 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.3 | 9.0 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.2 | 0.7 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.2 | 4.2 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.2 | 2.5 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.2 | 1.2 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.2 | 2.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.2 | 1.7 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.2 | 1.9 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.2 | 12.5 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.2 | 1.9 | GO:0036122 | BMP binding(GO:0036122) |
| 0.2 | 1.2 | GO:0005124 | scavenger receptor binding(GO:0005124) |
| 0.2 | 5.8 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.2 | 2.2 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.2 | 2.9 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.2 | 0.4 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.2 | 4.0 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.2 | 4.6 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.2 | 2.4 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.2 | 1.7 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.2 | 1.5 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.2 | 3.9 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.2 | 8.5 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.2 | 3.1 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.2 | 3.1 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.2 | 1.4 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.2 | 11.3 | GO:0097472 | cyclin-dependent protein kinase activity(GO:0097472) |
| 0.2 | 1.0 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.2 | 3.6 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.2 | 1.2 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.2 | 1.4 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.2 | 2.4 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.2 | 5.8 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.2 | 0.6 | GO:0008263 | pyrimidine-specific mismatch base pair DNA N-glycosylase activity(GO:0008263) |
| 0.2 | 2.2 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.2 | 1.0 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.2 | 1.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.2 | 1.7 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.2 | 2.1 | GO:0071253 | connexin binding(GO:0071253) |
| 0.2 | 2.3 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.2 | 8.7 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.2 | 1.3 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.2 | 1.5 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.2 | 2.6 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.2 | 1.5 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.2 | 2.4 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.2 | 7.8 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.2 | 1.6 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.2 | 0.7 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
| 0.2 | 9.4 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
| 0.2 | 0.5 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.2 | 20.0 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.2 | 1.1 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.2 | 0.7 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
| 0.2 | 4.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.2 | 0.5 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.2 | 0.7 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.2 | 1.6 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.2 | 4.9 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.2 | 1.4 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.2 | 0.7 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.2 | 4.7 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.2 | 3.0 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.2 | 1.8 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.2 | 1.8 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.2 | 21.2 | GO:0005178 | integrin binding(GO:0005178) |
| 0.2 | 0.6 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.2 | 2.8 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.2 | 24.8 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.2 | 5.9 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.2 | 1.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.2 | 2.0 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.2 | 3.5 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.2 | 1.2 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.2 | 3.9 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.1 | 3.6 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.1 | 7.8 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.1 | 0.9 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 1.0 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.1 | 1.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 1.5 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.1 | 1.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.1 | 6.9 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.1 | 3.1 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
| 0.1 | 8.8 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.1 | 1.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.1 | 4.7 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.1 | 2.6 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.1 | 3.7 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.1 | 15.5 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.1 | 2.1 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.1 | 1.7 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.1 | 1.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.1 | 0.8 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.1 | 3.5 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.1 | 0.5 | GO:0042008 | interleukin-18 receptor activity(GO:0042008) |
| 0.1 | 1.5 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.1 | 1.6 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.1 | 0.5 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.1 | 1.8 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
| 0.1 | 1.6 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.1 | 1.6 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 1.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 1.3 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.1 | 11.0 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.1 | 12.0 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.1 | 3.4 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.1 | 3.1 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.1 | 0.9 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.1 | 3.4 | GO:0005504 | fatty acid binding(GO:0005504) |
| 0.1 | 1.2 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 5.0 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.1 | 1.1 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.1 | 2.0 | GO:0001614 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
| 0.1 | 0.3 | GO:0035375 | zymogen binding(GO:0035375) |
| 0.1 | 0.3 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
| 0.1 | 1.5 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 1.9 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.1 | 1.7 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
| 0.1 | 0.5 | GO:0004736 | pyruvate carboxylase activity(GO:0004736) |
| 0.1 | 0.8 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 2.3 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.1 | 1.3 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.1 | 0.7 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
| 0.1 | 1.6 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.1 | 2.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.1 | 2.9 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.1 | 0.4 | GO:0019809 | spermidine binding(GO:0019809) |
| 0.1 | 6.2 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.1 | 3.7 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.1 | 0.6 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.1 | 0.8 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 0.2 | GO:0038100 | nodal binding(GO:0038100) |
| 0.1 | 9.4 | GO:0030414 | peptidase inhibitor activity(GO:0030414) |
| 0.1 | 1.0 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.1 | 6.9 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.1 | 3.3 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.1 | 3.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.1 | 0.3 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.1 | 4.1 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 1.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.1 | 4.9 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.1 | 1.6 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 1.1 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.1 | 2.3 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.1 | 1.0 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 2.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 1.0 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 6.3 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.1 | 0.3 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
| 0.1 | 11.8 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.1 | 0.4 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 0.1 | 0.6 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.1 | 0.3 | GO:0097604 | temperature-gated cation channel activity(GO:0097604) |
| 0.1 | 0.5 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.1 | 5.5 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.1 | 0.5 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.1 | 1.3 | GO:0048185 | activin binding(GO:0048185) |
| 0.1 | 0.3 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.1 | 0.6 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.1 | 0.9 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 0.4 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.1 | 4.4 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.1 | 0.2 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
| 0.1 | 0.8 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.1 | 1.6 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.1 | 0.2 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.1 | 1.5 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.1 | 2.3 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.1 | 0.2 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.1 | 7.9 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.1 | 1.9 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 1.2 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.1 | 1.5 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.1 | 0.6 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 5.7 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.1 | 14.8 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.1 | 1.1 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.1 | 1.4 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.1 | 1.3 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.1 | 0.4 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.1 | 0.3 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.1 | 7.1 | GO:0017048 | Rho GTPase binding(GO:0017048) |
| 0.1 | 4.4 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
| 0.1 | 1.5 | GO:0016620 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, NAD or NADP as acceptor(GO:0016620) |
| 0.1 | 0.3 | GO:0047710 | nickel cation binding(GO:0016151) bis(5'-adenosyl)-triphosphatase activity(GO:0047710) |
| 0.1 | 0.4 | GO:0035586 | purinergic receptor activity(GO:0035586) |
| 0.1 | 1.0 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 1.0 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 0.4 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.1 | 0.9 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.1 | 0.7 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.1 | 1.1 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 2.8 | GO:0043531 | ADP binding(GO:0043531) |
| 0.1 | 3.3 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.1 | 1.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 1.1 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.1 | 5.3 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
| 0.1 | 0.7 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.1 | 0.5 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.1 | 3.8 | GO:0016209 | antioxidant activity(GO:0016209) |
| 0.1 | 0.4 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 9.7 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.1 | 0.7 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.0 | 0.3 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.0 | 1.7 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.0 | 0.9 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 1.3 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.0 | 0.7 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.5 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.2 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.0 | 0.4 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.2 | GO:0016316 | phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity(GO:0016316) phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.0 | 0.2 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 0.3 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.4 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.0 | 1.9 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.1 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.0 | 0.3 | GO:0004556 | alpha-amylase activity(GO:0004556) |
| 0.0 | 1.6 | GO:0016651 | oxidoreductase activity, acting on NAD(P)H(GO:0016651) |
| 0.0 | 0.4 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.9 | GO:0043394 | proteoglycan binding(GO:0043394) |
| 0.0 | 0.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 0.2 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.5 | GO:0051378 | serotonin binding(GO:0051378) |
| 0.0 | 3.0 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.0 | 0.4 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 1.5 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.3 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 1.5 | GO:0016836 | hydro-lyase activity(GO:0016836) |
| 0.0 | 2.1 | GO:0008237 | metallopeptidase activity(GO:0008237) |
| 0.0 | 0.6 | GO:0042171 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.0 | 0.5 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.0 | 1.0 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 50.5 | GO:0003677 | DNA binding(GO:0003677) |
| 0.0 | 0.3 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.5 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 1.2 | GO:0015179 | L-amino acid transmembrane transporter activity(GO:0015179) |
| 0.0 | 2.3 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.2 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.0 | 0.4 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.0 | 0.1 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
| 0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.1 | GO:0008493 | tetracycline transporter activity(GO:0008493) |
| 0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.1 | GO:0090079 | translation repressor activity, nucleic acid binding(GO:0000900) translation regulator activity, nucleic acid binding(GO:0090079) |
| 0.0 | 0.1 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 0.2 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.0 | 0.5 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.3 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.0 | 0.4 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.7 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
| 0.0 | 0.6 | GO:0003823 | antigen binding(GO:0003823) |
| 0.0 | 0.3 | GO:0038024 | cargo receptor activity(GO:0038024) |
| 0.0 | 0.2 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.0 | 0.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.0 | 1.0 | GO:0016410 | N-acyltransferase activity(GO:0016410) |
| 0.0 | 0.0 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 29.9 | PID MYC PATHWAY | C-MYC pathway |
| 0.7 | 20.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.6 | 10.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.5 | 12.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.5 | 38.0 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.4 | 6.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.4 | 28.5 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.4 | 11.7 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.4 | 9.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.4 | 22.7 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.4 | 3.4 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.4 | 7.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.4 | 9.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.3 | 10.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.3 | 6.9 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.3 | 3.0 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.3 | 17.4 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.3 | 19.5 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.3 | 8.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.3 | 1.7 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.3 | 17.4 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.3 | 11.4 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.2 | 7.5 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.2 | 3.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.2 | 8.5 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.2 | 4.6 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.2 | 4.5 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.2 | 12.3 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.2 | 15.7 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.2 | 10.8 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.2 | 9.5 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.2 | 1.9 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.2 | 3.8 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.2 | 2.7 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.2 | 8.1 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.2 | 10.8 | PID E2F PATHWAY | E2F transcription factor network |
| 0.2 | 4.1 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.2 | 3.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.1 | 29.9 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.1 | 7.1 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 5.3 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.1 | 5.3 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 34.6 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.1 | 8.6 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.1 | 1.7 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 3.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.1 | 2.0 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.1 | 4.6 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.1 | 7.1 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.1 | 2.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.1 | 2.4 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.1 | 5.3 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.1 | 1.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.1 | 2.3 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.1 | 3.2 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.1 | 0.8 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 1.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.1 | 3.4 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.1 | 0.4 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 1.6 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.1 | 2.1 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.1 | 2.1 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.1 | 1.5 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.1 | 1.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 1.0 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.1 | 1.6 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.1 | 0.7 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.1 | 0.5 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.1 | 1.0 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.1 | 1.2 | PID P73PATHWAY | p73 transcription factor network |
| 0.1 | 1.4 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.1 | 1.0 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 3.0 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 1.5 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 1.0 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 3.9 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 0.4 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.8 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 0.6 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 1.1 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.6 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.7 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.2 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.6 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.8 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.5 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.8 | 5.4 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.8 | 13.3 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.8 | 27.1 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.8 | 23.5 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.8 | 13.5 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.7 | 1.5 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.7 | 12.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.7 | 7.6 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.7 | 19.8 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.6 | 21.5 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.6 | 8.7 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.6 | 2.3 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.6 | 6.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.5 | 9.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.5 | 4.5 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.5 | 19.1 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.5 | 9.3 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.5 | 12.2 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.5 | 6.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.4 | 28.1 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.4 | 6.7 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.4 | 16.6 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.4 | 9.0 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.4 | 4.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.4 | 4.4 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.4 | 2.7 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.4 | 18.9 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.4 | 7.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.4 | 10.6 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.4 | 4.6 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.3 | 2.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.3 | 10.5 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.3 | 1.7 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.3 | 17.1 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.3 | 13.4 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.3 | 4.2 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.3 | 9.7 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.3 | 1.5 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.3 | 4.5 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.3 | 4.5 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.3 | 14.6 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.3 | 4.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.3 | 6.8 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.3 | 7.8 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.3 | 2.4 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.3 | 26.6 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.3 | 11.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.3 | 9.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.3 | 5.7 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.3 | 10.9 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.3 | 5.2 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.3 | 3.8 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.2 | 10.2 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.2 | 4.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.2 | 13.2 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.2 | 1.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.2 | 3.5 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.2 | 2.8 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.2 | 1.3 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
| 0.2 | 0.9 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.2 | 5.5 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.2 | 3.9 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.2 | 5.5 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.2 | 6.8 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.2 | 3.2 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.2 | 10.2 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.2 | 25.7 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.2 | 5.7 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.2 | 4.8 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.2 | 3.0 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.2 | 8.8 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.2 | 3.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.2 | 2.4 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.2 | 0.5 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.2 | 1.3 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.2 | 3.1 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.2 | 2.6 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.2 | 2.9 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.1 | 2.9 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 1.4 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.1 | 1.5 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 9.3 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
| 0.1 | 1.0 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
| 0.1 | 1.9 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.1 | 1.0 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.1 | 28.8 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
| 0.1 | 4.4 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 4.1 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.1 | 2.3 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 2.2 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.1 | 5.0 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
| 0.1 | 2.5 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 2.7 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.1 | 3.6 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.1 | 5.7 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.1 | 2.2 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.1 | 1.5 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.1 | 1.1 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.1 | 3.6 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.1 | 4.3 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
| 0.1 | 2.2 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
| 0.1 | 4.9 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.1 | 2.5 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.1 | 2.5 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.1 | 6.7 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.1 | 3.3 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
| 0.1 | 3.7 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.1 | 1.4 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.1 | 1.7 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.1 | 2.7 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
| 0.1 | 1.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.1 | 2.7 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.1 | 0.8 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 8.6 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.1 | 1.1 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 1.1 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 1.6 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.1 | 3.6 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.1 | 1.2 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.1 | 1.3 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 1.0 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 0.9 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 2.0 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.0 | 1.0 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 1.1 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
| 0.0 | 1.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.5 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.0 | 1.7 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.0 | 0.5 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.6 | REACTOME BASE EXCISION REPAIR | Genes involved in Base Excision Repair |
| 0.0 | 0.5 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
| 0.0 | 0.7 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.3 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
| 0.0 | 1.1 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 0.9 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.3 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 0.5 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 1.4 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.0 | 1.9 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.4 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.1 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 0.8 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.4 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.2 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.0 | 0.2 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.0 | 0.9 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
| 0.0 | 0.6 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
| 0.0 | 0.2 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |