Project
PRJNA375882: Comprehensive Mouse Transcriptomic BodyMap
Navigation
Downloads
Results for UAAGGCA
Z-value: 0.91
Motif logo
miRNA associated with seed UAAGGCA
| Name | miRBASE accession |
|---|---|
|
mmu-miR-124-3p.2
|
|
|
mmu-miR-5624-3p
|
MIMAT0022378 |
|
mmu-miR-6540-5p
|
MIMAT0025585 |
Activity profile of UAAGGCA motif
Sorted Z-values of UAAGGCA motif
Network of associatons between targets according to the STRING database.
First level regulatory network of UAAGGCA
Gene Ontology Analysis
Gene overrepresentation in biological process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.3 | 6.4 | GO:0098971 | anterograde dendritic transport of neurotransmitter receptor complex(GO:0098971) |
| 1.3 | 3.8 | GO:0003220 | left ventricular cardiac muscle tissue morphogenesis(GO:0003220) |
| 1.2 | 3.7 | GO:1904049 | negative regulation of spontaneous neurotransmitter secretion(GO:1904049) |
| 1.1 | 3.3 | GO:0015825 | L-serine transport(GO:0015825) |
| 1.0 | 7.9 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
| 0.8 | 2.4 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.8 | 2.4 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) kidney smooth muscle tissue development(GO:0072194) negative regulation of dopaminergic neuron differentiation(GO:1904339) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.8 | 3.1 | GO:0003050 | regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.7 | 2.9 | GO:0042339 | keratan sulfate metabolic process(GO:0042339) |
| 0.7 | 4.3 | GO:0099525 | presynaptic dense core granule exocytosis(GO:0099525) |
| 0.7 | 4.2 | GO:0036394 | amylase secretion(GO:0036394) |
| 0.7 | 2.1 | GO:0021627 | olfactory nerve morphogenesis(GO:0021627) olfactory nerve structural organization(GO:0021629) |
| 0.7 | 4.1 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.6 | 1.9 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.6 | 4.5 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
| 0.6 | 1.9 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
| 0.6 | 3.7 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.6 | 2.5 | GO:0070650 | actin filament bundle distribution(GO:0070650) |
| 0.6 | 4.2 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.6 | 3.5 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.6 | 4.0 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.6 | 1.7 | GO:0042275 | error-free postreplication DNA repair(GO:0042275) |
| 0.6 | 3.4 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.6 | 2.8 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
| 0.5 | 3.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.5 | 5.5 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.5 | 2.8 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.5 | 1.4 | GO:0098928 | presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
| 0.4 | 1.8 | GO:0007208 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) |
| 0.4 | 1.3 | GO:0046619 | optic placode formation involved in camera-type eye formation(GO:0046619) |
| 0.4 | 1.7 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.4 | 2.5 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.4 | 1.6 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.4 | 1.2 | GO:0090076 | relaxation of skeletal muscle(GO:0090076) |
| 0.4 | 1.1 | GO:1902361 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
| 0.4 | 1.1 | GO:1900275 | negative regulation of phospholipase C activity(GO:1900275) |
| 0.4 | 3.7 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.4 | 2.9 | GO:0051775 | response to redox state(GO:0051775) |
| 0.4 | 1.5 | GO:0051586 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.4 | 2.9 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.4 | 2.8 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) negative regulation of serotonin uptake(GO:0051612) |
| 0.3 | 3.0 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.3 | 1.7 | GO:0071321 | negative regulation of protein import into nucleus, translocation(GO:0033159) cellular response to cGMP(GO:0071321) |
| 0.3 | 2.9 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.3 | 2.9 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.3 | 1.0 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.3 | 1.9 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.3 | 1.6 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.3 | 1.3 | GO:2000795 | negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.3 | 1.4 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.3 | 2.5 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.3 | 2.2 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.3 | 1.6 | GO:1902285 | semaphorin-plexin signaling pathway involved in neuron projection guidance(GO:1902285) |
| 0.3 | 1.6 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
| 0.3 | 4.2 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.3 | 1.3 | GO:0001550 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.3 | 1.0 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.3 | 1.8 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.3 | 1.8 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.3 | 1.3 | GO:1905161 | protein localization to phagocytic vesicle(GO:1905161) regulation of protein localization to phagocytic vesicle(GO:1905169) positive regulation of protein localization to phagocytic vesicle(GO:1905171) |
| 0.2 | 4.5 | GO:0061162 | establishment of monopolar cell polarity(GO:0061162) |
| 0.2 | 0.7 | GO:0010814 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.2 | 1.4 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) regulation of establishment of T cell polarity(GO:1903903) |
| 0.2 | 2.4 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.2 | 0.7 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.2 | 2.6 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.2 | 0.7 | GO:0052422 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.2 | 3.2 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.2 | 0.7 | GO:0033306 | phytol metabolic process(GO:0033306) fatty alcohol metabolic process(GO:1903173) |
| 0.2 | 1.3 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.2 | 0.9 | GO:0031959 | mineralocorticoid receptor signaling pathway(GO:0031959) |
| 0.2 | 0.9 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.2 | 1.1 | GO:0072363 | regulation of glycolytic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072363) |
| 0.2 | 1.3 | GO:0032902 | nerve growth factor production(GO:0032902) |
| 0.2 | 4.1 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.2 | 5.0 | GO:0046033 | AMP metabolic process(GO:0046033) |
| 0.2 | 1.7 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.2 | 0.8 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.2 | 1.4 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.2 | 0.6 | GO:0033577 | protein glycosylation in endoplasmic reticulum(GO:0033577) |
| 0.2 | 1.6 | GO:2000812 | regulation of barbed-end actin filament capping(GO:2000812) |
| 0.2 | 0.8 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.2 | 1.5 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.2 | 0.6 | GO:1900477 | negative regulation of G1/S transition of mitotic cell cycle by negative regulation of transcription from RNA polymerase II promoter(GO:1900477) |
| 0.2 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
| 0.2 | 0.5 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.2 | 0.7 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.2 | 3.4 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
| 0.2 | 0.5 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.2 | 1.2 | GO:0032349 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
| 0.2 | 8.2 | GO:0001919 | regulation of receptor recycling(GO:0001919) |
| 0.2 | 0.5 | GO:0090298 | negative regulation of mitochondrial DNA replication(GO:0090298) |
| 0.2 | 4.1 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.2 | 2.9 | GO:0031000 | response to caffeine(GO:0031000) |
| 0.2 | 8.2 | GO:0035774 | positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.1 | 0.4 | GO:0051542 | elastin biosynthetic process(GO:0051542) regulation of cytochrome-c oxidase activity(GO:1904959) |
| 0.1 | 0.7 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.1 | 0.8 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.1 | 1.0 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.1 | 0.4 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
| 0.1 | 0.5 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.1 | 3.2 | GO:0030953 | astral microtubule organization(GO:0030953) |
| 0.1 | 1.5 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.1 | 3.1 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.1 | 0.9 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 0.9 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
| 0.1 | 0.6 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.1 | 4.1 | GO:0001963 | synaptic transmission, dopaminergic(GO:0001963) |
| 0.1 | 1.0 | GO:0060313 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
| 0.1 | 0.8 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.1 | 1.4 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.1 | 1.5 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
| 0.1 | 0.4 | GO:0036269 | swimming behavior(GO:0036269) |
| 0.1 | 0.3 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.1 | 1.5 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.1 | 4.2 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.1 | 4.3 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.1 | 0.8 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.1 | 0.7 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.1 | 0.7 | GO:0060005 | vestibular reflex(GO:0060005) |
| 0.1 | 4.7 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
| 0.1 | 0.7 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.1 | 0.4 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
| 0.1 | 0.5 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.1 | 0.7 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 1.0 | GO:0086042 | cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) |
| 0.1 | 1.8 | GO:0030033 | microvillus assembly(GO:0030033) |
| 0.1 | 1.2 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.1 | 8.3 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
| 0.1 | 0.3 | GO:0040010 | positive regulation of growth rate(GO:0040010) |
| 0.1 | 4.8 | GO:0046470 | phosphatidylcholine metabolic process(GO:0046470) |
| 0.1 | 3.6 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 | 1.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.1 | 0.2 | GO:0097156 | fasciculation of motor neuron axon(GO:0097156) |
| 0.1 | 2.4 | GO:0051642 | centrosome localization(GO:0051642) |
| 0.1 | 0.5 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.1 | 0.7 | GO:0097240 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.1 | 0.9 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
| 0.1 | 0.6 | GO:0042987 | amyloid precursor protein catabolic process(GO:0042987) |
| 0.1 | 2.2 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
| 0.1 | 0.7 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.1 | 0.3 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 | 2.1 | GO:0014823 | response to activity(GO:0014823) |
| 0.1 | 0.9 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 | 2.6 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 1.0 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 0.5 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.1 | 2.1 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.1 | 0.9 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.1 | 1.9 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.1 | 1.3 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.1 | 0.4 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 | 4.6 | GO:0010765 | positive regulation of sodium ion transport(GO:0010765) |
| 0.1 | 1.5 | GO:0007097 | nuclear migration(GO:0007097) establishment of nucleus localization(GO:0040023) |
| 0.1 | 1.1 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.1 | 0.2 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.1 | 0.4 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.1 | 0.5 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.1 | 0.4 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.1 | 0.2 | GO:0050942 | positive regulation of pigment cell differentiation(GO:0050942) |
| 0.1 | 1.7 | GO:0010107 | potassium ion import(GO:0010107) |
| 0.1 | 1.4 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
| 0.1 | 0.6 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.1 | 0.4 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.1 | 3.1 | GO:0050771 | negative regulation of axonogenesis(GO:0050771) |
| 0.1 | 0.8 | GO:0032570 | response to progesterone(GO:0032570) |
| 0.1 | 1.6 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.1 | 1.6 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.1 | 0.7 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.1 | 1.0 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 | 3.2 | GO:0010812 | negative regulation of cell-substrate adhesion(GO:0010812) |
| 0.1 | 0.5 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.1 | 0.3 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.1 | 0.3 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.1 | 0.7 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.9 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
| 0.0 | 0.5 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 | 1.3 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
| 0.0 | 0.6 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.6 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 0.5 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.0 | 0.5 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.7 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.0 | 0.4 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.0 | 1.2 | GO:0055078 | sodium ion homeostasis(GO:0055078) |
| 0.0 | 0.6 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.0 | 1.5 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 | 0.8 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.0 | 0.7 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.2 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.0 | 1.0 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 | 0.5 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 2.3 | GO:0015914 | phospholipid transport(GO:0015914) |
| 0.0 | 0.4 | GO:2001273 | regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.0 | 1.8 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
| 0.0 | 2.5 | GO:0030516 | regulation of axon extension(GO:0030516) |
| 0.0 | 1.3 | GO:0010996 | response to auditory stimulus(GO:0010996) |
| 0.0 | 0.1 | GO:0014870 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to stimulus involved in regulation of muscle adaptation(GO:0014874) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.0 | 0.8 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
| 0.0 | 0.3 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 3.2 | GO:0048477 | oogenesis(GO:0048477) |
| 0.0 | 5.5 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
| 0.0 | 0.2 | GO:0046337 | phosphatidylethanolamine biosynthetic process(GO:0006646) phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.0 | 0.8 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.0 | 0.3 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.0 | 1.0 | GO:0033622 | integrin activation(GO:0033622) |
| 0.0 | 0.7 | GO:0060384 | innervation(GO:0060384) |
| 0.0 | 0.6 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.0 | 2.2 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
| 0.0 | 5.3 | GO:0007050 | cell cycle arrest(GO:0007050) |
| 0.0 | 1.6 | GO:0008088 | axo-dendritic transport(GO:0008088) |
| 0.0 | 3.3 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
| 0.0 | 4.0 | GO:0050807 | regulation of synapse organization(GO:0050807) |
| 0.0 | 0.1 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.0 | 0.4 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.0 | 1.0 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
| 0.0 | 1.4 | GO:0006695 | cholesterol biosynthetic process(GO:0006695) |
| 0.0 | 1.0 | GO:0015804 | neutral amino acid transport(GO:0015804) |
| 0.0 | 0.1 | GO:1901580 | post-embryonic appendage morphogenesis(GO:0035120) post-embryonic limb morphogenesis(GO:0035127) post-embryonic forelimb morphogenesis(GO:0035128) telomeric repeat-containing RNA transcription(GO:0097393) telomeric repeat-containing RNA transcription from RNA pol II promoter(GO:0097394) regulation of telomeric RNA transcription from RNA pol II promoter(GO:1901580) negative regulation of telomeric RNA transcription from RNA pol II promoter(GO:1901581) positive regulation of telomeric RNA transcription from RNA pol II promoter(GO:1901582) |
| 0.0 | 1.3 | GO:0050770 | regulation of axonogenesis(GO:0050770) |
| 0.0 | 1.7 | GO:0035914 | skeletal muscle cell differentiation(GO:0035914) |
| 0.0 | 0.6 | GO:0048713 | regulation of oligodendrocyte differentiation(GO:0048713) |
| 0.0 | 0.8 | GO:0010771 | negative regulation of cell morphogenesis involved in differentiation(GO:0010771) |
| 0.0 | 1.3 | GO:0007270 | neuron-neuron synaptic transmission(GO:0007270) |
| 0.0 | 0.7 | GO:1903146 | regulation of mitophagy(GO:1903146) |
| 0.0 | 1.8 | GO:0008277 | regulation of G-protein coupled receptor protein signaling pathway(GO:0008277) |
| 0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.2 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.0 | 4.6 | GO:0006869 | lipid transport(GO:0006869) |
| 0.0 | 0.5 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 | 0.5 | GO:0045022 | early endosome to late endosome transport(GO:0045022) |
| 0.0 | 1.4 | GO:0007229 | integrin-mediated signaling pathway(GO:0007229) |
| 0.0 | 0.5 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.0 | 0.4 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
| 0.0 | 0.4 | GO:0001541 | ovarian follicle development(GO:0001541) |
| 0.0 | 0.1 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
| 0.0 | 0.2 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) response to increased oxygen levels(GO:0036296) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.7 | GO:0060395 | SMAD protein signal transduction(GO:0060395) |
| 0.0 | 0.1 | GO:0070831 | basement membrane assembly(GO:0070831) |
| 0.0 | 1.1 | GO:0007631 | feeding behavior(GO:0007631) |
| 0.0 | 0.2 | GO:0021591 | ventricular system development(GO:0021591) |
Gene overrepresentation in cellular component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 2.3 | GO:0044308 | axonal spine(GO:0044308) |
| 1.0 | 4.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 1.0 | 2.9 | GO:0016014 | dystrobrevin complex(GO:0016014) |
| 0.7 | 2.8 | GO:0042642 | actomyosin, myosin complex part(GO:0042642) |
| 0.6 | 13.8 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.6 | 3.0 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.6 | 1.7 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.6 | 1.7 | GO:0034677 | integrin alpha7-beta1 complex(GO:0034677) |
| 0.6 | 1.7 | GO:0044302 | dentate gyrus mossy fiber(GO:0044302) |
| 0.5 | 7.9 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.5 | 1.4 | GO:1990257 | piccolo-bassoon transport vesicle(GO:1990257) |
| 0.4 | 3.7 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.4 | 4.5 | GO:0045179 | apical cortex(GO:0045179) |
| 0.3 | 8.7 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.3 | 7.8 | GO:0043196 | varicosity(GO:0043196) |
| 0.3 | 5.8 | GO:0031045 | dense core granule(GO:0031045) |
| 0.3 | 9.8 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.3 | 1.4 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.3 | 2.2 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.3 | 7.8 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.2 | 3.4 | GO:0005883 | neurofilament(GO:0005883) |
| 0.2 | 0.5 | GO:0036501 | UFD1-NPL4 complex(GO:0036501) |
| 0.2 | 1.2 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.2 | 2.1 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.1 | 0.6 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
| 0.1 | 1.1 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.1 | 3.0 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
| 0.1 | 3.1 | GO:0071437 | invadopodium(GO:0071437) |
| 0.1 | 0.4 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.1 | 2.2 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.1 | 1.1 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.1 | 1.8 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 2.1 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.1 | 1.3 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.1 | 3.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 1.5 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 3.0 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.1 | 0.8 | GO:0098837 | postsynaptic recycling endosome(GO:0098837) |
| 0.1 | 6.5 | GO:0005776 | autophagosome(GO:0005776) |
| 0.1 | 1.6 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.1 | 0.8 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 13.1 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.1 | 2.1 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.1 | 2.7 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
| 0.1 | 1.5 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.1 | 0.3 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.1 | 6.9 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.1 | 0.2 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 0.7 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 2.4 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.1 | 2.4 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.1 | 1.4 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.1 | 0.5 | GO:0070695 | FHF complex(GO:0070695) |
| 0.1 | 3.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.1 | 0.8 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.1 | 0.8 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.1 | 0.5 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.1 | 0.5 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 2.3 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.1 | 1.2 | GO:0097386 | glial cell projection(GO:0097386) |
| 0.0 | 0.2 | GO:0071920 | cleavage body(GO:0071920) |
| 0.0 | 13.7 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.0 | 2.4 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 6.3 | GO:0043204 | perikaryon(GO:0043204) |
| 0.0 | 0.8 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.5 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 9.0 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 0.3 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.4 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.4 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.7 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.3 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 1.7 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.0 | 0.8 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.8 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 1.5 | GO:0030315 | T-tubule(GO:0030315) |
| 0.0 | 1.1 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
| 0.0 | 0.4 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.3 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 1.3 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 0.1 | GO:1990421 | subtelomeric heterochromatin(GO:1990421) nuclear subtelomeric heterochromatin(GO:1990707) |
| 0.0 | 0.7 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 3.3 | GO:0005875 | microtubule associated complex(GO:0005875) |
| 0.0 | 1.0 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.7 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.4 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 1.6 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.1 | GO:0005606 | laminin-1 complex(GO:0005606) laminin-10 complex(GO:0043259) |
| 0.0 | 0.4 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.3 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.3 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
Gene overrepresentation in molecular function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.7 | 5.0 | GO:0019807 | aspartoacylase activity(GO:0019807) |
| 1.6 | 4.9 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 1.4 | 11.3 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 1.3 | 4.0 | GO:0086057 | voltage-gated calcium channel activity involved in bundle of His cell action potential(GO:0086057) |
| 1.3 | 5.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.9 | 5.6 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.8 | 4.0 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.7 | 2.9 | GO:0047275 | glucosaminylgalactosylglucosylceramide beta-galactosyltransferase activity(GO:0047275) |
| 0.7 | 4.1 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.6 | 1.8 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
| 0.6 | 4.0 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.6 | 1.7 | GO:0036004 | GAF domain binding(GO:0036004) |
| 0.5 | 1.6 | GO:0004962 | endothelin receptor activity(GO:0004962) |
| 0.5 | 3.0 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.5 | 4.5 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.5 | 2.8 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.4 | 2.9 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.4 | 2.9 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.4 | 3.7 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.4 | 1.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.4 | 1.5 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
| 0.4 | 1.4 | GO:0051381 | histamine binding(GO:0051381) |
| 0.4 | 1.1 | GO:0004342 | glucosamine-6-phosphate deaminase activity(GO:0004342) |
| 0.3 | 4.5 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.3 | 3.7 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.3 | 3.3 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) L-proline transmembrane transporter activity(GO:0015193) alanine transmembrane transporter activity(GO:0022858) |
| 0.3 | 7.7 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.3 | 2.4 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.3 | 0.9 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
| 0.3 | 1.9 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.3 | 3.2 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
| 0.2 | 1.5 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.2 | 1.5 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.2 | 6.1 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.2 | 2.4 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.2 | 3.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.2 | 1.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.2 | 6.4 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.2 | 0.8 | GO:0047710 | bis(5'-adenosyl)-triphosphatase activity(GO:0047710) |
| 0.2 | 0.4 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.2 | 2.2 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.2 | 0.6 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.2 | 2.2 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.2 | 1.0 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.2 | 2.1 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
| 0.2 | 2.4 | GO:0071253 | connexin binding(GO:0071253) |
| 0.2 | 3.4 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.2 | 1.4 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
| 0.2 | 2.7 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.2 | 5.9 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.2 | 0.7 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.2 | 1.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.2 | 1.6 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.2 | 4.1 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.2 | 5.7 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.2 | 2.7 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.2 | 0.9 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.7 | GO:0004925 | prolactin receptor activity(GO:0004925) |
| 0.1 | 1.9 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 2.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.1 | 2.8 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.1 | 0.7 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.1 | 0.7 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.1 | 3.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 0.7 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.1 | 1.8 | GO:0051378 | serotonin binding(GO:0051378) |
| 0.1 | 2.4 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.1 | 0.6 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
| 0.1 | 0.5 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.1 | 2.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.1 | 1.2 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.1 | 0.5 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.1 | 3.2 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
| 0.1 | 1.2 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.1 | 2.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.1 | 0.4 | GO:0004008 | copper-exporting ATPase activity(GO:0004008) copper-transporting ATPase activity(GO:0043682) |
| 0.1 | 2.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 1.3 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.1 | 3.4 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.1 | 8.2 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.1 | 0.8 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.1 | 1.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 2.0 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 0.3 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.1 | 0.6 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.1 | 2.0 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.1 | 0.4 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 3.2 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 0.8 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 1.9 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.1 | 0.5 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 1.3 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.1 | 1.7 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
| 0.1 | 1.7 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.1 | 1.5 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 2.5 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
| 0.1 | 1.4 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.1 | 0.2 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.1 | 6.2 | GO:0017022 | myosin binding(GO:0017022) |
| 0.1 | 0.4 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
| 0.1 | 0.8 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 0.4 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 0.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 2.1 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) |
| 0.1 | 0.3 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 0.1 | 1.5 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 0.2 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.1 | 0.6 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
| 0.1 | 1.9 | GO:0043236 | laminin binding(GO:0043236) |
| 0.0 | 2.0 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 2.2 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 0.6 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 1.4 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.0 | 0.4 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.0 | 0.5 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.0 | 3.0 | GO:0005249 | voltage-gated potassium channel activity(GO:0005249) |
| 0.0 | 0.5 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 1.2 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) |
| 0.0 | 2.3 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 1.3 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.4 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 3.6 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.3 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
| 0.0 | 0.8 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.8 | GO:0035250 | UDP-galactosyltransferase activity(GO:0035250) |
| 0.0 | 0.4 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 1.8 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.0 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 0.7 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.0 | 0.1 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
| 0.0 | 1.4 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.0 | 0.7 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.0 | 0.3 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.0 | 0.7 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.4 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 1.8 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.0 | 0.8 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 1.8 | GO:0005496 | steroid binding(GO:0005496) |
| 0.0 | 0.7 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.6 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 0.1 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.0 | 0.8 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 1.1 | GO:0008146 | sulfotransferase activity(GO:0008146) |
| 0.0 | 0.4 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.0 | 0.6 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.3 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.2 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 2.1 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.0 | 0.3 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.0 | 0.8 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.0 | 0.8 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.6 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.0 | 0.3 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 1.6 | GO:0032947 | protein complex scaffold(GO:0032947) |
| 0.0 | 1.8 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.7 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.1 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.3 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 1.3 | GO:0030165 | PDZ domain binding(GO:0030165) |
| 0.0 | 1.4 | GO:0008081 | phosphoric diester hydrolase activity(GO:0008081) |
| 0.0 | 4.1 | GO:0005096 | GTPase activator activity(GO:0005096) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.8 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.2 | 2.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.2 | 10.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 4.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.1 | 5.3 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.1 | 4.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.1 | 1.4 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.1 | 2.2 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.1 | 1.6 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 0.4 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 0.9 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.1 | 1.5 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 2.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 3.8 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.0 | 3.4 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.3 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.8 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 2.4 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.3 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.6 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 3.3 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 1.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.0 | 1.7 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.0 | 6.8 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.4 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 4.1 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.7 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 0.8 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 6.8 | NABA MATRISOME ASSOCIATED | Ensemble of genes encoding ECM-associated proteins including ECM-affilaited proteins, ECM regulators and secreted factors |
| 0.0 | 1.5 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.0 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.6 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.0 | 0.4 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 0.4 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 11.3 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.3 | 8.7 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.3 | 3.4 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.2 | 3.3 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.2 | 4.2 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.2 | 4.0 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.2 | 1.9 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.2 | 6.5 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.2 | 4.2 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.1 | 3.6 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 1.8 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.1 | 2.8 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.1 | 2.2 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.1 | 2.0 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.1 | 6.6 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.1 | 3.7 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.1 | 2.9 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.1 | 3.6 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 5.8 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 2.1 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.1 | 1.3 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.1 | 1.8 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 1.4 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 0.3 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
| 0.1 | 4.2 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.1 | 3.2 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.1 | 2.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 1.4 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 2.2 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 0.9 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 1.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 1.3 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.0 | 1.2 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.8 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.0 | 0.5 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 1.7 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 2.8 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 2.1 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 1.0 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
| 0.0 | 0.7 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 2.9 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.0 | 0.9 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 1.5 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.7 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.2 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.8 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 0.5 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.4 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 1.2 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.7 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.0 | 0.4 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.0 | 0.9 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 1.2 | REACTOME ION CHANNEL TRANSPORT | Genes involved in Ion channel transport |
| 0.0 | 0.1 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.0 | 0.6 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 1.1 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 1.0 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 0.4 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 1.7 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 1.9 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 1.6 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.0 | 0.6 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 1.7 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.4 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.0 | 0.3 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 1.0 | REACTOME TRANSPORT OF GLUCOSE AND OTHER SUGARS BILE SALTS AND ORGANIC ACIDS METAL IONS AND AMINE COMPOUNDS | Genes involved in Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds |
| 0.0 | 0.4 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 1.0 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 2.2 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |