PRJNA375882: Comprehensive Mouse Transcriptomic BodyMap
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Foxj3
|
ENSMUSG00000032998.17 | Foxj3 |
|
Tbl1xr1
|
ENSMUSG00000027630.14 | Tbl1xr1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Foxj3 | mm39_v1_chr4_+_119397710_119397732 | -0.47 | 3.8e-05 | Click! |
| Tbl1xr1 | mm39_v1_chr3_+_22130994_22131103 | -0.17 | 1.4e-01 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr6_-_70094604 | 23.01 |
ENSMUST00000103378.3
|
Igkv8-30
|
immunoglobulin kappa chain variable 8-30 |
| chr16_-_18884431 | 22.62 |
ENSMUST00000200235.2
|
Iglc3
|
immunoglobulin lambda constant 3 |
| chr16_-_18904240 | 19.26 |
ENSMUST00000103746.3
|
Iglv1
|
immunoglobulin lambda variable 1 |
| chr10_-_111833138 | 18.75 |
ENSMUST00000074805.12
|
Glipr1
|
GLI pathogenesis-related 1 (glioma) |
| chr1_+_163889551 | 18.22 |
ENSMUST00000192047.6
ENSMUST00000027871.13 |
Sell
|
selectin, lymphocyte |
| chr6_+_67838100 | 17.86 |
ENSMUST00000200586.2
ENSMUST00000103309.3 |
Igkv17-127
|
immunoglobulin kappa variable 17-127 |
| chr7_-_100164007 | 17.50 |
ENSMUST00000207405.2
|
Dnajb13
|
DnaJ heat shock protein family (Hsp40) member B13 |
| chr1_+_163889713 | 16.84 |
ENSMUST00000097491.10
|
Sell
|
selectin, lymphocyte |
| chr6_-_69584812 | 16.13 |
ENSMUST00000103359.3
|
Igkv4-55
|
immunoglobulin kappa variable 4-55 |
| chr6_-_70292451 | 15.57 |
ENSMUST00000103387.3
|
Igkv8-21
|
immunoglobulin kappa variable 8-21 |
| chr13_+_19528728 | 15.48 |
ENSMUST00000179181.3
|
Trgc4
|
T cell receptor gamma, constant 4 |
| chr6_+_41155309 | 15.31 |
ENSMUST00000103276.3
|
Trbv19
|
T cell receptor beta, variable 19 |
| chr7_+_126895463 | 14.90 |
ENSMUST00000106306.9
ENSMUST00000120857.8 |
Itgal
|
integrin alpha L |
| chrX_-_106992042 | 14.59 |
ENSMUST00000101290.2
ENSMUST00000155294.2 |
Wmp
|
WAVE homology in membrane protrusions |
| chr6_+_78347636 | 14.53 |
ENSMUST00000204873.3
|
Reg3b
|
regenerating islet-derived 3 beta |
| chrX_+_149330371 | 14.44 |
ENSMUST00000066337.13
ENSMUST00000112715.2 |
Alas2
|
aminolevulinic acid synthase 2, erythroid |
| chr6_+_68247469 | 14.11 |
ENSMUST00000103321.3
|
Igkv1-110
|
immunoglobulin kappa variable 1-110 |
| chr1_+_173458458 | 13.84 |
ENSMUST00000056071.13
|
Ifi209
|
interferon activated gene 209 |
| chr3_+_51568625 | 13.82 |
ENSMUST00000159554.7
ENSMUST00000161590.4 |
Mgst2
|
microsomal glutathione S-transferase 2 |
| chr10_+_79722081 | 13.75 |
ENSMUST00000046091.7
|
Elane
|
elastase, neutrophil expressed |
| chr6_-_69553484 | 13.62 |
ENSMUST00000103357.4
|
Igkv4-57
|
immunoglobulin kappa variable 4-57 |
| chr3_-_101195213 | 13.52 |
ENSMUST00000029456.5
|
Cd2
|
CD2 antigen |
| chr17_+_34524841 | 13.40 |
ENSMUST00000235530.2
|
H2-Eb1
|
histocompatibility 2, class II antigen E beta |
| chr6_+_41095752 | 13.29 |
ENSMUST00000103269.3
|
Trbv12-2
|
T cell receptor beta, variable 12-2 |
| chr6_+_129374441 | 13.26 |
ENSMUST00000112081.9
ENSMUST00000112079.3 |
Clec1b
|
C-type lectin domain family 1, member b |
| chr6_+_41248311 | 13.23 |
ENSMUST00000103281.3
|
Trbv29
|
T cell receptor beta, variable 29 |
| chr6_-_69626340 | 13.12 |
ENSMUST00000198328.2
|
Igkv4-53
|
immunoglobulin kappa variable 4-53 |
| chr6_-_68713748 | 12.71 |
ENSMUST00000183936.2
ENSMUST00000196863.2 |
Igkv19-93
|
immunoglobulin kappa chain variable 19-93 |
| chr9_+_44893077 | 12.69 |
ENSMUST00000034602.9
|
Cd3d
|
CD3 antigen, delta polypeptide |
| chr6_+_41107047 | 12.66 |
ENSMUST00000103271.2
|
Trbv13-3
|
T cell receptor beta, variable 13-3 |
| chr3_+_51568588 | 12.51 |
ENSMUST00000099106.10
|
Mgst2
|
microsomal glutathione S-transferase 2 |
| chrX_+_106299484 | 12.50 |
ENSMUST00000101294.9
ENSMUST00000118820.8 ENSMUST00000120971.8 |
Gpr174
|
G protein-coupled receptor 174 |
| chr6_+_70648743 | 12.40 |
ENSMUST00000103401.3
|
Igkv3-4
|
immunoglobulin kappa variable 3-4 |
| chr4_-_44710408 | 12.38 |
ENSMUST00000134968.9
ENSMUST00000173821.8 ENSMUST00000174319.8 ENSMUST00000173733.8 ENSMUST00000172866.8 ENSMUST00000165417.9 ENSMUST00000107825.9 ENSMUST00000102932.10 ENSMUST00000107827.9 ENSMUST00000107826.9 ENSMUST00000014174.14 |
Pax5
|
paired box 5 |
| chr3_-_90603013 | 12.36 |
ENSMUST00000069960.12
ENSMUST00000117167.2 |
S100a9
|
S100 calcium binding protein A9 (calgranulin B) |
| chr5_-_121045568 | 12.28 |
ENSMUST00000080322.8
|
Oas1a
|
2'-5' oligoadenylate synthetase 1A |
| chr1_+_174000304 | 12.25 |
ENSMUST00000027817.8
|
Spta1
|
spectrin alpha, erythrocytic 1 |
| chr11_-_6470918 | 12.17 |
ENSMUST00000003459.4
|
Myo1g
|
myosin IG |
| chr6_-_69741999 | 11.97 |
ENSMUST00000103365.3
|
Igkv12-46
|
immunoglobulin kappa variable 12-46 |
| chr6_-_70121150 | 11.93 |
ENSMUST00000197525.2
|
Igkv8-28
|
immunoglobulin kappa variable 8-28 |
| chr6_-_70149254 | 11.87 |
ENSMUST00000197272.2
|
Igkv8-27
|
immunoglobulin kappa chain variable 8-27 |
| chr7_+_126895423 | 11.87 |
ENSMUST00000117762.8
|
Itgal
|
integrin alpha L |
| chr6_-_69704122 | 11.73 |
ENSMUST00000103364.3
|
Igkv5-48
|
immunoglobulin kappa variable 5-48 |
| chr10_+_115653152 | 11.67 |
ENSMUST00000080630.11
ENSMUST00000179196.3 ENSMUST00000035563.15 |
Tspan8
|
tetraspanin 8 |
| chr6_-_69415741 | 11.58 |
ENSMUST00000103354.3
|
Igkv4-59
|
immunoglobulin kappa variable 4-59 |
| chr16_-_19079594 | 11.44 |
ENSMUST00000103752.3
ENSMUST00000197518.2 |
Iglv2
|
immunoglobulin lambda variable 2 |
| chr6_-_70051586 | 11.44 |
ENSMUST00000103377.3
|
Igkv6-32
|
immunoglobulin kappa variable 6-32 |
| chr6_-_68609426 | 11.21 |
ENSMUST00000103328.3
|
Igkv10-96
|
immunoglobulin kappa variable 10-96 |
| chr6_-_70194405 | 11.13 |
ENSMUST00000103384.2
|
Igkv8-24
|
immunoglobulin kappa chain variable 8-24 |
| chr5_+_34683141 | 11.00 |
ENSMUST00000125817.8
ENSMUST00000067638.14 |
Sh3bp2
|
SH3-domain binding protein 2 |
| chr1_-_138102972 | 10.96 |
ENSMUST00000195533.6
ENSMUST00000183301.8 |
Ptprc
|
protein tyrosine phosphatase, receptor type, C |
| chr6_+_67586695 | 10.96 |
ENSMUST00000103303.3
|
Igkv1-135
|
immunoglobulin kappa variable 1-135 |
| chr5_-_87682972 | 10.92 |
ENSMUST00000120150.2
|
Sult1b1
|
sulfotransferase family 1B, member 1 |
| chr16_+_48692976 | 10.88 |
ENSMUST00000065666.6
|
Retnlg
|
resistin like gamma |
| chr6_-_69245427 | 10.87 |
ENSMUST00000103348.3
|
Igkv4-70
|
immunoglobulin kappa chain variable 4-70 |
| chrX_-_100310959 | 10.77 |
ENSMUST00000135038.2
|
Il2rg
|
interleukin 2 receptor, gamma chain |
| chr6_+_41025217 | 10.70 |
ENSMUST00000103264.3
|
Trbv3
|
T cell receptor beta, variable 3 |
| chr5_-_100710702 | 10.70 |
ENSMUST00000097437.9
|
Plac8
|
placenta-specific 8 |
| chr6_+_129374260 | 10.64 |
ENSMUST00000032262.14
|
Clec1b
|
C-type lectin domain family 1, member b |
| chr5_-_100720063 | 10.62 |
ENSMUST00000031264.12
|
Plac8
|
placenta-specific 8 |
| chr6_-_69800923 | 10.55 |
ENSMUST00000103368.3
|
Igkv5-43
|
immunoglobulin kappa chain variable 5-43 |
| chr7_-_103463120 | 10.50 |
ENSMUST00000098192.4
|
Hbb-bt
|
hemoglobin, beta adult t chain |
| chr3_-_86906591 | 10.39 |
ENSMUST00000063869.11
ENSMUST00000029717.4 |
Cd1d1
|
CD1d1 antigen |
| chr15_+_6673167 | 10.18 |
ENSMUST00000163073.2
|
Fyb
|
FYN binding protein |
| chr6_+_41515152 | 10.16 |
ENSMUST00000103291.2
ENSMUST00000192856.6 |
Trbc1
|
T cell receptor beta, constant region 1 |
| chr6_-_70313491 | 10.15 |
ENSMUST00000103388.4
|
Igkv6-20
|
immunoglobulin kappa variable 6-20 |
| chr17_+_34524884 | 10.08 |
ENSMUST00000074557.11
|
H2-Eb1
|
histocompatibility 2, class II antigen E beta |
| chr6_-_69678271 | 10.06 |
ENSMUST00000103363.2
|
Igkv4-50
|
immunoglobulin kappa variable 4-50 |
| chr16_-_18880821 | 10.03 |
ENSMUST00000200568.2
|
Iglc1
|
immunoglobulin lambda constant 1 |
| chr16_+_36004452 | 9.96 |
ENSMUST00000114858.2
|
Cstdc4
|
cystatin domain containing 4 |
| chr14_-_68819544 | 9.92 |
ENSMUST00000022641.9
|
Adamdec1
|
ADAM-like, decysin 1 |
| chr7_+_100142977 | 9.84 |
ENSMUST00000129324.8
|
Ucp2
|
uncoupling protein 2 (mitochondrial, proton carrier) |
| chr6_-_68887922 | 9.80 |
ENSMUST00000103337.3
|
Igkv4-86
|
immunoglobulin kappa variable 4-86 |
| chr17_+_34482183 | 9.80 |
ENSMUST00000040828.7
ENSMUST00000237342.2 ENSMUST00000237866.2 |
H2-Ab1
|
histocompatibility 2, class II antigen A, beta 1 |
| chrX_-_133483849 | 9.79 |
ENSMUST00000113213.2
ENSMUST00000033617.13 |
Btk
|
Bruton agammaglobulinemia tyrosine kinase |
| chr17_+_44499451 | 9.70 |
ENSMUST00000024755.7
|
Clic5
|
chloride intracellular channel 5 |
| chr2_-_25517945 | 9.68 |
ENSMUST00000028307.9
|
Fcna
|
ficolin A |
| chr6_+_41098273 | 9.65 |
ENSMUST00000103270.4
|
Trbv13-2
|
T cell receptor beta, variable 13-2 |
| chr14_+_54198389 | 9.61 |
ENSMUST00000103678.4
|
Trdv2-2
|
T cell receptor delta variable 2-2 |
| chr6_-_69521891 | 9.61 |
ENSMUST00000103356.4
|
Igkv4-57-1
|
immunoglobulin kappa variable 4-57-1 |
| chr2_-_58050494 | 9.58 |
ENSMUST00000028175.7
|
Cytip
|
cytohesin 1 interacting protein |
| chr12_-_113912416 | 9.55 |
ENSMUST00000103464.3
|
Ighv4-1
|
immunoglobulin heavy variable 4-1 |
| chr16_-_45940602 | 9.52 |
ENSMUST00000023336.10
|
Cd96
|
CD96 antigen |
| chr6_-_68840015 | 9.49 |
ENSMUST00000103336.2
|
Igkv1-88
|
immunoglobulin kappa chain variable 1-88 |
| chr9_-_44473146 | 9.48 |
ENSMUST00000215293.2
|
Cxcr5
|
chemokine (C-X-C motif) receptor 5 |
| chr12_-_114140482 | 9.35 |
ENSMUST00000103475.2
ENSMUST00000195706.2 |
Ighv14-4
|
immunoglobulin heavy variable 14-4 |
| chr14_+_53093071 | 9.31 |
ENSMUST00000181038.3
ENSMUST00000187138.2 |
Trav14d-1
|
T cell receptor alpha variable 14D-1 |
| chr10_-_88520877 | 9.28 |
ENSMUST00000138734.2
|
Spic
|
Spi-C transcription factor (Spi-1/PU.1 related) |
| chr12_-_113860566 | 9.26 |
ENSMUST00000103474.5
|
Ighv7-1
|
immunoglobulin heavy variable 7-1 |
| chrX_+_106132055 | 9.19 |
ENSMUST00000150494.2
|
P2ry10
|
purinergic receptor P2Y, G-protein coupled 10 |
| chr6_+_41039255 | 9.17 |
ENSMUST00000103266.3
|
Trbv5
|
T cell receptor beta, variable 5 |
| chr1_-_138103021 | 9.15 |
ENSMUST00000182755.8
ENSMUST00000193650.2 ENSMUST00000182283.8 |
Ptprc
|
protein tyrosine phosphatase, receptor type, C |
| chr6_-_68887957 | 9.11 |
ENSMUST00000200454.2
|
Igkv4-86
|
immunoglobulin kappa variable 4-86 |
| chr4_-_155013002 | 9.08 |
ENSMUST00000152687.8
ENSMUST00000137803.8 ENSMUST00000145296.2 |
Tnfrsf14
|
tumor necrosis factor receptor superfamily, member 14 (herpesvirus entry mediator) |
| chr6_-_41681273 | 9.06 |
ENSMUST00000031899.14
|
Kel
|
Kell blood group |
| chr1_+_85503397 | 9.05 |
ENSMUST00000178024.2
|
G530012D18Rik
|
RIKEN cDNA G530012D1 gene |
| chr13_+_19398273 | 9.03 |
ENSMUST00000103558.3
|
Trgc1
|
T cell receptor gamma, constant 1 |
| chr16_-_19019100 | 9.01 |
ENSMUST00000103749.3
|
Iglc2
|
immunoglobulin lambda constant 2 |
| chr12_-_114398864 | 8.99 |
ENSMUST00000103489.2
|
Ighv6-6
|
immunoglobulin heavy variable 6-6 |
| chr13_-_20008397 | 8.96 |
ENSMUST00000222664.2
ENSMUST00000065335.3 |
Gpr141
|
G protein-coupled receptor 141 |
| chr6_+_129568745 | 8.88 |
ENSMUST00000032268.14
ENSMUST00000112063.9 ENSMUST00000119520.8 |
Klrd1
|
killer cell lectin-like receptor, subfamily D, member 1 |
| chr9_+_123603605 | 8.87 |
ENSMUST00000180093.2
|
Ccr9
|
chemokine (C-C motif) receptor 9 |
| chrX_+_8137620 | 8.84 |
ENSMUST00000033512.11
|
Slc38a5
|
solute carrier family 38, member 5 |
| chr5_+_86219593 | 8.74 |
ENSMUST00000198435.5
ENSMUST00000031171.9 |
Stap1
|
signal transducing adaptor family member 1 |
| chr6_-_69835868 | 8.73 |
ENSMUST00000103369.2
|
Igkv12-41
|
immunoglobulin kappa chain variable 12-41 |
| chr1_+_130793406 | 8.70 |
ENSMUST00000038829.7
|
Fcmr
|
Fc fragment of IgM receptor |
| chr16_+_32555015 | 8.68 |
ENSMUST00000239554.1
|
Muc4
|
mucin 4 |
| chr19_-_20368029 | 8.64 |
ENSMUST00000235280.2
|
Anxa1
|
annexin A1 |
| chr10_-_117128763 | 8.61 |
ENSMUST00000092162.7
|
Lyz1
|
lysozyme 1 |
| chr6_-_67919524 | 8.57 |
ENSMUST00000196768.2
|
Igkv9-124
|
immunoglobulin kappa chain variable 9-124 |
| chr12_-_114012399 | 8.54 |
ENSMUST00000103468.3
|
Ighv11-2
|
immunoglobulin heavy variable V11-2 |
| chr6_+_41024260 | 8.36 |
ENSMUST00000103263.3
|
Trbv2
|
T cell receptor beta, variable 2 |
| chr6_+_68414401 | 8.33 |
ENSMUST00000103324.3
|
Igkv15-103
|
immunoglobulin kappa chain variable 15-103 |
| chr17_+_34362281 | 8.32 |
ENSMUST00000236519.2
|
H2-DMb2
|
histocompatibility 2, class II, locus Mb2 |
| chr8_+_22145796 | 8.21 |
ENSMUST00000079528.6
|
Defa17
|
defensin, alpha, 17 |
| chr6_-_70318437 | 8.21 |
ENSMUST00000196599.2
|
Igkv8-19
|
immunoglobulin kappa variable 8-19 |
| chr12_-_75678092 | 8.18 |
ENSMUST00000238938.2
|
Rplp2-ps1
|
ribosomal protein, large P2, pseudogene 1 |
| chr6_+_48715971 | 8.18 |
ENSMUST00000054368.7
ENSMUST00000140054.3 ENSMUST00000204168.2 ENSMUST00000204408.2 |
Gimap1
Gm28053
|
GTPase, IMAP family member 1 predicted gene, 28053 |
| chr7_-_3848050 | 8.18 |
ENSMUST00000108615.10
ENSMUST00000119469.2 |
Pira2
|
paired-Ig-like receptor A2 |
| chr12_-_114487525 | 8.17 |
ENSMUST00000103495.3
|
Ighv10-3
|
immunoglobulin heavy variable V10-3 |
| chr15_+_79779218 | 8.14 |
ENSMUST00000023054.14
|
Apobec3
|
apolipoprotein B mRNA editing enzyme, catalytic polypeptide 3 |
| chr11_-_46280336 | 8.10 |
ENSMUST00000020664.13
|
Itk
|
IL2 inducible T cell kinase |
| chr10_+_51356728 | 8.09 |
ENSMUST00000102894.6
ENSMUST00000219661.2 ENSMUST00000219696.2 ENSMUST00000217706.2 |
Lilr4b
Gm49339
|
leukocyte immunoglobulin-like receptor, subfamily B, member 4B predicted gene, 49339 |
| chr6_-_70116066 | 8.08 |
ENSMUST00000103379.3
ENSMUST00000197371.2 |
Igkv6-29
|
immunoglobulin kappa chain variable 6-29 |
| chr5_+_115061293 | 8.06 |
ENSMUST00000031540.11
ENSMUST00000112143.4 |
Oasl1
|
2'-5' oligoadenylate synthetase-like 1 |
| chr12_-_113802603 | 8.04 |
ENSMUST00000103458.3
ENSMUST00000193652.2 |
Ighv5-16
|
immunoglobulin heavy variable 5-16 |
| chr7_-_103477126 | 8.02 |
ENSMUST00000023934.8
|
Hbb-bs
|
hemoglobin, beta adult s chain |
| chr16_-_19060440 | 8.02 |
ENSMUST00000103751.3
|
Iglv3
|
immunoglobulin lambda variable 3 |
| chr3_-_144638284 | 7.98 |
ENSMUST00000098549.4
|
Clca4b
|
chloride channel accessory 4B |
| chr14_+_53404083 | 7.93 |
ENSMUST00000196639.2
ENSMUST00000177578.2 |
Trav14n-1
|
T cell receptor alpha variable 14N-1 |
| chr17_+_35413415 | 7.92 |
ENSMUST00000025262.6
ENSMUST00000173600.2 |
Ltb
|
lymphotoxin B |
| chr10_+_51367052 | 7.91 |
ENSMUST00000217705.2
ENSMUST00000078778.5 ENSMUST00000220182.2 ENSMUST00000220226.2 |
Lilrb4a
|
leukocyte immunoglobulin-like receptor, subfamily B, member 4A |
| chr1_+_40554513 | 7.90 |
ENSMUST00000027237.12
|
Il18rap
|
interleukin 18 receptor accessory protein |
| chr6_-_70036183 | 7.89 |
ENSMUST00000197429.5
ENSMUST00000103376.3 |
Igkv7-33
|
immunoglobulin kappa chain variable 7-33 |
| chrX_-_141749704 | 7.86 |
ENSMUST00000041317.3
|
Ammecr1
|
Alport syndrome, mental retardation, midface hypoplasia and elliptocytosis chromosomal region gene 1 |
| chr17_+_41121979 | 7.84 |
ENSMUST00000024721.8
ENSMUST00000233740.2 |
Rhag
|
Rhesus blood group-associated A glycoprotein |
| chr2_+_84629172 | 7.74 |
ENSMUST00000102642.9
ENSMUST00000150325.2 |
Ube2l6
|
ubiquitin-conjugating enzyme E2L 6 |
| chr11_-_46280298 | 7.72 |
ENSMUST00000109237.9
|
Itk
|
IL2 inducible T cell kinase |
| chr12_-_103409912 | 7.70 |
ENSMUST00000055071.9
|
Ifi27l2a
|
interferon, alpha-inducible protein 27 like 2A |
| chr4_-_11386679 | 7.69 |
ENSMUST00000043781.14
ENSMUST00000108310.8 |
Esrp1
|
epithelial splicing regulatory protein 1 |
| chr17_+_37180437 | 7.66 |
ENSMUST00000060524.11
|
Trim10
|
tripartite motif-containing 10 |
| chr14_-_66071412 | 7.61 |
ENSMUST00000022613.10
|
Esco2
|
establishment of sister chromatid cohesion N-acetyltransferase 2 |
| chr3_+_134918298 | 7.56 |
ENSMUST00000062893.12
|
Cenpe
|
centromere protein E |
| chr7_+_100142544 | 7.54 |
ENSMUST00000126534.8
ENSMUST00000207748.2 |
Ucp2
|
uncoupling protein 2 (mitochondrial, proton carrier) |
| chr1_+_107456731 | 7.53 |
ENSMUST00000182198.8
|
Serpinb10
|
serine (or cysteine) peptidase inhibitor, clade B (ovalbumin), member 10 |
| chr14_+_75373766 | 7.48 |
ENSMUST00000145303.8
|
Lcp1
|
lymphocyte cytosolic protein 1 |
| chr10_-_21036824 | 7.48 |
ENSMUST00000020158.9
|
Myb
|
myeloblastosis oncogene |
| chr5_-_88675700 | 7.45 |
ENSMUST00000087033.6
|
Jchain
|
immunoglobulin joining chain |
| chr12_-_80159768 | 7.44 |
ENSMUST00000219642.2
ENSMUST00000165114.2 ENSMUST00000218835.2 ENSMUST00000021552.3 |
Zfp36l1
|
zinc finger protein 36, C3H type-like 1 |
| chrX_+_8137372 | 7.41 |
ENSMUST00000127103.8
ENSMUST00000115591.8 |
Slc38a5
|
solute carrier family 38, member 5 |
| chr7_+_19699291 | 7.38 |
ENSMUST00000094753.6
|
Ceacam20
|
carcinoembryonic antigen-related cell adhesion molecule 20 |
| chr17_-_34218301 | 7.38 |
ENSMUST00000235463.2
|
H2-K1
|
histocompatibility 2, K1, K region |
| chr6_-_68681962 | 7.38 |
ENSMUST00000103330.2
|
Igkv10-94
|
immunoglobulin kappa variable 10-94 |
| chr8_+_21777425 | 7.37 |
ENSMUST00000098893.4
|
Defa3
|
defensin, alpha, 3 |
| chrX_+_106132840 | 7.36 |
ENSMUST00000118666.8
ENSMUST00000053375.4 |
P2ry10
|
purinergic receptor P2Y, G-protein coupled 10 |
| chr16_+_45430743 | 7.35 |
ENSMUST00000161347.9
ENSMUST00000023339.5 |
Gcsam
|
germinal center associated, signaling and motility |
| chr6_-_69753317 | 7.28 |
ENSMUST00000103366.3
|
Igkv5-45
|
immunoglobulin kappa chain variable 5-45 |
| chr8_+_21681630 | 7.27 |
ENSMUST00000098896.5
|
Defa31
|
defensin, alpha, 31 |
| chr13_+_19524136 | 7.23 |
ENSMUST00000103564.3
|
Trgv1
|
T cell receptor gamma, variable 1 |
| chr6_+_68098030 | 7.22 |
ENSMUST00000103317.3
|
Igkv1-117
|
immunoglobulin kappa variable 1-117 |
| chr6_+_41128636 | 7.18 |
ENSMUST00000103274.4
|
Trbv16
|
T cell receptor beta, variable 16 |
| chr17_-_23864237 | 7.17 |
ENSMUST00000024696.9
|
Mmp25
|
matrix metallopeptidase 25 |
| chrX_-_50235283 | 7.15 |
ENSMUST00000041495.14
|
Mbnl3
|
muscleblind like splicing factor 3 |
| chr3_-_14873406 | 7.15 |
ENSMUST00000181860.8
ENSMUST00000144327.3 |
Car1
|
carbonic anhydrase 1 |
| chr1_-_144651157 | 7.14 |
ENSMUST00000027603.4
|
Rgs18
|
regulator of G-protein signaling 18 |
| chr6_+_41192984 | 7.14 |
ENSMUST00000193997.6
ENSMUST00000103279.3 |
Trbv23
|
T cell receptor beta, variable V23 |
| chr12_-_113958518 | 7.14 |
ENSMUST00000103467.2
|
Ighv14-2
|
immunoglobulin heavy variable 14-2 |
| chr17_-_35424281 | 7.13 |
ENSMUST00000025266.6
|
Lta
|
lymphotoxin A |
| chr6_+_41204430 | 7.09 |
ENSMUST00000193064.2
ENSMUST00000103280.3 |
Trbv26
|
T cell receptor beta, variable 26 |
| chr6_+_48653047 | 7.09 |
ENSMUST00000054050.5
|
Gimap9
|
GTPase, IMAP family member 9 |
| chr17_+_34457868 | 7.09 |
ENSMUST00000095342.11
ENSMUST00000167280.8 ENSMUST00000236838.2 |
H2-Ob
|
histocompatibility 2, O region beta locus |
| chr1_-_173426640 | 7.09 |
ENSMUST00000150649.9
ENSMUST00000180215.2 ENSMUST00000097462.9 |
Ifi213
|
interferon activated gene 213 |
| chr11_+_32233511 | 7.08 |
ENSMUST00000093209.4
|
Hba-a1
|
hemoglobin alpha, adult chain 1 |
| chr6_+_41139948 | 7.06 |
ENSMUST00000103275.4
|
Trbv17
|
T cell receptor beta, variable 17 |
| chr6_-_69204417 | 7.05 |
ENSMUST00000103346.3
|
Igkv4-72
|
immunoglobulin kappa chain variable 4-72 |
| chr7_-_104002534 | 7.04 |
ENSMUST00000130139.3
ENSMUST00000059037.15 |
Trim12c
|
tripartite motif-containing 12C |
| chr1_-_171434882 | 6.99 |
ENSMUST00000111277.2
ENSMUST00000004827.14 |
Ly9
|
lymphocyte antigen 9 |
| chr14_-_56339915 | 6.99 |
ENSMUST00000015583.2
|
Ctsg
|
cathepsin G |
| chr6_-_68994064 | 6.98 |
ENSMUST00000103341.4
|
Igkv4-80
|
immunoglobulin kappa variable 4-80 |
| chr6_+_68279392 | 6.98 |
ENSMUST00000103322.3
|
Igkv2-109
|
immunoglobulin kappa variable 2-109 |
| chr11_+_33996920 | 6.98 |
ENSMUST00000052413.12
|
Lcp2
|
lymphocyte cytosolic protein 2 |
| chr14_+_53878158 | 6.96 |
ENSMUST00000179267.4
|
Trav14-2
|
T cell receptor alpha variable 14-2 |
| chr2_+_174292471 | 6.95 |
ENSMUST00000016399.6
|
Tubb1
|
tubulin, beta 1 class VI |
| chr3_-_106126794 | 6.95 |
ENSMUST00000082219.6
|
Chil4
|
chitinase-like 4 |
| chr6_+_41512480 | 6.91 |
ENSMUST00000103289.2
ENSMUST00000103290.2 ENSMUST00000193061.2 |
Trbj1-6
Trbj1-7
|
T cell receptor beta joining 1-6 T cell receptor beta joining 1-7 |
| chr8_+_21545063 | 6.90 |
ENSMUST00000098899.4
|
Defa23
|
defensin, alpha, 23 |
| chrX_+_111404963 | 6.86 |
ENSMUST00000026602.9
ENSMUST00000113412.3 |
2010106E10Rik
|
RIKEN cDNA 2010106E10 gene |
| chr1_-_45542442 | 6.85 |
ENSMUST00000086430.5
|
Col5a2
|
collagen, type V, alpha 2 |
| chr12_-_113649535 | 6.85 |
ENSMUST00000103449.4
ENSMUST00000195707.3 |
Ighv2-5
|
immunoglobulin heavy variable 2-5 |
| chr7_-_28079678 | 6.84 |
ENSMUST00000051241.7
|
Zfp36
|
zinc finger protein 36 |
| chr10_+_130158737 | 6.84 |
ENSMUST00000217702.2
ENSMUST00000042586.10 ENSMUST00000218605.2 |
Tespa1
|
thymocyte expressed, positive selection associated 1 |
| chr13_-_113237505 | 6.83 |
ENSMUST00000224282.2
ENSMUST00000023897.7 |
Gzma
|
granzyme A |
| chr3_-_10273628 | 6.77 |
ENSMUST00000029041.6
|
Fabp4
|
fatty acid binding protein 4, adipocyte |
| chr15_-_9529898 | 6.73 |
ENSMUST00000228782.2
ENSMUST00000003981.6 |
Il7r
|
interleukin 7 receptor |
| chr17_-_31348576 | 6.71 |
ENSMUST00000024827.5
|
Tff3
|
trefoil factor 3, intestinal |
| chr6_+_142244145 | 6.70 |
ENSMUST00000041993.3
|
Iapp
|
islet amyloid polypeptide |
| chr7_+_24596806 | 6.70 |
ENSMUST00000003469.8
|
Cd79a
|
CD79A antigen (immunoglobulin-associated alpha) |
| chr6_-_69355456 | 6.70 |
ENSMUST00000196595.2
|
Igkv4-63
|
immunoglobulin kappa variable 4-63 |
| chr17_-_32643067 | 6.69 |
ENSMUST00000237130.2
|
Pglyrp2
|
peptidoglycan recognition protein 2 |
| chr1_-_173301492 | 6.69 |
ENSMUST00000169797.2
|
Ifi206
|
interferon activated gene 206 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 8.6 | 25.9 | GO:0002343 | peripheral B cell selection(GO:0002343) B cell affinity maturation(GO:0002344) |
| 7.1 | 28.5 | GO:2000471 | regulation of hematopoietic stem cell migration(GO:2000471) positive regulation of hematopoietic stem cell migration(GO:2000473) |
| 6.0 | 18.0 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
| 5.8 | 17.3 | GO:1904582 | positive regulation of intracellular mRNA localization(GO:1904582) |
| 5.3 | 5.3 | GO:0046136 | positive regulation of vitamin metabolic process(GO:0046136) positive regulation of vitamin D biosynthetic process(GO:0060557) positive regulation of calcidiol 1-monooxygenase activity(GO:0060559) |
| 5.1 | 20.3 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 4.8 | 14.4 | GO:0002305 | gamma-delta intraepithelial T cell differentiation(GO:0002304) CD8-positive, gamma-delta intraepithelial T cell differentiation(GO:0002305) |
| 4.4 | 13.2 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
| 4.3 | 4.3 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 4.2 | 37.8 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 4.1 | 12.4 | GO:0002476 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) |
| 4.1 | 12.3 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
| 4.1 | 12.3 | GO:0030887 | positive regulation of myeloid dendritic cell activation(GO:0030887) |
| 4.1 | 4.1 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 4.0 | 16.1 | GO:0070488 | neutrophil aggregation(GO:0070488) |
| 4.0 | 15.9 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 4.0 | 4.0 | GO:0002442 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
| 3.9 | 15.5 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 3.8 | 11.5 | GO:0033624 | negative regulation of integrin activation(GO:0033624) |
| 3.8 | 11.4 | GO:0002838 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
| 3.7 | 14.7 | GO:0038096 | immune response-regulating cell surface receptor signaling pathway involved in phagocytosis(GO:0002433) Fc-gamma receptor signaling pathway involved in phagocytosis(GO:0038096) |
| 3.7 | 62.6 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 3.7 | 11.0 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 3.5 | 10.6 | GO:0071846 | actin filament debranching(GO:0071846) |
| 3.5 | 3.5 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 3.5 | 7.0 | GO:0035700 | astrocyte chemotaxis(GO:0035700) regulation of astrocyte chemotaxis(GO:2000458) |
| 3.3 | 13.4 | GO:0002484 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 3.3 | 23.3 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 3.2 | 6.4 | GO:1903487 | regulation of lactation(GO:1903487) |
| 3.2 | 16.1 | GO:2000332 | response to linoleic acid(GO:0070543) blood microparticle formation(GO:0072564) regulation of blood microparticle formation(GO:2000332) positive regulation of blood microparticle formation(GO:2000334) |
| 3.2 | 9.5 | GO:1903969 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
| 3.1 | 15.3 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 3.0 | 18.3 | GO:0032831 | positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
| 3.0 | 9.1 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 3.0 | 9.1 | GO:0097350 | neutrophil clearance(GO:0097350) |
| 2.7 | 5.5 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
| 2.7 | 21.8 | GO:0000270 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 2.7 | 10.8 | GO:1900229 | biofilm formation(GO:0042710) single-species biofilm formation(GO:0044010) single-species biofilm formation in or on host organism(GO:0044407) regulation of single-species biofilm formation(GO:1900190) negative regulation of single-species biofilm formation(GO:1900191) regulation of single-species biofilm formation in or on host organism(GO:1900228) negative regulation of single-species biofilm formation in or on host organism(GO:1900229) |
| 2.6 | 34.1 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 2.5 | 7.4 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
| 2.4 | 14.7 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 2.4 | 2.4 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
| 2.4 | 7.3 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 2.4 | 7.1 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 2.3 | 7.0 | GO:0010925 | regulation of inositol-polyphosphate 5-phosphatase activity(GO:0010924) positive regulation of inositol-polyphosphate 5-phosphatase activity(GO:0010925) phospholipase C-inhibiting G-protein coupled receptor signaling pathway(GO:0030845) regulation of cell diameter(GO:0060305) |
| 2.3 | 369.2 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 2.3 | 2.3 | GO:0002777 | antimicrobial peptide biosynthetic process(GO:0002777) antibacterial peptide biosynthetic process(GO:0002780) |
| 2.3 | 6.9 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 2.3 | 9.1 | GO:2000373 | regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 2.3 | 31.9 | GO:0070269 | pyroptosis(GO:0070269) |
| 2.3 | 582.9 | GO:0002377 | immunoglobulin production(GO:0002377) |
| 2.3 | 11.3 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
| 2.2 | 13.3 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
| 2.2 | 4.4 | GO:0050712 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 2.2 | 6.6 | GO:1903632 | positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) |
| 2.1 | 12.8 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 2.1 | 6.4 | GO:0002270 | plasmacytoid dendritic cell activation(GO:0002270) |
| 2.1 | 53.0 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
| 2.1 | 10.6 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 2.1 | 10.5 | GO:0009624 | response to nematode(GO:0009624) |
| 2.1 | 2.1 | GO:0050787 | detoxification of mercury ion(GO:0050787) |
| 2.1 | 4.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 2.0 | 6.1 | GO:0045004 | DNA replication proofreading(GO:0045004) |
| 2.0 | 6.1 | GO:0090673 | endothelial cell-matrix adhesion(GO:0090673) |
| 2.0 | 2.0 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
| 2.0 | 14.2 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 2.0 | 6.1 | GO:1901642 | purine nucleoside transmembrane transport(GO:0015860) nucleoside transmembrane transport(GO:1901642) |
| 2.0 | 6.1 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 2.0 | 12.0 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 2.0 | 6.0 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 2.0 | 6.0 | GO:0070340 | detection of triacyl bacterial lipopeptide(GO:0042495) detection of bacterial lipopeptide(GO:0070340) |
| 2.0 | 9.9 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 2.0 | 2.0 | GO:0002467 | germinal center formation(GO:0002467) |
| 2.0 | 7.8 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 2.0 | 13.7 | GO:0060309 | elastin catabolic process(GO:0060309) |
| 1.9 | 5.7 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
| 1.9 | 3.8 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 1.9 | 17.0 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 1.9 | 1.9 | GO:0043309 | regulation of eosinophil degranulation(GO:0043309) |
| 1.9 | 1.9 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 1.8 | 9.2 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 1.8 | 25.8 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 1.8 | 11.0 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 1.8 | 51.0 | GO:0071624 | positive regulation of granulocyte chemotaxis(GO:0071624) |
| 1.8 | 5.4 | GO:0042694 | muscle cell fate specification(GO:0042694) |
| 1.8 | 22.9 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 1.8 | 21.0 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
| 1.7 | 15.7 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 1.7 | 5.2 | GO:0032701 | negative regulation of granulocyte macrophage colony-stimulating factor production(GO:0032685) negative regulation of interleukin-18 production(GO:0032701) |
| 1.7 | 1.7 | GO:0006067 | ethanol metabolic process(GO:0006067) |
| 1.7 | 6.8 | GO:0071449 | cellular response to lipid hydroperoxide(GO:0071449) |
| 1.7 | 5.1 | GO:0003167 | atrioventricular bundle cell differentiation(GO:0003167) |
| 1.7 | 6.8 | GO:0090096 | lactic acid secretion(GO:0046722) regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 1.7 | 6.8 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 1.7 | 6.8 | GO:0014064 | positive regulation of serotonin secretion(GO:0014064) |
| 1.7 | 5.0 | GO:0070839 | divalent metal ion export(GO:0070839) |
| 1.7 | 21.8 | GO:1903207 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 1.7 | 15.0 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 1.6 | 6.6 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 1.6 | 3.3 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 1.6 | 34.3 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 1.6 | 8.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 1.6 | 4.9 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 1.6 | 4.8 | GO:0060217 | hemangioblast cell differentiation(GO:0060217) |
| 1.6 | 6.4 | GO:0015855 | nucleobase transport(GO:0015851) pyrimidine nucleobase transport(GO:0015855) |
| 1.6 | 1.6 | GO:0048320 | axial mesoderm formation(GO:0048320) |
| 1.6 | 12.6 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 1.6 | 23.5 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 1.6 | 14.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
| 1.6 | 9.4 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 1.6 | 6.2 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 1.6 | 12.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 1.6 | 7.8 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 1.5 | 6.2 | GO:0015801 | aromatic amino acid transport(GO:0015801) tryptophan transport(GO:0015827) |
| 1.5 | 7.7 | GO:0032627 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) positive regulation of interleukin-23 production(GO:0032747) |
| 1.5 | 6.1 | GO:0000915 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 1.5 | 6.1 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
| 1.5 | 4.5 | GO:1901738 | regulation of vitamin A metabolic process(GO:1901738) |
| 1.5 | 4.5 | GO:0002149 | hypochlorous acid metabolic process(GO:0002148) hypochlorous acid biosynthetic process(GO:0002149) |
| 1.5 | 6.0 | GO:0033380 | protein localization to secretory granule(GO:0033366) protein localization to mast cell secretory granule(GO:0033367) protease localization to mast cell secretory granule(GO:0033368) maintenance of protein location in mast cell secretory granule(GO:0033370) T cell secretory granule organization(GO:0033371) maintenance of protease location in mast cell secretory granule(GO:0033373) protein localization to T cell secretory granule(GO:0033374) protease localization to T cell secretory granule(GO:0033375) maintenance of protein location in T cell secretory granule(GO:0033377) maintenance of protease location in T cell secretory granule(GO:0033379) granzyme B localization to T cell secretory granule(GO:0033380) maintenance of granzyme B location in T cell secretory granule(GO:0033382) |
| 1.5 | 25.4 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 1.5 | 10.4 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 1.5 | 3.0 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 1.5 | 5.9 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 1.5 | 3.0 | GO:0061198 | fungiform papilla formation(GO:0061198) |
| 1.5 | 5.9 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 1.5 | 17.7 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
| 1.5 | 13.3 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 1.5 | 8.7 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 1.4 | 39.1 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
| 1.4 | 8.6 | GO:0070944 | neutrophil mediated cytotoxicity(GO:0070942) neutrophil mediated killing of symbiont cell(GO:0070943) neutrophil mediated killing of bacterium(GO:0070944) |
| 1.4 | 2.9 | GO:0098583 | mastication(GO:0071626) learned vocalization behavior(GO:0098583) |
| 1.4 | 2.9 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 1.4 | 21.5 | GO:0010226 | response to lithium ion(GO:0010226) |
| 1.4 | 7.1 | GO:0070495 | regulation of thrombin receptor signaling pathway(GO:0070494) negative regulation of thrombin receptor signaling pathway(GO:0070495) |
| 1.4 | 14.2 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 1.4 | 4.2 | GO:0070175 | positive regulation of enamel mineralization(GO:0070175) |
| 1.4 | 9.8 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) |
| 1.4 | 4.2 | GO:0015688 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 1.4 | 27.6 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 1.4 | 4.1 | GO:0046108 | uridine catabolic process(GO:0006218) uridine metabolic process(GO:0046108) |
| 1.4 | 2.7 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 1.4 | 2.7 | GO:1902524 | positive regulation of protein K48-linked ubiquitination(GO:1902524) |
| 1.4 | 5.4 | GO:0060376 | positive regulation of mast cell differentiation(GO:0060376) |
| 1.4 | 6.8 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
| 1.4 | 2.7 | GO:0002339 | B cell selection(GO:0002339) B cell negative selection(GO:0002352) |
| 1.4 | 5.4 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 1.4 | 1.4 | GO:0060067 | cervix development(GO:0060067) |
| 1.3 | 4.0 | GO:0015825 | L-serine transport(GO:0015825) |
| 1.3 | 6.7 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
| 1.3 | 14.8 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 1.3 | 5.3 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 1.3 | 22.7 | GO:0001865 | NK T cell differentiation(GO:0001865) |
| 1.3 | 5.3 | GO:0002347 | response to tumor cell(GO:0002347) |
| 1.3 | 4.0 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 1.3 | 4.0 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 1.3 | 35.4 | GO:0001562 | response to protozoan(GO:0001562) |
| 1.3 | 2.6 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 1.3 | 22.0 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 1.3 | 1.3 | GO:2000426 | negative regulation of apoptotic cell clearance(GO:2000426) |
| 1.3 | 2.6 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 1.3 | 9.0 | GO:0060558 | regulation of calcidiol 1-monooxygenase activity(GO:0060558) |
| 1.3 | 7.6 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 1.3 | 5.0 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
| 1.3 | 1.3 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 1.3 | 2.5 | GO:0006711 | estrogen catabolic process(GO:0006711) |
| 1.2 | 8.7 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
| 1.2 | 6.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 1.2 | 6.2 | GO:0003409 | optic cup structural organization(GO:0003409) |
| 1.2 | 17.4 | GO:0006968 | cellular defense response(GO:0006968) |
| 1.2 | 6.2 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 1.2 | 3.7 | GO:0015898 | amiloride transport(GO:0015898) cellular response to copper ion starvation(GO:0035874) response to azide(GO:0097184) cellular response to azide(GO:0097185) |
| 1.2 | 7.3 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 1.2 | 7.3 | GO:0009177 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 1.2 | 4.9 | GO:0042125 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 1.2 | 1.2 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 1.2 | 7.3 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 1.2 | 3.6 | GO:0019230 | proprioception(GO:0019230) |
| 1.2 | 6.0 | GO:0097272 | ammonia homeostasis(GO:0097272) |
| 1.2 | 2.4 | GO:0060266 | regulation of respiratory burst involved in inflammatory response(GO:0060264) negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 1.2 | 4.8 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 1.2 | 11.9 | GO:0072672 | neutrophil extravasation(GO:0072672) |
| 1.2 | 9.5 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 1.2 | 4.7 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 1.2 | 1.2 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
| 1.2 | 3.5 | GO:0021570 | rhombomere 4 development(GO:0021570) |
| 1.2 | 2.3 | GO:0032621 | interleukin-18 production(GO:0032621) |
| 1.2 | 3.5 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 1.2 | 10.5 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
| 1.2 | 3.5 | GO:2000295 | regulation of hydrogen peroxide catabolic process(GO:2000295) |
| 1.2 | 1.2 | GO:0060932 | His-Purkinje system cell differentiation(GO:0060932) |
| 1.1 | 3.4 | GO:0032693 | negative regulation of interleukin-10 production(GO:0032693) |
| 1.1 | 5.7 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 1.1 | 4.6 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 1.1 | 4.6 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 1.1 | 20.4 | GO:0015816 | glycine transport(GO:0015816) |
| 1.1 | 5.6 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
| 1.1 | 3.4 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 1.1 | 2.2 | GO:0045358 | negative regulation of interferon-beta biosynthetic process(GO:0045358) |
| 1.1 | 3.3 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
| 1.1 | 1.1 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 1.1 | 4.4 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 1.1 | 5.5 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 1.1 | 2.2 | GO:1901623 | regulation of lymphocyte chemotaxis(GO:1901623) |
| 1.1 | 56.1 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
| 1.1 | 1.1 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) |
| 1.1 | 3.3 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 1.1 | 1.1 | GO:0046021 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 1.1 | 6.4 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 1.1 | 10.7 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
| 1.1 | 1.1 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
| 1.1 | 6.4 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 1.1 | 3.2 | GO:0006583 | melanin biosynthetic process from tyrosine(GO:0006583) |
| 1.1 | 4.2 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 1.0 | 5.2 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 1.0 | 4.2 | GO:0002431 | Fc receptor mediated stimulatory signaling pathway(GO:0002431) |
| 1.0 | 3.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 1.0 | 1.0 | GO:0032242 | regulation of nucleoside transport(GO:0032242) |
| 1.0 | 4.2 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 1.0 | 8.3 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
| 1.0 | 5.2 | GO:0019724 | B cell mediated immunity(GO:0019724) |
| 1.0 | 10.4 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 1.0 | 1.0 | GO:1905204 | negative regulation of connective tissue replacement(GO:1905204) |
| 1.0 | 2.1 | GO:0071608 | macrophage inflammatory protein-1 alpha production(GO:0071608) regulation of macrophage inflammatory protein 1 alpha production(GO:0071640) |
| 1.0 | 2.0 | GO:0048880 | sensory system development(GO:0048880) |
| 1.0 | 2.0 | GO:1902728 | positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 1.0 | 2.0 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 1.0 | 2.0 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
| 1.0 | 4.0 | GO:1900158 | negative regulation of bone mineralization involved in bone maturation(GO:1900158) |
| 1.0 | 3.0 | GO:0030221 | basophil differentiation(GO:0030221) |
| 1.0 | 2.0 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 1.0 | 1.0 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
| 1.0 | 10.0 | GO:0044334 | canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) |
| 1.0 | 1.0 | GO:1990918 | double-strand break repair involved in meiotic recombination(GO:1990918) |
| 1.0 | 2.0 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 1.0 | 6.0 | GO:0072539 | T-helper 17 cell differentiation(GO:0072539) |
| 1.0 | 1.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 1.0 | 7.0 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) |
| 1.0 | 5.0 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
| 1.0 | 10.9 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 1.0 | 4.9 | GO:0031394 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
| 1.0 | 6.9 | GO:0021603 | cranial nerve formation(GO:0021603) |
| 1.0 | 4.9 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 1.0 | 7.8 | GO:0060022 | hard palate development(GO:0060022) |
| 1.0 | 1.0 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 1.0 | 6.8 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 1.0 | 2.0 | GO:0042368 | vitamin D biosynthetic process(GO:0042368) regulation of vitamin D biosynthetic process(GO:0060556) |
| 1.0 | 8.8 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 1.0 | 5.8 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 1.0 | 41.9 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 1.0 | 1.9 | GO:0015867 | ATP transport(GO:0015867) |
| 1.0 | 1.9 | GO:0001878 | response to yeast(GO:0001878) |
| 1.0 | 4.8 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 1.0 | 3.8 | GO:0060697 | positive regulation of phospholipid catabolic process(GO:0060697) |
| 0.9 | 4.7 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.9 | 0.9 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.9 | 8.5 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.9 | 1.9 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.9 | 19.7 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.9 | 1.9 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
| 0.9 | 9.4 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.9 | 6.6 | GO:1904073 | regulation of trophectodermal cell proliferation(GO:1904073) positive regulation of trophectodermal cell proliferation(GO:1904075) |
| 0.9 | 2.8 | GO:0014739 | positive regulation of muscle hyperplasia(GO:0014739) |
| 0.9 | 1.9 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.9 | 12.0 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.9 | 3.7 | GO:0060690 | epithelial cell differentiation involved in salivary gland development(GO:0060690) |
| 0.9 | 16.5 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
| 0.9 | 4.5 | GO:0072733 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.9 | 0.9 | GO:0042262 | DNA protection(GO:0042262) |
| 0.9 | 4.5 | GO:1902336 | positive regulation of retinal ganglion cell axon guidance(GO:1902336) |
| 0.9 | 4.5 | GO:0034371 | chylomicron remodeling(GO:0034371) |
| 0.9 | 0.9 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.9 | 4.5 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
| 0.9 | 6.2 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.9 | 12.5 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
| 0.9 | 2.7 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.9 | 5.3 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.9 | 3.6 | GO:0046898 | response to cycloheximide(GO:0046898) |
| 0.9 | 5.3 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.9 | 8.0 | GO:0090009 | primitive streak formation(GO:0090009) |
| 0.9 | 5.3 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.9 | 3.5 | GO:0002479 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-dependent(GO:0002479) peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 0.9 | 2.6 | GO:1900226 | negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
| 0.9 | 5.3 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.9 | 0.9 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
| 0.9 | 2.6 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.9 | 7.0 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.9 | 9.6 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.9 | 0.9 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.9 | 8.7 | GO:0060099 | regulation of phagocytosis, engulfment(GO:0060099) |
| 0.9 | 2.6 | GO:0002577 | regulation of antigen processing and presentation(GO:0002577) |
| 0.9 | 2.6 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.9 | 4.3 | GO:0032918 | polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.9 | 3.4 | GO:0097017 | renal protein absorption(GO:0097017) |
| 0.8 | 2.5 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.8 | 9.3 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
| 0.8 | 2.5 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.8 | 1.7 | GO:0033686 | positive regulation of gonadotropin secretion(GO:0032278) positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.8 | 6.8 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
| 0.8 | 1.7 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
| 0.8 | 19.4 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.8 | 5.0 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.8 | 4.2 | GO:0046645 | positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
| 0.8 | 0.8 | GO:0060821 | inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.8 | 2.5 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
| 0.8 | 1.7 | GO:0001970 | positive regulation of activation of membrane attack complex(GO:0001970) |
| 0.8 | 7.4 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 0.8 | 3.3 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.8 | 2.5 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.8 | 29.6 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.8 | 4.1 | GO:0009597 | detection of virus(GO:0009597) |
| 0.8 | 9.8 | GO:0035376 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.8 | 4.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.8 | 15.4 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
| 0.8 | 3.2 | GO:0046381 | CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.8 | 7.2 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.8 | 4.0 | GO:0051096 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.8 | 0.8 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.8 | 0.8 | GO:1902164 | positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 0.8 | 4.8 | GO:1903182 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.8 | 1.6 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.8 | 12.7 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
| 0.8 | 6.3 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.8 | 0.8 | GO:0002740 | negative regulation of cytokine secretion involved in immune response(GO:0002740) |
| 0.8 | 1.6 | GO:0035547 | interferon-beta secretion(GO:0035546) regulation of interferon-beta secretion(GO:0035547) positive regulation of interferon-beta secretion(GO:0035549) |
| 0.8 | 3.9 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
| 0.8 | 7.0 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
| 0.8 | 17.9 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.8 | 13.1 | GO:0000737 | DNA catabolic process, endonucleolytic(GO:0000737) |
| 0.8 | 1.5 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.8 | 3.1 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.8 | 3.8 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.8 | 0.8 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.8 | 2.3 | GO:0009804 | coumarin metabolic process(GO:0009804) |
| 0.8 | 2.3 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) positive regulation of reciprocal meiotic recombination(GO:0010845) |
| 0.8 | 2.3 | GO:1904093 | regulation of autophagic cell death(GO:1904092) negative regulation of autophagic cell death(GO:1904093) |
| 0.8 | 0.8 | GO:0061346 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
| 0.7 | 27.7 | GO:0050892 | intestinal absorption(GO:0050892) |
| 0.7 | 2.2 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
| 0.7 | 3.7 | GO:0014901 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
| 0.7 | 7.4 | GO:0043383 | negative T cell selection(GO:0043383) |
| 0.7 | 2.2 | GO:0071938 | vitamin A transport(GO:0071938) vitamin A import(GO:0071939) |
| 0.7 | 3.0 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
| 0.7 | 0.7 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.7 | 1.5 | GO:0002446 | neutrophil mediated immunity(GO:0002446) |
| 0.7 | 7.4 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
| 0.7 | 2.2 | GO:1904456 | negative regulation of neuronal action potential(GO:1904456) |
| 0.7 | 11.7 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.7 | 3.7 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
| 0.7 | 12.4 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.7 | 2.9 | GO:1902490 | regulation of sperm capacitation(GO:1902490) |
| 0.7 | 8.0 | GO:0035655 | interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
| 0.7 | 22.5 | GO:0043029 | T cell homeostasis(GO:0043029) |
| 0.7 | 2.9 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.7 | 4.3 | GO:0097531 | mast cell chemotaxis(GO:0002551) mast cell migration(GO:0097531) |
| 0.7 | 7.2 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.7 | 2.2 | GO:1904733 | negative regulation of electron carrier activity(GO:1904733) regulation of fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:1904735) negative regulation of fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:1904736) |
| 0.7 | 2.1 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.7 | 9.2 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.7 | 4.9 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.7 | 4.9 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.7 | 4.2 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
| 0.7 | 39.1 | GO:0045576 | mast cell activation(GO:0045576) |
| 0.7 | 2.1 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.7 | 3.5 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.7 | 12.4 | GO:0048535 | lymph node development(GO:0048535) |
| 0.7 | 0.7 | GO:0002248 | connective tissue replacement involved in inflammatory response wound healing(GO:0002248) |
| 0.7 | 2.1 | GO:0006238 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) pyrimidine ribonucleotide salvage(GO:0010138) pyrimidine nucleotide salvage(GO:0032262) UMP salvage(GO:0044206) CMP metabolic process(GO:0046035) |
| 0.7 | 4.1 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.7 | 2.1 | GO:0097401 | synaptic vesicle lumen acidification(GO:0097401) |
| 0.7 | 1.4 | GO:0042977 | regulation of activation of JAK2 kinase activity(GO:0010534) activation of JAK2 kinase activity(GO:0042977) negative regulation of activation of JAK2 kinase activity(GO:1902569) |
| 0.7 | 0.7 | GO:0002448 | mast cell mediated immunity(GO:0002448) |
| 0.7 | 3.4 | GO:1990743 | protein sialylation(GO:1990743) |
| 0.7 | 4.8 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
| 0.7 | 0.7 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.7 | 4.0 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
| 0.7 | 4.0 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.7 | 3.3 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.7 | 2.7 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.7 | 4.0 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.7 | 14.6 | GO:0051573 | negative regulation of histone H3-K9 methylation(GO:0051573) |
| 0.7 | 2.0 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
| 0.7 | 4.0 | GO:0046884 | follicle-stimulating hormone secretion(GO:0046884) |
| 0.7 | 1.3 | GO:2000814 | positive regulation of barbed-end actin filament capping(GO:2000814) |
| 0.7 | 2.0 | GO:1901377 | mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) |
| 0.7 | 11.2 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.7 | 6.6 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.7 | 13.8 | GO:0002260 | lymphocyte homeostasis(GO:0002260) |
| 0.7 | 8.5 | GO:0002717 | positive regulation of natural killer cell mediated immunity(GO:0002717) |
| 0.7 | 3.3 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.7 | 2.6 | GO:0061206 | regulation of pronephros size(GO:0035565) hepatoblast differentiation(GO:0061017) mesonephros morphogenesis(GO:0061206) mesonephric nephron development(GO:0061215) mesonephric nephron morphogenesis(GO:0061228) mesenchymal stem cell maintenance involved in mesonephric nephron morphogenesis(GO:0061235) regulation of mesenchymal cell apoptotic process involved in mesonephric nephron morphogenesis(GO:0061295) negative regulation of mesenchymal cell apoptotic process involved in mesonephric nephron morphogenesis(GO:0061296) mesenchymal cell apoptotic process involved in mesonephric nephron morphogenesis(GO:1901146) |
| 0.6 | 0.6 | GO:0046724 | oxalic acid secretion(GO:0046724) |
| 0.6 | 7.1 | GO:0046851 | negative regulation of bone resorption(GO:0045779) negative regulation of bone remodeling(GO:0046851) |
| 0.6 | 2.6 | GO:0002003 | angiotensin maturation(GO:0002003) |
| 0.6 | 1.3 | GO:0046596 | regulation of viral entry into host cell(GO:0046596) |
| 0.6 | 6.5 | GO:0021842 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.6 | 1.3 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.6 | 1.9 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.6 | 3.8 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.6 | 16.7 | GO:0035634 | response to stilbenoid(GO:0035634) |
| 0.6 | 2.6 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.6 | 1.9 | GO:0003218 | cardiac left ventricle formation(GO:0003218) |
| 0.6 | 2.5 | GO:0046618 | drug export(GO:0046618) |
| 0.6 | 0.6 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.6 | 1.3 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
| 0.6 | 3.2 | GO:0050710 | negative regulation of cytokine secretion(GO:0050710) |
| 0.6 | 1.3 | GO:0042362 | fat-soluble vitamin biosynthetic process(GO:0042362) |
| 0.6 | 1.3 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
| 0.6 | 1.9 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.6 | 3.8 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.6 | 1.9 | GO:0002014 | vasoconstriction of artery involved in ischemic response to lowering of systemic arterial blood pressure(GO:0002014) |
| 0.6 | 2.5 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.6 | 0.6 | GO:0021557 | oculomotor nerve development(GO:0021557) |
| 0.6 | 4.3 | GO:0060242 | contact inhibition(GO:0060242) |
| 0.6 | 9.9 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.6 | 3.7 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.6 | 0.6 | GO:0009744 | response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.6 | 1.2 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
| 0.6 | 0.6 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
| 0.6 | 3.1 | GO:0019884 | antigen processing and presentation of exogenous antigen(GO:0019884) |
| 0.6 | 1.8 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.6 | 0.6 | GO:1901536 | negative regulation of DNA demethylation(GO:1901536) |
| 0.6 | 3.0 | GO:0021763 | subthalamic nucleus development(GO:0021763) pulmonary vein morphogenesis(GO:0060577) superior vena cava morphogenesis(GO:0060578) |
| 0.6 | 4.8 | GO:0002360 | T cell lineage commitment(GO:0002360) |
| 0.6 | 0.6 | GO:0050711 | negative regulation of interleukin-1 secretion(GO:0050711) |
| 0.6 | 0.6 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.6 | 1.2 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
| 0.6 | 1.2 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.6 | 7.8 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.6 | 1.2 | GO:1901535 | regulation of DNA demethylation(GO:1901535) |
| 0.6 | 1.2 | GO:0051436 | negative regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051436) regulation of ubiquitin-protein ligase activity involved in mitotic cell cycle(GO:0051439) |
| 0.6 | 1.8 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.6 | 4.7 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.6 | 7.7 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.6 | 1.2 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.6 | 3.5 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.6 | 2.9 | GO:0031061 | negative regulation of histone methylation(GO:0031061) |
| 0.6 | 0.6 | GO:0048817 | negative regulation of hair follicle maturation(GO:0048817) |
| 0.6 | 0.6 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
| 0.6 | 0.6 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.6 | 2.3 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.6 | 0.6 | GO:0090264 | immune complex clearance by monocytes and macrophages(GO:0002436) regulation of immune complex clearance by monocytes and macrophages(GO:0090264) positive regulation of immune complex clearance by monocytes and macrophages(GO:0090265) |
| 0.6 | 2.9 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.6 | 0.6 | GO:0060734 | regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:0060734) |
| 0.6 | 15.7 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 0.6 | 1.7 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.6 | 3.5 | GO:1904627 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.6 | 1.7 | GO:1903920 | positive regulation of actin filament severing(GO:1903920) |
| 0.6 | 0.6 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.6 | 4.1 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.6 | 1.2 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.6 | 4.6 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.6 | 4.0 | GO:0015864 | uridine transport(GO:0015862) pyrimidine nucleoside transport(GO:0015864) |
| 0.6 | 20.2 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
| 0.6 | 9.2 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.6 | 8.0 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.6 | 12.0 | GO:0048525 | negative regulation of viral process(GO:0048525) |
| 0.6 | 0.6 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.6 | 1.7 | GO:0031662 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
| 0.6 | 1.1 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.6 | 8.9 | GO:0001773 | myeloid dendritic cell activation(GO:0001773) |
| 0.6 | 1.7 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.6 | 3.9 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.6 | 3.3 | GO:0001705 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.5 | 4.9 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.5 | 2.2 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
| 0.5 | 1.6 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.5 | 14.8 | GO:0071346 | cellular response to interferon-gamma(GO:0071346) |
| 0.5 | 22.5 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.5 | 3.3 | GO:0019364 | pyridine nucleotide catabolic process(GO:0019364) |
| 0.5 | 3.8 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.5 | 1.6 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
| 0.5 | 3.3 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.5 | 4.4 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.5 | 4.4 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.5 | 2.7 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.5 | 13.0 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.5 | 2.2 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.5 | 4.3 | GO:2001179 | interleukin-10 secretion(GO:0072608) regulation of interleukin-10 secretion(GO:2001179) |
| 0.5 | 5.4 | GO:0009812 | flavonoid metabolic process(GO:0009812) flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
| 0.5 | 1.6 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.5 | 1.1 | GO:0032804 | negative regulation of low-density lipoprotein particle receptor catabolic process(GO:0032804) |
| 0.5 | 4.3 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 0.5 | 3.2 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
| 0.5 | 4.2 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.5 | 3.7 | GO:1900170 | negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 0.5 | 2.6 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
| 0.5 | 1.1 | GO:0097021 | lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.5 | 0.5 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 0.5 | 3.7 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.5 | 3.7 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.5 | 7.3 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
| 0.5 | 2.6 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 0.5 | 4.6 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.5 | 1.0 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.5 | 0.5 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.5 | 1.5 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.5 | 1.0 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.5 | 2.5 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.5 | 5.6 | GO:0032674 | interleukin-5 production(GO:0032634) regulation of interleukin-5 production(GO:0032674) |
| 0.5 | 1.5 | GO:1903778 | protein localization to vacuolar membrane(GO:1903778) |
| 0.5 | 2.0 | GO:0036414 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.5 | 0.5 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.5 | 0.5 | GO:0090320 | regulation of chylomicron remnant clearance(GO:0090320) |
| 0.5 | 2.0 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.5 | 2.5 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.5 | 4.5 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.5 | 5.4 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.5 | 0.5 | GO:0032070 | regulation of deoxyribonuclease activity(GO:0032070) |
| 0.5 | 0.5 | GO:1905072 | cardiac jelly development(GO:1905072) |
| 0.5 | 5.8 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.5 | 2.4 | GO:0034164 | negative regulation of toll-like receptor 9 signaling pathway(GO:0034164) |
| 0.5 | 1.5 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.5 | 3.4 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
| 0.5 | 0.5 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.5 | 1.0 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.5 | 2.4 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.5 | 1.4 | GO:0010767 | regulation of transcription from RNA polymerase II promoter in response to UV-induced DNA damage(GO:0010767) |
| 0.5 | 1.4 | GO:0036245 | cellular response to menadione(GO:0036245) |
| 0.5 | 2.4 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
| 0.5 | 8.5 | GO:0032814 | regulation of natural killer cell activation(GO:0032814) |
| 0.5 | 1.4 | GO:0033306 | phytol metabolic process(GO:0033306) fatty alcohol metabolic process(GO:1903173) |
| 0.5 | 1.9 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.5 | 3.3 | GO:0002507 | tolerance induction(GO:0002507) |
| 0.5 | 6.1 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.5 | 2.3 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
| 0.5 | 1.9 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.5 | 0.5 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.5 | 5.1 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
| 0.5 | 0.9 | GO:0043368 | positive T cell selection(GO:0043368) |
| 0.5 | 2.8 | GO:0032966 | negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) |
| 0.5 | 3.2 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
| 0.5 | 1.4 | GO:1902850 | microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.5 | 4.2 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.5 | 1.8 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.5 | 8.7 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.5 | 2.3 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.5 | 6.9 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.5 | 5.9 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.5 | 0.9 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
| 0.5 | 1.8 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.5 | 9.1 | GO:0019882 | antigen processing and presentation(GO:0019882) |
| 0.5 | 1.8 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.5 | 9.1 | GO:0050830 | defense response to Gram-positive bacterium(GO:0050830) |
| 0.5 | 2.3 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.5 | 0.5 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
| 0.5 | 1.4 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.5 | 2.3 | GO:0071455 | cellular response to hyperoxia(GO:0071455) |
| 0.5 | 1.8 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.5 | 4.1 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.4 | 2.2 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
| 0.4 | 1.8 | GO:0009609 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) |
| 0.4 | 1.3 | GO:2000360 | negative regulation of binding of sperm to zona pellucida(GO:2000360) |
| 0.4 | 2.2 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.4 | 1.8 | GO:0048840 | otolith development(GO:0048840) |
| 0.4 | 1.8 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.4 | 0.9 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.4 | 0.9 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
| 0.4 | 8.3 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.4 | 12.7 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.4 | 4.4 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.4 | 5.6 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.4 | 6.1 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.4 | 1.7 | GO:0002353 | plasma kallikrein-kinin cascade(GO:0002353) |
| 0.4 | 5.2 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.4 | 4.3 | GO:0040033 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.4 | 0.8 | GO:0046292 | formaldehyde metabolic process(GO:0046292) formaldehyde catabolic process(GO:0046294) |
| 0.4 | 3.0 | GO:0072678 | T cell migration(GO:0072678) |
| 0.4 | 2.1 | GO:0007403 | glial cell fate determination(GO:0007403) |
| 0.4 | 1.3 | GO:0046631 | alpha-beta T cell activation(GO:0046631) |
| 0.4 | 3.8 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.4 | 0.4 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.4 | 1.3 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.4 | 5.9 | GO:0019730 | antimicrobial humoral response(GO:0019730) |
| 0.4 | 0.4 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.4 | 0.8 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.4 | 3.7 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.4 | 2.5 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
| 0.4 | 2.5 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.4 | 1.7 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.4 | 1.6 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.4 | 1.2 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.4 | 3.7 | GO:0051546 | keratinocyte migration(GO:0051546) |
| 0.4 | 1.2 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.4 | 0.8 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
| 0.4 | 1.6 | GO:0007522 | visceral muscle development(GO:0007522) |
| 0.4 | 1.6 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.4 | 2.8 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.4 | 1.6 | GO:0034036 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.4 | 11.3 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.4 | 6.0 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.4 | 2.4 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.4 | 1.2 | GO:0060809 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 0.4 | 0.8 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
| 0.4 | 1.2 | GO:0034505 | tooth mineralization(GO:0034505) |
| 0.4 | 4.8 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.4 | 0.8 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.4 | 4.0 | GO:0031272 | regulation of pseudopodium assembly(GO:0031272) |
| 0.4 | 0.4 | GO:0043134 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
| 0.4 | 1.6 | GO:0015788 | UDP-N-acetylglucosamine transport(GO:0015788) |
| 0.4 | 1.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.4 | 2.0 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.4 | 1.6 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.4 | 2.3 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.4 | 1.9 | GO:0006548 | histidine catabolic process(GO:0006548) |
| 0.4 | 0.8 | GO:0072530 | purine-containing compound transmembrane transport(GO:0072530) |
| 0.4 | 3.5 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.4 | 5.0 | GO:0002228 | natural killer cell mediated immunity(GO:0002228) |
| 0.4 | 1.5 | GO:0046060 | dATP metabolic process(GO:0046060) |
| 0.4 | 1.5 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.4 | 2.3 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
| 0.4 | 0.4 | GO:0042088 | T-helper 1 type immune response(GO:0042088) |
| 0.4 | 0.8 | GO:0071288 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) cellular response to mercury ion(GO:0071288) |
| 0.4 | 1.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.4 | 2.3 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.4 | 1.1 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
| 0.4 | 1.5 | GO:0072606 | interleukin-8 secretion(GO:0072606) |
| 0.4 | 5.6 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.4 | 0.4 | GO:0060459 | left lung development(GO:0060459) left lung morphogenesis(GO:0060460) |
| 0.4 | 1.5 | GO:0046086 | adenosine biosynthetic process(GO:0046086) |
| 0.4 | 0.7 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
| 0.4 | 1.5 | GO:0090282 | positive regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0090282) |
| 0.4 | 1.1 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.4 | 1.1 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.4 | 2.6 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.4 | 3.6 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.4 | 2.2 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.4 | 7.2 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.4 | 4.7 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.4 | 3.2 | GO:0036037 | CD8-positive, alpha-beta T cell activation(GO:0036037) |
| 0.4 | 1.8 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.4 | 3.2 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.4 | 1.1 | GO:0040030 | regulation of molecular function, epigenetic(GO:0040030) |
| 0.4 | 0.4 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.4 | 1.4 | GO:0045605 | negative regulation of epidermal cell differentiation(GO:0045605) |
| 0.4 | 1.8 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.4 | 7.0 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.4 | 0.7 | GO:0033189 | response to vitamin A(GO:0033189) |
| 0.4 | 0.7 | GO:1904569 | regulation of selenocysteine incorporation(GO:1904569) |
| 0.3 | 2.1 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
| 0.3 | 0.3 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
| 0.3 | 0.3 | GO:0002254 | kinin cascade(GO:0002254) |
| 0.3 | 0.3 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.3 | 3.4 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.3 | 1.0 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
| 0.3 | 1.0 | GO:0006097 | glyoxylate cycle(GO:0006097) |
| 0.3 | 2.4 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.3 | 0.7 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.3 | 0.7 | GO:0071579 | regulation of zinc ion transport(GO:0071579) |
| 0.3 | 0.3 | GO:0002922 | positive regulation of humoral immune response(GO:0002922) |
| 0.3 | 3.7 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.3 | 1.3 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
| 0.3 | 1.3 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.3 | 2.3 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.3 | 4.0 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) |
| 0.3 | 1.3 | GO:0021615 | glossopharyngeal nerve development(GO:0021563) glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.3 | 4.0 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 0.3 | 1.7 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.3 | 1.7 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.3 | 0.7 | GO:0002407 | dendritic cell chemotaxis(GO:0002407) |
| 0.3 | 5.0 | GO:0070232 | regulation of T cell apoptotic process(GO:0070232) |
| 0.3 | 1.0 | GO:0035872 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) |
| 0.3 | 1.3 | GO:0036367 | adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 0.3 | 3.3 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 0.3 | 1.0 | GO:0006713 | glucocorticoid catabolic process(GO:0006713) |
| 0.3 | 1.3 | GO:0072719 | cellular response to cisplatin(GO:0072719) |
| 0.3 | 0.3 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.3 | 2.0 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.3 | 2.6 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.3 | 1.6 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.3 | 1.0 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.3 | 4.2 | GO:1901739 | regulation of myoblast fusion(GO:1901739) positive regulation of myoblast fusion(GO:1901741) |
| 0.3 | 1.9 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.3 | 1.3 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.3 | 1.3 | GO:0048207 | vesicle coating(GO:0006901) vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.3 | 1.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.3 | 2.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.3 | 0.6 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.3 | 1.3 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.3 | 1.0 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.3 | 3.5 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.3 | 2.2 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.3 | 1.3 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.3 | 1.6 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.3 | 0.3 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.3 | 2.5 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.3 | 1.9 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.3 | 7.2 | GO:0036344 | platelet morphogenesis(GO:0036344) |
| 0.3 | 18.7 | GO:0002250 | adaptive immune response(GO:0002250) |
| 0.3 | 5.0 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.3 | 1.2 | GO:0072738 | response to diamide(GO:0072737) cellular response to diamide(GO:0072738) cellular response to sodium arsenite(GO:1903936) |
| 0.3 | 2.5 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.3 | 1.2 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.3 | 0.6 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.3 | 6.2 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.3 | 1.2 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.3 | 1.9 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.3 | 1.2 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
| 0.3 | 0.9 | GO:2000158 | positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.3 | 0.6 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.3 | 2.2 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.3 | 3.1 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.3 | 8.3 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.3 | 0.9 | GO:0060290 | transdifferentiation(GO:0060290) |
| 0.3 | 1.8 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
| 0.3 | 5.2 | GO:0030539 | male genitalia development(GO:0030539) |
| 0.3 | 2.5 | GO:0060396 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.3 | 0.3 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
| 0.3 | 0.6 | GO:0019323 | pentose catabolic process(GO:0019323) |
| 0.3 | 3.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.3 | 2.8 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
| 0.3 | 1.8 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.3 | 0.9 | GO:0071472 | cellular response to salt stress(GO:0071472) |
| 0.3 | 2.1 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.3 | 3.3 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 0.3 | 1.5 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.3 | 0.6 | GO:0060935 | cardiac fibroblast cell differentiation(GO:0060935) cardiac fibroblast cell development(GO:0060936) epicardium-derived cardiac fibroblast cell differentiation(GO:0060938) epicardium-derived cardiac fibroblast cell development(GO:0060939) negative regulation of vascular smooth muscle cell differentiation(GO:1905064) |
| 0.3 | 1.8 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.3 | 0.6 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
| 0.3 | 0.9 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.3 | 3.0 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 0.3 | 1.8 | GO:0002385 | mucosal immune response(GO:0002385) |
| 0.3 | 3.8 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.3 | 1.5 | GO:0015791 | polyol transport(GO:0015791) |
| 0.3 | 0.6 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.3 | 3.8 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.3 | 2.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.3 | 2.1 | GO:0019659 | glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.3 | 0.6 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.3 | 0.9 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.3 | 0.6 | GO:0032416 | negative regulation of sodium:proton antiporter activity(GO:0032416) |
| 0.3 | 5.8 | GO:0030033 | microvillus assembly(GO:0030033) |
| 0.3 | 0.9 | GO:2000121 | regulation of removal of superoxide radicals(GO:2000121) |
| 0.3 | 0.9 | GO:0032570 | response to progesterone(GO:0032570) |
| 0.3 | 2.3 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.3 | 1.1 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.3 | 2.6 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.3 | 4.6 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
| 0.3 | 0.6 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.3 | 3.4 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.3 | 3.1 | GO:0001765 | membrane raft assembly(GO:0001765) |
| 0.3 | 0.8 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.3 | 4.5 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.3 | 2.2 | GO:0008228 | opsonization(GO:0008228) |
| 0.3 | 6.4 | GO:0048730 | epidermis morphogenesis(GO:0048730) |
| 0.3 | 1.1 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
| 0.3 | 4.2 | GO:0051923 | sulfation(GO:0051923) |
| 0.3 | 1.4 | GO:1903860 | negative regulation of dendrite extension(GO:1903860) |
| 0.3 | 0.8 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.3 | 5.8 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.3 | 0.8 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.3 | 2.5 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.3 | 0.8 | GO:0019541 | acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate metabolic process(GO:0019541) propionate biosynthetic process(GO:0019542) |
| 0.3 | 1.9 | GO:0030101 | natural killer cell activation(GO:0030101) |
| 0.3 | 1.4 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
| 0.3 | 2.4 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.3 | 1.4 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.3 | 1.3 | GO:1902962 | regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902962) negative regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902963) |
| 0.3 | 1.3 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.3 | 0.8 | GO:0006429 | leucyl-tRNA aminoacylation(GO:0006429) |
| 0.3 | 2.1 | GO:0097435 | fibril organization(GO:0097435) |
| 0.3 | 0.8 | GO:0061090 | positive regulation of sequestering of zinc ion(GO:0061090) |
| 0.3 | 2.7 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.3 | 0.8 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.3 | 6.4 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.3 | 1.1 | GO:0038156 | interleukin-3-mediated signaling pathway(GO:0038156) |
| 0.3 | 0.3 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
| 0.3 | 1.1 | GO:1903960 | negative regulation of anion transmembrane transport(GO:1903960) |
| 0.3 | 4.5 | GO:0042119 | neutrophil activation(GO:0042119) |
| 0.3 | 0.5 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
| 0.3 | 1.3 | GO:0009992 | cellular water homeostasis(GO:0009992) |
| 0.3 | 0.3 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
| 0.3 | 0.8 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.3 | 0.3 | GO:1903699 | tarsal gland development(GO:1903699) |
| 0.3 | 1.8 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.3 | 1.0 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.3 | 1.6 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.3 | 0.5 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
| 0.3 | 2.1 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.3 | 1.0 | GO:0090237 | regulation of arachidonic acid secretion(GO:0090237) |
| 0.3 | 6.4 | GO:0070527 | platelet aggregation(GO:0070527) |
| 0.3 | 1.0 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
| 0.3 | 0.8 | GO:0014866 | skeletal myofibril assembly(GO:0014866) skeletal muscle thin filament assembly(GO:0030240) |
| 0.3 | 3.6 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.3 | 1.3 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.3 | 6.3 | GO:0043276 | anoikis(GO:0043276) |
| 0.3 | 0.8 | GO:0006780 | uroporphyrinogen III biosynthetic process(GO:0006780) |
| 0.3 | 0.3 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.2 | 1.2 | GO:0000305 | response to oxygen radical(GO:0000305) |
| 0.2 | 1.7 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.2 | 1.0 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.2 | 0.7 | GO:1904828 | regulation of hydrogen sulfide biosynthetic process(GO:1904826) positive regulation of hydrogen sulfide biosynthetic process(GO:1904828) |
| 0.2 | 3.9 | GO:0007379 | segment specification(GO:0007379) |
| 0.2 | 2.2 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.2 | 1.0 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.2 | 0.2 | GO:0033864 | positive regulation of NAD(P)H oxidase activity(GO:0033864) |
| 0.2 | 5.6 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.2 | 0.7 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.2 | 1.0 | GO:0034724 | DNA replication-independent nucleosome organization(GO:0034724) |
| 0.2 | 0.5 | GO:0045297 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
| 0.2 | 1.2 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.2 | 0.9 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.2 | 0.5 | GO:0050955 | thermoception(GO:0050955) |
| 0.2 | 0.2 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.2 | 1.2 | GO:0019516 | lactate oxidation(GO:0019516) |
| 0.2 | 2.3 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.2 | 0.2 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.2 | 0.7 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.2 | 0.2 | GO:1902219 | regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.2 | 0.5 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
| 0.2 | 0.7 | GO:0035638 | patched ligand maturation(GO:0007225) signal maturation(GO:0035638) |
| 0.2 | 6.0 | GO:0098534 | centriole replication(GO:0007099) centriole assembly(GO:0098534) |
| 0.2 | 0.9 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.2 | 0.7 | GO:1904766 | negative regulation of macroautophagy by TORC1 signaling(GO:1904766) |
| 0.2 | 0.7 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
| 0.2 | 0.5 | GO:0006740 | NADPH regeneration(GO:0006740) |
| 0.2 | 3.4 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.2 | 13.3 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
| 0.2 | 0.7 | GO:0048806 | genitalia development(GO:0048806) |
| 0.2 | 0.2 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
| 0.2 | 0.9 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
| 0.2 | 3.1 | GO:0042407 | cristae formation(GO:0042407) |
| 0.2 | 1.5 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.2 | 0.4 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.2 | 2.0 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.2 | 0.4 | GO:0042853 | glycine biosynthetic process, by transamination of glyoxylate(GO:0019265) L-alanine catabolic process(GO:0042853) |
| 0.2 | 0.6 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
| 0.2 | 0.4 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.2 | 0.9 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.2 | 0.6 | GO:0035038 | female pronucleus assembly(GO:0035038) |
| 0.2 | 0.6 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
| 0.2 | 1.5 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.2 | 0.6 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) |
| 0.2 | 1.0 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.2 | 0.4 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.2 | 3.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.2 | 1.6 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
| 0.2 | 0.8 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.2 | 5.1 | GO:0051310 | metaphase plate congression(GO:0051310) |
| 0.2 | 0.6 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
| 0.2 | 0.4 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
| 0.2 | 0.6 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.2 | 5.7 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.2 | 0.6 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.2 | 5.0 | GO:0014823 | response to activity(GO:0014823) |
| 0.2 | 1.8 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.2 | 1.0 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 0.2 | 1.4 | GO:0021559 | trigeminal nerve development(GO:0021559) |
| 0.2 | 0.6 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.2 | 2.2 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.2 | 0.6 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.2 | 0.4 | GO:0044252 | negative regulation of multicellular organismal metabolic process(GO:0044252) |
| 0.2 | 1.2 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.2 | 3.4 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.2 | 0.2 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.2 | 2.4 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.2 | 1.2 | GO:0034435 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.2 | 2.0 | GO:0035878 | nail development(GO:0035878) |
| 0.2 | 3.1 | GO:0042168 | heme metabolic process(GO:0042168) |
| 0.2 | 0.8 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 0.2 | 0.8 | GO:1902269 | positive regulation of polyamine transmembrane transport(GO:1902269) |
| 0.2 | 0.8 | GO:0015938 | coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.2 | 0.8 | GO:0022601 | menstrual cycle phase(GO:0022601) |
| 0.2 | 0.2 | GO:0034442 | regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) |
| 0.2 | 1.2 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.2 | 2.5 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.2 | 0.6 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
| 0.2 | 0.4 | GO:0033504 | floor plate development(GO:0033504) |
| 0.2 | 1.0 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
| 0.2 | 3.1 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.2 | 2.1 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.2 | 1.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.2 | 12.1 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.2 | 0.6 | GO:0046641 | positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.2 | 0.6 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.2 | 0.6 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
| 0.2 | 2.8 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.2 | 1.3 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.2 | 0.2 | GO:0001545 | primary ovarian follicle growth(GO:0001545) |
| 0.2 | 0.4 | GO:1902741 | type I interferon secretion(GO:0072641) interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.2 | 0.7 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.2 | 0.4 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.2 | 1.3 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.2 | 1.8 | GO:0006833 | water transport(GO:0006833) |
| 0.2 | 1.3 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.2 | 13.4 | GO:0042742 | defense response to bacterium(GO:0042742) |
| 0.2 | 0.7 | GO:0017126 | nucleologenesis(GO:0017126) |
| 0.2 | 1.4 | GO:0044026 | DNA hypermethylation(GO:0044026) hypermethylation of CpG island(GO:0044027) |
| 0.2 | 1.1 | GO:0035455 | response to interferon-alpha(GO:0035455) |
| 0.2 | 0.7 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 0.2 | 0.5 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.2 | 0.7 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.2 | 1.6 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.2 | 1.4 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.2 | 0.3 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.2 | 1.2 | GO:0045738 | negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
| 0.2 | 1.4 | GO:0043486 | histone exchange(GO:0043486) |
| 0.2 | 0.3 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.2 | 1.9 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.2 | 0.5 | GO:0071428 | rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
| 0.2 | 0.9 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.2 | 0.3 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
| 0.2 | 0.3 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.2 | 2.7 | GO:0071594 | T cell differentiation in thymus(GO:0033077) thymocyte aggregation(GO:0071594) |
| 0.2 | 1.0 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.2 | 2.0 | GO:1901976 | regulation of cell cycle checkpoint(GO:1901976) |
| 0.2 | 3.5 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.2 | 0.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.2 | 0.3 | GO:1901072 | glucosamine-containing compound catabolic process(GO:1901072) |
| 0.2 | 0.7 | GO:0010896 | regulation of triglyceride catabolic process(GO:0010896) positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.2 | 0.3 | GO:0042268 | regulation of cytolysis(GO:0042268) |
| 0.2 | 0.5 | GO:0010692 | regulation of alkaline phosphatase activity(GO:0010692) |
| 0.2 | 0.3 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
| 0.2 | 1.1 | GO:0002369 | T cell cytokine production(GO:0002369) |
| 0.2 | 0.3 | GO:0044320 | cellular response to leptin stimulus(GO:0044320) |
| 0.2 | 1.6 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.2 | 4.2 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.2 | 1.8 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.2 | 0.3 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.2 | 3.5 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.2 | 0.3 | GO:0014908 | myotube differentiation involved in skeletal muscle regeneration(GO:0014908) |
| 0.2 | 0.2 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
| 0.2 | 0.8 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.2 | 0.5 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.2 | 0.9 | GO:0045901 | translational frameshifting(GO:0006452) positive regulation of translational elongation(GO:0045901) positive regulation of translational termination(GO:0045905) |
| 0.2 | 0.5 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.2 | 1.5 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.2 | 0.5 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.2 | 1.8 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.2 | 1.7 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.2 | 0.8 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.2 | 1.2 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
| 0.2 | 1.1 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.2 | 0.9 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.2 | 1.8 | GO:0032042 | mitochondrial DNA metabolic process(GO:0032042) |
| 0.1 | 0.7 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.1 | 0.7 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.1 | 0.9 | GO:0036337 | Fas signaling pathway(GO:0036337) |
| 0.1 | 1.0 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.1 | 0.9 | GO:0045088 | regulation of innate immune response(GO:0045088) |
| 0.1 | 1.5 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.1 | 0.6 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.1 | 1.8 | GO:0043277 | apoptotic cell clearance(GO:0043277) |
| 0.1 | 0.4 | GO:1902730 | positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 | 4.9 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.1 | 0.3 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
| 0.1 | 0.7 | GO:0071476 | cellular hypotonic response(GO:0071476) |
| 0.1 | 1.3 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.1 | 0.4 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.1 | 0.4 | GO:0070476 | rRNA (guanine-N7)-methylation(GO:0070476) |
| 0.1 | 1.1 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.1 | 0.4 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.1 | 0.7 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.1 | 1.1 | GO:0071802 | cellular response to muramyl dipeptide(GO:0071225) negative regulation of podosome assembly(GO:0071802) |
| 0.1 | 0.6 | GO:1904925 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.1 | 0.6 | GO:0016246 | RNA interference(GO:0016246) |
| 0.1 | 1.1 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.1 | 1.1 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.1 | 0.3 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.1 | 0.1 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.1 | 1.5 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.1 | 1.5 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
| 0.1 | 0.9 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 1.4 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.1 | 0.9 | GO:0060706 | cell differentiation involved in embryonic placenta development(GO:0060706) |
| 0.1 | 0.1 | GO:0046697 | decidualization(GO:0046697) |
| 0.1 | 0.9 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.1 | 2.3 | GO:0031050 | dsRNA fragmentation(GO:0031050) production of small RNA involved in gene silencing by RNA(GO:0070918) |
| 0.1 | 1.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 | 0.7 | GO:0070829 | heterochromatin maintenance(GO:0070829) |
| 0.1 | 0.1 | GO:0000239 | pachytene(GO:0000239) |
| 0.1 | 0.5 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.1 | 0.9 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.1 | 0.4 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.1 | 41.3 | GO:0050907 | detection of chemical stimulus involved in sensory perception(GO:0050907) |
| 0.1 | 0.4 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
| 0.1 | 0.3 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 0.4 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.1 | 0.4 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.1 | 4.2 | GO:0048704 | embryonic skeletal system morphogenesis(GO:0048704) |
| 0.1 | 2.7 | GO:0006801 | superoxide metabolic process(GO:0006801) |
| 0.1 | 0.8 | GO:0051151 | regulation of smooth muscle cell differentiation(GO:0051150) negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 | 1.8 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 | 0.4 | GO:0061723 | glycophagy(GO:0061723) |
| 0.1 | 1.3 | GO:0032261 | purine nucleotide salvage(GO:0032261) |
| 0.1 | 0.6 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
| 0.1 | 1.4 | GO:0060218 | hematopoietic stem cell differentiation(GO:0060218) |
| 0.1 | 4.4 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.1 | 4.3 | GO:0043124 | negative regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043124) |
| 0.1 | 0.4 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
| 0.1 | 0.7 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.1 | 0.4 | GO:0072501 | cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.1 | 1.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.1 | 3.4 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
| 0.1 | 0.2 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.1 | 0.2 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
| 0.1 | 0.1 | GO:0034122 | negative regulation of toll-like receptor signaling pathway(GO:0034122) |
| 0.1 | 0.5 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 0.1 | 0.5 | GO:0061085 | regulation of histone H3-K27 methylation(GO:0061085) positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.1 | 0.1 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
| 0.1 | 3.8 | GO:0042255 | ribosome assembly(GO:0042255) |
| 0.1 | 4.6 | GO:0030217 | T cell differentiation(GO:0030217) |
| 0.1 | 0.2 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.1 | 0.1 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.1 | 0.8 | GO:0048757 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.1 | 0.2 | GO:0042026 | protein refolding(GO:0042026) |
| 0.1 | 0.8 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.1 | 0.3 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 | 6.9 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.1 | 104.6 | GO:0007608 | sensory perception of smell(GO:0007608) |
| 0.1 | 4.0 | GO:1904888 | cranial skeletal system development(GO:1904888) |
| 0.1 | 0.8 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.1 | 0.6 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.1 | 0.9 | GO:0031295 | T cell costimulation(GO:0031295) |
| 0.1 | 1.5 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
| 0.1 | 0.3 | GO:1990168 | protein K27-linked deubiquitination(GO:1990167) protein K33-linked deubiquitination(GO:1990168) |
| 0.1 | 0.6 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 | 0.3 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 0.3 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.6 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
| 0.1 | 2.5 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.1 | 0.4 | GO:2000678 | negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.1 | 0.2 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 | 0.8 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.1 | 0.7 | GO:0055070 | copper ion homeostasis(GO:0055070) |
| 0.1 | 0.6 | GO:0046520 | sphingoid biosynthetic process(GO:0046520) |
| 0.1 | 0.4 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 | 1.3 | GO:0019682 | glyceraldehyde-3-phosphate metabolic process(GO:0019682) |
| 0.1 | 0.9 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.1 | 1.7 | GO:0051084 | 'de novo' posttranslational protein folding(GO:0051084) |
| 0.1 | 0.3 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.1 | 1.8 | GO:0006023 | aminoglycan biosynthetic process(GO:0006023) |
| 0.1 | 1.4 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.1 | 5.3 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.1 | 0.5 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 0.1 | 0.5 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
| 0.1 | 1.1 | GO:1901070 | guanosine-containing compound biosynthetic process(GO:1901070) |
| 0.1 | 0.2 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.1 | 0.5 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 0.6 | GO:0042640 | anagen(GO:0042640) |
| 0.1 | 0.3 | GO:1904180 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.1 | 0.4 | GO:0038016 | insulin receptor internalization(GO:0038016) |
| 0.1 | 0.3 | GO:0044107 | cellular alcohol metabolic process(GO:0044107) cellular alcohol biosynthetic process(GO:0044108) |
| 0.1 | 0.4 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.1 | 0.4 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 | 0.2 | GO:1903895 | negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
| 0.1 | 6.0 | GO:0050818 | regulation of coagulation(GO:0050818) |
| 0.1 | 0.5 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 0.1 | 0.2 | GO:1903826 | lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine transport(GO:1902022) L-ornithine transmembrane transport(GO:1903352) L-arginine transmembrane transport(GO:1903400) L-lysine transmembrane transport(GO:1903401) L-lysine import into cell(GO:1903410) arginine transmembrane transport(GO:1903826) |
| 0.1 | 0.5 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.1 | 0.2 | GO:0021888 | hypothalamus gonadotrophin-releasing hormone neuron differentiation(GO:0021886) hypothalamus gonadotrophin-releasing hormone neuron development(GO:0021888) |
| 0.1 | 1.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.1 | 0.3 | GO:0071586 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.1 | 0.3 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 0.1 | GO:0042092 | type 2 immune response(GO:0042092) |
| 0.1 | 0.8 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.1 | 0.9 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 | 9.3 | GO:0009615 | response to virus(GO:0009615) |
| 0.1 | 0.2 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 | 0.4 | GO:0071718 | sodium-independent icosanoid transport(GO:0071718) |
| 0.1 | 0.8 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.1 | 0.2 | GO:0046351 | disaccharide biosynthetic process(GO:0046351) |
| 0.1 | 0.8 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.1 | 7.7 | GO:0007249 | I-kappaB kinase/NF-kappaB signaling(GO:0007249) |
| 0.1 | 0.2 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.1 | 1.7 | GO:0032873 | negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
| 0.1 | 0.2 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.1 | 0.8 | GO:0045089 | positive regulation of innate immune response(GO:0045089) |
| 0.1 | 0.6 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.1 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
| 0.1 | 0.7 | GO:0046688 | response to copper ion(GO:0046688) |
| 0.1 | 0.6 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 | 1.5 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 | 0.3 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.1 | 0.7 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 0.2 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
| 0.1 | 0.1 | GO:0006212 | uracil catabolic process(GO:0006212) uracil metabolic process(GO:0019860) |
| 0.1 | 1.5 | GO:0032088 | negative regulation of NF-kappaB transcription factor activity(GO:0032088) |
| 0.1 | 1.0 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.1 | 0.2 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.1 | 0.1 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.1 | 1.0 | GO:0045604 | regulation of epidermal cell differentiation(GO:0045604) |
| 0.1 | 0.9 | GO:0050766 | positive regulation of phagocytosis(GO:0050766) |
| 0.1 | 0.1 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 0.1 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.1 | 0.3 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 1.9 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.1 | 0.6 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 0.6 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.1 | 0.5 | GO:0072376 | protein activation cascade(GO:0072376) |
| 0.1 | 1.5 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.1 | 0.3 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.1 | 0.2 | GO:1901836 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) |
| 0.1 | 0.4 | GO:0061709 | reticulophagy(GO:0061709) |
| 0.1 | 0.2 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 | 0.4 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.1 | 0.8 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.8 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.1 | 0.2 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.1 | 0.7 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.1 | 0.2 | GO:0090500 | endocardial cushion to mesenchymal transition(GO:0090500) |
| 0.1 | 0.2 | GO:0021747 | cochlear nucleus development(GO:0021747) |
| 0.1 | 0.1 | GO:0019042 | viral latency(GO:0019042) release from viral latency(GO:0019046) |
| 0.1 | 0.3 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.3 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.1 | 0.3 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.1 | 0.3 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.1 | 0.1 | GO:0035799 | ureter maturation(GO:0035799) |
| 0.1 | 0.3 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.1 | 0.2 | GO:0044725 | chromatin reprogramming in the zygote(GO:0044725) DNA demethylation of male pronucleus(GO:0044727) |
| 0.1 | 0.5 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.1 | 0.3 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
| 0.1 | 0.4 | GO:0015705 | iodide transport(GO:0015705) |
| 0.1 | 2.3 | GO:0042110 | T cell activation(GO:0042110) T cell aggregation(GO:0070489) |
| 0.0 | 0.2 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.0 | 0.1 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
| 0.0 | 0.0 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) |
| 0.0 | 0.2 | GO:0043129 | surfactant homeostasis(GO:0043129) |
| 0.0 | 0.2 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.0 | 0.7 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 | 0.4 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
| 0.0 | 0.4 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.1 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
| 0.0 | 0.8 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.4 | GO:1903309 | negative regulation of chromatin modification(GO:1903309) |
| 0.0 | 1.9 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.2 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.0 | 0.5 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.3 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.0 | 1.0 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.1 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 1.6 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
| 0.0 | 0.9 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.0 | 0.1 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.0 | 0.0 | GO:0034616 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
| 0.0 | 0.0 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.0 | 0.6 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.1 | GO:0031268 | pseudopodium organization(GO:0031268) |
| 0.0 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.0 | 0.0 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.0 | 0.2 | GO:0009445 | putrescine metabolic process(GO:0009445) putrescine biosynthetic process(GO:0009446) |
| 0.0 | 0.1 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.0 | 0.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.6 | GO:0007602 | phototransduction(GO:0007602) |
| 0.0 | 0.1 | GO:0018900 | dichloromethane metabolic process(GO:0018900) |
| 0.0 | 0.3 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.0 | 0.3 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 | 0.1 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
| 0.0 | 0.2 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.0 | 0.7 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.0 | 0.2 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.1 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.0 | 0.0 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.0 | 0.1 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.0 | 0.1 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.0 | 0.2 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.0 | 0.2 | GO:0006534 | cysteine metabolic process(GO:0006534) |
| 0.0 | 0.1 | GO:1904882 | telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.0 | 0.2 | GO:0001893 | maternal placenta development(GO:0001893) |
| 0.0 | 0.2 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 | 0.3 | GO:0097186 | amelogenesis(GO:0097186) |
| 0.0 | 0.3 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.0 | 0.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.6 | GO:0015804 | neutral amino acid transport(GO:0015804) |
| 0.0 | 0.0 | GO:0046038 | GMP catabolic process(GO:0046038) |
| 0.0 | 0.3 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.0 | 0.0 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.0 | 0.1 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 | 0.1 | GO:0050872 | white fat cell differentiation(GO:0050872) |
| 0.0 | 0.2 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.5 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.0 | 0.1 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.0 | 0.1 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.1 | GO:0035358 | regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035358) |
| 0.0 | 0.1 | GO:0055130 | D-serine catabolic process(GO:0036088) D-alanine family amino acid metabolic process(GO:0046144) D-alanine metabolic process(GO:0046436) D-alanine catabolic process(GO:0055130) |
| 0.0 | 0.1 | GO:0045212 | neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.0 | 0.2 | GO:0050858 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) |
| 0.0 | 0.2 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.0 | 0.1 | GO:0009227 | UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
| 0.0 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.0 | 0.1 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.0 | 0.1 | GO:0033326 | ciliary basal body organization(GO:0032053) cerebrospinal fluid secretion(GO:0033326) |
| 0.0 | 0.0 | GO:0034375 | high-density lipoprotein particle remodeling(GO:0034375) |
| 0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.1 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 | 0.1 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.0 | 0.1 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) cardiolipin biosynthetic process(GO:0032049) |
| 0.0 | 0.1 | GO:0008334 | histone mRNA metabolic process(GO:0008334) histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.1 | GO:0008356 | asymmetric cell division(GO:0008356) |
| 0.0 | 0.2 | GO:0032986 | nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) protein-DNA complex disassembly(GO:0032986) |
| 0.0 | 0.4 | GO:0061515 | myeloid cell development(GO:0061515) |
| 0.0 | 0.4 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
| 0.0 | 0.0 | GO:0071922 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.0 | 0.0 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.0 | 0.0 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.0 | 0.0 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
| 0.0 | 0.0 | GO:0015786 | UDP-glucose transport(GO:0015786) |
| 0.0 | 0.1 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
| 0.0 | 0.0 | GO:0034111 | negative regulation of homotypic cell-cell adhesion(GO:0034111) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 7.0 | 34.8 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 5.9 | 29.3 | GO:0034687 | integrin alphaL-beta2 complex(GO:0034687) |
| 5.5 | 66.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 4.3 | 17.4 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 3.7 | 44.5 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 3.3 | 16.4 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 3.3 | 32.6 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 3.0 | 9.0 | GO:0036398 | TCR signalosome(GO:0036398) |
| 2.9 | 41.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 2.7 | 324.0 | GO:0019814 | immunoglobulin complex(GO:0019814) immunoglobulin complex, circulating(GO:0042571) |
| 2.4 | 26.8 | GO:0042629 | mast cell granule(GO:0042629) |
| 2.4 | 2.4 | GO:0042611 | MHC protein complex(GO:0042611) |
| 2.3 | 6.9 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 2.3 | 33.9 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 2.2 | 10.9 | GO:0030690 | Noc1p-Noc2p complex(GO:0030690) |
| 2.1 | 12.5 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 2.0 | 6.0 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
| 2.0 | 9.9 | GO:0070442 | integrin alphaIIb-beta3 complex(GO:0070442) |
| 1.9 | 11.3 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 1.7 | 8.7 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 1.7 | 5.2 | GO:0005760 | gamma DNA polymerase complex(GO:0005760) |
| 1.7 | 11.9 | GO:0032437 | cuticular plate(GO:0032437) |
| 1.6 | 4.9 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 1.6 | 4.8 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
| 1.6 | 1.6 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 1.6 | 55.7 | GO:0042588 | zymogen granule(GO:0042588) |
| 1.6 | 4.8 | GO:0032998 | Fc receptor complex(GO:0032997) Fc-epsilon receptor I complex(GO:0032998) |
| 1.6 | 22.1 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
| 1.6 | 4.7 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
| 1.5 | 10.8 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 1.5 | 10.7 | GO:0098536 | deuterosome(GO:0098536) |
| 1.5 | 21.3 | GO:0031983 | vesicle lumen(GO:0031983) |
| 1.5 | 17.8 | GO:0000796 | condensin complex(GO:0000796) |
| 1.4 | 24.3 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 1.4 | 11.4 | GO:0042825 | TAP complex(GO:0042825) |
| 1.4 | 7.0 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 1.4 | 9.7 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 1.4 | 6.8 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 1.4 | 25.9 | GO:0031528 | microvillus membrane(GO:0031528) |
| 1.3 | 13.0 | GO:1990462 | omegasome(GO:1990462) |
| 1.3 | 6.4 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 1.3 | 6.4 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 1.3 | 5.1 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
| 1.2 | 22.5 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 1.2 | 4.9 | GO:0042585 | germinal vesicle(GO:0042585) |
| 1.2 | 20.3 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 1.2 | 3.6 | GO:0034657 | GID complex(GO:0034657) |
| 1.1 | 6.8 | GO:0044218 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
| 1.1 | 36.8 | GO:0001891 | phagocytic cup(GO:0001891) |
| 1.1 | 5.5 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 1.1 | 4.3 | GO:0008623 | CHRAC(GO:0008623) |
| 1.1 | 5.3 | GO:0031251 | PAN complex(GO:0031251) |
| 1.1 | 1.1 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 1.0 | 3.1 | GO:0090537 | CERF complex(GO:0090537) |
| 1.0 | 1.0 | GO:0000811 | GINS complex(GO:0000811) |
| 1.0 | 3.0 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 1.0 | 10.0 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
| 1.0 | 5.8 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 1.0 | 2.9 | GO:0044194 | cytolytic granule(GO:0044194) |
| 1.0 | 16.3 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 1.0 | 2.9 | GO:0070992 | translation initiation complex(GO:0070992) |
| 0.9 | 2.8 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.9 | 4.6 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.9 | 9.9 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.9 | 2.7 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.9 | 3.5 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.9 | 8.7 | GO:0030478 | actin cap(GO:0030478) |
| 0.9 | 385.3 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.9 | 5.2 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.8 | 3.4 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.8 | 4.2 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.8 | 0.8 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.8 | 4.0 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.8 | 65.9 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.8 | 4.8 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.8 | 2.4 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.8 | 3.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.8 | 2.4 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.8 | 3.1 | GO:0070722 | Tle3-Aes complex(GO:0070722) |
| 0.8 | 12.6 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.8 | 3.1 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
| 0.8 | 3.1 | GO:0033597 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.8 | 5.4 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.8 | 3.1 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
| 0.8 | 2.3 | GO:0097232 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
| 0.8 | 3.8 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.8 | 11.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.8 | 2.3 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.7 | 1.5 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
| 0.7 | 2.2 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.7 | 3.6 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.7 | 9.9 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.7 | 4.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.7 | 4.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.7 | 0.7 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.7 | 7.9 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.7 | 5.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.6 | 8.3 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.6 | 2.9 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.6 | 4.6 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.6 | 5.7 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.6 | 2.2 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.6 | 7.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.5 | 6.0 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.5 | 2.2 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.5 | 3.2 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.5 | 29.2 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.5 | 2.5 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.5 | 2.5 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.5 | 4.0 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.5 | 3.5 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.5 | 6.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.5 | 0.5 | GO:0035101 | FACT complex(GO:0035101) |
| 0.5 | 4.3 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.5 | 1.4 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
| 0.5 | 6.9 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.5 | 3.7 | GO:0045179 | apical cortex(GO:0045179) |
| 0.5 | 2.3 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
| 0.5 | 16.7 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.4 | 4.5 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.4 | 4.9 | GO:0043219 | lateral loop(GO:0043219) |
| 0.4 | 1.8 | GO:0098833 | presynaptic endocytic zone(GO:0098833) presynaptic endocytic zone membrane(GO:0098835) |
| 0.4 | 1.3 | GO:0060473 | cortical granule(GO:0060473) |
| 0.4 | 0.9 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.4 | 4.8 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.4 | 3.0 | GO:0005638 | lamin filament(GO:0005638) |
| 0.4 | 1.3 | GO:0097132 | cyclin D2-CDK6 complex(GO:0097132) |
| 0.4 | 3.8 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.4 | 1.3 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) cyclin K-CDK13 complex(GO:0002945) |
| 0.4 | 2.9 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.4 | 7.0 | GO:0090543 | Flemming body(GO:0090543) |
| 0.4 | 1.6 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.4 | 3.3 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.4 | 1.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.4 | 5.5 | GO:0042581 | specific granule(GO:0042581) |
| 0.4 | 1.2 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.4 | 4.2 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.4 | 4.5 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
| 0.4 | 0.7 | GO:0032010 | phagolysosome(GO:0032010) phagolysosome membrane(GO:0061474) |
| 0.4 | 2.2 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.4 | 4.0 | GO:0016589 | NURF complex(GO:0016589) |
| 0.4 | 5.1 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.4 | 1.4 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.4 | 1.1 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
| 0.4 | 8.9 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.4 | 4.3 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.4 | 1.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.4 | 3.9 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.3 | 1.0 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.3 | 47.2 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.3 | 1.7 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.3 | 12.9 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.3 | 1.6 | GO:0035838 | growing cell tip(GO:0035838) new growing cell tip(GO:0035841) |
| 0.3 | 4.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.3 | 4.9 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.3 | 1.0 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
| 0.3 | 1.3 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.3 | 2.2 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.3 | 3.8 | GO:0031415 | NatA complex(GO:0031415) |
| 0.3 | 1.0 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.3 | 3.2 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.3 | 2.5 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.3 | 0.3 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.3 | 0.9 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.3 | 1.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.3 | 1.5 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.3 | 13.3 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.3 | 6.0 | GO:0000791 | euchromatin(GO:0000791) |
| 0.3 | 8.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.3 | 2.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.3 | 6.5 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.3 | 1.8 | GO:0031523 | Myb complex(GO:0031523) |
| 0.3 | 1.8 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.3 | 8.7 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.3 | 2.0 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.3 | 2.8 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.3 | 9.3 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.3 | 2.0 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.3 | 3.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.3 | 4.1 | GO:0042555 | MCM complex(GO:0042555) |
| 0.3 | 3.5 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.3 | 1.6 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.3 | 0.8 | GO:0043540 | 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase complex(GO:0043540) |
| 0.3 | 0.8 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.3 | 1.6 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.3 | 509.3 | GO:0005615 | extracellular space(GO:0005615) |
| 0.3 | 1.0 | GO:0045273 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.3 | 3.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.3 | 1.5 | GO:0097226 | sperm mitochondrial sheath(GO:0097226) |
| 0.3 | 2.5 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.3 | 12.8 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.3 | 3.5 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.2 | 0.7 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.2 | 0.7 | GO:0043614 | multi-eIF complex(GO:0043614) |
| 0.2 | 1.0 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.2 | 1.2 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
| 0.2 | 2.1 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.2 | 4.6 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.2 | 0.7 | GO:0014801 | longitudinal sarcoplasmic reticulum(GO:0014801) |
| 0.2 | 0.7 | GO:0036020 | endolysosome(GO:0036019) endolysosome membrane(GO:0036020) |
| 0.2 | 25.2 | GO:0016605 | PML body(GO:0016605) |
| 0.2 | 1.4 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.2 | 0.9 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.2 | 1.3 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.2 | 3.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.2 | 4.2 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.2 | 1.3 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.2 | 0.7 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.2 | 9.5 | GO:0002102 | podosome(GO:0002102) |
| 0.2 | 1.1 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.2 | 3.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.2 | 5.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.2 | 1.3 | GO:0001652 | granular component(GO:0001652) |
| 0.2 | 0.8 | GO:0001740 | Barr body(GO:0001740) |
| 0.2 | 5.6 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.2 | 7.9 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.2 | 0.8 | GO:1990696 | USH2 complex(GO:1990696) |
| 0.2 | 0.6 | GO:1990415 | Pex17p-Pex14p docking complex(GO:1990415) peroxisomal importomer complex(GO:1990429) |
| 0.2 | 1.6 | GO:0097413 | Lewy body(GO:0097413) |
| 0.2 | 1.2 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.2 | 4.0 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.2 | 1.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.2 | 33.2 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.2 | 2.3 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.2 | 1.5 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.2 | 1.5 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.2 | 0.7 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 0.2 | 3.2 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.2 | 7.9 | GO:0005657 | replication fork(GO:0005657) |
| 0.2 | 1.8 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.2 | 2.0 | GO:0071012 | U2-type catalytic step 1 spliceosome(GO:0071006) catalytic step 1 spliceosome(GO:0071012) |
| 0.2 | 27.5 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
| 0.2 | 9.2 | GO:0005604 | basement membrane(GO:0005604) |
| 0.2 | 1.4 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.2 | 2.3 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.2 | 0.5 | GO:0032783 | ELL-EAF complex(GO:0032783) |
| 0.2 | 28.9 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.2 | 1.4 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.2 | 4.2 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.2 | 1.8 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.1 | 0.7 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.1 | 2.9 | GO:0033202 | DNA helicase complex(GO:0033202) |
| 0.1 | 0.6 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.1 | 12.7 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.1 | 8.4 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 1.7 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.1 | 1.2 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.1 | 0.5 | GO:1990578 | perinuclear endoplasmic reticulum membrane(GO:1990578) |
| 0.1 | 1.2 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.1 | 0.4 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.1 | 0.9 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 0.7 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 0.7 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 0.7 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.1 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.1 | 2.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 0.8 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
| 0.1 | 0.6 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.1 | 1.6 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.1 | 7.1 | GO:0032993 | protein-DNA complex(GO:0032993) |
| 0.1 | 0.3 | GO:0044317 | rod spherule(GO:0044317) |
| 0.1 | 0.3 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.1 | 0.2 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
| 0.1 | 1.5 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.1 | 0.8 | GO:0045120 | pronucleus(GO:0045120) |
| 0.1 | 1.0 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 34.9 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.1 | 20.3 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.1 | 15.9 | GO:0005903 | brush border(GO:0005903) |
| 0.1 | 0.4 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.1 | 0.2 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 0.7 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.1 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 0.4 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 0.1 | 1.4 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 4.2 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.1 | 0.3 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.1 | 0.3 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.1 | 6.8 | GO:0016459 | myosin complex(GO:0016459) |
| 0.1 | 0.6 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 0.4 | GO:0044299 | C-fiber(GO:0044299) |
| 0.1 | 7.8 | GO:0000922 | spindle pole(GO:0000922) |
| 0.1 | 0.4 | GO:0017177 | glucosidase II complex(GO:0017177) |
| 0.1 | 0.5 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.1 | 0.4 | GO:1990923 | PET complex(GO:1990923) |
| 0.1 | 0.2 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
| 0.1 | 0.3 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 0.3 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 1.3 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.1 | 0.5 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.1 | 0.8 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.1 | 0.7 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.1 | 2.4 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.1 | 0.1 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.1 | 0.4 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 0.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.1 | 0.3 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.1 | 0.2 | GO:0097361 | CIA complex(GO:0097361) |
| 0.1 | 0.6 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 1.3 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.0 | 0.2 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 1.5 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.4 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 1.2 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 1.2 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.2 | GO:0031417 | NatC complex(GO:0031417) |
| 0.0 | 1.4 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.1 | GO:0060187 | cell pole(GO:0060187) |
| 0.0 | 0.5 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.1 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.0 | 0.4 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 2.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.8 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.0 | 0.1 | GO:0060171 | stereocilium membrane(GO:0060171) |
| 0.0 | 0.1 | GO:0002111 | BRCA2-BRAF35 complex(GO:0002111) |
| 0.0 | 1.6 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 0.2 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) |
| 0.0 | 1.7 | GO:0005819 | spindle(GO:0005819) |
| 0.0 | 0.4 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
| 0.0 | 2.3 | GO:0000800 | lateral element(GO:0000800) |
| 0.0 | 1.1 | GO:0000793 | condensed chromosome(GO:0000793) |
| 0.0 | 0.1 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 0.0 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.0 | 0.1 | GO:0044307 | dendritic branch(GO:0044307) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 7.6 | 30.5 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 6.6 | 26.3 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
| 5.9 | 29.3 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
| 5.1 | 30.4 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 4.8 | 14.4 | GO:0003870 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 4.7 | 28.0 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 4.4 | 21.9 | GO:0019976 | interleukin-2 binding(GO:0019976) |
| 4.1 | 12.3 | GO:0032394 | MHC class Ib receptor activity(GO:0032394) |
| 4.0 | 16.0 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
| 3.7 | 11.1 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
| 3.3 | 39.8 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 3.2 | 16.1 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
| 3.1 | 21.9 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 3.1 | 18.5 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 3.1 | 9.2 | GO:0050785 | advanced glycation end-product receptor activity(GO:0050785) |
| 3.1 | 15.3 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 2.9 | 50.0 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 2.9 | 8.7 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 2.8 | 8.4 | GO:0035717 | chemokine (C-C motif) ligand 7 binding(GO:0035717) |
| 2.8 | 13.8 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
| 2.7 | 10.9 | GO:0097199 | cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097199) |
| 2.7 | 16.1 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
| 2.7 | 350.9 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 2.6 | 13.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 2.4 | 7.3 | GO:0052870 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) |
| 2.3 | 4.6 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 2.3 | 4.5 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
| 2.3 | 11.3 | GO:0004051 | arachidonate 5-lipoxygenase activity(GO:0004051) |
| 2.2 | 13.2 | GO:0019863 | IgE binding(GO:0019863) |
| 2.2 | 8.8 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 2.2 | 6.6 | GO:0035375 | zymogen binding(GO:0035375) |
| 2.2 | 32.6 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 2.1 | 6.4 | GO:0000402 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
| 2.1 | 6.3 | GO:0005330 | dopamine:sodium symporter activity(GO:0005330) |
| 2.0 | 24.4 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 2.0 | 8.0 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
| 2.0 | 9.9 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 2.0 | 7.9 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 2.0 | 11.7 | GO:0008142 | oxysterol binding(GO:0008142) |
| 1.9 | 7.7 | GO:0045159 | myosin II binding(GO:0045159) |
| 1.9 | 9.6 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
| 1.9 | 7.7 | GO:0042008 | interleukin-18 receptor activity(GO:0042008) |
| 1.9 | 17.0 | GO:0004568 | chitinase activity(GO:0004568) |
| 1.9 | 9.4 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 1.8 | 5.5 | GO:0033680 | ATP-dependent DNA/RNA helicase activity(GO:0033680) |
| 1.8 | 7.1 | GO:0005008 | hepatocyte growth factor-activated receptor activity(GO:0005008) |
| 1.7 | 7.0 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 1.7 | 12.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 1.7 | 5.1 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 1.7 | 10.0 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 1.6 | 4.9 | GO:0002113 | interleukin-33 binding(GO:0002113) |
| 1.6 | 144.8 | GO:0003823 | antigen binding(GO:0003823) |
| 1.6 | 4.8 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 1.6 | 4.8 | GO:0016890 | site-specific endodeoxyribonuclease activity, specific for altered base(GO:0016890) |
| 1.6 | 14.3 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 1.6 | 11.0 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 1.6 | 11.0 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
| 1.5 | 4.5 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 1.5 | 7.4 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 1.5 | 8.9 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 1.4 | 20.2 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 1.4 | 2.8 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 1.4 | 16.9 | GO:0038187 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
| 1.4 | 34.7 | GO:0051861 | glycolipid binding(GO:0051861) |
| 1.4 | 1.4 | GO:0003681 | bent DNA binding(GO:0003681) |
| 1.3 | 17.5 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 1.3 | 4.0 | GO:0047936 | glucose 1-dehydrogenase [NAD(P)] activity(GO:0047936) |
| 1.3 | 6.6 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 1.3 | 13.1 | GO:0004064 | arylesterase activity(GO:0004064) |
| 1.3 | 11.8 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 1.3 | 35.6 | GO:0001618 | virus receptor activity(GO:0001618) |
| 1.3 | 7.6 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 1.3 | 8.8 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 1.3 | 7.5 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 1.2 | 11.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 1.2 | 11.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 1.2 | 3.7 | GO:0052599 | diamine oxidase activity(GO:0052597) histamine oxidase activity(GO:0052598) methylputrescine oxidase activity(GO:0052599) propane-1,3-diamine oxidase activity(GO:0052600) |
| 1.2 | 4.9 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 1.2 | 3.7 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 1.2 | 21.5 | GO:0003796 | lysozyme activity(GO:0003796) |
| 1.2 | 4.6 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 1.2 | 18.4 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 1.1 | 9.1 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 1.1 | 10.2 | GO:0016936 | galactoside binding(GO:0016936) |
| 1.1 | 15.6 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 1.1 | 3.3 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 1.1 | 7.6 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 1.1 | 1.1 | GO:0001179 | RNA polymerase I transcription factor binding(GO:0001179) |
| 1.1 | 4.4 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 1.1 | 3.3 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 1.1 | 3.2 | GO:0001637 | G-protein coupled chemoattractant receptor activity(GO:0001637) chemokine receptor activity(GO:0004950) |
| 1.1 | 4.3 | GO:0019809 | spermidine binding(GO:0019809) |
| 1.1 | 5.3 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 1.0 | 6.2 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 1.0 | 3.0 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
| 1.0 | 3.0 | GO:0042602 | riboflavin reductase (NADPH) activity(GO:0042602) |
| 1.0 | 10.1 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 1.0 | 2.0 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 1.0 | 3.0 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 1.0 | 7.0 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 1.0 | 13.8 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 1.0 | 7.9 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 1.0 | 3.9 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 1.0 | 4.9 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 1.0 | 24.2 | GO:0045125 | bioactive lipid receptor activity(GO:0045125) |
| 1.0 | 2.9 | GO:0071820 | N-box binding(GO:0071820) |
| 1.0 | 4.8 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 1.0 | 9.6 | GO:0033691 | sialic acid binding(GO:0033691) |
| 1.0 | 1.0 | GO:0035877 | death effector domain binding(GO:0035877) |
| 1.0 | 3.8 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.9 | 2.8 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.9 | 10.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.9 | 3.7 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.9 | 56.7 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.9 | 11.9 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
| 0.9 | 4.5 | GO:0035478 | chylomicron binding(GO:0035478) |
| 0.9 | 74.9 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.9 | 8.9 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.9 | 2.7 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) |
| 0.9 | 4.4 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.9 | 3.5 | GO:0046977 | TAP binding(GO:0046977) |
| 0.9 | 4.4 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 0.8 | 6.8 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.8 | 5.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.8 | 5.9 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.8 | 5.9 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.8 | 2.5 | GO:0098918 | structural constituent of synapse(GO:0098918) structural constituent of postsynaptic actin cytoskeleton(GO:0098973) |
| 0.8 | 9.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.8 | 6.6 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.8 | 9.1 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.8 | 7.4 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.8 | 2.5 | GO:0019002 | GMP binding(GO:0019002) |
| 0.8 | 5.7 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.8 | 5.7 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.8 | 3.2 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.8 | 2.4 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
| 0.8 | 1.6 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.8 | 4.8 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
| 0.8 | 4.0 | GO:0001226 | RNA polymerase II transcription cofactor binding(GO:0001224) RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.8 | 6.3 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.8 | 2.4 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.8 | 31.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.8 | 14.9 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.8 | 6.2 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.8 | 8.6 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
| 0.8 | 2.3 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.8 | 2.3 | GO:0003692 | left-handed Z-DNA binding(GO:0003692) |
| 0.8 | 2.3 | GO:0004087 | carbamoyl-phosphate synthase (ammonia) activity(GO:0004087) carbamoyl-phosphate synthase (glutamine-hydrolyzing) activity(GO:0004088) |
| 0.8 | 3.1 | GO:0047522 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.8 | 2.3 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.8 | 9.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.7 | 10.4 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.7 | 15.6 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.7 | 2.2 | GO:0008061 | chitin binding(GO:0008061) |
| 0.7 | 6.7 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.7 | 2.2 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.7 | 2.2 | GO:0047256 | beta-galactosyl-N-acetylglucosaminylgalactosylglucosyl-ceramide beta-1,3-acetylglucosaminyltransferase activity(GO:0008457) lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase activity(GO:0047256) |
| 0.7 | 2.9 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.7 | 10.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.7 | 2.9 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.7 | 20.2 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.7 | 2.9 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.7 | 8.5 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.7 | 29.5 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.7 | 0.7 | GO:0003977 | UDP-N-acetylglucosamine diphosphorylase activity(GO:0003977) |
| 0.7 | 6.3 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.7 | 2.1 | GO:0004968 | gonadotropin-releasing hormone receptor activity(GO:0004968) |
| 0.7 | 2.1 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
| 0.7 | 2.1 | GO:0004557 | alpha-galactosidase activity(GO:0004557) |
| 0.7 | 2.0 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.7 | 4.0 | GO:0004875 | complement receptor activity(GO:0004875) |
| 0.7 | 2.0 | GO:0001729 | ceramide kinase activity(GO:0001729) |
| 0.7 | 4.0 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.7 | 1.3 | GO:0045142 | triplex DNA binding(GO:0045142) |
| 0.7 | 3.3 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.6 | 3.9 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.6 | 9.7 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.6 | 3.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.6 | 3.2 | GO:0055100 | adiponectin binding(GO:0055100) adipokinetic hormone receptor activity(GO:0097003) |
| 0.6 | 15.7 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.6 | 3.7 | GO:0038049 | glucocorticoid receptor activity(GO:0004883) transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.6 | 11.6 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.6 | 1.8 | GO:0003868 | 4-hydroxyphenylpyruvate dioxygenase activity(GO:0003868) |
| 0.6 | 2.4 | GO:0072354 | histone kinase activity (H3-T3 specific)(GO:0072354) |
| 0.6 | 3.0 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.6 | 4.2 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.6 | 4.8 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.6 | 12.6 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.6 | 17.4 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.6 | 0.6 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.6 | 1.8 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
| 0.6 | 2.4 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.6 | 4.7 | GO:0001614 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
| 0.6 | 0.6 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.6 | 4.1 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.6 | 4.1 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.6 | 7.0 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.6 | 7.0 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.6 | 5.2 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.6 | 9.8 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.6 | 8.7 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.6 | 1.7 | GO:0004372 | glycine hydroxymethyltransferase activity(GO:0004372) |
| 0.6 | 2.9 | GO:0042287 | MHC protein binding(GO:0042287) |
| 0.6 | 1.7 | GO:0070540 | stearic acid binding(GO:0070540) |
| 0.6 | 3.4 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.6 | 1.7 | GO:0050354 | glycerone kinase activity(GO:0004371) FAD-AMP lyase (cyclizing) activity(GO:0034012) triokinase activity(GO:0050354) |
| 0.6 | 14.1 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.6 | 26.3 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.6 | 2.8 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.6 | 2.8 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.6 | 40.2 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.5 | 1.1 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.5 | 1.6 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.5 | 8.8 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.5 | 7.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.5 | 4.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.5 | 2.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.5 | 12.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.5 | 0.5 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.5 | 2.6 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.5 | 1.6 | GO:0036461 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) BLOC-2 complex binding(GO:0036461) |
| 0.5 | 2.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.5 | 2.1 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.5 | 1.6 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.5 | 2.1 | GO:0047874 | dolichyldiphosphatase activity(GO:0047874) |
| 0.5 | 2.6 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.5 | 2.1 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.5 | 2.1 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.5 | 1.5 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.5 | 16.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.5 | 1.5 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.5 | 16.3 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.5 | 7.6 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.5 | 3.0 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.5 | 1.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.5 | 1.0 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.5 | 2.0 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.5 | 4.4 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.5 | 1.5 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.5 | 8.8 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.5 | 4.4 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.5 | 2.4 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.5 | 1.4 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.5 | 1.9 | GO:0051435 | BH4 domain binding(GO:0051435) |
| 0.5 | 2.8 | GO:0034618 | arginine binding(GO:0034618) |
| 0.5 | 0.5 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
| 0.5 | 1.4 | GO:1990955 | G-rich single-stranded DNA binding(GO:1990955) |
| 0.5 | 1.4 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.5 | 1.9 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.5 | 2.8 | GO:0070728 | leucine binding(GO:0070728) |
| 0.5 | 3.7 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.5 | 9.7 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.5 | 1.8 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.5 | 9.6 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.5 | 6.4 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.5 | 0.5 | GO:0005333 | norepinephrine transmembrane transporter activity(GO:0005333) |
| 0.5 | 5.5 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
| 0.5 | 14.6 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.5 | 0.9 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.5 | 5.9 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.5 | 4.5 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.4 | 1.3 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
| 0.4 | 1.3 | GO:0001034 | RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.4 | 7.2 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
| 0.4 | 2.7 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.4 | 12.0 | GO:0042379 | chemokine receptor binding(GO:0042379) |
| 0.4 | 1.3 | GO:0070002 | glutamic-type peptidase activity(GO:0070002) |
| 0.4 | 2.6 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.4 | 10.1 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.4 | 1.7 | GO:0047016 | cholest-5-ene-3-beta,7-alpha-diol 3-beta-dehydrogenase activity(GO:0047016) |
| 0.4 | 1.3 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.4 | 2.2 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.4 | 1.3 | GO:0052642 | lysophosphatidic acid phosphatase activity(GO:0052642) |
| 0.4 | 1.3 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.4 | 3.4 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.4 | 9.7 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.4 | 4.6 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.4 | 2.9 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.4 | 1.3 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.4 | 2.1 | GO:0005124 | scavenger receptor binding(GO:0005124) |
| 0.4 | 1.7 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.4 | 2.9 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.4 | 8.3 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.4 | 2.1 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.4 | 5.8 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.4 | 4.1 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.4 | 1.6 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.4 | 1.6 | GO:0004020 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
| 0.4 | 2.0 | GO:0045340 | mercury ion binding(GO:0045340) |
| 0.4 | 1.2 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.4 | 2.4 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.4 | 127.6 | GO:0030246 | carbohydrate binding(GO:0030246) |
| 0.4 | 0.8 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.4 | 2.0 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.4 | 4.0 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.4 | 2.4 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.4 | 4.8 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.4 | 2.4 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.4 | 5.5 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.4 | 5.1 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.4 | 1.2 | GO:0004473 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) oxaloacetate decarboxylase activity(GO:0008948) |
| 0.4 | 4.3 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.4 | 0.8 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.4 | 4.7 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.4 | 5.8 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.4 | 1.2 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 0.4 | 0.8 | GO:0036080 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
| 0.4 | 5.0 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.4 | 1.2 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
| 0.4 | 0.8 | GO:0008263 | pyrimidine-specific mismatch base pair DNA N-glycosylase activity(GO:0008263) |
| 0.4 | 5.7 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.4 | 1.9 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.4 | 1.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.4 | 90.6 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.4 | 2.6 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.4 | 6.3 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.4 | 0.7 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.4 | 0.7 | GO:0070976 | TIR domain binding(GO:0070976) |
| 0.4 | 3.3 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.4 | 1.8 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.4 | 1.1 | GO:0008124 | 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
| 0.4 | 1.8 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
| 0.4 | 1.5 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.4 | 9.4 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.4 | 4.3 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.4 | 1.1 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.4 | 42.6 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.4 | 1.1 | GO:0030116 | glial cell-derived neurotrophic factor receptor binding(GO:0030116) |
| 0.4 | 3.2 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.3 | 1.0 | GO:0019862 | IgA binding(GO:0019862) |
| 0.3 | 10.4 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.3 | 1.7 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.3 | 0.7 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.3 | 3.8 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.3 | 1.0 | GO:0001596 | angiotensin type I receptor activity(GO:0001596) |
| 0.3 | 2.8 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.3 | 2.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.3 | 0.3 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.3 | 0.7 | GO:0004802 | transketolase activity(GO:0004802) transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.3 | 9.3 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.3 | 1.7 | GO:0047635 | L-alanine:2-oxoglutarate aminotransferase activity(GO:0004021) alanine-oxo-acid transaminase activity(GO:0047635) |
| 0.3 | 1.7 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.3 | 1.7 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.3 | 3.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.3 | 1.0 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 0.3 | 1.0 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.3 | 4.3 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.3 | 4.6 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.3 | 3.3 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.3 | 29.8 | GO:0004540 | ribonuclease activity(GO:0004540) |
| 0.3 | 1.0 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.3 | 2.9 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.3 | 1.3 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.3 | 8.0 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.3 | 1.0 | GO:0005011 | macrophage colony-stimulating factor receptor activity(GO:0005011) |
| 0.3 | 2.2 | GO:0004556 | alpha-amylase activity(GO:0004556) amylase activity(GO:0016160) |
| 0.3 | 5.0 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.3 | 0.9 | GO:0004454 | ketohexokinase activity(GO:0004454) |
| 0.3 | 0.6 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.3 | 0.9 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.3 | 3.4 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
| 0.3 | 64.2 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.3 | 2.8 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.3 | 1.2 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.3 | 3.6 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.3 | 1.2 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.3 | 5.1 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.3 | 0.9 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.3 | 3.0 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.3 | 0.9 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.3 | 2.1 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.3 | 1.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.3 | 5.3 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.3 | 0.9 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.3 | 1.8 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.3 | 1.5 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.3 | 0.6 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.3 | 26.7 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.3 | 2.3 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.3 | 3.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.3 | 2.0 | GO:0015929 | hexosaminidase activity(GO:0015929) |
| 0.3 | 1.4 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.3 | 1.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.3 | 1.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.3 | 2.0 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.3 | 0.8 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
| 0.3 | 1.4 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.3 | 0.8 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.3 | 0.8 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.3 | 6.9 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.3 | 0.5 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.3 | 3.5 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.3 | 0.8 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.3 | 4.6 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
| 0.3 | 1.6 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.3 | 0.8 | GO:0004823 | leucine-tRNA ligase activity(GO:0004823) |
| 0.3 | 3.7 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.3 | 8.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.3 | 1.9 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.3 | 1.3 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 0.3 | 1.0 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
| 0.3 | 31.7 | GO:0005178 | integrin binding(GO:0005178) |
| 0.3 | 1.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.3 | 0.8 | GO:0042978 | ornithine decarboxylase activator activity(GO:0042978) |
| 0.3 | 1.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.3 | 1.0 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.3 | 0.8 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 0.3 | 0.8 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.3 | 0.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.2 | 1.0 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.2 | 43.2 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.2 | 2.9 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.2 | 5.1 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.2 | 2.9 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.2 | 2.1 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
| 0.2 | 0.9 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 0.2 | 3.3 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.2 | 0.9 | GO:0086038 | calcium:sodium antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086038) |
| 0.2 | 1.2 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.2 | 0.7 | GO:0004326 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) |
| 0.2 | 2.7 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.2 | 0.5 | GO:0043426 | MRF binding(GO:0043426) |
| 0.2 | 0.7 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.2 | 1.6 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.2 | 0.7 | GO:0004686 | elongation factor-2 kinase activity(GO:0004686) |
| 0.2 | 1.3 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.2 | 1.8 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.2 | 3.9 | GO:0000982 | transcription factor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0000982) |
| 0.2 | 1.7 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.2 | 8.7 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.2 | 2.3 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.2 | 0.6 | GO:0031370 | eukaryotic initiation factor 4G binding(GO:0031370) |
| 0.2 | 1.9 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.2 | 1.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.2 | 5.4 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.2 | 1.2 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.2 | 0.6 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.2 | 1.2 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
| 0.2 | 0.6 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.2 | 8.4 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.2 | 1.0 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.2 | 0.8 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.2 | 0.6 | GO:0001042 | RNA polymerase I core binding(GO:0001042) |
| 0.2 | 2.8 | GO:0070513 | death domain binding(GO:0070513) |
| 0.2 | 16.9 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.2 | 1.2 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.2 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.2 | 0.2 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.2 | 1.6 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.2 | 1.0 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.2 | 0.6 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.2 | 0.4 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.2 | 2.3 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.2 | 0.8 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.2 | 3.4 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.2 | 3.6 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.2 | 0.4 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.2 | 0.9 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.2 | 6.8 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.2 | 1.3 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.2 | 0.9 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.2 | 0.7 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.2 | 2.9 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.2 | 1.6 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.2 | 0.7 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.2 | 0.9 | GO:0001007 | transcription factor activity, RNA polymerase III transcription factor binding(GO:0001007) |
| 0.2 | 7.9 | GO:0016684 | oxidoreductase activity, acting on peroxide as acceptor(GO:0016684) |
| 0.2 | 4.1 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.2 | 2.7 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.2 | 0.9 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.2 | 7.4 | GO:0003690 | double-stranded DNA binding(GO:0003690) |
| 0.2 | 0.5 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.2 | 12.0 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.2 | 1.2 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.2 | 0.3 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
| 0.2 | 0.7 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.2 | 1.7 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.2 | 0.5 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) 8-oxo-7,8-dihydrodeoxyguanosine triphosphate pyrophosphatase activity(GO:0035539) |
| 0.2 | 4.8 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.2 | 1.2 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.2 | 1.9 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.2 | 3.0 | GO:0043236 | laminin binding(GO:0043236) |
| 0.2 | 9.8 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.2 | 1.3 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.2 | 3.0 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.2 | 0.2 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.2 | 0.7 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.2 | 4.7 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.2 | 1.8 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.2 | 1.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.2 | 0.5 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.2 | 0.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.2 | 0.8 | GO:0030977 | taurine binding(GO:0030977) |
| 0.2 | 0.9 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.2 | 1.2 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.2 | 1.8 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.2 | 0.3 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.2 | 1.8 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.2 | 1.5 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
| 0.2 | 1.5 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.2 | 0.5 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.2 | 0.5 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.1 | 1.3 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 171.5 | GO:0004984 | olfactory receptor activity(GO:0004984) |
| 0.1 | 1.5 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.1 | 0.4 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 0.1 | 0.6 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.1 | 0.6 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 1.0 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 1.4 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.1 | 0.1 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.1 | 0.3 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.1 | 1.7 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.1 | 0.5 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.1 | 0.3 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.1 | 0.4 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.1 | 13.3 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.1 | 2.1 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.1 | 0.8 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.1 | 0.4 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 1.6 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.1 | 1.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 0.5 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.1 | 2.6 | GO:0005504 | fatty acid binding(GO:0005504) |
| 0.1 | 0.6 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 0.8 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.1 | 0.4 | GO:0038100 | nodal binding(GO:0038100) |
| 0.1 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 3.5 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.1 | 113.0 | GO:0000975 | regulatory region DNA binding(GO:0000975) |
| 0.1 | 0.5 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.1 | 3.8 | GO:0016279 | lysine N-methyltransferase activity(GO:0016278) protein-lysine N-methyltransferase activity(GO:0016279) |
| 0.1 | 0.6 | GO:0033765 | steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) |
| 0.1 | 0.5 | GO:0089720 | caspase binding(GO:0089720) |
| 0.1 | 0.4 | GO:0043404 | corticotrophin-releasing factor receptor activity(GO:0015056) corticotropin-releasing hormone receptor activity(GO:0043404) |
| 0.1 | 2.3 | GO:0070001 | aspartic-type peptidase activity(GO:0070001) |
| 0.1 | 0.5 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.4 | GO:0002055 | adenine binding(GO:0002055) adenine phosphoribosyltransferase activity(GO:0003999) |
| 0.1 | 1.2 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.1 | 0.6 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.1 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 1.0 | GO:0016672 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) |
| 0.1 | 0.4 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.1 | 1.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.1 | 0.8 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.1 | 3.6 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
| 0.1 | 0.3 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
| 0.1 | 0.3 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.1 | 0.9 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.1 | 0.4 | GO:0031699 | beta-3 adrenergic receptor binding(GO:0031699) |
| 0.1 | 0.2 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.1 | 1.0 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.8 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
| 0.1 | 0.6 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.1 | 0.2 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
| 0.1 | 9.6 | GO:0004386 | helicase activity(GO:0004386) |
| 0.1 | 0.7 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.1 | 0.9 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.1 | 1.2 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 0.3 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
| 0.1 | 1.0 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.8 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.1 | 3.0 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.1 | 2.3 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.1 | 0.2 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.1 | 0.3 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.1 | 0.4 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.1 | 0.6 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.1 | 3.4 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
| 0.1 | 0.9 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.1 | 15.4 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
| 0.1 | 0.4 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
| 0.1 | 1.7 | GO:0015248 | sterol transporter activity(GO:0015248) |
| 0.1 | 0.5 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 3.0 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.1 | 0.6 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.1 | 0.8 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 0.7 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 0.7 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.1 | 0.7 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.1 | 0.2 | GO:0001571 | non-tyrosine kinase fibroblast growth factor receptor activity(GO:0001571) |
| 0.1 | 0.3 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.1 | 0.2 | GO:0005137 | interleukin-5 receptor binding(GO:0005137) |
| 0.1 | 0.3 | GO:0004058 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
| 0.1 | 0.5 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.1 | 0.5 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.1 | 0.9 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.1 | 0.6 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 0.6 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.1 | 1.0 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.1 | 14.5 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.1 | 0.2 | GO:0033971 | hydroxyisourate hydrolase activity(GO:0033971) |
| 0.1 | 0.5 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.1 | 0.3 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 0.5 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.1 | 0.3 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.1 | 0.5 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.1 | 0.2 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.1 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.1 | 0.2 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.1 | 0.2 | GO:1904408 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 0.1 | 0.1 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.1 | 0.6 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.1 | 0.3 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.1 | 2.9 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 1.2 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 0.1 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
| 0.1 | 0.5 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.1 | 0.1 | GO:0005308 | creatine transmembrane transporter activity(GO:0005308) |
| 0.1 | 0.3 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
| 0.0 | 0.4 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.0 | 1.3 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.0 | 0.1 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.0 | 1.0 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.6 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.0 | 0.7 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 1.1 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.0 | 0.0 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.0 | 0.2 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 0.2 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 1.7 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.0 | 0.4 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.5 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.0 | 0.1 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.0 | 0.2 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.0 | 0.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.0 | 0.6 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.2 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.0 | 0.3 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.1 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.0 | 0.1 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
| 0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.0 | 0.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.0 | 0.7 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.0 | 0.2 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.1 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 0.1 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.0 | 0.5 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
| 0.0 | 0.0 | GO:0055105 | ubiquitin-protein transferase inhibitor activity(GO:0055105) |
| 0.0 | 0.8 | GO:0043621 | protein self-association(GO:0043621) |
| 0.0 | 0.0 | GO:0003920 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.0 | 0.0 | GO:0008396 | oxysterol 7-alpha-hydroxylase activity(GO:0008396) |
| 0.0 | 0.7 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.1 | GO:0046527 | glucosyltransferase activity(GO:0046527) |
| 0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.0 | 0.1 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.0 | 48.6 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 2.2 | 8.6 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 1.6 | 57.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 1.3 | 157.7 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 1.2 | 71.9 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 1.1 | 16.8 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 1.1 | 1.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 1.0 | 45.4 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 1.0 | 30.8 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 1.0 | 12.4 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.9 | 1.9 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.9 | 52.0 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.9 | 3.5 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.8 | 3.4 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.8 | 0.8 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.8 | 45.5 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.8 | 19.4 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.8 | 28.5 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.8 | 2.3 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.7 | 12.7 | PID EPO PATHWAY | EPO signaling pathway |
| 0.6 | 23.1 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.6 | 7.7 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.6 | 44.9 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.6 | 2.4 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.6 | 36.2 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.6 | 5.2 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.6 | 1.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.6 | 9.9 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.5 | 35.3 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.5 | 8.4 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.5 | 4.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.5 | 7.8 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.5 | 12.7 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.5 | 29.0 | PID E2F PATHWAY | E2F transcription factor network |
| 0.5 | 22.7 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.5 | 3.0 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.5 | 4.5 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.5 | 3.5 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.5 | 14.4 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.5 | 31.7 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.5 | 3.3 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.5 | 8.9 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.5 | 4.2 | PID ATR PATHWAY | ATR signaling pathway |
| 0.5 | 6.8 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.4 | 9.3 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.4 | 13.2 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.4 | 18.8 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.4 | 5.7 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.4 | 10.6 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.4 | 37.3 | PID CMYB PATHWAY | C-MYB transcription factor network |
| 0.4 | 12.4 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.4 | 19.0 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.4 | 7.7 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.4 | 2.0 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.4 | 18.5 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.4 | 12.3 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.4 | 7.5 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.4 | 74.2 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.4 | 8.1 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.3 | 6.3 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.3 | 8.4 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.3 | 1.0 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.3 | 7.9 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.3 | 7.2 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.3 | 3.1 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.3 | 10.6 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.3 | 39.0 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.3 | 1.7 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.3 | 3.7 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.3 | 2.8 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.3 | 9.7 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.3 | 3.4 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.3 | 3.8 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.3 | 0.8 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.2 | 2.7 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.2 | 5.3 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.2 | 2.3 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.2 | 0.9 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.2 | 10.8 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.2 | 2.8 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.2 | 6.0 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.2 | 4.0 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.2 | 11.1 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.2 | 12.9 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.2 | 6.4 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.2 | 45.4 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.2 | 4.7 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.2 | 0.9 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.2 | 6.9 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.1 | 2.5 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 4.8 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.1 | 0.6 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.1 | 0.9 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 0.5 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.1 | 1.4 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.1 | 0.4 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.1 | 2.8 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.1 | 4.7 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 2.1 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.1 | 0.2 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.1 | 3.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 2.1 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.1 | 0.2 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.1 | 0.4 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.1 | 0.6 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 0.4 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.1 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 0.7 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.2 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.2 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.0 | 0.2 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.3 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 7.4 | 7.4 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 3.5 | 53.2 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 2.8 | 157.8 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 2.7 | 10.9 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 2.5 | 24.5 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 2.4 | 31.8 | REACTOME DEFENSINS | Genes involved in Defensins |
| 2.3 | 2.3 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 2.1 | 12.8 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
| 1.8 | 86.8 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 1.8 | 52.9 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 1.6 | 47.9 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 1.5 | 16.9 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 1.5 | 10.4 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 1.4 | 1.4 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 1.3 | 28.9 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 1.2 | 28.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 1.1 | 20.5 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 1.1 | 20.0 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 1.1 | 2.2 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 1.0 | 13.4 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 1.0 | 14.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 1.0 | 4.1 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 1.0 | 22.1 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 1.0 | 12.6 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 1.0 | 11.6 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 1.0 | 23.0 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 1.0 | 21.9 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.9 | 0.9 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.9 | 4.6 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.9 | 0.9 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.9 | 12.1 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.9 | 106.5 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.8 | 9.2 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.8 | 0.8 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.8 | 11.9 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.8 | 26.5 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.8 | 24.5 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.8 | 48.1 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.7 | 37.2 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.7 | 25.9 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.7 | 69.0 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.7 | 28.2 | REACTOME NUCLEOTIDE BINDING DOMAIN LEUCINE RICH REPEAT CONTAINING RECEPTOR NLR SIGNALING PATHWAYS | Genes involved in Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways |
| 0.7 | 3.5 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.7 | 29.4 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.7 | 8.3 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.7 | 7.4 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.7 | 2.0 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.6 | 30.3 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.6 | 3.2 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.6 | 16.4 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.6 | 12.5 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.6 | 8.7 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.6 | 10.8 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.6 | 4.8 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.6 | 14.9 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.6 | 6.8 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.6 | 2.2 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.5 | 20.2 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.5 | 8.7 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.5 | 35.3 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.5 | 1.6 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.5 | 11.3 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.5 | 10.6 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.5 | 25.2 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.5 | 5.3 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.5 | 7.0 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.5 | 1.9 | REACTOME SIGNALING BY FGFR IN DISEASE | Genes involved in Signaling by FGFR in disease |
| 0.5 | 1.8 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.4 | 6.6 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.4 | 6.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.4 | 17.9 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.4 | 7.3 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.4 | 10.2 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.4 | 3.0 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.4 | 14.3 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.4 | 15.0 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.4 | 10.8 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.4 | 6.7 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
| 0.4 | 7.4 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.4 | 10.3 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.4 | 13.6 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.4 | 9.0 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.3 | 4.1 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.3 | 5.3 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.3 | 1.0 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.3 | 0.7 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.3 | 1.6 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.3 | 9.5 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.3 | 5.5 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.3 | 4.2 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.3 | 17.1 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
| 0.3 | 2.7 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.3 | 3.3 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.3 | 1.5 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.3 | 5.3 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.3 | 4.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.3 | 4.5 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.3 | 5.0 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.3 | 2.8 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.3 | 20.1 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.3 | 4.6 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.3 | 3.4 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.3 | 5.8 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.3 | 10.0 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
| 0.2 | 2.0 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.2 | 0.7 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
| 0.2 | 1.3 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.2 | 2.0 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
| 0.2 | 4.2 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.2 | 3.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.2 | 2.5 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.2 | 2.3 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.2 | 1.9 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.2 | 14.1 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.2 | 8.1 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.2 | 11.2 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.2 | 23.4 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.2 | 8.7 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.2 | 4.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.2 | 2.0 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.2 | 3.5 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.2 | 1.2 | REACTOME HIV LIFE CYCLE | Genes involved in HIV Life Cycle |
| 0.2 | 1.8 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.2 | 1.5 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.2 | 1.8 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.2 | 1.8 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.2 | 1.6 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.2 | 16.5 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.2 | 2.0 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.2 | 9.0 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
| 0.2 | 0.3 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.1 | 1.9 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.1 | 0.5 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.1 | 5.6 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 0.6 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.1 | 2.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 13.0 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.1 | 2.4 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.1 | 2.0 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.1 | 0.1 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
| 0.1 | 5.4 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.1 | 3.8 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 1.2 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
| 0.1 | 0.7 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 2.6 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.1 | 0.4 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.1 | 3.6 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.1 | 0.3 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
| 0.1 | 1.1 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 2.1 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.1 | 0.6 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.1 | 1.7 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.1 | 1.4 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 2.3 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.1 | 0.3 | REACTOME SIGNALING BY ILS | Genes involved in Signaling by Interleukins |
| 0.1 | 0.9 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.1 | 0.5 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.1 | 0.6 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.1 | 2.0 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.1 | 0.5 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.1 | 0.9 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.1 | 0.1 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
| 0.1 | 0.2 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
| 0.1 | 0.8 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 3.5 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.1 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
| 0.0 | 0.1 | REACTOME ACETYLCHOLINE BINDING AND DOWNSTREAM EVENTS | Genes involved in Acetylcholine Binding And Downstream Events |
| 0.0 | 0.6 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
| 0.0 | 2.2 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 1.9 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.0 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.0 | 0.7 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.6 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.0 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.7 | REACTOME METABOLISM OF NUCLEOTIDES | Genes involved in Metabolism of nucleotides |
| 0.0 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.0 | 0.1 | REACTOME RNA POL II TRANSCRIPTION | Genes involved in RNA Polymerase II Transcription |
| 0.0 | 0.3 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 1.0 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.5 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |