PRJNA375882: Comprehensive Mouse Transcriptomic BodyMap
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Zfp384
|
ENSMUSG00000038346.19 | Zfp384 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Zfp384 | mm39_v1_chr6_+_124986078_124986142 | 0.18 | 1.3e-01 | Click! |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.4 | 13.6 | GO:0097017 | renal protein absorption(GO:0097017) |
| 2.8 | 11.1 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
| 2.3 | 7.0 | GO:0051977 | lysophospholipid transport(GO:0051977) |
| 1.9 | 7.6 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 1.7 | 1.7 | GO:0097325 | melanocyte proliferation(GO:0097325) |
| 1.3 | 7.6 | GO:1903609 | negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
| 1.2 | 4.9 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
| 1.0 | 3.0 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
| 1.0 | 3.8 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
| 1.0 | 1.9 | GO:2000521 | negative regulation of immunological synapse formation(GO:2000521) regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001188) negative regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001189) |
| 0.8 | 2.5 | GO:1904328 | regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
| 0.8 | 0.8 | GO:0060285 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
| 0.8 | 3.0 | GO:0035854 | eosinophil fate commitment(GO:0035854) |
| 0.8 | 2.3 | GO:0048817 | negative regulation of hair follicle maturation(GO:0048817) |
| 0.7 | 2.2 | GO:1904346 | regulation of gastric mucosal blood circulation(GO:1904344) positive regulation of gastric mucosal blood circulation(GO:1904346) gastric mucosal blood circulation(GO:1990768) |
| 0.7 | 3.6 | GO:0070543 | response to linoleic acid(GO:0070543) |
| 0.7 | 3.5 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.7 | 2.0 | GO:1990051 | activation of protein kinase C activity(GO:1990051) |
| 0.7 | 2.0 | GO:0034117 | erythrocyte aggregation(GO:0034117) regulation of erythrocyte aggregation(GO:0034118) |
| 0.7 | 2.6 | GO:2000230 | negative regulation of pancreatic stellate cell proliferation(GO:2000230) |
| 0.6 | 1.9 | GO:0072277 | metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
| 0.6 | 1.9 | GO:0002838 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
| 0.6 | 3.7 | GO:0035026 | leading edge cell differentiation(GO:0035026) |
| 0.6 | 1.9 | GO:0006740 | NADPH regeneration(GO:0006740) |
| 0.6 | 1.9 | GO:0002543 | activation of blood coagulation via clotting cascade(GO:0002543) phosphatidylserine exposure on blood platelet(GO:0097045) |
| 0.6 | 1.2 | GO:1903487 | regulation of lactation(GO:1903487) |
| 0.6 | 4.9 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
| 0.6 | 3.1 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.6 | 3.0 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.6 | 1.8 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 0.6 | 2.3 | GO:0071611 | macrophage colony-stimulating factor production(GO:0036301) granulocyte colony-stimulating factor production(GO:0071611) regulation of granulocyte colony-stimulating factor production(GO:0071655) regulation of macrophage colony-stimulating factor production(GO:1901256) |
| 0.6 | 2.9 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.6 | 2.2 | GO:0072566 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
| 0.5 | 2.1 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.5 | 4.2 | GO:0070163 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) |
| 0.5 | 1.6 | GO:0060435 | bronchiole development(GO:0060435) intestinal epithelial cell maturation(GO:0060574) |
| 0.5 | 2.0 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
| 0.5 | 2.4 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.5 | 2.9 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.5 | 2.8 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.5 | 2.4 | GO:0035470 | positive regulation of vascular wound healing(GO:0035470) |
| 0.5 | 2.8 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
| 0.5 | 3.7 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.5 | 1.4 | GO:0006788 | heme oxidation(GO:0006788) |
| 0.5 | 1.8 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.4 | 3.1 | GO:0060309 | elastin catabolic process(GO:0060309) |
| 0.4 | 1.3 | GO:0090673 | endothelial cell-matrix adhesion(GO:0090673) |
| 0.4 | 1.3 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.4 | 1.7 | GO:0003050 | regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
| 0.4 | 2.1 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.4 | 1.7 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.4 | 2.1 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.4 | 14.3 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.4 | 2.4 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
| 0.4 | 1.2 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.4 | 2.4 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.4 | 2.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 0.4 | 1.2 | GO:0070194 | synaptonemal complex disassembly(GO:0070194) |
| 0.4 | 2.7 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.4 | 1.1 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.4 | 0.4 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
| 0.4 | 1.1 | GO:0031554 | regulation of DNA-templated transcription, termination(GO:0031554) |
| 0.4 | 1.4 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) |
| 0.3 | 3.1 | GO:0003147 | neural crest cell migration involved in heart formation(GO:0003147) cell migration involved in heart formation(GO:0060974) anterior neural tube closure(GO:0061713) cellular response to folic acid(GO:0071231) |
| 0.3 | 1.0 | GO:2001034 | positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
| 0.3 | 1.7 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.3 | 1.7 | GO:0060921 | sinoatrial node cell differentiation(GO:0060921) sinoatrial node cell development(GO:0060931) |
| 0.3 | 1.7 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.3 | 1.3 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.3 | 1.3 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.3 | 1.0 | GO:1903632 | positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) |
| 0.3 | 2.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.3 | 0.6 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
| 0.3 | 1.2 | GO:0071873 | response to norepinephrine(GO:0071873) |
| 0.3 | 1.2 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
| 0.3 | 0.9 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.3 | 1.7 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.3 | 1.1 | GO:0030450 | regulation of complement activation, classical pathway(GO:0030450) |
| 0.3 | 0.9 | GO:0035638 | patched ligand maturation(GO:0007225) signal maturation(GO:0035638) |
| 0.3 | 0.8 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.3 | 1.1 | GO:0014064 | positive regulation of serotonin secretion(GO:0014064) negative regulation of cerebellar granule cell precursor proliferation(GO:0021941) |
| 0.3 | 2.5 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.3 | 2.8 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.3 | 0.8 | GO:0015688 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.3 | 0.8 | GO:0061090 | positive regulation of sequestering of zinc ion(GO:0061090) |
| 0.3 | 3.3 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.3 | 1.1 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
| 0.3 | 1.1 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.3 | 0.8 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) DNA replication preinitiation complex assembly(GO:0071163) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.3 | 0.3 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
| 0.3 | 0.8 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.3 | 1.3 | GO:0097195 | pilomotor reflex(GO:0097195) positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.3 | 0.8 | GO:0015898 | amiloride transport(GO:0015898) cellular response to copper ion starvation(GO:0035874) response to azide(GO:0097184) cellular response to azide(GO:0097185) |
| 0.3 | 1.0 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.3 | 0.8 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.3 | 1.3 | GO:0015793 | glycerol transport(GO:0015793) |
| 0.3 | 1.0 | GO:0061386 | closure of optic fissure(GO:0061386) |
| 0.3 | 2.0 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.2 | 1.7 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.2 | 1.2 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.2 | 1.0 | GO:0003142 | cardiogenic plate morphogenesis(GO:0003142) endodermal cell fate determination(GO:0007493) regulation of transcription from RNA polymerase II promoter involved in definitive endodermal cell fate specification(GO:0060807) |
| 0.2 | 0.5 | GO:0072104 | glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.2 | 1.2 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.2 | 2.4 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.2 | 0.7 | GO:0090285 | negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.2 | 1.2 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.2 | 2.6 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.2 | 4.9 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.2 | 0.9 | GO:0046226 | coumarin catabolic process(GO:0046226) |
| 0.2 | 2.1 | GO:0006971 | hypotonic response(GO:0006971) positive regulation of phagocytosis, engulfment(GO:0060100) positive regulation of membrane invagination(GO:1905155) |
| 0.2 | 5.7 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
| 0.2 | 2.3 | GO:1901970 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.2 | 0.7 | GO:0002270 | plasmacytoid dendritic cell activation(GO:0002270) |
| 0.2 | 0.7 | GO:0061360 | optic nerve formation(GO:0021634) optic chiasma development(GO:0061360) regulation of optic nerve formation(GO:2000595) positive regulation of optic nerve formation(GO:2000597) |
| 0.2 | 0.9 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.2 | 1.3 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.2 | 0.6 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
| 0.2 | 3.2 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.2 | 2.5 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.2 | 0.6 | GO:0002585 | myeloid dendritic cell activation involved in immune response(GO:0002277) positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
| 0.2 | 2.3 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.2 | 0.6 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.2 | 1.0 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.2 | 0.6 | GO:0001878 | response to yeast(GO:0001878) |
| 0.2 | 0.6 | GO:2000542 | negative regulation of gastrulation(GO:2000542) |
| 0.2 | 2.8 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.2 | 5.6 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.2 | 3.3 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.2 | 0.8 | GO:1904882 | telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.2 | 0.6 | GO:0033082 | regulation of extrathymic T cell differentiation(GO:0033082) |
| 0.2 | 1.1 | GO:0071166 | ribonucleoprotein complex localization(GO:0071166) ribonucleoprotein complex export from nucleus(GO:0071426) |
| 0.2 | 1.1 | GO:1901314 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.2 | 1.3 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.2 | 1.1 | GO:0060023 | soft palate development(GO:0060023) |
| 0.2 | 1.6 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.2 | 1.3 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.2 | 2.0 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.2 | 0.7 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.2 | 1.1 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.2 | 0.7 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) |
| 0.2 | 0.2 | GO:0010813 | neuropeptide catabolic process(GO:0010813) |
| 0.2 | 0.7 | GO:0042637 | catagen(GO:0042637) |
| 0.2 | 4.0 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.2 | 1.0 | GO:0097491 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
| 0.2 | 0.9 | GO:0071718 | sodium-independent icosanoid transport(GO:0071718) |
| 0.2 | 1.6 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
| 0.2 | 1.4 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.2 | 0.3 | GO:0001788 | antibody-dependent cellular cytotoxicity(GO:0001788) |
| 0.2 | 0.5 | GO:2000820 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.2 | 0.5 | GO:1904499 | regulation of chromatin-mediated maintenance of transcription(GO:1904499) positive regulation of chromatin-mediated maintenance of transcription(GO:1904501) regulation of euchromatin binding(GO:1904793) |
| 0.2 | 1.5 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.2 | 1.9 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.2 | 0.7 | GO:0006226 | dUMP biosynthetic process(GO:0006226) |
| 0.2 | 1.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.2 | 1.5 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 0.2 | 1.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.2 | 4.2 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.2 | 1.2 | GO:0051012 | microtubule sliding(GO:0051012) |
| 0.2 | 1.0 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.2 | 1.8 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.2 | 1.0 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.2 | 0.8 | GO:0009597 | detection of virus(GO:0009597) |
| 0.2 | 1.0 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
| 0.2 | 3.6 | GO:0061615 | glycolytic process through fructose-6-phosphate(GO:0061615) |
| 0.2 | 0.6 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 | 2.6 | GO:0036344 | platelet formation(GO:0030220) platelet morphogenesis(GO:0036344) |
| 0.2 | 0.2 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.2 | 0.8 | GO:0086048 | membrane depolarization during bundle of His cell action potential(GO:0086048) |
| 0.2 | 0.5 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.2 | 1.4 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.2 | 0.2 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.2 | 2.0 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 0.2 | 3.2 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.2 | 0.6 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.2 | 1.7 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.2 | 0.9 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.2 | 0.5 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.1 | 1.3 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.1 | 3.1 | GO:0046688 | response to copper ion(GO:0046688) |
| 0.1 | 0.9 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.1 | 0.7 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) response to interleukin-9(GO:0071104) |
| 0.1 | 1.9 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
| 0.1 | 0.9 | GO:0035553 | oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.1 | 0.4 | GO:0009629 | response to gravity(GO:0009629) |
| 0.1 | 1.0 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.1 | 0.4 | GO:1904735 | negative regulation of electron carrier activity(GO:1904733) regulation of fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:1904735) negative regulation of fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:1904736) |
| 0.1 | 2.6 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 | 0.4 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.1 | 1.7 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 | 2.7 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.1 | 0.4 | GO:0035037 | sperm entry(GO:0035037) |
| 0.1 | 0.8 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.1 | 0.7 | GO:0070314 | threonine metabolic process(GO:0006566) G1 to G0 transition(GO:0070314) |
| 0.1 | 1.7 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.1 | 1.2 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.1 | 0.5 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.1 | 0.7 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
| 0.1 | 1.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.1 | 0.3 | GO:0035666 | TRIF-dependent toll-like receptor signaling pathway(GO:0035666) response to diacyl bacterial lipopeptide(GO:0071724) cellular response to diacyl bacterial lipopeptide(GO:0071726) |
| 0.1 | 0.9 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.1 | 1.1 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.1 | 2.4 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.1 | 1.8 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.1 | 0.4 | GO:0055014 | atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
| 0.1 | 0.4 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.1 | 0.4 | GO:1990167 | protein K27-linked deubiquitination(GO:1990167) |
| 0.1 | 0.4 | GO:0001545 | primary ovarian follicle growth(GO:0001545) |
| 0.1 | 0.8 | GO:0050904 | diapedesis(GO:0050904) |
| 0.1 | 0.5 | GO:0042628 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
| 0.1 | 1.7 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 3.4 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.1 | 1.4 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.1 | 1.1 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.1 | 0.6 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 2.9 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.1 | 0.3 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.1 | 2.6 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.5 | GO:0046086 | adenosine biosynthetic process(GO:0046086) |
| 0.1 | 1.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.1 | 0.4 | GO:0030573 | bile acid catabolic process(GO:0030573) |
| 0.1 | 1.8 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.1 | 0.1 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 | 1.6 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 | 4.0 | GO:0060008 | Sertoli cell differentiation(GO:0060008) |
| 0.1 | 1.1 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.1 | 1.8 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.1 | 0.5 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.1 | 0.4 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.1 | 0.6 | GO:1902946 | protein localization to early endosome(GO:1902946) regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.1 | 2.3 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.1 | 2.0 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 0.3 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 | 0.3 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.1 | 0.5 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 0.1 | 0.5 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.1 | 1.0 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.1 | 1.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 | 0.9 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
| 0.1 | 0.3 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.1 | 0.5 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.1 | 1.0 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 1.9 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.1 | 0.7 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.1 | 2.4 | GO:0045214 | sarcomere organization(GO:0045214) |
| 0.1 | 1.6 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.1 | 0.2 | GO:0002343 | peripheral B cell selection(GO:0002343) B cell affinity maturation(GO:0002344) |
| 0.1 | 2.3 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
| 0.1 | 0.4 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 | 1.1 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.1 | 0.8 | GO:0019659 | glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.1 | 0.4 | GO:0040030 | regulation of molecular function, epigenetic(GO:0040030) |
| 0.1 | 0.9 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.1 | 1.5 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.1 | 0.4 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 0.6 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.1 | 2.4 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.1 | 1.8 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 0.1 | 0.4 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.1 | 1.0 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 | 0.3 | GO:0051792 | medium-chain fatty acid biosynthetic process(GO:0051792) |
| 0.1 | 0.8 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.1 | 1.7 | GO:0031000 | response to caffeine(GO:0031000) |
| 0.1 | 1.0 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.1 | 0.8 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.1 | 0.8 | GO:2000143 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.1 | 0.9 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.1 | 0.7 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.1 | 1.8 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.1 | 0.8 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 | 0.4 | GO:1903575 | cornified envelope assembly(GO:1903575) |
| 0.1 | 0.4 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
| 0.1 | 0.3 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.1 | 1.6 | GO:0070233 | negative regulation of T cell apoptotic process(GO:0070233) |
| 0.1 | 0.4 | GO:1901675 | negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.1 | 0.6 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.1 | 2.2 | GO:0060707 | trophoblast giant cell differentiation(GO:0060707) |
| 0.1 | 1.0 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.1 | 1.4 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.1 | 2.6 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.1 | 0.5 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
| 0.1 | 4.7 | GO:0051310 | metaphase plate congression(GO:0051310) |
| 0.1 | 2.0 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.1 | 0.4 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.1 | 0.4 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.1 | 0.5 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.1 | 1.4 | GO:0043129 | surfactant homeostasis(GO:0043129) |
| 0.1 | 3.2 | GO:0003341 | cilium movement(GO:0003341) |
| 0.1 | 0.8 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 | 0.4 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.1 | 0.2 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.1 | 1.0 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.1 | 2.1 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.1 | 0.8 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 1.1 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 | 0.3 | GO:0015788 | UDP-N-acetylglucosamine transport(GO:0015788) |
| 0.1 | 0.9 | GO:0035635 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.1 | 1.4 | GO:0097435 | fibril organization(GO:0097435) |
| 0.1 | 2.0 | GO:0030317 | sperm motility(GO:0030317) |
| 0.1 | 0.8 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.1 | 0.3 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.1 | 1.8 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 | 0.6 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.1 | 2.5 | GO:0051894 | positive regulation of focal adhesion assembly(GO:0051894) |
| 0.1 | 0.8 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.1 | 0.4 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
| 0.1 | 0.2 | GO:0044029 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.1 | 0.6 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.1 | 0.1 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
| 0.1 | 1.3 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.1 | 0.4 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
| 0.1 | 1.1 | GO:0002176 | male germ cell proliferation(GO:0002176) |
| 0.1 | 0.3 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.1 | 0.3 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
| 0.1 | 0.3 | GO:2001287 | negative regulation of caveolin-mediated endocytosis(GO:2001287) |
| 0.1 | 4.7 | GO:0018149 | peptide cross-linking(GO:0018149) |
| 0.1 | 0.4 | GO:0009115 | xanthine catabolic process(GO:0009115) xanthine metabolic process(GO:0046110) |
| 0.1 | 0.6 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.1 | 0.7 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.1 | 1.4 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.1 | 0.8 | GO:0010831 | positive regulation of myotube differentiation(GO:0010831) |
| 0.1 | 0.3 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 3.2 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
| 0.1 | 0.7 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.1 | 0.9 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.1 | 0.5 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.1 | 1.1 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.1 | 0.4 | GO:0090005 | protein depalmitoylation(GO:0002084) negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) macromolecule depalmitoylation(GO:0098734) |
| 0.1 | 0.7 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.1 | 1.2 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.1 | 1.2 | GO:2001223 | negative regulation of neuron migration(GO:2001223) |
| 0.1 | 1.3 | GO:0032506 | cytokinetic process(GO:0032506) |
| 0.1 | 0.5 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.1 | 1.5 | GO:0006700 | C21-steroid hormone biosynthetic process(GO:0006700) |
| 0.1 | 1.0 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.1 | 1.5 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
| 0.1 | 0.7 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.1 | 0.4 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.1 | 2.9 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.1 | 0.1 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
| 0.1 | 2.5 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.1 | 0.9 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 1.1 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.1 | 1.1 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 0.1 | 0.3 | GO:0030091 | protein repair(GO:0030091) |
| 0.1 | 0.3 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.1 | 2.6 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.1 | 0.3 | GO:0097298 | regulation of nucleus size(GO:0097298) |
| 0.1 | 5.2 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
| 0.1 | 0.5 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
| 0.1 | 1.0 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.1 | 0.3 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.1 | 0.7 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 0.3 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.1 | 0.3 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
| 0.1 | 0.7 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.2 | GO:1903093 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.1 | 0.4 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.1 | 0.2 | GO:2000864 | estradiol secretion(GO:0035938) regulation of estradiol secretion(GO:2000864) |
| 0.1 | 0.3 | GO:0003263 | cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) |
| 0.1 | 1.4 | GO:0030033 | microvillus assembly(GO:0030033) |
| 0.1 | 0.2 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
| 0.1 | 0.7 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 | 1.1 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.1 | 1.1 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.1 | 0.2 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 0.1 | 1.2 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 2.9 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.1 | 0.2 | GO:0010232 | vascular transport(GO:0010232) milk ejection(GO:0060156) |
| 0.1 | 0.6 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.1 | 0.3 | GO:0035660 | MyD88-dependent toll-like receptor 4 signaling pathway(GO:0035660) |
| 0.1 | 0.3 | GO:0040031 | snRNA pseudouridine synthesis(GO:0031120) snRNA modification(GO:0040031) |
| 0.1 | 0.3 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.1 | 0.9 | GO:0043312 | neutrophil degranulation(GO:0043312) |
| 0.1 | 0.4 | GO:0010744 | positive regulation of macrophage derived foam cell differentiation(GO:0010744) |
| 0.1 | 0.5 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.1 | 0.2 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.1 | 0.6 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 | 0.3 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.1 | 0.9 | GO:0033753 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.1 | 3.1 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
| 0.1 | 0.3 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.1 | 0.6 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.1 | 0.7 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
| 0.1 | 0.4 | GO:0051775 | response to redox state(GO:0051775) |
| 0.1 | 3.1 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.1 | 1.2 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
| 0.1 | 3.8 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
| 0.1 | 0.2 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 | 3.4 | GO:0060711 | labyrinthine layer development(GO:0060711) |
| 0.1 | 1.0 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.1 | 0.7 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 | 1.0 | GO:0006662 | glycerol ether metabolic process(GO:0006662) |
| 0.1 | 2.7 | GO:0042491 | auditory receptor cell differentiation(GO:0042491) |
| 0.1 | 0.4 | GO:0007527 | adult somatic muscle development(GO:0007527) |
| 0.1 | 0.2 | GO:1903406 | regulation of sodium:potassium-exchanging ATPase activity(GO:1903406) |
| 0.0 | 0.4 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.7 | GO:0032096 | negative regulation of response to food(GO:0032096) |
| 0.0 | 0.6 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.0 | 0.5 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.0 | 0.8 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.0 | 0.3 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 1.4 | GO:0003382 | epithelial cell morphogenesis(GO:0003382) |
| 0.0 | 0.4 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
| 0.0 | 0.4 | GO:0007440 | foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
| 0.0 | 0.4 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.0 | 1.5 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 | 1.5 | GO:0001755 | neural crest cell migration(GO:0001755) |
| 0.0 | 0.8 | GO:0006855 | drug transmembrane transport(GO:0006855) |
| 0.0 | 0.5 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.0 | 0.8 | GO:0070633 | transepithelial transport(GO:0070633) |
| 0.0 | 0.6 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 2.3 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
| 0.0 | 1.4 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
| 0.0 | 0.5 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.0 | 0.2 | GO:0033580 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.0 | 0.8 | GO:0060512 | prostate gland morphogenesis(GO:0060512) |
| 0.0 | 0.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.0 | 0.6 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 0.2 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.0 | 2.3 | GO:0010761 | fibroblast migration(GO:0010761) |
| 0.0 | 0.6 | GO:0002313 | mature B cell differentiation involved in immune response(GO:0002313) |
| 0.0 | 1.0 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
| 0.0 | 0.7 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 1.4 | GO:0045445 | myoblast differentiation(GO:0045445) |
| 0.0 | 1.0 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 | 0.8 | GO:1903672 | positive regulation of sprouting angiogenesis(GO:1903672) |
| 0.0 | 1.1 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 1.0 | GO:0006301 | postreplication repair(GO:0006301) |
| 0.0 | 0.5 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.0 | 0.2 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.0 | 1.6 | GO:0046039 | GTP metabolic process(GO:0046039) |
| 0.0 | 0.7 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.6 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.6 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.0 | 0.1 | GO:1904816 | regulation of protein localization to chromosome, telomeric region(GO:1904814) positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.0 | 2.2 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
| 0.0 | 0.2 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 0.0 | 0.4 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.0 | 0.5 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 2.8 | GO:0008543 | fibroblast growth factor receptor signaling pathway(GO:0008543) |
| 0.0 | 0.3 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.0 | 0.6 | GO:0045143 | homologous chromosome segregation(GO:0045143) |
| 0.0 | 0.5 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.0 | 0.4 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 4.1 | GO:0006664 | glycolipid metabolic process(GO:0006664) |
| 0.0 | 1.4 | GO:0051972 | regulation of telomerase activity(GO:0051972) |
| 0.0 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
| 0.0 | 1.5 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
| 0.0 | 0.7 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.0 | 0.8 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.9 | GO:0045669 | positive regulation of osteoblast differentiation(GO:0045669) |
| 0.0 | 0.9 | GO:0021591 | ventricular system development(GO:0021591) |
| 0.0 | 10.3 | GO:0016042 | lipid catabolic process(GO:0016042) |
| 0.0 | 0.8 | GO:0030857 | negative regulation of epithelial cell differentiation(GO:0030857) |
| 0.0 | 4.0 | GO:0030178 | negative regulation of Wnt signaling pathway(GO:0030178) |
| 0.0 | 1.5 | GO:0043001 | Golgi to plasma membrane protein transport(GO:0043001) |
| 0.0 | 0.3 | GO:2001183 | negative regulation of interleukin-12 secretion(GO:2001183) |
| 0.0 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.0 | 0.3 | GO:0070232 | regulation of T cell apoptotic process(GO:0070232) |
| 0.0 | 0.3 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.0 | 0.3 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.0 | 0.2 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 0.0 | 1.0 | GO:0042775 | mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
| 0.0 | 0.4 | GO:0002385 | organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
| 0.0 | 0.3 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 0.0 | GO:2000397 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.0 | 0.7 | GO:0051281 | positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
| 0.0 | 0.2 | GO:0003181 | atrioventricular valve morphogenesis(GO:0003181) atrial septum development(GO:0003283) |
| 0.0 | 0.4 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.4 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.0 | 0.3 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.0 | 0.7 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.3 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.5 | GO:0021983 | pituitary gland development(GO:0021983) |
| 0.0 | 0.3 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.3 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 | 0.7 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.3 | GO:1904261 | positive regulation of extracellular matrix assembly(GO:1901203) regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.0 | 0.6 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.0 | 4.3 | GO:1990830 | response to leukemia inhibitory factor(GO:1990823) cellular response to leukemia inhibitory factor(GO:1990830) |
| 0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.0 | 0.1 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.0 | 0.2 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.0 | 0.4 | GO:1904778 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.0 | 0.4 | GO:0010667 | negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
| 0.0 | 0.2 | GO:0061641 | chromatin remodeling at centromere(GO:0031055) CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.0 | 0.2 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.0 | 0.1 | GO:0050712 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.0 | 0.3 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 0.3 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.8 | GO:0042255 | ribosome assembly(GO:0042255) |
| 0.0 | 0.2 | GO:0051900 | regulation of mitochondrial depolarization(GO:0051900) |
| 0.0 | 1.9 | GO:0034446 | substrate adhesion-dependent cell spreading(GO:0034446) |
| 0.0 | 0.1 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.0 | 0.2 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
| 0.0 | 9.8 | GO:0007283 | spermatogenesis(GO:0007283) male gamete generation(GO:0048232) |
| 0.0 | 0.3 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.4 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.0 | 0.1 | GO:0021936 | regulation of cerebellar granule cell precursor proliferation(GO:0021936) |
| 0.0 | 0.2 | GO:0006893 | Golgi to plasma membrane transport(GO:0006893) |
| 0.0 | 0.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.0 | 0.7 | GO:0060325 | face morphogenesis(GO:0060325) |
| 0.0 | 0.0 | GO:0040010 | positive regulation of growth rate(GO:0040010) |
| 0.0 | 0.1 | GO:1904037 | positive regulation of epithelial cell apoptotic process(GO:1904037) |
| 0.0 | 0.3 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
| 0.0 | 1.4 | GO:0044782 | cilium organization(GO:0044782) |
| 0.0 | 0.3 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.0 | 1.0 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
| 0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.5 | GO:0010107 | potassium ion import(GO:0010107) |
| 0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.1 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.0 | 0.6 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
| 0.0 | 0.7 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.1 | GO:0043486 | histone exchange(GO:0043486) |
| 0.0 | 0.6 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.1 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.0 | 1.7 | GO:0051028 | mRNA transport(GO:0051028) |
| 0.0 | 1.5 | GO:0007568 | aging(GO:0007568) |
| 0.0 | 0.1 | GO:2000279 | negative regulation of DNA biosynthetic process(GO:2000279) |
| 0.0 | 0.3 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.0 | 0.2 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.0 | 0.2 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.0 | 0.6 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.0 | 1.0 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.1 | GO:1903504 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.0 | 1.9 | GO:0009952 | anterior/posterior pattern specification(GO:0009952) |
| 0.0 | 0.5 | GO:1901184 | regulation of ERBB signaling pathway(GO:1901184) |
| 0.0 | 0.6 | GO:0055078 | sodium ion homeostasis(GO:0055078) |
| 0.0 | 0.3 | GO:0007368 | determination of left/right symmetry(GO:0007368) specification of symmetry(GO:0009799) determination of bilateral symmetry(GO:0009855) |
| 0.0 | 0.3 | GO:0048565 | digestive tract development(GO:0048565) |
| 0.0 | 0.8 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 1.0 | GO:0007369 | gastrulation(GO:0007369) |
| 0.0 | 0.4 | GO:0001541 | ovarian follicle development(GO:0001541) |
| 0.0 | 0.1 | GO:0006983 | ER overload response(GO:0006983) |
| 0.0 | 0.3 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 | 0.1 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.1 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.0 | 0.1 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.0 | 0.2 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.1 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.0 | 0.0 | GO:0061213 | positive regulation of mesonephros development(GO:0061213) regulation of mesonephros development(GO:0061217) regulation of branching involved in ureteric bud morphogenesis(GO:0090189) positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
| 0.0 | 0.0 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.0 | 0.3 | GO:0045907 | positive regulation of vasoconstriction(GO:0045907) |
| 0.0 | 0.2 | GO:0045740 | positive regulation of DNA replication(GO:0045740) |
| 0.0 | 0.1 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.0 | 1.1 | GO:0031214 | biomineral tissue development(GO:0031214) |
| 0.0 | 0.1 | GO:1901538 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.0 | 0.5 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.0 | 0.1 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.0 | GO:0060674 | placenta blood vessel development(GO:0060674) |
| 0.0 | 0.1 | GO:0032277 | negative regulation of gonadotropin secretion(GO:0032277) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 4.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.9 | 2.8 | GO:0031904 | endosome lumen(GO:0031904) |
| 0.9 | 2.8 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.9 | 3.7 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.8 | 2.4 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.8 | 3.2 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.7 | 3.7 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.7 | 10.9 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.6 | 1.8 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
| 0.6 | 1.7 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.5 | 5.4 | GO:0030478 | actin cap(GO:0030478) |
| 0.5 | 8.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.5 | 3.4 | GO:0071914 | prominosome(GO:0071914) |
| 0.4 | 3.3 | GO:0001652 | granular component(GO:0001652) |
| 0.4 | 0.8 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 0.4 | 2.0 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.4 | 4.4 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.4 | 1.6 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.4 | 1.1 | GO:0044393 | microspike(GO:0044393) |
| 0.4 | 2.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.3 | 1.0 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
| 0.3 | 0.9 | GO:0002945 | cyclin K-CDK12 complex(GO:0002944) cyclin K-CDK13 complex(GO:0002945) |
| 0.3 | 1.2 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
| 0.3 | 0.9 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.3 | 1.8 | GO:0071547 | piP-body(GO:0071547) |
| 0.3 | 0.9 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
| 0.3 | 2.6 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.3 | 1.7 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.3 | 3.8 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.3 | 0.8 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
| 0.3 | 1.3 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
| 0.3 | 1.8 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.2 | 1.5 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.2 | 1.0 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.2 | 1.7 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.2 | 0.7 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
| 0.2 | 7.1 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.2 | 1.6 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.2 | 4.0 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.2 | 3.2 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
| 0.2 | 1.6 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.2 | 1.8 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.2 | 3.6 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.2 | 22.9 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.2 | 0.9 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.2 | 2.0 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.2 | 4.1 | GO:0005861 | troponin complex(GO:0005861) |
| 0.2 | 1.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.2 | 31.4 | GO:0036126 | sperm flagellum(GO:0036126) |
| 0.2 | 4.9 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.2 | 1.4 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.2 | 19.9 | GO:0005811 | lipid particle(GO:0005811) |
| 0.2 | 2.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.2 | 1.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.2 | 0.7 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.2 | 1.9 | GO:0045495 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.2 | 2.2 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.2 | 1.6 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.2 | 0.5 | GO:1990879 | CST complex(GO:1990879) |
| 0.2 | 0.3 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
| 0.2 | 1.5 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 2.8 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.1 | 1.6 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.1 | 0.7 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.1 | 1.0 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.1 | 2.7 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.1 | 1.6 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 2.5 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 2.3 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 0.4 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 3.0 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.1 | 0.5 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
| 0.1 | 0.6 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.1 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 0.1 | 0.9 | GO:0033503 | HULC complex(GO:0033503) |
| 0.1 | 1.0 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 2.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 3.0 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.1 | 1.0 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.1 | 1.4 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 0.5 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 4.2 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.1 | 5.9 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.1 | 0.5 | GO:0031251 | PAN complex(GO:0031251) |
| 0.1 | 8.3 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.1 | 2.7 | GO:0005605 | basal lamina(GO:0005605) |
| 0.1 | 0.6 | GO:1990421 | subtelomeric heterochromatin(GO:1990421) nuclear subtelomeric heterochromatin(GO:1990707) |
| 0.1 | 0.8 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.1 | 0.6 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 0.1 | 1.0 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.1 | 5.5 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.1 | 4.1 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.1 | 1.5 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 3.0 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.1 | 1.8 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.1 | 4.6 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.1 | 1.6 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.1 | 1.3 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.1 | 0.5 | GO:0002177 | manchette(GO:0002177) |
| 0.1 | 0.2 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
| 0.1 | 0.8 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.1 | 0.5 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.1 | 0.6 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 0.5 | GO:0005713 | recombination nodule(GO:0005713) |
| 0.1 | 1.8 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.1 | 0.6 | GO:0042825 | TAP complex(GO:0042825) |
| 0.1 | 1.3 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.1 | 1.0 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 1.3 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
| 0.1 | 4.8 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.1 | 1.3 | GO:0043218 | compact myelin(GO:0043218) |
| 0.1 | 0.3 | GO:0002111 | BRCA2-BRAF35 complex(GO:0002111) |
| 0.1 | 0.3 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 1.9 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 1.0 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.1 | 0.5 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.1 | 0.4 | GO:0036396 | MIS complex(GO:0036396) |
| 0.1 | 1.2 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.1 | 1.2 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.1 | 5.4 | GO:0031970 | mitochondrial intermembrane space(GO:0005758) organelle envelope lumen(GO:0031970) |
| 0.1 | 0.7 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 0.7 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.1 | 3.4 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.1 | 1.1 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.1 | 0.5 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 5.7 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.1 | 0.7 | GO:0005675 | holo TFIIH complex(GO:0005675) |
| 0.1 | 0.9 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.1 | 0.7 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 0.8 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 0.2 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.1 | 0.5 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.1 | 3.2 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.1 | 0.7 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.1 | 2.9 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.1 | 0.7 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.1 | 0.6 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.1 | 0.4 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 0.4 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.1 | 0.3 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 1.0 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 0.3 | GO:0031429 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
| 0.0 | 2.5 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 1.5 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 9.5 | GO:0031225 | anchored component of membrane(GO:0031225) |
| 0.0 | 2.9 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 0.3 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.0 | 0.3 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 0.2 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 0.0 | 4.0 | GO:0005604 | basement membrane(GO:0005604) |
| 0.0 | 2.5 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 2.8 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 1.3 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 3.4 | GO:0005903 | brush border(GO:0005903) |
| 0.0 | 0.3 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
| 0.0 | 0.4 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 1.5 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.8 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.3 | GO:0097413 | Lewy body(GO:0097413) |
| 0.0 | 0.3 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.0 | 0.4 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.2 | GO:0032797 | SMN complex(GO:0032797) |
| 0.0 | 13.7 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.0 | 0.1 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
| 0.0 | 1.0 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.8 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 1.5 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.5 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.3 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.6 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.0 | 1.0 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.9 | GO:0097386 | glial cell projection(GO:0097386) |
| 0.0 | 1.5 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.0 | 0.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.0 | 1.8 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 14.5 | GO:0005925 | focal adhesion(GO:0005925) |
| 0.0 | 1.0 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 4.7 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.8 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 3.3 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.4 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 1.8 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.2 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.3 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 3.4 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
| 0.0 | 0.3 | GO:0044215 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
| 0.0 | 1.8 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.8 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.0 | 0.2 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.5 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.9 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.5 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.2 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 1.4 | GO:0005901 | caveola(GO:0005901) |
| 0.0 | 0.1 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 1.0 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 0.4 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 0.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 0.5 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.0 | 0.4 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 0.3 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 1.8 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.3 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 4.6 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 0.4 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 3.8 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.3 | 5.2 | GO:0045159 | myosin II binding(GO:0045159) |
| 1.3 | 7.6 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 1.3 | 5.1 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
| 1.1 | 7.6 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.8 | 15.2 | GO:0008430 | selenium binding(GO:0008430) |
| 0.8 | 2.4 | GO:0047936 | glucose 1-dehydrogenase [NAD(P)] activity(GO:0047936) |
| 0.8 | 2.4 | GO:0070401 | NADP+ binding(GO:0070401) |
| 0.7 | 2.2 | GO:0031768 | ghrelin receptor binding(GO:0031768) |
| 0.7 | 3.6 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
| 0.7 | 4.0 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.7 | 4.6 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.6 | 1.9 | GO:0005017 | platelet-derived growth factor-activated receptor activity(GO:0005017) |
| 0.6 | 1.9 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 0.6 | 1.9 | GO:0050785 | advanced glycation end-product receptor activity(GO:0050785) |
| 0.6 | 4.7 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.5 | 2.2 | GO:0008386 | cholesterol monooxygenase (side-chain-cleaving) activity(GO:0008386) |
| 0.5 | 1.6 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.5 | 2.6 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.5 | 1.0 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.5 | 2.0 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.5 | 1.4 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
| 0.4 | 2.7 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.4 | 1.3 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.4 | 7.9 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.4 | 2.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.4 | 4.1 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.4 | 2.0 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.4 | 3.2 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.4 | 4.4 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.4 | 4.8 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.4 | 2.7 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.4 | 1.1 | GO:0015222 | dopamine:sodium symporter activity(GO:0005330) serotonin transmembrane transporter activity(GO:0015222) |
| 0.4 | 1.1 | GO:0001147 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 0.4 | 2.5 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.3 | 1.4 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.3 | 2.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.3 | 2.3 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.3 | 1.3 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.3 | 1.3 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.3 | 5.1 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.3 | 1.9 | GO:0004144 | 2-acylglycerol O-acyltransferase activity(GO:0003846) diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.3 | 1.9 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.3 | 1.8 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.3 | 1.7 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.3 | 2.3 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.3 | 2.9 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.3 | 3.1 | GO:0051870 | methotrexate binding(GO:0051870) |
| 0.3 | 2.5 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.3 | 1.3 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.3 | 0.8 | GO:0086057 | voltage-gated calcium channel activity involved in bundle of His cell action potential(GO:0086057) |
| 0.3 | 0.8 | GO:0052597 | diamine oxidase activity(GO:0052597) histamine oxidase activity(GO:0052598) methylputrescine oxidase activity(GO:0052599) propane-1,3-diamine oxidase activity(GO:0052600) |
| 0.3 | 0.8 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.2 | 1.0 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.2 | 1.7 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 0.2 | 2.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.2 | 9.0 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.2 | 0.9 | GO:0004063 | aryldialkylphosphatase activity(GO:0004063) |
| 0.2 | 3.6 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.2 | 0.7 | GO:0000402 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
| 0.2 | 4.7 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.2 | 3.1 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.2 | 1.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.2 | 1.5 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.2 | 0.6 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
| 0.2 | 1.1 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.2 | 10.8 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.2 | 1.3 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.2 | 0.6 | GO:0032090 | Pyrin domain binding(GO:0032090) |
| 0.2 | 0.6 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) tapasin binding(GO:0046980) |
| 0.2 | 0.8 | GO:0005118 | sevenless binding(GO:0005118) |
| 0.2 | 1.0 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
| 0.2 | 6.1 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.2 | 1.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.2 | 3.7 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.2 | 1.0 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.2 | 2.1 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.2 | 2.5 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.2 | 1.3 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.2 | 0.6 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.2 | 3.4 | GO:0043495 | protein anchor(GO:0043495) |
| 0.2 | 1.1 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.2 | 1.1 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.2 | 4.8 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.2 | 1.8 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.2 | 0.7 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.2 | 0.5 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.2 | 1.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.2 | 3.1 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.2 | 0.4 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.2 | 0.7 | GO:0036470 | tyrosine 3-monooxygenase activator activity(GO:0036470) L-dopa decarboxylase activator activity(GO:0036478) |
| 0.2 | 0.9 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.2 | 6.6 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.2 | 1.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.2 | 0.5 | GO:0015928 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
| 0.2 | 0.5 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.2 | 2.4 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.2 | 1.3 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.2 | 0.5 | GO:0004342 | glucosamine-6-phosphate deaminase activity(GO:0004342) |
| 0.2 | 2.5 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.2 | 3.0 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.2 | 1.5 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
| 0.2 | 0.5 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.2 | 1.0 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.2 | 1.1 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.2 | 0.5 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) |
| 0.2 | 3.3 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.2 | 0.6 | GO:0070976 | TIR domain binding(GO:0070976) |
| 0.2 | 0.5 | GO:0033680 | ATP-dependent DNA/RNA helicase activity(GO:0033680) |
| 0.2 | 4.4 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.2 | 0.9 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.2 | 0.5 | GO:0004458 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
| 0.2 | 1.4 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 0.4 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
| 0.1 | 0.9 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.1 | 0.7 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.1 | 1.2 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.1 | 1.9 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.1 | 0.6 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.1 | 2.0 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 1.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.1 | 1.0 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.7 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.1 | 1.2 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.1 | 0.4 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
| 0.1 | 0.3 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.1 | 3.4 | GO:0005537 | mannose binding(GO:0005537) |
| 0.1 | 2.8 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.1 | 1.7 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.1 | 0.8 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.1 | 1.5 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 2.9 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.1 | 1.7 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.1 | 28.8 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.1 | 0.2 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
| 0.1 | 0.4 | GO:0008396 | oxysterol 7-alpha-hydroxylase activity(GO:0008396) |
| 0.1 | 1.7 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.1 | 1.1 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.1 | 0.5 | GO:0004478 | methionine adenosyltransferase activity(GO:0004478) |
| 0.1 | 0.6 | GO:0004051 | arachidonate 5-lipoxygenase activity(GO:0004051) |
| 0.1 | 0.6 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.1 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.1 | 0.6 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.1 | 2.0 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.1 | 2.1 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.1 | 0.8 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.1 | 3.0 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.1 | 0.4 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
| 0.1 | 0.3 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.1 | 2.4 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.6 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 3.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 2.3 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.1 | 0.3 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 0.6 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
| 0.1 | 0.5 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.1 | 0.4 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.1 | 0.4 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.1 | 1.4 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.1 | 5.0 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.1 | 2.4 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.1 | 1.7 | GO:0005522 | profilin binding(GO:0005522) |
| 0.1 | 2.0 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.1 | 1.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 0.7 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.1 | 0.2 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 5.8 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.1 | 0.7 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 0.5 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.1 | 0.7 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 1.2 | GO:0048185 | activin binding(GO:0048185) |
| 0.1 | 1.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.1 | 0.4 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.1 | 1.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.1 | 1.0 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.1 | 0.8 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.1 | 0.6 | GO:0089720 | caspase binding(GO:0089720) |
| 0.1 | 0.3 | GO:0019862 | IgA binding(GO:0019862) |
| 0.1 | 0.5 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.1 | 0.9 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) serine-type exopeptidase activity(GO:0070008) |
| 0.1 | 1.2 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.1 | 2.1 | GO:0000217 | DNA secondary structure binding(GO:0000217) |
| 0.1 | 5.5 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.1 | 0.8 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) L-lactate dehydrogenase activity(GO:0004459) |
| 0.1 | 0.4 | GO:0016623 | aldehyde oxidase activity(GO:0004031) xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
| 0.1 | 0.5 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.1 | 0.8 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.1 | 6.9 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.1 | 1.8 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.1 | 1.0 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.1 | 0.4 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.1 | 0.7 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.1 | 1.0 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.1 | 1.5 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 9.5 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.1 | 1.4 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.9 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.1 | 1.8 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.1 | 0.5 | GO:0004556 | alpha-amylase activity(GO:0004556) |
| 0.1 | 1.1 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.1 | 0.4 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.1 | 0.4 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.1 | 0.3 | GO:0042834 | peptidoglycan binding(GO:0042834) |
| 0.1 | 0.3 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.1 | 2.4 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.1 | 9.6 | GO:0005178 | integrin binding(GO:0005178) |
| 0.1 | 2.0 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 1.8 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.1 | 1.7 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.1 | 0.9 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.1 | 0.2 | GO:0071796 | K6-linked polyubiquitin binding(GO:0071796) |
| 0.1 | 0.4 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.1 | 0.9 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.1 | 0.2 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
| 0.1 | 0.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.1 | 1.5 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.1 | 0.4 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 0.3 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.1 | 3.6 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.1 | 1.5 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.1 | 0.2 | GO:0001034 | RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.1 | 1.8 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 0.6 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.1 | 0.5 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.1 | 1.0 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 0.2 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.1 | 3.7 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.1 | 5.9 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.1 | 2.2 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.1 | 0.3 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.1 | 0.3 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.1 | 0.2 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
| 0.1 | 0.5 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.1 | 1.1 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.5 | GO:0001055 | RNA polymerase I activity(GO:0001054) RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.3 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 1.7 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.5 | GO:0008329 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
| 0.0 | 0.2 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.0 | 0.5 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.9 | GO:0008236 | serine-type peptidase activity(GO:0008236) |
| 0.0 | 2.4 | GO:0051018 | protein kinase A binding(GO:0051018) |
| 0.0 | 0.3 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.0 | 0.5 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
| 0.0 | 0.4 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.8 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.0 | 0.7 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 1.1 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.0 | 0.4 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 1.6 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.0 | 0.3 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
| 0.0 | 0.4 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.5 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.0 | 1.9 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.0 | 0.8 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.0 | 0.4 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.0 | 0.8 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
| 0.0 | 0.2 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.0 | 0.7 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 1.2 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
| 0.0 | 0.5 | GO:0035473 | lipase binding(GO:0035473) |
| 0.0 | 0.7 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
| 0.0 | 0.9 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.0 | 2.9 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 6.6 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 2.3 | GO:0042805 | actinin binding(GO:0042805) |
| 0.0 | 0.8 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.9 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.0 | 3.0 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.0 | 0.6 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 4.7 | GO:0008201 | heparin binding(GO:0008201) |
| 0.0 | 0.5 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.0 | 0.1 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.0 | 0.5 | GO:0046977 | TAP binding(GO:0046977) |
| 0.0 | 0.2 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.2 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.0 | 0.2 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.0 | 1.2 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 1.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.2 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) flap endonuclease activity(GO:0048256) |
| 0.0 | 0.7 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 2.9 | GO:0017048 | Rho GTPase binding(GO:0017048) |
| 0.0 | 0.3 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 0.8 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.3 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.3 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.0 | 0.3 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.0 | 1.1 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.6 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 0.2 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.0 | 1.6 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.0 | 3.4 | GO:0031072 | heat shock protein binding(GO:0031072) |
| 0.0 | 0.2 | GO:0086075 | gap junction channel activity involved in cardiac conduction electrical coupling(GO:0086075) |
| 0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.6 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.2 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.0 | 0.4 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.0 | 0.2 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.1 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.0 | 0.4 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.0 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.0 | 0.4 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.0 | 3.3 | GO:0017124 | SH3 domain binding(GO:0017124) |
| 0.0 | 1.9 | GO:0015297 | antiporter activity(GO:0015297) |
| 0.0 | 1.1 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.0 | 0.6 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 1.7 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.0 | 0.9 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.0 | 0.2 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 1.1 | GO:0004004 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
| 0.0 | 0.2 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 0.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 4.2 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.0 | 0.4 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.0 | 1.4 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 3.1 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.0 | 1.0 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.6 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
| 0.0 | 0.3 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.3 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.3 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.3 | GO:0005351 | sugar:proton symporter activity(GO:0005351) cation:sugar symporter activity(GO:0005402) |
| 0.0 | 0.5 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
| 0.0 | 0.2 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.0 | 0.2 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 2.2 | GO:0008234 | cysteine-type peptidase activity(GO:0008234) |
| 0.0 | 0.3 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.2 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.6 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.2 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.2 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.4 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.1 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.0 | 0.6 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.1 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.2 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 8.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.2 | 13.2 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.2 | 5.4 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.2 | 1.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 1.3 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.1 | 6.4 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.1 | 13.4 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 7.3 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 4.1 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.1 | 21.4 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.1 | 7.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 0.9 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.1 | 4.8 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.1 | 3.6 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.1 | 4.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 0.9 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.1 | 2.7 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.1 | 2.0 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.1 | 1.9 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 3.6 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 1.3 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 0.6 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.1 | 1.8 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 16.0 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.1 | 1.9 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 0.9 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 2.3 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 1.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 2.2 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 1.6 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 5.5 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 8.4 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 1.0 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.5 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 1.4 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 1.6 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 1.3 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 1.6 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.7 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.4 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 3.8 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 0.7 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 0.7 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 0.6 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 1.1 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 1.5 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.0 | 1.8 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 1.4 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.3 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 1.5 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.8 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.8 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.8 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.2 | PID EPO PATHWAY | EPO signaling pathway |
| 0.0 | 0.0 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.2 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.4 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 0.4 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.3 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.3 | PID RAS PATHWAY | Regulation of Ras family activation |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 27.7 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.6 | 0.6 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
| 0.5 | 2.2 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.5 | 9.0 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.4 | 0.4 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.4 | 3.7 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
| 0.4 | 1.2 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.3 | 16.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.2 | 4.7 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.2 | 15.5 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.2 | 3.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.2 | 5.1 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.2 | 6.2 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.2 | 6.5 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.2 | 2.3 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.2 | 3.1 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.2 | 2.3 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.2 | 2.4 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.1 | 2.8 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.1 | 4.2 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.1 | 15.8 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.1 | 6.7 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.1 | 3.0 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 1.7 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.1 | 2.1 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.1 | 2.6 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.1 | 0.6 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.1 | 1.5 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.1 | 1.9 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
| 0.1 | 5.6 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.1 | 0.2 | REACTOME SIGNALING BY TGF BETA RECEPTOR COMPLEX | Genes involved in Signaling by TGF-beta Receptor Complex |
| 0.1 | 0.9 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 3.9 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.1 | 4.7 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 11.6 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.1 | 2.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 1.4 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.1 | 2.1 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.1 | 1.9 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 2.6 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 1.6 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 1.2 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.1 | 4.7 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.1 | 2.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 1.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.1 | 1.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.1 | 3.0 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.1 | 2.4 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.1 | 2.6 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.1 | 1.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 1.4 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.1 | 3.2 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.1 | 1.7 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.1 | 1.3 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.1 | 0.6 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 3.7 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.1 | 1.0 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 1.1 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 1.6 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.1 | 1.0 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.1 | 0.6 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 1.5 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.1 | 1.9 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.1 | 2.2 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.1 | 1.1 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.1 | 0.8 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.1 | 0.6 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.1 | 2.6 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 1.3 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
| 0.0 | 0.7 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.0 | 1.2 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.0 | 1.4 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 1.0 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.0 | 0.9 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.5 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 0.0 | 1.0 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 0.8 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.4 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.9 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.9 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.0 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 1.1 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.0 | 1.5 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
| 0.0 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.2 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.0 | 2.1 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 1.0 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.7 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 1.1 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
| 0.0 | 0.9 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 0.7 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.3 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.5 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 0.5 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.6 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.5 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 1.0 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.5 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.2 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.0 | 0.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 1.9 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.3 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.8 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.2 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.0 | 0.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.9 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.3 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.2 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 0.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |