PRJNA375882: Comprehensive Mouse Transcriptomic BodyMap
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Smad1
|
ENSMUSG00000031681.17 | Smad1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Smad1 | mm39_v1_chr8_-_80126120_80126168 | -0.27 | 2.4e-02 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr16_-_18904240 | 16.77 |
ENSMUST00000103746.3
|
Iglv1
|
immunoglobulin lambda variable 1 |
| chr6_+_70348416 | 16.37 |
ENSMUST00000103391.4
|
Igkv6-17
|
immunoglobulin kappa variable 6-17 |
| chr6_-_70194405 | 15.90 |
ENSMUST00000103384.2
|
Igkv8-24
|
immunoglobulin kappa chain variable 8-24 |
| chr12_-_103322226 | 15.09 |
ENSMUST00000021617.14
|
Asb2
|
ankyrin repeat and SOCS box-containing 2 |
| chr6_-_70051586 | 15.09 |
ENSMUST00000103377.3
|
Igkv6-32
|
immunoglobulin kappa variable 6-32 |
| chr6_-_70149254 | 14.88 |
ENSMUST00000197272.2
|
Igkv8-27
|
immunoglobulin kappa chain variable 8-27 |
| chr7_+_24596806 | 14.64 |
ENSMUST00000003469.8
|
Cd79a
|
CD79A antigen (immunoglobulin-associated alpha) |
| chr16_-_18884431 | 13.05 |
ENSMUST00000200235.2
|
Iglc3
|
immunoglobulin lambda constant 3 |
| chr17_-_34736326 | 12.88 |
ENSMUST00000075483.5
|
Btnl6
|
butyrophilin-like 6 |
| chr6_-_70383976 | 12.86 |
ENSMUST00000103393.2
|
Igkv6-15
|
immunoglobulin kappa variable 6-15 |
| chr17_-_84990360 | 12.41 |
ENSMUST00000066175.10
|
Abcg5
|
ATP binding cassette subfamily G member 5 |
| chr6_+_55313409 | 12.08 |
ENSMUST00000004774.4
|
Aqp1
|
aquaporin 1 |
| chr16_-_19060440 | 12.02 |
ENSMUST00000103751.3
|
Iglv3
|
immunoglobulin lambda variable 3 |
| chr17_-_34694911 | 11.54 |
ENSMUST00000065841.5
|
Btnl4
|
butyrophilin-like 4 |
| chr6_-_70292451 | 11.32 |
ENSMUST00000103387.3
|
Igkv8-21
|
immunoglobulin kappa variable 8-21 |
| chr17_+_48571298 | 10.84 |
ENSMUST00000059873.14
ENSMUST00000154335.8 ENSMUST00000136272.8 ENSMUST00000125426.8 ENSMUST00000153420.2 |
Treml4
|
triggering receptor expressed on myeloid cells-like 4 |
| chr6_-_68746087 | 10.72 |
ENSMUST00000103333.4
|
Igkv4-91
|
immunoglobulin kappa chain variable 4-91 |
| chr17_+_34364206 | 10.60 |
ENSMUST00000041982.9
ENSMUST00000171231.8 |
H2-DMb2
|
histocompatibility 2, class II, locus Mb2 |
| chr3_-_144680801 | 10.40 |
ENSMUST00000029923.10
ENSMUST00000238960.2 |
Clca4a
|
chloride channel accessory 4A |
| chr17_+_35539505 | 10.14 |
ENSMUST00000105041.10
ENSMUST00000073208.6 |
H2-Q1
|
histocompatibility 2, Q region locus 1 |
| chr6_-_70435020 | 10.12 |
ENSMUST00000198184.2
|
Igkv6-13
|
immunoglobulin kappa variable 6-13 |
| chr6_-_70237939 | 9.62 |
ENSMUST00000103386.3
|
Igkv6-23
|
immunoglobulin kappa variable 6-23 |
| chr7_-_127593003 | 9.53 |
ENSMUST00000033056.5
|
Pycard
|
PYD and CARD domain containing |
| chr6_+_67838100 | 8.95 |
ENSMUST00000200586.2
ENSMUST00000103309.3 |
Igkv17-127
|
immunoglobulin kappa variable 17-127 |
| chr19_+_58717319 | 8.90 |
ENSMUST00000048644.6
ENSMUST00000236445.2 |
Pnliprp1
|
pancreatic lipase related protein 1 |
| chr17_-_57385490 | 8.70 |
ENSMUST00000011623.9
|
Dennd1c
|
DENN/MADD domain containing 1C |
| chr16_-_18880821 | 8.69 |
ENSMUST00000200568.2
|
Iglc1
|
immunoglobulin lambda constant 1 |
| chr12_-_114252202 | 8.65 |
ENSMUST00000195124.6
ENSMUST00000103481.3 |
Ighv3-6
|
immunoglobulin heavy variable 3-6 |
| chr6_+_70495224 | 8.65 |
ENSMUST00000103396.2
|
Igkv3-12
|
immunoglobulin kappa variable 3-12 |
| chr16_-_19079594 | 8.49 |
ENSMUST00000103752.3
ENSMUST00000197518.2 |
Iglv2
|
immunoglobulin lambda variable 2 |
| chrX_+_72527208 | 8.42 |
ENSMUST00000033741.15
ENSMUST00000169489.2 |
Bgn
|
biglycan |
| chr15_-_77417512 | 8.41 |
ENSMUST00000062562.7
ENSMUST00000230863.2 |
Apol7c
|
apolipoprotein L 7c |
| chr6_+_70703409 | 8.41 |
ENSMUST00000103410.3
|
Igkc
|
immunoglobulin kappa constant |
| chr10_+_127612243 | 8.40 |
ENSMUST00000136223.2
ENSMUST00000052652.7 |
Rdh9
|
retinol dehydrogenase 9 |
| chr12_-_113575237 | 8.16 |
ENSMUST00000178229.3
|
Ighv2-3
|
immunoglobulin heavy variable 2-3 |
| chr15_-_76501041 | 8.11 |
ENSMUST00000073428.7
|
Slc39a4
|
solute carrier family 39 (zinc transporter), member 4 |
| chr9_+_110848339 | 8.03 |
ENSMUST00000198884.5
ENSMUST00000196777.5 ENSMUST00000196209.5 ENSMUST00000035077.8 ENSMUST00000196122.3 |
Ltf
|
lactotransferrin |
| chr8_+_85628557 | 7.99 |
ENSMUST00000067060.10
ENSMUST00000239392.2 |
Klf1
|
Kruppel-like factor 1 (erythroid) |
| chr17_+_34457868 | 7.97 |
ENSMUST00000095342.11
ENSMUST00000167280.8 ENSMUST00000236838.2 |
H2-Ob
|
histocompatibility 2, O region beta locus |
| chr5_+_96104775 | 7.93 |
ENSMUST00000023840.7
|
Cxcl13
|
chemokine (C-X-C motif) ligand 13 |
| chr11_-_83483807 | 7.86 |
ENSMUST00000019071.4
|
Ccl6
|
chemokine (C-C motif) ligand 6 |
| chr11_-_6470918 | 7.83 |
ENSMUST00000003459.4
|
Myo1g
|
myosin IG |
| chr6_-_70094604 | 7.81 |
ENSMUST00000103378.3
|
Igkv8-30
|
immunoglobulin kappa chain variable 8-30 |
| chr13_-_20008397 | 7.71 |
ENSMUST00000222664.2
ENSMUST00000065335.3 |
Gpr141
|
G protein-coupled receptor 141 |
| chr6_-_69204417 | 7.69 |
ENSMUST00000103346.3
|
Igkv4-72
|
immunoglobulin kappa chain variable 4-72 |
| chr6_-_68609426 | 7.63 |
ENSMUST00000103328.3
|
Igkv10-96
|
immunoglobulin kappa variable 10-96 |
| chr9_+_46139878 | 7.60 |
ENSMUST00000034588.9
ENSMUST00000132155.2 |
Apoa1
|
apolipoprotein A-I |
| chr6_+_70192384 | 7.58 |
ENSMUST00000103383.3
|
Igkv6-25
|
immunoglobulin kappa chain variable 6-25 |
| chr6_+_125298372 | 7.49 |
ENSMUST00000176442.8
ENSMUST00000177329.2 |
Scnn1a
|
sodium channel, nonvoltage-gated 1 alpha |
| chr2_-_129213050 | 7.49 |
ENSMUST00000028881.14
|
Il1b
|
interleukin 1 beta |
| chr11_+_101339233 | 7.48 |
ENSMUST00000010502.13
|
Ifi35
|
interferon-induced protein 35 |
| chr17_+_84990541 | 7.47 |
ENSMUST00000045714.15
ENSMUST00000171915.2 |
Abcg8
|
ATP binding cassette subfamily G member 8 |
| chr6_-_69553484 | 7.37 |
ENSMUST00000103357.4
|
Igkv4-57
|
immunoglobulin kappa variable 4-57 |
| chr3_-_14873406 | 7.32 |
ENSMUST00000181860.8
ENSMUST00000144327.3 |
Car1
|
carbonic anhydrase 1 |
| chr7_-_46392403 | 7.26 |
ENSMUST00000128088.4
|
Saa1
|
serum amyloid A 1 |
| chr8_+_105460627 | 7.25 |
ENSMUST00000034346.15
ENSMUST00000164182.3 |
Ces2a
|
carboxylesterase 2A |
| chr12_-_113912416 | 7.14 |
ENSMUST00000103464.3
|
Ighv4-1
|
immunoglobulin heavy variable 4-1 |
| chr6_-_68713748 | 7.12 |
ENSMUST00000183936.2
ENSMUST00000196863.2 |
Igkv19-93
|
immunoglobulin kappa chain variable 19-93 |
| chr17_-_31348576 | 7.08 |
ENSMUST00000024827.5
|
Tff3
|
trefoil factor 3, intestinal |
| chr6_-_69584812 | 6.98 |
ENSMUST00000103359.3
|
Igkv4-55
|
immunoglobulin kappa variable 4-55 |
| chr17_+_34524884 | 6.91 |
ENSMUST00000074557.11
|
H2-Eb1
|
histocompatibility 2, class II antigen E beta |
| chr3_+_94600863 | 6.90 |
ENSMUST00000090848.10
ENSMUST00000173981.8 ENSMUST00000173849.8 ENSMUST00000174223.2 |
Selenbp2
|
selenium binding protein 2 |
| chr6_-_69415741 | 6.86 |
ENSMUST00000103354.3
|
Igkv4-59
|
immunoglobulin kappa variable 4-59 |
| chr12_-_113271532 | 6.85 |
ENSMUST00000192188.3
ENSMUST00000103418.3 |
Ighg2b
|
immunoglobulin heavy constant gamma 2B |
| chr5_-_100710702 | 6.71 |
ENSMUST00000097437.9
|
Plac8
|
placenta-specific 8 |
| chr12_-_113223839 | 6.70 |
ENSMUST00000194738.6
ENSMUST00000178282.3 |
Igha
|
immunoglobulin heavy constant alpha |
| chr17_+_34524841 | 6.65 |
ENSMUST00000235530.2
|
H2-Eb1
|
histocompatibility 2, class II antigen E beta |
| chr7_-_25176959 | 6.65 |
ENSMUST00000098668.3
ENSMUST00000206687.2 ENSMUST00000206676.2 ENSMUST00000205308.2 ENSMUST00000098669.8 ENSMUST00000206171.2 ENSMUST00000098666.9 |
Ceacam1
|
carcinoembryonic antigen-related cell adhesion molecule 1 |
| chr10_+_51367052 | 6.64 |
ENSMUST00000217705.2
ENSMUST00000078778.5 ENSMUST00000220182.2 ENSMUST00000220226.2 |
Lilrb4a
|
leukocyte immunoglobulin-like receptor, subfamily B, member 4A |
| chr12_+_31440842 | 6.63 |
ENSMUST00000167432.8
|
Slc26a3
|
solute carrier family 26, member 3 |
| chr5_-_33375509 | 6.63 |
ENSMUST00000201475.2
|
Spon2
|
spondin 2, extracellular matrix protein |
| chr6_-_68994064 | 6.61 |
ENSMUST00000103341.4
|
Igkv4-80
|
immunoglobulin kappa variable 4-80 |
| chr9_+_110248815 | 6.50 |
ENSMUST00000035061.9
|
Ngp
|
neutrophilic granule protein |
| chr13_-_100453124 | 6.47 |
ENSMUST00000042220.3
|
Naip6
|
NLR family, apoptosis inhibitory protein 6 |
| chr9_-_22043083 | 6.45 |
ENSMUST00000069330.14
ENSMUST00000217643.2 |
Acp5
|
acid phosphatase 5, tartrate resistant |
| chr3_+_51568625 | 6.42 |
ENSMUST00000159554.7
ENSMUST00000161590.4 |
Mgst2
|
microsomal glutathione S-transferase 2 |
| chr10_-_127724557 | 6.39 |
ENSMUST00000047199.5
|
Rdh7
|
retinol dehydrogenase 7 |
| chr2_-_93283024 | 6.39 |
ENSMUST00000111257.8
ENSMUST00000145553.8 |
Cd82
|
CD82 antigen |
| chr7_-_79492091 | 6.38 |
ENSMUST00000049004.8
|
Anpep
|
alanyl (membrane) aminopeptidase |
| chr6_+_60921456 | 6.37 |
ENSMUST00000129603.4
ENSMUST00000204333.2 |
Mmrn1
|
multimerin 1 |
| chr8_-_112417633 | 6.35 |
ENSMUST00000034435.7
|
Ctrb1
|
chymotrypsinogen B1 |
| chr6_-_124710030 | 6.32 |
ENSMUST00000173647.2
|
Ptpn6
|
protein tyrosine phosphatase, non-receptor type 6 |
| chr9_+_110867807 | 6.30 |
ENSMUST00000197575.2
|
Ltf
|
lactotransferrin |
| chr1_-_194858918 | 6.26 |
ENSMUST00000210219.2
ENSMUST00000193801.2 |
Cr2
|
complement receptor 2 |
| chr11_-_5848771 | 6.16 |
ENSMUST00000102921.4
|
Myl7
|
myosin, light polypeptide 7, regulatory |
| chr5_+_33261563 | 6.14 |
ENSMUST00000011178.5
|
Slc5a1
|
solute carrier family 5 (sodium/glucose cotransporter), member 1 |
| chr6_+_43242516 | 6.08 |
ENSMUST00000031750.14
|
Arhgef5
|
Rho guanine nucleotide exchange factor (GEF) 5 |
| chr12_-_115109539 | 6.03 |
ENSMUST00000192554.6
ENSMUST00000103522.3 |
Ighv1-52
|
immunoglobulin heavy variable 1-52 |
| chr3_-_88455556 | 6.02 |
ENSMUST00000131775.2
ENSMUST00000008745.13 |
Rab25
|
RAB25, member RAS oncogene family |
| chr10_-_81121596 | 6.02 |
ENSMUST00000218484.2
|
Tjp3
|
tight junction protein 3 |
| chr17_-_57501170 | 6.01 |
ENSMUST00000005976.8
|
Tnfsf14
|
tumor necrosis factor (ligand) superfamily, member 14 |
| chr7_-_24459736 | 5.99 |
ENSMUST00000063956.7
|
Cd177
|
CD177 antigen |
| chr1_+_163889713 | 5.97 |
ENSMUST00000097491.10
|
Sell
|
selectin, lymphocyte |
| chr7_-_44803946 | 5.94 |
ENSMUST00000209963.2
ENSMUST00000107815.4 |
Aldh16a1
|
aldehyde dehydrogenase 16 family, member A1 |
| chr12_-_113958518 | 5.93 |
ENSMUST00000103467.2
|
Ighv14-2
|
immunoglobulin heavy variable 14-2 |
| chr1_-_194859015 | 5.88 |
ENSMUST00000082321.9
ENSMUST00000195120.6 |
Cr2
|
complement receptor 2 |
| chr11_+_95728042 | 5.87 |
ENSMUST00000107712.8
|
Gngt2
|
guanine nucleotide binding protein (G protein), gamma transducing activity polypeptide 2 |
| chr7_-_103463120 | 5.85 |
ENSMUST00000098192.4
|
Hbb-bt
|
hemoglobin, beta adult t chain |
| chr6_+_68013772 | 5.84 |
ENSMUST00000197515.2
ENSMUST00000103315.3 |
Igkv17-121
|
immunoglobulin kappa variable 17-121 |
| chr6_-_124710084 | 5.84 |
ENSMUST00000112484.10
|
Ptpn6
|
protein tyrosine phosphatase, non-receptor type 6 |
| chr7_+_24476597 | 5.81 |
ENSMUST00000038069.9
ENSMUST00000206847.2 |
Ceacam10
|
carcinoembryonic antigen-related cell adhesion molecule 10 |
| chr6_-_55152002 | 5.77 |
ENSMUST00000003569.6
|
Inmt
|
indolethylamine N-methyltransferase |
| chr10_-_117118226 | 5.70 |
ENSMUST00000092163.9
|
Lyz2
|
lysozyme 2 |
| chrX_+_73314418 | 5.66 |
ENSMUST00000008826.14
ENSMUST00000151702.8 ENSMUST00000074085.12 ENSMUST00000135690.2 |
Rpl10
|
ribosomal protein L10 |
| chr6_+_129157576 | 5.64 |
ENSMUST00000032260.6
|
Clec2d
|
C-type lectin domain family 2, member d |
| chr1_-_173703424 | 5.63 |
ENSMUST00000186442.7
|
Mndal
|
myeloid nuclear differentiation antigen like |
| chr3_+_87265181 | 5.63 |
ENSMUST00000015998.8
|
Cd5l
|
CD5 antigen-like |
| chr10_+_127157784 | 5.63 |
ENSMUST00000219511.2
|
Arhgap9
|
Rho GTPase activating protein 9 |
| chr13_-_34529157 | 5.63 |
ENSMUST00000040336.12
|
Slc22a23
|
solute carrier family 22, member 23 |
| chr17_+_34362281 | 5.62 |
ENSMUST00000236519.2
|
H2-DMb2
|
histocompatibility 2, class II, locus Mb2 |
| chr19_-_4889284 | 5.56 |
ENSMUST00000236451.2
ENSMUST00000236178.2 |
Ccs
|
copper chaperone for superoxide dismutase |
| chr19_+_10819896 | 5.53 |
ENSMUST00000025646.3
|
Slc15a3
|
solute carrier family 15, member 3 |
| chr2_-_164197987 | 5.51 |
ENSMUST00000165980.2
|
Slpi
|
secretory leukocyte peptidase inhibitor |
| chr12_-_113386312 | 5.50 |
ENSMUST00000177715.8
ENSMUST00000103426.3 |
Ighm
|
immunoglobulin heavy constant mu |
| chr7_+_43086554 | 5.47 |
ENSMUST00000206741.2
|
Nkg7
|
natural killer cell group 7 sequence |
| chr10_+_79852750 | 5.47 |
ENSMUST00000105373.8
|
Arhgap45
|
Rho GTPase activating protein 45 |
| chr6_-_70412460 | 5.47 |
ENSMUST00000103394.2
|
Igkv6-14
|
immunoglobulin kappa variable 6-14 |
| chr9_-_34967081 | 5.45 |
ENSMUST00000215463.2
|
St3gal4
|
ST3 beta-galactoside alpha-2,3-sialyltransferase 4 |
| chr3_+_90434160 | 5.44 |
ENSMUST00000199538.5
ENSMUST00000164481.7 ENSMUST00000167598.6 |
S100a14
|
S100 calcium binding protein A14 |
| chr8_+_110717062 | 5.44 |
ENSMUST00000001720.14
ENSMUST00000143741.2 |
Tat
|
tyrosine aminotransferase |
| chr4_+_152243324 | 5.44 |
ENSMUST00000030782.2
|
Hes2
|
hes family bHLH transcription factor 2 |
| chr2_+_84810802 | 5.43 |
ENSMUST00000028467.6
|
Prg2
|
proteoglycan 2, bone marrow |
| chr17_+_31605184 | 5.43 |
ENSMUST00000047168.13
ENSMUST00000127929.8 ENSMUST00000134525.9 ENSMUST00000236454.2 ENSMUST00000238091.2 ENSMUST00000235719.2 |
Pde9a
|
phosphodiesterase 9A |
| chr2_-_130928658 | 5.39 |
ENSMUST00000028794.10
ENSMUST00000110227.8 ENSMUST00000110226.2 |
Siglec1
|
sialic acid binding Ig-like lectin 1, sialoadhesin |
| chr6_+_67532481 | 5.34 |
ENSMUST00000103302.3
|
Igkv2-137
|
immunoglobulin kappa chain variable 2-137 |
| chr9_-_22042930 | 5.29 |
ENSMUST00000213815.2
|
Acp5
|
acid phosphatase 5, tartrate resistant |
| chr6_-_68681962 | 5.28 |
ENSMUST00000103330.2
|
Igkv10-94
|
immunoglobulin kappa variable 10-94 |
| chr12_-_114140482 | 5.22 |
ENSMUST00000103475.2
ENSMUST00000195706.2 |
Ighv14-4
|
immunoglobulin heavy variable 14-4 |
| chr8_-_21586066 | 5.21 |
ENSMUST00000077452.4
|
Defa38
|
defensin, alpha, 38 |
| chr6_-_68887957 | 5.20 |
ENSMUST00000200454.2
|
Igkv4-86
|
immunoglobulin kappa variable 4-86 |
| chr6_+_41092970 | 5.20 |
ENSMUST00000103268.3
|
Trbv13-1
|
T cell receptor beta, variable 13-1 |
| chr12_-_114443071 | 5.20 |
ENSMUST00000103492.2
|
Ighv10-1
|
immunoglobulin heavy variable 10-1 |
| chr17_-_66901568 | 5.19 |
ENSMUST00000024914.4
|
Themis3
|
thymocyte selection associated family member 3 |
| chr19_-_5518515 | 5.19 |
ENSMUST00000236256.2
ENSMUST00000025844.6 |
Ctsw
|
cathepsin W |
| chr11_+_11634967 | 5.19 |
ENSMUST00000141436.8
ENSMUST00000126058.8 |
Ikzf1
|
IKAROS family zinc finger 1 |
| chr5_+_43976218 | 5.17 |
ENSMUST00000101237.8
|
Bst1
|
bone marrow stromal cell antigen 1 |
| chr3_+_51568588 | 5.16 |
ENSMUST00000099106.10
|
Mgst2
|
microsomal glutathione S-transferase 2 |
| chr4_-_94940425 | 5.15 |
ENSMUST00000107094.2
|
Jun
|
jun proto-oncogene |
| chr3_-_98670369 | 5.12 |
ENSMUST00000107019.8
ENSMUST00000107018.8 |
Hsd3b3
|
hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 3 |
| chr6_+_71350519 | 5.12 |
ENSMUST00000172321.3
|
Cd8a
|
CD8 antigen, alpha chain |
| chr14_+_51193449 | 5.12 |
ENSMUST00000095925.5
|
Pnp2
|
purine-nucleoside phosphorylase 2 |
| chr6_+_48624158 | 5.11 |
ENSMUST00000203083.3
|
Gimap8
|
GTPase, IMAP family member 8 |
| chr10_-_86843878 | 5.10 |
ENSMUST00000035288.17
|
Stab2
|
stabilin 2 |
| chr8_+_125302843 | 5.10 |
ENSMUST00000093033.6
ENSMUST00000133086.2 |
Capn9
|
calpain 9 |
| chr5_-_120887864 | 5.09 |
ENSMUST00000053909.13
ENSMUST00000081491.13 |
Oas2
|
2'-5' oligoadenylate synthetase 2 |
| chr11_+_46701619 | 5.08 |
ENSMUST00000068877.7
|
Timd4
|
T cell immunoglobulin and mucin domain containing 4 |
| chr9_+_20927271 | 5.07 |
ENSMUST00000086399.6
|
Icam1
|
intercellular adhesion molecule 1 |
| chr1_-_130390418 | 5.06 |
ENSMUST00000027650.13
|
Cd55
|
CD55 molecule, decay accelerating factor for complement |
| chr12_-_113392728 | 5.06 |
ENSMUST00000103428.2
|
Ighj3
|
immunoglobulin heavy joining 3 |
| chr6_+_71350411 | 5.05 |
ENSMUST00000066747.14
|
Cd8a
|
CD8 antigen, alpha chain |
| chr15_+_83447784 | 5.04 |
ENSMUST00000047419.8
|
Tspo
|
translocator protein |
| chr10_+_75784126 | 5.01 |
ENSMUST00000000926.3
|
Vpreb3
|
pre-B lymphocyte gene 3 |
| chrX_-_73325204 | 5.01 |
ENSMUST00000114189.10
ENSMUST00000119361.4 |
Dnase1l1
|
deoxyribonuclease 1-like 1 |
| chr7_+_127728712 | 5.00 |
ENSMUST00000033053.8
ENSMUST00000205460.2 |
Itgax
|
integrin alpha X |
| chr11_+_81948649 | 4.99 |
ENSMUST00000000342.3
|
Ccl11
|
chemokine (C-C motif) ligand 11 |
| chr10_+_79722081 | 4.96 |
ENSMUST00000046091.7
|
Elane
|
elastase, neutrophil expressed |
| chr19_-_6973393 | 4.96 |
ENSMUST00000041686.10
ENSMUST00000180765.2 |
Nudt22
|
nudix (nucleoside diphosphate linked moiety X)-type motif 22 |
| chr4_-_130068484 | 4.95 |
ENSMUST00000132545.3
ENSMUST00000175992.8 ENSMUST00000105999.9 |
Tinagl1
|
tubulointerstitial nephritis antigen-like 1 |
| chr6_+_70640233 | 4.95 |
ENSMUST00000103400.3
|
Igkv3-5
|
immunoglobulin kappa chain variable 3-5 |
| chr14_-_51384236 | 4.94 |
ENSMUST00000080126.4
|
Rnase1
|
ribonuclease, RNase A family, 1 (pancreatic) |
| chr12_-_113324852 | 4.93 |
ENSMUST00000223179.2
ENSMUST00000103423.3 |
Ighg3
|
Immunoglobulin heavy constant gamma 3 |
| chr6_+_48624295 | 4.91 |
ENSMUST00000078223.6
ENSMUST00000203509.2 |
Gimap8
|
GTPase, IMAP family member 8 |
| chr2_-_160208977 | 4.91 |
ENSMUST00000099126.5
|
Mafb
|
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein B (avian) |
| chr18_+_4921663 | 4.88 |
ENSMUST00000143254.8
|
Svil
|
supervillin |
| chr8_-_3770642 | 4.88 |
ENSMUST00000062037.7
|
Clec4g
|
C-type lectin domain family 4, member g |
| chr17_+_35643853 | 4.86 |
ENSMUST00000113879.4
|
H2-Q6
|
histocompatibility 2, Q region locus 6 |
| chr11_+_104498824 | 4.85 |
ENSMUST00000021028.5
|
Itgb3
|
integrin beta 3 |
| chr12_-_113802603 | 4.84 |
ENSMUST00000103458.3
ENSMUST00000193652.2 |
Ighv5-16
|
immunoglobulin heavy variable 5-16 |
| chr2_-_157988303 | 4.83 |
ENSMUST00000103122.10
|
Tgm2
|
transglutaminase 2, C polypeptide |
| chr11_+_72889889 | 4.83 |
ENSMUST00000021141.14
|
P2rx1
|
purinergic receptor P2X, ligand-gated ion channel, 1 |
| chr13_-_115068626 | 4.81 |
ENSMUST00000056117.10
|
Itga2
|
integrin alpha 2 |
| chr19_+_11446716 | 4.81 |
ENSMUST00000165310.3
|
Ms4a6c
|
membrane-spanning 4-domains, subfamily A, member 6C |
| chr6_-_69678271 | 4.77 |
ENSMUST00000103363.2
|
Igkv4-50
|
immunoglobulin kappa variable 4-50 |
| chr6_-_115569504 | 4.77 |
ENSMUST00000112957.2
|
Mkrn2os
|
makorin, ring finger protein 2, opposite strand |
| chr4_-_150093435 | 4.77 |
ENSMUST00000030830.4
|
H6pd
|
hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) |
| chr12_-_114226570 | 4.75 |
ENSMUST00000103479.4
ENSMUST00000195619.2 |
Ighv3-5
|
immunoglobulin heavy variable 3-5 |
| chr12_-_113392174 | 4.75 |
ENSMUST00000103427.2
|
Ighj4
|
immunoglobulin heavy joining 4 |
| chr2_+_84629172 | 4.74 |
ENSMUST00000102642.9
ENSMUST00000150325.2 |
Ube2l6
|
ubiquitin-conjugating enzyme E2L 6 |
| chr16_+_57173456 | 4.73 |
ENSMUST00000159816.8
|
Filip1l
|
filamin A interacting protein 1-like |
| chr10_+_127595639 | 4.73 |
ENSMUST00000128247.2
|
Rdh16f1
|
RDH16 family member 1 |
| chr12_-_113552322 | 4.72 |
ENSMUST00000103443.3
|
Ighv2-2
|
immunoglobulin heavy variable 2-2 |
| chr12_-_113625906 | 4.72 |
ENSMUST00000103448.3
|
Ighv5-9
|
immunoglobulin heavy variable 5-9 |
| chr11_+_69856222 | 4.68 |
ENSMUST00000018713.13
|
Cldn7
|
claudin 7 |
| chr7_+_142025575 | 4.66 |
ENSMUST00000038946.9
|
Lsp1
|
lymphocyte specific 1 |
| chr16_+_48692976 | 4.66 |
ENSMUST00000065666.6
|
Retnlg
|
resistin like gamma |
| chr15_-_78449172 | 4.66 |
ENSMUST00000230952.2
|
Rac2
|
Rac family small GTPase 2 |
| chr12_-_115706126 | 4.63 |
ENSMUST00000166645.2
ENSMUST00000196690.2 |
Ighv1-71
|
immunoglobulin heavy variable 1-71 |
| chr7_-_3901119 | 4.62 |
ENSMUST00000070639.8
|
Gm14548
|
predicted gene 14548 |
| chr7_+_19699291 | 4.61 |
ENSMUST00000094753.6
|
Ceacam20
|
carcinoembryonic antigen-related cell adhesion molecule 20 |
| chr7_+_126690525 | 4.61 |
ENSMUST00000056288.7
ENSMUST00000206102.2 |
AI467606
|
expressed sequence AI467606 |
| chr7_+_101033218 | 4.60 |
ENSMUST00000148902.8
|
Arap1
|
ArfGAP with RhoGAP domain, ankyrin repeat and PH domain 1 |
| chr11_+_117716759 | 4.60 |
ENSMUST00000149668.2
|
Afmid
|
arylformamidase |
| chr10_+_51356728 | 4.60 |
ENSMUST00000102894.6
ENSMUST00000219661.2 ENSMUST00000219696.2 ENSMUST00000217706.2 |
Lilr4b
Gm49339
|
leukocyte immunoglobulin-like receptor, subfamily B, member 4B predicted gene, 49339 |
| chr12_+_113112311 | 4.59 |
ENSMUST00000199089.5
|
Crip1
|
cysteine-rich protein 1 (intestinal) |
| chr5_-_113957318 | 4.58 |
ENSMUST00000201194.4
|
Selplg
|
selectin, platelet (p-selectin) ligand |
| chr9_+_108216233 | 4.54 |
ENSMUST00000082429.8
|
Gpx1
|
glutathione peroxidase 1 |
| chr6_+_123206802 | 4.53 |
ENSMUST00000112554.9
ENSMUST00000024118.11 ENSMUST00000117130.8 |
Clec4n
|
C-type lectin domain family 4, member n |
| chr3_-_144638284 | 4.53 |
ENSMUST00000098549.4
|
Clca4b
|
chloride channel accessory 4B |
| chr2_-_84605764 | 4.51 |
ENSMUST00000111641.2
|
Serping1
|
serine (or cysteine) peptidase inhibitor, clade G, member 1 |
| chr6_-_69626340 | 4.51 |
ENSMUST00000198328.2
|
Igkv4-53
|
immunoglobulin kappa variable 4-53 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.8 | 11.4 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
| 3.7 | 11.2 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
| 3.6 | 14.3 | GO:1900229 | biofilm formation(GO:0042710) single-species biofilm formation(GO:0044010) single-species biofilm formation in or on host organism(GO:0044407) membrane disruption in other organism(GO:0051673) regulation of single-species biofilm formation(GO:1900190) negative regulation of single-species biofilm formation(GO:1900191) regulation of single-species biofilm formation in or on host organism(GO:1900228) negative regulation of single-species biofilm formation in or on host organism(GO:1900229) |
| 3.3 | 19.8 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 3.0 | 18.1 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 3.0 | 9.0 | GO:0001868 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 2.9 | 8.7 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 2.8 | 11.2 | GO:0009608 | response to symbiont(GO:0009608) response to symbiotic bacterium(GO:0009609) response to selenium ion(GO:0010269) |
| 2.8 | 22.3 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
| 2.7 | 5.5 | GO:0002344 | peripheral B cell selection(GO:0002343) B cell affinity maturation(GO:0002344) |
| 2.7 | 10.8 | GO:0060697 | positive regulation of phospholipid catabolic process(GO:0060697) |
| 2.7 | 10.7 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 2.7 | 8.0 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
| 2.6 | 7.8 | GO:0097185 | amiloride transport(GO:0015898) cellular response to copper ion starvation(GO:0035874) response to azide(GO:0097184) cellular response to azide(GO:0097185) |
| 2.6 | 20.5 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
| 2.6 | 7.7 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 2.6 | 2.6 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
| 2.5 | 7.5 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 2.5 | 7.5 | GO:0060557 | positive regulation of vitamin metabolic process(GO:0046136) positive regulation of vitamin D biosynthetic process(GO:0060557) positive regulation of calcidiol 1-monooxygenase activity(GO:0060559) |
| 2.4 | 7.2 | GO:0002777 | antimicrobial peptide biosynthetic process(GO:0002777) antibacterial peptide biosynthetic process(GO:0002780) |
| 2.3 | 11.7 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
| 2.3 | 6.9 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 2.2 | 8.9 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
| 2.2 | 6.7 | GO:0070237 | positive regulation of activation-induced cell death of T cells(GO:0070237) |
| 2.1 | 8.5 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 2.1 | 4.2 | GO:0002477 | antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) |
| 2.0 | 32.6 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 2.0 | 15.9 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 2.0 | 7.9 | GO:0033580 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 2.0 | 7.8 | GO:0010901 | negative regulation of cytokine secretion involved in immune response(GO:0002740) regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
| 1.9 | 9.7 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
| 1.9 | 5.8 | GO:0046724 | oxalic acid secretion(GO:0046724) |
| 1.9 | 5.7 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 1.8 | 1.8 | GO:0002856 | negative regulation of natural killer cell mediated immune response to tumor cell(GO:0002856) negative regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002859) |
| 1.8 | 5.5 | GO:0098583 | mastication(GO:0071626) learned vocalization behavior(GO:0098583) |
| 1.8 | 5.4 | GO:0002215 | defense response to nematode(GO:0002215) |
| 1.8 | 1.8 | GO:0019405 | alditol catabolic process(GO:0019405) |
| 1.8 | 5.3 | GO:1902567 | negative regulation of eosinophil activation(GO:1902567) |
| 1.8 | 8.8 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 1.8 | 7.0 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 1.7 | 8.7 | GO:1903918 | regulation of actin filament severing(GO:1903918) negative regulation of actin filament severing(GO:1903919) |
| 1.7 | 5.2 | GO:0045660 | positive regulation of neutrophil differentiation(GO:0045660) |
| 1.7 | 5.1 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 1.7 | 6.9 | GO:0001810 | regulation of type I hypersensitivity(GO:0001810) type I hypersensitivity(GO:0016068) |
| 1.7 | 5.1 | GO:0009087 | methionine catabolic process(GO:0009087) |
| 1.7 | 6.8 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 1.7 | 5.1 | GO:2000422 | regulation of eosinophil chemotaxis(GO:2000422) positive regulation of eosinophil chemotaxis(GO:2000424) |
| 1.7 | 3.4 | GO:0002296 | T-helper 1 cell lineage commitment(GO:0002296) |
| 1.7 | 1.7 | GO:2000547 | regulation of dendritic cell dendrite assembly(GO:2000547) |
| 1.7 | 6.6 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 1.7 | 13.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 1.6 | 6.5 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 1.6 | 8.1 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
| 1.6 | 4.9 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
| 1.6 | 4.8 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 1.6 | 4.8 | GO:0071939 | vitamin A transport(GO:0071938) vitamin A import(GO:0071939) |
| 1.6 | 20.9 | GO:0070269 | pyroptosis(GO:0070269) |
| 1.6 | 9.6 | GO:1903436 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 1.6 | 8.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 1.6 | 6.3 | GO:0010813 | neuropeptide catabolic process(GO:0010813) |
| 1.5 | 3.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 1.5 | 1.5 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 1.5 | 4.6 | GO:0018900 | dichloromethane metabolic process(GO:0018900) |
| 1.5 | 10.7 | GO:0015862 | uridine transport(GO:0015862) |
| 1.5 | 13.6 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 1.5 | 4.5 | GO:1903632 | positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) |
| 1.5 | 13.4 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 1.5 | 4.4 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
| 1.4 | 7.2 | GO:0002485 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 1.4 | 7.2 | GO:2000334 | response to linoleic acid(GO:0070543) blood microparticle formation(GO:0072564) regulation of blood microparticle formation(GO:2000332) positive regulation of blood microparticle formation(GO:2000334) |
| 1.4 | 4.3 | GO:0010925 | regulation of inositol-polyphosphate 5-phosphatase activity(GO:0010924) positive regulation of inositol-polyphosphate 5-phosphatase activity(GO:0010925) phospholipase C-inhibiting G-protein coupled receptor signaling pathway(GO:0030845) regulation of cell diameter(GO:0060305) |
| 1.4 | 1.4 | GO:0070268 | cornification(GO:0070268) |
| 1.4 | 4.1 | GO:0071846 | actin filament debranching(GO:0071846) |
| 1.4 | 5.4 | GO:1902530 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 1.4 | 1.4 | GO:0015864 | pyrimidine nucleoside transport(GO:0015864) |
| 1.4 | 4.1 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 1.4 | 4.1 | GO:0032701 | negative regulation of granulocyte macrophage colony-stimulating factor production(GO:0032685) negative regulation of interleukin-18 production(GO:0032701) |
| 1.3 | 204.1 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 1.3 | 5.3 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 1.3 | 2.6 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 1.3 | 1.3 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 1.3 | 5.3 | GO:0090472 | dibasic protein processing(GO:0090472) |
| 1.3 | 10.5 | GO:0046149 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 1.3 | 2.6 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
| 1.3 | 2.6 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 1.3 | 3.9 | GO:0002414 | immune response in mucosal-associated lymphoid tissue(GO:0002386) immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 1.2 | 3.7 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
| 1.2 | 4.9 | GO:1902081 | regulation of calcium ion import into sarcoplasmic reticulum(GO:1902080) negative regulation of calcium ion import into sarcoplasmic reticulum(GO:1902081) |
| 1.2 | 6.1 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 1.2 | 7.3 | GO:1903609 | negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
| 1.2 | 4.8 | GO:0002554 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
| 1.2 | 9.7 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 1.2 | 6.0 | GO:1904171 | negative regulation of bleb assembly(GO:1904171) |
| 1.2 | 6.0 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 1.2 | 1.2 | GO:0071724 | response to diacyl bacterial lipopeptide(GO:0071724) cellular response to diacyl bacterial lipopeptide(GO:0071726) |
| 1.2 | 2.3 | GO:0045608 | negative regulation of auditory receptor cell differentiation(GO:0045608) |
| 1.2 | 5.8 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 1.1 | 3.4 | GO:1903413 | response to bile acid(GO:1903412) cellular response to bile acid(GO:1903413) |
| 1.1 | 13.7 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 1.1 | 1.1 | GO:0060264 | regulation of respiratory burst involved in inflammatory response(GO:0060264) |
| 1.1 | 6.8 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 1.1 | 3.4 | GO:0043305 | negative regulation of mast cell degranulation(GO:0043305) |
| 1.1 | 44.3 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 1.1 | 4.4 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 1.1 | 6.6 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 1.1 | 2.2 | GO:0042196 | chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
| 1.1 | 9.7 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
| 1.1 | 3.2 | GO:0090673 | endothelial cell-matrix adhesion(GO:0090673) |
| 1.1 | 5.4 | GO:0002232 | leukocyte chemotaxis involved in inflammatory response(GO:0002232) |
| 1.1 | 3.2 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 1.1 | 1.1 | GO:0019883 | antigen processing and presentation of endogenous antigen(GO:0019883) |
| 1.1 | 4.2 | GO:0086047 | membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
| 1.1 | 2.1 | GO:0046226 | coumarin metabolic process(GO:0009804) coumarin catabolic process(GO:0046226) |
| 1.1 | 1.1 | GO:0090182 | regulation of secretion of lysosomal enzymes(GO:0090182) |
| 1.0 | 4.2 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 1.0 | 2.1 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 1.0 | 3.1 | GO:1904629 | negative regulation of interleukin-12 biosynthetic process(GO:0045083) response to diterpene(GO:1904629) cellular response to diterpene(GO:1904630) response to glucoside(GO:1904631) cellular response to glucoside(GO:1904632) |
| 1.0 | 3.1 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 1.0 | 5.1 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 1.0 | 7.2 | GO:0060309 | elastin catabolic process(GO:0060309) |
| 1.0 | 259.7 | GO:0002377 | immunoglobulin production(GO:0002377) |
| 1.0 | 4.1 | GO:0006710 | androgen catabolic process(GO:0006710) |
| 1.0 | 9.1 | GO:0052697 | flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
| 1.0 | 5.0 | GO:0009597 | detection of virus(GO:0009597) |
| 1.0 | 3.0 | GO:1905072 | cloacal septation(GO:0060197) regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) cardiac jelly development(GO:1905072) negative regulation of cell proliferation involved in heart morphogenesis(GO:2000137) |
| 1.0 | 4.0 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 1.0 | 12.8 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 1.0 | 4.9 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 1.0 | 5.9 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) |
| 1.0 | 2.9 | GO:0034371 | chylomicron remodeling(GO:0034371) |
| 1.0 | 2.9 | GO:0018160 | peptidyl-pyrromethane cofactor linkage(GO:0018160) |
| 1.0 | 5.7 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 1.0 | 7.6 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.9 | 5.6 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.9 | 19.7 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
| 0.9 | 0.9 | GO:1901074 | regulation of engulfment of apoptotic cell(GO:1901074) |
| 0.9 | 1.9 | GO:0016102 | retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
| 0.9 | 2.8 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.9 | 4.6 | GO:1990743 | protein sialylation(GO:1990743) |
| 0.9 | 8.2 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.9 | 21.7 | GO:0071624 | positive regulation of granulocyte chemotaxis(GO:0071624) |
| 0.9 | 6.3 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.9 | 4.5 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
| 0.9 | 0.9 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.9 | 2.7 | GO:0060540 | atrial septum secundum morphogenesis(GO:0003290) lung lobe formation(GO:0060464) diaphragm morphogenesis(GO:0060540) |
| 0.9 | 9.8 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.9 | 6.2 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
| 0.9 | 3.5 | GO:0033368 | protein localization to secretory granule(GO:0033366) protein localization to mast cell secretory granule(GO:0033367) protease localization to mast cell secretory granule(GO:0033368) maintenance of protein location in mast cell secretory granule(GO:0033370) T cell secretory granule organization(GO:0033371) maintenance of protease location in mast cell secretory granule(GO:0033373) protein localization to T cell secretory granule(GO:0033374) protease localization to T cell secretory granule(GO:0033375) maintenance of protein location in T cell secretory granule(GO:0033377) maintenance of protease location in T cell secretory granule(GO:0033379) granzyme B localization to T cell secretory granule(GO:0033380) maintenance of granzyme B location in T cell secretory granule(GO:0033382) |
| 0.9 | 3.5 | GO:0060598 | dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 0.9 | 3.5 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.9 | 18.4 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.9 | 4.4 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.9 | 16.5 | GO:0019731 | antibacterial humoral response(GO:0019731) |
| 0.9 | 2.6 | GO:1904733 | negative regulation of electron carrier activity(GO:1904733) regulation of fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:1904735) negative regulation of fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:1904736) |
| 0.9 | 9.5 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.9 | 6.1 | GO:0035696 | monocyte extravasation(GO:0035696) |
| 0.9 | 3.5 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
| 0.9 | 0.9 | GO:0090265 | immune complex clearance by monocytes and macrophages(GO:0002436) regulation of immune complex clearance by monocytes and macrophages(GO:0090264) positive regulation of immune complex clearance by monocytes and macrophages(GO:0090265) |
| 0.9 | 4.3 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.9 | 3.4 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.9 | 2.6 | GO:0061623 | glycolytic process from galactose(GO:0061623) |
| 0.8 | 1.7 | GO:1902624 | positive regulation of neutrophil migration(GO:1902624) |
| 0.8 | 2.5 | GO:0033082 | regulation of extrathymic T cell differentiation(GO:0033082) |
| 0.8 | 5.9 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.8 | 0.8 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.8 | 5.9 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.8 | 1.7 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.8 | 0.8 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.8 | 9.1 | GO:0006569 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
| 0.8 | 2.5 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.8 | 2.5 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
| 0.8 | 7.4 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.8 | 4.9 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
| 0.8 | 2.5 | GO:0033091 | positive regulation of immature T cell proliferation(GO:0033091) |
| 0.8 | 11.4 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.8 | 2.4 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.8 | 4.9 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.8 | 3.2 | GO:0034756 | regulation of iron ion transport(GO:0034756) negative regulation of iron ion transport(GO:0034757) regulation of iron ion transmembrane transport(GO:0034759) negative regulation of iron ion transmembrane transport(GO:0034760) |
| 0.8 | 2.4 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.8 | 1.6 | GO:0033029 | neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.8 | 3.2 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.8 | 2.4 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.8 | 6.3 | GO:0097460 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.8 | 4.7 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.8 | 6.8 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.8 | 3.0 | GO:0046351 | disaccharide biosynthetic process(GO:0046351) |
| 0.8 | 5.3 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
| 0.7 | 13.5 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.7 | 3.0 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
| 0.7 | 1.5 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
| 0.7 | 3.6 | GO:0036302 | atrioventricular canal development(GO:0036302) |
| 0.7 | 9.4 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
| 0.7 | 2.9 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.7 | 10.0 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
| 0.7 | 3.6 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
| 0.7 | 3.5 | GO:0070229 | negative regulation of lymphocyte apoptotic process(GO:0070229) |
| 0.7 | 3.5 | GO:0000117 | regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.7 | 1.4 | GO:0060003 | copper ion export(GO:0060003) |
| 0.7 | 4.9 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.7 | 3.5 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
| 0.7 | 2.8 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.7 | 2.8 | GO:2000587 | negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.7 | 3.4 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.7 | 4.1 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.7 | 0.7 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.7 | 3.4 | GO:0010255 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
| 0.7 | 4.7 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
| 0.7 | 0.7 | GO:0035799 | ureter maturation(GO:0035799) |
| 0.7 | 3.4 | GO:0006548 | histidine catabolic process(GO:0006548) |
| 0.7 | 2.7 | GO:0036233 | glycine import(GO:0036233) |
| 0.7 | 10.6 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.7 | 1.3 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
| 0.7 | 2.6 | GO:0000915 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.7 | 4.6 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.7 | 2.0 | GO:1904456 | negative regulation of neuronal action potential(GO:1904456) |
| 0.7 | 3.3 | GO:0070829 | heterochromatin maintenance(GO:0070829) |
| 0.7 | 1.3 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.7 | 2.0 | GO:0048817 | negative regulation of hair follicle maturation(GO:0048817) |
| 0.6 | 3.9 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.6 | 1.9 | GO:0034378 | chylomicron assembly(GO:0034378) regulation of chylomicron remnant clearance(GO:0090320) |
| 0.6 | 1.9 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.6 | 1.9 | GO:1901994 | negative regulation of meiotic cell cycle phase transition(GO:1901994) |
| 0.6 | 1.3 | GO:0021558 | trochlear nerve development(GO:0021558) |
| 0.6 | 5.1 | GO:0018377 | protein myristoylation(GO:0018377) |
| 0.6 | 1.3 | GO:0090362 | positive regulation of platelet-derived growth factor production(GO:0090362) |
| 0.6 | 1.9 | GO:1990168 | protein K27-linked deubiquitination(GO:1990167) protein K33-linked deubiquitination(GO:1990168) |
| 0.6 | 1.3 | GO:0072679 | regulation of interleukin-1 biosynthetic process(GO:0045360) positive regulation of interleukin-1 biosynthetic process(GO:0045362) thymocyte migration(GO:0072679) |
| 0.6 | 3.2 | GO:0009732 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.6 | 3.8 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
| 0.6 | 5.0 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
| 0.6 | 3.7 | GO:0019732 | antifungal humoral response(GO:0019732) |
| 0.6 | 3.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.6 | 1.9 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.6 | 1.9 | GO:0002302 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 0.6 | 1.8 | GO:0001762 | beta-alanine transport(GO:0001762) taurine transport(GO:0015734) |
| 0.6 | 1.2 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.6 | 6.1 | GO:0060242 | contact inhibition(GO:0060242) |
| 0.6 | 5.4 | GO:0045588 | positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
| 0.6 | 2.4 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.6 | 0.6 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.6 | 1.8 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
| 0.6 | 1.8 | GO:0051885 | positive regulation of anagen(GO:0051885) |
| 0.6 | 1.8 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.6 | 7.0 | GO:1905155 | positive regulation of phagocytosis, engulfment(GO:0060100) positive regulation of membrane invagination(GO:1905155) |
| 0.6 | 2.3 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.6 | 4.6 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.6 | 4.0 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.6 | 4.5 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.6 | 1.7 | GO:0006272 | leading strand elongation(GO:0006272) DNA replication proofreading(GO:0045004) |
| 0.6 | 2.8 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 0.6 | 9.0 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.6 | 3.4 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.6 | 2.8 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.6 | 5.5 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
| 0.6 | 1.1 | GO:0002604 | regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
| 0.5 | 2.7 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.5 | 7.6 | GO:0042730 | fibrinolysis(GO:0042730) |
| 0.5 | 4.4 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
| 0.5 | 2.7 | GO:1903758 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.5 | 0.5 | GO:0050777 | negative regulation of immune response(GO:0050777) |
| 0.5 | 3.2 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.5 | 7.0 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.5 | 4.8 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.5 | 3.7 | GO:0015871 | choline transport(GO:0015871) |
| 0.5 | 2.7 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.5 | 4.3 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.5 | 1.1 | GO:0070384 | Harderian gland development(GO:0070384) |
| 0.5 | 3.2 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.5 | 1.6 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.5 | 2.6 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.5 | 2.6 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.5 | 2.1 | GO:0009223 | pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.5 | 1.6 | GO:0072278 | metanephric comma-shaped body morphogenesis(GO:0072278) |
| 0.5 | 5.2 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.5 | 1.5 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.5 | 2.6 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
| 0.5 | 1.5 | GO:1901053 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.5 | 1.5 | GO:0036275 | response to 5-fluorouracil(GO:0036275) |
| 0.5 | 22.7 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.5 | 6.0 | GO:1902400 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) signal transduction involved in mitotic G1 DNA damage checkpoint(GO:0072431) intracellular signal transduction involved in G1 DNA damage checkpoint(GO:1902400) |
| 0.5 | 4.5 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.5 | 2.0 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.5 | 1.5 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) basophil differentiation(GO:0030221) eosinophil fate commitment(GO:0035854) |
| 0.5 | 1.5 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
| 0.5 | 3.5 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.5 | 2.0 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.5 | 3.0 | GO:0039019 | pronephric nephron development(GO:0039019) |
| 0.5 | 0.5 | GO:0034118 | erythrocyte aggregation(GO:0034117) regulation of erythrocyte aggregation(GO:0034118) |
| 0.5 | 2.5 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.5 | 2.5 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.5 | 5.4 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.5 | 2.4 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 0.5 | 1.5 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.5 | 2.4 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.5 | 14.6 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.5 | 1.5 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
| 0.5 | 3.9 | GO:0009253 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.5 | 2.9 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.5 | 2.4 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.5 | 1.9 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.5 | 3.4 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.5 | 3.8 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.5 | 13.3 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.5 | 2.8 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.5 | 2.4 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.5 | 4.2 | GO:0035912 | dorsal aorta morphogenesis(GO:0035912) |
| 0.5 | 0.9 | GO:0097021 | lymphocyte migration into lymphoid organs(GO:0097021) |
| 0.5 | 2.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.5 | 0.5 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.5 | 1.4 | GO:0036245 | cellular response to menadione(GO:0036245) |
| 0.5 | 2.3 | GO:0021622 | optic cup structural organization(GO:0003409) oculomotor nerve development(GO:0021557) oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
| 0.5 | 4.2 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.5 | 0.9 | GO:0071281 | cellular response to iron ion(GO:0071281) |
| 0.5 | 0.5 | GO:0003256 | regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003256) |
| 0.5 | 1.4 | GO:0002645 | positive regulation of tolerance induction(GO:0002645) |
| 0.5 | 2.3 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.5 | 1.4 | GO:0061076 | negative regulation of neural retina development(GO:0061076) negative regulation of retina development in camera-type eye(GO:1902867) negative regulation of amacrine cell differentiation(GO:1902870) |
| 0.5 | 2.3 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.4 | 7.6 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.4 | 1.3 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
| 0.4 | 2.7 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.4 | 8.0 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.4 | 6.7 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.4 | 1.3 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.4 | 1.3 | GO:0009624 | response to nematode(GO:0009624) |
| 0.4 | 3.1 | GO:0019661 | glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.4 | 0.9 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.4 | 24.9 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
| 0.4 | 1.3 | GO:0008628 | hormone-mediated apoptotic signaling pathway(GO:0008628) |
| 0.4 | 0.9 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.4 | 4.8 | GO:0044146 | negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.4 | 2.6 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.4 | 2.2 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.4 | 3.5 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.4 | 2.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.4 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
| 0.4 | 1.3 | GO:0003167 | atrioventricular bundle cell differentiation(GO:0003167) |
| 0.4 | 1.7 | GO:0045348 | MHC class II biosynthetic process(GO:0045342) regulation of MHC class II biosynthetic process(GO:0045346) positive regulation of MHC class II biosynthetic process(GO:0045348) |
| 0.4 | 1.3 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
| 0.4 | 4.7 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
| 0.4 | 5.9 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.4 | 8.1 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.4 | 4.2 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.4 | 1.7 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.4 | 4.6 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
| 0.4 | 2.1 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.4 | 1.2 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.4 | 1.6 | GO:0046381 | CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.4 | 3.3 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.4 | 2.4 | GO:0060577 | pulmonary vein morphogenesis(GO:0060577) |
| 0.4 | 7.7 | GO:0031268 | pseudopodium organization(GO:0031268) |
| 0.4 | 3.7 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
| 0.4 | 10.6 | GO:0002446 | neutrophil mediated immunity(GO:0002446) |
| 0.4 | 6.1 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.4 | 5.2 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.4 | 1.2 | GO:0098749 | cerebellar neuron development(GO:0098749) |
| 0.4 | 2.0 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.4 | 1.2 | GO:0003218 | cardiac left ventricle formation(GO:0003218) |
| 0.4 | 1.6 | GO:1904180 | negative regulation of membrane depolarization(GO:1904180) |
| 0.4 | 2.8 | GO:0072606 | interleukin-8 secretion(GO:0072606) |
| 0.4 | 3.2 | GO:0043383 | negative T cell selection(GO:0043383) |
| 0.4 | 4.0 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
| 0.4 | 2.4 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.4 | 4.3 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.4 | 1.2 | GO:1903173 | phytol metabolic process(GO:0033306) fatty alcohol metabolic process(GO:1903173) |
| 0.4 | 2.0 | GO:0072733 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.4 | 2.3 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.4 | 1.9 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.4 | 0.4 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
| 0.4 | 1.2 | GO:0051715 | cytolysis in other organism(GO:0051715) |
| 0.4 | 1.9 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.4 | 1.5 | GO:0042758 | peroxisomal long-chain fatty acid import(GO:0015910) long-chain fatty acid catabolic process(GO:0042758) |
| 0.4 | 1.5 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.4 | 3.8 | GO:0043129 | surfactant homeostasis(GO:0043129) |
| 0.4 | 2.6 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.4 | 2.6 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.4 | 0.7 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
| 0.4 | 2.6 | GO:0002003 | angiotensin maturation(GO:0002003) |
| 0.4 | 1.5 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.4 | 1.1 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.4 | 5.2 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.4 | 4.8 | GO:0050862 | positive regulation of antigen receptor-mediated signaling pathway(GO:0050857) positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.4 | 2.6 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.4 | 8.1 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
| 0.4 | 1.5 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
| 0.4 | 1.1 | GO:2000156 | regulation of constitutive secretory pathway(GO:1903433) regulation of retrograde vesicle-mediated transport, Golgi to ER(GO:2000156) |
| 0.4 | 2.5 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.4 | 1.1 | GO:0002014 | vasoconstriction of artery involved in ischemic response to lowering of systemic arterial blood pressure(GO:0002014) |
| 0.4 | 2.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.4 | 2.9 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
| 0.4 | 2.9 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.4 | 3.6 | GO:0031640 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
| 0.4 | 1.4 | GO:1904569 | regulation of selenocysteine incorporation(GO:1904569) |
| 0.4 | 4.3 | GO:0035376 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.4 | 10.4 | GO:0019835 | cytolysis(GO:0019835) |
| 0.4 | 3.2 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
| 0.4 | 6.7 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
| 0.4 | 3.2 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.4 | 1.8 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.4 | 3.9 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.4 | 1.1 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
| 0.3 | 1.0 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.3 | 1.4 | GO:0034031 | coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) acetyl-CoA catabolic process(GO:0046356) |
| 0.3 | 2.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.3 | 0.3 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.3 | 1.4 | GO:0034036 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
| 0.3 | 0.7 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.3 | 1.7 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.3 | 1.0 | GO:0006780 | uroporphyrinogen III biosynthetic process(GO:0006780) |
| 0.3 | 3.1 | GO:0051546 | keratinocyte migration(GO:0051546) |
| 0.3 | 1.4 | GO:0014064 | positive regulation of serotonin secretion(GO:0014064) |
| 0.3 | 3.1 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 0.3 | 1.3 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.3 | 2.0 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.3 | 5.4 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.3 | 5.3 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.3 | 0.7 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.3 | 1.6 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.3 | 7.2 | GO:0008209 | androgen metabolic process(GO:0008209) |
| 0.3 | 5.3 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.3 | 1.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.3 | 13.4 | GO:0034340 | response to type I interferon(GO:0034340) |
| 0.3 | 2.6 | GO:0070602 | regulation of centromeric sister chromatid cohesion(GO:0070602) |
| 0.3 | 1.6 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.3 | 2.6 | GO:0008228 | opsonization(GO:0008228) |
| 0.3 | 2.9 | GO:0015865 | purine nucleotide transport(GO:0015865) purine ribonucleotide transport(GO:0015868) |
| 0.3 | 1.3 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.3 | 1.9 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
| 0.3 | 3.5 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.3 | 6.4 | GO:0097435 | fibril organization(GO:0097435) |
| 0.3 | 1.0 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.3 | 3.2 | GO:0097577 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.3 | 2.2 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
| 0.3 | 2.9 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
| 0.3 | 1.6 | GO:0032823 | regulation of natural killer cell differentiation(GO:0032823) |
| 0.3 | 5.0 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.3 | 4.1 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.3 | 2.5 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
| 0.3 | 3.5 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.3 | 8.2 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.3 | 0.6 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
| 0.3 | 0.9 | GO:0010447 | response to acidic pH(GO:0010447) |
| 0.3 | 0.6 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.3 | 8.7 | GO:0070232 | regulation of T cell apoptotic process(GO:0070232) |
| 0.3 | 0.6 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.3 | 1.2 | GO:0014718 | positive regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014718) sodium-dependent self proteolysis(GO:1990091) |
| 0.3 | 1.5 | GO:0040010 | positive regulation of growth rate(GO:0040010) |
| 0.3 | 2.2 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.3 | 1.5 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.3 | 0.9 | GO:0038156 | interleukin-3-mediated signaling pathway(GO:0038156) |
| 0.3 | 0.3 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.3 | 6.4 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.3 | 1.2 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
| 0.3 | 1.2 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.3 | 0.9 | GO:0021589 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) |
| 0.3 | 0.9 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.3 | 1.2 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.3 | 1.8 | GO:0009992 | cellular water homeostasis(GO:0009992) |
| 0.3 | 5.4 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.3 | 5.1 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
| 0.3 | 7.7 | GO:0002548 | monocyte chemotaxis(GO:0002548) |
| 0.3 | 2.6 | GO:0002544 | chronic inflammatory response(GO:0002544) |
| 0.3 | 1.5 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.3 | 2.3 | GO:0072540 | T-helper cell lineage commitment(GO:0002295) CD4-positive, alpha-beta T cell lineage commitment(GO:0043373) T-helper 17 cell lineage commitment(GO:0072540) |
| 0.3 | 13.0 | GO:0050891 | multicellular organismal water homeostasis(GO:0050891) |
| 0.3 | 1.2 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) |
| 0.3 | 2.3 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
| 0.3 | 2.0 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.3 | 12.8 | GO:0006801 | superoxide metabolic process(GO:0006801) |
| 0.3 | 2.0 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.3 | 5.9 | GO:0072376 | protein activation cascade(GO:0072376) |
| 0.3 | 0.8 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.3 | 0.8 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
| 0.3 | 1.7 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.3 | 2.0 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.3 | 2.8 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.3 | 0.6 | GO:0003093 | regulation of glomerular filtration(GO:0003093) |
| 0.3 | 1.4 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.3 | 2.2 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.3 | 1.9 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.3 | 4.7 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.3 | 0.6 | GO:2000515 | negative regulation of CD4-positive, alpha-beta T cell differentiation(GO:0043371) negative regulation of T-helper cell differentiation(GO:0045623) negative regulation of CD4-positive, alpha-beta T cell activation(GO:2000515) |
| 0.3 | 1.6 | GO:0045730 | respiratory burst(GO:0045730) |
| 0.3 | 1.4 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
| 0.3 | 3.5 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.3 | 0.5 | GO:0060594 | mammary gland specification(GO:0060594) |
| 0.3 | 1.6 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.3 | 1.3 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.3 | 1.6 | GO:0035553 | oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.3 | 0.8 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.3 | 0.8 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
| 0.3 | 1.1 | GO:0032098 | regulation of appetite(GO:0032098) |
| 0.3 | 0.8 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.3 | 2.1 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
| 0.3 | 1.3 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
| 0.3 | 2.9 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.3 | 1.3 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.3 | 2.8 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.3 | 1.0 | GO:0046596 | regulation of viral entry into host cell(GO:0046596) |
| 0.3 | 1.0 | GO:0032887 | regulation of spindle elongation(GO:0032887) regulation of mitotic spindle elongation(GO:0032888) anastral spindle assembly(GO:0055048) protein localization to spindle pole body(GO:0071988) regulation of protein localization to spindle pole body(GO:1902363) positive regulation of protein localization to spindle pole body(GO:1902365) positive regulation of mitotic spindle elongation(GO:1902846) |
| 0.3 | 0.5 | GO:0060775 | mediolateral intercalation(GO:0060031) planar cell polarity pathway involved in gastrula mediolateral intercalation(GO:0060775) |
| 0.3 | 1.3 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.3 | 1.3 | GO:0002712 | regulation of B cell mediated immunity(GO:0002712) regulation of immunoglobulin mediated immune response(GO:0002889) |
| 0.3 | 1.5 | GO:0061450 | trophoblast cell migration(GO:0061450) |
| 0.2 | 4.0 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.2 | 2.0 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.2 | 1.0 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.2 | 1.5 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.2 | 1.2 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.2 | 1.0 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.2 | 1.7 | GO:0015705 | iodide transport(GO:0015705) |
| 0.2 | 5.9 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.2 | 3.7 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.2 | 0.7 | GO:0010705 | meiotic DNA double-strand break processing involved in reciprocal meiotic recombination(GO:0010705) |
| 0.2 | 1.0 | GO:0071839 | apoptotic process in bone marrow(GO:0071839) regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.2 | 9.8 | GO:0050798 | activated T cell proliferation(GO:0050798) |
| 0.2 | 1.5 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.2 | 2.2 | GO:0009437 | carnitine metabolic process(GO:0009437) |
| 0.2 | 1.2 | GO:0060023 | soft palate development(GO:0060023) |
| 0.2 | 2.9 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
| 0.2 | 4.5 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.2 | 1.2 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.2 | 1.7 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.2 | 0.7 | GO:0046491 | L-methylmalonyl-CoA metabolic process(GO:0046491) |
| 0.2 | 0.7 | GO:0034769 | basement membrane disassembly(GO:0034769) |
| 0.2 | 2.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.2 | 2.1 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.2 | 5.6 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.2 | 4.6 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.2 | 0.9 | GO:1902477 | defense response, incompatible interaction(GO:0009814) defense response to bacterium, incompatible interaction(GO:0009816) regulation of defense response to bacterium, incompatible interaction(GO:1902477) |
| 0.2 | 1.4 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.2 | 1.6 | GO:0046060 | dATP metabolic process(GO:0046060) |
| 0.2 | 0.9 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.2 | 1.1 | GO:0045872 | positive regulation of rhodopsin gene expression(GO:0045872) |
| 0.2 | 1.6 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.2 | 2.3 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.2 | 1.6 | GO:0060312 | regulation of blood vessel remodeling(GO:0060312) |
| 0.2 | 2.7 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.2 | 0.7 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.2 | 0.2 | GO:2000848 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) positive regulation of cortisol secretion(GO:0051464) positive regulation of corticosteroid hormone secretion(GO:2000848) positive regulation of glucocorticoid secretion(GO:2000851) |
| 0.2 | 3.3 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.2 | 1.5 | GO:0001766 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.2 | 0.4 | GO:0010988 | regulation of low-density lipoprotein particle clearance(GO:0010988) |
| 0.2 | 4.4 | GO:0031579 | membrane raft organization(GO:0031579) |
| 0.2 | 1.5 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.2 | 1.7 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.2 | 4.3 | GO:0015701 | bicarbonate transport(GO:0015701) |
| 0.2 | 0.9 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.2 | 1.1 | GO:0060290 | transdifferentiation(GO:0060290) |
| 0.2 | 2.4 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.2 | 0.9 | GO:0051450 | myoblast proliferation(GO:0051450) |
| 0.2 | 1.3 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.2 | 0.4 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.2 | 1.1 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.2 | 1.1 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.2 | 4.0 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.2 | 1.5 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.2 | 0.6 | GO:0019413 | acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate biosynthetic process(GO:0019542) |
| 0.2 | 4.0 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.2 | 1.3 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.2 | 1.4 | GO:0001865 | NK T cell differentiation(GO:0001865) |
| 0.2 | 1.6 | GO:0048242 | epinephrine secretion(GO:0048242) |
| 0.2 | 4.5 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
| 0.2 | 1.6 | GO:0035878 | nail development(GO:0035878) |
| 0.2 | 2.0 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.2 | 0.4 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.2 | 0.6 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.2 | 1.8 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.2 | 0.6 | GO:0097283 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
| 0.2 | 1.8 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.2 | 4.0 | GO:0045109 | intermediate filament organization(GO:0045109) |
| 0.2 | 13.7 | GO:0045445 | myoblast differentiation(GO:0045445) |
| 0.2 | 0.6 | GO:0072014 | proximal tubule development(GO:0072014) |
| 0.2 | 3.0 | GO:0032096 | negative regulation of response to food(GO:0032096) |
| 0.2 | 2.4 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.2 | 2.0 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) |
| 0.2 | 0.8 | GO:0006222 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.2 | 1.4 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.2 | 0.8 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
| 0.2 | 1.0 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.2 | 0.8 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.2 | 1.9 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
| 0.2 | 1.1 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.2 | 0.4 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.2 | 0.9 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
| 0.2 | 0.4 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.2 | 9.2 | GO:0051310 | metaphase plate congression(GO:0051310) |
| 0.2 | 0.2 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 | 0.6 | GO:0001980 | regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.2 | 1.5 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
| 0.2 | 0.6 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.2 | 0.9 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.2 | 0.4 | GO:0014908 | myotube differentiation involved in skeletal muscle regeneration(GO:0014908) |
| 0.2 | 3.7 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.2 | 1.3 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.2 | 2.8 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.2 | 0.5 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.2 | 1.1 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.2 | 2.4 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.2 | 1.1 | GO:0061034 | olfactory bulb mitral cell layer development(GO:0061034) |
| 0.2 | 1.1 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.2 | 1.3 | GO:0019884 | antigen processing and presentation of exogenous antigen(GO:0019884) |
| 0.2 | 3.2 | GO:0042832 | defense response to protozoan(GO:0042832) |
| 0.2 | 3.4 | GO:1900047 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
| 0.2 | 1.4 | GO:0002820 | negative regulation of adaptive immune response(GO:0002820) |
| 0.2 | 1.8 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.2 | 2.5 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.2 | 5.1 | GO:0010613 | positive regulation of cardiac muscle hypertrophy(GO:0010613) positive regulation of muscle hypertrophy(GO:0014742) |
| 0.2 | 0.4 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
| 0.2 | 0.7 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 0.2 | 14.2 | GO:0007586 | digestion(GO:0007586) |
| 0.2 | 1.4 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.2 | 0.5 | GO:0033577 | protein glycosylation in endoplasmic reticulum(GO:0033577) |
| 0.2 | 0.3 | GO:0061181 | regulation of chondrocyte development(GO:0061181) negative regulation of bone mineralization involved in bone maturation(GO:1900158) |
| 0.2 | 3.4 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.2 | 0.5 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.2 | 1.2 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.2 | 4.7 | GO:1900046 | regulation of blood coagulation(GO:0030193) regulation of hemostasis(GO:1900046) |
| 0.2 | 1.0 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.2 | 0.7 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.2 | 1.3 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.2 | 2.0 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.2 | 1.3 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.2 | 1.5 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.2 | 0.5 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
| 0.2 | 16.9 | GO:0030216 | keratinocyte differentiation(GO:0030216) |
| 0.2 | 1.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 | 0.2 | GO:1902159 | regulation of cyclic nucleotide-gated ion channel activity(GO:1902159) |
| 0.2 | 4.2 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.2 | 2.1 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 0.2 | 1.8 | GO:0090335 | regulation of brown fat cell differentiation(GO:0090335) positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.2 | 0.6 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
| 0.2 | 1.3 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.2 | 1.9 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.2 | 0.8 | GO:0043589 | skin morphogenesis(GO:0043589) |
| 0.2 | 0.5 | GO:0044268 | multicellular organismal protein metabolic process(GO:0044268) |
| 0.2 | 0.6 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.2 | 2.9 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
| 0.2 | 2.0 | GO:0033006 | regulation of mast cell activation involved in immune response(GO:0033006) regulation of mast cell degranulation(GO:0043304) |
| 0.2 | 2.3 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.2 | 0.6 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.2 | 0.8 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.2 | 1.5 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.1 | 13.7 | GO:0050817 | coagulation(GO:0050817) |
| 0.1 | 3.7 | GO:0009299 | mRNA transcription(GO:0009299) |
| 0.1 | 1.2 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.1 | 0.3 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.1 | 0.7 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.1 | 0.7 | GO:0072086 | specification of loop of Henle identity(GO:0072086) |
| 0.1 | 0.1 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.1 | 1.7 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 | 0.7 | GO:0031126 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) snoRNA 3'-end processing(GO:0031126) telomerase RNA stabilization(GO:0090669) |
| 0.1 | 1.6 | GO:1901028 | regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901028) |
| 0.1 | 0.7 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 1.2 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.1 | 0.3 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
| 0.1 | 0.4 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 0.1 | 1.0 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 | 3.6 | GO:0045214 | sarcomere organization(GO:0045214) |
| 0.1 | 0.7 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.1 | 7.1 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.1 | 0.6 | GO:1901250 | regulation of lung goblet cell differentiation(GO:1901249) negative regulation of lung goblet cell differentiation(GO:1901250) |
| 0.1 | 0.6 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.8 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.1 | 1.0 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.1 | 0.7 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.1 | 0.8 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.1 | 1.0 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.1 | 0.3 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.1 | 1.9 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.1 | 2.0 | GO:0001523 | retinoid metabolic process(GO:0001523) |
| 0.1 | 2.3 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 0.1 | 0.8 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.1 | 2.8 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.1 | 1.7 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.1 | 1.1 | GO:0032506 | cytokinetic process(GO:0032506) |
| 0.1 | 0.7 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.1 | 1.2 | GO:1904707 | regulation of vascular smooth muscle cell proliferation(GO:1904705) positive regulation of vascular smooth muscle cell proliferation(GO:1904707) vascular smooth muscle cell proliferation(GO:1990874) |
| 0.1 | 0.3 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.1 | 0.5 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.1 | 0.7 | GO:0035660 | MyD88-dependent toll-like receptor 4 signaling pathway(GO:0035660) |
| 0.1 | 3.8 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.1 | 0.3 | GO:0021762 | substantia nigra development(GO:0021762) corticotropin hormone secreting cell differentiation(GO:0060128) thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
| 0.1 | 1.2 | GO:0009072 | aromatic amino acid family metabolic process(GO:0009072) |
| 0.1 | 2.1 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.1 | 1.3 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.1 | 0.4 | GO:0035965 | cardiolipin acyl-chain remodeling(GO:0035965) |
| 0.1 | 2.0 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.1 | 3.0 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.1 | 3.2 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
| 0.1 | 0.5 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
| 0.1 | 1.2 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.1 | 0.7 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 1.1 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.1 | 2.1 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
| 0.1 | 2.1 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.1 | 0.2 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.1 | 1.0 | GO:0046794 | transport of virus(GO:0046794) |
| 0.1 | 1.3 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
| 0.1 | 0.7 | GO:0097012 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.1 | 0.5 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 0.3 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.1 | 0.1 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.1 | 0.2 | GO:1901536 | negative regulation of DNA demethylation(GO:1901536) |
| 0.1 | 0.1 | GO:0042335 | cuticle development(GO:0042335) |
| 0.1 | 1.1 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
| 0.1 | 1.8 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.1 | 2.5 | GO:0032801 | receptor catabolic process(GO:0032801) |
| 0.1 | 1.3 | GO:0030953 | astral microtubule organization(GO:0030953) |
| 0.1 | 0.2 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.1 | 1.1 | GO:0000305 | response to oxygen radical(GO:0000305) |
| 0.1 | 4.4 | GO:0090501 | RNA phosphodiester bond hydrolysis(GO:0090501) |
| 0.1 | 1.4 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 1.4 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
| 0.1 | 1.2 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.1 | 0.5 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 1.3 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.1 | 2.2 | GO:0030199 | collagen fibril organization(GO:0030199) |
| 0.1 | 0.4 | GO:0071469 | cellular response to alkaline pH(GO:0071469) |
| 0.1 | 3.2 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.1 | 1.4 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.1 | 2.0 | GO:0051307 | meiotic chromosome separation(GO:0051307) |
| 0.1 | 0.5 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
| 0.1 | 0.8 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.1 | 2.1 | GO:0051084 | 'de novo' posttranslational protein folding(GO:0051084) |
| 0.1 | 0.7 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.5 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.1 | 1.8 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.1 | 0.9 | GO:0061709 | reticulophagy(GO:0061709) |
| 0.1 | 1.4 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.1 | 0.5 | GO:0035809 | regulation of urine volume(GO:0035809) |
| 0.1 | 1.4 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.1 | 2.5 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
| 0.1 | 0.9 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
| 0.1 | 0.4 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.1 | 2.4 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.1 | 0.4 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.1 | 0.5 | GO:1903350 | response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
| 0.1 | 0.6 | GO:0001705 | ectoderm formation(GO:0001705) ectodermal cell fate commitment(GO:0001712) |
| 0.1 | 2.4 | GO:0006940 | regulation of smooth muscle contraction(GO:0006940) |
| 0.1 | 2.2 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
| 0.1 | 3.9 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
| 0.1 | 0.8 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
| 0.1 | 0.7 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) |
| 0.1 | 2.2 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
| 0.1 | 0.9 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.1 | 0.5 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.4 | GO:0006983 | ER overload response(GO:0006983) |
| 0.1 | 1.1 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
| 0.1 | 0.9 | GO:0030225 | macrophage differentiation(GO:0030225) |
| 0.1 | 0.5 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.1 | 1.4 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.1 | 2.7 | GO:1902041 | regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902041) |
| 0.1 | 0.2 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
| 0.1 | 0.3 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
| 0.1 | 2.3 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 1.7 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.1 | 0.7 | GO:0019433 | triglyceride catabolic process(GO:0019433) |
| 0.1 | 2.7 | GO:0006919 | activation of cysteine-type endopeptidase activity involved in apoptotic process(GO:0006919) |
| 0.1 | 0.9 | GO:0007379 | segment specification(GO:0007379) |
| 0.1 | 0.6 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.1 | 1.2 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 | 0.2 | GO:0042117 | monocyte activation(GO:0042117) |
| 0.1 | 5.1 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.1 | 2.0 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
| 0.1 | 1.0 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
| 0.1 | 0.9 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.1 | 0.2 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.1 | 1.8 | GO:0043276 | anoikis(GO:0043276) |
| 0.1 | 0.7 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
| 0.1 | 1.3 | GO:0048753 | pigment granule organization(GO:0048753) |
| 0.1 | 2.1 | GO:0010390 | histone monoubiquitination(GO:0010390) |
| 0.1 | 2.1 | GO:0033209 | tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.1 | 1.2 | GO:0051573 | negative regulation of histone H3-K9 methylation(GO:0051573) |
| 0.1 | 2.4 | GO:0032330 | regulation of chondrocyte differentiation(GO:0032330) |
| 0.1 | 2.0 | GO:0001706 | endoderm formation(GO:0001706) |
| 0.1 | 0.1 | GO:0001545 | primary ovarian follicle growth(GO:0001545) |
| 0.1 | 2.3 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.1 | 1.2 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
| 0.1 | 0.5 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 2.3 | GO:0031529 | ruffle organization(GO:0031529) |
| 0.1 | 0.4 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 | 0.5 | GO:0006706 | steroid catabolic process(GO:0006706) |
| 0.1 | 0.4 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.1 | 1.1 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 0.7 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.1 | 0.5 | GO:0010837 | regulation of keratinocyte proliferation(GO:0010837) negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.1 | 0.9 | GO:0034626 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 | 0.9 | GO:0045776 | negative regulation of blood pressure(GO:0045776) |
| 0.1 | 1.1 | GO:0030238 | male sex determination(GO:0030238) |
| 0.1 | 0.4 | GO:0097646 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.1 | 0.3 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.1 | 0.7 | GO:0051596 | methylglyoxal metabolic process(GO:0009438) methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.1 | 0.9 | GO:0030851 | granulocyte differentiation(GO:0030851) |
| 0.1 | 0.3 | GO:0070781 | protein biotinylation(GO:0009305) response to biotin(GO:0070781) histone biotinylation(GO:0071110) |
| 0.1 | 1.6 | GO:0071467 | cellular response to pH(GO:0071467) |
| 0.1 | 0.9 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.1 | 0.2 | GO:0009138 | dUDP biosynthetic process(GO:0006227) dTDP biosynthetic process(GO:0006233) pyrimidine nucleoside diphosphate metabolic process(GO:0009138) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dTDP metabolic process(GO:0046072) dUDP metabolic process(GO:0046077) |
| 0.1 | 0.5 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 | 0.2 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.1 | 1.6 | GO:0045576 | mast cell activation(GO:0045576) |
| 0.1 | 1.5 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 | 0.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
| 0.1 | 0.7 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.1 | 0.4 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.1 | 0.4 | GO:0003222 | ventricular trabecula myocardium morphogenesis(GO:0003222) |
| 0.1 | 0.6 | GO:0033077 | T cell differentiation in thymus(GO:0033077) thymocyte aggregation(GO:0071594) |
| 0.1 | 2.1 | GO:0010761 | fibroblast migration(GO:0010761) |
| 0.1 | 1.0 | GO:0033627 | cell adhesion mediated by integrin(GO:0033627) |
| 0.1 | 0.9 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.5 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.1 | 0.2 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
| 0.1 | 0.7 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.1 | 0.2 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.1 | 0.8 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.1 | 0.6 | GO:0031295 | T cell costimulation(GO:0031295) |
| 0.1 | 0.1 | GO:0022601 | menstrual cycle phase(GO:0022601) |
| 0.1 | 0.5 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.1 | 0.4 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.1 | 0.1 | GO:0030961 | peptidyl-arginine hydroxylation(GO:0030961) |
| 0.1 | 1.4 | GO:0002224 | toll-like receptor signaling pathway(GO:0002224) |
| 0.1 | 0.3 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.6 | GO:0046051 | UTP metabolic process(GO:0046051) |
| 0.1 | 0.4 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.1 | 1.2 | GO:0045668 | negative regulation of osteoblast differentiation(GO:0045668) |
| 0.1 | 0.9 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.1 | 0.4 | GO:0031343 | positive regulation of cell killing(GO:0031343) |
| 0.1 | 0.3 | GO:0098957 | anterograde axonal transport of mitochondrion(GO:0098957) |
| 0.1 | 1.0 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
| 0.1 | 0.1 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.1 | 2.5 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.1 | 0.6 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.1 | 0.1 | GO:0061045 | negative regulation of wound healing(GO:0061045) |
| 0.1 | 0.2 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.2 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.1 | 0.8 | GO:0097286 | iron ion import(GO:0097286) |
| 0.1 | 2.0 | GO:0046580 | negative regulation of Ras protein signal transduction(GO:0046580) negative regulation of small GTPase mediated signal transduction(GO:0051058) |
| 0.0 | 0.3 | GO:0048333 | mesodermal cell differentiation(GO:0048333) |
| 0.0 | 2.1 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.3 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
| 0.0 | 0.5 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.0 | 0.3 | GO:0097066 | response to thyroid hormone(GO:0097066) |
| 0.0 | 3.5 | GO:0009311 | oligosaccharide metabolic process(GO:0009311) |
| 0.0 | 0.5 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
| 0.0 | 0.2 | GO:0032918 | polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.0 | 0.3 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 | 0.2 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.0 | 1.0 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.0 | 1.1 | GO:0009880 | embryonic pattern specification(GO:0009880) |
| 0.0 | 0.2 | GO:0015786 | UDP-glucose transport(GO:0015786) |
| 0.0 | 0.2 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.0 | 0.9 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
| 0.0 | 0.1 | GO:0051775 | response to redox state(GO:0051775) |
| 0.0 | 2.8 | GO:0042742 | defense response to bacterium(GO:0042742) |
| 0.0 | 0.5 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.2 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.0 | 1.0 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.0 | 0.7 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 | 0.9 | GO:0002088 | lens development in camera-type eye(GO:0002088) |
| 0.0 | 2.8 | GO:2000045 | regulation of G1/S transition of mitotic cell cycle(GO:2000045) |
| 0.0 | 0.2 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 | 0.7 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
| 0.0 | 0.3 | GO:1905209 | positive regulation of cardiocyte differentiation(GO:1905209) |
| 0.0 | 2.1 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 | 0.3 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.5 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.0 | 0.5 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.0 | 0.9 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.0 | 0.8 | GO:0001938 | positive regulation of endothelial cell proliferation(GO:0001938) |
| 0.0 | 0.4 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 | 1.4 | GO:1901998 | toxin transport(GO:1901998) |
| 0.0 | 0.3 | GO:1903430 | negative regulation of cell maturation(GO:1903430) |
| 0.0 | 1.8 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.0 | 0.1 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
| 0.0 | 0.4 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 1.3 | GO:0006641 | triglyceride metabolic process(GO:0006641) |
| 0.0 | 0.7 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
| 0.0 | 0.4 | GO:0070734 | histone H3-K27 methylation(GO:0070734) |
| 0.0 | 0.7 | GO:0080184 | response to phenylpropanoid(GO:0080184) |
| 0.0 | 0.3 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 | 4.4 | GO:0007249 | I-kappaB kinase/NF-kappaB signaling(GO:0007249) |
| 0.0 | 0.6 | GO:0097006 | regulation of plasma lipoprotein particle levels(GO:0097006) |
| 0.0 | 0.4 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.0 | 0.2 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 0.1 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.0 | 0.5 | GO:0031060 | regulation of histone methylation(GO:0031060) |
| 0.0 | 0.2 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
| 0.0 | 0.3 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.0 | 0.4 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.0 | 0.6 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.0 | 0.5 | GO:0009651 | response to salt stress(GO:0009651) |
| 0.0 | 0.5 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.0 | 0.2 | GO:0070670 | response to interleukin-4(GO:0070670) cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.2 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.2 | GO:0019321 | pentose metabolic process(GO:0019321) |
| 0.0 | 0.7 | GO:0050728 | negative regulation of inflammatory response(GO:0050728) |
| 0.0 | 0.3 | GO:0097186 | amelogenesis(GO:0097186) |
| 0.0 | 0.0 | GO:0060462 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
| 0.0 | 1.1 | GO:0042303 | molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.0 | 0.6 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.0 | 0.4 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.0 | 0.1 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
| 0.0 | 0.2 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
| 0.0 | 0.2 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
| 0.0 | 0.1 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.0 | 0.6 | GO:0007032 | endosome organization(GO:0007032) |
| 0.0 | 0.0 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.1 | GO:0031054 | pre-miRNA processing(GO:0031054) |
| 0.0 | 0.0 | GO:2000790 | mesenchymal cell proliferation involved in lung development(GO:0060916) regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) |
| 0.0 | 0.0 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.0 | 0.0 | GO:0009650 | UV protection(GO:0009650) |
| 0.0 | 0.0 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
| 0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.3 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 0.0 | 0.6 | GO:0030032 | lamellipodium assembly(GO:0030032) |
| 0.0 | 0.3 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.0 | 0.2 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.0 | 0.0 | GO:0046469 | platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.4 | GO:0050911 | detection of chemical stimulus involved in sensory perception of smell(GO:0050911) |
| 0.0 | 0.1 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.4 | 40.6 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 3.3 | 13.3 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 3.0 | 12.2 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 2.9 | 14.5 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 2.8 | 16.7 | GO:0044279 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
| 2.8 | 41.5 | GO:0042611 | MHC protein complex(GO:0042611) |
| 2.8 | 27.5 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 2.6 | 7.8 | GO:0032997 | Fc receptor complex(GO:0032997) Fc-epsilon receptor I complex(GO:0032998) |
| 2.4 | 16.9 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 2.4 | 4.8 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 1.9 | 23.4 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 1.8 | 5.3 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
| 1.7 | 6.9 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 1.6 | 26.4 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 1.5 | 7.6 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 1.5 | 179.7 | GO:0019814 | immunoglobulin complex(GO:0019814) immunoglobulin complex, circulating(GO:0042571) |
| 1.4 | 2.9 | GO:0015934 | large ribosomal subunit(GO:0015934) |
| 1.4 | 14.5 | GO:0030478 | actin cap(GO:0030478) |
| 1.2 | 9.4 | GO:0097413 | Lewy body(GO:0097413) |
| 1.2 | 5.8 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 1.1 | 8.0 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 1.1 | 5.7 | GO:0035976 | AP1 complex(GO:0035976) |
| 1.1 | 3.4 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 1.1 | 3.3 | GO:0005760 | gamma DNA polymerase complex(GO:0005760) |
| 1.0 | 3.1 | GO:0036398 | TCR signalosome(GO:0036398) |
| 1.0 | 3.0 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 1.0 | 4.8 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.9 | 4.7 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.9 | 9.9 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.9 | 4.4 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.9 | 7.9 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.9 | 7.7 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.8 | 5.7 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.8 | 3.2 | GO:0045257 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.8 | 8.8 | GO:0061702 | inflammasome complex(GO:0061702) |
| 0.8 | 26.3 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.8 | 14.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.8 | 5.5 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.8 | 2.3 | GO:0044299 | C-fiber(GO:0044299) |
| 0.7 | 2.2 | GO:0005584 | collagen type I trimer(GO:0005584) |
| 0.7 | 5.1 | GO:0072487 | MSL complex(GO:0072487) |
| 0.7 | 2.1 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.7 | 3.4 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.7 | 6.8 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.7 | 11.4 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.6 | 5.1 | GO:0042825 | TAP complex(GO:0042825) |
| 0.6 | 4.4 | GO:0005638 | lamin filament(GO:0005638) |
| 0.6 | 6.3 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.6 | 1.9 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
| 0.6 | 1.9 | GO:1990630 | IRE1-RACK1-PP2A complex(GO:1990630) |
| 0.6 | 2.5 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.6 | 10.5 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.6 | 5.4 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.6 | 3.0 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.6 | 1.8 | GO:0032783 | ELL-EAF complex(GO:0032783) |
| 0.6 | 7.2 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
| 0.6 | 2.3 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.6 | 10.4 | GO:0090543 | Flemming body(GO:0090543) |
| 0.6 | 7.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.6 | 2.9 | GO:0043293 | apoptosome(GO:0043293) |
| 0.6 | 8.4 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
| 0.5 | 8.1 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
| 0.5 | 4.6 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.5 | 1.5 | GO:0097132 | cyclin D2-CDK6 complex(GO:0097132) |
| 0.5 | 2.0 | GO:0036284 | tubulobulbar complex(GO:0036284) |
| 0.5 | 13.4 | GO:0005922 | connexon complex(GO:0005922) |
| 0.5 | 2.4 | GO:0005914 | spot adherens junction(GO:0005914) |
| 0.5 | 7.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.5 | 1.9 | GO:0070722 | Tle3-Aes complex(GO:0070722) |
| 0.5 | 15.1 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.5 | 3.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.5 | 0.9 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.4 | 2.2 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.4 | 36.9 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.4 | 2.6 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.4 | 6.5 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.4 | 3.4 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.4 | 6.8 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.4 | 7.3 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.4 | 2.9 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.4 | 3.7 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.4 | 3.3 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.4 | 0.8 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.4 | 1.6 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.4 | 3.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.4 | 6.1 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.4 | 3.2 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.4 | 2.8 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.4 | 2.8 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.4 | 3.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.4 | 1.1 | GO:0005775 | vacuolar lumen(GO:0005775) |
| 0.4 | 1.5 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.4 | 1.5 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.4 | 10.4 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.4 | 1.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.4 | 2.1 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.3 | 47.3 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.3 | 12.8 | GO:0008305 | integrin complex(GO:0008305) |
| 0.3 | 3.4 | GO:1990462 | omegasome(GO:1990462) |
| 0.3 | 0.7 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
| 0.3 | 4.4 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.3 | 3.7 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.3 | 11.1 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.3 | 13.4 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.3 | 5.6 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.3 | 5.0 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.3 | 0.6 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.3 | 2.8 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.3 | 1.5 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.3 | 6.0 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.3 | 0.9 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.3 | 12.9 | GO:0045095 | keratin filament(GO:0045095) |
| 0.3 | 1.7 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.3 | 1.4 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.3 | 1.4 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.3 | 1.3 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.3 | 1.6 | GO:0031523 | Myb complex(GO:0031523) |
| 0.3 | 11.4 | GO:0002102 | podosome(GO:0002102) |
| 0.3 | 1.6 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.3 | 2.3 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.3 | 0.5 | GO:0044393 | microspike(GO:0044393) |
| 0.2 | 4.5 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.2 | 13.6 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.2 | 6.3 | GO:0070938 | contractile ring(GO:0070938) |
| 0.2 | 1.9 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.2 | 4.8 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.2 | 1.2 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.2 | 5.7 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.2 | 3.5 | GO:0031011 | Ino80 complex(GO:0031011) |
| 0.2 | 1.1 | GO:0035838 | growing cell tip(GO:0035838) new growing cell tip(GO:0035841) |
| 0.2 | 3.2 | GO:0044754 | autolysosome(GO:0044754) |
| 0.2 | 4.5 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.2 | 2.3 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.2 | 5.0 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.2 | 5.4 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.2 | 0.7 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
| 0.2 | 1.3 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.2 | 12.3 | GO:0015030 | Cajal body(GO:0015030) |
| 0.2 | 1.7 | GO:0046930 | pore complex(GO:0046930) |
| 0.2 | 75.9 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.2 | 9.8 | GO:0031985 | Golgi cisterna(GO:0031985) |
| 0.2 | 1.0 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 0.2 | 11.0 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.2 | 4.9 | GO:0030057 | desmosome(GO:0030057) |
| 0.2 | 2.0 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.2 | 361.2 | GO:0005615 | extracellular space(GO:0005615) |
| 0.2 | 1.6 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.2 | 0.8 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.2 | 10.6 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.2 | 1.1 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.2 | 1.5 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.2 | 7.5 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.2 | 0.7 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.2 | 1.3 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.2 | 19.1 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.2 | 1.9 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.2 | 6.5 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.2 | 0.5 | GO:0034657 | GID complex(GO:0034657) |
| 0.2 | 1.1 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.2 | 54.3 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.2 | 2.3 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.2 | 1.9 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.2 | 0.8 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
| 0.2 | 1.6 | GO:0045180 | basal cortex(GO:0045180) |
| 0.2 | 2.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.2 | 0.6 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.1 | 4.9 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.1 | 2.4 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.1 | 4.5 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.1 | 0.7 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.1 | 0.4 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.1 | 0.6 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.1 | 0.6 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 1.4 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 2.5 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.1 | 2.7 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.1 | 0.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 0.7 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.1 | 0.4 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.1 | 0.4 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.1 | 6.9 | GO:0044438 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
| 0.1 | 1.9 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 0.5 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.1 | 1.0 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.1 | 0.5 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.1 | 1.0 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 1.0 | GO:0016011 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
| 0.1 | 0.7 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 39.1 | GO:0005925 | focal adhesion(GO:0005925) |
| 0.1 | 12.6 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.1 | 1.0 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 1.4 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.1 | 1.3 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.1 | 0.4 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.1 | 2.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.1 | 1.9 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 1.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.1 | 12.5 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.1 | 1.0 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.1 | 0.5 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 1.1 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 4.8 | GO:0005657 | replication fork(GO:0005657) |
| 0.1 | 1.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 1.1 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 0.9 | GO:0005787 | signal peptidase complex(GO:0005787) |
| 0.1 | 5.4 | GO:0016459 | myosin complex(GO:0016459) |
| 0.1 | 0.6 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) catenin-TCF7L2 complex(GO:0071664) |
| 0.1 | 6.6 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.1 | 0.8 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 0.4 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.1 | 5.7 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.1 | 0.2 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.1 | 0.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.1 | 0.2 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 41.3 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.1 | 0.7 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 2.2 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.1 | 1.3 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.1 | 0.2 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 0.6 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 0.7 | GO:0000796 | condensin complex(GO:0000796) |
| 0.1 | 1.2 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 2.4 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.1 | 3.0 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 6.7 | GO:0016605 | PML body(GO:0016605) |
| 0.1 | 1.8 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 2.2 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 0.8 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 0.4 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 1.8 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.1 | 0.5 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.1 | 0.7 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.1 | 0.7 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.1 | 3.9 | GO:0005811 | lipid particle(GO:0005811) |
| 0.1 | 1.5 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 1.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.3 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 0.3 | GO:0032432 | actin filament bundle(GO:0032432) |
| 0.0 | 0.4 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.0 | 4.2 | GO:0005903 | brush border(GO:0005903) |
| 0.0 | 1.8 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.3 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.4 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 5.6 | GO:0031674 | I band(GO:0031674) |
| 0.0 | 0.5 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.3 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.0 | 0.4 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.0 | 1.0 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.0 | 6.1 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.5 | GO:0000801 | central element(GO:0000801) |
| 0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.0 | 0.1 | GO:0042827 | platelet dense granule(GO:0042827) |
| 0.0 | 0.7 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 6.2 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.1 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.0 | 3.6 | GO:0005923 | bicellular tight junction(GO:0005923) occluding junction(GO:0070160) |
| 0.0 | 0.3 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 0.3 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 0.1 | GO:1990584 | cardiac myofibril(GO:0097512) cardiac Troponin complex(GO:1990584) |
| 0.0 | 0.8 | GO:0005604 | basement membrane(GO:0005604) |
| 0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.1 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.0 | 0.1 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.5 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.1 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.0 | 1.2 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.0 | 0.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.0 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.6 | 10.9 | GO:0033971 | hydroxyisourate hydrolase activity(GO:0033971) |
| 3.2 | 9.5 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 3.2 | 9.5 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 2.9 | 11.8 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
| 2.9 | 8.7 | GO:0042602 | riboflavin reductase (NADPH) activity(GO:0042602) |
| 2.7 | 8.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 2.6 | 7.8 | GO:0052597 | diamine oxidase activity(GO:0052597) histamine oxidase activity(GO:0052598) methylputrescine oxidase activity(GO:0052599) propane-1,3-diamine oxidase activity(GO:0052600) |
| 2.4 | 42.4 | GO:0046977 | TAP binding(GO:0046977) |
| 2.3 | 7.0 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 2.3 | 9.3 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 2.2 | 6.6 | GO:0047936 | glucose 1-dehydrogenase [NAD(P)] activity(GO:0047936) |
| 2.2 | 8.6 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
| 1.8 | 5.4 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 1.8 | 5.4 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 1.8 | 5.3 | GO:0098640 | integrin binding involved in cell-matrix adhesion(GO:0098640) |
| 1.7 | 10.4 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 1.7 | 10.2 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 1.7 | 8.4 | GO:0047635 | L-alanine:2-oxoglutarate aminotransferase activity(GO:0004021) alanine-oxo-acid transaminase activity(GO:0047635) |
| 1.7 | 5.0 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
| 1.7 | 10.0 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 1.6 | 11.1 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 1.6 | 6.3 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
| 1.6 | 4.7 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
| 1.6 | 7.8 | GO:0019767 | IgE receptor activity(GO:0019767) |
| 1.5 | 4.6 | GO:0019120 | hydrolase activity, acting on acid halide bonds(GO:0016824) hydrolase activity, acting on acid halide bonds, in C-halide compounds(GO:0019120) alkylhalidase activity(GO:0047651) |
| 1.5 | 19.9 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 1.5 | 18.3 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 1.5 | 13.5 | GO:0004875 | complement receptor activity(GO:0004875) |
| 1.5 | 198.5 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 1.5 | 8.9 | GO:0032810 | sterol response element binding(GO:0032810) |
| 1.5 | 4.4 | GO:0045030 | UTP-activated nucleotide receptor activity(GO:0045030) |
| 1.4 | 7.2 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
| 1.4 | 10.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 1.4 | 6.8 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 1.4 | 4.1 | GO:0003692 | left-handed Z-DNA binding(GO:0003692) |
| 1.4 | 6.8 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
| 1.3 | 8.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 1.3 | 3.9 | GO:0033680 | ATP-dependent DNA/RNA helicase activity(GO:0033680) |
| 1.3 | 3.9 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 1.3 | 7.6 | GO:0030294 | receptor signaling protein tyrosine kinase inhibitor activity(GO:0030294) |
| 1.3 | 5.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 1.2 | 7.3 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 1.2 | 4.8 | GO:0004478 | methionine adenosyltransferase activity(GO:0004478) |
| 1.2 | 3.6 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 1.2 | 5.9 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 1.2 | 4.7 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 1.2 | 5.8 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 1.1 | 5.7 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 1.1 | 26.1 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 1.1 | 4.5 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 1.1 | 7.9 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 1.1 | 3.4 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 1.1 | 5.6 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 1.1 | 3.3 | GO:0016890 | site-specific endodeoxyribonuclease activity, specific for altered base(GO:0016890) |
| 1.1 | 5.4 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 1.1 | 7.6 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 1.1 | 4.3 | GO:0086038 | calcium:sodium antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086038) |
| 1.1 | 3.2 | GO:0035717 | chemokine (C-C motif) ligand 7 binding(GO:0035717) |
| 1.1 | 3.2 | GO:0004658 | propionyl-CoA carboxylase activity(GO:0004658) |
| 1.0 | 7.3 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 1.0 | 25.1 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 1.0 | 4.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 1.0 | 6.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 1.0 | 3.1 | GO:0004911 | interleukin-2 receptor activity(GO:0004911) |
| 1.0 | 4.1 | GO:0030249 | guanylate cyclase regulator activity(GO:0030249) |
| 1.0 | 1.0 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 1.0 | 3.0 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 1.0 | 4.9 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 1.0 | 3.9 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 1.0 | 2.9 | GO:0004418 | hydroxymethylbilane synthase activity(GO:0004418) |
| 0.9 | 2.8 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.9 | 1.9 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.9 | 6.6 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
| 0.9 | 2.8 | GO:0016034 | maleylacetoacetate isomerase activity(GO:0016034) |
| 0.9 | 3.7 | GO:0047016 | cholest-5-ene-3-beta,7-alpha-diol 3-beta-dehydrogenase activity(GO:0047016) |
| 0.9 | 2.8 | GO:0019862 | IgA binding(GO:0019862) |
| 0.9 | 16.7 | GO:0008430 | selenium binding(GO:0008430) |
| 0.9 | 3.7 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.9 | 2.8 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.9 | 9.9 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.9 | 3.6 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
| 0.9 | 3.6 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.9 | 2.6 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
| 0.9 | 2.6 | GO:0003990 | acetylcholinesterase activity(GO:0003990) |
| 0.9 | 2.6 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.9 | 3.4 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.9 | 3.4 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.8 | 5.0 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
| 0.8 | 19.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.8 | 5.0 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.8 | 2.5 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.8 | 8.1 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.8 | 4.0 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.8 | 3.2 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.8 | 4.8 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
| 0.8 | 2.4 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.8 | 6.4 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.8 | 4.8 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.8 | 2.3 | GO:0004421 | hydroxymethylglutaryl-CoA synthase activity(GO:0004421) |
| 0.8 | 3.8 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.8 | 2.3 | GO:0004088 | carbamoyl-phosphate synthase (ammonia) activity(GO:0004087) carbamoyl-phosphate synthase (glutamine-hydrolyzing) activity(GO:0004088) |
| 0.7 | 15.0 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.7 | 2.2 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
| 0.7 | 18.6 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.7 | 4.3 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.7 | 43.7 | GO:0003823 | antigen binding(GO:0003823) |
| 0.7 | 3.5 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.7 | 2.8 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.7 | 5.6 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
| 0.7 | 3.5 | GO:0015091 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
| 0.7 | 6.1 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.7 | 6.1 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.7 | 0.7 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.7 | 3.3 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.7 | 8.5 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.6 | 1.9 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 0.6 | 7.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.6 | 2.5 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.6 | 3.1 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
| 0.6 | 1.9 | GO:0016749 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.6 | 5.6 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.6 | 6.9 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.6 | 1.9 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.6 | 3.7 | GO:0034618 | arginine binding(GO:0034618) |
| 0.6 | 14.1 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
| 0.6 | 4.3 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.6 | 2.4 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.6 | 12.8 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.6 | 1.8 | GO:0001761 | beta-alanine transmembrane transporter activity(GO:0001761) taurine transmembrane transporter activity(GO:0005368) taurine:sodium symporter activity(GO:0005369) |
| 0.6 | 11.0 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.6 | 3.6 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.6 | 4.2 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.6 | 6.6 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
| 0.6 | 5.4 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.6 | 1.8 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.6 | 3.6 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.6 | 5.3 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.6 | 1.8 | GO:0047057 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
| 0.6 | 3.5 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.6 | 2.3 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.6 | 13.4 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.6 | 5.2 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.6 | 0.6 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.6 | 35.8 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.6 | 6.9 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.6 | 10.3 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.6 | 15.5 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
| 0.6 | 12.6 | GO:0001848 | complement binding(GO:0001848) |
| 0.6 | 1.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.6 | 2.9 | GO:0005124 | scavenger receptor binding(GO:0005124) |
| 0.6 | 18.2 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.6 | 3.4 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.6 | 6.8 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.6 | 2.8 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
| 0.6 | 4.5 | GO:0005534 | galactose binding(GO:0005534) |
| 0.6 | 12.8 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.6 | 2.8 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.6 | 1.7 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 0.6 | 4.4 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.6 | 1.7 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
| 0.5 | 3.3 | GO:0032357 | oxidized purine DNA binding(GO:0032357) |
| 0.5 | 3.2 | GO:0090554 | phosphatidylcholine-translocating ATPase activity(GO:0090554) |
| 0.5 | 29.7 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.5 | 1.1 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.5 | 3.2 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.5 | 2.6 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.5 | 1.6 | GO:0034012 | glycerone kinase activity(GO:0004371) FAD-AMP lyase (cyclizing) activity(GO:0034012) triokinase activity(GO:0050354) |
| 0.5 | 1.6 | GO:0070287 | ferritin receptor activity(GO:0070287) |
| 0.5 | 1.0 | GO:0030977 | taurine binding(GO:0030977) |
| 0.5 | 2.1 | GO:0042008 | interleukin-18 receptor activity(GO:0042008) |
| 0.5 | 2.1 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.5 | 2.1 | GO:0070905 | serine binding(GO:0070905) |
| 0.5 | 3.6 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.5 | 1.5 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) |
| 0.5 | 1.5 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.5 | 1.5 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
| 0.5 | 4.5 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.5 | 3.5 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.5 | 1.5 | GO:0008456 | alpha-galactosidase activity(GO:0004557) alpha-N-acetylgalactosaminidase activity(GO:0008456) |
| 0.5 | 6.0 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.5 | 9.4 | GO:0019825 | oxygen binding(GO:0019825) |
| 0.5 | 5.4 | GO:0070513 | death domain binding(GO:0070513) |
| 0.5 | 1.0 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.5 | 5.8 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.5 | 14.4 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.5 | 5.7 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.5 | 5.7 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.5 | 1.9 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.5 | 8.0 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.5 | 1.4 | GO:0008124 | 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
| 0.5 | 1.4 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
| 0.5 | 1.4 | GO:0019962 | interferon receptor activity(GO:0004904) type I interferon receptor activity(GO:0004905) type I interferon binding(GO:0019962) |
| 0.5 | 2.3 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 0.4 | 4.9 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.4 | 1.8 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.4 | 2.6 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.4 | 0.4 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.4 | 6.9 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.4 | 1.7 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.4 | 2.1 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.4 | 12.0 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.4 | 4.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.4 | 1.7 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.4 | 9.9 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.4 | 3.3 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.4 | 4.1 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.4 | 2.5 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.4 | 3.3 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.4 | 6.9 | GO:0043495 | protein anchor(GO:0043495) |
| 0.4 | 13.0 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.4 | 1.6 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.4 | 3.5 | GO:0008481 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.4 | 3.9 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.4 | 2.8 | GO:0050610 | oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.4 | 3.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.4 | 1.6 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.4 | 2.3 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
| 0.4 | 1.5 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.4 | 1.5 | GO:0047522 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.4 | 17.1 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.4 | 12.5 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.4 | 2.6 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.4 | 3.4 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.4 | 15.3 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.4 | 1.5 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.4 | 4.4 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.4 | 1.1 | GO:0001607 | neuromedin U receptor activity(GO:0001607) |
| 0.4 | 1.1 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
| 0.4 | 1.1 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.4 | 2.2 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.4 | 2.9 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.4 | 1.4 | GO:0050145 | uridylate kinase activity(GO:0009041) nucleoside phosphate kinase activity(GO:0050145) |
| 0.4 | 1.4 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.4 | 1.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.4 | 1.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.4 | 9.2 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.4 | 1.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.3 | 4.9 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.3 | 1.0 | GO:0015928 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
| 0.3 | 1.4 | GO:0043682 | copper-exporting ATPase activity(GO:0004008) copper-transporting ATPase activity(GO:0043682) |
| 0.3 | 1.0 | GO:0070279 | vitamin B6 binding(GO:0070279) |
| 0.3 | 14.6 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.3 | 1.4 | GO:0004779 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
| 0.3 | 1.7 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.3 | 1.0 | GO:0061769 | ribosylnicotinamide kinase activity(GO:0050262) ribosylnicotinate kinase activity(GO:0061769) |
| 0.3 | 1.0 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.3 | 2.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.3 | 1.4 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.3 | 2.4 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.3 | 3.0 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.3 | 6.0 | GO:0001614 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
| 0.3 | 1.3 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.3 | 4.6 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.3 | 1.0 | GO:0002058 | uracil binding(GO:0002058) pyrimidine nucleobase binding(GO:0002061) |
| 0.3 | 2.3 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.3 | 2.0 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.3 | 1.6 | GO:0008761 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) |
| 0.3 | 1.6 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.3 | 3.6 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.3 | 2.6 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.3 | 2.9 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.3 | 1.3 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.3 | 2.9 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.3 | 4.4 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.3 | 14.4 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.3 | 0.9 | GO:0030116 | glial cell-derived neurotrophic factor receptor binding(GO:0030116) |
| 0.3 | 2.2 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.3 | 2.2 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.3 | 0.9 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.3 | 3.1 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.3 | 0.9 | GO:0004912 | interleukin-3 receptor activity(GO:0004912) interleukin-3 binding(GO:0019978) |
| 0.3 | 1.2 | GO:0005118 | sevenless binding(GO:0005118) |
| 0.3 | 11.9 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.3 | 0.9 | GO:0005136 | interleukin-4 receptor binding(GO:0005136) |
| 0.3 | 1.5 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.3 | 1.2 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.3 | 1.2 | GO:1904408 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 0.3 | 5.4 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.3 | 16.3 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.3 | 0.9 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.3 | 1.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.3 | 1.2 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
| 0.3 | 3.8 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.3 | 5.5 | GO:0004601 | peroxidase activity(GO:0004601) |
| 0.3 | 7.7 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.3 | 4.8 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.3 | 1.1 | GO:0072354 | histone kinase activity (H3-T3 specific)(GO:0072354) |
| 0.3 | 2.0 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.3 | 5.4 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.3 | 2.5 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.3 | 3.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.3 | 1.7 | GO:0004144 | 2-acylglycerol O-acyltransferase activity(GO:0003846) diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.3 | 1.4 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.3 | 0.8 | GO:0070773 | protein-N-terminal glutamine amidohydrolase activity(GO:0070773) |
| 0.3 | 1.7 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.3 | 2.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.3 | 1.9 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.3 | 1.6 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.3 | 1.6 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.3 | 3.7 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.3 | 7.5 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.3 | 1.9 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.3 | 1.6 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.3 | 2.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.3 | 3.9 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.3 | 1.3 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.3 | 0.8 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.3 | 1.8 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.3 | 2.8 | GO:0008061 | chitin binding(GO:0008061) |
| 0.3 | 1.5 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.3 | 1.5 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.2 | 1.2 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.2 | 2.4 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.2 | 1.0 | GO:0004058 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
| 0.2 | 1.7 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 0.2 | 1.2 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
| 0.2 | 1.2 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.2 | 1.2 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
| 0.2 | 2.4 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.2 | 0.9 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.2 | 7.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.2 | 0.7 | GO:0004493 | methylmalonyl-CoA epimerase activity(GO:0004493) |
| 0.2 | 0.9 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.2 | 6.3 | GO:0043236 | laminin binding(GO:0043236) |
| 0.2 | 0.5 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.2 | 0.9 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.2 | 1.1 | GO:0004051 | arachidonate 5-lipoxygenase activity(GO:0004051) |
| 0.2 | 0.2 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.2 | 1.4 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
| 0.2 | 1.6 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) hemi-methylated DNA-binding(GO:0044729) |
| 0.2 | 0.9 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.2 | 3.3 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.2 | 3.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.2 | 8.2 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.2 | 2.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.2 | 5.5 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.2 | 8.5 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.2 | 1.1 | GO:0034602 | oxoglutarate dehydrogenase (NAD+) activity(GO:0034602) |
| 0.2 | 0.7 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.2 | 2.8 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.2 | 1.3 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.2 | 0.6 | GO:0031753 | endothelial differentiation G-protein coupled receptor binding(GO:0031753) Edg-2 lysophosphatidic acid receptor binding(GO:0031755) |
| 0.2 | 2.3 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.2 | 14.1 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
| 0.2 | 1.6 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 0.2 | 3.0 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.2 | 1.8 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.2 | 1.4 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.2 | 0.6 | GO:0003826 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.2 | 1.0 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.2 | 4.9 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.2 | 1.4 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.2 | 1.4 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 0.2 | 0.8 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.2 | 1.0 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.2 | 2.3 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.2 | 1.0 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.2 | 2.7 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.2 | 3.8 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.2 | 2.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.2 | 2.1 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.2 | 28.4 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.2 | 1.3 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.2 | 1.3 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.2 | 1.8 | GO:0038187 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
| 0.2 | 2.4 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.2 | 34.1 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.2 | 14.0 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.2 | 1.3 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.2 | 0.7 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.2 | 4.7 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.2 | 2.1 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.2 | 4.2 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.2 | 35.0 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.2 | 3.3 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.2 | 0.5 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.2 | 1.0 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.2 | 0.7 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.2 | 4.9 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.2 | 5.5 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.2 | 3.5 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.2 | 1.0 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.2 | 2.5 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.2 | 2.3 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.2 | 1.0 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.2 | 2.1 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.2 | 0.6 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.2 | 6.0 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.2 | 1.3 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.2 | 0.6 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.2 | 1.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.2 | 1.1 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.1 | 1.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 0.7 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.1 | 0.7 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.1 | 0.7 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.1 | 0.3 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.1 | 0.4 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.1 | 6.3 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.8 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 1.8 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.1 | 0.4 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
| 0.1 | 1.8 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.1 | 0.5 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 0.5 | GO:0030629 | U6 snRNA 3'-end binding(GO:0030629) |
| 0.1 | 0.9 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 0.1 | 0.8 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.1 | 0.4 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
| 0.1 | 1.3 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 0.6 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.1 | 15.4 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 0.1 | 1.7 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.1 | 2.2 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.1 | 1.0 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.1 | 0.4 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
| 0.1 | 1.6 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.1 | 14.5 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.1 | 1.3 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
| 0.1 | 0.7 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 0.5 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.1 | 0.4 | GO:0003868 | 4-hydroxyphenylpyruvate dioxygenase activity(GO:0003868) |
| 0.1 | 1.9 | GO:0010181 | FMN binding(GO:0010181) |
| 0.1 | 0.9 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.1 | 0.3 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.1 | 0.5 | GO:0032093 | SAM domain binding(GO:0032093) |
| 0.1 | 3.7 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.1 | 2.5 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 0.8 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.1 | 1.0 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.1 | 0.7 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 1.6 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
| 0.1 | 7.8 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.1 | 3.5 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.1 | 0.8 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 0.5 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.1 | 0.2 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.1 | 0.3 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.1 | 0.5 | GO:0031432 | titin binding(GO:0031432) |
| 0.1 | 0.4 | GO:0034597 | phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity(GO:0016316) phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.1 | 0.5 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.1 | 1.0 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.1 | 1.7 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 0.2 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
| 0.1 | 0.9 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.1 | 0.3 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 2.8 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.1 | 0.8 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.1 | 0.3 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.1 | 6.1 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.1 | 1.1 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 1.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 0.5 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.1 | 3.4 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.1 | 0.6 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 0.3 | GO:0005302 | L-tyrosine transmembrane transporter activity(GO:0005302) |
| 0.1 | 8.5 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.1 | 0.4 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 1.7 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 2.7 | GO:0008378 | galactosyltransferase activity(GO:0008378) |
| 0.1 | 0.4 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.1 | 1.0 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 7.7 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.1 | 0.5 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 1.3 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.1 | 0.5 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.8 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.1 | 0.4 | GO:0004925 | prolactin receptor activity(GO:0004925) |
| 0.1 | 1.0 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.1 | 0.9 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.1 | 2.0 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.1 | 0.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.6 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.1 | 0.8 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.1 | 0.7 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.1 | 5.6 | GO:0016279 | lysine N-methyltransferase activity(GO:0016278) protein-lysine N-methyltransferase activity(GO:0016279) |
| 0.1 | 0.2 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.9 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.1 | 0.9 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 8.1 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.1 | 1.3 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.1 | 0.8 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 6.2 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.1 | 0.5 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 2.3 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.1 | 0.5 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 0.5 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.1 | 1.1 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 1.3 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.1 | 0.5 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 1.4 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.4 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 0.5 | GO:0030549 | acetylcholine receptor activator activity(GO:0030549) |
| 0.1 | 0.9 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 0.9 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.1 | 0.2 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.1 | 0.4 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.1 | 0.4 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.1 | 0.3 | GO:0052796 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.1 | 0.3 | GO:0018271 | biotin-[acetyl-CoA-carboxylase] ligase activity(GO:0004077) biotin-[methylcrotonoyl-CoA-carboxylase] ligase activity(GO:0004078) biotin-[methylmalonyl-CoA-carboxytransferase] ligase activity(GO:0004079) biotin-[propionyl-CoA-carboxylase (ATP-hydrolyzing)] ligase activity(GO:0004080) biotin-protein ligase activity(GO:0018271) |
| 0.1 | 0.4 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 0.3 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 1.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.3 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 0.1 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 0.3 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.1 | 0.5 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 0.9 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.1 | 2.7 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
| 0.1 | 1.6 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 0.4 | GO:0050294 | alcohol sulfotransferase activity(GO:0004027) steroid sulfotransferase activity(GO:0050294) |
| 0.1 | 2.3 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.1 | 0.7 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.1 | 2.2 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.1 | 0.6 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
| 0.1 | 0.3 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.1 | 1.5 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) |
| 0.1 | 3.0 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 0.1 | 0.4 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.1 | 0.2 | GO:0019809 | spermidine binding(GO:0019809) |
| 0.1 | 0.3 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.1 | 0.3 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.1 | 24.7 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
| 0.1 | 3.8 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.0 | 0.1 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.0 | 0.3 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.0 | 0.4 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 3.1 | GO:0004540 | ribonuclease activity(GO:0004540) |
| 0.0 | 0.6 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.0 | 0.6 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 3.6 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.0 | 5.5 | GO:0052689 | carboxylic ester hydrolase activity(GO:0052689) |
| 0.0 | 2.1 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 1.9 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.4 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.7 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.3 | GO:0005272 | sodium channel activity(GO:0005272) |
| 0.0 | 0.5 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 0.1 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
| 0.0 | 4.9 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.0 | 0.2 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.0 | 0.3 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.0 | 0.3 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.9 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.0 | 0.6 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.2 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 3.5 | GO:0019903 | protein phosphatase binding(GO:0019903) |
| 0.0 | 0.2 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.0 | 0.2 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.0 | 4.0 | GO:0008234 | cysteine-type peptidase activity(GO:0008234) |
| 0.0 | 0.1 | GO:0004452 | isopentenyl-diphosphate delta-isomerase activity(GO:0004452) |
| 0.0 | 0.3 | GO:0008237 | metallopeptidase activity(GO:0008237) |
| 0.0 | 0.5 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.7 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.0 | 0.4 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.4 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.5 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.0 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.0 | 0.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.0 | 0.3 | GO:0005402 | cation:sugar symporter activity(GO:0005402) |
| 0.0 | 4.8 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
| 0.0 | 0.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.1 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
| 0.0 | 0.0 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 11.7 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 1.4 | 21.6 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.9 | 3.7 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.8 | 4.9 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.7 | 12.3 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.7 | 6.4 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.7 | 2.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.6 | 24.4 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
| 0.6 | 21.1 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.6 | 13.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.5 | 57.7 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.5 | 3.0 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.5 | 3.0 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.5 | 40.8 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.5 | 15.5 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.5 | 9.3 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.5 | 4.6 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.4 | 4.4 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.4 | 14.3 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.4 | 29.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.4 | 5.4 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.4 | 11.9 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.4 | 13.4 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.3 | 1.4 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.3 | 58.9 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.3 | 7.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.3 | 4.4 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.3 | 8.4 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.3 | 14.6 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.3 | 1.5 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.3 | 17.2 | PID BMP PATHWAY | BMP receptor signaling |
| 0.3 | 9.8 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.3 | 7.4 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.3 | 4.7 | PID MYC PATHWAY | C-MYC pathway |
| 0.3 | 2.0 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.2 | 1.9 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.2 | 4.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.2 | 3.8 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.2 | 4.6 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.2 | 56.6 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.2 | 2.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.2 | 15.4 | PID E2F PATHWAY | E2F transcription factor network |
| 0.2 | 1.3 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.2 | 8.3 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.2 | 16.6 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.2 | 5.7 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.2 | 10.1 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.2 | 15.9 | PID CMYB PATHWAY | C-MYB transcription factor network |
| 0.2 | 1.4 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.2 | 2.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.2 | 4.2 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.2 | 2.8 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.2 | 2.3 | PID EPO PATHWAY | EPO signaling pathway |
| 0.2 | 1.9 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.2 | 6.1 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.2 | 0.9 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.2 | 3.9 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.2 | 2.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.2 | 35.7 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.2 | 33.7 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.2 | 7.1 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.2 | 6.1 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.2 | 2.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.2 | 9.0 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.1 | 1.9 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 8.7 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.1 | 8.7 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.1 | 3.0 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.1 | 1.8 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 7.4 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.1 | 1.2 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.1 | 6.0 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.1 | 1.6 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.1 | 0.5 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.1 | 1.1 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.1 | 5.3 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 7.0 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.1 | 3.5 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 1.8 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 4.6 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.1 | 1.7 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 2.3 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.1 | 0.2 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.1 | 1.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 1.4 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 5.9 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 0.9 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 0.6 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.1 | 3.2 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 2.5 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.1 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.1 | 1.8 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.1 | 0.8 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.1 | 4.0 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 1.0 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 1.7 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 1.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.4 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 1.8 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.3 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.0 | 0.8 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.3 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.7 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 0.7 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.5 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.6 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.2 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 32.3 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 1.4 | 4.1 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 1.4 | 21.7 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 1.2 | 17.0 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 1.1 | 1.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 1.1 | 2.1 | REACTOME CDK MEDIATED PHOSPHORYLATION AND REMOVAL OF CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
| 1.0 | 14.2 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 1.0 | 1.0 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
| 0.9 | 13.1 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.9 | 14.8 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.9 | 26.5 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.9 | 20.6 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.9 | 11.9 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.9 | 16.2 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.8 | 5.7 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.8 | 8.9 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.8 | 20.2 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.7 | 8.8 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.7 | 2.8 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.7 | 8.8 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.7 | 2.0 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
| 0.6 | 7.0 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.6 | 6.8 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.6 | 33.3 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.6 | 9.9 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.6 | 7.6 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.6 | 13.4 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.6 | 1.2 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.6 | 6.2 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.5 | 1.6 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.5 | 5.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.5 | 26.8 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.5 | 7.7 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.5 | 8.7 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.5 | 10.8 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.5 | 28.8 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.5 | 0.5 | REACTOME HIV INFECTION | Genes involved in HIV Infection |
| 0.5 | 1.9 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.5 | 24.2 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.5 | 5.3 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.5 | 4.7 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.4 | 0.9 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.4 | 20.3 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.4 | 3.4 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.4 | 30.4 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
| 0.4 | 7.6 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.4 | 50.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.4 | 5.8 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.4 | 9.8 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.4 | 24.0 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.4 | 9.1 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
| 0.4 | 20.2 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.4 | 9.6 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.3 | 2.4 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.3 | 17.6 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.3 | 5.6 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.3 | 4.3 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.3 | 8.9 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.3 | 4.1 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.3 | 1.9 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.3 | 4.0 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.3 | 9.0 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.3 | 5.5 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.3 | 13.9 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.3 | 2.6 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.3 | 7.7 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.3 | 9.0 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.3 | 4.0 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.3 | 4.9 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.3 | 11.8 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.3 | 4.6 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.3 | 6.8 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.2 | 11.8 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.2 | 1.7 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.2 | 6.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.2 | 1.7 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 0.2 | 16.8 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.2 | 2.6 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.2 | 3.0 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.2 | 4.6 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.2 | 14.8 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.2 | 6.6 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.2 | 3.4 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.2 | 4.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.2 | 14.5 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.2 | 5.1 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.2 | 4.9 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.2 | 7.9 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.2 | 1.7 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.2 | 4.0 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.2 | 1.3 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
| 0.2 | 5.5 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.2 | 5.1 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.2 | 5.6 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.2 | 11.4 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.2 | 0.7 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.2 | 2.5 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.2 | 19.9 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.2 | 4.6 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.2 | 5.0 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.2 | 3.2 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.2 | 10.6 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.2 | 8.6 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.2 | 3.9 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.1 | 2.2 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 3.5 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.1 | 1.0 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.1 | 1.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.1 | 1.9 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 0.3 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.1 | 2.3 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.1 | 12.8 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 1.6 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
| 0.1 | 1.8 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.1 | 1.3 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 2.4 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 2.6 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.1 | 1.4 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.1 | 1.9 | REACTOME ORC1 REMOVAL FROM CHROMATIN | Genes involved in Orc1 removal from chromatin |
| 0.1 | 2.9 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 1.9 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 0.9 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 1.3 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.1 | 0.5 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.1 | 0.8 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.1 | 0.6 | REACTOME LAGGING STRAND SYNTHESIS | Genes involved in Lagging Strand Synthesis |
| 0.1 | 3.8 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.1 | 2.2 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.1 | 1.2 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.1 | 1.2 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.1 | 1.8 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.1 | 1.2 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.1 | 3.2 | REACTOME MEIOSIS | Genes involved in Meiosis |
| 0.1 | 1.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 1.0 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.1 | 2.2 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
| 0.1 | 1.3 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.1 | 1.9 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.1 | 0.3 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.8 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.4 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.0 | 0.5 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.8 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.6 | REACTOME NUCLEOTIDE EXCISION REPAIR | Genes involved in Nucleotide Excision Repair |
| 0.0 | 0.6 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.0 | 1.0 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.7 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 1.0 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 3.5 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 1.0 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.0 | 1.9 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 0.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.8 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 0.5 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.3 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 1.0 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.0 | 1.5 | REACTOME TOLL RECEPTOR CASCADES | Genes involved in Toll Receptor Cascades |
| 0.0 | 1.2 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 0.2 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.3 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.3 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
| 0.0 | 0.4 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.1 | REACTOME HEMOSTASIS | Genes involved in Hemostasis |
| 0.0 | 0.2 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.3 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.2 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 0.8 | REACTOME TRANSPORT OF GLUCOSE AND OTHER SUGARS BILE SALTS AND ORGANIC ACIDS METAL IONS AND AMINE COMPOUNDS | Genes involved in Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds |
| 0.0 | 0.4 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |