12D miR HR13_24
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Foxi1
|
ENSMUSG00000047861.2 | forkhead box I1 |
Foxo1
|
ENSMUSG00000044167.5 | forkhead box O1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Foxo1 | mm10_v2_chr3_+_52268337_52268388 | 0.77 | 5.8e-03 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr12_+_109452833 | 6.35 |
ENSMUST00000056110.8
|
Dlk1
|
delta-like 1 homolog (Drosophila) |
chr5_-_138170992 | 4.35 |
ENSMUST00000139983.1
|
Mcm7
|
minichromosome maintenance deficient 7 (S. cerevisiae) |
chr5_-_138171248 | 3.92 |
ENSMUST00000153867.1
|
Mcm7
|
minichromosome maintenance deficient 7 (S. cerevisiae) |
chr7_+_141476374 | 3.86 |
ENSMUST00000117634.1
|
Tspan4
|
tetraspanin 4 |
chr14_+_64589802 | 3.70 |
ENSMUST00000180610.1
|
A930011O12Rik
|
RIKEN cDNA A930011O12 gene |
chr5_-_138171216 | 3.43 |
ENSMUST00000147920.1
|
Mcm7
|
minichromosome maintenance deficient 7 (S. cerevisiae) |
chr16_-_4559720 | 3.06 |
ENSMUST00000005862.7
|
Tfap4
|
transcription factor AP4 |
chr18_-_47333311 | 2.83 |
ENSMUST00000126684.1
ENSMUST00000156422.1 |
Sema6a
|
sema domain, transmembrane domain (TM), and cytoplasmic domain, (semaphorin) 6A |
chr11_+_3330781 | 2.66 |
ENSMUST00000136536.1
ENSMUST00000093399.4 |
Pik3ip1
|
phosphoinositide-3-kinase interacting protein 1 |
chr12_-_103904887 | 2.62 |
ENSMUST00000074051.5
|
Serpina1c
|
serine (or cysteine) peptidase inhibitor, clade A, member 1C |
chr4_-_82885148 | 2.61 |
ENSMUST00000048430.3
|
Cer1
|
cerberus 1 homolog (Xenopus laevis) |
chr15_-_58324161 | 2.58 |
ENSMUST00000022985.1
|
Klhl38
|
kelch-like 38 |
chr2_+_181767040 | 2.55 |
ENSMUST00000108756.1
|
Myt1
|
myelin transcription factor 1 |
chr18_+_5593566 | 2.43 |
ENSMUST00000160910.1
|
Zeb1
|
zinc finger E-box binding homeobox 1 |
chr2_+_181767283 | 2.42 |
ENSMUST00000108757.2
|
Myt1
|
myelin transcription factor 1 |
chr2_+_130277157 | 2.35 |
ENSMUST00000028890.8
ENSMUST00000159373.1 |
Nop56
|
NOP56 ribonucleoprotein |
chr19_-_28911879 | 2.33 |
ENSMUST00000179171.1
|
AC163993.1
|
AC163993.1 |
chr9_-_45955170 | 2.32 |
ENSMUST00000162072.1
|
Sidt2
|
SID1 transmembrane family, member 2 |
chr6_-_39557830 | 2.31 |
ENSMUST00000036877.3
ENSMUST00000154149.1 |
Dennd2a
|
DENN/MADD domain containing 2A |
chr7_+_140968028 | 2.30 |
ENSMUST00000106040.1
ENSMUST00000026564.8 |
Ifitm1
|
interferon induced transmembrane protein 1 |
chr12_-_103773592 | 2.28 |
ENSMUST00000078869.5
|
Serpina1d
|
serine (or cysteine) peptidase inhibitor, clade A, member 1D |
chr1_-_171196229 | 2.23 |
ENSMUST00000111332.1
|
Pcp4l1
|
Purkinje cell protein 4-like 1 |
chr12_-_103738158 | 2.22 |
ENSMUST00000095450.4
|
Serpina1b
|
serine (or cysteine) preptidase inhibitor, clade A, member 1B |
chr17_-_34627148 | 2.19 |
ENSMUST00000171376.1
ENSMUST00000169287.1 |
Ppt2
|
palmitoyl-protein thioesterase 2 |
chr17_-_34627365 | 2.19 |
ENSMUST00000064953.8
ENSMUST00000170345.1 ENSMUST00000171121.2 ENSMUST00000168391.2 ENSMUST00000169067.2 |
Ppt2
|
palmitoyl-protein thioesterase 2 |
chr12_-_103863551 | 2.12 |
ENSMUST00000085056.6
ENSMUST00000072876.5 ENSMUST00000124717.1 |
Serpina1a
|
serine (or cysteine) peptidase inhibitor, clade A, member 1A |
chr15_+_62178175 | 2.10 |
ENSMUST00000182476.1
|
Pvt1
|
plasmacytoma variant translocation 1 |
chr8_-_53638945 | 2.02 |
ENSMUST00000047768.4
|
Neil3
|
nei like 3 (E. coli) |
chr10_+_4611971 | 2.01 |
ENSMUST00000105590.1
ENSMUST00000067086.7 |
Esr1
|
estrogen receptor 1 (alpha) |
chr3_-_27153861 | 1.99 |
ENSMUST00000108300.1
ENSMUST00000108298.2 |
Ect2
|
ect2 oncogene |
chr5_+_110330697 | 1.93 |
ENSMUST00000112481.1
|
Pole
|
polymerase (DNA directed), epsilon |
chr19_-_34255325 | 1.92 |
ENSMUST00000039631.8
|
Acta2
|
actin, alpha 2, smooth muscle, aorta |
chr1_+_136467958 | 1.89 |
ENSMUST00000047817.6
|
Kif14
|
kinesin family member 14 |
chr16_+_17146937 | 1.88 |
ENSMUST00000115706.1
ENSMUST00000069064.4 |
Ydjc
|
YdjC homolog (bacterial) |
chr17_-_12868126 | 1.87 |
ENSMUST00000089015.3
|
Mas1
|
MAS1 oncogene |
chr15_+_28203726 | 1.86 |
ENSMUST00000067048.6
|
Dnah5
|
dynein, axonemal, heavy chain 5 |
chr4_-_129121889 | 1.84 |
ENSMUST00000139450.1
ENSMUST00000125931.1 ENSMUST00000116444.2 |
Hpca
|
hippocalcin |
chr15_-_79285470 | 1.84 |
ENSMUST00000170955.1
|
Baiap2l2
|
BAI1-associated protein 2-like 2 |
chr9_+_65890237 | 1.83 |
ENSMUST00000045802.6
|
2810417H13Rik
|
RIKEN cDNA 2810417H13 gene |
chr3_-_27153844 | 1.83 |
ENSMUST00000176242.2
ENSMUST00000176780.1 |
Ect2
|
ect2 oncogene |
chr4_+_119637704 | 1.82 |
ENSMUST00000024015.2
|
Guca2a
|
guanylate cyclase activator 2a (guanylin) |
chr11_+_3330401 | 1.79 |
ENSMUST00000045153.4
|
Pik3ip1
|
phosphoinositide-3-kinase interacting protein 1 |
chr15_-_79285502 | 1.78 |
ENSMUST00000165408.1
|
Baiap2l2
|
BAI1-associated protein 2-like 2 |
chr9_+_7272514 | 1.78 |
ENSMUST00000015394.8
|
Mmp13
|
matrix metallopeptidase 13 |
chr2_-_127133909 | 1.75 |
ENSMUST00000110387.3
|
Ncaph
|
non-SMC condensin I complex, subunit H |
chr18_+_4993795 | 1.72 |
ENSMUST00000153016.1
|
Svil
|
supervillin |
chr5_-_90640464 | 1.71 |
ENSMUST00000031317.6
|
Rassf6
|
Ras association (RalGDS/AF-6) domain family member 6 |
chr12_-_71136611 | 1.70 |
ENSMUST00000021486.8
ENSMUST00000166120.1 |
Timm9
|
translocase of inner mitochondrial membrane 9 |
chr18_-_43059418 | 1.69 |
ENSMUST00000025377.7
|
Ppp2r2b
|
protein phosphatase 2 (formerly 2A), regulatory subunit B (PR 52), beta isoform |
chr2_-_51149100 | 1.64 |
ENSMUST00000154545.1
ENSMUST00000017288.2 |
Rnd3
|
Rho family GTPase 3 |
chr10_+_88091070 | 1.63 |
ENSMUST00000048621.7
|
Pmch
|
pro-melanin-concentrating hormone |
chr3_-_27153782 | 1.63 |
ENSMUST00000175857.1
ENSMUST00000177055.1 ENSMUST00000176535.1 |
Ect2
|
ect2 oncogene |
chr11_-_101551837 | 1.62 |
ENSMUST00000017290.4
|
Brca1
|
breast cancer 1 |
chr9_-_45955226 | 1.62 |
ENSMUST00000038488.9
|
Sidt2
|
SID1 transmembrane family, member 2 |
chr8_-_84773381 | 1.59 |
ENSMUST00000109764.1
|
Nfix
|
nuclear factor I/X |
chr11_+_69045640 | 1.59 |
ENSMUST00000108666.1
ENSMUST00000021277.5 |
Aurkb
|
aurora kinase B |
chr1_-_130661613 | 1.57 |
ENSMUST00000027657.7
|
C4bp
|
complement component 4 binding protein |
chr4_-_117178726 | 1.57 |
ENSMUST00000153953.1
ENSMUST00000106436.1 |
Kif2c
|
kinesin family member 2C |
chr1_-_130661584 | 1.56 |
ENSMUST00000137276.2
|
C4bp
|
complement component 4 binding protein |
chr19_+_37376359 | 1.54 |
ENSMUST00000012587.3
|
Kif11
|
kinesin family member 11 |
chr18_-_39489157 | 1.54 |
ENSMUST00000131885.1
|
Nr3c1
|
nuclear receptor subfamily 3, group C, member 1 |
chr3_+_129532386 | 1.54 |
ENSMUST00000071402.2
|
Elovl6
|
ELOVL family member 6, elongation of long chain fatty acids (yeast) |
chr11_+_70214105 | 1.51 |
ENSMUST00000094055.3
ENSMUST00000136328.1 ENSMUST00000126296.1 ENSMUST00000153993.2 |
Slc16a11
|
solute carrier family 16 (monocarboxylic acid transporters), member 11 |
chr11_+_115334731 | 1.50 |
ENSMUST00000106543.1
ENSMUST00000019006.4 |
Otop3
|
otopetrin 3 |
chr11_+_97685903 | 1.49 |
ENSMUST00000107583.2
|
Cisd3
|
CDGSH iron sulfur domain 3 |
chr19_+_53329413 | 1.48 |
ENSMUST00000025998.7
|
Mxi1
|
Max interacting protein 1 |
chr3_+_68584154 | 1.46 |
ENSMUST00000182997.1
|
Schip1
|
schwannomin interacting protein 1 |
chr12_-_108275409 | 1.44 |
ENSMUST00000136175.1
|
Ccdc85c
|
coiled-coil domain containing 85C |
chr18_+_4920509 | 1.43 |
ENSMUST00000126977.1
|
Svil
|
supervillin |
chr17_-_31129602 | 1.43 |
ENSMUST00000024827.4
|
Tff3
|
trefoil factor 3, intestinal |
chr11_+_3332426 | 1.39 |
ENSMUST00000136474.1
|
Pik3ip1
|
phosphoinositide-3-kinase interacting protein 1 |
chr5_-_96164147 | 1.39 |
ENSMUST00000137207.1
|
Cnot6l
|
CCR4-NOT transcription complex, subunit 6-like |
chr5_+_31251678 | 1.38 |
ENSMUST00000054829.7
ENSMUST00000114570.1 ENSMUST00000075611.7 |
Krtcap3
|
keratinocyte associated protein 3 |
chr11_+_70213910 | 1.37 |
ENSMUST00000171032.1
|
Slc16a11
|
solute carrier family 16 (monocarboxylic acid transporters), member 11 |
chr6_-_83536215 | 1.37 |
ENSMUST00000075161.5
|
Actg2
|
actin, gamma 2, smooth muscle, enteric |
chr3_-_27896360 | 1.36 |
ENSMUST00000058077.3
|
Tmem212
|
transmembrane protein 212 |
chr5_-_107687990 | 1.35 |
ENSMUST00000180428.1
|
Gm26692
|
predicted gene, 26692 |
chr14_-_51913393 | 1.34 |
ENSMUST00000004673.7
ENSMUST00000111632.3 |
Ndrg2
|
N-myc downstream regulated gene 2 |
chr15_-_101954276 | 1.33 |
ENSMUST00000164932.1
|
Krt78
|
keratin 78 |
chr17_-_70851710 | 1.33 |
ENSMUST00000166395.2
|
Tgif1
|
TGFB-induced factor homeobox 1 |
chr9_-_45954966 | 1.33 |
ENSMUST00000114573.2
|
Sidt2
|
SID1 transmembrane family, member 2 |
chr5_-_33433976 | 1.33 |
ENSMUST00000173348.1
|
Nkx1-1
|
NK1 transcription factor related, locus 1 (Drosophila) |
chr11_+_97685794 | 1.33 |
ENSMUST00000107584.1
ENSMUST00000107585.2 |
Cisd3
|
CDGSH iron sulfur domain 3 |
chr15_+_78430086 | 1.27 |
ENSMUST00000162808.1
|
Kctd17
|
potassium channel tetramerisation domain containing 17 |
chr1_+_40515362 | 1.27 |
ENSMUST00000027237.5
|
Il18rap
|
interleukin 18 receptor accessory protein |
chr7_-_68264201 | 1.26 |
ENSMUST00000032770.2
|
Pgpep1l
|
pyroglutamyl-peptidase I-like |
chrX_+_169685191 | 1.25 |
ENSMUST00000112104.1
ENSMUST00000112107.1 |
Mid1
|
midline 1 |
chr12_+_38781093 | 1.25 |
ENSMUST00000161513.1
|
Etv1
|
ets variant gene 1 |
chr11_-_102925086 | 1.24 |
ENSMUST00000021311.9
|
Kif18b
|
kinesin family member 18B |
chrX_+_56786527 | 1.24 |
ENSMUST00000144600.1
|
Fhl1
|
four and a half LIM domains 1 |
chr9_+_78615501 | 1.23 |
ENSMUST00000093812.4
|
Cd109
|
CD109 antigen |
chr16_-_92400067 | 1.22 |
ENSMUST00000023672.8
|
Rcan1
|
regulator of calcineurin 1 |
chr7_+_16309577 | 1.22 |
ENSMUST00000002152.6
|
Bbc3
|
BCL2 binding component 3 |
chr13_+_104229366 | 1.21 |
ENSMUST00000022227.6
|
Cenpk
|
centromere protein K |
chr18_-_77767752 | 1.21 |
ENSMUST00000048192.7
|
Haus1
|
HAUS augmin-like complex, subunit 1 |
chr12_+_38780817 | 1.20 |
ENSMUST00000160856.1
|
Etv1
|
ets variant gene 1 |
chr4_-_117182623 | 1.17 |
ENSMUST00000065896.2
|
Kif2c
|
kinesin family member 2C |
chr6_+_34598500 | 1.15 |
ENSMUST00000079391.3
ENSMUST00000142512.1 |
Cald1
|
caldesmon 1 |
chr8_+_20136455 | 1.15 |
ENSMUST00000179299.1
ENSMUST00000096485.4 |
Gm21811
|
predicted gene, 21811 |
chr9_+_47530173 | 1.15 |
ENSMUST00000114548.1
ENSMUST00000152459.1 ENSMUST00000143026.1 ENSMUST00000085909.2 ENSMUST00000114547.1 ENSMUST00000034581.3 |
Cadm1
|
cell adhesion molecule 1 |
chr13_+_55445301 | 1.15 |
ENSMUST00000001115.8
ENSMUST00000099482.3 |
Grk6
|
G protein-coupled receptor kinase 6 |
chr7_+_19518731 | 1.14 |
ENSMUST00000078908.4
|
Nkpd1
|
NTPase, KAP family P-loop domain containing 1 |
chr17_+_47505073 | 1.14 |
ENSMUST00000183210.1
|
Ccnd3
|
cyclin D3 |
chr16_+_4036942 | 1.13 |
ENSMUST00000137748.1
ENSMUST00000006136.4 ENSMUST00000157044.1 ENSMUST00000120009.1 |
Dnase1
|
deoxyribonuclease I |
chr13_+_49544443 | 1.13 |
ENSMUST00000177948.1
ENSMUST00000021820.6 |
Aspn
|
asporin |
chr6_+_14901344 | 1.12 |
ENSMUST00000115477.1
|
Foxp2
|
forkhead box P2 |
chr3_-_33082004 | 1.11 |
ENSMUST00000108225.3
|
Pex5l
|
peroxisomal biogenesis factor 5-like |
chr4_+_108847827 | 1.11 |
ENSMUST00000102738.2
|
Kti12
|
KTI12 homolog, chromatin associated (S. cerevisiae) |
chr9_+_55326913 | 1.10 |
ENSMUST00000085754.3
ENSMUST00000034862.4 |
AI118078
|
expressed sequence AI118078 |
chr13_-_100775844 | 1.10 |
ENSMUST00000075550.3
|
Cenph
|
centromere protein H |
chr19_+_47228804 | 1.08 |
ENSMUST00000111807.3
|
Neurl1a
|
neuralized homolog 1A (Drosophila) |
chr6_+_34598530 | 1.08 |
ENSMUST00000115027.1
ENSMUST00000115026.1 |
Cald1
|
caldesmon 1 |
chr7_-_38107490 | 1.07 |
ENSMUST00000108023.3
|
Ccne1
|
cyclin E1 |
chr1_+_66386968 | 1.07 |
ENSMUST00000145419.1
|
Map2
|
microtubule-associated protein 2 |
chr7_-_80901220 | 1.06 |
ENSMUST00000146402.1
ENSMUST00000026816.8 |
Wdr73
|
WD repeat domain 73 |
chr15_+_3270767 | 1.06 |
ENSMUST00000082424.4
ENSMUST00000159158.1 ENSMUST00000159216.1 ENSMUST00000160311.1 |
Sepp1
|
selenoprotein P, plasma, 1 |
chr11_+_120232921 | 1.06 |
ENSMUST00000122148.1
ENSMUST00000044985.7 |
Bahcc1
|
BAH domain and coiled-coil containing 1 |
chr4_+_11191726 | 1.06 |
ENSMUST00000029866.9
ENSMUST00000108324.3 |
Ccne2
|
cyclin E2 |
chr18_+_4994600 | 1.04 |
ENSMUST00000140448.1
|
Svil
|
supervillin |
chr3_+_94398517 | 1.03 |
ENSMUST00000050975.3
|
Lingo4
|
leucine rich repeat and Ig domain containing 4 |
chr6_+_34709610 | 1.01 |
ENSMUST00000031775.6
|
Cald1
|
caldesmon 1 |
chr14_-_55106547 | 1.01 |
ENSMUST00000036041.8
|
Ap1g2
|
adaptor protein complex AP-1, gamma 2 subunit |
chr3_+_94377432 | 1.01 |
ENSMUST00000107292.1
|
Rorc
|
RAR-related orphan receptor gamma |
chr2_+_119047116 | 1.01 |
ENSMUST00000152380.1
ENSMUST00000099542.2 |
Casc5
|
cancer susceptibility candidate 5 |
chr16_-_57754707 | 1.00 |
ENSMUST00000089332.4
|
Col8a1
|
collagen, type VIII, alpha 1 |
chr5_-_148392810 | 1.00 |
ENSMUST00000138257.1
|
Slc7a1
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 1 |
chr11_+_102268732 | 1.00 |
ENSMUST00000036467.4
|
Asb16
|
ankyrin repeat and SOCS box-containing 16 |
chr4_-_43499608 | 0.99 |
ENSMUST00000136005.1
ENSMUST00000054538.6 |
Arhgef39
|
Rho guanine nucleotide exchange factor (GEF) 39 |
chr4_-_87806296 | 0.98 |
ENSMUST00000126353.1
ENSMUST00000149357.1 |
Mllt3
|
myeloid/lymphoid or mixed-lineage leukemia (trithorax homolog, Drosophila); translocated to, 3 |
chr4_+_52439235 | 0.98 |
ENSMUST00000117280.1
ENSMUST00000102915.3 ENSMUST00000142227.1 |
Smc2
|
structural maintenance of chromosomes 2 |
chr9_+_78113275 | 0.97 |
ENSMUST00000009972.5
ENSMUST00000117330.1 ENSMUST00000044551.7 |
Ick
|
intestinal cell kinase |
chr3_+_94377505 | 0.96 |
ENSMUST00000098877.2
|
Rorc
|
RAR-related orphan receptor gamma |
chr12_-_72070991 | 0.96 |
ENSMUST00000050649.4
|
Gpr135
|
G protein-coupled receptor 135 |
chr2_-_80128834 | 0.96 |
ENSMUST00000102654.4
ENSMUST00000102655.3 |
Pde1a
|
phosphodiesterase 1A, calmodulin-dependent |
chr7_+_82175156 | 0.95 |
ENSMUST00000180243.1
|
Sh3gl3
|
SH3-domain GRB2-like 3 |
chr1_-_169531447 | 0.95 |
ENSMUST00000111368.1
|
Nuf2
|
NUF2, NDC80 kinetochore complex component, homolog (S. cerevisiae) |
chr7_-_62420139 | 0.95 |
ENSMUST00000094340.3
|
Mkrn3
|
makorin, ring finger protein, 3 |
chr6_+_135362931 | 0.95 |
ENSMUST00000032330.9
|
Emp1
|
epithelial membrane protein 1 |
chr4_+_24496434 | 0.95 |
ENSMUST00000108222.2
ENSMUST00000138567.2 ENSMUST00000050446.6 |
Mms22l
|
MMS22-like, DNA repair protein |
chrX_+_139800795 | 0.94 |
ENSMUST00000054889.3
|
Cldn2
|
claudin 2 |
chr10_-_18234930 | 0.94 |
ENSMUST00000052648.8
ENSMUST00000080860.6 ENSMUST00000173243.1 |
Ccdc28a
|
coiled-coil domain containing 28A |
chr1_-_169531343 | 0.94 |
ENSMUST00000028000.7
|
Nuf2
|
NUF2, NDC80 kinetochore complex component, homolog (S. cerevisiae) |
chr8_+_31091593 | 0.94 |
ENSMUST00000161713.1
|
Dusp26
|
dual specificity phosphatase 26 (putative) |
chr2_+_38511643 | 0.93 |
ENSMUST00000054234.3
ENSMUST00000112902.1 ENSMUST00000112895.1 |
Nek6
|
NIMA (never in mitosis gene a)-related expressed kinase 6 |
chr11_-_52282564 | 0.93 |
ENSMUST00000086844.3
|
Tcf7
|
transcription factor 7, T cell specific |
chr7_+_130577334 | 0.93 |
ENSMUST00000059145.7
ENSMUST00000084513.4 |
Tacc2
|
transforming, acidic coiled-coil containing protein 2 |
chr6_+_124830217 | 0.93 |
ENSMUST00000131847.1
ENSMUST00000151674.1 |
Cdca3
|
cell division cycle associated 3 |
chr14_+_48120841 | 0.92 |
ENSMUST00000073150.4
|
Peli2
|
pellino 2 |
chr19_+_8740712 | 0.92 |
ENSMUST00000163172.1
|
1700092M07Rik
|
RIKEN cDNA 1700092M07 gene |
chrX_-_102252154 | 0.92 |
ENSMUST00000050551.3
|
Cited1
|
Cbp/p300-interacting transactivator with Glu/Asp-rich carboxy-terminal domain 1 |
chr5_+_150522599 | 0.91 |
ENSMUST00000044620.7
|
Brca2
|
breast cancer 2 |
chr10_+_18469958 | 0.91 |
ENSMUST00000162891.1
ENSMUST00000100054.3 |
Nhsl1
|
NHS-like 1 |
chr15_+_85879306 | 0.91 |
ENSMUST00000023019.5
|
Trmu
|
tRNA 5-methylaminomethyl-2-thiouridylate methyltransferase |
chr7_-_102100227 | 0.91 |
ENSMUST00000106937.1
|
Art5
|
ADP-ribosyltransferase 5 |
chr7_+_79660196 | 0.91 |
ENSMUST00000035977.7
|
Ticrr
|
TOPBP1-interacting checkpoint and replication regulator |
chr6_+_8520008 | 0.91 |
ENSMUST00000162567.1
ENSMUST00000161217.1 |
Glcci1
|
glucocorticoid induced transcript 1 |
chr7_+_16310412 | 0.91 |
ENSMUST00000136781.1
|
Bbc3
|
BCL2 binding component 3 |
chr6_-_148946146 | 0.91 |
ENSMUST00000132696.1
|
Fam60a
|
family with sequence similarity 60, member A |
chr16_-_18811972 | 0.91 |
ENSMUST00000000028.7
ENSMUST00000115585.1 |
Cdc45
|
cell division cycle 45 |
chr10_-_49783259 | 0.90 |
ENSMUST00000105484.3
ENSMUST00000105486.1 ENSMUST00000079751.2 ENSMUST00000105485.1 |
Grik2
|
glutamate receptor, ionotropic, kainate 2 (beta 2) |
chr7_+_24907618 | 0.89 |
ENSMUST00000151121.1
|
Arhgef1
|
Rho guanine nucleotide exchange factor (GEF) 1 |
chr17_+_29090969 | 0.88 |
ENSMUST00000119901.1
|
Cdkn1a
|
cyclin-dependent kinase inhibitor 1A (P21) |
chr14_+_14820765 | 0.88 |
ENSMUST00000112631.2
ENSMUST00000178538.1 ENSMUST00000112630.2 |
Nek10
|
NIMA (never in mitosis gene a)- related kinase 10 |
chr1_+_34005872 | 0.87 |
ENSMUST00000182296.1
|
Dst
|
dystonin |
chr2_+_118598209 | 0.87 |
ENSMUST00000038341.7
|
Bub1b
|
budding uninhibited by benzimidazoles 1 homolog, beta (S. cerevisiae) |
chr17_+_7925990 | 0.87 |
ENSMUST00000036370.7
|
Tagap
|
T cell activation Rho GTPase activating protein |
chr15_+_103503261 | 0.87 |
ENSMUST00000023132.3
|
Pde1b
|
phosphodiesterase 1B, Ca2+-calmodulin dependent |
chr7_-_44974781 | 0.87 |
ENSMUST00000063761.7
|
Cpt1c
|
carnitine palmitoyltransferase 1c |
chr7_-_122132844 | 0.86 |
ENSMUST00000106469.1
ENSMUST00000063587.6 ENSMUST00000106468.1 ENSMUST00000130149.1 ENSMUST00000098068.3 |
Palb2
|
partner and localizer of BRCA2 |
chr10_+_20347788 | 0.86 |
ENSMUST00000169712.1
|
Mtfr2
|
mitochondrial fission regulator 2 |
chr16_+_22920222 | 0.86 |
ENSMUST00000023587.4
ENSMUST00000116625.2 |
Fetub
|
fetuin beta |
chr8_+_116921735 | 0.86 |
ENSMUST00000034205.4
|
Cenpn
|
centromere protein N |
chr7_+_81862674 | 0.85 |
ENSMUST00000119543.1
|
Tm6sf1
|
transmembrane 6 superfamily member 1 |
chr2_-_64975762 | 0.85 |
ENSMUST00000156765.1
|
Grb14
|
growth factor receptor bound protein 14 |
chr10_-_67912620 | 0.85 |
ENSMUST00000064656.7
|
Zfp365
|
zinc finger protein 365 |
chr7_+_105375053 | 0.84 |
ENSMUST00000106805.2
|
Gm5901
|
predicted gene 5901 |
chr7_-_141443989 | 0.84 |
ENSMUST00000026580.5
|
Lrdd
|
leucine-rich and death domain containing |
chr2_+_12924041 | 0.83 |
ENSMUST00000134794.1
ENSMUST00000028063.4 ENSMUST00000154269.1 ENSMUST00000114796.3 |
Pter
|
phosphotriesterase related |
chr10_+_38965515 | 0.83 |
ENSMUST00000019992.5
|
Lama4
|
laminin, alpha 4 |
chr6_-_100671126 | 0.82 |
ENSMUST00000089245.6
ENSMUST00000113312.2 ENSMUST00000170667.1 |
Shq1
|
SHQ1 homolog (S. cerevisiae) |
chr12_+_71170589 | 0.81 |
ENSMUST00000129376.1
|
2700049A03Rik
|
RIKEN cDNA 2700049A03 gene |
chr2_-_65364000 | 0.81 |
ENSMUST00000155962.1
ENSMUST00000112420.1 ENSMUST00000152324.1 |
Slc38a11
|
solute carrier family 38, member 11 |
chr6_-_135168162 | 0.81 |
ENSMUST00000045855.7
|
Hebp1
|
heme binding protein 1 |
chrX_-_102250940 | 0.81 |
ENSMUST00000134887.1
|
Cited1
|
Cbp/p300-interacting transactivator with Glu/Asp-rich carboxy-terminal domain 1 |
chr7_+_82173798 | 0.81 |
ENSMUST00000179318.1
|
Sh3gl3
|
SH3-domain GRB2-like 3 |
chr6_-_139501907 | 0.80 |
ENSMUST00000170650.1
|
Rergl
|
RERG/RAS-like |
chr3_-_36571952 | 0.80 |
ENSMUST00000029270.3
|
Ccna2
|
cyclin A2 |
chr13_+_44840686 | 0.80 |
ENSMUST00000173906.1
|
Jarid2
|
jumonji, AT rich interactive domain 2 |
chr8_-_36953139 | 0.80 |
ENSMUST00000179501.1
|
Dlc1
|
deleted in liver cancer 1 |
chr17_+_36943025 | 0.80 |
ENSMUST00000173072.1
|
Rnf39
|
ring finger protein 39 |
chr17_+_71204647 | 0.80 |
ENSMUST00000126681.1
|
Lpin2
|
lipin 2 |
chr7_+_140763739 | 0.79 |
ENSMUST00000026552.7
|
Cyp2e1
|
cytochrome P450, family 2, subfamily e, polypeptide 1 |
chr2_-_168601620 | 0.79 |
ENSMUST00000171689.1
ENSMUST00000137451.1 |
Nfatc2
|
nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 2 |
chrX_+_75096039 | 0.78 |
ENSMUST00000131155.1
ENSMUST00000132000.1 |
Dkc1
|
dyskeratosis congenita 1, dyskerin |
chr2_-_104028287 | 0.78 |
ENSMUST00000056170.3
|
4931422A03Rik
|
RIKEN cDNA 4931422A03 gene |
chr4_-_149774238 | 0.78 |
ENSMUST00000105686.2
|
Slc25a33
|
solute carrier family 25, member 33 |
chr2_-_110761564 | 0.78 |
ENSMUST00000140777.1
|
Ano3
|
anoctamin 3 |
chr3_-_32365643 | 0.78 |
ENSMUST00000029199.5
|
Zmat3
|
zinc finger matrin type 3 |
chr11_+_115381906 | 0.77 |
ENSMUST00000053288.5
|
Cdr2l
|
cerebellar degeneration-related protein 2-like |
chr6_-_106800051 | 0.77 |
ENSMUST00000013882.7
ENSMUST00000049675.4 ENSMUST00000113239.3 |
Crbn
|
cereblon |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 12.4 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.8 | 5.8 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.6 | 1.9 | GO:0045004 | DNA replication proofreading(GO:0045004) |
0.6 | 2.5 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) negative regulation of nodal signaling pathway(GO:1900108) |
0.6 | 1.9 | GO:0033624 | negative regulation of integrin activation(GO:0033624) |
0.6 | 1.8 | GO:0031283 | negative regulation of cGMP metabolic process(GO:0030824) negative regulation of cGMP biosynthetic process(GO:0030827) negative regulation of guanylate cyclase activity(GO:0031283) |
0.6 | 5.3 | GO:0033227 | dsRNA transport(GO:0033227) |
0.6 | 1.7 | GO:2000371 | regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
0.5 | 1.6 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.5 | 2.7 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.5 | 1.6 | GO:2000620 | positive regulation of histone H4-K16 acetylation(GO:2000620) |
0.5 | 2.1 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.5 | 1.4 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
0.4 | 1.3 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.4 | 1.8 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.4 | 1.3 | GO:0099578 | regulation of translation at synapse, modulating synaptic transmission(GO:0099547) regulation of translation at postsynapse, modulating synaptic transmission(GO:0099578) positive regulation of intracellular transport of viral material(GO:1901254) |
0.4 | 0.9 | GO:1903538 | meiotic cell cycle process involved in oocyte maturation(GO:1903537) regulation of meiotic cell cycle process involved in oocyte maturation(GO:1903538) |
0.4 | 1.2 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.4 | 2.0 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.4 | 1.1 | GO:0009826 | unidimensional cell growth(GO:0009826) susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.4 | 1.1 | GO:0090172 | microtubule cytoskeleton organization involved in homologous chromosome segregation(GO:0090172) |
0.4 | 1.8 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
0.4 | 6.5 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.4 | 1.1 | GO:0031448 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
0.3 | 1.7 | GO:0071105 | response to interleukin-9(GO:0071104) response to interleukin-11(GO:0071105) |
0.3 | 0.3 | GO:1904173 | regulation of histone demethylase activity (H3-K4 specific)(GO:1904173) |
0.3 | 1.7 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.3 | 1.6 | GO:0042320 | regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) circadian sleep/wake cycle, REM sleep(GO:0042747) |
0.3 | 0.9 | GO:1902299 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) DNA replication preinitiation complex assembly(GO:0071163) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
0.3 | 0.9 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
0.3 | 1.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.3 | 0.8 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.3 | 0.8 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.3 | 2.8 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.3 | 0.8 | GO:0017055 | negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) |
0.3 | 1.5 | GO:1900170 | negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
0.2 | 1.5 | GO:0031120 | snRNA pseudouridine synthesis(GO:0031120) |
0.2 | 1.0 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.2 | 1.9 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.2 | 0.9 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.2 | 2.5 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.2 | 5.0 | GO:0060539 | diaphragm development(GO:0060539) |
0.2 | 0.7 | GO:0060382 | regulation of DNA strand elongation(GO:0060382) |
0.2 | 6.3 | GO:0045780 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
0.2 | 2.8 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.2 | 0.6 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.2 | 0.4 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.2 | 1.4 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.2 | 1.0 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
0.2 | 2.0 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.2 | 0.6 | GO:0007521 | muscle cell fate determination(GO:0007521) |
0.2 | 0.6 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.2 | 1.0 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
0.2 | 0.6 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.2 | 0.6 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
0.2 | 1.6 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.2 | 2.3 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
0.2 | 2.3 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
0.2 | 0.5 | GO:0097048 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
0.2 | 0.5 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.2 | 1.5 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.2 | 0.5 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
0.2 | 0.5 | GO:0010615 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) regulation of connective tissue replacement(GO:1905203) |
0.2 | 0.5 | GO:0031591 | wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
0.2 | 0.8 | GO:0060449 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) bud elongation involved in lung branching(GO:0060449) |
0.2 | 0.7 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.2 | 0.3 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.2 | 0.5 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.2 | 0.5 | GO:1990869 | apoptotic process involved in outflow tract morphogenesis(GO:0003275) regulation of apoptotic process involved in outflow tract morphogenesis(GO:1902256) response to chemokine(GO:1990868) cellular response to chemokine(GO:1990869) |
0.2 | 2.6 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.2 | 4.3 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.2 | 0.3 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.2 | 1.3 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.2 | 0.5 | GO:2000850 | negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.2 | 0.3 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.2 | 0.5 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.2 | 0.8 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.1 | 1.0 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.6 | GO:1902045 | regulation of Fas signaling pathway(GO:1902044) negative regulation of Fas signaling pathway(GO:1902045) |
0.1 | 1.6 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.1 | 0.6 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
0.1 | 1.8 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.1 | 0.3 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.1 | 1.3 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.1 | 0.4 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.1 | 2.6 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.1 | 0.4 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.1 | 0.7 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.1 | 2.0 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.1 | 0.5 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.1 | 0.5 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.7 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.4 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.1 | 0.3 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.1 | 0.4 | GO:0097535 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
0.1 | 0.4 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
0.1 | 1.7 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.1 | 1.5 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.6 | GO:0008355 | olfactory learning(GO:0008355) |
0.1 | 3.9 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.1 | 0.7 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.5 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.1 | 0.5 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.1 | 0.7 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 1.1 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.1 | 0.4 | GO:0010534 | regulation of activation of JAK2 kinase activity(GO:0010534) activation of JAK2 kinase activity(GO:0042977) negative regulation of activation of JAK2 kinase activity(GO:1902569) |
0.1 | 1.5 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
0.1 | 0.7 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.1 | 0.6 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.1 | 0.9 | GO:0097475 | motor neuron migration(GO:0097475) |
0.1 | 0.4 | GO:0014870 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.1 | 0.1 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
0.1 | 0.6 | GO:0061588 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
0.1 | 0.4 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.1 | 2.8 | GO:0000154 | rRNA modification(GO:0000154) |
0.1 | 0.2 | GO:0003032 | detection of oxygen(GO:0003032) |
0.1 | 0.3 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.1 | 1.0 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.1 | 0.5 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 1.0 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.1 | 1.6 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.1 | 2.0 | GO:0015802 | basic amino acid transport(GO:0015802) |
0.1 | 0.4 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
0.1 | 0.9 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
0.1 | 0.9 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
0.1 | 0.5 | GO:0002034 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
0.1 | 1.8 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.1 | 0.3 | GO:0032240 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
0.1 | 0.2 | GO:0071477 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
0.1 | 0.5 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.1 | 0.4 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
0.1 | 0.4 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
0.1 | 0.4 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.1 | 0.6 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.1 | 0.2 | GO:2000320 | negative regulation of T-helper 17 type immune response(GO:2000317) negative regulation of T-helper 17 cell differentiation(GO:2000320) regulation of T-helper 17 cell lineage commitment(GO:2000328) |
0.1 | 0.5 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
0.1 | 0.6 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.1 | 0.5 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.1 | 0.5 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
0.1 | 1.2 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.1 | 0.4 | GO:0002740 | negative regulation of cytokine secretion involved in immune response(GO:0002740) |
0.1 | 0.6 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.1 | GO:0009441 | glycolate metabolic process(GO:0009441) |
0.1 | 0.9 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) |
0.1 | 0.5 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.1 | 0.5 | GO:0002681 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
0.1 | 0.9 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.1 | 0.3 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.1 | 0.6 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.1 | 0.3 | GO:0019323 | pentose catabolic process(GO:0019323) |
0.1 | 1.4 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.1 | 0.2 | GO:0035709 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
0.1 | 0.5 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.1 | 1.2 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.1 | 1.1 | GO:0051382 | kinetochore assembly(GO:0051382) kinetochore organization(GO:0051383) |
0.1 | 0.9 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.1 | 0.1 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
0.1 | 0.2 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
0.1 | 0.4 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.1 | 0.7 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.1 | 0.3 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.5 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.1 | 1.0 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 2.5 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
0.1 | 0.7 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
0.1 | 0.6 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.1 | 1.2 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.1 | 0.2 | GO:1904348 | negative regulation of gastro-intestinal system smooth muscle contraction(GO:1904305) negative regulation of small intestine smooth muscle contraction(GO:1904348) |
0.1 | 0.7 | GO:0048617 | embryonic foregut morphogenesis(GO:0048617) |
0.1 | 0.2 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) |
0.1 | 0.4 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
0.1 | 1.3 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.1 | 0.5 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.1 | 0.7 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.1 | 0.8 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.1 | 0.4 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.1 | 1.3 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.1 | 0.9 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.8 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.1 | 0.3 | GO:0061141 | lung ciliated cell differentiation(GO:0061141) |
0.1 | 0.3 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
0.1 | 0.6 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
0.1 | 0.2 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
0.1 | 0.3 | GO:1990401 | embryonic lung development(GO:1990401) |
0.1 | 0.3 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.4 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.3 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
0.1 | 0.1 | GO:0002513 | tolerance induction to self antigen(GO:0002513) |
0.1 | 0.8 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.1 | 0.2 | GO:1904158 | axonemal central apparatus assembly(GO:1904158) |
0.1 | 0.2 | GO:0002270 | plasmacytoid dendritic cell activation(GO:0002270) |
0.1 | 0.3 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.1 | 0.2 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.1 | 0.2 | GO:0045645 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
0.1 | 0.1 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.1 | 0.6 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 1.1 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.1 | 1.0 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.1 | 0.2 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.1 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.1 | 0.2 | GO:0002777 | antimicrobial peptide biosynthetic process(GO:0002777) antibacterial peptide biosynthetic process(GO:0002780) |
0.1 | 0.3 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
0.1 | 0.2 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.1 | 0.5 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.1 | 3.3 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
0.1 | 1.6 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.1 | 0.3 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.1 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.1 | 0.6 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.1 | 0.3 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.1 | 0.2 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
0.1 | 0.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 0.3 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.1 | 0.4 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.1 | 0.2 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.1 | 0.2 | GO:0098912 | membrane depolarization during atrial cardiac muscle cell action potential(GO:0098912) |
0.1 | 0.7 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.1 | 1.1 | GO:0051084 | 'de novo' posttranslational protein folding(GO:0051084) |
0.1 | 0.6 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.1 | 0.5 | GO:0098700 | neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.1 | 0.3 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.0 | 0.5 | GO:0098989 | NMDA selective glutamate receptor signaling pathway(GO:0098989) |
0.0 | 1.0 | GO:0031297 | replication fork processing(GO:0031297) |
0.0 | 0.2 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
0.0 | 0.3 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.0 | 0.3 | GO:2001212 | regulation of vasculogenesis(GO:2001212) positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.2 | GO:0046112 | nucleobase biosynthetic process(GO:0046112) embryonic neurocranium morphogenesis(GO:0048702) |
0.0 | 0.3 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.0 | 0.3 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.3 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.0 | 0.6 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.0 | 0.1 | GO:1990535 | neuron projection maintenance(GO:1990535) |
0.0 | 0.8 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) |
0.0 | 0.1 | GO:0015755 | fructose transport(GO:0015755) |
0.0 | 0.3 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.0 | 0.5 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
0.0 | 0.2 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 0.6 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.0 | 0.7 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.2 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.0 | 0.2 | GO:0090472 | dibasic protein processing(GO:0090472) |
0.0 | 0.3 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.0 | 0.7 | GO:0019236 | response to pheromone(GO:0019236) |
0.0 | 0.6 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
0.0 | 0.3 | GO:0007144 | female meiosis I(GO:0007144) |
0.0 | 0.7 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.0 | 0.4 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
0.0 | 1.5 | GO:0006953 | acute-phase response(GO:0006953) |
0.0 | 0.9 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.0 | 0.2 | GO:0060613 | fat pad development(GO:0060613) |
0.0 | 0.3 | GO:0035878 | nail development(GO:0035878) |
0.0 | 0.5 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
0.0 | 0.5 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
0.0 | 0.8 | GO:0055012 | ventricular cardiac muscle cell differentiation(GO:0055012) |
0.0 | 1.0 | GO:0009303 | rRNA transcription(GO:0009303) |
0.0 | 0.8 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.0 | 0.1 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
0.0 | 0.1 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.1 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
0.0 | 0.1 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.2 | GO:0097473 | cellular response to light intensity(GO:0071484) cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
0.0 | 0.7 | GO:0003351 | epithelial cilium movement(GO:0003351) |
0.0 | 0.5 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
0.0 | 0.3 | GO:0048539 | bone marrow development(GO:0048539) |
0.0 | 0.2 | GO:0061072 | iris morphogenesis(GO:0061072) |
0.0 | 0.3 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.3 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
0.0 | 0.2 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.0 | 0.4 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.1 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
0.0 | 0.1 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.0 | 0.4 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.3 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.0 | 0.4 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) |
0.0 | 0.1 | GO:2000861 | estrogen secretion(GO:0035937) regulation of estrogen secretion(GO:2000861) |
0.0 | 0.2 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.0 | 0.0 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
0.0 | 1.2 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.0 | 2.0 | GO:0007019 | microtubule depolymerization(GO:0007019) |
0.0 | 0.7 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.9 | GO:0030071 | regulation of mitotic metaphase/anaphase transition(GO:0030071) |
0.0 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) selenocysteine metabolic process(GO:0016259) |
0.0 | 0.9 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
0.0 | 0.2 | GO:1904406 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
0.0 | 0.4 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.2 | GO:0097324 | melanocyte migration(GO:0097324) positive regulation of lens fiber cell differentiation(GO:1902748) |
0.0 | 0.6 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.2 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
0.0 | 0.2 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.0 | 0.1 | GO:0072307 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.0 | 0.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.0 | 0.6 | GO:0031100 | organ regeneration(GO:0031100) |
0.0 | 0.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.3 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.3 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.1 | GO:0070343 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.0 | 1.1 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.0 | 0.3 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.0 | 0.1 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
0.0 | 0.3 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) regulation of SNARE complex assembly(GO:0035542) |
0.0 | 0.3 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.0 | 0.3 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.4 | GO:0006337 | nucleosome disassembly(GO:0006337) |
0.0 | 0.1 | GO:0090024 | negative regulation of granulocyte chemotaxis(GO:0071623) negative regulation of neutrophil chemotaxis(GO:0090024) |
0.0 | 0.3 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.0 | 0.1 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
0.0 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.0 | 0.3 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
0.0 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.3 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.0 | 0.1 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
0.0 | 0.1 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) ornithine transport(GO:0015822) |
0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.2 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.0 | 0.1 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
0.0 | 0.2 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.0 | 0.4 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.3 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
0.0 | 0.9 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.4 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.0 | 1.0 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.2 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.0 | 2.1 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
0.0 | 0.3 | GO:0010650 | positive regulation of cell communication by electrical coupling(GO:0010650) positive regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900827) |
0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.4 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.0 | 0.2 | GO:0051198 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
0.0 | 0.1 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
0.0 | 0.3 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.1 | GO:0080144 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) modulation by virus of host autophagy(GO:0039519) suppression by virus of host autophagy(GO:0039521) amino acid homeostasis(GO:0080144) negative regulation of sphingolipid biosynthesis involved in cellular sphingolipid homeostasis(GO:0090157) negative regulation of histone H4-K16 acetylation(GO:2000619) |
0.0 | 0.1 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.0 | 0.3 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.0 | 0.3 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.8 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.0 | 0.2 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.4 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.0 | 0.7 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.0 | 0.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.0 | 0.1 | GO:0021779 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.0 | 0.1 | GO:0098886 | modification of dendritic spine(GO:0098886) |
0.0 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.1 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.0 | 0.2 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.0 | 0.1 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.0 | 0.3 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 0.3 | GO:0035635 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.0 | 0.4 | GO:0030220 | platelet formation(GO:0030220) |
0.0 | 1.2 | GO:0006261 | DNA-dependent DNA replication(GO:0006261) |
0.0 | 0.2 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.0 | 0.2 | GO:0050427 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.0 | 0.4 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
0.0 | 0.5 | GO:0033622 | integrin activation(GO:0033622) |
0.0 | 0.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.1 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.0 | 0.3 | GO:0051451 | myoblast migration(GO:0051451) |
0.0 | 0.3 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.4 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
0.0 | 0.2 | GO:0090043 | tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.3 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.4 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.1 | GO:0015867 | ATP transport(GO:0015867) |
0.0 | 0.3 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.0 | 0.0 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) detection of bacterial lipopeptide(GO:0070340) |
0.0 | 0.3 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.1 | GO:0044029 | DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
0.0 | 1.1 | GO:0009060 | aerobic respiration(GO:0009060) |
0.0 | 0.1 | GO:0050917 | sensory perception of sweet taste(GO:0050916) sensory perception of umami taste(GO:0050917) |
0.0 | 0.2 | GO:0006071 | glycerol metabolic process(GO:0006071) |
0.0 | 0.0 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.1 | GO:1903874 | ferrous iron transmembrane transport(GO:1903874) |
0.0 | 0.0 | GO:0038001 | autocrine signaling(GO:0035425) paracrine signaling(GO:0038001) |
0.0 | 0.1 | GO:0002719 | negative regulation of cytokine production involved in immune response(GO:0002719) |
0.0 | 0.9 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.0 | 0.6 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 0.1 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
0.0 | 0.1 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.0 | 0.0 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.3 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
0.0 | 0.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.1 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.0 | 0.6 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.0 | 0.8 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.0 | 0.4 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.1 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.0 | 0.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.1 | GO:1904715 | negative regulation of chaperone-mediated autophagy(GO:1904715) |
0.0 | 0.2 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.1 | GO:0072520 | seminiferous tubule development(GO:0072520) |
0.0 | 2.3 | GO:0051017 | actin filament bundle assembly(GO:0051017) actin filament bundle organization(GO:0061572) |
0.0 | 0.9 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.1 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) negative regulation of SMAD protein complex assembly(GO:0010991) |
0.0 | 0.7 | GO:0008542 | visual learning(GO:0008542) |
0.0 | 0.0 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.0 | 0.2 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
0.0 | 0.5 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
0.0 | 0.1 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.0 | 0.2 | GO:0044804 | nucleophagy(GO:0044804) |
0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.2 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.0 | 0.4 | GO:0030225 | macrophage differentiation(GO:0030225) |
0.0 | 0.1 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.0 | 0.1 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.0 | 0.7 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
0.0 | 0.1 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.0 | 0.2 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
0.0 | 0.2 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.1 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.0 | 0.3 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.1 | GO:1902564 | negative regulation of cellular extravasation(GO:0002692) negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) negative regulation of neutrophil activation(GO:1902564) |
0.0 | 0.1 | GO:0070233 | negative regulation of T cell apoptotic process(GO:0070233) |
0.0 | 0.0 | GO:0051892 | negative regulation of cardioblast differentiation(GO:0051892) |
0.0 | 0.8 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.1 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.0 | 1.2 | GO:0042254 | ribosome biogenesis(GO:0042254) |
0.0 | 0.2 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
0.0 | 0.2 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
0.0 | 0.5 | GO:0006414 | translational elongation(GO:0006414) |
0.0 | 0.2 | GO:0000338 | protein deneddylation(GO:0000338) |
0.0 | 0.0 | GO:0046110 | xanthine catabolic process(GO:0009115) xanthine metabolic process(GO:0046110) |
0.0 | 0.2 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.1 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
0.0 | 0.1 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.0 | 0.7 | GO:0051225 | spindle assembly(GO:0051225) |
0.0 | 0.2 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.0 | 0.2 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.0 | 0.1 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.0 | 1.0 | GO:0051092 | positive regulation of NF-kappaB transcription factor activity(GO:0051092) |
0.0 | 0.1 | GO:0007398 | ectoderm development(GO:0007398) |
0.0 | 0.3 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 6.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.9 | 13.9 | GO:0042555 | MCM complex(GO:0042555) |
0.6 | 1.8 | GO:0000799 | nuclear condensin complex(GO:0000799) |
0.5 | 1.4 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
0.4 | 3.8 | GO:0030478 | actin cap(GO:0030478) |
0.4 | 0.4 | GO:0070552 | BRISC complex(GO:0070552) |
0.4 | 1.9 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.4 | 2.7 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.4 | 1.1 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
0.4 | 2.5 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
0.3 | 1.7 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.3 | 3.6 | GO:0071439 | clathrin complex(GO:0071439) |
0.3 | 1.3 | GO:1902737 | viral replication complex(GO:0019034) dendritic filopodium(GO:1902737) |
0.3 | 2.0 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.3 | 0.9 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
0.3 | 1.2 | GO:0008623 | CHRAC(GO:0008623) |
0.3 | 1.6 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.3 | 1.8 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.3 | 1.5 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.2 | 1.5 | GO:0031429 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
0.2 | 1.2 | GO:0000235 | astral microtubule(GO:0000235) |
0.2 | 1.4 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.2 | 1.8 | GO:0044327 | dendritic spine head(GO:0044327) |
0.2 | 0.5 | GO:0098835 | presynaptic endocytic zone(GO:0098833) presynaptic endocytic zone membrane(GO:0098835) |
0.2 | 0.9 | GO:0031673 | H zone(GO:0031673) |
0.2 | 0.5 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.2 | 0.7 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
0.2 | 0.8 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.2 | 0.6 | GO:0071797 | LUBAC complex(GO:0071797) |
0.2 | 1.7 | GO:0031931 | TORC1 complex(GO:0031931) |
0.2 | 1.2 | GO:0070652 | HAUS complex(GO:0070652) |
0.2 | 0.9 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.1 | 1.0 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 1.8 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.7 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.1 | 1.1 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
0.1 | 7.3 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 0.6 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.1 | 0.4 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.1 | 0.5 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.4 | GO:0099524 | region of cytosol(GO:0099522) postsynaptic cytosol(GO:0099524) |
0.1 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
0.1 | 0.8 | GO:0000243 | commitment complex(GO:0000243) |
0.1 | 0.1 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.1 | 1.0 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.5 | GO:0034715 | U7 snRNP(GO:0005683) pICln-Sm protein complex(GO:0034715) |
0.1 | 0.3 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.1 | 1.1 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.1 | 0.6 | GO:0001940 | male pronucleus(GO:0001940) |
0.1 | 0.3 | GO:0043512 | inhibin A complex(GO:0043512) |
0.1 | 0.7 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.1 | 4.4 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.6 | GO:0070187 | telosome(GO:0070187) |
0.1 | 0.5 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 0.7 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.1 | 0.3 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
0.1 | 0.7 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.1 | 0.8 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 1.1 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.8 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 0.4 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.1 | 0.3 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 0.2 | GO:0031533 | mRNA cap methyltransferase complex(GO:0031533) |
0.1 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 1.5 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.1 | 0.3 | GO:0014802 | terminal cisterna(GO:0014802) |
0.1 | 0.3 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 0.7 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.1 | 0.2 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.1 | 0.4 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.1 | 0.7 | GO:0097542 | ciliary tip(GO:0097542) |
0.1 | 0.6 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.1 | 0.4 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 0.3 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
0.1 | 0.4 | GO:1990357 | terminal web(GO:1990357) |
0.1 | 3.0 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.1 | 1.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 4.5 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 1.8 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.2 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 0.4 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 0.9 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.1 | 0.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.2 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
0.0 | 1.8 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 0.2 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.0 | 0.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.0 | 0.4 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.5 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.8 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.2 | GO:0044307 | dendritic branch(GO:0044307) |
0.0 | 1.1 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.9 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.3 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 2.3 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.5 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.0 | 0.4 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.9 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 0.4 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.3 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
0.0 | 0.3 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 1.0 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.2 | GO:0035976 | AP1 complex(GO:0035976) |
0.0 | 1.0 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.5 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 1.2 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.2 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
0.0 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.8 | GO:0005605 | basal lamina(GO:0005605) |
0.0 | 0.7 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 3.2 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 1.0 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.2 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 0.1 | GO:0034657 | GID complex(GO:0034657) |
0.0 | 0.8 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.7 | GO:0001741 | XY body(GO:0001741) |
0.0 | 0.3 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.1 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
0.0 | 0.4 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) CIA complex(GO:0097361) |
0.0 | 1.6 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.1 | GO:0097444 | spine apparatus(GO:0097444) |
0.0 | 2.9 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.0 | 1.3 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.4 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.2 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.0 | 0.4 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.8 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.5 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 1.0 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.4 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.5 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.2 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.8 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.0 | 0.2 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.0 | 0.1 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
0.0 | 0.2 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.0 | 0.5 | GO:0045259 | proton-transporting ATP synthase complex(GO:0045259) |
0.0 | 0.2 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 0.9 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
0.0 | 0.1 | GO:0001739 | sex chromatin(GO:0001739) |
0.0 | 0.3 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 3.6 | GO:0043197 | dendritic spine(GO:0043197) |
0.0 | 0.1 | GO:0032806 | core TFIIH complex(GO:0000439) holo TFIIH complex(GO:0005675) carboxy-terminal domain protein kinase complex(GO:0032806) |
0.0 | 0.6 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 1.1 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.3 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 1.7 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.3 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.1 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
0.0 | 1.3 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.8 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 1.0 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.6 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.8 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 1.9 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 1.0 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.0 | 0.8 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 0.9 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.0 | 0.2 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 0.4 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.1 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.4 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.3 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.2 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.0 | 0.6 | GO:0070469 | respiratory chain(GO:0070469) |
0.0 | 0.1 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.0 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
0.0 | 0.2 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
0.0 | 0.0 | GO:0030870 | Mre11 complex(GO:0030870) |
0.0 | 0.6 | GO:0031970 | organelle envelope lumen(GO:0031970) |
0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.0 | 0.0 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.0 | 0.1 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 5.8 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
0.9 | 5.3 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.8 | 2.5 | GO:0016015 | morphogen activity(GO:0016015) |
0.7 | 2.0 | GO:0038052 | type 1 metabotropic glutamate receptor binding(GO:0031798) RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
0.5 | 1.4 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.5 | 0.5 | GO:0016623 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
0.4 | 4.4 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.4 | 2.0 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.4 | 2.0 | GO:0008142 | oxysterol binding(GO:0008142) |
0.4 | 1.1 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.4 | 1.8 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.3 | 0.7 | GO:1990955 | G-rich single-stranded DNA binding(GO:1990955) |
0.3 | 1.7 | GO:0038051 | glucocorticoid receptor activity(GO:0004883) transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
0.3 | 12.4 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
0.3 | 1.0 | GO:0050479 | glyceryl-ether monooxygenase activity(GO:0050479) |
0.3 | 1.9 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.3 | 1.7 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
0.3 | 1.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.3 | 0.8 | GO:0002153 | steroid receptor RNA activator RNA binding(GO:0002153) |
0.3 | 1.8 | GO:0048101 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.2 | 1.9 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.2 | 0.7 | GO:0035827 | rubidium ion transmembrane transporter activity(GO:0035827) |
0.2 | 1.0 | GO:0001011 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
0.2 | 0.7 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.2 | 1.2 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
0.2 | 0.7 | GO:0004686 | elongation factor-2 kinase activity(GO:0004686) |
0.2 | 0.9 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.2 | 0.9 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.2 | 1.3 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.2 | 1.1 | GO:0043515 | kinetochore binding(GO:0043515) |
0.2 | 0.6 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
0.2 | 1.3 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
0.2 | 1.9 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.2 | 1.5 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.2 | 1.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.2 | 0.6 | GO:0004088 | carbamoyl-phosphate synthase (ammonia) activity(GO:0004087) carbamoyl-phosphate synthase (glutamine-hydrolyzing) activity(GO:0004088) |
0.2 | 1.5 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
0.2 | 1.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.2 | 0.5 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
0.2 | 0.5 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.2 | 0.9 | GO:0016416 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
0.2 | 1.0 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.2 | 2.7 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.2 | 1.3 | GO:0003678 | DNA helicase activity(GO:0003678) |
0.2 | 0.6 | GO:0004308 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.2 | 0.5 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.2 | 0.6 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.2 | 1.2 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.2 | 0.9 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.2 | 0.6 | GO:0008169 | C-methyltransferase activity(GO:0008169) |
0.1 | 0.6 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.6 | GO:0047275 | glucosaminylgalactosylglucosylceramide beta-galactosyltransferase activity(GO:0047275) |
0.1 | 1.3 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 0.4 | GO:0070540 | stearic acid binding(GO:0070540) |
0.1 | 2.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.4 | GO:0050429 | calcium-dependent phospholipase C activity(GO:0050429) |
0.1 | 0.6 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.1 | 0.7 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
0.1 | 0.4 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.1 | 0.7 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.1 | 1.1 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.1 | 0.8 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.4 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.1 | 1.5 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 0.4 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.1 | 0.5 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.1 | 0.4 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.1 | 0.7 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.1 | 0.4 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 0.7 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.1 | 0.5 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.1 | 1.8 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 0.3 | GO:0052596 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
0.1 | 3.6 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.1 | 0.3 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
0.1 | 0.4 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.1 | 0.4 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
0.1 | 0.3 | GO:0005333 | norepinephrine transmembrane transporter activity(GO:0005333) |
0.1 | 0.3 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
0.1 | 0.6 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.1 | 0.7 | GO:0005550 | pheromone binding(GO:0005550) |
0.1 | 0.9 | GO:0034711 | inhibin binding(GO:0034711) |
0.1 | 0.3 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.1 | 0.8 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.1 | 0.5 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.1 | 0.3 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.1 | 1.9 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.1 | 0.4 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 0.6 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 0.3 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
0.1 | 0.6 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.3 | GO:0070052 | collagen V binding(GO:0070052) |
0.1 | 0.3 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.1 | 0.4 | GO:0015526 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.1 | 0.4 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
0.1 | 0.3 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.1 | 1.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.5 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 0.6 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 1.6 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 0.3 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 9.0 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.1 | 0.5 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 2.6 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.1 | 0.3 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 0.3 | GO:0004058 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
0.1 | 0.3 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.1 | 0.5 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.2 | GO:0031208 | POZ domain binding(GO:0031208) |
0.1 | 0.8 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.1 | 0.3 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.1 | 0.4 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
0.1 | 0.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 1.4 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.1 | 0.3 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.1 | 1.8 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.1 | 2.4 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.1 | 0.3 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.1 | 0.7 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 0.2 | GO:0004482 | mRNA (guanine-N7-)-methyltransferase activity(GO:0004482) |
0.1 | 0.9 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.1 | 0.2 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
0.1 | 0.3 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.1 | 0.3 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.1 | 2.4 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.1 | 0.4 | GO:0005534 | galactose binding(GO:0005534) |
0.1 | 0.3 | GO:0042610 | CD8 receptor binding(GO:0042610) |
0.1 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.1 | 0.8 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.2 | GO:0000401 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
0.1 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.6 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.1 | 0.1 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.1 | 1.6 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 0.4 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.1 | 0.2 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 0.2 | GO:0004488 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.1 | 1.3 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.1 | 0.8 | GO:0010181 | FMN binding(GO:0010181) |
0.1 | 1.0 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.1 | 0.2 | GO:0023030 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
0.1 | 0.3 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.1 | 0.3 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.1 | 0.3 | GO:0097643 | amylin receptor activity(GO:0097643) |
0.1 | 0.2 | GO:0043532 | angiostatin binding(GO:0043532) |
0.1 | 0.2 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
0.1 | 0.2 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.1 | 0.5 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 1.3 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.1 | 0.7 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.1 | 0.4 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.2 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
0.0 | 0.2 | GO:0016316 | phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity(GO:0016316) |
0.0 | 0.9 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.9 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
0.0 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.2 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.0 | 2.5 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.1 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
0.0 | 0.6 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.0 | 0.9 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.4 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
0.0 | 0.3 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 3.6 | GO:0003823 | antigen binding(GO:0003823) |
0.0 | 1.8 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.0 | 0.6 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.4 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.5 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 0.4 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.0 | 0.2 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.0 | 0.6 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.7 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 0.7 | GO:0042287 | MHC protein binding(GO:0042287) |
0.0 | 0.3 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 2.6 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.0 | 4.2 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.3 | GO:0044213 | intronic transcription regulatory region DNA binding(GO:0044213) |
0.0 | 0.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 5.0 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.7 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.1 | GO:0071077 | coenzyme A transmembrane transporter activity(GO:0015228) adenosine 3',5'-bisphosphate transmembrane transporter activity(GO:0071077) AMP transmembrane transporter activity(GO:0080122) |
0.0 | 0.4 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.2 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 0.4 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.3 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.2 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
0.0 | 0.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.4 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.4 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 0.4 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.3 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.3 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.0 | 0.6 | GO:0005123 | death receptor binding(GO:0005123) |
0.0 | 0.6 | GO:0001221 | transcription cofactor binding(GO:0001221) |
0.0 | 0.3 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.0 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.6 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.3 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.0 | 0.2 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.3 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.0 | 1.2 | GO:0097472 | cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.3 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.0 | 0.2 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 2.7 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
0.0 | 0.8 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 1.5 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 0.2 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 5.0 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 1.0 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 1.1 | GO:0001098 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.3 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.0 | 0.1 | GO:0001847 | opsonin receptor activity(GO:0001847) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.3 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.4 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.0 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.2 | GO:0016503 | pheromone receptor activity(GO:0016503) |
0.0 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.1 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.0 | 0.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.0 | 0.5 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.2 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 0.5 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.5 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.7 | GO:0045182 | translation regulator activity(GO:0045182) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.3 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
0.0 | 0.1 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.0 | 1.6 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.0 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
0.0 | 0.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.0 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 1.3 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
0.0 | 0.1 | GO:0019779 | Atg12 activating enzyme activity(GO:0019778) Atg8 activating enzyme activity(GO:0019779) |
0.0 | 6.6 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.0 | 0.3 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.3 | GO:0001163 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.0 | 2.0 | GO:0019888 | protein phosphatase regulator activity(GO:0019888) |
0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.7 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.2 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.0 | 0.3 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.0 | 0.5 | GO:0015605 | organophosphate ester transmembrane transporter activity(GO:0015605) |
0.0 | 0.1 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.0 | 0.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.1 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
0.0 | 0.1 | GO:0016653 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.0 | 0.7 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 1.1 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.0 | 0.3 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
0.0 | 0.1 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.0 | 0.4 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 0.1 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.1 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.3 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.1 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.1 | GO:0004952 | dopamine neurotransmitter receptor activity(GO:0004952) |
0.0 | 0.1 | GO:0008527 | taste receptor activity(GO:0008527) |
0.0 | 0.1 | GO:0086038 | calcium:sodium antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086038) |
0.0 | 0.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.1 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.0 | 0.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.8 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.0 | 0.2 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.1 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.0 | 0.4 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 0.3 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.3 | GO:0034061 | DNA polymerase activity(GO:0034061) |
0.0 | 0.1 | GO:0001851 | complement component C3b binding(GO:0001851) |
0.0 | 0.8 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.1 | GO:0031699 | beta-3 adrenergic receptor binding(GO:0031699) |
0.0 | 0.1 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
0.0 | 0.6 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.1 | GO:0042328 | heparan sulfate N-acetylglucosaminyltransferase activity(GO:0042328) |
0.0 | 0.3 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.2 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.4 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.4 | GO:0016875 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.1 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.2 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.0 | 0.3 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.3 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.6 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.2 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.3 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.1 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.0 | 2.3 | GO:0051015 | actin filament binding(GO:0051015) |
0.0 | 0.1 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.2 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.0 | 0.2 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 0.0 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
0.0 | 0.0 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 2.8 | GO:0003779 | actin binding(GO:0003779) |
0.0 | 5.3 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 15.7 | PID ATR PATHWAY | ATR signaling pathway |
0.2 | 2.5 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.2 | 1.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.2 | 7.1 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 7.5 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 8.1 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 2.9 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 8.7 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 0.4 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.1 | 0.5 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.1 | 0.3 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.1 | 0.7 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 3.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 2.8 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.1 | 2.0 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 2.7 | PID BMP PATHWAY | BMP receptor signaling |
0.1 | 1.0 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.5 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 1.8 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.7 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 0.6 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 1.2 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.3 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.5 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 1.6 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.9 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.5 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 1.9 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.5 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 1.3 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.9 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.7 | PID ATM PATHWAY | ATM pathway |
0.0 | 1.1 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.1 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.0 | 0.2 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 1.2 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.0 | 0.9 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.3 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.6 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.0 | 0.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.6 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 0.6 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.1 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.3 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.6 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.6 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.1 | PID EPO PATHWAY | EPO signaling pathway |
0.0 | 0.6 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 0.6 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.2 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.3 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.2 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 13.9 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.3 | 0.3 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
0.2 | 0.8 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
0.2 | 4.9 | REACTOME KINESINS | Genes involved in Kinesins |
0.2 | 7.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.2 | 1.9 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.2 | 2.9 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.2 | 5.9 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.1 | 3.5 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 3.1 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.1 | 3.0 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.1 | 11.8 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 0.9 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.1 | 1.1 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.1 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 2.6 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.1 | 0.9 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 1.0 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.1 | 7.2 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 0.5 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.1 | 1.1 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 3.2 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 1.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 1.9 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.1 | 5.2 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.1 | 1.0 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 2.1 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.1 | 1.5 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.1 | 1.7 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.1 | 1.1 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.1 | 1.3 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.1 | 1.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.1 | 0.3 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.8 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.5 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.0 | 0.5 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.7 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 2.4 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 1.0 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.8 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.3 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.0 | 0.1 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.0 | 2.1 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.6 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.0 | 1.9 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.0 | 0.4 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.4 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.6 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.5 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 0.5 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 0.3 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.3 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.4 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.3 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
0.0 | 0.2 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
0.0 | 1.2 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 0.3 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.6 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.5 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.5 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.0 | 0.5 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.1 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 2.3 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.3 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 0.1 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.0 | 0.5 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.8 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.2 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.3 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 0.6 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 0.4 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.0 | 0.2 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.0 | 1.1 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 1.0 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.1 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.0 | 0.3 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.3 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.0 | 0.2 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.0 | 0.2 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.2 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.1 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |