PRJNA375882: Comprehensive Mouse Transcriptomic BodyMap
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Zfx
|
ENSMUSG00000079509.11 | Zfx |
|
Zfp711
|
ENSMUSG00000025529.15 | Zfp711 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Zfx | mm39_v1_chrX_-_93166964_93166989 | 0.50 | 8.8e-06 | Click! |
| Zfp711 | mm39_v1_chrX_+_111524998_111524998 | 0.21 | 8.1e-02 | Click! |
| Promoter | Score | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr1_+_87192067 | 11.06 |
ENSMUST00000027472.7
|
Efhd1
|
EF hand domain containing 1 |
| chr15_+_89218601 | 9.69 |
ENSMUST00000023282.9
|
Miox
|
myo-inositol oxygenase |
| chr3_-_90373165 | 7.98 |
ENSMUST00000029540.13
|
Npr1
|
natriuretic peptide receptor 1 |
| chr11_+_78079243 | 7.74 |
ENSMUST00000002128.14
ENSMUST00000150941.8 |
Rab34
|
RAB34, member RAS oncogene family |
| chr9_-_52079872 | 7.61 |
ENSMUST00000213645.2
|
Zc3h12c
|
zinc finger CCCH type containing 12C |
| chr11_+_78079631 | 7.23 |
ENSMUST00000056241.12
ENSMUST00000207728.2 |
Rab34
|
RAB34, member RAS oncogene family |
| chr11_+_78079562 | 7.22 |
ENSMUST00000108322.9
|
Rab34
|
RAB34, member RAS oncogene family |
| chr6_-_85351524 | 7.05 |
ENSMUST00000060837.10
|
Rab11fip5
|
RAB11 family interacting protein 5 (class I) |
| chr8_-_105350898 | 6.65 |
ENSMUST00000212882.2
ENSMUST00000163783.4 |
Cdh16
|
cadherin 16 |
| chr2_-_38604503 | 6.63 |
ENSMUST00000028084.5
|
Nr5a1
|
nuclear receptor subfamily 5, group A, member 1 |
| chr6_-_85351588 | 6.40 |
ENSMUST00000204087.2
|
Rab11fip5
|
RAB11 family interacting protein 5 (class I) |
| chr8_-_11362731 | 5.95 |
ENSMUST00000033898.10
|
Col4a1
|
collagen, type IV, alpha 1 |
| chr3_+_34074222 | 5.85 |
ENSMUST00000167354.8
ENSMUST00000198051.5 ENSMUST00000197694.5 ENSMUST00000200392.5 |
Fxr1
|
fragile X mental retardation gene 1, autosomal homolog |
| chr9_-_110571645 | 5.85 |
ENSMUST00000006005.12
|
Pth1r
|
parathyroid hormone 1 receptor |
| chr1_-_155120190 | 5.82 |
ENSMUST00000186156.7
|
BC034090
|
cDNA sequence BC034090 |
| chr8_-_105350881 | 5.80 |
ENSMUST00000211903.2
|
Cdh16
|
cadherin 16 |
| chr2_+_172994841 | 5.69 |
ENSMUST00000029017.6
|
Pck1
|
phosphoenolpyruvate carboxykinase 1, cytosolic |
| chr2_+_74528071 | 5.58 |
ENSMUST00000059272.10
|
Hoxd9
|
homeobox D9 |
| chr14_+_34097474 | 5.57 |
ENSMUST00000227130.2
|
Mmrn2
|
multimerin 2 |
| chr9_+_51959534 | 5.56 |
ENSMUST00000061352.11
|
Rdx
|
radixin |
| chr4_-_150093435 | 5.34 |
ENSMUST00000030830.4
|
H6pd
|
hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) |
| chr9_+_92424276 | 5.32 |
ENSMUST00000070522.14
ENSMUST00000160359.2 |
Plod2
|
procollagen lysine, 2-oxoglutarate 5-dioxygenase 2 |
| chr2_+_74535242 | 5.31 |
ENSMUST00000019749.4
|
Hoxd8
|
homeobox D8 |
| chr11_+_48728291 | 5.31 |
ENSMUST00000046903.6
|
Trim7
|
tripartite motif-containing 7 |
| chr1_-_75187417 | 5.30 |
ENSMUST00000113623.8
|
Glb1l
|
galactosidase, beta 1-like |
| chr7_-_81104423 | 5.17 |
ENSMUST00000178892.3
ENSMUST00000098331.10 |
Cpeb1
|
cytoplasmic polyadenylation element binding protein 1 |
| chr8_+_11362805 | 5.16 |
ENSMUST00000033899.14
|
Col4a2
|
collagen, type IV, alpha 2 |
| chr9_-_26717686 | 5.07 |
ENSMUST00000162702.8
ENSMUST00000040398.14 ENSMUST00000066560.13 |
Glb1l2
|
galactosidase, beta 1-like 2 |
| chr2_-_156921135 | 5.03 |
ENSMUST00000069098.7
|
Soga1
|
suppressor of glucose, autophagy associated 1 |
| chr14_+_73380163 | 4.92 |
ENSMUST00000170368.8
ENSMUST00000171767.8 ENSMUST00000163533.8 |
Rcbtb2
|
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
| chr8_-_105350533 | 4.89 |
ENSMUST00000212662.2
|
Cdh16
|
cadherin 16 |
| chr13_-_58421935 | 4.86 |
ENSMUST00000091579.6
|
Gkap1
|
G kinase anchoring protein 1 |
| chr1_-_10038030 | 4.86 |
ENSMUST00000185184.2
|
Tcf24
|
transcription factor 24 |
| chr1_-_75187441 | 4.85 |
ENSMUST00000185448.2
|
Glb1l
|
galactosidase, beta 1-like |
| chr5_-_122402451 | 4.75 |
ENSMUST00000111738.8
|
Tctn1
|
tectonic family member 1 |
| chr6_+_65755972 | 4.74 |
ENSMUST00000031976.14
ENSMUST00000081219.14 ENSMUST00000031973.13 ENSMUST00000172638.2 |
Prdm5
|
PR domain containing 5 |
| chr9_-_110572721 | 4.74 |
ENSMUST00000166716.8
|
Pth1r
|
parathyroid hormone 1 receptor |
| chr15_+_75468473 | 4.61 |
ENSMUST00000189944.7
ENSMUST00000023243.11 |
Gpihbp1
|
GPI-anchored HDL-binding protein 1 |
| chr14_+_34097422 | 4.57 |
ENSMUST00000111908.3
|
Mmrn2
|
multimerin 2 |
| chr2_-_102230602 | 4.49 |
ENSMUST00000152929.2
|
Trim44
|
tripartite motif-containing 44 |
| chr9_-_110576124 | 4.46 |
ENSMUST00000199862.5
ENSMUST00000198865.5 |
Pth1r
|
parathyroid hormone 1 receptor |
| chr2_-_69416365 | 4.39 |
ENSMUST00000100051.9
ENSMUST00000092551.5 ENSMUST00000080953.12 |
Lrp2
|
low density lipoprotein receptor-related protein 2 |
| chr6_+_29735666 | 4.37 |
ENSMUST00000001812.5
|
Smo
|
smoothened, frizzled class receptor |
| chr9_-_51874846 | 4.35 |
ENSMUST00000034552.8
ENSMUST00000214013.2 |
Fdx1
|
ferredoxin 1 |
| chr14_+_73380577 | 4.32 |
ENSMUST00000165567.8
ENSMUST00000022702.13 |
Rcbtb2
|
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
| chr1_-_9770434 | 4.26 |
ENSMUST00000088658.11
|
Mybl1
|
myeloblastosis oncogene-like 1 |
| chr6_+_145692439 | 4.24 |
ENSMUST00000111704.8
|
Rassf8
|
Ras association (RalGDS/AF-6) domain family (N-terminal) member 8 |
| chr12_+_112455882 | 4.24 |
ENSMUST00000057465.7
ENSMUST00000223266.2 |
A530016L24Rik
|
RIKEN cDNA A530016L24 gene |
| chr7_-_80338600 | 4.23 |
ENSMUST00000122255.8
|
Crtc3
|
CREB regulated transcription coactivator 3 |
| chr13_-_58421910 | 4.22 |
ENSMUST00000224505.2
|
Gkap1
|
G kinase anchoring protein 1 |
| chr8_-_105350816 | 4.19 |
ENSMUST00000212447.2
|
Cdh16
|
cadherin 16 |
| chr7_-_97066937 | 4.19 |
ENSMUST00000043077.8
|
Thrsp
|
thyroid hormone responsive |
| chr4_-_115504907 | 4.18 |
ENSMUST00000102707.10
|
Cyp4b1
|
cytochrome P450, family 4, subfamily b, polypeptide 1 |
| chr5_+_144705346 | 4.16 |
ENSMUST00000128550.8
|
Trrap
|
transformation/transcription domain-associated protein |
| chr7_+_86895851 | 4.16 |
ENSMUST00000032781.14
|
Nox4
|
NADPH oxidase 4 |
| chr1_-_155108455 | 4.14 |
ENSMUST00000035914.5
|
BC034090
|
cDNA sequence BC034090 |
| chr8_-_85696369 | 4.12 |
ENSMUST00000109736.9
ENSMUST00000140561.8 |
Rnaseh2a
|
ribonuclease H2, large subunit |
| chr14_+_30853010 | 4.11 |
ENSMUST00000227096.2
|
Nt5dc2
|
5'-nucleotidase domain containing 2 |
| chr14_+_73381003 | 4.10 |
ENSMUST00000110952.10
|
Rcbtb2
|
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
| chr16_+_36648728 | 4.07 |
ENSMUST00000114819.8
ENSMUST00000023535.4 |
Iqcb1
|
IQ calmodulin-binding motif containing 1 |
| chr14_+_73380539 | 3.94 |
ENSMUST00000169513.8
ENSMUST00000165727.8 |
Rcbtb2
|
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
| chr9_-_37525009 | 3.94 |
ENSMUST00000002013.11
|
Spa17
|
sperm autoantigenic protein 17 |
| chr14_+_73380485 | 3.92 |
ENSMUST00000170677.8
ENSMUST00000167401.8 |
Rcbtb2
|
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
| chr3_-_27764571 | 3.92 |
ENSMUST00000046157.10
|
Fndc3b
|
fibronectin type III domain containing 3B |
| chr5_-_23880939 | 3.92 |
ENSMUST00000196388.5
|
Srpk2
|
serine/arginine-rich protein specific kinase 2 |
| chr13_-_49401617 | 3.92 |
ENSMUST00000119721.2
ENSMUST00000058196.13 |
Susd3
|
sushi domain containing 3 |
| chr7_+_86895996 | 3.92 |
ENSMUST00000068829.13
|
Nox4
|
NADPH oxidase 4 |
| chr12_+_113061819 | 3.89 |
ENSMUST00000109727.9
ENSMUST00000009099.13 ENSMUST00000109723.8 ENSMUST00000109726.8 ENSMUST00000069690.5 |
Mta1
|
metastasis associated 1 |
| chr1_+_157286124 | 3.89 |
ENSMUST00000193791.6
ENSMUST00000046743.11 ENSMUST00000119891.7 |
Cryzl2
|
crystallin zeta like 2 |
| chr12_-_72132168 | 3.86 |
ENSMUST00000019862.3
|
L3hypdh
|
L-3-hydroxyproline dehydratase (trans-) |
| chr9_+_51959415 | 3.85 |
ENSMUST00000000590.16
ENSMUST00000238858.2 |
Rdx
|
radixin |
| chr15_-_100497863 | 3.85 |
ENSMUST00000073837.13
|
Pou6f1
|
POU domain, class 6, transcription factor 1 |
| chr8_-_105350842 | 3.79 |
ENSMUST00000212324.2
|
Cdh16
|
cadherin 16 |
| chr4_+_137196080 | 3.79 |
ENSMUST00000030547.15
ENSMUST00000171332.2 |
Hspg2
|
perlecan (heparan sulfate proteoglycan 2) |
| chr3_+_66892979 | 3.78 |
ENSMUST00000162362.8
ENSMUST00000065074.14 ENSMUST00000065047.13 |
Rsrc1
|
arginine/serine-rich coiled-coil 1 |
| chr9_-_58220469 | 3.76 |
ENSMUST00000061799.10
|
Loxl1
|
lysyl oxidase-like 1 |
| chr18_+_36414122 | 3.75 |
ENSMUST00000051301.6
|
Pura
|
purine rich element binding protein A |
| chr19_+_4905158 | 3.72 |
ENSMUST00000119694.3
ENSMUST00000237504.2 ENSMUST00000237011.2 |
Ctsf
|
cathepsin F |
| chr8_-_85696040 | 3.72 |
ENSMUST00000214133.2
ENSMUST00000147812.8 |
Gm49661
Rnaseh2a
|
predicted gene, 49661 ribonuclease H2, large subunit |
| chr2_-_181313415 | 3.71 |
ENSMUST00000054491.6
|
Sox18
|
SRY (sex determining region Y)-box 18 |
| chr7_-_127307791 | 3.70 |
ENSMUST00000205977.2
|
Bcl7c
|
B cell CLL/lymphoma 7C |
| chr7_-_143013899 | 3.69 |
ENSMUST00000208137.2
ENSMUST00000207910.2 |
Cdkn1c
|
cyclin-dependent kinase inhibitor 1C (P57) |
| chr8_+_12807001 | 3.68 |
ENSMUST00000033818.10
ENSMUST00000091237.12 |
Atp11a
|
ATPase, class VI, type 11A |
| chr1_-_192718064 | 3.67 |
ENSMUST00000215093.2
ENSMUST00000195354.6 |
Syt14
|
synaptotagmin XIV |
| chr1_-_63153414 | 3.67 |
ENSMUST00000153992.2
ENSMUST00000165066.8 ENSMUST00000172416.8 ENSMUST00000137511.8 |
Ino80d
|
INO80 complex subunit D |
| chr2_-_102231208 | 3.66 |
ENSMUST00000102573.8
|
Trim44
|
tripartite motif-containing 44 |
| chr13_+_56850795 | 3.62 |
ENSMUST00000069557.14
ENSMUST00000109876.8 |
Smad5
|
SMAD family member 5 |
| chr2_+_160573604 | 3.62 |
ENSMUST00000174885.2
ENSMUST00000109462.8 |
Plcg1
|
phospholipase C, gamma 1 |
| chr13_-_17869314 | 3.56 |
ENSMUST00000221598.2
ENSMUST00000068545.6 ENSMUST00000220514.2 |
Sugct
|
succinyl-CoA glutarate-CoA transferase |
| chr15_-_97806142 | 3.55 |
ENSMUST00000023119.15
|
Vdr
|
vitamin D (1,25-dihydroxyvitamin D3) receptor |
| chr3_-_27764522 | 3.52 |
ENSMUST00000195008.6
|
Fndc3b
|
fibronectin type III domain containing 3B |
| chr8_+_84728123 | 3.48 |
ENSMUST00000060357.15
ENSMUST00000239176.2 |
1700067K01Rik
|
RIKEN cDNA 1700067K01 gene |
| chr11_-_70590923 | 3.46 |
ENSMUST00000108543.4
ENSMUST00000108542.8 ENSMUST00000108541.9 ENSMUST00000126114.9 ENSMUST00000073625.8 |
Inca1
|
inhibitor of CDK, cyclin A1 interacting protein 1 |
| chr4_+_126042250 | 3.44 |
ENSMUST00000106150.3
|
Eva1b
|
eva-1 homolog B (C. elegans) |
| chr8_-_14024715 | 3.43 |
ENSMUST00000062613.12
|
Tdrp
|
testis development related protein |
| chr2_+_74557418 | 3.43 |
ENSMUST00000111980.4
|
Hoxd4
|
homeobox D4 |
| chr3_-_57483330 | 3.43 |
ENSMUST00000120977.2
|
Wwtr1
|
WW domain containing transcription regulator 1 |
| chr2_-_65068960 | 3.43 |
ENSMUST00000112429.9
ENSMUST00000102726.8 ENSMUST00000112430.8 |
Cobll1
|
Cobl-like 1 |
| chr9_-_37524866 | 3.41 |
ENSMUST00000214786.2
|
Spa17
|
sperm autoantigenic protein 17 |
| chr2_+_32041083 | 3.39 |
ENSMUST00000036691.14
ENSMUST00000069817.15 |
Prrc2b
|
proline-rich coiled-coil 2B |
| chr2_-_25465236 | 3.39 |
ENSMUST00000039156.7
|
Phpt1
|
phosphohistidine phosphatase 1 |
| chr19_-_10079091 | 3.38 |
ENSMUST00000025567.9
|
Fads2
|
fatty acid desaturase 2 |
| chr6_-_128332789 | 3.37 |
ENSMUST00000001562.9
|
Tulp3
|
tubby-like protein 3 |
| chr7_-_44753168 | 3.35 |
ENSMUST00000211085.2
ENSMUST00000210642.2 ENSMUST00000003512.9 |
Fcgrt
|
Fc fragment of IgG receptor and transporter |
| chr4_-_118347249 | 3.35 |
ENSMUST00000047421.6
|
Tie1
|
tyrosine kinase with immunoglobulin-like and EGF-like domains 1 |
| chrX_-_72974357 | 3.34 |
ENSMUST00000155597.2
ENSMUST00000114379.8 |
Renbp
|
renin binding protein |
| chr9_+_72569755 | 3.33 |
ENSMUST00000184450.8
ENSMUST00000183375.8 |
Nedd4
|
neural precursor cell expressed, developmentally down-regulated 4 |
| chr16_+_4412546 | 3.33 |
ENSMUST00000014447.13
|
Glis2
|
GLIS family zinc finger 2 |
| chr13_+_119565424 | 3.30 |
ENSMUST00000026520.14
|
Paip1
|
polyadenylate binding protein-interacting protein 1 |
| chr1_-_72323407 | 3.30 |
ENSMUST00000097698.5
|
Pecr
|
peroxisomal trans-2-enoyl-CoA reductase |
| chr18_+_50184769 | 3.29 |
ENSMUST00000134348.8
ENSMUST00000153873.3 |
Tnfaip8
|
tumor necrosis factor, alpha-induced protein 8 |
| chr2_+_18069375 | 3.29 |
ENSMUST00000114671.8
ENSMUST00000114680.9 |
Mllt10
|
myeloid/lymphoid or mixed-lineage leukemia; translocated to, 10 |
| chr6_+_115751499 | 3.28 |
ENSMUST00000075995.7
|
Cand2
|
cullin-associated and neddylation-dissociated 2 (putative) |
| chr1_+_156138286 | 3.27 |
ENSMUST00000027896.10
|
Nphs2
|
nephrosis 2, podocin |
| chr7_-_101519973 | 3.27 |
ENSMUST00000126204.8
ENSMUST00000155311.2 ENSMUST00000106983.8 ENSMUST00000123630.8 |
Folr1
|
folate receptor 1 (adult) |
| chr15_+_35296237 | 3.26 |
ENSMUST00000022952.6
|
Osr2
|
odd-skipped related 2 |
| chr11_-_61268879 | 3.25 |
ENSMUST00000010267.10
|
Slc47a1
|
solute carrier family 47, member 1 |
| chr8_-_116434517 | 3.25 |
ENSMUST00000109104.2
|
Maf
|
avian musculoaponeurotic fibrosarcoma oncogene homolog |
| chr13_-_74210360 | 3.24 |
ENSMUST00000222609.2
ENSMUST00000036456.8 |
Cep72
|
centrosomal protein 72 |
| chr11_+_49684984 | 3.22 |
ENSMUST00000020629.5
|
Gfpt2
|
glutamine fructose-6-phosphate transaminase 2 |
| chr19_-_34504871 | 3.22 |
ENSMUST00000178114.2
ENSMUST00000049572.15 |
Lipa
|
lysosomal acid lipase A |
| chr2_+_104961228 | 3.22 |
ENSMUST00000111098.8
ENSMUST00000111099.2 |
Wt1
|
Wilms tumor 1 homolog |
| chr15_-_73517514 | 3.21 |
ENSMUST00000130765.2
|
Slc45a4
|
solute carrier family 45, member 4 |
| chr1_-_4566619 | 3.21 |
ENSMUST00000192913.2
ENSMUST00000027035.10 |
Sox17
|
SRY (sex determining region Y)-box 17 |
| chr2_+_160573178 | 3.20 |
ENSMUST00000103115.8
|
Plcg1
|
phospholipase C, gamma 1 |
| chr5_-_34326753 | 3.20 |
ENSMUST00000202409.2
ENSMUST00000202638.4 ENSMUST00000042954.11 ENSMUST00000202541.2 |
Poln
Haus3
|
DNA polymerase N HAUS augmin-like complex, subunit 3 |
| chr2_-_91025492 | 3.19 |
ENSMUST00000111354.2
|
Nr1h3
|
nuclear receptor subfamily 1, group H, member 3 |
| chr7_+_142606476 | 3.18 |
ENSMUST00000037941.10
|
Cd81
|
CD81 antigen |
| chr2_-_60711706 | 3.18 |
ENSMUST00000164147.8
ENSMUST00000112509.2 |
Rbms1
|
RNA binding motif, single stranded interacting protein 1 |
| chr15_+_99499252 | 3.16 |
ENSMUST00000230075.2
ENSMUST00000023754.6 |
Aqp6
|
aquaporin 6 |
| chr3_-_129854477 | 3.14 |
ENSMUST00000001079.15
|
Sec24b
|
Sec24 related gene family, member B (S. cerevisiae) |
| chr7_-_110213968 | 3.13 |
ENSMUST00000166020.8
ENSMUST00000171218.8 ENSMUST00000033058.14 ENSMUST00000164759.8 |
Sbf2
|
SET binding factor 2 |
| chr2_-_6217844 | 3.12 |
ENSMUST00000042658.5
|
Echdc3
|
enoyl Coenzyme A hydratase domain containing 3 |
| chr2_+_158508609 | 3.10 |
ENSMUST00000103116.10
|
Ppp1r16b
|
protein phosphatase 1, regulatory subunit 16B |
| chr11_+_98277276 | 3.09 |
ENSMUST00000041301.8
|
Pnmt
|
phenylethanolamine-N-methyltransferase |
| chr3_+_34074048 | 3.06 |
ENSMUST00000001620.13
|
Fxr1
|
fragile X mental retardation gene 1, autosomal homolog |
| chr6_-_31540913 | 3.06 |
ENSMUST00000026698.8
|
Podxl
|
podocalyxin-like |
| chr14_+_32578713 | 3.04 |
ENSMUST00000053175.13
|
Vstm4
|
V-set and transmembrane domain containing 4 |
| chr11_+_3152683 | 3.03 |
ENSMUST00000125637.8
|
Eif4enif1
|
eukaryotic translation initiation factor 4E nuclear import factor 1 |
| chr2_+_104956850 | 3.03 |
ENSMUST00000143043.8
|
Wt1
|
Wilms tumor 1 homolog |
| chrX_+_95139639 | 3.03 |
ENSMUST00000117399.2
|
Msn
|
moesin |
| chr9_-_108443916 | 3.03 |
ENSMUST00000194381.2
|
Ndufaf3
|
NADH:ubiquinone oxidoreductase complex assembly factor 3 |
| chr15_-_97729341 | 3.03 |
ENSMUST00000079838.14
ENSMUST00000118294.8 |
Hdac7
|
histone deacetylase 7 |
| chr9_-_71678814 | 3.03 |
ENSMUST00000122065.2
ENSMUST00000121322.8 ENSMUST00000072899.9 |
Cgnl1
|
cingulin-like 1 |
| chr6_-_142453531 | 3.01 |
ENSMUST00000134191.3
ENSMUST00000239397.2 ENSMUST00000239395.2 ENSMUST00000032373.12 |
Ldhb
|
lactate dehydrogenase B |
| chr19_-_33369655 | 3.01 |
ENSMUST00000163093.2
|
Rnls
|
renalase, FAD-dependent amine oxidase |
| chr6_+_89620956 | 3.00 |
ENSMUST00000000828.14
ENSMUST00000101171.3 |
Txnrd3
|
thioredoxin reductase 3 |
| chr10_-_59057570 | 2.99 |
ENSMUST00000220156.2
ENSMUST00000165971.3 |
Septin10
|
septin 10 |
| chr17_-_45906428 | 2.99 |
ENSMUST00000171081.8
ENSMUST00000172301.8 ENSMUST00000167332.8 ENSMUST00000170488.8 ENSMUST00000167195.8 ENSMUST00000064889.13 ENSMUST00000051574.13 ENSMUST00000164217.8 |
Slc29a1
|
solute carrier family 29 (nucleoside transporters), member 1 |
| chr9_-_8134295 | 2.98 |
ENSMUST00000037397.8
|
Cep126
|
centrosomal protein 126 |
| chr8_+_26298502 | 2.98 |
ENSMUST00000033979.6
|
Star
|
steroidogenic acute regulatory protein |
| chr3_-_57483175 | 2.98 |
ENSMUST00000029380.14
|
Wwtr1
|
WW domain containing transcription regulator 1 |
| chr19_+_8568618 | 2.98 |
ENSMUST00000170817.2
ENSMUST00000010251.11 |
Slc22a8
|
solute carrier family 22 (organic anion transporter), member 8 |
| chr19_+_4036562 | 2.96 |
ENSMUST00000236224.2
ENSMUST00000236510.2 ENSMUST00000237910.2 ENSMUST00000235612.2 ENSMUST00000054030.8 |
Acy3
|
aspartoacylase (aminoacylase) 3 |
| chr11_+_82802079 | 2.96 |
ENSMUST00000018989.14
ENSMUST00000164945.3 |
Unc45b
|
unc-45 myosin chaperone B |
| chr19_+_4264292 | 2.95 |
ENSMUST00000046506.7
|
Clcf1
|
cardiotrophin-like cytokine factor 1 |
| chr7_+_45276906 | 2.95 |
ENSMUST00000057927.10
|
Rasip1
|
Ras interacting protein 1 |
| chr6_+_149210941 | 2.94 |
ENSMUST00000190785.7
ENSMUST00000189932.7 ENSMUST00000100765.11 |
Resf1
|
retroelement silencing factor 1 |
| chr6_+_91661074 | 2.94 |
ENSMUST00000205480.2
ENSMUST00000206545.2 |
Slc6a6
|
solute carrier family 6 (neurotransmitter transporter, taurine), member 6 |
| chr17_+_12803019 | 2.93 |
ENSMUST00000046959.9
ENSMUST00000233066.2 |
Slc22a2
|
solute carrier family 22 (organic cation transporter), member 2 |
| chr13_-_73826124 | 2.93 |
ENSMUST00000022105.15
ENSMUST00000109680.10 ENSMUST00000221026.2 ENSMUST00000109679.4 |
Slc6a18
|
solute carrier family 6 (neurotransmitter transporter), member 18 |
| chr2_-_130539382 | 2.93 |
ENSMUST00000127397.3
ENSMUST00000099362.11 |
Slc4a11
|
solute carrier family 4, sodium bicarbonate transporter-like, member 11 |
| chr16_+_37688744 | 2.93 |
ENSMUST00000078717.7
|
Lrrc58
|
leucine rich repeat containing 58 |
| chr19_-_59931432 | 2.92 |
ENSMUST00000170819.2
|
Rab11fip2
|
RAB11 family interacting protein 2 (class I) |
| chr4_+_43631935 | 2.92 |
ENSMUST00000030191.15
|
Npr2
|
natriuretic peptide receptor 2 |
| chr14_+_19801333 | 2.92 |
ENSMUST00000022340.5
|
Nid2
|
nidogen 2 |
| chr1_+_43769750 | 2.92 |
ENSMUST00000027217.9
|
Ecrg4
|
ECRG4 augurin precursor |
| chr6_+_91661034 | 2.91 |
ENSMUST00000032185.9
|
Slc6a6
|
solute carrier family 6 (neurotransmitter transporter, taurine), member 6 |
| chr4_+_155553571 | 2.91 |
ENSMUST00000178188.8
ENSMUST00000178238.8 ENSMUST00000023920.3 |
Tmem52
|
transmembrane protein 52 |
| chr9_-_110576192 | 2.90 |
ENSMUST00000199791.2
|
Pth1r
|
parathyroid hormone 1 receptor |
| chr6_+_4601124 | 2.90 |
ENSMUST00000141359.2
|
Casd1
|
CAS1 domain containing 1 |
| chr15_-_10713621 | 2.90 |
ENSMUST00000090339.11
|
Rai14
|
retinoic acid induced 14 |
| chr2_-_181234526 | 2.90 |
ENSMUST00000108789.9
ENSMUST00000153998.2 |
Zfp512b
|
zinc finger protein 512B |
| chr14_-_57902411 | 2.89 |
ENSMUST00000089482.12
|
Xpo4
|
exportin 4 |
| chr3_+_51324022 | 2.89 |
ENSMUST00000192419.6
|
Naa15
|
N(alpha)-acetyltransferase 15, NatA auxiliary subunit |
| chr3_-_69506293 | 2.89 |
ENSMUST00000061826.3
|
B3galnt1
|
UDP-GalNAc:betaGlcNAc beta 1,3-galactosaminyltransferase, polypeptide 1 |
| chr10_-_78187887 | 2.88 |
ENSMUST00000105388.8
|
Agpat3
|
1-acylglycerol-3-phosphate O-acyltransferase 3 |
| chr10_-_78131228 | 2.87 |
ENSMUST00000105387.8
|
Agpat3
|
1-acylglycerol-3-phosphate O-acyltransferase 3 |
| chr19_-_46561532 | 2.85 |
ENSMUST00000026009.10
ENSMUST00000236255.2 |
Arl3
|
ADP-ribosylation factor-like 3 |
| chr11_+_6339442 | 2.84 |
ENSMUST00000109786.8
|
Zmiz2
|
zinc finger, MIZ-type containing 2 |
| chr2_-_65068917 | 2.84 |
ENSMUST00000090896.10
ENSMUST00000155082.2 |
Cobll1
|
Cobl-like 1 |
| chr6_+_55180366 | 2.84 |
ENSMUST00000204842.3
ENSMUST00000053094.8 |
Mindy4
|
MINDY lysine 48 deubiquitinase 4 |
| chr2_+_104957541 | 2.84 |
ENSMUST00000139585.8
|
Wt1
|
Wilms tumor 1 homolog |
| chr9_-_43027809 | 2.82 |
ENSMUST00000216126.2
ENSMUST00000213544.2 ENSMUST00000061833.6 |
Tlcd5
|
TLC domain containing 5 |
| chr7_+_80707328 | 2.80 |
ENSMUST00000107348.2
|
Alpk3
|
alpha-kinase 3 |
| chr2_+_173952123 | 2.80 |
ENSMUST00000044415.16
|
Npepl1
|
aminopeptidase-like 1 |
| chr2_+_26471062 | 2.80 |
ENSMUST00000238951.2
ENSMUST00000166920.10 |
Egfl7
|
EGF-like domain 7 |
| chr1_-_33853476 | 2.79 |
ENSMUST00000194656.6
|
Zfp451
|
zinc finger protein 451 |
| chr3_+_66893031 | 2.79 |
ENSMUST00000046542.13
ENSMUST00000162693.8 |
Rsrc1
|
arginine/serine-rich coiled-coil 1 |
| chr5_+_137639538 | 2.78 |
ENSMUST00000177466.8
ENSMUST00000166099.3 |
Sap25
|
sin3 associated polypeptide |
| chr8_-_94739469 | 2.78 |
ENSMUST00000053766.14
|
Amfr
|
autocrine motility factor receptor |
| chr13_+_119565669 | 2.77 |
ENSMUST00000173627.8
ENSMUST00000126957.9 ENSMUST00000174691.8 |
Paip1
|
polyadenylate binding protein-interacting protein 1 |
| chr2_-_91025441 | 2.76 |
ENSMUST00000002177.9
|
Nr1h3
|
nuclear receptor subfamily 1, group H, member 3 |
| chr10_-_88339773 | 2.76 |
ENSMUST00000117579.8
ENSMUST00000073783.6 |
Chpt1
|
choline phosphotransferase 1 |
| chr1_-_4566553 | 2.75 |
ENSMUST00000191647.2
ENSMUST00000116652.8 |
Sox17
|
SRY (sex determining region Y)-box 17 |
| chr1_-_74163575 | 2.75 |
ENSMUST00000169786.8
ENSMUST00000212888.2 ENSMUST00000191104.7 |
Tns1
|
tensin 1 |
| chr2_-_65069065 | 2.75 |
ENSMUST00000112431.8
|
Cobll1
|
Cobl-like 1 |
| chr15_+_101191077 | 2.75 |
ENSMUST00000071328.7
|
Smim41
|
small integral membrane protein 41 |
| chr2_-_104324035 | 2.75 |
ENSMUST00000111124.8
|
Hipk3
|
homeodomain interacting protein kinase 3 |
| chr13_-_67080968 | 2.74 |
ENSMUST00000172597.8
ENSMUST00000173773.2 |
Mterf3
|
mitochondrial transcription termination factor 3 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.3 | 21.6 | GO:1905161 | protein localization to phagocytic vesicle(GO:1905161) regulation of protein localization to phagocytic vesicle(GO:1905169) positive regulation of protein localization to phagocytic vesicle(GO:1905171) |
| 3.0 | 9.1 | GO:2001074 | negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
| 2.4 | 9.5 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
| 2.3 | 7.0 | GO:0090320 | regulation of chylomicron remnant clearance(GO:0090320) |
| 2.2 | 13.0 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 2.1 | 8.4 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
| 2.0 | 2.0 | GO:1905072 | cardiac jelly development(GO:1905072) |
| 2.0 | 5.9 | GO:0001762 | beta-alanine transport(GO:0001762) taurine transport(GO:0015734) |
| 1.9 | 7.8 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 1.9 | 9.7 | GO:0048866 | stem cell fate specification(GO:0048866) |
| 1.8 | 5.3 | GO:0033306 | phytol metabolic process(GO:0033306) fatty alcohol metabolic process(GO:1903173) |
| 1.7 | 1.7 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 1.7 | 5.0 | GO:0009095 | tyrosine biosynthetic process(GO:0006571) aromatic amino acid family biosynthetic process(GO:0009073) aromatic amino acid family biosynthetic process, prephenate pathway(GO:0009095) |
| 1.7 | 8.3 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
| 1.6 | 1.6 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
| 1.6 | 8.0 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 1.5 | 4.6 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 1.5 | 4.5 | GO:2000612 | regulation of thyroid-stimulating hormone secretion(GO:2000612) |
| 1.4 | 10.1 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 1.4 | 11.4 | GO:1902966 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 1.4 | 4.3 | GO:0072138 | mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
| 1.4 | 4.2 | GO:1900062 | regulation of replicative cell aging(GO:1900062) |
| 1.4 | 8.4 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 1.4 | 7.0 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 1.4 | 4.2 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 1.4 | 4.1 | GO:0051878 | lateral element assembly(GO:0051878) |
| 1.3 | 7.9 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 1.3 | 1.3 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 1.2 | 9.9 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
| 1.2 | 6.0 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 1.2 | 11.6 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 1.2 | 3.5 | GO:0014805 | smooth muscle adaptation(GO:0014805) |
| 1.2 | 10.4 | GO:0003147 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) cellular response to folic acid(GO:0071231) |
| 1.1 | 18.1 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 1.1 | 4.5 | GO:0060434 | bronchus morphogenesis(GO:0060434) |
| 1.1 | 3.4 | GO:0072262 | metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
| 1.1 | 6.6 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 1.1 | 3.3 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 1.1 | 5.5 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 1.1 | 3.2 | GO:0031554 | regulation of DNA-templated transcription, termination(GO:0031554) |
| 1.0 | 3.1 | GO:0035037 | sperm entry(GO:0035037) |
| 1.0 | 3.1 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
| 1.0 | 5.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 1.0 | 2.0 | GO:1990051 | activation of protein kinase C activity(GO:1990051) |
| 1.0 | 6.0 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 1.0 | 1.0 | GO:0071047 | nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 1.0 | 7.9 | GO:0072307 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 1.0 | 3.0 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
| 1.0 | 3.0 | GO:0015882 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 1.0 | 5.7 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 1.0 | 3.8 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 0.9 | 3.8 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
| 0.9 | 4.7 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.9 | 2.8 | GO:0006562 | proline catabolic process(GO:0006562) D-serine catabolic process(GO:0036088) D-alanine family amino acid metabolic process(GO:0046144) D-alanine metabolic process(GO:0046436) D-alanine catabolic process(GO:0055130) |
| 0.9 | 1.8 | GO:0060849 | regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 0.9 | 6.4 | GO:0003072 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
| 0.9 | 3.7 | GO:2000984 | regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.9 | 2.7 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.9 | 4.5 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.9 | 2.7 | GO:1900247 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.9 | 3.5 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 0.9 | 6.2 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.9 | 12.4 | GO:0046449 | creatinine metabolic process(GO:0046449) |
| 0.9 | 4.4 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.9 | 3.5 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.9 | 7.0 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.9 | 3.5 | GO:0010889 | regulation of sequestering of triglyceride(GO:0010889) negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.9 | 18.2 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.9 | 2.6 | GO:2001034 | positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
| 0.8 | 5.1 | GO:0036482 | neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
| 0.8 | 3.4 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.8 | 3.4 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.8 | 4.2 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
| 0.8 | 0.8 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.8 | 2.4 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
| 0.8 | 3.2 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
| 0.8 | 4.8 | GO:0034184 | positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.8 | 5.6 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.8 | 3.1 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.8 | 2.3 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.8 | 3.1 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.8 | 2.3 | GO:0019427 | acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate biosynthetic process(GO:0019542) |
| 0.8 | 1.5 | GO:0006740 | NADPH regeneration(GO:0006740) |
| 0.8 | 3.8 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.8 | 5.3 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.8 | 1.5 | GO:0061198 | fungiform papilla formation(GO:0061198) |
| 0.8 | 2.3 | GO:0018003 | peptidyl-lysine N6-acetylation(GO:0018003) |
| 0.8 | 0.8 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.8 | 0.8 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 0.7 | 3.0 | GO:0000239 | pachytene(GO:0000239) |
| 0.7 | 6.7 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
| 0.7 | 2.2 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.7 | 5.1 | GO:0015862 | uridine transport(GO:0015862) |
| 0.7 | 2.9 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.7 | 1.5 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
| 0.7 | 2.9 | GO:0001743 | optic placode formation(GO:0001743) |
| 0.7 | 2.9 | GO:2000668 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
| 0.7 | 2.2 | GO:2000536 | negative regulation of entry of bacterium into host cell(GO:2000536) |
| 0.7 | 1.4 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.7 | 0.7 | GO:0010752 | regulation of cGMP-mediated signaling(GO:0010752) |
| 0.7 | 2.1 | GO:1905223 | epicardium morphogenesis(GO:1905223) |
| 0.7 | 2.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.7 | 2.8 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.7 | 2.8 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.7 | 2.8 | GO:0044849 | estrous cycle(GO:0044849) |
| 0.7 | 2.8 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.7 | 4.2 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.7 | 4.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.7 | 3.4 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.7 | 5.5 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.7 | 3.4 | GO:1903445 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.7 | 2.0 | GO:0002343 | peripheral B cell selection(GO:0002343) B cell affinity maturation(GO:0002344) |
| 0.7 | 2.7 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.7 | 6.0 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.7 | 2.0 | GO:1904826 | regulation of hydrogen sulfide biosynthetic process(GO:1904826) positive regulation of hydrogen sulfide biosynthetic process(GO:1904828) |
| 0.7 | 7.9 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.7 | 0.7 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.7 | 2.6 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.7 | 2.6 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
| 0.7 | 2.0 | GO:0002270 | plasmacytoid dendritic cell activation(GO:0002270) |
| 0.7 | 1.3 | GO:0046655 | folic acid metabolic process(GO:0046655) |
| 0.7 | 2.0 | GO:0010816 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.7 | 2.0 | GO:0001180 | transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
| 0.6 | 2.6 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.6 | 3.2 | GO:0060857 | establishment of glial blood-brain barrier(GO:0060857) |
| 0.6 | 1.9 | GO:1904049 | negative regulation of spontaneous neurotransmitter secretion(GO:1904049) |
| 0.6 | 0.6 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.6 | 2.5 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
| 0.6 | 3.2 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.6 | 1.9 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.6 | 3.1 | GO:0061439 | renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.6 | 4.4 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.6 | 0.6 | GO:1904173 | regulation of histone demethylase activity (H3-K4 specific)(GO:1904173) |
| 0.6 | 6.9 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.6 | 0.6 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.6 | 1.2 | GO:0035799 | ureter maturation(GO:0035799) |
| 0.6 | 1.8 | GO:0070845 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.6 | 1.2 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
| 0.6 | 2.5 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.6 | 1.2 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
| 0.6 | 0.6 | GO:0072162 | metanephric mesenchymal cell differentiation(GO:0072162) |
| 0.6 | 1.2 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
| 0.6 | 0.6 | GO:1902462 | mesenchymal stem cell proliferation(GO:0097168) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.6 | 1.2 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.6 | 1.2 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.6 | 7.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.6 | 3.0 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.6 | 2.4 | GO:0032298 | positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.6 | 3.5 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.6 | 2.3 | GO:0030421 | defecation(GO:0030421) |
| 0.6 | 3.5 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.6 | 2.3 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.6 | 1.7 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.6 | 1.7 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.6 | 1.7 | GO:0044415 | evasion or tolerance of host defenses by virus(GO:0019049) avoidance of host defenses(GO:0044413) evasion or tolerance of host defenses(GO:0044415) avoidance of defenses of other organism involved in symbiotic interaction(GO:0051832) evasion or tolerance of defenses of other organism involved in symbiotic interaction(GO:0051834) |
| 0.6 | 5.8 | GO:1902949 | positive regulation of tau-protein kinase activity(GO:1902949) |
| 0.6 | 21.2 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.6 | 2.3 | GO:1902269 | positive regulation of polyamine transmembrane transport(GO:1902269) |
| 0.6 | 1.1 | GO:0034226 | lysine import(GO:0034226) L-lysine import(GO:0061461) L-lysine import into cell(GO:1903410) |
| 0.6 | 1.7 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.6 | 2.8 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.6 | 4.0 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
| 0.6 | 4.0 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.6 | 2.8 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.6 | 1.7 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.6 | 1.7 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
| 0.6 | 2.8 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) |
| 0.6 | 2.2 | GO:2000065 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 0.6 | 1.1 | GO:0010899 | regulation of phosphatidylcholine catabolic process(GO:0010899) |
| 0.6 | 2.2 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.6 | 0.6 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.5 | 1.6 | GO:1990166 | protein localization to site of double-strand break(GO:1990166) |
| 0.5 | 3.8 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.5 | 6.5 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.5 | 1.6 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.5 | 2.2 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.5 | 10.2 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
| 0.5 | 2.7 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.5 | 0.5 | GO:0042662 | negative regulation of mesodermal cell fate specification(GO:0042662) |
| 0.5 | 5.9 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.5 | 2.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.5 | 0.5 | GO:0046439 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine catabolic process to taurine(GO:0019452) L-cysteine metabolic process(GO:0046439) |
| 0.5 | 12.8 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.5 | 7.9 | GO:0006241 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
| 0.5 | 0.5 | GO:0000105 | histidine biosynthetic process(GO:0000105) |
| 0.5 | 15.3 | GO:0019363 | pyridine nucleotide biosynthetic process(GO:0019363) |
| 0.5 | 5.2 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.5 | 3.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.5 | 2.1 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.5 | 4.1 | GO:1903564 | regulation of protein localization to cilium(GO:1903564) |
| 0.5 | 1.6 | GO:1903699 | tarsal gland development(GO:1903699) |
| 0.5 | 2.6 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.5 | 0.5 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.5 | 8.8 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.5 | 1.5 | GO:1990535 | neuron projection maintenance(GO:1990535) |
| 0.5 | 3.0 | GO:0035552 | oxidative single-stranded DNA demethylation(GO:0035552) |
| 0.5 | 1.0 | GO:1990144 | intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.5 | 1.5 | GO:0003085 | negative regulation of systemic arterial blood pressure(GO:0003085) |
| 0.5 | 6.1 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.5 | 2.5 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.5 | 6.0 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.5 | 5.0 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.5 | 1.0 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.5 | 4.4 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.5 | 8.4 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
| 0.5 | 2.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.5 | 1.5 | GO:0070476 | rRNA (guanine-N7)-methylation(GO:0070476) |
| 0.5 | 1.5 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 0.5 | 1.0 | GO:2000793 | cell proliferation involved in heart valve development(GO:2000793) |
| 0.5 | 2.4 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.5 | 1.0 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.5 | 1.9 | GO:0090222 | centrosome-templated microtubule nucleation(GO:0090222) |
| 0.5 | 4.4 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.5 | 2.4 | GO:1905034 | regulation of antifungal innate immune response(GO:1905034) negative regulation of antifungal innate immune response(GO:1905035) |
| 0.5 | 3.4 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.5 | 1.9 | GO:2001107 | negative regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001107) |
| 0.5 | 4.3 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
| 0.5 | 1.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.5 | 0.5 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.5 | 1.0 | GO:1902946 | protein localization to early endosome(GO:1902946) |
| 0.5 | 3.3 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.5 | 2.4 | GO:1904352 | positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.5 | 4.7 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.5 | 5.6 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.5 | 1.4 | GO:0036275 | response to 5-fluorouracil(GO:0036275) |
| 0.5 | 4.2 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.5 | 1.9 | GO:1904884 | telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.5 | 0.5 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.5 | 0.9 | GO:0048865 | stem cell fate commitment(GO:0048865) |
| 0.5 | 0.5 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
| 0.5 | 1.4 | GO:0046032 | ADP catabolic process(GO:0046032) |
| 0.5 | 1.4 | GO:0090367 | negative regulation of mRNA modification(GO:0090367) |
| 0.5 | 1.8 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.5 | 2.7 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.5 | 3.2 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
| 0.5 | 5.9 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.5 | 2.7 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.5 | 3.2 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
| 0.5 | 1.8 | GO:1904451 | regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
| 0.5 | 2.3 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.4 | 6.3 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.4 | 2.7 | GO:0035026 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) leading edge cell differentiation(GO:0035026) |
| 0.4 | 1.3 | GO:0016132 | brassinosteroid metabolic process(GO:0016131) brassinosteroid biosynthetic process(GO:0016132) |
| 0.4 | 0.4 | GO:0072284 | metanephric S-shaped body morphogenesis(GO:0072284) |
| 0.4 | 2.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.4 | 1.3 | GO:0072752 | cellular response to rapamycin(GO:0072752) |
| 0.4 | 2.7 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.4 | 1.3 | GO:0021570 | rhombomere 4 development(GO:0021570) |
| 0.4 | 2.2 | GO:0015793 | glycerol transport(GO:0015793) renal water absorption(GO:0070295) |
| 0.4 | 0.4 | GO:2000277 | positive regulation of oxidative phosphorylation uncoupler activity(GO:2000277) |
| 0.4 | 2.2 | GO:0060356 | leucine import(GO:0060356) |
| 0.4 | 0.4 | GO:0060854 | patterning of lymph vessels(GO:0060854) |
| 0.4 | 6.6 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.4 | 1.3 | GO:0032240 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.4 | 1.3 | GO:1901420 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) negative regulation of response to alcohol(GO:1901420) |
| 0.4 | 2.2 | GO:0097491 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
| 0.4 | 1.3 | GO:0072244 | metanephric glomerular epithelium development(GO:0072244) metanephric glomerular visceral epithelial cell differentiation(GO:0072248) metanephric glomerular visceral epithelial cell development(GO:0072249) metanephric glomerular epithelial cell differentiation(GO:0072312) metanephric glomerular epithelial cell development(GO:0072313) |
| 0.4 | 1.7 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.4 | 3.0 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
| 0.4 | 1.3 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
| 0.4 | 4.3 | GO:0002568 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
| 0.4 | 0.4 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.4 | 1.7 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.4 | 3.0 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.4 | 2.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.4 | 2.1 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.4 | 1.3 | GO:1901053 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.4 | 3.0 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.4 | 5.5 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.4 | 1.7 | GO:0097298 | regulation of nucleus size(GO:0097298) |
| 0.4 | 3.4 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.4 | 1.7 | GO:0040030 | regulation of molecular function, epigenetic(GO:0040030) |
| 0.4 | 1.7 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.4 | 3.0 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.4 | 0.4 | GO:0035194 | posttranscriptional gene silencing by RNA(GO:0035194) |
| 0.4 | 4.6 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.4 | 2.5 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.4 | 1.2 | GO:0046487 | glyoxylate cycle(GO:0006097) glyoxylate metabolic process(GO:0046487) |
| 0.4 | 0.4 | GO:0033122 | negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.4 | 4.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.4 | 1.2 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.4 | 0.8 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.4 | 2.5 | GO:1903438 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.4 | 0.4 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.4 | 0.8 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
| 0.4 | 1.2 | GO:0018008 | N-terminal peptidyl-glycine N-myristoylation(GO:0018008) |
| 0.4 | 1.6 | GO:0030091 | protein repair(GO:0030091) |
| 0.4 | 9.4 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
| 0.4 | 3.3 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.4 | 6.5 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
| 0.4 | 4.4 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.4 | 2.4 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.4 | 0.4 | GO:0003278 | apoptotic process involved in outflow tract morphogenesis(GO:0003275) apoptotic process involved in heart morphogenesis(GO:0003278) regulation of apoptotic process involved in outflow tract morphogenesis(GO:1902256) |
| 0.4 | 2.0 | GO:1902163 | negative regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902163) |
| 0.4 | 2.0 | GO:0003349 | epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.4 | 0.8 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.4 | 4.8 | GO:0009301 | snRNA transcription(GO:0009301) |
| 0.4 | 1.2 | GO:1990918 | double-strand break repair involved in meiotic recombination(GO:1990918) |
| 0.4 | 2.0 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.4 | 0.8 | GO:0043921 | modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
| 0.4 | 3.5 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.4 | 3.1 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.4 | 0.8 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.4 | 2.0 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.4 | 1.6 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
| 0.4 | 2.7 | GO:0044359 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.4 | 1.9 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.4 | 1.2 | GO:1903778 | protein localization to vacuolar membrane(GO:1903778) |
| 0.4 | 1.6 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.4 | 0.4 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.4 | 0.8 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.4 | 3.4 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.4 | 4.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.4 | 0.4 | GO:1902567 | negative regulation of eosinophil activation(GO:1902567) |
| 0.4 | 2.3 | GO:0097473 | cellular response to light intensity(GO:0071484) cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
| 0.4 | 7.2 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.4 | 4.2 | GO:0000730 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.4 | 0.4 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.4 | 4.5 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.4 | 2.2 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.4 | 1.5 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.4 | 1.1 | GO:0060821 | inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.4 | 1.5 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
| 0.4 | 1.1 | GO:0090327 | negative regulation of locomotion involved in locomotory behavior(GO:0090327) |
| 0.4 | 7.0 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.4 | 3.3 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.4 | 6.9 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
| 0.4 | 6.9 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.4 | 1.8 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.4 | 2.2 | GO:1902915 | negative regulation of histone ubiquitination(GO:0033183) negative regulation of protein K63-linked ubiquitination(GO:1900045) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.4 | 1.4 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.4 | 5.8 | GO:0006085 | acetyl-CoA biosynthetic process(GO:0006085) |
| 0.4 | 2.5 | GO:0097503 | sialylation(GO:0097503) |
| 0.4 | 1.4 | GO:0014045 | establishment of endothelial blood-brain barrier(GO:0014045) |
| 0.4 | 4.0 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.4 | 7.5 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.4 | 1.1 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.4 | 1.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.4 | 1.4 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
| 0.4 | 1.1 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.4 | 4.3 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.4 | 1.1 | GO:0006507 | GPI anchor release(GO:0006507) protein depalmitoleylation(GO:1990697) |
| 0.4 | 1.1 | GO:0045660 | positive regulation of neutrophil differentiation(GO:0045660) |
| 0.4 | 3.5 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
| 0.4 | 2.5 | GO:0014874 | response to stimulus involved in regulation of muscle adaptation(GO:0014874) |
| 0.4 | 0.4 | GO:1900150 | regulation of defense response to fungus(GO:1900150) |
| 0.4 | 1.4 | GO:0043465 | regulation of fermentation(GO:0043465) negative regulation of fermentation(GO:1901003) |
| 0.3 | 2.4 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
| 0.3 | 2.4 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.3 | 0.7 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.3 | 1.0 | GO:2000911 | positive regulation of cholesterol import(GO:1904109) positive regulation of sterol import(GO:2000911) |
| 0.3 | 4.2 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.3 | 1.4 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.3 | 2.1 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.3 | 3.5 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
| 0.3 | 1.0 | GO:0019389 | glucuronoside metabolic process(GO:0019389) |
| 0.3 | 0.3 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.3 | 2.7 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.3 | 1.4 | GO:1902365 | regulation of spindle elongation(GO:0032887) regulation of mitotic spindle elongation(GO:0032888) anastral spindle assembly(GO:0055048) protein localization to spindle pole body(GO:0071988) regulation of protein localization to spindle pole body(GO:1902363) positive regulation of protein localization to spindle pole body(GO:1902365) positive regulation of mitotic spindle elongation(GO:1902846) |
| 0.3 | 3.7 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.3 | 0.7 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.3 | 1.0 | GO:0044376 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.3 | 1.4 | GO:0060065 | uterus development(GO:0060065) |
| 0.3 | 1.0 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.3 | 3.0 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.3 | 2.0 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.3 | 1.0 | GO:1904629 | negative regulation of interleukin-12 biosynthetic process(GO:0045083) response to diterpene(GO:1904629) cellular response to diterpene(GO:1904630) response to glucoside(GO:1904631) cellular response to glucoside(GO:1904632) |
| 0.3 | 0.7 | GO:1903487 | regulation of lactation(GO:1903487) |
| 0.3 | 2.7 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.3 | 1.0 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.3 | 1.7 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.3 | 2.3 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.3 | 0.3 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
| 0.3 | 1.7 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.3 | 2.0 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.3 | 0.7 | GO:0060139 | positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation of apoptotic process by virus(GO:0060139) |
| 0.3 | 1.7 | GO:0045588 | positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
| 0.3 | 4.6 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.3 | 1.6 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.3 | 0.7 | GO:2000371 | regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.3 | 2.3 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.3 | 8.9 | GO:0003416 | endochondral bone growth(GO:0003416) bone growth(GO:0098868) |
| 0.3 | 0.7 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
| 0.3 | 1.0 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
| 0.3 | 7.2 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.3 | 0.3 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.3 | 1.3 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.3 | 11.7 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.3 | 0.6 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
| 0.3 | 0.3 | GO:0031104 | dendrite regeneration(GO:0031104) |
| 0.3 | 0.3 | GO:0033121 | regulation of purine nucleotide catabolic process(GO:0033121) |
| 0.3 | 1.3 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.3 | 5.5 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.3 | 0.3 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.3 | 0.3 | GO:0018201 | peptidyl-glycine modification(GO:0018201) |
| 0.3 | 5.1 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.3 | 0.3 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.3 | 1.3 | GO:0060745 | mammary gland branching involved in pregnancy(GO:0060745) |
| 0.3 | 1.6 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.3 | 1.6 | GO:0032917 | polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.3 | 1.0 | GO:2001200 | positive regulation of dendritic cell differentiation(GO:2001200) |
| 0.3 | 1.6 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.3 | 2.2 | GO:1904100 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 0.3 | 0.9 | GO:0060768 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.3 | 7.2 | GO:0035455 | response to interferon-alpha(GO:0035455) |
| 0.3 | 0.9 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
| 0.3 | 1.6 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.3 | 0.9 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.3 | 0.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.3 | 1.2 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.3 | 3.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.3 | 3.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 0.3 | 2.5 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.3 | 0.9 | GO:0061090 | positive regulation of sequestering of zinc ion(GO:0061090) |
| 0.3 | 1.2 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.3 | 1.2 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.3 | 1.8 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.3 | 0.6 | GO:1903923 | protein processing in phagocytic vesicle(GO:1900756) regulation of protein processing in phagocytic vesicle(GO:1903921) positive regulation of protein processing in phagocytic vesicle(GO:1903923) |
| 0.3 | 2.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.3 | 1.2 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.3 | 0.3 | GO:1900365 | positive regulation of mRNA polyadenylation(GO:1900365) |
| 0.3 | 0.3 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K27-linked deubiquitination(GO:1990167) protein K33-linked deubiquitination(GO:1990168) |
| 0.3 | 2.1 | GO:0072615 | interleukin-17 secretion(GO:0072615) |
| 0.3 | 3.3 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.3 | 4.2 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.3 | 2.7 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.3 | 3.0 | GO:0098706 | ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.3 | 6.6 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.3 | 3.6 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.3 | 4.5 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.3 | 0.3 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.3 | 0.9 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.3 | 0.9 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
| 0.3 | 2.7 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.3 | 2.4 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.3 | 0.9 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 0.3 | 1.5 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.3 | 4.1 | GO:0015695 | organic cation transport(GO:0015695) |
| 0.3 | 1.2 | GO:0060709 | glycogen cell differentiation involved in embryonic placenta development(GO:0060709) |
| 0.3 | 0.9 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.3 | 2.6 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.3 | 1.2 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
| 0.3 | 0.3 | GO:0034088 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.3 | 1.2 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.3 | 1.7 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.3 | 2.0 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.3 | 0.9 | GO:0031590 | wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
| 0.3 | 0.6 | GO:0071211 | protein targeting to vacuole involved in autophagy(GO:0071211) |
| 0.3 | 0.3 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
| 0.3 | 1.4 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
| 0.3 | 1.4 | GO:0044268 | multicellular organismal protein metabolic process(GO:0044268) |
| 0.3 | 1.1 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 0.3 | 2.6 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.3 | 3.1 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.3 | 1.1 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.3 | 1.7 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.3 | 10.0 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.3 | 1.4 | GO:0060596 | mammary placode formation(GO:0060596) |
| 0.3 | 0.6 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.3 | 5.1 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.3 | 0.6 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
| 0.3 | 5.6 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.3 | 1.1 | GO:0046618 | drug export(GO:0046618) |
| 0.3 | 1.7 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.3 | 0.6 | GO:2000852 | regulation of corticosterone secretion(GO:2000852) |
| 0.3 | 1.1 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.3 | 1.9 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.3 | 1.4 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.3 | 0.3 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.3 | 1.9 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.3 | 0.6 | GO:0060722 | spongiotrophoblast cell proliferation(GO:0060720) cell proliferation involved in embryonic placenta development(GO:0060722) |
| 0.3 | 2.8 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.3 | 1.9 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.3 | 3.6 | GO:0006000 | fructose metabolic process(GO:0006000) |
| 0.3 | 1.1 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.3 | 1.6 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
| 0.3 | 1.4 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.3 | 0.8 | GO:0014739 | positive regulation of muscle hyperplasia(GO:0014739) |
| 0.3 | 0.5 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.3 | 1.6 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.3 | 1.1 | GO:0010286 | heat acclimation(GO:0010286) |
| 0.3 | 2.5 | GO:1902895 | positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
| 0.3 | 1.4 | GO:0042362 | fat-soluble vitamin biosynthetic process(GO:0042362) |
| 0.3 | 0.8 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.3 | 0.8 | GO:0098912 | membrane depolarization during atrial cardiac muscle cell action potential(GO:0098912) |
| 0.3 | 1.1 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.3 | 0.8 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.3 | 3.3 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.3 | 1.4 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.3 | 0.8 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.3 | 1.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.3 | 1.3 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.3 | 0.3 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 0.3 | 1.6 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.3 | 0.3 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
| 0.3 | 5.6 | GO:0010165 | response to X-ray(GO:0010165) |
| 0.3 | 4.0 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.3 | 0.5 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.3 | 0.8 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
| 0.3 | 0.5 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.3 | 3.7 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
| 0.3 | 2.4 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.3 | 3.2 | GO:0006833 | water transport(GO:0006833) |
| 0.3 | 0.5 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
| 0.3 | 0.3 | GO:0006404 | RNA import into nucleus(GO:0006404) |
| 0.3 | 0.5 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 0.3 | 0.5 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
| 0.3 | 0.3 | GO:0002514 | B cell tolerance induction(GO:0002514) regulation of B cell tolerance induction(GO:0002661) positive regulation of B cell tolerance induction(GO:0002663) lung ciliated cell differentiation(GO:0061141) |
| 0.3 | 1.3 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.3 | 0.5 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.3 | 3.1 | GO:0043129 | surfactant homeostasis(GO:0043129) |
| 0.3 | 2.1 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
| 0.3 | 0.8 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.3 | 2.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.3 | 4.4 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.3 | 0.5 | GO:1901536 | negative regulation of DNA demethylation(GO:1901536) |
| 0.3 | 1.0 | GO:0033371 | protein localization to secretory granule(GO:0033366) protein localization to mast cell secretory granule(GO:0033367) protease localization to mast cell secretory granule(GO:0033368) maintenance of protein location in mast cell secretory granule(GO:0033370) T cell secretory granule organization(GO:0033371) maintenance of protease location in mast cell secretory granule(GO:0033373) protein localization to T cell secretory granule(GO:0033374) protease localization to T cell secretory granule(GO:0033375) maintenance of protein location in T cell secretory granule(GO:0033377) maintenance of protease location in T cell secretory granule(GO:0033379) granzyme B localization to T cell secretory granule(GO:0033380) maintenance of granzyme B location in T cell secretory granule(GO:0033382) |
| 0.3 | 0.8 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.3 | 0.8 | GO:0021594 | rhombomere formation(GO:0021594) rhombomere 3 formation(GO:0021660) rhombomere 5 morphogenesis(GO:0021664) rhombomere 5 formation(GO:0021666) |
| 0.3 | 1.8 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.3 | 2.1 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.3 | 0.3 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.3 | 1.8 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
| 0.3 | 0.5 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
| 0.3 | 0.8 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.3 | 1.5 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.3 | 1.5 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.3 | 0.3 | GO:0032905 | transforming growth factor beta1 production(GO:0032905) regulation of transforming growth factor beta1 production(GO:0032908) negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.3 | 1.8 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.3 | 1.0 | GO:0060920 | cardiac pacemaker cell differentiation(GO:0060920) |
| 0.3 | 1.5 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.3 | 1.8 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.3 | 1.3 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.3 | 0.3 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.3 | 1.0 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.3 | 1.5 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.3 | 5.5 | GO:0098534 | centriole assembly(GO:0098534) |
| 0.3 | 1.3 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.2 | 2.0 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.2 | 1.7 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
| 0.2 | 1.2 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
| 0.2 | 2.7 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.2 | 1.5 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
| 0.2 | 0.2 | GO:2000328 | regulation of T-helper 17 cell lineage commitment(GO:2000328) |
| 0.2 | 0.5 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.2 | 8.1 | GO:0097435 | fibril organization(GO:0097435) |
| 0.2 | 2.0 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.2 | 2.0 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.2 | 1.0 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.2 | 0.5 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.2 | 1.0 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.2 | 3.1 | GO:0015747 | urate transport(GO:0015747) |
| 0.2 | 2.9 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.2 | 1.4 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.2 | 1.7 | GO:0032811 | negative regulation of epinephrine secretion(GO:0032811) |
| 0.2 | 1.7 | GO:0007527 | adult somatic muscle development(GO:0007527) |
| 0.2 | 1.9 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.2 | 3.6 | GO:0061614 | pri-miRNA transcription from RNA polymerase II promoter(GO:0061614) |
| 0.2 | 0.5 | GO:0061357 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) positive regulation of Wnt protein secretion(GO:0061357) |
| 0.2 | 1.4 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.2 | 0.5 | GO:0001545 | primary ovarian follicle growth(GO:0001545) |
| 0.2 | 0.2 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.2 | 1.9 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.2 | 1.4 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.2 | 4.2 | GO:0050872 | white fat cell differentiation(GO:0050872) |
| 0.2 | 0.7 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.2 | 0.5 | GO:1904569 | regulation of selenocysteine incorporation(GO:1904569) |
| 0.2 | 0.2 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
| 0.2 | 1.9 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.2 | 0.9 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.2 | 0.7 | GO:0015755 | fructose transport(GO:0015755) |
| 0.2 | 1.6 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.2 | 0.2 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.2 | 0.7 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.2 | 1.4 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
| 0.2 | 4.6 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.2 | 4.1 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.2 | 1.1 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.2 | 0.2 | GO:2000501 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.2 | 0.2 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.2 | 0.5 | GO:0043366 | beta selection(GO:0043366) |
| 0.2 | 0.2 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.2 | 1.8 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
| 0.2 | 0.5 | GO:0051316 | attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
| 0.2 | 0.7 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.2 | 2.5 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.2 | 2.5 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.2 | 0.2 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.2 | 1.4 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.2 | 0.7 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
| 0.2 | 2.2 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.2 | 0.9 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.2 | 2.0 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.2 | 1.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.2 | 3.5 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.2 | 1.3 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.2 | 6.6 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.2 | 1.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.2 | 0.4 | GO:0018931 | naphthalene metabolic process(GO:0018931) naphthalene-containing compound metabolic process(GO:0090420) |
| 0.2 | 0.9 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.2 | 1.8 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.2 | 0.9 | GO:0051177 | meiotic sister chromatid cohesion(GO:0051177) |
| 0.2 | 5.0 | GO:0010667 | negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
| 0.2 | 1.1 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
| 0.2 | 1.1 | GO:0036414 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.2 | 0.4 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.2 | 1.3 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.2 | 0.6 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
| 0.2 | 2.2 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.2 | 5.4 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.2 | 0.4 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.2 | 0.6 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.2 | 0.9 | GO:0016445 | somatic diversification of immunoglobulins(GO:0016445) |
| 0.2 | 1.1 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.2 | 1.3 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.2 | 0.4 | GO:0036124 | histone H3-K9 trimethylation(GO:0036124) |
| 0.2 | 2.3 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.2 | 1.5 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.2 | 0.6 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.2 | 0.8 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.2 | 0.6 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.2 | 1.3 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.2 | 0.6 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.2 | 0.4 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.2 | 0.6 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.2 | 3.6 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
| 0.2 | 0.4 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.2 | 1.5 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.2 | 0.6 | GO:0021558 | trochlear nerve development(GO:0021558) |
| 0.2 | 9.6 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.2 | 0.6 | GO:0015688 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
| 0.2 | 2.5 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
| 0.2 | 0.2 | GO:1902861 | plasma membrane copper ion transport(GO:0015679) copper ion import across plasma membrane(GO:0098705) copper ion import into cell(GO:1902861) |
| 0.2 | 2.3 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.2 | 3.7 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.2 | 0.8 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.2 | 0.4 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.2 | 0.2 | GO:0090399 | replicative senescence(GO:0090399) |
| 0.2 | 0.6 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.2 | 0.6 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.2 | 0.2 | GO:1905165 | regulation of lysosomal protein catabolic process(GO:1905165) |
| 0.2 | 0.6 | GO:0061723 | glycophagy(GO:0061723) |
| 0.2 | 0.4 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.2 | 1.2 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.2 | 4.3 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.2 | 1.0 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.2 | 0.8 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.2 | 2.4 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.2 | 0.8 | GO:0061187 | regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.2 | 0.2 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.2 | 3.8 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.2 | 0.6 | GO:0002946 | tRNA C5-cytosine methylation(GO:0002946) |
| 0.2 | 6.4 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.2 | 2.4 | GO:2001199 | regulation of dendritic cell differentiation(GO:2001198) negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.2 | 1.8 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.2 | 0.6 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.2 | 0.6 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.2 | 2.0 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.2 | 0.4 | GO:0071655 | macrophage colony-stimulating factor production(GO:0036301) granulocyte colony-stimulating factor production(GO:0071611) regulation of granulocyte colony-stimulating factor production(GO:0071655) regulation of macrophage colony-stimulating factor production(GO:1901256) |
| 0.2 | 0.6 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.2 | 7.3 | GO:0042073 | intraciliary transport(GO:0042073) |
| 0.2 | 1.0 | GO:0071455 | cellular response to hyperoxia(GO:0071455) |
| 0.2 | 1.6 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.2 | 2.5 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.2 | 8.6 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.2 | 1.4 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.2 | 3.1 | GO:0019682 | glyceraldehyde-3-phosphate metabolic process(GO:0019682) |
| 0.2 | 1.0 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.2 | 0.6 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.2 | 0.8 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.2 | 1.4 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.2 | 0.6 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.2 | 0.2 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.2 | 1.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.2 | 2.1 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.2 | 1.9 | GO:0070166 | enamel mineralization(GO:0070166) |
| 0.2 | 1.3 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.2 | 1.9 | GO:0006577 | amino-acid betaine metabolic process(GO:0006577) |
| 0.2 | 0.6 | GO:0043181 | vacuolar sequestering(GO:0043181) |
| 0.2 | 0.6 | GO:1904715 | negative regulation of chaperone-mediated autophagy(GO:1904715) |
| 0.2 | 0.8 | GO:0097117 | guanylate kinase-associated protein clustering(GO:0097117) |
| 0.2 | 0.8 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.2 | 0.6 | GO:0001868 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.2 | 2.5 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.2 | 2.6 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.2 | 0.9 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
| 0.2 | 1.7 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
| 0.2 | 7.9 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.2 | 0.2 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.2 | 1.8 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.2 | 2.6 | GO:0009299 | mRNA transcription(GO:0009299) |
| 0.2 | 0.4 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.2 | 0.5 | GO:0003218 | cardiac left ventricle formation(GO:0003218) |
| 0.2 | 0.7 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
| 0.2 | 0.5 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.2 | 1.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.2 | 1.1 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
| 0.2 | 1.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.2 | 0.5 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.2 | 4.5 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.2 | 1.3 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
| 0.2 | 0.4 | GO:0034378 | chylomicron assembly(GO:0034378) |
| 0.2 | 0.7 | GO:0071316 | cellular response to nicotine(GO:0071316) |
| 0.2 | 0.7 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
| 0.2 | 0.4 | GO:0046709 | IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
| 0.2 | 0.5 | GO:2000299 | negative regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000299) |
| 0.2 | 0.7 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.2 | 0.4 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.2 | 0.2 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.2 | 2.7 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.2 | 0.2 | GO:0021636 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) semaphorin-plexin signaling pathway involved in neuron projection guidance(GO:1902285) semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.2 | 0.5 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.2 | 1.4 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.2 | 3.9 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.2 | 3.9 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.2 | 3.3 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.2 | 0.7 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.2 | 0.2 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.2 | 0.7 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.2 | 0.3 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
| 0.2 | 1.0 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.2 | 0.7 | GO:1902490 | regulation of sperm capacitation(GO:1902490) |
| 0.2 | 0.7 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.2 | 5.4 | GO:0046039 | GTP metabolic process(GO:0046039) |
| 0.2 | 1.0 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.2 | 0.7 | GO:0002604 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
| 0.2 | 1.9 | GO:0031047 | gene silencing by RNA(GO:0031047) |
| 0.2 | 1.7 | GO:0006700 | C21-steroid hormone biosynthetic process(GO:0006700) |
| 0.2 | 0.5 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) |
| 0.2 | 1.5 | GO:2000582 | regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.2 | 0.3 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.2 | 1.0 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
| 0.2 | 2.6 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 0.2 | 0.9 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
| 0.2 | 0.7 | GO:0038156 | interleukin-3-mediated signaling pathway(GO:0038156) |
| 0.2 | 0.7 | GO:0007522 | visceral muscle development(GO:0007522) |
| 0.2 | 1.2 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.2 | 0.5 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
| 0.2 | 1.2 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
| 0.2 | 2.4 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
| 0.2 | 0.3 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.2 | 1.5 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.2 | 6.4 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.2 | 1.0 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 0.2 | 0.7 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.2 | 0.2 | GO:0097534 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
| 0.2 | 2.7 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.2 | 0.5 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
| 0.2 | 0.8 | GO:0097309 | cap1 mRNA methylation(GO:0097309) |
| 0.2 | 0.5 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.2 | 0.3 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.2 | 1.8 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.2 | 2.0 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.2 | 4.6 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.2 | 0.3 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.2 | 2.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.2 | 0.7 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.2 | 1.6 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
| 0.2 | 0.3 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
| 0.2 | 0.2 | GO:0035722 | interleukin-12-mediated signaling pathway(GO:0035722) cellular response to interleukin-12(GO:0071349) |
| 0.2 | 2.9 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.2 | 0.7 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.2 | 0.7 | GO:0003383 | apical constriction(GO:0003383) |
| 0.2 | 2.0 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.2 | 0.2 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
| 0.2 | 0.7 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.2 | 4.5 | GO:2000779 | regulation of double-strand break repair(GO:2000779) |
| 0.2 | 0.2 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
| 0.2 | 0.2 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) positive regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071931) |
| 0.2 | 0.8 | GO:0019072 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.2 | 0.3 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 0.2 | 2.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.2 | 1.3 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.2 | 0.2 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
| 0.2 | 2.1 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
| 0.2 | 0.3 | GO:1905146 | lysosomal protein catabolic process(GO:1905146) |
| 0.2 | 4.6 | GO:0072577 | endothelial cell apoptotic process(GO:0072577) |
| 0.2 | 1.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.2 | 2.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.2 | 1.3 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.2 | 0.8 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.2 | 0.6 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.2 | 0.3 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 0.2 | 1.9 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.2 | 0.2 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.2 | 1.4 | GO:0042044 | fluid transport(GO:0042044) |
| 0.2 | 1.1 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
| 0.2 | 0.5 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.2 | 5.8 | GO:0032330 | regulation of chondrocyte differentiation(GO:0032330) |
| 0.2 | 1.2 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
| 0.2 | 0.8 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.2 | 1.1 | GO:0002829 | negative regulation of type 2 immune response(GO:0002829) |
| 0.2 | 1.7 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
| 0.2 | 0.6 | GO:0072525 | pyridine-containing compound biosynthetic process(GO:0072525) |
| 0.2 | 1.4 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.2 | 0.8 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.2 | 0.3 | GO:0031938 | regulation of chromatin silencing at telomere(GO:0031938) DNA replication preinitiation complex assembly(GO:0071163) |
| 0.2 | 1.4 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.1 | 0.3 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 1.6 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.1 | 3.3 | GO:0007140 | male meiosis(GO:0007140) |
| 0.1 | 1.8 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 | 1.8 | GO:0097354 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.1 | 0.7 | GO:0046716 | muscle cell cellular homeostasis(GO:0046716) |
| 0.1 | 3.7 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.1 | 1.5 | GO:0001845 | phagolysosome assembly(GO:0001845) |
| 0.1 | 0.6 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.1 | 0.6 | GO:0015801 | aromatic amino acid transport(GO:0015801) tryptophan transport(GO:0015827) |
| 0.1 | 4.6 | GO:0010596 | negative regulation of endothelial cell migration(GO:0010596) |
| 0.1 | 0.3 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.1 | 0.4 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.1 | 0.1 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 0.1 | 1.4 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.1 | 1.6 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 1.0 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 | 0.3 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.1 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
| 0.1 | 1.7 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.1 | 0.4 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.1 | 0.4 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.1 | 3.5 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.1 | 0.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.1 | 0.4 | GO:1901069 | GDP metabolic process(GO:0046710) guanosine-containing compound catabolic process(GO:1901069) |
| 0.1 | 0.7 | GO:0051084 | 'de novo' posttranslational protein folding(GO:0051084) |
| 0.1 | 1.1 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
| 0.1 | 2.4 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.1 | 3.5 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.1 | 0.1 | GO:0046949 | fatty-acyl-CoA biosynthetic process(GO:0046949) |
| 0.1 | 3.3 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
| 0.1 | 0.7 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 | 1.8 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.1 | 5.6 | GO:0016575 | histone deacetylation(GO:0016575) |
| 0.1 | 1.7 | GO:2000757 | negative regulation of peptidyl-lysine acetylation(GO:2000757) |
| 0.1 | 1.0 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.1 | 0.6 | GO:0032042 | mitochondrial DNA metabolic process(GO:0032042) |
| 0.1 | 0.6 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.1 | 1.1 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.1 | 0.8 | GO:0035739 | CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.1 | 0.1 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
| 0.1 | 1.6 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 | 0.3 | GO:0034239 | macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
| 0.1 | 0.3 | GO:0014826 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) vein smooth muscle contraction(GO:0014826) |
| 0.1 | 2.3 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.1 | 0.4 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 | 2.0 | GO:0002042 | cell migration involved in sprouting angiogenesis(GO:0002042) |
| 0.1 | 0.7 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
| 0.1 | 1.3 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 | 1.6 | GO:0097033 | mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.1 | 0.7 | GO:0019516 | lactate oxidation(GO:0019516) |
| 0.1 | 1.1 | GO:0051126 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
| 0.1 | 2.8 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.1 | 1.3 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
| 0.1 | 0.1 | GO:1902668 | negative regulation of axon guidance(GO:1902668) |
| 0.1 | 0.9 | GO:0060177 | regulation of angiotensin metabolic process(GO:0060177) |
| 0.1 | 2.0 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 4.6 | GO:0035904 | aorta development(GO:0035904) |
| 0.1 | 0.7 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.1 | 3.2 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.1 | 0.4 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.1 | 0.8 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.1 | 0.5 | GO:0045910 | negative regulation of DNA recombination(GO:0045910) |
| 0.1 | 0.4 | GO:0098779 | mitophagy in response to mitochondrial depolarization(GO:0098779) |
| 0.1 | 1.4 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.1 | 1.3 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.1 | 1.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 | 0.4 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.1 | 0.4 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
| 0.1 | 0.9 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.1 | 0.8 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
| 0.1 | 27.6 | GO:0060271 | cilium morphogenesis(GO:0060271) |
| 0.1 | 1.5 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.1 | 0.1 | GO:1990764 | regulation of myofibroblast contraction(GO:1904328) regulation of gastric mucosal blood circulation(GO:1904344) positive regulation of gastric mucosal blood circulation(GO:1904346) myofibroblast contraction(GO:1990764) gastric mucosal blood circulation(GO:1990768) |
| 0.1 | 2.2 | GO:0070897 | DNA-templated transcriptional preinitiation complex assembly(GO:0070897) |
| 0.1 | 0.6 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.1 | 0.5 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.1 | 1.7 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.1 | 5.5 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
| 0.1 | 0.4 | GO:0036245 | cellular response to menadione(GO:0036245) |
| 0.1 | 2.2 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.1 | 1.3 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 0.9 | GO:1904684 | negative regulation of metalloendopeptidase activity(GO:1904684) |
| 0.1 | 1.3 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.1 | 1.5 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.1 | 1.4 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.1 | 0.3 | GO:0021814 | cell motility involved in cerebral cortex radial glia guided migration(GO:0021814) modulation of microtubule cytoskeleton involved in cerebral cortex radial glia guided migration(GO:0021815) |
| 0.1 | 0.8 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 | 0.6 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.1 | 0.4 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
| 0.1 | 0.6 | GO:0070831 | basement membrane assembly(GO:0070831) |
| 0.1 | 0.1 | GO:0000912 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.1 | 1.0 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.1 | 0.5 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 | 0.9 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.1 | 0.1 | GO:0002313 | mature B cell differentiation involved in immune response(GO:0002313) |
| 0.1 | 0.2 | GO:0017126 | nucleologenesis(GO:0017126) |
| 0.1 | 4.4 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.1 | 2.6 | GO:0009994 | oocyte differentiation(GO:0009994) |
| 0.1 | 0.4 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
| 0.1 | 1.7 | GO:0045663 | positive regulation of myoblast differentiation(GO:0045663) |
| 0.1 | 1.0 | GO:0044351 | macropinocytosis(GO:0044351) |
| 0.1 | 0.4 | GO:1904627 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.1 | 0.6 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
| 0.1 | 0.5 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 0.1 | 0.5 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
| 0.1 | 0.2 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.1 | 1.6 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.1 | 0.5 | GO:0002158 | osteoclast proliferation(GO:0002158) |
| 0.1 | 0.2 | GO:0035247 | peptidyl-arginine N-methylation(GO:0035246) peptidyl-arginine omega-N-methylation(GO:0035247) |
| 0.1 | 3.2 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.1 | 0.2 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.1 | 0.4 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
| 0.1 | 0.2 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
| 0.1 | 0.7 | GO:1900084 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) |
| 0.1 | 0.6 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.1 | 1.5 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.1 | 0.2 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.1 | 1.0 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.1 | 0.2 | GO:0014857 | regulation of skeletal muscle cell proliferation(GO:0014857) |
| 0.1 | 0.2 | GO:0071929 | alpha-tubulin acetylation(GO:0071929) |
| 0.1 | 0.9 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.1 | 8.0 | GO:0007286 | spermatid development(GO:0007286) |
| 0.1 | 4.9 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 1.4 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.1 | 1.1 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.1 | 0.3 | GO:1904457 | positive regulation of neuronal action potential(GO:1904457) |
| 0.1 | 3.6 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.1 | 0.4 | GO:0061718 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.1 | 0.2 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
| 0.1 | 4.5 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
| 0.1 | 0.6 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 | 0.6 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.1 | 1.6 | GO:0048311 | mitochondrion distribution(GO:0048311) |
| 0.1 | 0.6 | GO:0098886 | modification of dendritic spine(GO:0098886) |
| 0.1 | 2.3 | GO:0006378 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
| 0.1 | 0.3 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.1 | 0.2 | GO:0002248 | wound healing involved in inflammatory response(GO:0002246) connective tissue replacement involved in inflammatory response wound healing(GO:0002248) inflammatory response to wounding(GO:0090594) |
| 0.1 | 1.4 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.1 | 0.3 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.1 | 1.1 | GO:1903432 | regulation of TORC1 signaling(GO:1903432) |
| 0.1 | 1.6 | GO:0045601 | regulation of endothelial cell differentiation(GO:0045601) |
| 0.1 | 0.4 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.1 | 1.2 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.1 | 1.9 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
| 0.1 | 0.3 | GO:2000588 | positive regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000588) |
| 0.1 | 1.5 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.1 | 1.5 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.1 | 0.7 | GO:0048635 | negative regulation of muscle organ development(GO:0048635) |
| 0.1 | 0.5 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.1 | 0.2 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.1 | 1.4 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.1 | 0.2 | GO:0015675 | nickel cation transport(GO:0015675) |
| 0.1 | 0.1 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.1 | 0.3 | GO:0033189 | response to vitamin A(GO:0033189) |
| 0.1 | 0.2 | GO:0006649 | phospholipid transfer to membrane(GO:0006649) |
| 0.1 | 3.0 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.1 | 1.9 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.1 | 2.5 | GO:0035634 | response to stilbenoid(GO:0035634) |
| 0.1 | 1.5 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
| 0.1 | 0.2 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.1 | 4.3 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
| 0.1 | 0.5 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.1 | 3.4 | GO:0007588 | excretion(GO:0007588) |
| 0.1 | 0.7 | GO:0043174 | nucleoside salvage(GO:0043174) |
| 0.1 | 1.1 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
| 0.1 | 0.3 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.1 | 1.3 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.1 | 1.6 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
| 0.1 | 0.1 | GO:0021658 | rhombomere 3 morphogenesis(GO:0021658) |
| 0.1 | 0.3 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.1 | 0.4 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.1 | 0.5 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.1 | 0.4 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.1 | 0.5 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.1 | 0.3 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.1 | 1.0 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.1 | 0.3 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.1 | 1.3 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
| 0.1 | 0.5 | GO:0021995 | anterior neuropore closure(GO:0021506) neuropore closure(GO:0021995) |
| 0.1 | 0.9 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.1 | 0.4 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.1 | 0.9 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.1 | 0.2 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.1 | 1.2 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.1 | 0.7 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.1 | 0.2 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.1 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 0.5 | GO:0035809 | regulation of urine volume(GO:0035809) |
| 0.1 | 0.8 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.1 | 0.5 | GO:0035660 | MyD88-dependent toll-like receptor 4 signaling pathway(GO:0035660) |
| 0.1 | 0.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.1 | 0.3 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.1 | 0.4 | GO:0002266 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
| 0.1 | 0.4 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 0.1 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.1 | 0.5 | GO:0051197 | positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.1 | 1.5 | GO:0016556 | mRNA modification(GO:0016556) |
| 0.1 | 0.6 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.1 | 1.9 | GO:0014823 | response to activity(GO:0014823) |
| 0.1 | 0.4 | GO:0042631 | cellular response to water deprivation(GO:0042631) |
| 0.1 | 0.4 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
| 0.1 | 0.2 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 | 0.3 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.3 | GO:0006083 | acetate metabolic process(GO:0006083) |
| 0.1 | 0.9 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
| 0.1 | 0.3 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.1 | 0.8 | GO:0030811 | regulation of glycolytic process(GO:0006110) regulation of nucleotide catabolic process(GO:0030811) |
| 0.1 | 0.3 | GO:0001510 | RNA methylation(GO:0001510) |
| 0.1 | 1.6 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
| 0.1 | 0.5 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.1 | 0.9 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 0.1 | 0.4 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 | 0.3 | GO:0098884 | postsynaptic neurotransmitter receptor internalization(GO:0098884) |
| 0.1 | 0.7 | GO:0030728 | ovulation(GO:0030728) |
| 0.1 | 1.7 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.1 | 0.9 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.1 | 2.1 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
| 0.1 | 2.4 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.1 | 0.9 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.1 | 1.5 | GO:0030199 | collagen fibril organization(GO:0030199) |
| 0.1 | 0.3 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 | 0.2 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.1 | 1.3 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
| 0.1 | 0.5 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.1 | 1.1 | GO:0097499 | protein localization to nonmotile primary cilium(GO:0097499) |
| 0.1 | 0.4 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.1 | 1.3 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.1 | 2.4 | GO:0060612 | adipose tissue development(GO:0060612) |
| 0.1 | 0.2 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 | 1.1 | GO:0010259 | multicellular organism aging(GO:0010259) |
| 0.1 | 1.0 | GO:1902914 | regulation of protein polyubiquitination(GO:1902914) |
| 0.1 | 0.7 | GO:0006337 | nucleosome disassembly(GO:0006337) |
| 0.1 | 0.8 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.1 | 0.3 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.1 | 0.5 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.8 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 0.1 | 0.2 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
| 0.1 | 2.7 | GO:0042255 | ribosome assembly(GO:0042255) |
| 0.1 | 0.3 | GO:0071104 | response to interleukin-9(GO:0071104) |
| 0.1 | 0.4 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.3 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 | 0.6 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 | 0.4 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.1 | 0.1 | GO:2000650 | negative regulation of sodium ion transmembrane transport(GO:1902306) negative regulation of sodium ion transmembrane transporter activity(GO:2000650) |
| 0.1 | 0.8 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.1 | 0.1 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
| 0.1 | 0.5 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.1 | 1.6 | GO:0098596 | vocal learning(GO:0042297) imitative learning(GO:0098596) |
| 0.1 | 1.6 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
| 0.1 | 0.1 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 | 0.4 | GO:0038032 | termination of G-protein coupled receptor signaling pathway(GO:0038032) |
| 0.1 | 3.0 | GO:0009060 | aerobic respiration(GO:0009060) |
| 0.1 | 0.6 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 | 0.8 | GO:0006405 | RNA export from nucleus(GO:0006405) |
| 0.1 | 1.8 | GO:0051646 | mitochondrion localization(GO:0051646) |
| 0.1 | 0.3 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
| 0.1 | 0.2 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 | 0.2 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.1 | 0.7 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.1 | 3.9 | GO:0031497 | chromatin assembly(GO:0031497) |
| 0.1 | 0.9 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.1 | 0.1 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
| 0.1 | 0.3 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.1 | 0.2 | GO:2001106 | regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.1 | 1.6 | GO:0010972 | negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
| 0.1 | 0.1 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.1 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
| 0.1 | 1.7 | GO:0032801 | receptor catabolic process(GO:0032801) |
| 0.1 | 0.3 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
| 0.1 | 0.5 | GO:0019249 | lactate biosynthetic process(GO:0019249) |
| 0.1 | 1.4 | GO:0046148 | pigment biosynthetic process(GO:0046148) |
| 0.1 | 0.2 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.1 | 1.2 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
| 0.1 | 2.1 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.1 | 0.5 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
| 0.1 | 0.6 | GO:0060009 | Sertoli cell development(GO:0060009) |
| 0.1 | 0.3 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
| 0.1 | 0.1 | GO:0060620 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.1 | 0.3 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.1 | 0.3 | GO:0034505 | tooth mineralization(GO:0034505) |
| 0.1 | 2.8 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.1 | 0.6 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
| 0.1 | 0.3 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 | 0.3 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.1 | 0.4 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
| 0.1 | 0.1 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.1 | 1.8 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.1 | 0.8 | GO:0010831 | positive regulation of myotube differentiation(GO:0010831) |
| 0.1 | 0.2 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.1 | 1.0 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.1 | 0.1 | GO:1900063 | regulation of peroxisome organization(GO:1900063) |
| 0.1 | 0.4 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
| 0.1 | 0.3 | GO:0035655 | interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
| 0.1 | 0.3 | GO:0090032 | negative regulation of steroid hormone biosynthetic process(GO:0090032) |
| 0.1 | 0.6 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 9.0 | GO:0000209 | protein polyubiquitination(GO:0000209) |
| 0.1 | 0.6 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 | 0.6 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.1 | 0.2 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.1 | 2.2 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.1 | 0.5 | GO:0030953 | astral microtubule organization(GO:0030953) |
| 0.1 | 0.7 | GO:0015732 | prostaglandin transport(GO:0015732) |
| 0.1 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.1 | 0.2 | GO:0006069 | ethanol oxidation(GO:0006069) |
| 0.1 | 0.2 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.1 | 0.4 | GO:1901798 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) positive regulation of signal transduction by p53 class mediator(GO:1901798) |
| 0.1 | 1.3 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
| 0.1 | 0.2 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.1 | 5.7 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
| 0.1 | 0.4 | GO:0061709 | reticulophagy(GO:0061709) |
| 0.1 | 0.9 | GO:1901663 | quinone biosynthetic process(GO:1901663) |
| 0.1 | 0.1 | GO:0002327 | immature B cell differentiation(GO:0002327) |
| 0.1 | 0.2 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.1 | 0.5 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.1 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.1 | 0.4 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.1 | 0.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 0.7 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.1 | 1.7 | GO:0051028 | mRNA transport(GO:0051028) |
| 0.1 | 0.2 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.1 | 0.2 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.1 | 0.3 | GO:0051444 | negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.1 | 0.2 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.1 | 1.7 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
| 0.1 | 0.2 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
| 0.1 | 0.1 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
| 0.1 | 0.2 | GO:1903048 | regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.1 | 0.4 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.1 | 0.2 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
| 0.1 | 1.6 | GO:0031424 | keratinization(GO:0031424) |
| 0.1 | 0.1 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 | 0.7 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.1 | 0.3 | GO:0035728 | response to hepatocyte growth factor(GO:0035728) |
| 0.1 | 0.1 | GO:0097350 | neutrophil clearance(GO:0097350) |
| 0.1 | 0.4 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.1 | 0.4 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.1 | 1.5 | GO:0006310 | DNA recombination(GO:0006310) |
| 0.1 | 0.7 | GO:0033233 | regulation of protein sumoylation(GO:0033233) |
| 0.0 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.0 | 1.6 | GO:0001578 | microtubule bundle formation(GO:0001578) |
| 0.0 | 0.5 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.5 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 1.3 | GO:0000724 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.0 | 0.2 | GO:0033280 | response to vitamin D(GO:0033280) |
| 0.0 | 0.0 | GO:0061760 | antifungal innate immune response(GO:0061760) |
| 0.0 | 0.0 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
| 0.0 | 0.8 | GO:0032309 | icosanoid secretion(GO:0032309) |
| 0.0 | 0.7 | GO:0071470 | cellular response to osmotic stress(GO:0071470) |
| 0.0 | 0.1 | GO:0061512 | protein localization to cilium(GO:0061512) |
| 0.0 | 0.3 | GO:1901908 | diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.0 | 0.2 | GO:0071569 | protein ufmylation(GO:0071569) protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 | 0.2 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.0 | 0.3 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.6 | GO:0001706 | endoderm formation(GO:0001706) |
| 0.0 | 0.2 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
| 0.0 | 0.5 | GO:0006582 | melanin metabolic process(GO:0006582) |
| 0.0 | 0.4 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.0 | 0.5 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) negative regulation of biomineral tissue development(GO:0070168) |
| 0.0 | 0.1 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
| 0.0 | 0.0 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.0 | 1.0 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
| 0.0 | 1.5 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.0 | 0.3 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.0 | 0.2 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.6 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.0 | 0.2 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.2 | GO:0050746 | regulation of lipoprotein metabolic process(GO:0050746) |
| 0.0 | 0.2 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
| 0.0 | 0.0 | GO:0051958 | methotrexate transport(GO:0051958) |
| 0.0 | 1.0 | GO:1903845 | negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
| 0.0 | 0.1 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.0 | 0.2 | GO:0042125 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.0 | 0.2 | GO:0042339 | keratan sulfate metabolic process(GO:0042339) |
| 0.0 | 0.6 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.0 | 1.5 | GO:0006397 | mRNA processing(GO:0006397) |
| 0.0 | 0.2 | GO:0021670 | lateral ventricle development(GO:0021670) |
| 0.0 | 0.3 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.0 | 0.1 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.0 | 0.4 | GO:0006662 | glycerol ether metabolic process(GO:0006662) |
| 0.0 | 0.6 | GO:0002478 | antigen processing and presentation of exogenous peptide antigen(GO:0002478) |
| 0.0 | 0.0 | GO:0035574 | histone H4-K20 demethylation(GO:0035574) |
| 0.0 | 0.9 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 0.0 | 2.3 | GO:0006457 | protein folding(GO:0006457) |
| 0.0 | 0.2 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.0 | 0.5 | GO:0051180 | vitamin transport(GO:0051180) |
| 0.0 | 0.0 | GO:0071315 | cellular response to morphine(GO:0071315) cellular response to isoquinoline alkaloid(GO:0071317) |
| 0.0 | 0.3 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.0 | 3.1 | GO:0017148 | negative regulation of translation(GO:0017148) |
| 0.0 | 0.3 | GO:0045714 | low-density lipoprotein particle receptor biosynthetic process(GO:0045713) regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
| 0.0 | 0.1 | GO:0007128 | M phase(GO:0000279) meiotic prophase I(GO:0007128) prophase(GO:0051324) |
| 0.0 | 0.2 | GO:0009074 | tryptophan catabolic process(GO:0006569) aromatic amino acid family catabolic process(GO:0009074) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
| 0.0 | 1.1 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.0 | 1.5 | GO:0006261 | DNA-dependent DNA replication(GO:0006261) |
| 0.0 | 1.2 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.0 | 0.5 | GO:0043485 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.0 | 0.9 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.1 | GO:0016115 | diterpenoid catabolic process(GO:0016103) terpenoid catabolic process(GO:0016115) retinoic acid catabolic process(GO:0034653) |
| 0.0 | 0.1 | GO:0060544 | regulation of necroptotic process(GO:0060544) negative regulation of necroptotic process(GO:0060546) negative regulation of necrotic cell death(GO:0060547) |
| 0.0 | 0.1 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
| 0.0 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 | 1.3 | GO:0032526 | response to retinoic acid(GO:0032526) |
| 0.0 | 0.4 | GO:2001273 | regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.0 | 0.1 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.0 | 0.2 | GO:0060969 | negative regulation of gene silencing(GO:0060969) |
| 0.0 | 0.1 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.0 | 0.2 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.0 | 0.1 | GO:0015851 | nucleobase transport(GO:0015851) pyrimidine nucleobase transport(GO:0015855) |
| 0.0 | 1.4 | GO:0055013 | cardiac muscle cell development(GO:0055013) |
| 0.0 | 0.1 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.0 | 0.3 | GO:0052696 | flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
| 0.0 | 0.1 | GO:0050917 | sensory perception of sweet taste(GO:0050916) sensory perception of umami taste(GO:0050917) |
| 0.0 | 0.1 | GO:0072641 | type I interferon secretion(GO:0072641) interferon-alpha secretion(GO:0072642) regulation of interferon-alpha secretion(GO:1902739) positive regulation of interferon-alpha secretion(GO:1902741) |
| 0.0 | 0.1 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.0 | 0.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 | 0.3 | GO:0061462 | protein localization to lysosome(GO:0061462) |
| 0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.0 | 0.3 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.0 | 1.3 | GO:0032922 | circadian regulation of gene expression(GO:0032922) |
| 0.0 | 0.7 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.0 | 0.1 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
| 0.0 | 0.1 | GO:0045953 | negative regulation of natural killer cell mediated cytotoxicity(GO:0045953) |
| 0.0 | 0.3 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.0 | 0.2 | GO:0098781 | ncRNA transcription(GO:0098781) |
| 0.0 | 0.2 | GO:0098743 | cell aggregation(GO:0098743) |
| 0.0 | 0.5 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
| 0.0 | 0.1 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 0.1 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
| 0.0 | 0.7 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.0 | 1.7 | GO:0005976 | polysaccharide metabolic process(GO:0005976) |
| 0.0 | 0.1 | GO:1902477 | defense response to bacterium, incompatible interaction(GO:0009816) regulation of defense response to bacterium, incompatible interaction(GO:1902477) |
| 0.0 | 0.1 | GO:0097494 | regulation of vesicle size(GO:0097494) |
| 0.0 | 0.6 | GO:0033622 | integrin activation(GO:0033622) |
| 0.0 | 0.6 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 | 0.1 | GO:0018900 | dichloromethane metabolic process(GO:0018900) |
| 0.0 | 0.1 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
| 0.0 | 0.2 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.0 | GO:0048069 | eye pigmentation(GO:0048069) |
| 0.0 | 0.1 | GO:0036367 | adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 0.0 | 0.0 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.0 | 0.1 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.1 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.0 | 0.5 | GO:1902807 | negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.0 | 0.1 | GO:0035376 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.0 | 0.4 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.0 | 0.0 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.0 | 0.0 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.0 | 0.0 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.1 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.0 | 0.1 | GO:0034397 | telomere localization(GO:0034397) meiotic telomere clustering(GO:0045141) chromosome localization to nuclear envelope involved in homologous chromosome segregation(GO:0090220) |
| 0.0 | 0.3 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.0 | 0.1 | GO:0071586 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
| 0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.1 | GO:0019321 | pentose metabolic process(GO:0019321) |
| 0.0 | 0.2 | GO:0006970 | response to osmotic stress(GO:0006970) |
| 0.0 | 0.0 | GO:0021764 | amygdala development(GO:0021764) |
| 0.0 | 0.1 | GO:0051168 | nuclear export(GO:0051168) |
| 0.0 | 0.2 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.0 | 0.2 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.1 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
| 0.0 | 0.0 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
| 0.0 | 2.4 | GO:0008380 | RNA splicing(GO:0008380) |
| 0.0 | 0.1 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
| 0.0 | 0.0 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.0 | 0.1 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.0 | 0.1 | GO:1905214 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) positive regulation of RNA binding(GO:1905216) |
| 0.0 | 0.2 | GO:0050798 | activated T cell proliferation(GO:0050798) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 11.1 | GO:0098651 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 1.5 | 4.6 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
| 1.4 | 8.6 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 1.1 | 3.4 | GO:1903754 | cortical microtubule plus-end(GO:1903754) cytoplasmic microtubule plus-end(GO:1904511) |
| 1.1 | 3.3 | GO:1990630 | IRE1-RACK1-PP2A complex(GO:1990630) |
| 1.1 | 5.5 | GO:0000125 | PCAF complex(GO:0000125) |
| 1.0 | 3.0 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
| 1.0 | 6.0 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 1.0 | 6.7 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.9 | 10.8 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.9 | 2.6 | GO:0034455 | t-UTP complex(GO:0034455) |
| 0.9 | 3.4 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.8 | 2.5 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.8 | 4.1 | GO:0000802 | transverse filament(GO:0000802) |
| 0.8 | 7.4 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.8 | 9.9 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.8 | 4.1 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 0.8 | 3.2 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.8 | 6.2 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.8 | 7.7 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.7 | 2.2 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.7 | 3.6 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.7 | 13.6 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.7 | 2.8 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.7 | 9.7 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.7 | 2.7 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.7 | 11.9 | GO:0036038 | MKS complex(GO:0036038) |
| 0.6 | 1.9 | GO:0043540 | 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase complex(GO:0043540) |
| 0.6 | 1.9 | GO:0044326 | dendritic spine neck(GO:0044326) growth cone lamellipodium(GO:1990761) |
| 0.6 | 2.6 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.6 | 4.4 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.6 | 5.5 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.6 | 9.0 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.6 | 11.3 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.6 | 2.4 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.6 | 4.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.6 | 1.7 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.6 | 5.1 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.6 | 2.3 | GO:0001740 | Barr body(GO:0001740) |
| 0.6 | 1.7 | GO:0005760 | gamma DNA polymerase complex(GO:0005760) |
| 0.5 | 1.6 | GO:0044753 | amphisome(GO:0044753) |
| 0.5 | 2.7 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.5 | 2.6 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.5 | 2.6 | GO:0035363 | histone locus body(GO:0035363) |
| 0.5 | 6.2 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.5 | 3.0 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.5 | 5.0 | GO:0034464 | BBSome(GO:0034464) |
| 0.5 | 2.0 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.5 | 2.9 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.5 | 2.9 | GO:1990393 | 3M complex(GO:1990393) |
| 0.5 | 2.9 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.5 | 1.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.5 | 2.4 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.5 | 0.5 | GO:0000805 | X chromosome(GO:0000805) |
| 0.5 | 1.4 | GO:0097132 | cyclin D2-CDK6 complex(GO:0097132) |
| 0.5 | 4.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.5 | 1.4 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.5 | 1.8 | GO:0097574 | lateral part of cell(GO:0097574) basolateral part of cell(GO:1990794) rod bipolar cell terminal bouton(GO:1990795) |
| 0.4 | 2.7 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.4 | 11.6 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.4 | 2.7 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.4 | 1.3 | GO:1990435 | stereocilia tip link(GO:0002140) myosin VII complex(GO:0031477) stereocilia tip-link density(GO:1990427) upper tip-link density(GO:1990435) |
| 0.4 | 4.7 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.4 | 0.8 | GO:0016589 | NURF complex(GO:0016589) |
| 0.4 | 2.1 | GO:0045160 | myosin I complex(GO:0045160) |
| 0.4 | 2.5 | GO:0071547 | piP-body(GO:0071547) |
| 0.4 | 2.1 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.4 | 10.5 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.4 | 0.4 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.4 | 4.2 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.4 | 1.7 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.4 | 2.0 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.4 | 1.2 | GO:0032783 | ELL-EAF complex(GO:0032783) |
| 0.4 | 3.2 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.4 | 6.8 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.4 | 6.3 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.4 | 2.7 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.4 | 1.5 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.4 | 1.1 | GO:0005715 | chiasma(GO:0005712) late recombination nodule(GO:0005715) |
| 0.4 | 4.0 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.4 | 8.0 | GO:0051286 | cell tip(GO:0051286) |
| 0.4 | 4.7 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.4 | 1.8 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.4 | 1.1 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.4 | 0.4 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.4 | 2.5 | GO:1990923 | PET complex(GO:1990923) |
| 0.3 | 2.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.3 | 9.7 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.3 | 1.7 | GO:0032797 | SMN complex(GO:0032797) |
| 0.3 | 1.4 | GO:0055028 | cortical microtubule(GO:0055028) mitotic spindle astral microtubule(GO:0061673) |
| 0.3 | 9.1 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.3 | 6.7 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.3 | 5.3 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.3 | 1.3 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 0.3 | 1.3 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.3 | 1.7 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.3 | 3.6 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.3 | 1.3 | GO:0097447 | dendritic tree(GO:0097447) |
| 0.3 | 2.6 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.3 | 1.0 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.3 | 1.0 | GO:0097361 | CIA complex(GO:0097361) |
| 0.3 | 11.7 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.3 | 3.8 | GO:0031415 | NatA complex(GO:0031415) |
| 0.3 | 1.3 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.3 | 2.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.3 | 2.2 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.3 | 3.8 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.3 | 5.1 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.3 | 3.5 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.3 | 0.9 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.3 | 0.6 | GO:0005638 | lamin filament(GO:0005638) |
| 0.3 | 10.7 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.3 | 7.3 | GO:0038201 | TOR complex(GO:0038201) |
| 0.3 | 1.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.3 | 3.0 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.3 | 1.2 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.3 | 17.1 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.3 | 0.9 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.3 | 2.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.3 | 2.7 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.3 | 2.4 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.3 | 8.9 | GO:0097546 | ciliary base(GO:0097546) |
| 0.3 | 0.9 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
| 0.3 | 0.6 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) TAP complex(GO:0042825) |
| 0.3 | 5.5 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.3 | 3.8 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.3 | 6.3 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.3 | 2.0 | GO:0098536 | deuterosome(GO:0098536) |
| 0.3 | 2.8 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.3 | 6.3 | GO:0030990 | intraciliary transport particle(GO:0030990) |
| 0.3 | 1.7 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.3 | 2.3 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.3 | 0.8 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.3 | 2.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.3 | 1.1 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 0.3 | 0.8 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.3 | 2.2 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.3 | 0.8 | GO:0002095 | caveolar macromolecular signaling complex(GO:0002095) |
| 0.3 | 1.6 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.3 | 2.7 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.3 | 3.2 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.3 | 4.8 | GO:0005605 | basal lamina(GO:0005605) |
| 0.3 | 2.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.3 | 2.9 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.3 | 7.4 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.3 | 1.6 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.3 | 0.8 | GO:0034066 | RIC1-RGP1 guanyl-nucleotide exchange factor complex(GO:0034066) |
| 0.3 | 1.8 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.3 | 0.5 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.3 | 0.8 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.3 | 1.0 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.3 | 3.6 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.3 | 0.8 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
| 0.3 | 14.2 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.3 | 0.8 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.3 | 5.5 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.2 | 6.2 | GO:0043596 | nuclear replication fork(GO:0043596) |
| 0.2 | 0.2 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 0.2 | 1.0 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.2 | 4.1 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.2 | 2.0 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.2 | 6.6 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.2 | 1.9 | GO:0045252 | dihydrolipoyl dehydrogenase complex(GO:0045240) oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.2 | 1.4 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.2 | 0.7 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.2 | 0.7 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.2 | 0.5 | GO:0070822 | Sin3-type complex(GO:0070822) |
| 0.2 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.2 | 4.4 | GO:0032039 | integrator complex(GO:0032039) |
| 0.2 | 0.7 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.2 | 21.4 | GO:0005814 | centriole(GO:0005814) |
| 0.2 | 0.2 | GO:0034681 | integrin alpha11-beta1 complex(GO:0034681) |
| 0.2 | 1.2 | GO:0034657 | GID complex(GO:0034657) |
| 0.2 | 1.8 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.2 | 2.8 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
| 0.2 | 4.3 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.2 | 1.6 | GO:0002177 | manchette(GO:0002177) |
| 0.2 | 4.9 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.2 | 1.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.2 | 4.5 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.2 | 2.9 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.2 | 0.9 | GO:0002111 | BRCA2-BRAF35 complex(GO:0002111) |
| 0.2 | 5.4 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.2 | 1.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.2 | 7.3 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.2 | 23.4 | GO:0005604 | basement membrane(GO:0005604) |
| 0.2 | 1.1 | GO:0031251 | PAN complex(GO:0031251) |
| 0.2 | 2.6 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.2 | 9.2 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.2 | 7.0 | GO:0030286 | dynein complex(GO:0030286) |
| 0.2 | 1.9 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.2 | 1.5 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.2 | 1.9 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.2 | 85.5 | GO:0016607 | nuclear speck(GO:0016607) |
| 0.2 | 6.1 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.2 | 3.7 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.2 | 6.3 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.2 | 0.6 | GO:0060473 | cortical granule(GO:0060473) |
| 0.2 | 0.6 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.2 | 2.6 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.2 | 1.6 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.2 | 0.8 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.2 | 0.4 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.2 | 6.1 | GO:0001741 | XY body(GO:0001741) |
| 0.2 | 2.1 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.2 | 3.1 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.2 | 2.7 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.2 | 0.6 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.2 | 3.3 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.2 | 0.4 | GO:0071920 | cleavage body(GO:0071920) |
| 0.2 | 2.7 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.2 | 0.8 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.2 | 12.2 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.2 | 10.2 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.2 | 1.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.2 | 1.1 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.2 | 1.8 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.2 | 2.9 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.2 | 0.5 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.2 | 0.5 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.2 | 0.5 | GO:0030689 | Noc complex(GO:0030689) |
| 0.2 | 1.2 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.2 | 0.9 | GO:0034272 | phosphatidylinositol 3-kinase complex, class III, type I(GO:0034271) phosphatidylinositol 3-kinase complex, class III, type II(GO:0034272) |
| 0.2 | 0.5 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.2 | 0.7 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.2 | 0.3 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.2 | 3.3 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.2 | 0.2 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.2 | 0.5 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.2 | 4.6 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.2 | 7.0 | GO:0016592 | mediator complex(GO:0016592) |
| 0.2 | 0.2 | GO:0000796 | condensin complex(GO:0000796) |
| 0.2 | 1.5 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.2 | 2.0 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.2 | 1.8 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.2 | 1.6 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.2 | 1.6 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.2 | 18.6 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.2 | 1.6 | GO:0044754 | autolysosome(GO:0044754) |
| 0.2 | 2.9 | GO:0000786 | nucleosome(GO:0000786) |
| 0.2 | 1.0 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.2 | 1.9 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.2 | 0.9 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.2 | 0.5 | GO:0070985 | TFIIK complex(GO:0070985) |
| 0.2 | 15.5 | GO:0005811 | lipid particle(GO:0005811) |
| 0.2 | 3.0 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.2 | 0.8 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.2 | 3.2 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.2 | 7.1 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.2 | 0.9 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.2 | 1.5 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.2 | 9.6 | GO:0005844 | polysome(GO:0005844) |
| 0.1 | 1.0 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.1 | 5.1 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 1.2 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 3.3 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 10.7 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.1 | 1.6 | GO:0000428 | DNA-directed RNA polymerase complex(GO:0000428) |
| 0.1 | 1.7 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 22.1 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.1 | 3.3 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 1.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.1 | 1.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 1.0 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 1.1 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.1 | 2.2 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.1 | 0.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.1 | 1.8 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 0.7 | GO:0071437 | invadopodium(GO:0071437) |
| 0.1 | 1.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.1 | 0.6 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.1 | 0.5 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.1 | 1.3 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.1 | 0.9 | GO:0043186 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.1 | 0.9 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 1.0 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.1 | 0.8 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 0.6 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.1 | 11.0 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.1 | 20.5 | GO:0044798 | nuclear transcription factor complex(GO:0044798) |
| 0.1 | 3.0 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.1 | 1.0 | GO:0031673 | H zone(GO:0031673) |
| 0.1 | 9.6 | GO:0016605 | PML body(GO:0016605) |
| 0.1 | 0.4 | GO:0070877 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
| 0.1 | 2.8 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.1 | 3.7 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.1 | 0.6 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 0.8 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) INO80-type complex(GO:0097346) |
| 0.1 | 0.9 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
| 0.1 | 3.0 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 0.3 | GO:0090537 | CERF complex(GO:0090537) |
| 0.1 | 0.5 | GO:0005694 | chromosome(GO:0005694) |
| 0.1 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.1 | 1.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.1 | 8.8 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.1 | 1.6 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 1.5 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.1 | 0.4 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.1 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.1 | 0.6 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.1 | 0.6 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.1 | 0.9 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.1 | 0.6 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.1 | 0.2 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.1 | 0.2 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 1.7 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.1 | 0.6 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 0.3 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.1 | 0.3 | GO:0036019 | endolysosome(GO:0036019) endolysosome membrane(GO:0036020) |
| 0.1 | 7.4 | GO:0031514 | motile cilium(GO:0031514) |
| 0.1 | 1.7 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.1 | 7.1 | GO:0030315 | T-tubule(GO:0030315) |
| 0.1 | 19.3 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.1 | 0.2 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
| 0.1 | 0.3 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.1 | 0.3 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 0.1 | 5.4 | GO:0000922 | spindle pole(GO:0000922) |
| 0.1 | 6.7 | GO:0000776 | kinetochore(GO:0000776) |
| 0.1 | 1.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.1 | 6.8 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 1.4 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 0.2 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
| 0.1 | 2.0 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.1 | 1.6 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.1 | 0.1 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.1 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 3.4 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.1 | 0.5 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.1 | 0.3 | GO:0070187 | telosome(GO:0070187) |
| 0.1 | 1.8 | GO:0000145 | exocyst(GO:0000145) |
| 0.1 | 0.3 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
| 0.1 | 0.5 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 2.2 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 6.8 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.1 | 14.8 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.1 | 1.0 | GO:0030904 | retromer complex(GO:0030904) |
| 0.1 | 1.9 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 1.9 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.1 | 0.5 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.1 | 0.4 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
| 0.1 | 0.8 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 2.0 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.1 | 9.4 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.1 | 0.6 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.4 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) |
| 0.1 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.1 | 0.3 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 0.1 | 21.7 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.1 | 6.4 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.1 | 0.2 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.1 | 1.0 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.1 | 1.2 | GO:0044453 | nuclear membrane part(GO:0044453) |
| 0.1 | 0.3 | GO:0000221 | vacuolar proton-transporting V-type ATPase, V1 domain(GO:0000221) |
| 0.1 | 15.8 | GO:0005813 | centrosome(GO:0005813) |
| 0.1 | 1.4 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.1 | 1.4 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.1 | 0.4 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 0.2 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.1 | 0.4 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 0.2 | GO:0032545 | CURI complex(GO:0032545) UTP-C complex(GO:0034456) |
| 0.1 | 0.8 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) |
| 0.1 | 29.7 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
| 0.1 | 120.7 | GO:0005739 | mitochondrion(GO:0005739) |
| 0.1 | 4.0 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.1 | 9.6 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.1 | 0.5 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 0.2 | GO:0098830 | presynaptic endosome(GO:0098830) |
| 0.1 | 45.6 | GO:0005730 | nucleolus(GO:0005730) |
| 0.1 | 0.8 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.1 | 0.2 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.1 | 1.4 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 3.2 | GO:0005902 | microvillus(GO:0005902) |
| 0.1 | 0.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.1 | 0.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.1 | 0.2 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.1 | 0.5 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.1 | 13.8 | GO:0016604 | nuclear body(GO:0016604) |
| 0.1 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.1 | 89.4 | GO:0005654 | nucleoplasm(GO:0005654) |
| 0.1 | 0.4 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 0.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 0.2 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.1 | 0.2 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 0.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.1 | 0.5 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.1 | 0.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.1 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.1 | 0.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.1 | 0.7 | GO:0030666 | clathrin coat of endocytic vesicle(GO:0030128) endocytic vesicle membrane(GO:0030666) clathrin-coated endocytic vesicle membrane(GO:0030669) |
| 0.1 | 0.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.5 | GO:0045178 | basal part of cell(GO:0045178) |
| 0.0 | 0.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 0.2 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.0 | 1.2 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.0 | 0.8 | GO:0008305 | integrin complex(GO:0008305) |
| 0.0 | 124.1 | GO:0005634 | nucleus(GO:0005634) |
| 0.0 | 0.7 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.2 | GO:0016011 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
| 0.0 | 0.3 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 1.3 | GO:0031461 | cullin-RING ubiquitin ligase complex(GO:0031461) |
| 0.0 | 4.1 | GO:0030055 | focal adhesion(GO:0005925) cell-substrate junction(GO:0030055) |
| 0.0 | 0.5 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
| 0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.0 | 0.1 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.3 | GO:0005871 | kinesin complex(GO:0005871) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.9 | 20.4 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
| 2.1 | 12.9 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 2.0 | 5.9 | GO:0005368 | beta-alanine transmembrane transporter activity(GO:0001761) taurine transmembrane transporter activity(GO:0005368) taurine:sodium symporter activity(GO:0005369) |
| 1.9 | 5.6 | GO:0050262 | ribosylnicotinamide kinase activity(GO:0050262) ribosylnicotinate kinase activity(GO:0061769) |
| 1.8 | 5.3 | GO:0047936 | glucose 1-dehydrogenase [NAD(P)] activity(GO:0047936) |
| 1.7 | 5.2 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
| 1.6 | 9.5 | GO:0032810 | sterol response element binding(GO:0032810) |
| 1.5 | 4.6 | GO:0004903 | growth hormone receptor activity(GO:0004903) |
| 1.5 | 6.2 | GO:0008386 | cholesterol monooxygenase (side-chain-cleaving) activity(GO:0008386) |
| 1.5 | 6.0 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 1.4 | 15.9 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 1.4 | 7.2 | GO:0035478 | chylomicron binding(GO:0035478) |
| 1.4 | 4.3 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 1.4 | 4.2 | GO:0005333 | norepinephrine transmembrane transporter activity(GO:0005333) |
| 1.4 | 5.5 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 1.4 | 4.1 | GO:0001147 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 1.3 | 5.3 | GO:0005118 | sevenless binding(GO:0005118) |
| 1.3 | 3.9 | GO:0016749 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 1.3 | 9.1 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) hemi-methylated DNA-binding(GO:0044729) |
| 1.2 | 8.5 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 1.2 | 8.4 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 1.2 | 6.0 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 1.2 | 3.6 | GO:1902121 | lithocholic acid binding(GO:1902121) |
| 1.1 | 5.7 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 1.1 | 3.4 | GO:0016420 | [acyl-carrier-protein] S-malonyltransferase activity(GO:0004314) S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
| 1.1 | 5.6 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 1.1 | 3.4 | GO:0016855 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 1.1 | 3.3 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
| 1.1 | 9.8 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 1.1 | 1.1 | GO:0001132 | RNA polymerase II transcription factor activity, TBP-class protein binding, involved in preinitiation complex assembly(GO:0001129) RNA polymerase II transcription factor activity, TBP-class protein binding(GO:0001132) |
| 1.1 | 4.3 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 1.0 | 3.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 1.0 | 3.1 | GO:0004371 | glycerone kinase activity(GO:0004371) FAD-AMP lyase (cyclizing) activity(GO:0034012) triokinase activity(GO:0050354) |
| 1.0 | 11.2 | GO:0008494 | translation activator activity(GO:0008494) |
| 1.0 | 6.0 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 1.0 | 4.0 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 1.0 | 5.9 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 1.0 | 3.0 | GO:0015229 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
| 1.0 | 27.2 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 1.0 | 10.7 | GO:0051870 | methotrexate binding(GO:0051870) |
| 1.0 | 1.9 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.9 | 5.6 | GO:0016416 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
| 0.9 | 2.7 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
| 0.9 | 1.8 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.9 | 0.9 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.8 | 2.5 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.8 | 11.3 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.8 | 7.3 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.8 | 2.4 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
| 0.8 | 8.0 | GO:0043559 | insulin binding(GO:0043559) |
| 0.8 | 4.7 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
| 0.8 | 2.4 | GO:0004572 | mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase activity(GO:0004572) |
| 0.8 | 11.0 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.8 | 1.6 | GO:0070401 | NADP+ binding(GO:0070401) |
| 0.8 | 0.8 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.8 | 2.3 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.8 | 2.3 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.8 | 0.8 | GO:0016005 | phospholipase A2 activator activity(GO:0016005) |
| 0.8 | 2.3 | GO:0001729 | ceramide kinase activity(GO:0001729) |
| 0.8 | 2.3 | GO:0004342 | glucosamine-6-phosphate deaminase activity(GO:0004342) |
| 0.7 | 2.2 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.7 | 8.1 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.7 | 2.9 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.7 | 2.9 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.7 | 5.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.7 | 2.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.7 | 1.4 | GO:0004921 | interleukin-11 receptor activity(GO:0004921) interleukin-11 binding(GO:0019970) |
| 0.7 | 2.2 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.7 | 0.7 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.7 | 3.6 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.7 | 0.7 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.7 | 2.8 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.7 | 2.8 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.7 | 2.8 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 0.7 | 6.3 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.7 | 16.7 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.7 | 2.1 | GO:0005171 | hepatocyte growth factor receptor binding(GO:0005171) |
| 0.7 | 2.8 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
| 0.7 | 6.8 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.7 | 2.0 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.7 | 2.7 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
| 0.7 | 1.3 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.7 | 2.6 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.7 | 2.0 | GO:0000402 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
| 0.7 | 0.7 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.6 | 1.9 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.6 | 3.2 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 0.6 | 3.2 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.6 | 3.9 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.6 | 4.4 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.6 | 1.9 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.6 | 8.7 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
| 0.6 | 3.1 | GO:0004905 | interferon receptor activity(GO:0004904) type I interferon receptor activity(GO:0004905) type I interferon binding(GO:0019962) |
| 0.6 | 0.6 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.6 | 1.8 | GO:0005017 | platelet-derived growth factor-activated receptor activity(GO:0005017) |
| 0.6 | 4.8 | GO:0005534 | galactose binding(GO:0005534) |
| 0.6 | 4.2 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
| 0.6 | 2.9 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.6 | 2.9 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
| 0.6 | 3.5 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.6 | 1.1 | GO:0005287 | high-affinity basic amino acid transmembrane transporter activity(GO:0005287) high-affinity arginine transmembrane transporter activity(GO:0005289) high-affinity lysine transmembrane transporter activity(GO:0005292) |
| 0.6 | 6.3 | GO:0005113 | patched binding(GO:0005113) |
| 0.6 | 5.1 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.6 | 3.4 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.6 | 1.7 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.6 | 7.8 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.6 | 1.7 | GO:0016034 | maleylacetoacetate isomerase activity(GO:0016034) |
| 0.6 | 1.1 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.5 | 4.3 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.5 | 1.6 | GO:0032142 | single guanine insertion binding(GO:0032142) |
| 0.5 | 2.2 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.5 | 1.1 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.5 | 0.5 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.5 | 0.5 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.5 | 1.6 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
| 0.5 | 5.2 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.5 | 2.1 | GO:0086077 | gap junction channel activity involved in AV node cell-bundle of His cell electrical coupling(GO:0086077) |
| 0.5 | 2.6 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) |
| 0.5 | 2.6 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
| 0.5 | 1.5 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.5 | 1.5 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
| 0.5 | 3.6 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.5 | 3.1 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
| 0.5 | 0.5 | GO:0004637 | phosphoribosylamine-glycine ligase activity(GO:0004637) |
| 0.5 | 3.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.5 | 8.1 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.5 | 2.5 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.5 | 1.5 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.5 | 1.0 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
| 0.5 | 2.0 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.5 | 2.0 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.5 | 1.5 | GO:0016872 | inositol-3-phosphate synthase activity(GO:0004512) intramolecular lyase activity(GO:0016872) |
| 0.5 | 3.4 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.5 | 4.4 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.5 | 2.0 | GO:0034437 | glycoprotein transporter activity(GO:0034437) |
| 0.5 | 1.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.5 | 1.9 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.5 | 2.4 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.5 | 3.4 | GO:0019770 | IgG receptor activity(GO:0019770) |
| 0.5 | 2.9 | GO:0044020 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.5 | 0.5 | GO:0072354 | histone kinase activity (H3-T3 specific)(GO:0072354) |
| 0.5 | 1.4 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.5 | 3.8 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.5 | 2.3 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 0.5 | 1.9 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.5 | 5.5 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.5 | 3.2 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.5 | 1.4 | GO:0098808 | mRNA cap binding(GO:0098808) |
| 0.5 | 1.8 | GO:0036470 | tyrosine 3-monooxygenase activator activity(GO:0036470) L-dopa decarboxylase activator activity(GO:0036478) |
| 0.5 | 1.8 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.4 | 25.6 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.4 | 2.2 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.4 | 1.3 | GO:0009918 | sterol delta7 reductase activity(GO:0009918) 7-dehydrocholesterol reductase activity(GO:0047598) |
| 0.4 | 1.3 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.4 | 2.2 | GO:0015254 | glycerol channel activity(GO:0015254) |
| 0.4 | 2.6 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.4 | 1.7 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.4 | 3.5 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.4 | 5.2 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.4 | 0.9 | GO:0001156 | TFIIIC-class transcription factor binding(GO:0001156) |
| 0.4 | 3.9 | GO:0004321 | fatty-acyl-CoA synthase activity(GO:0004321) |
| 0.4 | 2.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.4 | 1.3 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) |
| 0.4 | 3.0 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.4 | 5.9 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.4 | 0.4 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
| 0.4 | 3.8 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.4 | 1.7 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.4 | 1.3 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) |
| 0.4 | 0.4 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
| 0.4 | 5.4 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.4 | 0.8 | GO:0048256 | flap endonuclease activity(GO:0048256) |
| 0.4 | 16.8 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.4 | 1.7 | GO:0008802 | betaine-aldehyde dehydrogenase activity(GO:0008802) |
| 0.4 | 2.1 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.4 | 4.2 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.4 | 2.1 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.4 | 1.2 | GO:0004379 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
| 0.4 | 4.5 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.4 | 3.7 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
| 0.4 | 9.8 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.4 | 3.6 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.4 | 4.8 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.4 | 0.8 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.4 | 2.4 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.4 | 2.3 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.4 | 0.4 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.4 | 4.7 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.4 | 1.2 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
| 0.4 | 2.3 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.4 | 5.0 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.4 | 8.8 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.4 | 1.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.4 | 3.8 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.4 | 2.3 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.4 | 1.1 | GO:0008263 | pyrimidine-specific mismatch base pair DNA N-glycosylase activity(GO:0008263) |
| 0.4 | 3.4 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.4 | 1.5 | GO:0031699 | beta-3 adrenergic receptor binding(GO:0031699) |
| 0.4 | 1.1 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.4 | 0.8 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
| 0.4 | 3.0 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.4 | 12.6 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.4 | 8.2 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.4 | 6.3 | GO:0005522 | profilin binding(GO:0005522) |
| 0.4 | 1.1 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.4 | 1.5 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.4 | 1.8 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
| 0.4 | 0.4 | GO:0016901 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.4 | 4.0 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.4 | 4.3 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.4 | 2.5 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.4 | 0.7 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.4 | 4.6 | GO:0015250 | water channel activity(GO:0015250) |
| 0.4 | 1.8 | GO:0070287 | ferritin receptor activity(GO:0070287) |
| 0.4 | 1.1 | GO:0004911 | interleukin-2 receptor activity(GO:0004911) |
| 0.4 | 1.1 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
| 0.3 | 1.4 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.3 | 2.4 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.3 | 5.9 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.3 | 2.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.3 | 4.8 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.3 | 0.3 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.3 | 1.0 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.3 | 2.0 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.3 | 1.0 | GO:0030622 | U4atac snRNA binding(GO:0030622) |
| 0.3 | 3.0 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.3 | 1.0 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
| 0.3 | 0.7 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.3 | 1.0 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.3 | 0.7 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.3 | 2.6 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.3 | 1.0 | GO:0016213 | linoleoyl-CoA desaturase activity(GO:0016213) |
| 0.3 | 1.6 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.3 | 2.9 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.3 | 1.3 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.3 | 1.3 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.3 | 6.4 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.3 | 2.2 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.3 | 1.0 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.3 | 6.7 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.3 | 15.3 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.3 | 3.5 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.3 | 0.3 | GO:0019961 | interferon binding(GO:0019961) |
| 0.3 | 1.0 | GO:0016405 | CoA-ligase activity(GO:0016405) |
| 0.3 | 1.0 | GO:0019150 | D-ribulokinase activity(GO:0019150) |
| 0.3 | 1.6 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
| 0.3 | 1.9 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.3 | 3.8 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.3 | 1.3 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.3 | 1.3 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.3 | 1.9 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.3 | 1.3 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.3 | 1.3 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.3 | 0.6 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 0.3 | 0.9 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
| 0.3 | 3.7 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.3 | 8.7 | GO:0015238 | drug transmembrane transporter activity(GO:0015238) |
| 0.3 | 2.8 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.3 | 0.9 | GO:0003826 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.3 | 1.5 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.3 | 4.6 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.3 | 2.8 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.3 | 2.1 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.3 | 1.8 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.3 | 1.2 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.3 | 0.3 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
| 0.3 | 1.2 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
| 0.3 | 10.5 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.3 | 0.9 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.3 | 0.3 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.3 | 1.2 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
| 0.3 | 0.3 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.3 | 1.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.3 | 2.4 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.3 | 3.3 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.3 | 8.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.3 | 0.6 | GO:0030619 | U1 snRNA binding(GO:0030619) |
| 0.3 | 6.7 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.3 | 0.6 | GO:0046977 | TAP binding(GO:0046977) |
| 0.3 | 4.9 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.3 | 0.9 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.3 | 1.5 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.3 | 2.3 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.3 | 1.7 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.3 | 0.6 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.3 | 2.3 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.3 | 1.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.3 | 2.6 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.3 | 0.9 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.3 | 7.4 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.3 | 0.8 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.3 | 1.7 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.3 | 1.1 | GO:0034595 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) phosphatidylinositol phosphate 5-phosphatase activity(GO:0034595) |
| 0.3 | 2.8 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.3 | 3.6 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.3 | 8.6 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.3 | 1.1 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.3 | 2.5 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
| 0.3 | 10.7 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.3 | 0.8 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.3 | 2.5 | GO:0048019 | receptor antagonist activity(GO:0048019) |
| 0.3 | 0.5 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.3 | 1.1 | GO:0016273 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.3 | 6.8 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.3 | 0.5 | GO:0030629 | U6 snRNA 3'-end binding(GO:0030629) |
| 0.3 | 2.2 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.3 | 11.8 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.3 | 4.6 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
| 0.3 | 0.8 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.3 | 1.6 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.3 | 1.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.3 | 1.8 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.3 | 0.8 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.3 | 9.4 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.3 | 1.3 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.3 | 1.6 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.3 | 1.8 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.3 | 0.8 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.3 | 1.3 | GO:2001070 | starch binding(GO:2001070) |
| 0.3 | 2.6 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.3 | 1.5 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.3 | 1.0 | GO:0003844 | 1,4-alpha-glucan branching enzyme activity(GO:0003844) |
| 0.3 | 19.2 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.3 | 0.8 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.2 | 1.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.2 | 1.7 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.2 | 0.7 | GO:0004912 | interleukin-3 receptor activity(GO:0004912) interleukin-3 binding(GO:0019978) |
| 0.2 | 3.0 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.2 | 5.9 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.2 | 6.8 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.2 | 1.2 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
| 0.2 | 3.6 | GO:0031432 | titin binding(GO:0031432) |
| 0.2 | 2.6 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.2 | 3.8 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.2 | 0.7 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.2 | 1.7 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.2 | 4.0 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.2 | 2.6 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.2 | 2.4 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.2 | 1.6 | GO:0001179 | RNA polymerase I transcription factor binding(GO:0001179) |
| 0.2 | 1.9 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.2 | 1.4 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.2 | 1.9 | GO:0005124 | scavenger receptor binding(GO:0005124) |
| 0.2 | 0.9 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.2 | 1.9 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.2 | 0.2 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.2 | 4.4 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.2 | 0.7 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
| 0.2 | 3.7 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.2 | 3.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.2 | 2.7 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.2 | 0.7 | GO:0070140 | isopeptidase activity(GO:0070122) ubiquitin-like protein-specific isopeptidase activity(GO:0070138) SUMO-specific isopeptidase activity(GO:0070140) |
| 0.2 | 1.1 | GO:0070012 | oligopeptidase activity(GO:0070012) |
| 0.2 | 1.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.2 | 2.0 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.2 | 0.7 | GO:0004798 | thymidylate kinase activity(GO:0004798) |
| 0.2 | 0.7 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
| 0.2 | 0.9 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.2 | 6.2 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.2 | 1.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.2 | 0.9 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.2 | 2.4 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.2 | 0.7 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.2 | 1.1 | GO:0070728 | leucine binding(GO:0070728) |
| 0.2 | 1.3 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.2 | 1.1 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.2 | 0.2 | GO:0001007 | transcription factor activity, RNA polymerase III transcription factor binding(GO:0001007) |
| 0.2 | 1.5 | GO:0070403 | NAD+ binding(GO:0070403) |
| 0.2 | 1.5 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
| 0.2 | 0.9 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.2 | 0.6 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.2 | 0.6 | GO:0004326 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) |
| 0.2 | 0.6 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.2 | 0.6 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) |
| 0.2 | 2.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.2 | 0.2 | GO:1990955 | G-rich single-stranded DNA binding(GO:1990955) |
| 0.2 | 0.6 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.2 | 0.4 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) |
| 0.2 | 0.8 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.2 | 0.6 | GO:0070002 | glutamic-type peptidase activity(GO:0070002) |
| 0.2 | 4.4 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.2 | 6.4 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.2 | 14.9 | GO:0004004 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) |
| 0.2 | 2.8 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.2 | 2.8 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.2 | 2.0 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.2 | 0.4 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.2 | 1.6 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.2 | 2.8 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.2 | 1.4 | GO:0089720 | caspase binding(GO:0089720) |
| 0.2 | 0.6 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.2 | 1.4 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.2 | 7.1 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.2 | 0.2 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
| 0.2 | 3.2 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.2 | 4.9 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.2 | 1.5 | GO:0016896 | exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
| 0.2 | 0.8 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.2 | 1.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.2 | 3.4 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.2 | 2.7 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.2 | 0.8 | GO:0004478 | methionine adenosyltransferase activity(GO:0004478) |
| 0.2 | 1.5 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.2 | 0.6 | GO:0002061 | uracil binding(GO:0002058) pyrimidine nucleobase binding(GO:0002061) |
| 0.2 | 0.9 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.2 | 2.6 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.2 | 2.4 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.2 | 0.7 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.2 | 3.7 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.2 | 0.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.2 | 2.6 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.2 | 0.5 | GO:0016657 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.2 | 0.5 | GO:0070905 | serine binding(GO:0070905) |
| 0.2 | 1.5 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.2 | 0.5 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.2 | 0.5 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
| 0.2 | 2.7 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.2 | 0.5 | GO:0004454 | ketohexokinase activity(GO:0004454) |
| 0.2 | 3.8 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.2 | 1.3 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.2 | 0.5 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.2 | 0.7 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.2 | 0.7 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.2 | 0.5 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.2 | 1.6 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.2 | 0.7 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.2 | 1.2 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
| 0.2 | 0.5 | GO:0086059 | voltage-gated calcium channel activity involved SA node cell action potential(GO:0086059) |
| 0.2 | 2.9 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.2 | 1.2 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.2 | 1.2 | GO:0070061 | fructose binding(GO:0070061) |
| 0.2 | 0.3 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
| 0.2 | 0.2 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.2 | 0.2 | GO:0015932 | nucleobase-containing compound transmembrane transporter activity(GO:0015932) nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.2 | 11.7 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.2 | 0.5 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.2 | 0.7 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.2 | 1.5 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.2 | 1.1 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.2 | 5.8 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.2 | 2.2 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.2 | 1.1 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.2 | 0.6 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.2 | 5.4 | GO:0034062 | RNA polymerase activity(GO:0034062) |
| 0.2 | 2.7 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.2 | 0.6 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.2 | 0.6 | GO:0046030 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) inositol trisphosphate phosphatase activity(GO:0046030) |
| 0.2 | 11.8 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.2 | 0.6 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.2 | 0.3 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.2 | 2.5 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.2 | 1.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.2 | 1.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.2 | 2.6 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.2 | 1.7 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.2 | 1.2 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.2 | 0.5 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.2 | 1.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.2 | 4.0 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.2 | 3.4 | GO:0005521 | lamin binding(GO:0005521) |
| 0.2 | 0.9 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.2 | 0.5 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.2 | 0.6 | GO:0004736 | pyruvate carboxylase activity(GO:0004736) |
| 0.2 | 0.5 | GO:0080130 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.1 | 0.3 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
| 0.1 | 1.8 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.1 | 1.6 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.1 | 9.8 | GO:0004386 | helicase activity(GO:0004386) |
| 0.1 | 3.2 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.1 | 1.0 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 0.1 | 26.0 | GO:0008168 | methyltransferase activity(GO:0008168) |
| 0.1 | 7.1 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.1 | 0.1 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.1 | 0.4 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.1 | 9.5 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.1 | 0.4 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.1 | 0.6 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.1 | 16.1 | GO:0019783 | ubiquitin-like protein-specific protease activity(GO:0019783) |
| 0.1 | 1.0 | GO:0010859 | calcium-dependent cysteine-type endopeptidase inhibitor activity(GO:0010859) |
| 0.1 | 0.6 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.1 | 0.8 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.1 | 1.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.1 | 0.4 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.1 | 0.3 | GO:0004096 | catalase activity(GO:0004096) |
| 0.1 | 0.7 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.1 | 6.8 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.4 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.1 | 3.0 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.1 | 0.5 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 1.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.1 | 0.7 | GO:0004925 | prolactin receptor activity(GO:0004925) |
| 0.1 | 4.7 | GO:0004527 | exonuclease activity(GO:0004527) |
| 0.1 | 0.4 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
| 0.1 | 0.5 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.1 | 1.8 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 1.7 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.1 | 4.4 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 3.6 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 0.9 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
| 0.1 | 0.8 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
| 0.1 | 1.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.1 | 1.3 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.1 | 2.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.1 | 13.3 | GO:0008013 | beta-catenin binding(GO:0008013) |
| 0.1 | 0.6 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 0.5 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.1 | 2.0 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.1 | 0.4 | GO:0070279 | vitamin B6 binding(GO:0070279) |
| 0.1 | 0.4 | GO:0004492 | methylmalonyl-CoA decarboxylase activity(GO:0004492) |
| 0.1 | 0.4 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.1 | 0.9 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.1 | 0.5 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.1 | 5.3 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.1 | 6.8 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 1.0 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.1 | 2.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.7 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.1 | 1.4 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.1 | 0.4 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
| 0.1 | 0.2 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
| 0.1 | 1.8 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.1 | 0.5 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 0.8 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.1 | 1.6 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 3.0 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.1 | 2.1 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 1.3 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.1 | 1.0 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.1 | 0.3 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 0.8 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.2 | GO:0004161 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.1 | 2.0 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.1 | 2.1 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.1 | 1.0 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
| 0.1 | 0.6 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.1 | 0.4 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.1 | 0.6 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.1 | 1.4 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.1 | 0.4 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.9 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.1 | 2.1 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.1 | 1.0 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.1 | 4.4 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.1 | 0.6 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.1 | 0.3 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.1 | 1.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.1 | 3.1 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.1 | 0.3 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.1 | 0.2 | GO:0090555 | phosphatidylethanolamine-translocating ATPase activity(GO:0090555) |
| 0.1 | 0.5 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.1 | 0.5 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 0.9 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.1 | 5.0 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
| 0.1 | 3.5 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.1 | 0.8 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 2.6 | GO:0043531 | ADP binding(GO:0043531) |
| 0.1 | 3.4 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 3.1 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.1 | 1.3 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
| 0.1 | 0.7 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.1 | 2.2 | GO:0004521 | endoribonuclease activity(GO:0004521) |
| 0.1 | 5.7 | GO:0004518 | nuclease activity(GO:0004518) |
| 0.1 | 0.7 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.1 | 1.0 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.1 | 0.4 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.1 | 0.5 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.1 | 0.3 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.1 | 20.5 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.1 | 2.2 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.1 | 0.1 | GO:0008967 | phosphoglycolate phosphatase activity(GO:0008967) |
| 0.1 | 29.9 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
| 0.1 | 0.4 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.1 | 3.0 | GO:0016504 | peptidase activator activity(GO:0016504) |
| 0.1 | 1.1 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 3.8 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.1 | 0.4 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.1 | 1.5 | GO:0001076 | transcription factor activity, RNA polymerase II transcription factor binding(GO:0001076) |
| 0.1 | 2.8 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.1 | 1.7 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 0.5 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 1.6 | GO:0005537 | mannose binding(GO:0005537) |
| 0.1 | 0.3 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.1 | 4.3 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.1 | 1.0 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.1 | 1.3 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
| 0.1 | 1.0 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 0.5 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.1 | 0.2 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.1 | 0.3 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.1 | 0.6 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.1 | 3.3 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 1.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 1.9 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.1 | 0.2 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.1 | 0.8 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.1 | 0.2 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.1 | 1.1 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 0.2 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.1 | 0.2 | GO:0004134 | glycogen debranching enzyme activity(GO:0004133) 4-alpha-glucanotransferase activity(GO:0004134) amylo-alpha-1,6-glucosidase activity(GO:0004135) |
| 0.1 | 2.4 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.1 | 0.1 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
| 0.1 | 1.1 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.1 | 0.8 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 0.2 | GO:0010428 | methyl-CpNpG binding(GO:0010428) |
| 0.1 | 0.3 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.1 | 1.8 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.1 | 0.4 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.3 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 3.7 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.1 | 8.6 | GO:0005178 | integrin binding(GO:0005178) |
| 0.1 | 1.2 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.1 | 0.2 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
| 0.1 | 5.0 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.1 | 0.2 | GO:0071796 | K6-linked polyubiquitin binding(GO:0071796) |
| 0.1 | 0.3 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.1 | 5.4 | GO:0035326 | enhancer binding(GO:0035326) |
| 0.1 | 0.4 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.1 | 1.2 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.1 | 6.0 | GO:0035591 | signaling adaptor activity(GO:0035591) |
| 0.1 | 0.1 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.1 | 0.4 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
| 0.1 | 1.6 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.1 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.1 | 0.3 | GO:0048185 | activin binding(GO:0048185) |
| 0.1 | 0.1 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.1 | 0.5 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.1 | 0.6 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.1 | 0.5 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.1 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.1 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.1 | 0.3 | GO:0045182 | translation regulator activity(GO:0045182) |
| 0.1 | 0.5 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.1 | 0.5 | GO:0052655 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.1 | 0.4 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
| 0.1 | 0.4 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.1 | 0.3 | GO:0070990 | snRNP binding(GO:0070990) U1 snRNP binding(GO:1990446) |
| 0.1 | 0.4 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.1 | 1.5 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.1 | 1.8 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.1 | 0.1 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.1 | 0.3 | GO:0042008 | interleukin-18 receptor activity(GO:0042008) |
| 0.1 | 2.3 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.1 | 0.2 | GO:0004373 | glycogen (starch) synthase activity(GO:0004373) |
| 0.1 | 3.6 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 1.1 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
| 0.1 | 0.3 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.1 | 4.8 | GO:0032182 | ubiquitin-like protein binding(GO:0032182) |
| 0.1 | 2.8 | GO:0008238 | exopeptidase activity(GO:0008238) |
| 0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 1.3 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.1 | 0.3 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.1 | 0.6 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.1 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.1 | 0.3 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.1 | 0.2 | GO:0072591 | citrate-L-glutamate ligase activity(GO:0072591) |
| 0.1 | 0.4 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.6 | GO:0016594 | glycine binding(GO:0016594) |
| 0.1 | 0.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.1 | 1.4 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.1 | 0.2 | GO:0016706 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, 2-oxoglutarate as one donor, and incorporation of one atom each of oxygen into both donors(GO:0016706) |
| 0.1 | 0.3 | GO:0016840 | carbon-nitrogen lyase activity(GO:0016840) |
| 0.1 | 1.1 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.1 | 0.2 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
| 0.1 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.1 | 0.2 | GO:0005174 | CD40 receptor binding(GO:0005174) |
| 0.1 | 70.1 | GO:0003723 | RNA binding(GO:0003723) |
| 0.1 | 0.4 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.1 | 0.3 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
| 0.1 | 0.2 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.1 | 0.5 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.1 | 0.5 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.1 | 0.3 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.1 | 0.5 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.1 | 0.4 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.1 | 0.1 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.0 | 1.5 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 11.3 | GO:0001071 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
| 0.0 | 1.7 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.0 | 1.0 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.0 | 0.7 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.0 | 0.3 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.2 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 0.0 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.0 | 1.7 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.0 | 0.6 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.0 | 0.9 | GO:0071949 | FAD binding(GO:0071949) |
| 0.0 | 0.2 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.2 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.0 | 0.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 1.0 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.0 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.1 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.0 | 0.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.0 | 0.2 | GO:0052796 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 0.8 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.8 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.0 | 0.1 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.4 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.0 | 0.7 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 1.2 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 1.9 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.0 | 0.4 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.7 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 1.3 | GO:0043028 | cysteine-type endopeptidase regulator activity involved in apoptotic process(GO:0043028) |
| 0.0 | 0.0 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.0 | 0.1 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 0.6 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.3 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.7 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.0 | 0.1 | GO:0097199 | cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097199) |
| 0.0 | 0.1 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 8.4 | GO:0008270 | zinc ion binding(GO:0008270) |
| 0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 2.9 | GO:0008083 | growth factor activity(GO:0008083) |
| 0.0 | 0.3 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.3 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.0 | 3.0 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 1.0 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.3 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 0.7 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.0 | 0.2 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.5 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.0 | 0.1 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
| 0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 2.7 | GO:0008237 | metallopeptidase activity(GO:0008237) |
| 0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.1 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
| 0.0 | 0.6 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.2 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.0 | 35.3 | GO:0003677 | DNA binding(GO:0003677) |
| 0.0 | 0.2 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 1.3 | GO:0032947 | protein complex scaffold(GO:0032947) |
| 0.0 | 0.2 | GO:0046332 | SMAD binding(GO:0046332) |
| 0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.1 | GO:0016824 | hydrolase activity, acting on acid halide bonds(GO:0016824) hydrolase activity, acting on acid halide bonds, in C-halide compounds(GO:0019120) alkylhalidase activity(GO:0047651) |
| 0.0 | 0.2 | GO:0009975 | cyclase activity(GO:0009975) |
| 0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.0 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.0 | GO:0047291 | lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
| 0.0 | 0.6 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.0 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.1 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
| 0.0 | 0.2 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
| 0.0 | 6.7 | GO:0005509 | calcium ion binding(GO:0005509) |
| 0.0 | 0.1 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 0.0 | 0.0 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.3 | 2.3 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.5 | 30.5 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.5 | 1.5 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.5 | 6.4 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.5 | 18.9 | PID MYC PATHWAY | C-MYC pathway |
| 0.4 | 9.4 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.4 | 17.0 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.4 | 0.9 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.4 | 2.5 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.3 | 0.6 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.3 | 7.2 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.3 | 11.6 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.3 | 14.8 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.3 | 15.7 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.3 | 2.7 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.3 | 18.0 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.3 | 0.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.3 | 0.8 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.2 | 5.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.2 | 19.5 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.2 | 7.8 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.2 | 0.4 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.2 | 0.6 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.2 | 2.7 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.2 | 18.2 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.2 | 8.1 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.2 | 1.3 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.2 | 1.7 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.2 | 3.9 | PID ATM PATHWAY | ATM pathway |
| 0.2 | 0.9 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.2 | 11.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.2 | 32.2 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.2 | 0.5 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.2 | 4.0 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.2 | 5.4 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.2 | 0.3 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.2 | 3.0 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 3.5 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.1 | 10.5 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.1 | 3.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 1.5 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.1 | 2.6 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 2.2 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.1 | 1.4 | PID EPO PATHWAY | EPO signaling pathway |
| 0.1 | 2.4 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.1 | 8.6 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 5.2 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.1 | 4.4 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.1 | 1.0 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 7.3 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.1 | 1.5 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.1 | 0.9 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 0.8 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 6.1 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.1 | 3.8 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.1 | 6.0 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 3.6 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.1 | 1.7 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.1 | 3.0 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.1 | 3.2 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 0.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 1.4 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.1 | 4.7 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.1 | 1.6 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.1 | 9.4 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.1 | 2.0 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.1 | 5.7 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.1 | 1.1 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.1 | 3.2 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.1 | 4.4 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.1 | 1.5 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 1.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 1.1 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.1 | 6.7 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.1 | 1.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 1.7 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.1 | 2.6 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.1 | 0.7 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.1 | 1.0 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 0.9 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 0.2 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.1 | 0.3 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.1 | 1.3 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.1 | 1.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 1.0 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 3.2 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.1 | 1.5 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.1 | 1.4 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 1.4 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.1 | 2.5 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 2.0 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.1 | 1.1 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.1 | 0.8 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.1 | 14.0 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.1 | 1.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.1 | 0.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 0.4 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 1.8 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.0 | 0.7 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 1.1 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 2.1 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.6 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 1.1 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 1.4 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 0.4 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.8 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.3 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.4 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 1.6 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 0.3 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 2.6 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 0.3 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.3 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.7 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.7 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.3 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 0.1 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.2 | PID INSULIN PATHWAY | Insulin Pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 1.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.9 | 14.5 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.9 | 2.6 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.9 | 0.9 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.8 | 0.8 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.8 | 3.2 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
| 0.8 | 10.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.8 | 0.8 | REACTOME SIGNALING BY FGFR MUTANTS | Genes involved in Signaling by FGFR mutants |
| 0.6 | 5.6 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.5 | 11.1 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.5 | 2.8 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.5 | 16.0 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.4 | 3.1 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.4 | 4.8 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.4 | 8.2 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.4 | 5.6 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.4 | 3.8 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.4 | 16.9 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.4 | 9.0 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.4 | 8.9 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.4 | 15.6 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.4 | 10.3 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.4 | 11.0 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.4 | 12.4 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.4 | 4.7 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.3 | 5.2 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.3 | 3.5 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.3 | 5.3 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.3 | 3.7 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.3 | 21.7 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.3 | 5.1 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.3 | 3.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.3 | 6.2 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.3 | 0.9 | REACTOME GLYCOSAMINOGLYCAN METABOLISM | Genes involved in Glycosaminoglycan metabolism |
| 0.3 | 12.2 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.3 | 13.3 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.3 | 4.8 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.3 | 4.5 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.3 | 8.1 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.3 | 2.8 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.3 | 2.8 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.3 | 10.5 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.3 | 3.1 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.3 | 10.3 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.3 | 2.5 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
| 0.2 | 4.7 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.2 | 1.0 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.2 | 7.6 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.2 | 0.7 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.2 | 5.0 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.2 | 5.8 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.2 | 0.5 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.2 | 4.0 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.2 | 5.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.2 | 12.3 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.2 | 0.6 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
| 0.2 | 3.8 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.2 | 3.3 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.2 | 7.3 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.2 | 1.0 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.2 | 1.6 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.2 | 4.7 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.2 | 8.2 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.2 | 0.2 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.2 | 3.1 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.2 | 0.6 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.2 | 3.3 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
| 0.2 | 0.6 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.2 | 4.5 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.2 | 9.3 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.2 | 2.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.2 | 3.9 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.2 | 6.0 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.2 | 4.4 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.2 | 2.6 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.2 | 3.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.2 | 5.6 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.2 | 7.5 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.2 | 1.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.2 | 0.6 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.1 | 2.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 0.9 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
| 0.1 | 2.5 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 3.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 2.8 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 11.5 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.1 | 11.7 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.1 | 1.7 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.1 | 17.6 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.1 | 0.9 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.1 | 0.1 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.1 | 1.4 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.1 | 6.7 | REACTOME MEIOSIS | Genes involved in Meiosis |
| 0.1 | 4.7 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.1 | 1.5 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.1 | 2.5 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 8.7 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.1 | 1.9 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
| 0.1 | 1.7 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.1 | 25.5 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.1 | 0.8 | REACTOME TRANSCRIPTION | Genes involved in Transcription |
| 0.1 | 2.5 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 0.5 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.1 | 1.6 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.1 | 9.8 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.1 | 1.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.1 | 9.5 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.1 | 1.7 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.1 | 1.1 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.1 | 0.2 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
| 0.1 | 2.4 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.1 | 0.8 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.1 | 0.8 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.1 | 7.3 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
| 0.1 | 0.9 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.1 | 4.0 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 5.1 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.1 | 2.1 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 5.1 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.1 | 0.2 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.1 | 0.8 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.1 | 0.7 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.1 | 2.7 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.1 | 0.2 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
| 0.1 | 1.9 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.1 | 2.8 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.1 | 4.4 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.1 | 2.1 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.1 | 1.1 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 1.7 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 7.3 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 1.1 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 0.2 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
| 0.1 | 0.8 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.1 | 3.8 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 0.7 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.1 | 0.4 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.1 | 0.8 | REACTOME CHROMOSOME MAINTENANCE | Genes involved in Chromosome Maintenance |
| 0.1 | 1.1 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.1 | 1.2 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.1 | 1.7 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.1 | 0.7 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.1 | 0.6 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.1 | 2.2 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.1 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 0.5 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.1 | 1.5 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 1.0 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.4 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.0 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 0.0 | 0.3 | REACTOME RNA POL III TRANSCRIPTION | Genes involved in RNA Polymerase III Transcription |
| 0.0 | 2.3 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 1.6 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
| 0.0 | 1.0 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.6 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.7 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.5 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 1.7 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.5 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.0 | 0.5 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.0 | 0.1 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.0 | 0.2 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.4 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 1.3 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.6 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.0 | 1.2 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 0.3 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 2.6 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.0 | 0.4 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 6.2 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.3 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.4 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.0 | 1.1 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.3 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
| 0.0 | 0.4 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.0 | 0.4 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 1.1 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.2 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
| 0.0 | 0.1 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 0.2 | REACTOME SHC MEDIATED CASCADE | Genes involved in SHC-mediated cascade |