PRJNA375882: Comprehensive Mouse Transcriptomic BodyMap
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Klf6
|
ENSMUSG00000000078.8 | Klf6 |
|
Patz1
|
ENSMUSG00000020453.18 | Patz1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Klf6 | mm39_v1_chr13_+_5911481_5911521 | -0.30 | 1.1e-02 | Click! |
| Patz1 | mm39_v1_chr11_+_3239165_3239281 | -0.13 | 2.6e-01 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr11_+_70548022 | 11.19 |
ENSMUST00000157027.8
ENSMUST00000072841.12 ENSMUST00000108548.8 ENSMUST00000126241.8 |
Eno3
|
enolase 3, beta muscle |
| chr19_-_5475002 | 7.64 |
ENSMUST00000025853.16
|
Drap1
|
Dr1 associated protein 1 (negative cofactor 2 alpha) |
| chr19_-_5474934 | 7.63 |
ENSMUST00000113674.8
|
Drap1
|
Dr1 associated protein 1 (negative cofactor 2 alpha) |
| chr7_+_44984681 | 7.53 |
ENSMUST00000085351.7
|
Hrc
|
histidine rich calcium binding protein |
| chr19_-_5474787 | 7.28 |
ENSMUST00000148219.9
|
Drap1
|
Dr1 associated protein 1 (negative cofactor 2 alpha) |
| chr6_-_52168675 | 6.77 |
ENSMUST00000101395.3
|
Hoxa4
|
homeobox A4 |
| chr11_+_69826603 | 6.70 |
ENSMUST00000018698.12
|
Ybx2
|
Y box protein 2 |
| chr3_+_104688363 | 6.61 |
ENSMUST00000002298.7
|
Ppm1j
|
protein phosphatase 1J |
| chr14_-_20844074 | 6.49 |
ENSMUST00000080440.14
ENSMUST00000100837.11 ENSMUST00000071816.7 |
Camk2g
|
calcium/calmodulin-dependent protein kinase II gamma |
| chr7_-_99276310 | 6.46 |
ENSMUST00000178124.3
|
Tpbgl
|
trophoblast glycoprotein-like |
| chr11_+_69826719 | 6.37 |
ENSMUST00000149194.8
|
Ybx2
|
Y box protein 2 |
| chr17_+_29709723 | 6.15 |
ENSMUST00000024811.9
|
Pim1
|
proviral integration site 1 |
| chr6_-_72876686 | 5.96 |
ENSMUST00000206378.2
|
Kcmf1
|
potassium channel modulatory factor 1 |
| chr7_+_45063079 | 5.93 |
ENSMUST00000058879.8
|
Ntf5
|
neurotrophin 5 |
| chr7_+_44984723 | 5.75 |
ENSMUST00000211327.2
|
Hrc
|
histidine rich calcium binding protein |
| chr7_-_126625739 | 5.56 |
ENSMUST00000205461.2
|
Maz
|
MYC-associated zinc finger protein (purine-binding transcription factor) |
| chr3_+_22130994 | 5.53 |
ENSMUST00000200793.4
ENSMUST00000200943.4 |
Tbl1xr1
|
transducin (beta)-like 1X-linked receptor 1 |
| chr18_+_64473091 | 5.49 |
ENSMUST00000175965.10
|
Onecut2
|
one cut domain, family member 2 |
| chr6_+_120643323 | 5.43 |
ENSMUST00000112686.8
|
Cecr2
|
CECR2, histone acetyl-lysine reader |
| chr11_-_69871320 | 5.28 |
ENSMUST00000143175.2
|
Elp5
|
elongator acetyltransferase complex subunit 5 |
| chr3_+_22130866 | 5.15 |
ENSMUST00000202747.4
|
Tbl1xr1
|
transducin (beta)-like 1X-linked receptor 1 |
| chr19_-_4927910 | 5.07 |
ENSMUST00000006626.5
|
Actn3
|
actinin alpha 3 |
| chr19_-_45731312 | 4.96 |
ENSMUST00000026241.12
ENSMUST00000026240.14 ENSMUST00000111928.8 |
Fgf8
|
fibroblast growth factor 8 |
| chrX_+_158410229 | 4.95 |
ENSMUST00000112456.9
|
Sh3kbp1
|
SH3-domain kinase binding protein 1 |
| chr19_-_45731290 | 4.82 |
ENSMUST00000111927.8
|
Fgf8
|
fibroblast growth factor 8 |
| chr14_+_55813074 | 4.79 |
ENSMUST00000022826.7
|
Fitm1
|
fat storage-inducing transmembrane protein 1 |
| chr14_-_52252003 | 4.77 |
ENSMUST00000226522.2
|
Zfp219
|
zinc finger protein 219 |
| chr4_-_3938352 | 4.73 |
ENSMUST00000003369.10
|
Plag1
|
pleiomorphic adenoma gene 1 |
| chr7_-_126625657 | 4.72 |
ENSMUST00000205568.2
|
Maz
|
MYC-associated zinc finger protein (purine-binding transcription factor) |
| chr17_-_46991709 | 4.70 |
ENSMUST00000233524.2
ENSMUST00000233733.2 ENSMUST00000071841.7 ENSMUST00000165007.9 |
Klhdc3
|
kelch domain containing 3 |
| chr11_-_88608958 | 4.66 |
ENSMUST00000107908.2
|
Msi2
|
musashi RNA-binding protein 2 |
| chr1_+_92759324 | 4.64 |
ENSMUST00000045970.8
|
Gpc1
|
glypican 1 |
| chr7_+_27879650 | 4.55 |
ENSMUST00000172467.8
|
Dyrk1b
|
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1b |
| chrX_+_72760183 | 4.53 |
ENSMUST00000002084.14
|
Abcd1
|
ATP-binding cassette, sub-family D (ALD), member 1 |
| chr12_-_112893382 | 4.43 |
ENSMUST00000075827.5
|
Jag2
|
jagged 2 |
| chr11_-_59029996 | 4.41 |
ENSMUST00000219084.3
|
Obscn
|
obscurin, cytoskeletal calmodulin and titin-interacting RhoGEF |
| chr3_+_34074222 | 4.39 |
ENSMUST00000167354.8
ENSMUST00000198051.5 ENSMUST00000197694.5 ENSMUST00000200392.5 |
Fxr1
|
fragile X mental retardation gene 1, autosomal homolog |
| chr19_+_41970148 | 4.35 |
ENSMUST00000026170.3
|
Ubtd1
|
ubiquitin domain containing 1 |
| chr1_-_17168063 | 4.25 |
ENSMUST00000038382.5
|
Jph1
|
junctophilin 1 |
| chr17_+_27775637 | 4.24 |
ENSMUST00000117254.9
ENSMUST00000231243.2 ENSMUST00000231358.2 ENSMUST00000118570.2 ENSMUST00000231796.2 |
Hmga1
|
high mobility group AT-hook 1 |
| chr9_-_119408047 | 4.18 |
ENSMUST00000117911.8
ENSMUST00000120420.2 |
Scn5a
|
sodium channel, voltage-gated, type V, alpha |
| chr11_-_88609048 | 4.18 |
ENSMUST00000107909.8
|
Msi2
|
musashi RNA-binding protein 2 |
| chr11_-_97913420 | 4.10 |
ENSMUST00000103144.10
ENSMUST00000017552.13 ENSMUST00000092736.11 ENSMUST00000107562.2 |
Cacnb1
|
calcium channel, voltage-dependent, beta 1 subunit |
| chr10_-_23226034 | 4.08 |
ENSMUST00000219315.2
|
Eya4
|
EYA transcriptional coactivator and phosphatase 4 |
| chr17_-_74601769 | 4.04 |
ENSMUST00000078459.8
ENSMUST00000232989.2 |
Memo1
|
mediator of cell motility 1 |
| chr5_+_35546363 | 4.01 |
ENSMUST00000172923.2
ENSMUST00000087674.6 |
Hmx1
|
H6 homeobox 1 |
| chr19_-_5474509 | 3.92 |
ENSMUST00000136579.3
ENSMUST00000113673.9 |
Drap1
|
Dr1 associated protein 1 (negative cofactor 2 alpha) |
| chr14_-_20844034 | 3.88 |
ENSMUST00000226630.2
|
Camk2g
|
calcium/calmodulin-dependent protein kinase II gamma |
| chr10_-_128727542 | 3.85 |
ENSMUST00000026408.7
|
Gdf11
|
growth differentiation factor 11 |
| chr16_+_76810588 | 3.84 |
ENSMUST00000239066.2
ENSMUST00000023580.8 |
Usp25
|
ubiquitin specific peptidase 25 |
| chr17_+_27775613 | 3.77 |
ENSMUST00000231780.2
ENSMUST00000232253.2 ENSMUST00000232552.2 ENSMUST00000117600.9 |
Hmga1
|
high mobility group AT-hook 1 |
| chr7_+_19016536 | 3.77 |
ENSMUST00000032559.17
|
Rtn2
|
reticulon 2 (Z-band associated protein) |
| chr17_+_27775471 | 3.72 |
ENSMUST00000118599.9
ENSMUST00000232265.2 ENSMUST00000232013.2 ENSMUST00000114888.11 ENSMUST00000231874.2 ENSMUST00000119486.9 ENSMUST00000231825.2 ENSMUST00000231866.2 |
Hmga1
|
high mobility group AT-hook 1 |
| chr6_-_72876269 | 3.70 |
ENSMUST00000204598.3
|
Kcmf1
|
potassium channel modulatory factor 1 |
| chr7_+_19024994 | 3.69 |
ENSMUST00000108468.5
|
Rtn2
|
reticulon 2 (Z-band associated protein) |
| chr2_-_31973795 | 3.64 |
ENSMUST00000056406.7
|
Fam78a
|
family with sequence similarity 78, member A |
| chr7_-_126625617 | 3.62 |
ENSMUST00000032916.6
|
Maz
|
MYC-associated zinc finger protein (purine-binding transcription factor) |
| chr11_-_48707763 | 3.60 |
ENSMUST00000140800.2
|
Trim41
|
tripartite motif-containing 41 |
| chr2_-_25911691 | 3.59 |
ENSMUST00000036509.14
|
Ubac1
|
ubiquitin associated domain containing 1 |
| chr7_+_126376319 | 3.58 |
ENSMUST00000132643.2
|
Ypel3
|
yippee like 3 |
| chr4_-_43669141 | 3.54 |
ENSMUST00000056474.7
|
Fam221b
|
family with sequence similarity 221, member B |
| chr10_+_3316057 | 3.50 |
ENSMUST00000043374.7
|
Ppp1r14c
|
protein phosphatase 1, regulatory inhibitor subunit 14C |
| chr6_-_72876882 | 3.50 |
ENSMUST00000068697.11
|
Kcmf1
|
potassium channel modulatory factor 1 |
| chr15_-_76406602 | 3.49 |
ENSMUST00000096365.5
|
Scrt1
|
scratch family zinc finger 1 |
| chr2_-_25911544 | 3.47 |
ENSMUST00000136750.3
|
Ubac1
|
ubiquitin associated domain containing 1 |
| chr1_-_180641099 | 3.44 |
ENSMUST00000159789.2
ENSMUST00000081026.11 |
H3f3a
|
H3.3 histone A |
| chr2_-_113883285 | 3.42 |
ENSMUST00000090269.7
|
Actc1
|
actin, alpha, cardiac muscle 1 |
| chr10_-_53255959 | 3.41 |
ENSMUST00000220443.2
|
Cep85l
|
centrosomal protein 85-like |
| chr12_-_104439589 | 3.40 |
ENSMUST00000021513.6
|
Gsc
|
goosecoid homeobox |
| chr3_+_34074048 | 3.39 |
ENSMUST00000001620.13
|
Fxr1
|
fragile X mental retardation gene 1, autosomal homolog |
| chr10_+_3316505 | 3.37 |
ENSMUST00000217573.2
|
Ppp1r14c
|
protein phosphatase 1, regulatory inhibitor subunit 14C |
| chr4_+_3938881 | 3.37 |
ENSMUST00000108386.8
ENSMUST00000121110.8 ENSMUST00000149544.8 |
Chchd7
|
coiled-coil-helix-coiled-coil-helix domain containing 7 |
| chr17_+_74645936 | 3.33 |
ENSMUST00000224711.2
ENSMUST00000024869.8 ENSMUST00000233611.2 |
Spast
|
spastin |
| chr14_-_52252318 | 3.33 |
ENSMUST00000228051.2
|
Zfp219
|
zinc finger protein 219 |
| chr1_-_183766195 | 3.33 |
ENSMUST00000050306.8
|
1700056E22Rik
|
RIKEN cDNA 1700056E22 gene |
| chr9_-_103242737 | 3.27 |
ENSMUST00000072249.13
ENSMUST00000189896.2 |
Cdv3
|
carnitine deficiency-associated gene expressed in ventricle 3 |
| chr9_+_110592709 | 3.23 |
ENSMUST00000079784.12
|
Myl3
|
myosin, light polypeptide 3 |
| chr18_+_35963353 | 3.21 |
ENSMUST00000235169.2
|
Cxxc5
|
CXXC finger 5 |
| chr5_+_33787249 | 3.18 |
ENSMUST00000181102.2
|
Gm9903
|
predicted gene 9903 |
| chr12_-_76756772 | 3.18 |
ENSMUST00000166101.2
|
Sptb
|
spectrin beta, erythrocytic |
| chr9_-_57743989 | 3.17 |
ENSMUST00000164010.8
ENSMUST00000171444.8 ENSMUST00000098686.4 |
Arid3b
|
AT rich interactive domain 3B (BRIGHT-like) |
| chr12_+_108145997 | 3.17 |
ENSMUST00000101055.5
|
Ccnk
|
cyclin K |
| chr7_-_127307898 | 3.13 |
ENSMUST00000207019.2
|
Bcl7c
|
B cell CLL/lymphoma 7C |
| chr3_+_22130779 | 3.13 |
ENSMUST00000193734.6
|
Tbl1xr1
|
transducin (beta)-like 1X-linked receptor 1 |
| chr1_-_9770434 | 3.12 |
ENSMUST00000088658.11
|
Mybl1
|
myeloblastosis oncogene-like 1 |
| chr6_+_29433247 | 3.10 |
ENSMUST00000101617.9
ENSMUST00000065090.8 |
Flnc
|
filamin C, gamma |
| chr9_-_50663571 | 3.10 |
ENSMUST00000042790.5
|
Hspb2
|
heat shock protein 2 |
| chr4_+_129030710 | 3.09 |
ENSMUST00000102600.4
|
Fndc5
|
fibronectin type III domain containing 5 |
| chr3_+_99161070 | 3.09 |
ENSMUST00000029462.10
|
Tbx15
|
T-box 15 |
| chr1_-_160862364 | 3.08 |
ENSMUST00000177003.2
ENSMUST00000159250.9 ENSMUST00000162226.9 |
Zbtb37
|
zinc finger and BTB domain containing 37 |
| chr17_+_31783708 | 3.06 |
ENSMUST00000097352.11
ENSMUST00000237248.2 ENSMUST00000235869.2 ENSMUST00000175806.9 |
Pknox1
|
Pbx/knotted 1 homeobox |
| chr19_+_6952580 | 3.04 |
ENSMUST00000237084.2
ENSMUST00000236218.2 ENSMUST00000237235.2 |
Ppp1r14b
|
protein phosphatase 1, regulatory inhibitor subunit 14B |
| chr11_+_103061905 | 3.03 |
ENSMUST00000042286.12
ENSMUST00000218163.2 |
Fmnl1
|
formin-like 1 |
| chr9_+_65583852 | 3.02 |
ENSMUST00000136166.3
|
Oaz2
|
ornithine decarboxylase antizyme 2 |
| chr1_-_180641159 | 3.00 |
ENSMUST00000162118.8
ENSMUST00000159685.2 ENSMUST00000161308.8 |
H3f3a
|
H3.3 histone A |
| chr4_+_3938903 | 2.99 |
ENSMUST00000121210.8
ENSMUST00000121651.8 ENSMUST00000041122.11 ENSMUST00000120732.8 ENSMUST00000119307.8 ENSMUST00000123769.8 |
Chchd7
|
coiled-coil-helix-coiled-coil-helix domain containing 7 |
| chr7_-_28824440 | 2.99 |
ENSMUST00000214374.2
ENSMUST00000179893.9 ENSMUST00000032813.10 |
Ryr1
|
ryanodine receptor 1, skeletal muscle |
| chr12_+_112586465 | 2.99 |
ENSMUST00000021726.8
|
Adssl1
|
adenylosuccinate synthetase like 1 |
| chr12_+_32870334 | 2.99 |
ENSMUST00000020886.9
|
Nampt
|
nicotinamide phosphoribosyltransferase |
| chr11_+_105858764 | 2.99 |
ENSMUST00000001963.14
|
Ace
|
angiotensin I converting enzyme (peptidyl-dipeptidase A) 1 |
| chr17_+_48047955 | 2.98 |
ENSMUST00000086932.10
|
Tfeb
|
transcription factor EB |
| chr3_+_130904000 | 2.97 |
ENSMUST00000029611.14
ENSMUST00000106341.9 ENSMUST00000066849.13 |
Lef1
|
lymphoid enhancer binding factor 1 |
| chr2_-_38177182 | 2.96 |
ENSMUST00000130472.8
|
Dennd1a
|
DENN/MADD domain containing 1A |
| chr2_+_172864153 | 2.95 |
ENSMUST00000173997.2
|
Rbm38
|
RNA binding motif protein 38 |
| chr4_-_91260182 | 2.94 |
ENSMUST00000176362.2
|
Elavl2
|
ELAV like RNA binding protein 1 |
| chr17_+_30224003 | 2.94 |
ENSMUST00000057897.10
|
Zfand3
|
zinc finger, AN1-type domain 3 |
| chr8_-_106140106 | 2.93 |
ENSMUST00000167294.8
ENSMUST00000063071.13 |
Kctd19
|
potassium channel tetramerisation domain containing 19 |
| chr4_+_41135730 | 2.91 |
ENSMUST00000040008.4
|
Ube2r2
|
ubiquitin-conjugating enzyme E2R 2 |
| chr19_-_29783389 | 2.91 |
ENSMUST00000177155.8
|
9930021J03Rik
|
RIKEN cDNA 9930021J03 gene |
| chrX_+_72760318 | 2.90 |
ENSMUST00000114461.3
|
Abcd1
|
ATP-binding cassette, sub-family D (ALD), member 1 |
| chr13_+_35925296 | 2.89 |
ENSMUST00000163595.3
|
Cdyl
|
chromodomain protein, Y chromosome-like |
| chr4_-_151946219 | 2.88 |
ENSMUST00000097774.9
|
Camta1
|
calmodulin binding transcription activator 1 |
| chr4_+_124594492 | 2.86 |
ENSMUST00000106199.10
ENSMUST00000038684.6 |
Fhl3
|
four and a half LIM domains 3 |
| chr7_+_27291126 | 2.84 |
ENSMUST00000167435.8
|
Akt2
|
thymoma viral proto-oncogene 2 |
| chr1_-_180641430 | 2.84 |
ENSMUST00000162814.8
|
H3f3a
|
H3.3 histone A |
| chr15_-_76406102 | 2.84 |
ENSMUST00000164703.2
|
Scrt1
|
scratch family zinc finger 1 |
| chr16_-_18405709 | 2.84 |
ENSMUST00000232335.2
|
Tbx1
|
T-box 1 |
| chr16_+_35803674 | 2.83 |
ENSMUST00000004054.13
|
Kpna1
|
karyopherin (importin) alpha 1 |
| chr11_+_69871952 | 2.83 |
ENSMUST00000108593.8
|
Ctdnep1
|
CTD nuclear envelope phosphatase 1 |
| chr4_-_120144546 | 2.83 |
ENSMUST00000102656.4
|
Foxo6
|
forkhead box O6 |
| chr4_-_141345549 | 2.81 |
ENSMUST00000053263.9
|
Tmem82
|
transmembrane protein 82 |
| chr9_-_103243039 | 2.77 |
ENSMUST00000035484.11
|
Cdv3
|
carnitine deficiency-associated gene expressed in ventricle 3 |
| chr5_+_129802127 | 2.75 |
ENSMUST00000086046.10
ENSMUST00000186265.6 |
Nipsnap2
|
nipsnap homolog 2 |
| chr19_+_45139098 | 2.74 |
ENSMUST00000026236.11
|
Tlx1
|
T cell leukemia, homeobox 1 |
| chr7_-_127307791 | 2.74 |
ENSMUST00000205977.2
|
Bcl7c
|
B cell CLL/lymphoma 7C |
| chr4_+_99544536 | 2.73 |
ENSMUST00000087285.5
|
Foxd3
|
forkhead box D3 |
| chr15_+_26309125 | 2.72 |
ENSMUST00000126304.2
ENSMUST00000140840.8 ENSMUST00000152841.2 |
Marchf11
|
membrane associated ring-CH-type finger 11 |
| chr2_-_160208977 | 2.71 |
ENSMUST00000099126.5
|
Mafb
|
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein B (avian) |
| chr3_-_8732316 | 2.71 |
ENSMUST00000042412.5
|
Hey1
|
hairy/enhancer-of-split related with YRPW motif 1 |
| chr1_-_80318197 | 2.70 |
ENSMUST00000163119.8
|
Cul3
|
cullin 3 |
| chr3_+_89680867 | 2.69 |
ENSMUST00000038356.13
|
Ube2q1
|
ubiquitin-conjugating enzyme E2Q family member 1 |
| chr2_-_26096547 | 2.68 |
ENSMUST00000028302.8
|
Lhx3
|
LIM homeobox protein 3 |
| chr5_-_41865461 | 2.65 |
ENSMUST00000201422.4
|
Rab28
|
RAB28, member RAS oncogene family |
| chr9_+_43996236 | 2.65 |
ENSMUST00000065461.9
ENSMUST00000176416.8 |
Usp2
|
ubiquitin specific peptidase 2 |
| chr2_+_172863688 | 2.64 |
ENSMUST00000029014.16
|
Rbm38
|
RNA binding motif protein 38 |
| chr11_-_5211558 | 2.63 |
ENSMUST00000020662.15
|
Kremen1
|
kringle containing transmembrane protein 1 |
| chr2_+_78699360 | 2.62 |
ENSMUST00000028398.14
|
Ube2e3
|
ubiquitin-conjugating enzyme E2E 3 |
| chr1_+_171157137 | 2.61 |
ENSMUST00000142063.8
ENSMUST00000129116.8 |
Dedd
|
death effector domain-containing |
| chr17_-_10538253 | 2.61 |
ENSMUST00000233828.2
ENSMUST00000233645.2 ENSMUST00000042296.9 |
Qk
|
quaking, KH domain containing RNA binding |
| chr10_-_80223475 | 2.60 |
ENSMUST00000105350.3
|
Mex3d
|
mex3 RNA binding family member D |
| chr17_-_74602469 | 2.60 |
ENSMUST00000233144.2
|
Memo1
|
mediator of cell motility 1 |
| chr11_-_69872050 | 2.57 |
ENSMUST00000108594.8
|
Elp5
|
elongator acetyltransferase complex subunit 5 |
| chr12_+_108145802 | 2.55 |
ENSMUST00000221167.2
|
Ccnk
|
cyclin K |
| chr2_+_152873772 | 2.55 |
ENSMUST00000037235.7
|
Xkr7
|
X-linked Kx blood group related 7 |
| chr8_-_48128164 | 2.52 |
ENSMUST00000080353.3
|
Ing2
|
inhibitor of growth family, member 2 |
| chr12_+_112586501 | 2.52 |
ENSMUST00000180015.9
|
Adssl1
|
adenylosuccinate synthetase like 1 |
| chr17_+_46991972 | 2.51 |
ENSMUST00000002845.8
|
Mea1
|
male enhanced antigen 1 |
| chr4_-_152080634 | 2.51 |
ENSMUST00000055688.10
|
Phf13
|
PHD finger protein 13 |
| chr9_+_65583826 | 2.50 |
ENSMUST00000153700.9
ENSMUST00000046490.14 |
Oaz2
|
ornithine decarboxylase antizyme 2 |
| chr7_-_24643919 | 2.50 |
ENSMUST00000206705.3
|
Erfl
|
ETS repressor factor like |
| chr17_+_64907697 | 2.49 |
ENSMUST00000086723.10
|
Man2a1
|
mannosidase 2, alpha 1 |
| chr15_-_73056713 | 2.48 |
ENSMUST00000044113.12
|
Ago2
|
argonaute RISC catalytic subunit 2 |
| chr18_-_35788255 | 2.47 |
ENSMUST00000190196.5
|
Prob1
|
proline rich basic protein 1 |
| chr8_+_70945806 | 2.47 |
ENSMUST00000008032.14
|
Crlf1
|
cytokine receptor-like factor 1 |
| chr2_-_181101158 | 2.47 |
ENSMUST00000155535.2
ENSMUST00000029106.13 ENSMUST00000087409.10 |
Zbtb46
|
zinc finger and BTB domain containing 46 |
| chr6_-_84564623 | 2.46 |
ENSMUST00000205228.3
|
Cyp26b1
|
cytochrome P450, family 26, subfamily b, polypeptide 1 |
| chr2_+_160573604 | 2.45 |
ENSMUST00000174885.2
ENSMUST00000109462.8 |
Plcg1
|
phospholipase C, gamma 1 |
| chr8_+_73072877 | 2.44 |
ENSMUST00000067912.8
|
Klf2
|
Kruppel-like factor 2 (lung) |
| chr3_+_28317354 | 2.44 |
ENSMUST00000159236.9
|
Tnik
|
TRAF2 and NCK interacting kinase |
| chr2_+_18681812 | 2.43 |
ENSMUST00000028071.13
|
Bmi1
|
Bmi1 polycomb ring finger oncogene |
| chr10_-_84938350 | 2.43 |
ENSMUST00000059383.8
ENSMUST00000216889.2 |
Fhl4
|
four and a half LIM domains 4 |
| chr8_+_84724130 | 2.42 |
ENSMUST00000095228.5
|
Samd1
|
sterile alpha motif domain containing 1 |
| chr4_-_119151717 | 2.41 |
ENSMUST00000079644.13
|
Ybx1
|
Y box protein 1 |
| chr15_-_100945261 | 2.39 |
ENSMUST00000222611.2
|
Tmdd1
|
transmembrane and death domain 1 |
| chr19_+_6952319 | 2.39 |
ENSMUST00000070850.8
|
Ppp1r14b
|
protein phosphatase 1, regulatory inhibitor subunit 14B |
| chr17_+_46991926 | 2.39 |
ENSMUST00000233491.2
|
Mea1
|
male enhanced antigen 1 |
| chr11_-_48708159 | 2.38 |
ENSMUST00000047145.14
|
Trim41
|
tripartite motif-containing 41 |
| chr7_-_103792462 | 2.38 |
ENSMUST00000057254.6
|
Ubqln3
|
ubiquilin 3 |
| chr11_-_106050927 | 2.38 |
ENSMUST00000045923.10
|
Limd2
|
LIM domain containing 2 |
| chr11_+_23256883 | 2.38 |
ENSMUST00000180046.8
|
Usp34
|
ubiquitin specific peptidase 34 |
| chr9_-_121621544 | 2.36 |
ENSMUST00000035110.11
|
Hhatl
|
hedgehog acyltransferase-like |
| chr7_+_16043502 | 2.36 |
ENSMUST00000002152.13
|
Bbc3
|
BCL2 binding component 3 |
| chr2_-_44817173 | 2.34 |
ENSMUST00000130991.8
|
Gtdc1
|
glycosyltransferase-like domain containing 1 |
| chr7_+_18788608 | 2.33 |
ENSMUST00000035521.11
ENSMUST00000076887.6 |
Rsph6a
|
radial spoke head 6 homolog A (Chlamydomonas) |
| chr9_+_106080307 | 2.32 |
ENSMUST00000024047.12
ENSMUST00000216348.2 |
Twf2
|
twinfilin actin binding protein 2 |
| chr1_-_172047282 | 2.31 |
ENSMUST00000170700.2
ENSMUST00000003554.11 |
Casq1
|
calsequestrin 1 |
| chr15_-_103248512 | 2.31 |
ENSMUST00000168828.3
|
Zfp385a
|
zinc finger protein 385A |
| chr16_+_35803794 | 2.29 |
ENSMUST00000173555.8
|
Kpna1
|
karyopherin (importin) alpha 1 |
| chr4_-_151946124 | 2.29 |
ENSMUST00000169423.9
|
Camta1
|
calmodulin binding transcription activator 1 |
| chrX_-_58179754 | 2.29 |
ENSMUST00000033473.12
|
Fgf13
|
fibroblast growth factor 13 |
| chr15_-_103231921 | 2.28 |
ENSMUST00000229551.2
|
Zfp385a
|
zinc finger protein 385A |
| chr1_+_75336965 | 2.28 |
ENSMUST00000027409.10
|
Des
|
desmin |
| chr3_+_96011810 | 2.28 |
ENSMUST00000132980.8
ENSMUST00000138206.8 ENSMUST00000090785.9 ENSMUST00000035519.12 |
Otud7b
|
OTU domain containing 7B |
| chr2_-_38177359 | 2.28 |
ENSMUST00000102787.10
|
Dennd1a
|
DENN/MADD domain containing 1A |
| chr5_+_122296322 | 2.26 |
ENSMUST00000102528.11
ENSMUST00000086294.11 |
Ppp1cc
|
protein phosphatase 1 catalytic subunit gamma |
| chr4_+_135975243 | 2.25 |
ENSMUST00000102533.11
ENSMUST00000143942.2 |
Tcea3
|
transcription elongation factor A (SII), 3 |
| chr11_-_105347500 | 2.22 |
ENSMUST00000049995.10
ENSMUST00000100332.4 |
Marchf10
|
membrane associated ring-CH-type finger 10 |
| chr9_-_48747232 | 2.21 |
ENSMUST00000093852.5
|
Zbtb16
|
zinc finger and BTB domain containing 16 |
| chr9_+_95441652 | 2.21 |
ENSMUST00000079597.7
|
Paqr9
|
progestin and adipoQ receptor family member IX |
| chr7_+_16044336 | 2.21 |
ENSMUST00000136781.2
|
Bbc3
|
BCL2 binding component 3 |
| chr1_+_177270101 | 2.21 |
ENSMUST00000194319.2
|
Zbtb18
|
zinc finger and BTB domain containing 18 |
| chr17_-_15181491 | 2.20 |
ENSMUST00000024657.12
|
Phf10
|
PHD finger protein 10 |
| chr7_+_126376099 | 2.19 |
ENSMUST00000038614.12
ENSMUST00000170882.8 ENSMUST00000106359.2 ENSMUST00000106357.8 ENSMUST00000145762.8 |
Ypel3
|
yippee like 3 |
| chr10_+_80165961 | 2.18 |
ENSMUST00000186864.7
ENSMUST00000040081.7 |
Reep6
|
receptor accessory protein 6 |
| chr14_-_31552608 | 2.18 |
ENSMUST00000014640.9
|
Ankrd28
|
ankyrin repeat domain 28 |
| chr6_-_52237765 | 2.17 |
ENSMUST00000147595.7
|
Hoxa13
|
homeobox A13 |
| chr10_+_84412490 | 2.17 |
ENSMUST00000020223.8
|
Tcp11l2
|
t-complex 11 (mouse) like 2 |
| chr7_-_81104423 | 2.17 |
ENSMUST00000178892.3
ENSMUST00000098331.10 |
Cpeb1
|
cytoplasmic polyadenylation element binding protein 1 |
| chr11_-_106811507 | 2.17 |
ENSMUST00000103067.10
|
Smurf2
|
SMAD specific E3 ubiquitin protein ligase 2 |
| chr3_+_95067759 | 2.17 |
ENSMUST00000131742.8
ENSMUST00000090823.8 ENSMUST00000090821.10 |
Sema6c
|
sema domain, transmembrane domain (TM), and cytoplasmic domain, (semaphorin) 6C |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.3 | 13.3 | GO:1902081 | regulation of calcium ion import into sarcoplasmic reticulum(GO:1902080) negative regulation of calcium ion import into sarcoplasmic reticulum(GO:1902081) |
| 2.3 | 6.8 | GO:0014728 | regulation of the force of skeletal muscle contraction(GO:0014728) regulation of skeletal muscle contraction by chemo-mechanical energy conversion(GO:0014862) |
| 2.0 | 5.9 | GO:0061193 | taste bud development(GO:0061193) |
| 2.0 | 9.8 | GO:0060128 | corticotropin hormone secreting cell differentiation(GO:0060128) |
| 1.9 | 9.3 | GO:1902340 | telomeric heterochromatin assembly(GO:0031509) negative regulation of chromosome condensation(GO:1902340) |
| 1.8 | 7.3 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 1.5 | 4.6 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 1.5 | 16.7 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 1.5 | 6.0 | GO:1902164 | mRNA localization resulting in posttranscriptional regulation of gene expression(GO:0010609) positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
| 1.4 | 8.5 | GO:2001037 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
| 1.4 | 5.7 | GO:0007522 | visceral muscle development(GO:0007522) |
| 1.4 | 5.6 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 1.4 | 5.5 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 1.2 | 6.0 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 1.1 | 4.6 | GO:0086047 | membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
| 1.1 | 2.3 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 1.1 | 3.4 | GO:0021682 | nerve maturation(GO:0021682) |
| 1.1 | 4.5 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 1.1 | 5.6 | GO:0030576 | Cajal body organization(GO:0030576) |
| 1.1 | 3.2 | GO:1990164 | histone H2A phosphorylation(GO:1990164) |
| 1.1 | 4.3 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 1.1 | 4.3 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 1.1 | 3.2 | GO:0060821 | inactivation of X chromosome by DNA methylation(GO:0060821) |
| 1.0 | 1.0 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
| 1.0 | 13.2 | GO:0060613 | fat pad development(GO:0060613) |
| 1.0 | 3.0 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 1.0 | 4.0 | GO:1903760 | regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) |
| 1.0 | 3.9 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 1.0 | 4.8 | GO:1902163 | negative regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902163) |
| 1.0 | 2.9 | GO:2000011 | adaxial/abaxial pattern specification(GO:0009955) regulation of adaxial/abaxial pattern formation(GO:2000011) |
| 0.9 | 2.7 | GO:0001868 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.9 | 2.7 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.9 | 6.2 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.9 | 5.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.9 | 3.5 | GO:0009816 | defense response to bacterium, incompatible interaction(GO:0009816) regulation of defense response to bacterium, incompatible interaction(GO:1902477) |
| 0.9 | 4.3 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.9 | 2.6 | GO:0061723 | glycophagy(GO:0061723) |
| 0.9 | 5.1 | GO:0099527 | postsynapse to nucleus signaling pathway(GO:0099527) |
| 0.8 | 2.5 | GO:2001200 | positive regulation of dendritic cell differentiation(GO:2001200) |
| 0.8 | 0.8 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
| 0.8 | 1.6 | GO:0032470 | positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) |
| 0.8 | 2.4 | GO:0006500 | N-terminal protein palmitoylation(GO:0006500) |
| 0.8 | 3.1 | GO:0003017 | lymph circulation(GO:0003017) |
| 0.8 | 3.9 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.8 | 4.6 | GO:0071486 | cellular response to light intensity(GO:0071484) cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
| 0.8 | 3.8 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.8 | 3.0 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
| 0.8 | 6.0 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.8 | 2.3 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.7 | 2.2 | GO:1905223 | epicardium morphogenesis(GO:1905223) |
| 0.7 | 2.2 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
| 0.7 | 2.2 | GO:0045660 | positive regulation of neutrophil differentiation(GO:0045660) |
| 0.7 | 2.2 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 0.7 | 7.3 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.7 | 2.1 | GO:2001034 | positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
| 0.7 | 8.4 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
| 0.7 | 2.1 | GO:0060217 | hemangioblast cell differentiation(GO:0060217) |
| 0.7 | 5.5 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.7 | 2.8 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.7 | 2.8 | GO:2000983 | regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.7 | 3.4 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.7 | 2.1 | GO:0019413 | acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate biosynthetic process(GO:0019542) |
| 0.7 | 3.4 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.7 | 4.0 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.6 | 3.2 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.6 | 1.9 | GO:0010387 | COP9 signalosome assembly(GO:0010387) negative regulation of cardioblast differentiation(GO:0051892) negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.6 | 2.5 | GO:1901675 | negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.6 | 6.9 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.6 | 0.6 | GO:0072554 | blood vessel lumenization(GO:0072554) |
| 0.6 | 0.6 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.6 | 0.6 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.6 | 2.4 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.6 | 6.0 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.6 | 1.8 | GO:0019405 | alditol catabolic process(GO:0019405) |
| 0.6 | 0.6 | GO:1901082 | regulation of relaxation of smooth muscle(GO:1901080) positive regulation of relaxation of smooth muscle(GO:1901082) |
| 0.6 | 3.0 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
| 0.6 | 0.6 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 0.6 | 1.8 | GO:1904826 | regulation of hydrogen sulfide biosynthetic process(GO:1904826) positive regulation of hydrogen sulfide biosynthetic process(GO:1904828) |
| 0.6 | 4.1 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.6 | 2.3 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
| 0.6 | 4.5 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.6 | 1.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 0.5 | 2.7 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.5 | 2.2 | GO:0038156 | interleukin-3-mediated signaling pathway(GO:0038156) |
| 0.5 | 4.9 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.5 | 1.1 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.5 | 2.7 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.5 | 1.6 | GO:0006867 | asparagine transport(GO:0006867) positive regulation of glutamine transport(GO:2000487) |
| 0.5 | 2.1 | GO:1904453 | regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
| 0.5 | 3.7 | GO:1900170 | negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 0.5 | 3.7 | GO:0098909 | regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
| 0.5 | 3.7 | GO:0015862 | uridine transport(GO:0015862) |
| 0.5 | 1.6 | GO:2000850 | negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.5 | 1.5 | GO:0014908 | myotube differentiation involved in skeletal muscle regeneration(GO:0014908) |
| 0.5 | 3.1 | GO:1904925 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.5 | 3.5 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.5 | 3.5 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.5 | 1.0 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.5 | 27.2 | GO:0048255 | mRNA stabilization(GO:0048255) |
| 0.5 | 1.5 | GO:0006740 | NADPH regeneration(GO:0006740) |
| 0.5 | 5.9 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.5 | 0.5 | GO:0097494 | regulation of vesicle size(GO:0097494) |
| 0.5 | 1.4 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 0.5 | 1.4 | GO:0036275 | response to 5-fluorouracil(GO:0036275) |
| 0.5 | 0.5 | GO:1904024 | negative regulation of NAD metabolic process(GO:1902689) negative regulation of glucose catabolic process to lactate via pyruvate(GO:1904024) |
| 0.4 | 0.4 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.4 | 1.8 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.4 | 1.3 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.4 | 2.6 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.4 | 2.6 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.4 | 1.3 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
| 0.4 | 7.7 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.4 | 2.1 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.4 | 2.5 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.4 | 1.7 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.4 | 4.5 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.4 | 1.6 | GO:0014735 | regulation of muscle atrophy(GO:0014735) |
| 0.4 | 1.6 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.4 | 1.2 | GO:0045645 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
| 0.4 | 1.2 | GO:0035470 | positive regulation of vascular wound healing(GO:0035470) |
| 0.4 | 2.0 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.4 | 3.9 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.4 | 1.2 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.4 | 5.8 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.4 | 1.2 | GO:0010705 | meiotic DNA double-strand break processing involved in reciprocal meiotic recombination(GO:0010705) |
| 0.4 | 1.1 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
| 0.4 | 1.9 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.4 | 1.1 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
| 0.4 | 1.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.4 | 5.2 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
| 0.4 | 0.7 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 0.4 | 1.1 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.4 | 2.9 | GO:0061718 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.4 | 7.7 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.4 | 0.7 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.4 | 0.7 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
| 0.4 | 1.1 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 0.4 | 0.4 | GO:0002085 | inhibition of neuroepithelial cell differentiation(GO:0002085) |
| 0.4 | 0.4 | GO:0035574 | histone H4-K20 demethylation(GO:0035574) |
| 0.4 | 1.1 | GO:0071707 | immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
| 0.3 | 1.4 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.3 | 1.4 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.3 | 2.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.3 | 0.3 | GO:0003130 | BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) cell-cell signaling involved in cell fate commitment(GO:0045168) |
| 0.3 | 1.0 | GO:0071211 | protein targeting to vacuole involved in autophagy(GO:0071211) |
| 0.3 | 1.4 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.3 | 0.7 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.3 | 1.0 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
| 0.3 | 1.7 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.3 | 2.3 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.3 | 3.0 | GO:0071313 | cellular response to caffeine(GO:0071313) |
| 0.3 | 4.6 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.3 | 0.3 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.3 | 1.3 | GO:0009216 | purine deoxyribonucleoside triphosphate biosynthetic process(GO:0009216) |
| 0.3 | 1.0 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.3 | 0.3 | GO:1905072 | cardiac jelly development(GO:1905072) |
| 0.3 | 2.6 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.3 | 5.2 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
| 0.3 | 1.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.3 | 1.6 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.3 | 1.6 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) negative regulation of defense response to virus by host(GO:0050689) |
| 0.3 | 1.3 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.3 | 3.5 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.3 | 1.3 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.3 | 0.6 | GO:1904954 | canonical Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904954) |
| 0.3 | 1.6 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.3 | 1.3 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.3 | 1.3 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
| 0.3 | 8.8 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.3 | 1.3 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.3 | 2.5 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
| 0.3 | 1.6 | GO:0009996 | negative regulation of cell fate specification(GO:0009996) |
| 0.3 | 3.4 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.3 | 0.9 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.3 | 1.9 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.3 | 1.2 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.3 | 11.0 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
| 0.3 | 1.2 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.3 | 1.2 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.3 | 2.1 | GO:0071499 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
| 0.3 | 0.3 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
| 0.3 | 3.9 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.3 | 0.9 | GO:0003245 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.3 | 4.2 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.3 | 1.8 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.3 | 2.3 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.3 | 1.5 | GO:0002268 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
| 0.3 | 3.2 | GO:0006105 | succinate metabolic process(GO:0006105) |
| 0.3 | 1.2 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.3 | 2.6 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.3 | 4.3 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.3 | 2.0 | GO:0006498 | N-terminal protein lipidation(GO:0006498) N-terminal protein myristoylation(GO:0006499) |
| 0.3 | 1.4 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.3 | 1.1 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
| 0.3 | 0.3 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
| 0.3 | 0.8 | GO:0019230 | proprioception(GO:0019230) |
| 0.3 | 2.8 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.3 | 2.0 | GO:1903753 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of p38MAPK cascade(GO:1903753) |
| 0.3 | 3.6 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
| 0.3 | 0.8 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
| 0.3 | 1.9 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.3 | 0.5 | GO:0051794 | regulation of catagen(GO:0051794) |
| 0.3 | 1.1 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.3 | 2.4 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
| 0.3 | 13.2 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.3 | 0.8 | GO:1904933 | regulation of cell proliferation in midbrain(GO:1904933) |
| 0.3 | 0.8 | GO:0034553 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.3 | 0.8 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.3 | 1.1 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.3 | 3.7 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.3 | 1.1 | GO:0032329 | serine transport(GO:0032329) |
| 0.3 | 5.3 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
| 0.3 | 3.9 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
| 0.3 | 1.6 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
| 0.3 | 2.6 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.3 | 3.9 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.3 | 4.7 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.3 | 1.0 | GO:0010286 | heat acclimation(GO:0010286) |
| 0.3 | 2.8 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.3 | 0.3 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.3 | 1.5 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.3 | 0.8 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
| 0.3 | 4.6 | GO:1902571 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.3 | 1.5 | GO:0033183 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.3 | 3.5 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.3 | 2.5 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
| 0.2 | 1.5 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.2 | 1.0 | GO:0042339 | keratan sulfate metabolic process(GO:0042339) |
| 0.2 | 1.5 | GO:1900085 | negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
| 0.2 | 2.2 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.2 | 0.2 | GO:0044533 | killing by symbiont of host cells(GO:0001907) induction of programmed cell death(GO:0012502) disruption by symbiont of host cell(GO:0044004) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) |
| 0.2 | 2.2 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.2 | 0.7 | GO:1990773 | regulation of matrix metallopeptidase secretion(GO:1904464) matrix metallopeptidase secretion(GO:1990773) |
| 0.2 | 1.2 | GO:0060023 | soft palate development(GO:0060023) |
| 0.2 | 0.5 | GO:0070671 | response to interleukin-12(GO:0070671) |
| 0.2 | 1.4 | GO:0061734 | parkin-mediated mitophagy in response to mitochondrial depolarization(GO:0061734) |
| 0.2 | 1.0 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.2 | 1.4 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
| 0.2 | 1.7 | GO:1901908 | diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.2 | 1.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.2 | 1.7 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.2 | 1.2 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.2 | 1.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.2 | 1.2 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.2 | 0.5 | GO:0021571 | rhombomere 5 development(GO:0021571) |
| 0.2 | 0.5 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.2 | 1.2 | GO:0072014 | proximal tubule development(GO:0072014) |
| 0.2 | 3.7 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.2 | 1.8 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.2 | 0.5 | GO:0002930 | trabecular meshwork development(GO:0002930) |
| 0.2 | 1.1 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.2 | 1.6 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.2 | 1.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.2 | 1.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.2 | 0.7 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.2 | 3.5 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.2 | 0.7 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.2 | 0.6 | GO:0030221 | basophil differentiation(GO:0030221) |
| 0.2 | 1.5 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.2 | 0.9 | GO:1904428 | negative regulation of tubulin deacetylation(GO:1904428) |
| 0.2 | 1.1 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.2 | 0.6 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.2 | 0.4 | GO:0086097 | phospholipase C-activating angiotensin-activated signaling pathway(GO:0086097) |
| 0.2 | 1.3 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.2 | 1.3 | GO:0019659 | glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.2 | 1.3 | GO:0010694 | regulation of alkaline phosphatase activity(GO:0010692) positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.2 | 0.6 | GO:0061439 | renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.2 | 0.8 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.2 | 5.2 | GO:0009299 | mRNA transcription(GO:0009299) |
| 0.2 | 0.4 | GO:0050955 | thermoception(GO:0050955) |
| 0.2 | 0.6 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.2 | 1.6 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.2 | 0.6 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.2 | 1.0 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.2 | 2.2 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.2 | 3.0 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.2 | 0.6 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.2 | 2.0 | GO:0080111 | DNA demethylation(GO:0080111) |
| 0.2 | 0.8 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.2 | 1.6 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.2 | 0.4 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.2 | 1.2 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.2 | 0.2 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.2 | 1.0 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
| 0.2 | 0.4 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.2 | 1.0 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.2 | 2.4 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.2 | 0.8 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.2 | 0.6 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.2 | 1.6 | GO:0033153 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
| 0.2 | 0.6 | GO:0046351 | disaccharide biosynthetic process(GO:0046351) |
| 0.2 | 1.8 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.2 | 0.8 | GO:0061646 | positive regulation of glutamate neurotransmitter secretion in response to membrane depolarization(GO:0061646) |
| 0.2 | 10.7 | GO:0060612 | adipose tissue development(GO:0060612) |
| 0.2 | 2.5 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.2 | 1.9 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.2 | 1.2 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.2 | 0.6 | GO:0046832 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.2 | 3.6 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
| 0.2 | 0.8 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.2 | 2.1 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
| 0.2 | 0.8 | GO:2000588 | positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
| 0.2 | 4.9 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.2 | 0.6 | GO:0060290 | transdifferentiation(GO:0060290) |
| 0.2 | 1.9 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.2 | 2.1 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.2 | 0.6 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
| 0.2 | 1.3 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.2 | 0.4 | GO:1903181 | regulation of dopamine biosynthetic process(GO:1903179) positive regulation of dopamine biosynthetic process(GO:1903181) |
| 0.2 | 3.0 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.2 | 1.5 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.2 | 2.0 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.2 | 1.5 | GO:0051198 | negative regulation of nucleotide catabolic process(GO:0030812) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
| 0.2 | 4.2 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.2 | 1.5 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.2 | 1.8 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.2 | 0.9 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.2 | 1.1 | GO:1903438 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.2 | 1.3 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.2 | 0.5 | GO:0061038 | uterus morphogenesis(GO:0061038) |
| 0.2 | 1.4 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.2 | 1.6 | GO:1901534 | positive regulation of hematopoietic progenitor cell differentiation(GO:1901534) |
| 0.2 | 0.5 | GO:1904117 | response to vasopressin(GO:1904116) cellular response to vasopressin(GO:1904117) |
| 0.2 | 1.4 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.2 | 0.4 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.2 | 3.4 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.2 | 2.8 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.2 | 0.5 | GO:0002380 | immunoglobulin secretion involved in immune response(GO:0002380) |
| 0.2 | 3.7 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.2 | 0.9 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.2 | 0.5 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.2 | 0.7 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
| 0.2 | 2.6 | GO:0006000 | fructose metabolic process(GO:0006000) |
| 0.2 | 3.3 | GO:0061157 | mRNA destabilization(GO:0061157) |
| 0.2 | 4.5 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.2 | 1.0 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.2 | 1.0 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.2 | 0.7 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.2 | 1.5 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.2 | 3.6 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.2 | 2.9 | GO:0009251 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.2 | 2.5 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.2 | 7.1 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.2 | 0.7 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
| 0.2 | 0.5 | GO:0046022 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 0.2 | 4.5 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.2 | 0.5 | GO:0015734 | beta-alanine transport(GO:0001762) taurine transport(GO:0015734) |
| 0.2 | 0.8 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 0.2 | 1.0 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.2 | 0.8 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.2 | 0.7 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.2 | 1.1 | GO:0090042 | tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
| 0.2 | 0.5 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.2 | 0.8 | GO:1902962 | regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902962) negative regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902963) |
| 0.2 | 8.3 | GO:0001958 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.2 | 0.3 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) regulation of adrenergic receptor signaling pathway involved in heart process(GO:1901204) |
| 0.2 | 1.1 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.2 | 0.5 | GO:0010138 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) pyrimidine ribonucleotide salvage(GO:0010138) pyrimidine nucleotide salvage(GO:0032262) UMP salvage(GO:0044206) CMP metabolic process(GO:0046035) |
| 0.2 | 3.0 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.2 | 1.3 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.2 | 0.6 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.2 | 0.6 | GO:0070316 | G0 to G1 transition(GO:0045023) regulation of G0 to G1 transition(GO:0070316) |
| 0.2 | 1.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.2 | 1.1 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.2 | 1.1 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.2 | 0.5 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.2 | 1.7 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.2 | 1.4 | GO:0045002 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) double-strand break repair via single-strand annealing(GO:0045002) |
| 0.2 | 0.9 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.2 | 1.8 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.2 | 0.6 | GO:0032298 | positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.1 | 0.3 | GO:0003190 | atrioventricular valve formation(GO:0003190) |
| 0.1 | 1.2 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
| 0.1 | 0.7 | GO:0035993 | subthalamic nucleus development(GO:0021763) deltoid tuberosity development(GO:0035993) pulmonary vein morphogenesis(GO:0060577) superior vena cava morphogenesis(GO:0060578) |
| 0.1 | 0.4 | GO:1904456 | negative regulation of neuronal action potential(GO:1904456) |
| 0.1 | 0.6 | GO:0080163 | regulation of protein serine/threonine phosphatase activity(GO:0080163) |
| 0.1 | 1.2 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.1 | 0.3 | GO:0071579 | regulation of zinc ion transport(GO:0071579) |
| 0.1 | 1.6 | GO:0010831 | positive regulation of myotube differentiation(GO:0010831) |
| 0.1 | 1.3 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 | 2.0 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
| 0.1 | 2.5 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.1 | 0.4 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.1 | 1.6 | GO:0060307 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) |
| 0.1 | 0.6 | GO:0034031 | coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.1 | 1.4 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.1 | 0.1 | GO:0046619 | optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.1 | 1.0 | GO:0061709 | reticulophagy(GO:0061709) |
| 0.1 | 1.0 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.1 | 1.0 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.1 | 1.3 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 1.3 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.1 | 2.5 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.1 | 1.1 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.1 | 1.0 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
| 0.1 | 1.3 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 | 3.6 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.1 | 1.3 | GO:0006527 | arginine catabolic process(GO:0006527) |
| 0.1 | 0.3 | GO:0021747 | cochlear nucleus development(GO:0021747) |
| 0.1 | 2.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.1 | 0.6 | GO:0031662 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
| 0.1 | 3.2 | GO:0031100 | organ regeneration(GO:0031100) |
| 0.1 | 0.5 | GO:0061187 | regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.1 | 0.8 | GO:0033280 | response to vitamin D(GO:0033280) |
| 0.1 | 0.4 | GO:0042128 | nitrate assimilation(GO:0042128) |
| 0.1 | 0.5 | GO:0034350 | regulation of glial cell apoptotic process(GO:0034350) |
| 0.1 | 2.3 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.1 | 0.4 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) positive regulation of cellular pH reduction(GO:0032849) |
| 0.1 | 0.4 | GO:0060872 | semicircular canal development(GO:0060872) |
| 0.1 | 0.4 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 | 2.0 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.1 | 1.0 | GO:0051715 | cytolysis in other organism(GO:0051715) |
| 0.1 | 0.9 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.1 | 0.6 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 0.1 | 1.8 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
| 0.1 | 1.0 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.1 | 2.6 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.1 | 0.3 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 | 0.6 | GO:0010747 | positive regulation of plasma membrane long-chain fatty acid transport(GO:0010747) |
| 0.1 | 2.7 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 0.1 | 0.3 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 | 0.3 | GO:1900453 | negative regulation of long term synaptic depression(GO:1900453) |
| 0.1 | 0.4 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
| 0.1 | 1.1 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.1 | 0.6 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.1 | 0.4 | GO:0071460 | cellular response to cell-matrix adhesion(GO:0071460) |
| 0.1 | 0.7 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.1 | 0.7 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.1 | 0.6 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.1 | 3.7 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.1 | 0.4 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.1 | 1.1 | GO:0010667 | negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
| 0.1 | 0.2 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.1 | 0.7 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.1 | 0.4 | GO:0086048 | membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 0.1 | 3.1 | GO:0048701 | embryonic cranial skeleton morphogenesis(GO:0048701) |
| 0.1 | 3.2 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 0.8 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.1 | 5.9 | GO:1901998 | toxin transport(GO:1901998) |
| 0.1 | 0.2 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.1 | 4.0 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 0.5 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
| 0.1 | 2.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 | 5.3 | GO:0060122 | inner ear receptor stereocilium organization(GO:0060122) |
| 0.1 | 0.5 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
| 0.1 | 1.9 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.1 | 0.6 | GO:0009804 | coumarin metabolic process(GO:0009804) |
| 0.1 | 9.6 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.1 | 4.9 | GO:0031018 | endocrine pancreas development(GO:0031018) |
| 0.1 | 1.4 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.1 | 0.3 | GO:2000016 | negative regulation of determination of dorsal identity(GO:2000016) |
| 0.1 | 0.5 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 0.1 | 0.3 | GO:0019085 | early viral transcription(GO:0019085) |
| 0.1 | 0.9 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.1 | 0.2 | GO:0097240 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.1 | 0.6 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 1.6 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.1 | 2.2 | GO:0048535 | lymph node development(GO:0048535) |
| 0.1 | 5.8 | GO:0006757 | glycolytic process(GO:0006096) ATP generation from ADP(GO:0006757) |
| 0.1 | 0.3 | GO:1902913 | positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.1 | 0.5 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.1 | 3.5 | GO:0033198 | response to ATP(GO:0033198) |
| 0.1 | 0.8 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.1 | 0.7 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 | 0.9 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.1 | 0.7 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.1 | 0.9 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.1 | 1.1 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.1 | 2.8 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.1 | 0.3 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.1 | 0.1 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
| 0.1 | 1.1 | GO:1902856 | negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 0.1 | 0.4 | GO:0060154 | suppression by virus of host apoptotic process(GO:0019050) modulation by virus of host apoptotic process(GO:0039526) cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 0.1 | 0.7 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
| 0.1 | 0.3 | GO:0032916 | positive regulation of transforming growth factor beta3 production(GO:0032916) chemotaxis to arachidonic acid(GO:0034670) response to arachidonic acid(GO:1904550) |
| 0.1 | 2.8 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.1 | 0.3 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.1 | 0.1 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.1 | 0.4 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 | 0.4 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.1 | 0.8 | GO:0033034 | positive regulation of myeloid cell apoptotic process(GO:0033034) |
| 0.1 | 0.7 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.1 | 2.4 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.1 | 1.0 | GO:0001502 | cartilage condensation(GO:0001502) |
| 0.1 | 0.8 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.1 | 0.3 | GO:1901642 | purine nucleoside transmembrane transport(GO:0015860) nucleoside transmembrane transport(GO:1901642) |
| 0.1 | 1.0 | GO:0035743 | CD4-positive, alpha-beta T cell cytokine production(GO:0035743) T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 | 1.7 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.1 | 1.1 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.1 | 1.4 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.1 | 0.3 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 | 0.6 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.1 | 0.3 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 | 0.3 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.1 | 0.4 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 | 2.6 | GO:0048704 | embryonic skeletal system morphogenesis(GO:0048704) |
| 0.1 | 0.1 | GO:0021623 | oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
| 0.1 | 0.4 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.1 | 0.8 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 | 0.4 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.1 | 3.5 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.1 | 0.1 | GO:0072144 | mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) |
| 0.1 | 0.5 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 | 0.4 | GO:0071477 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.1 | 0.3 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
| 0.1 | 0.5 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.1 | 0.7 | GO:1901533 | negative regulation of hematopoietic progenitor cell differentiation(GO:1901533) |
| 0.1 | 0.2 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
| 0.1 | 2.2 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 | 1.2 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.1 | 1.9 | GO:0007129 | synapsis(GO:0007129) |
| 0.1 | 0.3 | GO:1903538 | meiotic cell cycle process involved in oocyte maturation(GO:1903537) regulation of meiotic cell cycle process involved in oocyte maturation(GO:1903538) |
| 0.1 | 0.8 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.1 | 0.5 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.1 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.1 | 0.4 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
| 0.1 | 1.7 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.1 | 0.6 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.1 | 1.4 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.1 | 0.5 | GO:0035660 | MyD88-dependent toll-like receptor 4 signaling pathway(GO:0035660) |
| 0.1 | 0.7 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.1 | 0.2 | GO:0010635 | regulation of mitochondrial fusion(GO:0010635) negative regulation of mitochondrial fusion(GO:0010637) |
| 0.1 | 1.3 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.1 | 3.6 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) |
| 0.1 | 1.1 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.1 | 1.9 | GO:0009250 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.1 | 1.1 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.1 | 0.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 1.0 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.1 | 0.8 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.1 | 0.3 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.1 | 1.2 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.1 | 0.3 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.1 | 0.4 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.1 | 1.1 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.8 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.1 | 0.2 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.1 | 0.8 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.1 | 1.4 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.1 | 0.3 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.1 | 0.1 | GO:0061074 | regulation of neural retina development(GO:0061074) |
| 0.1 | 0.7 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
| 0.1 | 0.4 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.1 | 0.5 | GO:1990166 | protein localization to site of double-strand break(GO:1990166) |
| 0.1 | 0.3 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.1 | 5.5 | GO:0046324 | regulation of glucose import(GO:0046324) |
| 0.1 | 0.6 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.1 | 3.2 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.1 | 0.4 | GO:0014028 | notochord formation(GO:0014028) |
| 0.1 | 0.4 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.1 | 0.2 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
| 0.1 | 0.2 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.1 | 0.8 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 | 1.2 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.1 | 1.7 | GO:0045109 | intermediate filament organization(GO:0045109) |
| 0.1 | 0.1 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.1 | 0.4 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 | 0.6 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.1 | 2.2 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
| 0.1 | 0.4 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.1 | 0.2 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.1 | 0.3 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.1 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.1 | 0.7 | GO:0036371 | T-tubule organization(GO:0033292) protein localization to M-band(GO:0036309) protein localization to T-tubule(GO:0036371) regulation of SA node cell action potential(GO:0098907) regulation of atrial cardiac muscle cell action potential(GO:0098910) |
| 0.1 | 1.4 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 | 0.6 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
| 0.1 | 0.7 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.1 | 0.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.1 | 0.4 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 0.2 | GO:0071455 | cellular response to hyperoxia(GO:0071455) |
| 0.1 | 0.7 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 | 0.1 | GO:0090149 | mitochondrial membrane fission(GO:0090149) |
| 0.1 | 1.4 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.1 | 0.4 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.1 | 0.2 | GO:0032097 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
| 0.1 | 1.3 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.1 | 1.7 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.1 | 2.7 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.1 | 2.1 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.1 | 0.8 | GO:0055012 | ventricular cardiac muscle cell differentiation(GO:0055012) |
| 0.1 | 1.1 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 0.1 | 1.3 | GO:0042092 | type 2 immune response(GO:0042092) |
| 0.1 | 0.8 | GO:0051324 | meiotic prophase I(GO:0007128) prophase(GO:0051324) |
| 0.1 | 0.4 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.1 | 0.7 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
| 0.1 | 0.1 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 0.1 | 1.1 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.1 | 0.2 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.1 | 0.8 | GO:0071549 | cellular response to dexamethasone stimulus(GO:0071549) |
| 0.1 | 0.6 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.1 | 0.5 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
| 0.1 | 30.6 | GO:0007283 | spermatogenesis(GO:0007283) |
| 0.1 | 1.5 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
| 0.1 | 0.1 | GO:0044381 | glucose import in response to insulin stimulus(GO:0044381) |
| 0.1 | 0.2 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.1 | 0.3 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.1 | 1.8 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.1 | 0.7 | GO:0032332 | positive regulation of chondrocyte differentiation(GO:0032332) |
| 0.1 | 1.1 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.1 | 0.8 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
| 0.1 | 0.3 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
| 0.1 | 0.8 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.1 | 0.4 | GO:0090312 | positive regulation of protein deacetylation(GO:0090312) |
| 0.1 | 0.4 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.1 | 0.8 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.3 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.1 | 0.3 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.1 | 0.2 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.1 | 1.4 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
| 0.1 | 0.4 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.1 | 0.1 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
| 0.1 | 0.7 | GO:0048665 | neuron fate specification(GO:0048665) |
| 0.1 | 0.1 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.1 | 1.0 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.1 | 0.1 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.1 | 0.4 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.1 | 0.6 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.1 | 0.3 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 48.0 | GO:0000122 | negative regulation of transcription from RNA polymerase II promoter(GO:0000122) |
| 0.1 | 2.0 | GO:0009060 | aerobic respiration(GO:0009060) |
| 0.1 | 1.0 | GO:0048311 | mitochondrion distribution(GO:0048311) |
| 0.1 | 0.1 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.1 | 1.5 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.4 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
| 0.1 | 0.5 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 | 0.4 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
| 0.1 | 0.5 | GO:0060487 | lung epithelial cell differentiation(GO:0060487) |
| 0.1 | 0.2 | GO:0030091 | protein repair(GO:0030091) |
| 0.1 | 1.0 | GO:0030514 | negative regulation of BMP signaling pathway(GO:0030514) |
| 0.1 | 0.3 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.1 | 2.3 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.1 | 0.5 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
| 0.1 | 0.9 | GO:0002190 | cap-independent translational initiation(GO:0002190) |
| 0.1 | 0.2 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 | 0.4 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
| 0.1 | 0.4 | GO:0021854 | hypothalamus development(GO:0021854) |
| 0.1 | 0.4 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 0.1 | 1.5 | GO:0010596 | negative regulation of endothelial cell migration(GO:0010596) |
| 0.1 | 0.2 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.1 | 2.4 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.6 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.1 | 0.3 | GO:0070829 | heterochromatin maintenance(GO:0070829) |
| 0.1 | 0.8 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.1 | 0.4 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.1 | 0.3 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 | 0.7 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.1 | 0.3 | GO:0038032 | termination of G-protein coupled receptor signaling pathway(GO:0038032) |
| 0.1 | 0.9 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 | 0.2 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.1 | 0.7 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.1 | 0.2 | GO:2000104 | negative regulation of DNA-dependent DNA replication(GO:2000104) |
| 0.0 | 0.8 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 | 0.2 | GO:0039533 | regulation of MDA-5 signaling pathway(GO:0039533) |
| 0.0 | 0.3 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 | 0.3 | GO:0000821 | regulation of glutamine family amino acid metabolic process(GO:0000820) regulation of arginine metabolic process(GO:0000821) |
| 0.0 | 0.2 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) |
| 0.0 | 0.2 | GO:0070474 | positive regulation of uterine smooth muscle contraction(GO:0070474) |
| 0.0 | 0.2 | GO:0046449 | creatinine metabolic process(GO:0046449) |
| 0.0 | 0.4 | GO:0032225 | regulation of synaptic transmission, dopaminergic(GO:0032225) |
| 0.0 | 0.1 | GO:0045212 | neurotransmitter receptor biosynthetic process(GO:0045212) |
| 0.0 | 0.1 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.0 | 0.2 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.0 | 0.5 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 | 0.7 | GO:0040001 | establishment of mitotic spindle localization(GO:0040001) |
| 0.0 | 0.1 | GO:0015755 | fructose transport(GO:0015755) |
| 0.0 | 0.5 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.0 | 0.2 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.0 | 0.3 | GO:0042772 | DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.0 | 0.4 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.0 | 0.7 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
| 0.0 | 0.7 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.0 | 0.3 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.2 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
| 0.0 | 0.3 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.0 | 0.8 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.6 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.0 | 0.5 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 | 0.2 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.0 | 1.6 | GO:0045069 | regulation of viral genome replication(GO:0045069) |
| 0.0 | 0.0 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.0 | 1.3 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.0 | 2.5 | GO:0030218 | erythrocyte differentiation(GO:0030218) |
| 0.0 | 1.2 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
| 0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.0 | 0.2 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.0 | 0.2 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.0 | 0.6 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 | 0.2 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.0 | 0.1 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.0 | 0.0 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
| 0.0 | 0.2 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.0 | 0.2 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 | 0.3 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.1 | GO:0097401 | synaptic vesicle lumen acidification(GO:0097401) |
| 0.0 | 0.3 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 | 0.2 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.0 | 0.2 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
| 0.0 | 0.4 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.7 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.0 | 1.2 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.6 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
| 0.0 | 0.1 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.0 | 0.1 | GO:0050823 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-dependent(GO:0002479) peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
| 0.0 | 0.2 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.2 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.0 | 0.2 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.0 | 0.2 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.2 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.0 | 0.1 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.0 | 0.1 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.0 | 0.1 | GO:0034969 | histone arginine methylation(GO:0034969) |
| 0.0 | 0.1 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
| 0.0 | 0.3 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.0 | 0.2 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.0 | 0.1 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.0 | 0.0 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
| 0.0 | 0.4 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
| 0.0 | 0.1 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.0 | 1.4 | GO:0007093 | mitotic cell cycle checkpoint(GO:0007093) |
| 0.0 | 0.9 | GO:0045841 | negative regulation of sister chromatid segregation(GO:0033046) negative regulation of mitotic sister chromatid segregation(GO:0033048) negative regulation of mitotic metaphase/anaphase transition(GO:0045841) negative regulation of mitotic sister chromatid separation(GO:2000816) |
| 0.0 | 0.1 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.0 | 0.2 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
| 0.0 | 0.3 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 0.7 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.6 | GO:0030225 | macrophage differentiation(GO:0030225) |
| 0.0 | 0.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 0.2 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.0 | 0.7 | GO:0000768 | syncytium formation by plasma membrane fusion(GO:0000768) |
| 0.0 | 0.3 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.0 | 0.2 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.3 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.5 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 | 0.7 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
| 0.0 | 0.0 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) |
| 0.0 | 0.1 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.0 | 1.4 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.3 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.0 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.0 | 0.2 | GO:1903020 | positive regulation of glycoprotein metabolic process(GO:1903020) |
| 0.0 | 0.2 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.0 | 0.3 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.0 | 0.2 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.0 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 | 0.5 | GO:0033139 | regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033139) |
| 0.0 | 0.1 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.0 | 0.1 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
| 0.0 | 0.4 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.8 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.0 | 0.2 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.1 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
| 0.0 | 0.1 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 0.0 | 0.3 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.0 | 0.4 | GO:0042531 | positive regulation of tyrosine phosphorylation of STAT protein(GO:0042531) |
| 0.0 | 0.6 | GO:0030279 | negative regulation of ossification(GO:0030279) |
| 0.0 | 0.2 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 0.1 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.0 | 0.2 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.0 | 0.2 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.0 | 0.3 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.0 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.0 | 0.1 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.0 | 0.3 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
| 0.0 | 0.1 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) |
| 0.0 | 0.1 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
| 0.0 | 0.1 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.0 | 0.6 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.2 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.0 | 0.2 | GO:0042554 | superoxide anion generation(GO:0042554) |
| 0.0 | 0.5 | GO:0018279 | peptidyl-asparagine modification(GO:0018196) protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.0 | 0.9 | GO:0009247 | glycolipid biosynthetic process(GO:0009247) |
| 0.0 | 0.1 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.0 | 0.2 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
| 0.0 | 0.2 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.0 | 0.0 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.0 | 0.2 | GO:0055070 | copper ion homeostasis(GO:0055070) |
| 0.0 | 0.0 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
| 0.0 | 0.0 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.0 | 0.4 | GO:0022900 | electron transport chain(GO:0022900) |
| 0.0 | 0.1 | GO:0006415 | translational termination(GO:0006415) |
| 0.0 | 0.2 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
| 0.0 | 0.1 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.5 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.0 | 0.1 | GO:1903670 | regulation of sprouting angiogenesis(GO:1903670) |
| 0.0 | 0.1 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
| 0.0 | 0.2 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.2 | 12.8 | GO:0014802 | terminal cisterna(GO:0014802) |
| 2.3 | 9.3 | GO:0001740 | Barr body(GO:0001740) |
| 1.9 | 5.7 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
| 1.5 | 11.7 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 1.2 | 3.5 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 1.1 | 7.8 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 1.1 | 4.5 | GO:0070722 | Tle3-Aes complex(GO:0070722) |
| 1.1 | 6.4 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 1.1 | 4.2 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 1.0 | 3.0 | GO:0044317 | rod spherule(GO:0044317) |
| 0.9 | 2.8 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.9 | 2.8 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 0.9 | 3.6 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
| 0.9 | 2.6 | GO:0097224 | sperm connecting piece(GO:0097224) |
| 0.8 | 4.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.8 | 2.3 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.8 | 2.3 | GO:0014801 | longitudinal sarcoplasmic reticulum(GO:0014801) |
| 0.7 | 2.1 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
| 0.7 | 4.8 | GO:0072487 | MSL complex(GO:0072487) |
| 0.7 | 0.7 | GO:0034677 | integrin alpha7-beta1 complex(GO:0034677) |
| 0.7 | 3.3 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.7 | 9.2 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.6 | 2.6 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.6 | 1.9 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
| 0.6 | 4.5 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.6 | 3.0 | GO:0000802 | transverse filament(GO:0000802) |
| 0.6 | 1.8 | GO:0042025 | host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
| 0.6 | 0.6 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.6 | 45.2 | GO:0005844 | polysome(GO:0005844) |
| 0.6 | 2.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.6 | 4.4 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.5 | 13.4 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.5 | 2.1 | GO:1990795 | lateral part of cell(GO:0097574) basolateral part of cell(GO:1990794) rod bipolar cell terminal bouton(GO:1990795) |
| 0.5 | 4.5 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.5 | 3.9 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.5 | 1.4 | GO:0097132 | cyclin D2-CDK6 complex(GO:0097132) |
| 0.5 | 1.9 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
| 0.4 | 3.5 | GO:0008091 | spectrin(GO:0008091) |
| 0.4 | 2.0 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.4 | 9.6 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.4 | 2.0 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.4 | 0.4 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.4 | 3.4 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.4 | 1.9 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.4 | 3.3 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.4 | 1.5 | GO:0045273 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.4 | 5.6 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.3 | 1.4 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.3 | 1.3 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.3 | 0.9 | GO:0060187 | cell pole(GO:0060187) |
| 0.3 | 3.7 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.3 | 1.2 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
| 0.3 | 0.9 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.3 | 0.6 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.3 | 1.8 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.3 | 1.5 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
| 0.3 | 3.4 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.3 | 3.7 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.3 | 0.6 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.3 | 8.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.3 | 3.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.3 | 0.8 | GO:0097123 | cyclin A1-CDK2 complex(GO:0097123) |
| 0.3 | 0.8 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
| 0.3 | 2.2 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.3 | 5.1 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.3 | 0.8 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.3 | 1.6 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.3 | 3.4 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.3 | 1.0 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.3 | 3.1 | GO:0016011 | dystroglycan complex(GO:0016011) |
| 0.2 | 0.7 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.2 | 2.0 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.2 | 1.0 | GO:0071942 | XPC complex(GO:0071942) |
| 0.2 | 0.7 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 0.2 | 5.6 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.2 | 1.2 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.2 | 0.7 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.2 | 1.8 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.2 | 1.1 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.2 | 2.5 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.2 | 18.1 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.2 | 13.2 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.2 | 7.3 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.2 | 0.6 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.2 | 21.3 | GO:0016528 | sarcoplasm(GO:0016528) |
| 0.2 | 1.3 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.2 | 0.6 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.2 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
| 0.2 | 2.9 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.2 | 5.4 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.2 | 1.4 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.2 | 4.5 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.2 | 0.6 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.2 | 1.9 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.2 | 1.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.2 | 1.7 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.2 | 0.6 | GO:0098842 | postsynaptic early endosome(GO:0098842) |
| 0.2 | 2.3 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.2 | 0.5 | GO:0097361 | CIA complex(GO:0097361) |
| 0.2 | 0.7 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.2 | 0.7 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.2 | 0.8 | GO:0070449 | elongin complex(GO:0070449) |
| 0.2 | 8.9 | GO:0036379 | myofilament(GO:0036379) |
| 0.2 | 3.5 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.2 | 4.9 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.2 | 0.8 | GO:0098890 | extrinsic component of postsynaptic membrane(GO:0098890) |
| 0.2 | 3.8 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.2 | 4.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.2 | 0.2 | GO:0031231 | intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.2 | 1.4 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.2 | 0.6 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.2 | 0.3 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.2 | 0.5 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.2 | 0.5 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.2 | 1.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.2 | 0.6 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.2 | 1.2 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 0.4 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.1 | 2.5 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.1 | 0.7 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.1 | 0.4 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
| 0.1 | 2.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 1.8 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 1.0 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.1 | 1.8 | GO:0034464 | BBSome(GO:0034464) |
| 0.1 | 1.6 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.1 | 0.8 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.1 | 1.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 1.6 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.1 | 0.9 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.1 | 2.6 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 3.2 | GO:0000792 | heterochromatin(GO:0000792) |
| 0.1 | 1.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.1 | 5.9 | GO:0031672 | A band(GO:0031672) |
| 0.1 | 2.5 | GO:0000803 | sex chromosome(GO:0000803) |
| 0.1 | 0.6 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 3.7 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.1 | 2.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 0.4 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.1 | 3.1 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 2.7 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.1 | 2.0 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.1 | 0.6 | GO:1990923 | PET complex(GO:1990923) |
| 0.1 | 0.5 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.1 | 2.2 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.1 | 1.1 | GO:0000801 | central element(GO:0000801) |
| 0.1 | 0.9 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 1.3 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 0.4 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.1 | 0.6 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.1 | 0.6 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.1 | 0.8 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.1 | 1.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 1.4 | GO:0010369 | chromocenter(GO:0010369) |
| 0.1 | 8.2 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.1 | 1.0 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.1 | 2.4 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.1 | 0.8 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.1 | 0.7 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 2.8 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 2.2 | GO:0051286 | cell tip(GO:0051286) |
| 0.1 | 0.5 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
| 0.1 | 1.4 | GO:0044217 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
| 0.1 | 0.5 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.1 | 1.6 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 0.3 | GO:1990589 | ATF4-CREB1 transcription factor complex(GO:1990589) |
| 0.1 | 4.1 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
| 0.1 | 0.8 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 0.5 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 0.8 | GO:0000796 | condensin complex(GO:0000796) |
| 0.1 | 0.5 | GO:0043293 | apoptosome(GO:0043293) |
| 0.1 | 1.7 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.1 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 0.5 | GO:0035363 | histone locus body(GO:0035363) |
| 0.1 | 0.3 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.1 | 0.5 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 2.2 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.1 | 0.5 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 3.9 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.1 | 0.4 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.1 | 0.8 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.1 | 2.9 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.1 | 0.6 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.1 | 2.4 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.1 | 1.5 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.1 | 1.8 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.1 | 1.5 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.1 | 1.9 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.1 | 4.8 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.1 | 2.0 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.1 | 0.8 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 1.9 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 10.1 | GO:0016605 | PML body(GO:0016605) |
| 0.1 | 4.2 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 1.5 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 0.4 | GO:0071547 | piP-body(GO:0071547) |
| 0.1 | 5.4 | GO:0034358 | plasma lipoprotein particle(GO:0034358) lipoprotein particle(GO:1990777) |
| 0.1 | 0.3 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.1 | 1.0 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 5.9 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 0.3 | GO:0005607 | laminin-2 complex(GO:0005607) |
| 0.1 | 1.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.1 | 2.7 | GO:0014704 | intercalated disc(GO:0014704) |
| 0.1 | 0.8 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.1 | 1.1 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.1 | 0.4 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.1 | 6.0 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.1 | 0.8 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 0.5 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.1 | 0.6 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 1.0 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.1 | 1.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.1 | 0.6 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 2.0 | GO:0016592 | mediator complex(GO:0016592) |
| 0.1 | 0.6 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) TAP complex(GO:0042825) |
| 0.1 | 53.5 | GO:0016604 | nuclear body(GO:0016604) |
| 0.1 | 0.4 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.1 | 2.6 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.1 | 2.1 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.1 | 0.8 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.1 | 0.6 | GO:0031011 | Ino80 complex(GO:0031011) |
| 0.1 | 0.7 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.1 | 0.7 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.1 | 2.6 | GO:0031674 | I band(GO:0031674) |
| 0.1 | 0.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.1 | 2.3 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.1 | 8.8 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.1 | 0.6 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.1 | 0.3 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.1 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 0.4 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 0.1 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.1 | 1.9 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 3.4 | GO:0032420 | stereocilium(GO:0032420) |
| 0.1 | 0.1 | GO:0032994 | protein-lipid complex(GO:0032994) |
| 0.1 | 0.2 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.1 | 1.0 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.1 | 5.0 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.1 | 3.0 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.1 | 12.5 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.1 | 0.2 | GO:0036398 | TCR signalosome(GO:0036398) |
| 0.1 | 0.6 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 18.8 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.1 | 1.3 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.1 | 0.9 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 0.5 | GO:0044815 | DNA packaging complex(GO:0044815) |
| 0.1 | 0.6 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
| 0.1 | 0.8 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 3.7 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.1 | 0.6 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.1 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.0 | 0.1 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.0 | 1.4 | GO:0032993 | protein-DNA complex(GO:0032993) |
| 0.0 | 0.9 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 2.8 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.5 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.2 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 1.0 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 1.2 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.4 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.5 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.3 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.0 | 0.6 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 1.0 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.2 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 0.0 | 1.2 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.1 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.0 | 0.1 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 0.4 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.0 | 1.1 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 4.4 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.0 | 4.1 | GO:0031514 | motile cilium(GO:0031514) |
| 0.0 | 0.5 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.0 | 1.0 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 59.9 | GO:0005654 | nucleoplasm(GO:0005654) |
| 0.0 | 0.1 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.0 | 1.5 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 2.0 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.0 | 0.4 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.0 | 0.1 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.0 | 1.3 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 2.6 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 118.5 | GO:0005634 | nucleus(GO:0005634) |
| 0.0 | 0.4 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 5.0 | GO:0005815 | microtubule organizing center(GO:0005815) |
| 0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 2.2 | GO:1990904 | intracellular ribonucleoprotein complex(GO:0030529) ribonucleoprotein complex(GO:1990904) |
| 0.0 | 0.4 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
| 0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.0 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.0 | 3.2 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 0.2 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.0 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.2 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.0 | 10.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 1.5 | 4.6 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 1.5 | 4.4 | GO:0070140 | isopeptidase activity(GO:0070122) ubiquitin-like protein-specific isopeptidase activity(GO:0070138) SUMO-specific isopeptidase activity(GO:0070140) |
| 1.4 | 4.3 | GO:0004019 | adenylosuccinate synthase activity(GO:0004019) |
| 1.4 | 5.6 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 1.4 | 4.1 | GO:0001571 | non-tyrosine kinase fibroblast growth factor receptor activity(GO:0001571) |
| 1.4 | 12.3 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 1.1 | 8.7 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 1.1 | 3.2 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 1.1 | 3.2 | GO:0004133 | glycogen debranching enzyme activity(GO:0004133) 4-alpha-glucanotransferase activity(GO:0004134) amylo-alpha-1,6-glucosidase activity(GO:0004135) |
| 1.1 | 4.2 | GO:0070052 | collagen V binding(GO:0070052) |
| 1.0 | 5.2 | GO:2001070 | starch binding(GO:2001070) |
| 1.0 | 3.9 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.9 | 2.8 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.9 | 2.8 | GO:0071820 | N-box binding(GO:0071820) |
| 0.8 | 2.5 | GO:0004572 | mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase activity(GO:0004572) |
| 0.8 | 2.5 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.8 | 5.7 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.8 | 7.3 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.8 | 4.8 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.7 | 3.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.7 | 2.2 | GO:0004912 | interleukin-3 receptor activity(GO:0004912) interleukin-3 binding(GO:0019978) |
| 0.7 | 2.8 | GO:0045183 | translation factor activity, non-nucleic acid binding(GO:0045183) |
| 0.7 | 2.1 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.7 | 5.5 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.7 | 3.4 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
| 0.7 | 1.4 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.7 | 4.0 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.7 | 9.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.6 | 7.1 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.6 | 1.9 | GO:0005110 | frizzled-2 binding(GO:0005110) |
| 0.6 | 7.7 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.6 | 4.4 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.6 | 7.6 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.6 | 4.4 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.6 | 3.7 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.6 | 5.9 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.6 | 3.5 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.6 | 6.9 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.5 | 1.6 | GO:0004373 | glycogen (starch) synthase activity(GO:0004373) |
| 0.5 | 2.1 | GO:0072591 | citrate-L-glutamate ligase activity(GO:0072591) |
| 0.5 | 2.6 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
| 0.5 | 3.6 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.5 | 20.5 | GO:0045182 | translation regulator activity(GO:0045182) |
| 0.5 | 4.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.5 | 1.0 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.5 | 2.9 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.5 | 3.3 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.5 | 1.4 | GO:0015152 | glucose-6-phosphate transmembrane transporter activity(GO:0015152) |
| 0.5 | 1.8 | GO:0055105 | ubiquitin-protein transferase inhibitor activity(GO:0055105) |
| 0.4 | 7.6 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.4 | 1.3 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.4 | 13.2 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
| 0.4 | 3.4 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.4 | 1.3 | GO:0008967 | phosphoglycolate phosphatase activity(GO:0008967) |
| 0.4 | 1.2 | GO:0034189 | very-low-density lipoprotein particle binding(GO:0034189) |
| 0.4 | 2.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.4 | 3.3 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.4 | 2.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.4 | 1.6 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) |
| 0.4 | 1.2 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.4 | 3.2 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.4 | 4.8 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.4 | 1.2 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.4 | 1.2 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.4 | 3.5 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.4 | 2.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.4 | 1.9 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.4 | 0.4 | GO:0004915 | interleukin-6 receptor activity(GO:0004915) interleukin-6 binding(GO:0019981) |
| 0.4 | 3.8 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.4 | 1.1 | GO:0050354 | glycerone kinase activity(GO:0004371) FAD-AMP lyase (cyclizing) activity(GO:0034012) triokinase activity(GO:0050354) |
| 0.4 | 1.8 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.4 | 1.4 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.3 | 1.0 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.3 | 13.7 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.3 | 0.3 | GO:0031177 | phosphopantetheine binding(GO:0031177) |
| 0.3 | 6.0 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.3 | 12.4 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.3 | 1.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.3 | 1.9 | GO:0038049 | glucocorticoid receptor activity(GO:0004883) transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.3 | 3.2 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.3 | 1.3 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.3 | 3.5 | GO:0070061 | fructose binding(GO:0070061) |
| 0.3 | 0.6 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.3 | 9.5 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.3 | 1.6 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.3 | 7.8 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.3 | 1.2 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.3 | 7.7 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.3 | 0.9 | GO:0005277 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.3 | 1.2 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.3 | 2.0 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.3 | 0.9 | GO:1902121 | lithocholic acid binding(GO:1902121) |
| 0.3 | 1.2 | GO:0051435 | BH4 domain binding(GO:0051435) |
| 0.3 | 1.2 | GO:0070888 | E-box binding(GO:0070888) |
| 0.3 | 2.6 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.3 | 2.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.3 | 6.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.3 | 14.3 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.3 | 1.1 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.3 | 0.5 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.3 | 0.8 | GO:0031370 | eukaryotic initiation factor 4G binding(GO:0031370) |
| 0.3 | 2.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.3 | 1.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.3 | 0.8 | GO:0001160 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 0.3 | 1.5 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.3 | 9.8 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.3 | 3.3 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.2 | 1.5 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 0.2 | 0.7 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.2 | 11.7 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.2 | 2.4 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.2 | 1.7 | GO:0008486 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
| 0.2 | 0.7 | GO:0004903 | growth hormone receptor activity(GO:0004903) |
| 0.2 | 0.9 | GO:0003844 | 1,4-alpha-glucan branching enzyme activity(GO:0003844) |
| 0.2 | 0.9 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.2 | 1.6 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
| 0.2 | 2.6 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.2 | 1.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.2 | 1.2 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.2 | 0.5 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.2 | 2.5 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.2 | 0.7 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.2 | 16.8 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.2 | 0.7 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.2 | 6.2 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.2 | 1.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.2 | 2.0 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.2 | 3.5 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.2 | 0.7 | GO:0001729 | ceramide kinase activity(GO:0001729) |
| 0.2 | 1.3 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.2 | 0.4 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.2 | 0.9 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.2 | 2.6 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.2 | 0.7 | GO:0000982 | transcription factor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0000982) |
| 0.2 | 8.0 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.2 | 3.7 | GO:0043495 | protein anchor(GO:0043495) |
| 0.2 | 0.4 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.2 | 2.1 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.2 | 1.1 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.2 | 6.8 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.2 | 2.7 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.2 | 7.1 | GO:0005112 | Notch binding(GO:0005112) |
| 0.2 | 0.8 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.2 | 20.0 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.2 | 0.6 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.2 | 1.8 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.2 | 1.2 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.2 | 2.4 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.2 | 1.0 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.2 | 0.6 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.2 | 1.2 | GO:0051734 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.2 | 5.8 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.2 | 1.9 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.2 | 1.9 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.2 | 51.7 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.2 | 0.9 | GO:0034618 | arginine binding(GO:0034618) |
| 0.2 | 1.5 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.2 | 0.9 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.2 | 0.7 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) peptide transmembrane transporter activity(GO:1904680) |
| 0.2 | 2.9 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.2 | 1.4 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.2 | 1.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.2 | 1.1 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
| 0.2 | 5.5 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.2 | 0.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.2 | 0.5 | GO:0030116 | glial cell-derived neurotrophic factor receptor binding(GO:0030116) |
| 0.2 | 2.6 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.2 | 1.4 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.2 | 2.6 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.2 | 1.8 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.2 | 0.5 | GO:0005368 | beta-alanine transmembrane transporter activity(GO:0001761) taurine transmembrane transporter activity(GO:0005368) taurine:sodium symporter activity(GO:0005369) |
| 0.2 | 1.2 | GO:0089720 | caspase binding(GO:0089720) |
| 0.2 | 0.8 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.2 | 1.7 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.2 | 3.1 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.2 | 1.0 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.2 | 14.1 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.2 | 0.5 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.2 | 0.3 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
| 0.2 | 2.5 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.2 | 0.6 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.2 | 0.3 | GO:1990269 | RNA polymerase II C-terminal domain phosphoserine binding(GO:1990269) |
| 0.2 | 1.6 | GO:0005536 | glucose binding(GO:0005536) |
| 0.2 | 6.4 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.2 | 2.9 | GO:0005521 | lamin binding(GO:0005521) |
| 0.2 | 4.4 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.4 | GO:0016901 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.1 | 1.5 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.1 | 0.9 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.1 | 1.2 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.1 | 0.4 | GO:0004001 | adenosine kinase activity(GO:0004001) |
| 0.1 | 0.4 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.1 | 0.6 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.1 | 0.6 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 0.9 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.1 | 1.0 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.1 | 0.3 | GO:0032142 | single guanine insertion binding(GO:0032142) |
| 0.1 | 0.6 | GO:0072354 | histone kinase activity (H3-T3 specific)(GO:0072354) |
| 0.1 | 0.6 | GO:0005008 | hepatocyte growth factor-activated receptor activity(GO:0005008) |
| 0.1 | 3.3 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.1 | 0.3 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.1 | 1.0 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.1 | 0.8 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
| 0.1 | 1.9 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.1 | 0.8 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.1 | 0.9 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.1 | 7.6 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.5 | GO:0050347 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
| 0.1 | 0.9 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 0.4 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.1 | 0.7 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.1 | 1.4 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.1 | 1.0 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.1 | 5.6 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.1 | 1.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.1 | 1.4 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.1 | 0.6 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.1 | 2.3 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.1 | 0.7 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.1 | 0.7 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.1 | 2.1 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.1 | 0.5 | GO:0071209 | histone pre-mRNA DCP binding(GO:0071208) U7 snRNA binding(GO:0071209) |
| 0.1 | 1.6 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.1 | 0.4 | GO:0086057 | voltage-gated calcium channel activity involved in bundle of His cell action potential(GO:0086057) |
| 0.1 | 0.4 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.1 | 0.4 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.1 | 1.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.1 | 0.9 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.1 | 0.1 | GO:0001093 | TFIIB-class transcription factor binding(GO:0001093) |
| 0.1 | 1.2 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.1 | 1.3 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.1 | 11.5 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.1 | 0.7 | GO:0032810 | sterol response element binding(GO:0032810) |
| 0.1 | 0.6 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 2.1 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.1 | 0.8 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.1 | 2.7 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 0.4 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.1 | 0.3 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
| 0.1 | 4.6 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.1 | 0.3 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.1 | 3.2 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) |
| 0.1 | 0.7 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.1 | 141.4 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
| 0.1 | 0.6 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.1 | 0.7 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 0.9 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.1 | 0.3 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 0.4 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.1 | 0.6 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.1 | 0.9 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.1 | 0.7 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.1 | 1.3 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
| 0.1 | 0.4 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 0.5 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
| 0.1 | 0.2 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.1 | 0.4 | GO:0035827 | rubidium ion transmembrane transporter activity(GO:0035827) |
| 0.1 | 1.5 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.1 | 1.6 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.1 | 1.0 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.1 | 3.7 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 4.4 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.1 | 0.6 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.1 | 1.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.1 | 0.7 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.1 | 0.3 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.1 | 1.3 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.1 | 7.9 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.1 | 0.8 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.1 | 0.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.1 | 0.2 | GO:0000401 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
| 0.1 | 8.4 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.1 | 0.4 | GO:0098809 | nitrite reductase activity(GO:0098809) |
| 0.1 | 5.0 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.1 | 0.7 | GO:0016672 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) |
| 0.1 | 0.5 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.1 | 0.4 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.1 | 1.2 | GO:0046977 | TAP binding(GO:0046977) |
| 0.1 | 1.0 | GO:0042834 | peptidoglycan binding(GO:0042834) |
| 0.1 | 1.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 0.6 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.1 | 11.7 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.1 | 0.8 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 1.7 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.1 | 2.0 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.1 | 1.3 | GO:0005522 | profilin binding(GO:0005522) |
| 0.1 | 1.9 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 1.4 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.1 | 0.3 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.1 | 1.5 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.1 | 0.4 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 2.9 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.1 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.1 | 2.6 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.1 | 1.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 0.5 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 2.2 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 0.5 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.1 | 0.4 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.1 | 0.8 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.1 | 0.8 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 0.5 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.1 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 1.0 | GO:0010857 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
| 0.1 | 3.1 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.1 | 3.3 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 1.8 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
| 0.1 | 0.3 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 0.6 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.1 | 1.2 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.1 | 0.3 | GO:0031692 | alpha-1A adrenergic receptor binding(GO:0031691) alpha-1B adrenergic receptor binding(GO:0031692) follicle-stimulating hormone receptor binding(GO:0031762) |
| 0.1 | 0.4 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.1 | 0.5 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.1 | 0.1 | GO:0038025 | reelin receptor activity(GO:0038025) |
| 0.1 | 0.8 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.1 | 0.4 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.1 | 0.7 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.1 | 2.7 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.1 | 0.2 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.1 | 0.8 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 0.4 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 2.0 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.1 | 0.3 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.1 | 0.1 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
| 0.1 | 0.2 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.1 | 2.5 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.1 | 0.5 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.1 | 1.7 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 0.3 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.1 | 0.4 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 0.3 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.1 | 0.5 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.1 | 0.5 | GO:0034062 | RNA polymerase activity(GO:0034062) |
| 0.1 | 3.4 | GO:0004386 | helicase activity(GO:0004386) |
| 0.1 | 2.3 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 0.6 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 1.6 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.1 | 0.2 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 1.6 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.0 | 0.1 | GO:0019948 | SUMO activating enzyme activity(GO:0019948) |
| 0.0 | 0.9 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.2 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 0.6 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
| 0.0 | 0.1 | GO:0070279 | vitamin B6 binding(GO:0070279) |
| 0.0 | 1.1 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.3 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 1.2 | GO:0035591 | signaling adaptor activity(GO:0035591) |
| 0.0 | 0.9 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 1.3 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.2 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.0 | 0.0 | GO:0070717 | poly-purine tract binding(GO:0070717) |
| 0.0 | 0.6 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.0 | 1.3 | GO:0016504 | peptidase activator activity(GO:0016504) |
| 0.0 | 10.4 | GO:0061659 | ubiquitin-like protein ligase activity(GO:0061659) |
| 0.0 | 2.6 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.0 | 4.2 | GO:0030674 | protein binding, bridging(GO:0030674) |
| 0.0 | 0.5 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.0 | 0.3 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.1 | GO:0035870 | dITP diphosphatase activity(GO:0035870) |
| 0.0 | 1.1 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.1 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 0.0 | 0.2 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.0 | 0.1 | GO:0016034 | maleylacetoacetate isomerase activity(GO:0016034) |
| 0.0 | 0.3 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 0.8 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.1 | GO:0047256 | beta-galactosyl-N-acetylglucosaminylgalactosylglucosyl-ceramide beta-1,3-acetylglucosaminyltransferase activity(GO:0008457) lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase activity(GO:0047256) |
| 0.0 | 0.3 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.0 | 0.5 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.8 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.1 | GO:0004478 | methionine adenosyltransferase activity(GO:0004478) |
| 0.0 | 0.2 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.2 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 0.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
| 0.0 | 29.8 | GO:0003677 | DNA binding(GO:0003677) |
| 0.0 | 0.3 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.0 | 0.2 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.6 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 2.8 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.0 | 0.2 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.0 | 0.7 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.3 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 1.6 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.2 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
| 0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 0.4 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.5 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.2 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.0 | 0.1 | GO:0003826 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.0 | 0.3 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.3 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.3 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.0 | 0.6 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.2 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.0 | 0.2 | GO:0046030 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) inositol trisphosphate phosphatase activity(GO:0046030) |
| 0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.2 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
| 0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 1.0 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
| 0.0 | 0.6 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.3 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.0 | 0.1 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.0 | 0.8 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.0 | 0.4 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.0 | 0.5 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.0 | 0.3 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.0 | 0.3 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.0 | 0.4 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.6 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.9 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
| 0.0 | 0.0 | GO:0070012 | oligopeptidase activity(GO:0070012) |
| 0.0 | 0.1 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.0 | 2.2 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.3 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 2.4 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.2 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 1.2 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.0 | 1.6 | GO:0044822 | mRNA binding(GO:0003729) poly(A) RNA binding(GO:0044822) |
| 0.0 | 0.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.4 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.0 | 0.2 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.0 | 0.2 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.0 | 0.1 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.2 | GO:0015250 | water channel activity(GO:0015250) |
| 0.0 | 0.3 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.0 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 0.7 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.5 | 1.5 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.5 | 1.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.4 | 6.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.4 | 2.0 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.4 | 0.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.3 | 1.9 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.3 | 3.4 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.3 | 9.9 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.3 | 1.0 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.2 | 3.5 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.2 | 5.9 | PID EPO PATHWAY | EPO signaling pathway |
| 0.2 | 2.1 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.2 | 8.6 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.2 | 7.6 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.2 | 11.3 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.2 | 3.7 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.2 | 0.7 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.2 | 2.7 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.2 | 19.1 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.2 | 12.1 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.2 | 4.5 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.2 | 11.8 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.2 | 9.6 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.2 | 4.0 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.2 | 8.6 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.2 | 2.3 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.2 | 11.4 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.2 | 2.1 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.2 | 8.7 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.1 | 16.4 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.1 | 2.4 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 9.2 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 0.7 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 5.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.1 | 9.2 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.1 | 2.6 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.1 | 8.0 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.1 | 6.4 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.1 | 10.5 | PID P73PATHWAY | p73 transcription factor network |
| 0.1 | 4.6 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.1 | 5.7 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.1 | 5.8 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 13.1 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.1 | 1.9 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.1 | 2.4 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.1 | 6.1 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.1 | 4.6 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 3.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.1 | 2.4 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.1 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 1.2 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.1 | 3.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.1 | 3.9 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.1 | 1.9 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.1 | 2.2 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 1.1 | PID ATM PATHWAY | ATM pathway |
| 0.1 | 0.3 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.1 | 1.8 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.1 | 1.7 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 2.7 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 0.8 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.1 | 2.3 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.1 | 3.6 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 17.9 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.1 | 0.2 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.1 | 0.9 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.1 | 0.5 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 1.8 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 1.4 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.7 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.8 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 1.2 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.3 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 0.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.2 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.2 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 0.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.3 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 0.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 13.4 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 1.3 | 1.3 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.9 | 26.2 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.9 | 0.9 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.5 | 20.3 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.5 | 6.5 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.5 | 10.3 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.4 | 6.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.4 | 12.9 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.4 | 2.6 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.4 | 7.1 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.3 | 10.0 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.3 | 10.7 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.3 | 4.9 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.3 | 7.7 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.3 | 4.7 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.3 | 6.4 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.3 | 5.6 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.3 | 13.0 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.3 | 0.5 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.3 | 6.0 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.2 | 0.7 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.2 | 12.0 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.2 | 3.8 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.2 | 3.3 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.2 | 3.0 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.2 | 2.6 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.2 | 6.3 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.2 | 6.3 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.2 | 13.2 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.2 | 0.6 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.2 | 2.1 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.2 | 5.7 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.2 | 2.2 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.2 | 1.6 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.2 | 5.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.2 | 4.7 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.2 | 0.3 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.2 | 5.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 4.6 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
| 0.1 | 1.8 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
| 0.1 | 2.5 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.1 | 0.1 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.1 | 2.9 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.1 | 2.4 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF CYCLIN B | Genes involved in APC/C:Cdc20 mediated degradation of Cyclin B |
| 0.1 | 8.3 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 2.8 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.1 | 2.6 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 3.6 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.1 | 1.6 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 6.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 0.7 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.1 | 2.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 0.9 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 2.5 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.1 | 1.1 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.1 | 4.4 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.1 | 1.2 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.1 | 2.5 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.1 | 0.6 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.1 | 1.7 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.1 | 2.0 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.1 | 19.8 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.1 | 0.5 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.1 | 2.0 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.1 | 0.5 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.1 | 0.7 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.1 | 2.0 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.1 | 1.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 1.0 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.1 | 1.1 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.1 | 3.0 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.1 | 6.8 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.1 | 3.6 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.1 | 2.5 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.1 | 1.2 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
| 0.1 | 0.7 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 9.2 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.1 | 2.5 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.1 | 1.0 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 1.3 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 1.2 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.1 | 1.2 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 0.4 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.1 | 1.1 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.0 | 1.5 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 1.8 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 3.0 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.0 | 0.8 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.0 | 2.9 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 3.6 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 1.4 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 0.7 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.0 | 1.0 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.5 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.7 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.6 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.0 | 0.7 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 0.4 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.0 | 0.5 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 2.7 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 1.3 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.0 | 1.0 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 1.0 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.3 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 0.7 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
| 0.0 | 0.4 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 1.1 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.0 | 0.7 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 3.3 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.6 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.6 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.3 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 1.9 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.1 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.0 | 0.7 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.1 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.0 | 0.3 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 1.1 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 0.0 | 0.4 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 0.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.8 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.0 | 0.2 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.0 | 0.3 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.4 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.5 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
| 0.0 | 0.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.0 | 0.2 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 0.1 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.0 | 0.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.2 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.0 | 1.4 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.6 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |