12D miR HR13_24
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Spi1
|
ENSMUSG00000002111.8 | spleen focus forming virus (SFFV) proviral integration oncogene |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Spi1 | mm10_v2_chr2_+_91082362_91082390 | -0.37 | 2.6e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr16_+_5007306 | 2.67 |
ENSMUST00000178155.2
ENSMUST00000184256.1 ENSMUST00000185147.1 |
Smim22
|
small integral membrane protein 22 |
chr7_-_19796789 | 2.56 |
ENSMUST00000108449.2
ENSMUST00000043822.7 |
Cblc
|
Casitas B-lineage lymphoma c |
chr14_+_103046977 | 2.43 |
ENSMUST00000022722.6
|
Irg1
|
immunoresponsive gene 1 |
chrX_+_164436987 | 2.35 |
ENSMUST00000036858.4
|
Asb11
|
ankyrin repeat and SOCS box-containing 11 |
chrX_+_164162167 | 2.33 |
ENSMUST00000131543.1
|
Ace2
|
angiotensin I converting enzyme (peptidyl-dipeptidase A) 2 |
chr19_+_32619997 | 2.03 |
ENSMUST00000025833.6
|
Papss2
|
3'-phosphoadenosine 5'-phosphosulfate synthase 2 |
chr11_-_83592981 | 2.03 |
ENSMUST00000019071.3
|
Ccl6
|
chemokine (C-C motif) ligand 6 |
chr7_-_127137807 | 2.02 |
ENSMUST00000049931.5
|
Spn
|
sialophorin |
chr3_-_90695706 | 2.01 |
ENSMUST00000069960.5
ENSMUST00000117167.1 |
S100a9
|
S100 calcium binding protein A9 (calgranulin B) |
chr7_-_101864093 | 2.00 |
ENSMUST00000106981.1
|
Folr1
|
folate receptor 1 (adult) |
chr1_+_16688405 | 1.99 |
ENSMUST00000026881.4
|
Ly96
|
lymphocyte antigen 96 |
chr3_+_138277489 | 1.99 |
ENSMUST00000004232.9
|
Adh1
|
alcohol dehydrogenase 1 (class I) |
chr16_+_5007283 | 1.98 |
ENSMUST00000184439.1
|
Smim22
|
small integral membrane protein 22 |
chrX_-_108664891 | 1.95 |
ENSMUST00000178160.1
|
Gm379
|
predicted gene 379 |
chr3_+_90669063 | 1.94 |
ENSMUST00000069927.8
|
S100a8
|
S100 calcium binding protein A8 (calgranulin A) |
chr6_-_124738579 | 1.90 |
ENSMUST00000174265.1
ENSMUST00000004377.8 |
Ptpn6
|
protein tyrosine phosphatase, non-receptor type 6 |
chr6_-_124738714 | 1.85 |
ENSMUST00000171549.2
|
Ptpn6
|
protein tyrosine phosphatase, non-receptor type 6 |
chr3_-_137981523 | 1.75 |
ENSMUST00000136613.1
ENSMUST00000029806.6 |
Dapp1
|
dual adaptor for phosphotyrosine and 3-phosphoinositides 1 |
chr10_-_127041513 | 1.72 |
ENSMUST00000116231.2
|
Mettl21b
|
methyltransferase like 21B |
chr11_+_29692937 | 1.67 |
ENSMUST00000102843.3
ENSMUST00000102842.3 ENSMUST00000078830.4 ENSMUST00000170731.1 |
Rtn4
|
reticulon 4 |
chr4_+_54947976 | 1.66 |
ENSMUST00000098070.3
|
Zfp462
|
zinc finger protein 462 |
chr16_+_96361654 | 1.66 |
ENSMUST00000113794.1
|
Igsf5
|
immunoglobulin superfamily, member 5 |
chr16_+_96361749 | 1.63 |
ENSMUST00000000163.6
ENSMUST00000081093.3 ENSMUST00000113795.1 |
Igsf5
|
immunoglobulin superfamily, member 5 |
chr17_+_69439326 | 1.58 |
ENSMUST00000169935.1
|
A330050F15Rik
|
RIKEN cDNA A330050F15 gene |
chr2_-_25196759 | 1.57 |
ENSMUST00000081869.6
|
Tor4a
|
torsin family 4, member A |
chr15_+_78244781 | 1.56 |
ENSMUST00000096357.5
ENSMUST00000133618.1 |
Ncf4
|
neutrophil cytosolic factor 4 |
chr11_+_69964758 | 1.55 |
ENSMUST00000108597.1
ENSMUST00000060651.5 ENSMUST00000108596.1 |
Cldn7
|
claudin 7 |
chr12_-_84698769 | 1.54 |
ENSMUST00000095550.2
|
Syndig1l
|
synapse differentiation inducing 1 like |
chr1_-_131276914 | 1.52 |
ENSMUST00000161764.1
|
Ikbke
|
inhibitor of kappaB kinase epsilon |
chr1_-_134235420 | 1.51 |
ENSMUST00000038191.6
ENSMUST00000086465.4 |
Adora1
|
adenosine A1 receptor |
chr4_-_130279205 | 1.51 |
ENSMUST00000120126.2
|
Serinc2
|
serine incorporator 2 |
chr7_-_141100526 | 1.48 |
ENSMUST00000097958.2
|
Sigirr
|
single immunoglobulin and toll-interleukin 1 receptor (TIR) domain |
chr11_-_102107822 | 1.44 |
ENSMUST00000177304.1
ENSMUST00000017455.8 |
Pyy
|
peptide YY |
chr8_+_105427634 | 1.44 |
ENSMUST00000067305.6
|
Lrrc36
|
leucine rich repeat containing 36 |
chr11_-_83578496 | 1.43 |
ENSMUST00000019266.5
|
Ccl9
|
chemokine (C-C motif) ligand 9 |
chr3_+_145292472 | 1.40 |
ENSMUST00000029848.4
ENSMUST00000139001.1 |
Col24a1
|
collagen, type XXIV, alpha 1 |
chr8_-_38661508 | 1.39 |
ENSMUST00000118896.1
|
Sgcz
|
sarcoglycan zeta |
chr11_+_61684419 | 1.38 |
ENSMUST00000093019.5
|
Fam83g
|
family with sequence similarity 83, member G |
chr2_-_103303179 | 1.35 |
ENSMUST00000090475.3
|
Ehf
|
ets homologous factor |
chr19_-_40994133 | 1.32 |
ENSMUST00000117695.1
|
Blnk
|
B cell linker |
chr15_-_101370125 | 1.32 |
ENSMUST00000077196.4
|
Krt80
|
keratin 80 |
chr12_-_86988676 | 1.31 |
ENSMUST00000095521.2
|
Zdhhc22
|
zinc finger, DHHC-type containing 22 |
chr10_+_34483400 | 1.31 |
ENSMUST00000019913.7
ENSMUST00000170771.1 |
Frk
|
fyn-related kinase |
chr16_+_36694024 | 1.30 |
ENSMUST00000119464.1
|
Ildr1
|
immunoglobulin-like domain containing receptor 1 |
chr14_+_41105359 | 1.27 |
ENSMUST00000047286.6
|
Mat1a
|
methionine adenosyltransferase I, alpha |
chr2_-_103303158 | 1.27 |
ENSMUST00000111176.2
|
Ehf
|
ets homologous factor |
chr7_+_18884679 | 1.26 |
ENSMUST00000032573.6
|
Pglyrp1
|
peptidoglycan recognition protein 1 |
chr7_-_100964371 | 1.26 |
ENSMUST00000060174.4
|
P2ry6
|
pyrimidinergic receptor P2Y, G-protein coupled, 6 |
chr5_-_123865491 | 1.24 |
ENSMUST00000057145.5
|
Niacr1
|
niacin receptor 1 |
chr11_-_109722214 | 1.24 |
ENSMUST00000020938.7
|
Fam20a
|
family with sequence similarity 20, member A |
chr6_+_17065129 | 1.24 |
ENSMUST00000115467.4
ENSMUST00000154266.2 ENSMUST00000076654.7 |
Tes
|
testis derived transcript |
chr15_+_100304782 | 1.23 |
ENSMUST00000067752.3
|
Mettl7a1
|
methyltransferase like 7A1 |
chr18_-_36726730 | 1.22 |
ENSMUST00000061829.6
|
Cd14
|
CD14 antigen |
chr17_+_23660477 | 1.22 |
ENSMUST00000062967.8
|
Ccdc64b
|
coiled-coil domain containing 64B |
chr2_+_19445632 | 1.20 |
ENSMUST00000028068.2
|
Ptf1a
|
pancreas specific transcription factor, 1a |
chr2_-_24048857 | 1.19 |
ENSMUST00000114497.1
|
Hnmt
|
histamine N-methyltransferase |
chr14_-_8378753 | 1.18 |
ENSMUST00000022269.5
|
Oit1
|
oncoprotein induced transcript 1 |
chr5_+_21372642 | 1.17 |
ENSMUST00000035799.5
|
Fgl2
|
fibrinogen-like protein 2 |
chr7_+_19083842 | 1.14 |
ENSMUST00000032568.7
ENSMUST00000122999.1 ENSMUST00000108473.3 ENSMUST00000108474.1 |
Dmpk
|
dystrophia myotonica-protein kinase |
chr14_-_110755100 | 1.14 |
ENSMUST00000078386.2
|
Slitrk6
|
SLIT and NTRK-like family, member 6 |
chr7_-_45239108 | 1.13 |
ENSMUST00000033063.6
|
Cd37
|
CD37 antigen |
chr16_-_24393588 | 1.13 |
ENSMUST00000181640.1
|
1110054M08Rik
|
RIKEN cDNA 1110054M08 gene |
chr11_+_69965396 | 1.12 |
ENSMUST00000018713.6
|
Cldn7
|
claudin 7 |
chr9_-_105395237 | 1.11 |
ENSMUST00000140851.1
|
Nek11
|
NIMA (never in mitosis gene a)-related expressed kinase 11 |
chr10_+_127866457 | 1.10 |
ENSMUST00000092058.3
|
BC089597
|
cDNA sequence BC089597 |
chr18_+_74442500 | 1.09 |
ENSMUST00000074157.6
|
Myo5b
|
myosin VB |
chr11_+_87760533 | 1.08 |
ENSMUST00000039627.5
ENSMUST00000100644.3 |
Bzrap1
|
benzodiazepine receptor associated protein 1 |
chr11_-_114989854 | 1.04 |
ENSMUST00000045075.2
|
Cd300ld
|
CD300 molecule-like family member d |
chr17_-_91088726 | 1.04 |
ENSMUST00000072671.7
ENSMUST00000174331.1 ENSMUST00000161402.3 ENSMUST00000054059.8 |
Nrxn1
|
neurexin I |
chr14_-_55788810 | 1.02 |
ENSMUST00000022830.6
ENSMUST00000168716.1 ENSMUST00000178399.1 |
Ripk3
|
receptor-interacting serine-threonine kinase 3 |
chr14_+_41131777 | 1.02 |
ENSMUST00000022314.3
ENSMUST00000170719.1 |
Sftpa1
|
surfactant associated protein A1 |
chr13_-_23622502 | 1.02 |
ENSMUST00000062045.2
|
Hist1h1e
|
histone cluster 1, H1e |
chrX_-_153037549 | 1.01 |
ENSMUST00000051484.3
|
Mageh1
|
melanoma antigen, family H, 1 |
chr16_+_36693972 | 1.01 |
ENSMUST00000023617.6
ENSMUST00000089618.3 |
Ildr1
|
immunoglobulin-like domain containing receptor 1 |
chr2_+_70563435 | 1.01 |
ENSMUST00000123330.1
|
Gad1
|
glutamate decarboxylase 1 |
chr4_+_102570065 | 1.00 |
ENSMUST00000097950.2
|
Pde4b
|
phosphodiesterase 4B, cAMP specific |
chr17_-_63499983 | 1.00 |
ENSMUST00000024761.6
|
Fbxl17
|
F-box and leucine-rich repeat protein 17 |
chr2_+_70562007 | 0.99 |
ENSMUST00000094934.4
|
Gad1
|
glutamate decarboxylase 1 |
chr10_-_83648713 | 0.98 |
ENSMUST00000020500.7
|
Appl2
|
adaptor protein, phosphotyrosine interaction, PH domain and leucine zipper containing 2 |
chr3_-_69859875 | 0.98 |
ENSMUST00000051239.7
ENSMUST00000171529.1 |
Sptssb
|
serine palmitoyltransferase, small subunit B |
chr5_+_90786100 | 0.98 |
ENSMUST00000031326.8
|
Cxcl3
|
chemokine (C-X-C motif) ligand 3 |
chr7_-_3898120 | 0.98 |
ENSMUST00000070639.7
|
Gm14548
|
predicted gene 14548 |
chr10_-_77259223 | 0.97 |
ENSMUST00000105408.3
|
Gm10941
|
predicted gene 10941 |
chr11_+_68968107 | 0.97 |
ENSMUST00000102606.3
ENSMUST00000018884.5 |
Slc25a35
|
solute carrier family 25, member 35 |
chr1_-_171294937 | 0.96 |
ENSMUST00000111302.3
ENSMUST00000080001.2 |
Ufc1
|
ubiquitin-fold modifier conjugating enzyme 1 |
chr7_-_45239041 | 0.95 |
ENSMUST00000131290.1
|
Cd37
|
CD37 antigen |
chr15_-_54278420 | 0.95 |
ENSMUST00000079772.3
|
Tnfrsf11b
|
tumor necrosis factor receptor superfamily, member 11b (osteoprotegerin) |
chr9_+_110476985 | 0.94 |
ENSMUST00000084948.4
ENSMUST00000061155.6 ENSMUST00000140686.1 ENSMUST00000084952.5 |
Kif9
|
kinesin family member 9 |
chr11_-_114066174 | 0.94 |
ENSMUST00000041627.7
|
Sdk2
|
sidekick homolog 2 (chicken) |
chr2_+_24386604 | 0.93 |
ENSMUST00000166388.1
|
Psd4
|
pleckstrin and Sec7 domain containing 4 |
chr11_-_105944412 | 0.93 |
ENSMUST00000019734.4
ENSMUST00000184269.1 ENSMUST00000150563.1 |
Cyb561
|
cytochrome b-561 |
chr4_+_106622424 | 0.93 |
ENSMUST00000047922.2
|
Ttc22
|
tetratricopeptide repeat domain 22 |
chr19_-_7607103 | 0.93 |
ENSMUST00000079902.5
ENSMUST00000099729.3 ENSMUST00000159983.1 |
Lgals12
|
lectin, galactose binding, soluble 12 |
chr13_-_37049203 | 0.93 |
ENSMUST00000037491.8
|
F13a1
|
coagulation factor XIII, A1 subunit |
chr13_-_13393592 | 0.93 |
ENSMUST00000021738.8
|
Gpr137b
|
G protein-coupled receptor 137B |
chrX_-_162643575 | 0.92 |
ENSMUST00000101102.1
|
Reps2
|
RALBP1 associated Eps domain containing protein 2 |
chr8_+_94923687 | 0.92 |
ENSMUST00000153448.1
ENSMUST00000074570.3 ENSMUST00000166802.1 |
Gpr114
|
G protein-coupled receptor 114 |
chr2_-_30903255 | 0.92 |
ENSMUST00000102852.3
|
Ptges
|
prostaglandin E synthase |
chr2_-_104742802 | 0.92 |
ENSMUST00000028595.7
|
Depdc7
|
DEP domain containing 7 |
chr7_-_46099752 | 0.92 |
ENSMUST00000180081.1
|
Kcnj11
|
potassium inwardly rectifying channel, subfamily J, member 11 |
chr6_-_123289862 | 0.92 |
ENSMUST00000032239.4
ENSMUST00000177367.1 |
Clec4e
|
C-type lectin domain family 4, member e |
chr5_-_29735928 | 0.91 |
ENSMUST00000065372.3
|
Gm5129
|
predicted gene 5129 |
chr3_+_106486009 | 0.91 |
ENSMUST00000183271.1
ENSMUST00000061206.3 |
Dennd2d
|
DENN/MADD domain containing 2D |
chr2_+_129592914 | 0.91 |
ENSMUST00000103203.1
|
Sirpa
|
signal-regulatory protein alpha |
chr3_+_141465564 | 0.91 |
ENSMUST00000106236.2
ENSMUST00000075282.3 |
Unc5c
|
unc-5 homolog C (C. elegans) |
chr10_-_93310963 | 0.91 |
ENSMUST00000151153.1
|
Elk3
|
ELK3, member of ETS oncogene family |
chr11_-_69858723 | 0.90 |
ENSMUST00000001626.3
ENSMUST00000108626.1 |
Tnk1
|
tyrosine kinase, non-receptor, 1 |
chr1_+_152807877 | 0.90 |
ENSMUST00000027754.6
|
Ncf2
|
neutrophil cytosolic factor 2 |
chr7_+_35555367 | 0.90 |
ENSMUST00000181932.1
|
B230322F03Rik
|
RIKEN cDNA B230322F03 gene |
chr7_-_73537621 | 0.89 |
ENSMUST00000172704.1
|
Chd2
|
chromodomain helicase DNA binding protein 2 |
chr9_-_53706211 | 0.89 |
ENSMUST00000068449.3
|
Rab39
|
RAB39, member RAS oncogene family |
chr5_+_24428208 | 0.89 |
ENSMUST00000115049.2
|
Slc4a2
|
solute carrier family 4 (anion exchanger), member 2 |
chr11_+_96464587 | 0.88 |
ENSMUST00000103154.4
ENSMUST00000100521.3 ENSMUST00000100519.4 ENSMUST00000071510.7 ENSMUST00000107662.2 |
Skap1
|
src family associated phosphoprotein 1 |
chr1_+_134182150 | 0.87 |
ENSMUST00000156873.1
|
Chi3l1
|
chitinase 3-like 1 |
chr7_+_51878967 | 0.87 |
ENSMUST00000051912.6
|
Gas2
|
growth arrest specific 2 |
chr16_+_31878810 | 0.87 |
ENSMUST00000023464.5
|
Mfi2
|
antigen p97 (melanoma associated) identified by monoclonal antibodies 133.2 and 96.5 |
chr1_-_161251153 | 0.86 |
ENSMUST00000051925.4
ENSMUST00000071718.5 |
Prdx6
|
peroxiredoxin 6 |
chr3_+_96670131 | 0.86 |
ENSMUST00000048427.5
|
Ankrd35
|
ankyrin repeat domain 35 |
chr1_+_135132693 | 0.86 |
ENSMUST00000049449.4
|
Ptpn7
|
protein tyrosine phosphatase, non-receptor type 7 |
chr15_-_66560997 | 0.86 |
ENSMUST00000048372.5
|
Tmem71
|
transmembrane protein 71 |
chr2_-_103283760 | 0.85 |
ENSMUST00000111174.1
|
Ehf
|
ets homologous factor |
chr15_+_102102926 | 0.85 |
ENSMUST00000169627.1
ENSMUST00000046144.9 |
Tenc1
|
tensin like C1 domain-containing phosphatase |
chr7_-_45238794 | 0.85 |
ENSMUST00000098461.1
ENSMUST00000107797.1 |
Cd37
|
CD37 antigen |
chr16_-_44016387 | 0.84 |
ENSMUST00000036174.3
|
Gramd1c
|
GRAM domain containing 1C |
chr11_-_69880971 | 0.84 |
ENSMUST00000050555.3
|
Kctd11
|
potassium channel tetramerisation domain containing 11 |
chr13_+_38151343 | 0.84 |
ENSMUST00000124830.1
|
Dsp
|
desmoplakin |
chr1_-_156035891 | 0.83 |
ENSMUST00000126448.1
|
Tor1aip1
|
torsin A interacting protein 1 |
chr6_+_29853746 | 0.83 |
ENSMUST00000064872.6
ENSMUST00000152581.1 ENSMUST00000176265.1 ENSMUST00000154079.1 |
Ahcyl2
|
S-adenosylhomocysteine hydrolase-like 2 |
chr12_-_108835845 | 0.82 |
ENSMUST00000021693.3
|
Slc25a29
|
solute carrier family 25 (mitochondrial carrier, palmitoylcarnitine transporter), member 29 |
chr5_+_30913398 | 0.82 |
ENSMUST00000031055.5
|
Emilin1
|
elastin microfibril interfacer 1 |
chr2_+_129592818 | 0.82 |
ENSMUST00000153491.1
ENSMUST00000161620.1 ENSMUST00000179001.1 |
Sirpa
|
signal-regulatory protein alpha |
chr4_+_120666562 | 0.82 |
ENSMUST00000094814.4
|
Cited4
|
Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 |
chr3_-_75451818 | 0.81 |
ENSMUST00000178270.1
|
Wdr49
|
WD repeat domain 49 |
chr1_-_20617992 | 0.81 |
ENSMUST00000088448.5
|
Pkhd1
|
polycystic kidney and hepatic disease 1 |
chrX_+_139684980 | 0.81 |
ENSMUST00000096313.3
|
Tbc1d8b
|
TBC1 domain family, member 8B |
chr17_+_27057288 | 0.81 |
ENSMUST00000049308.8
|
Itpr3
|
inositol 1,4,5-triphosphate receptor 3 |
chr8_-_54529951 | 0.81 |
ENSMUST00000067476.8
|
Spcs3
|
signal peptidase complex subunit 3 homolog (S. cerevisiae) |
chr17_-_35201996 | 0.81 |
ENSMUST00000167924.1
ENSMUST00000025263.8 |
Tnf
|
tumor necrosis factor |
chr9_-_66126559 | 0.80 |
ENSMUST00000137542.1
|
Snx1
|
sorting nexin 1 |
chr16_-_52296924 | 0.80 |
ENSMUST00000167115.1
|
Alcam
|
activated leukocyte cell adhesion molecule |
chr6_+_96115249 | 0.80 |
ENSMUST00000075080.5
|
Fam19a1
|
family with sequence similarity 19, member A1 |
chr16_+_97356721 | 0.80 |
ENSMUST00000047275.6
|
Bace2
|
beta-site APP-cleaving enzyme 2 |
chr16_+_30008657 | 0.80 |
ENSMUST00000181485.1
|
4632428C04Rik
|
RIKEN cDNA 4632428C04 gene |
chr5_+_102481374 | 0.79 |
ENSMUST00000094559.2
ENSMUST00000073302.5 |
Arhgap24
|
Rho GTPase activating protein 24 |
chr12_-_4841583 | 0.79 |
ENSMUST00000020964.5
|
Fkbp1b
|
FK506 binding protein 1b |
chrX_+_142681398 | 0.79 |
ENSMUST00000112889.1
ENSMUST00000101198.2 ENSMUST00000112891.1 ENSMUST00000087333.2 |
Tmem164
|
transmembrane protein 164 |
chr10_-_18023229 | 0.79 |
ENSMUST00000020002.7
|
Abracl
|
ABRA C-terminal like |
chr9_-_21312255 | 0.79 |
ENSMUST00000115433.3
ENSMUST00000003397.7 |
Ap1m2
|
adaptor protein complex AP-1, mu 2 subunit |
chr9_+_108392820 | 0.79 |
ENSMUST00000035234.4
|
1700102P08Rik
|
RIKEN cDNA 1700102P08 gene |
chr3_+_89436699 | 0.79 |
ENSMUST00000038942.3
ENSMUST00000130858.1 |
Pbxip1
|
pre B cell leukemia transcription factor interacting protein 1 |
chr3_+_95526777 | 0.78 |
ENSMUST00000015667.2
ENSMUST00000116304.2 |
Ctss
|
cathepsin S |
chr2_+_69135799 | 0.78 |
ENSMUST00000041865.7
|
Nostrin
|
nitric oxide synthase trafficker |
chr16_+_96280798 | 0.78 |
ENSMUST00000099497.3
|
B3galt5
|
UDP-Gal:betaGlcNAc beta 1,3-galactosyltransferase, polypeptide 5 |
chr6_+_71272019 | 0.78 |
ENSMUST00000168700.1
|
Krcc1
|
lysine-rich coiled-coil 1 |
chr7_+_27195781 | 0.77 |
ENSMUST00000108379.1
ENSMUST00000179391.1 |
BC024978
|
cDNA sequence BC024978 |
chr4_-_106799779 | 0.77 |
ENSMUST00000145061.1
ENSMUST00000102762.3 |
Acot11
|
acyl-CoA thioesterase 11 |
chr19_+_8920358 | 0.77 |
ENSMUST00000096243.5
|
B3gat3
|
beta-1,3-glucuronyltransferase 3 (glucuronosyltransferase I) |
chr5_+_102481546 | 0.77 |
ENSMUST00000112854.1
|
Arhgap24
|
Rho GTPase activating protein 24 |
chr11_-_69858687 | 0.77 |
ENSMUST00000125571.1
|
Tnk1
|
tyrosine kinase, non-receptor, 1 |
chr6_-_52012476 | 0.77 |
ENSMUST00000078214.5
|
Skap2
|
src family associated phosphoprotein 2 |
chrX_-_8090442 | 0.76 |
ENSMUST00000033505.6
|
Was
|
Wiskott-Aldrich syndrome homolog (human) |
chr4_-_62434722 | 0.76 |
ENSMUST00000107454.1
|
Rnf183
|
ring finger protein 183 |
chr11_-_59163281 | 0.76 |
ENSMUST00000069631.2
|
Iba57
|
IBA57, iron-sulfur cluster assembly homolog (S. cerevisiae) |
chr4_-_129573637 | 0.76 |
ENSMUST00000102596.1
|
Lck
|
lymphocyte protein tyrosine kinase |
chr15_+_10177623 | 0.75 |
ENSMUST00000124470.1
|
Prlr
|
prolactin receptor |
chr7_+_51879041 | 0.75 |
ENSMUST00000107591.2
|
Gas2
|
growth arrest specific 2 |
chr12_-_78980758 | 0.74 |
ENSMUST00000174072.1
|
Tmem229b
|
transmembrane protein 229B |
chr8_-_83166170 | 0.74 |
ENSMUST00000098605.2
|
Gm10645
|
predicted gene 10645 |
chrX_+_159840463 | 0.74 |
ENSMUST00000112451.1
ENSMUST00000112453.2 |
Sh3kbp1
|
SH3-domain kinase binding protein 1 |
chr10_-_24101951 | 0.74 |
ENSMUST00000170267.1
|
Taar8c
|
trace amine-associated receptor 8C |
chr6_-_128581597 | 0.74 |
ENSMUST00000060574.7
|
BC048546
|
cDNA sequence BC048546 |
chr17_-_57078490 | 0.74 |
ENSMUST00000011623.7
|
Dennd1c
|
DENN/MADD domain containing 1C |
chr11_-_95514570 | 0.74 |
ENSMUST00000058866.7
|
Nxph3
|
neurexophilin 3 |
chr19_+_5474681 | 0.73 |
ENSMUST00000165485.1
ENSMUST00000166253.1 ENSMUST00000167371.1 ENSMUST00000167855.1 ENSMUST00000070118.7 |
Efemp2
|
epidermal growth factor-containing fibulin-like extracellular matrix protein 2 |
chr3_+_122729158 | 0.73 |
ENSMUST00000066728.5
|
Pde5a
|
phosphodiesterase 5A, cGMP-specific |
chr11_-_83649349 | 0.73 |
ENSMUST00000001008.5
|
Ccl3
|
chemokine (C-C motif) ligand 3 |
chr18_-_6241486 | 0.73 |
ENSMUST00000025083.7
|
Kif5b
|
kinesin family member 5B |
chr8_+_68880491 | 0.73 |
ENSMUST00000015712.8
|
Lpl
|
lipoprotein lipase |
chr9_-_21592805 | 0.73 |
ENSMUST00000034700.7
ENSMUST00000180365.1 ENSMUST00000078572.7 |
Yipf2
|
Yip1 domain family, member 2 |
chr9_+_66126611 | 0.73 |
ENSMUST00000034945.5
|
Fam96a
|
family with sequence similarity 96, member A |
chr19_+_22139028 | 0.73 |
ENSMUST00000099569.2
ENSMUST00000087576.4 ENSMUST00000074770.5 |
Trpm3
|
transient receptor potential cation channel, subfamily M, member 3 |
chr14_+_54464141 | 0.72 |
ENSMUST00000022782.8
|
Lrp10
|
low-density lipoprotein receptor-related protein 10 |
chr9_-_22131801 | 0.72 |
ENSMUST00000069330.6
|
Acp5
|
acid phosphatase 5, tartrate resistant |
chr11_+_78536393 | 0.72 |
ENSMUST00000050366.8
ENSMUST00000108275.1 |
Ift20
|
intraflagellar transport 20 |
chr6_-_115592571 | 0.72 |
ENSMUST00000112957.1
|
2510049J12Rik
|
RIKEN cDNA 2510049J12 gene |
chr6_+_86526271 | 0.72 |
ENSMUST00000180896.1
|
1600020E01Rik
|
RIKEN cDNA 1600020E01 gene |
chr4_-_154300029 | 0.71 |
ENSMUST00000030898.5
|
Arhgef16
|
Rho guanine nucleotide exchange factor (GEF) 16 |
chr8_-_105326252 | 0.71 |
ENSMUST00000070508.7
|
Lrrc29
|
leucine rich repeat containing 29 |
chr11_+_114765363 | 0.71 |
ENSMUST00000138804.1
ENSMUST00000084368.5 |
Kif19a
|
kinesin family member 19A |
chr10_-_93311073 | 0.71 |
ENSMUST00000008542.5
|
Elk3
|
ELK3, member of ETS oncogene family |
chr4_-_46138398 | 0.70 |
ENSMUST00000144495.1
ENSMUST00000107770.1 ENSMUST00000156021.1 ENSMUST00000107772.1 |
Tstd2
|
thiosulfate sulfurtransferase (rhodanese)-like domain containing 2 |
chr5_+_149439706 | 0.70 |
ENSMUST00000031667.4
|
Tex26
|
testis expressed 26 |
chr4_+_128058962 | 0.70 |
ENSMUST00000184063.1
|
Csmd2
|
CUB and Sushi multiple domains 2 |
chr3_-_95251049 | 0.70 |
ENSMUST00000098871.4
|
Bnipl
|
BCL2/adenovirus E1B 19kD interacting protein like |
chr5_-_135573036 | 0.70 |
ENSMUST00000004936.6
|
Ccl24
|
chemokine (C-C motif) ligand 24 |
chrX_+_73123068 | 0.70 |
ENSMUST00000179117.1
|
Gm14685
|
predicted gene 14685 |
chr16_-_42340595 | 0.70 |
ENSMUST00000102817.4
|
Gap43
|
growth associated protein 43 |
chr18_-_3281036 | 0.69 |
ENSMUST00000049942.6
ENSMUST00000139537.1 ENSMUST00000124747.1 |
Crem
|
cAMP responsive element modulator |
chr1_-_119504736 | 0.69 |
ENSMUST00000004565.8
|
Ralb
|
v-ral simian leukemia viral oncogene homolog B (ras related) |
chr2_-_25500613 | 0.69 |
ENSMUST00000040042.4
|
C8g
|
complement component 8, gamma polypeptide |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 3.9 | GO:0070488 | neutrophil aggregation(GO:0070488) |
0.7 | 3.7 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
0.7 | 2.2 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
0.7 | 3.0 | GO:0015827 | aromatic amino acid transport(GO:0015801) tryptophan transport(GO:0015827) |
0.7 | 0.7 | GO:0002588 | positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
0.6 | 2.3 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.6 | 1.7 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) |
0.6 | 1.1 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.5 | 2.0 | GO:0006069 | ethanol oxidation(GO:0006069) |
0.5 | 1.5 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.5 | 1.4 | GO:0032827 | peptidoglycan metabolic process(GO:0000270) natural killer cell differentiation involved in immune response(GO:0002325) peptidoglycan catabolic process(GO:0009253) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.4 | 2.0 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.4 | 0.4 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.4 | 1.2 | GO:0071727 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.4 | 2.4 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.4 | 1.5 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.4 | 1.1 | GO:2001076 | negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
0.3 | 1.0 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
0.3 | 2.0 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.3 | 3.0 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.3 | 0.6 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.3 | 0.9 | GO:0034769 | basement membrane disassembly(GO:0034769) |
0.3 | 0.6 | GO:1904000 | positive regulation of eating behavior(GO:1904000) positive regulation of small intestine smooth muscle contraction(GO:1904349) |
0.3 | 2.5 | GO:1904220 | regulation of serine C-palmitoyltransferase activity(GO:1904220) |
0.3 | 1.2 | GO:2000449 | regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) |
0.3 | 0.6 | GO:0002343 | peripheral B cell selection(GO:0002343) B cell affinity maturation(GO:0002344) |
0.3 | 1.2 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.3 | 0.9 | GO:2000642 | negative regulation of early endosome to late endosome transport(GO:2000642) |
0.3 | 0.3 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.3 | 1.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.3 | 2.0 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.3 | 1.1 | GO:0060005 | vestibular reflex(GO:0060005) |
0.3 | 1.7 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.3 | 0.8 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) L-lysine transport(GO:1902022) |
0.3 | 2.6 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
0.3 | 1.0 | GO:0090126 | protein complex assembly involved in synapse maturation(GO:0090126) |
0.3 | 0.8 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.2 | 1.5 | GO:0032439 | endosome localization(GO:0032439) |
0.2 | 0.5 | GO:2000439 | positive regulation of monocyte extravasation(GO:2000439) |
0.2 | 1.0 | GO:0010808 | positive regulation of synaptic vesicle priming(GO:0010808) |
0.2 | 0.5 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.2 | 0.5 | GO:0046271 | coumarin metabolic process(GO:0009804) phenylpropanoid catabolic process(GO:0046271) |
0.2 | 0.7 | GO:0046021 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
0.2 | 0.7 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.2 | 0.7 | GO:0001928 | regulation of exocyst assembly(GO:0001928) |
0.2 | 0.5 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.2 | 0.7 | GO:0048209 | regulation of vesicle targeting, to, from or within Golgi(GO:0048209) |
0.2 | 0.2 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.2 | 2.0 | GO:0071231 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) cellular response to folic acid(GO:0071231) |
0.2 | 0.7 | GO:0061144 | epithelial cell maturation involved in prostate gland development(GO:0060743) alveolar secondary septum development(GO:0061144) |
0.2 | 0.7 | GO:0035482 | gastric motility(GO:0035482) |
0.2 | 0.7 | GO:0043309 | regulation of eosinophil degranulation(GO:0043309) positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
0.2 | 0.9 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.2 | 0.4 | GO:0071608 | macrophage inflammatory protein-1 alpha production(GO:0071608) |
0.2 | 0.6 | GO:0051462 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) positive regulation of cortisol secretion(GO:0051464) |
0.2 | 1.3 | GO:0036258 | multivesicular body assembly(GO:0036258) |
0.2 | 0.8 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.2 | 1.5 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.2 | 1.0 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.2 | 1.7 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.2 | 2.1 | GO:0070474 | positive regulation of uterine smooth muscle contraction(GO:0070474) |
0.2 | 0.6 | GO:2000473 | regulation of hematopoietic stem cell migration(GO:2000471) positive regulation of hematopoietic stem cell migration(GO:2000473) |
0.2 | 2.0 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.2 | 1.8 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
0.2 | 0.6 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.2 | 0.8 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.2 | 1.0 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.2 | 1.5 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.2 | 0.4 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.2 | 0.6 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
0.2 | 1.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.2 | 0.2 | GO:0002865 | negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
0.2 | 0.6 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.2 | 1.6 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.2 | 1.3 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.2 | 0.7 | GO:0045608 | negative regulation of auditory receptor cell differentiation(GO:0045608) |
0.2 | 0.5 | GO:0045660 | positive regulation of neutrophil differentiation(GO:0045660) |
0.2 | 0.5 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
0.2 | 0.7 | GO:2000256 | endomitotic cell cycle(GO:0007113) thrombopoietin-mediated signaling pathway(GO:0038163) positive regulation of male germ cell proliferation(GO:2000256) |
0.2 | 3.3 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.2 | 0.7 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.2 | 0.5 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.2 | 0.5 | GO:0002003 | angiotensin maturation(GO:0002003) |
0.2 | 1.2 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.2 | 0.5 | GO:2000872 | positive regulation of progesterone secretion(GO:2000872) |
0.2 | 0.5 | GO:0006710 | androgen catabolic process(GO:0006710) estradiol secretion(GO:0035938) regulation of estradiol secretion(GO:2000864) |
0.2 | 0.5 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.2 | 0.5 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.2 | 0.5 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.2 | 0.2 | GO:0002305 | gamma-delta intraepithelial T cell differentiation(GO:0002304) CD8-positive, gamma-delta intraepithelial T cell differentiation(GO:0002305) |
0.2 | 0.5 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.2 | 1.1 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
0.2 | 0.5 | GO:0003274 | endocardial cushion fusion(GO:0003274) |
0.2 | 0.6 | GO:1903896 | positive regulation of IRE1-mediated unfolded protein response(GO:1903896) |
0.2 | 0.8 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.2 | 0.8 | GO:0032472 | Golgi calcium ion transport(GO:0032472) |
0.2 | 0.6 | GO:1904139 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.2 | 0.5 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
0.2 | 0.8 | GO:0051036 | regulation of endosome size(GO:0051036) |
0.2 | 1.1 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
0.2 | 0.5 | GO:0009073 | tyrosine biosynthetic process(GO:0006571) aromatic amino acid family biosynthetic process(GO:0009073) aromatic amino acid family biosynthetic process, prephenate pathway(GO:0009095) |
0.1 | 0.6 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.1 | 0.9 | GO:0090383 | phagosome acidification(GO:0090383) |
0.1 | 0.4 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.1 | 2.8 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.1 | 0.4 | GO:0002355 | detection of tumor cell(GO:0002355) |
0.1 | 3.1 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.1 | 0.7 | GO:0035617 | stress granule disassembly(GO:0035617) plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.1 | 0.7 | GO:0055096 | lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
0.1 | 0.4 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.1 | 0.4 | GO:1904578 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
0.1 | 1.3 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.1 | 1.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.1 | 0.3 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.1 | 0.4 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
0.1 | 0.4 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
0.1 | 0.4 | GO:0038093 | Fc receptor signaling pathway(GO:0038093) |
0.1 | 0.4 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 0.7 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.1 | 0.4 | GO:0043396 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.1 | 0.8 | GO:0031944 | negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
0.1 | 1.4 | GO:0061074 | regulation of neural retina development(GO:0061074) |
0.1 | 2.2 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.1 | 0.4 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.1 | 0.4 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.1 | 0.3 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
0.1 | 0.8 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
0.1 | 1.7 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
0.1 | 0.5 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.1 | 0.4 | GO:0045715 | negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
0.1 | 1.3 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
0.1 | 0.6 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.1 | 0.4 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
0.1 | 0.5 | GO:1990743 | protein sialylation(GO:1990743) |
0.1 | 0.4 | GO:0046351 | disaccharide biosynthetic process(GO:0046351) |
0.1 | 0.4 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
0.1 | 1.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 0.8 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.1 | 0.7 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.1 | 0.7 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.1 | 1.9 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.1 | 0.4 | GO:0006713 | glucocorticoid catabolic process(GO:0006713) |
0.1 | 0.6 | GO:0009227 | nucleotide-sugar catabolic process(GO:0009227) |
0.1 | 0.4 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
0.1 | 0.6 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.1 | 0.6 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 0.9 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.1 | 0.5 | GO:0072198 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) |
0.1 | 1.2 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.1 | 1.1 | GO:0048619 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) embryonic genitalia morphogenesis(GO:0030538) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) embryonic hindgut morphogenesis(GO:0048619) |
0.1 | 1.8 | GO:0032096 | negative regulation of response to food(GO:0032096) |
0.1 | 0.5 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.1 | 0.8 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.1 | 0.6 | GO:1905049 | negative regulation of metallopeptidase activity(GO:1905049) |
0.1 | 1.1 | GO:0070166 | enamel mineralization(GO:0070166) |
0.1 | 0.6 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.1 | 1.0 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
0.1 | 0.5 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 0.5 | GO:2001287 | negative regulation of caveolin-mediated endocytosis(GO:2001287) |
0.1 | 0.3 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
0.1 | 0.5 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
0.1 | 0.5 | GO:0099566 | regulation of postsynaptic cytosolic calcium ion concentration(GO:0099566) |
0.1 | 1.1 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.1 | 0.7 | GO:0098705 | copper ion import across plasma membrane(GO:0098705) copper ion import into cell(GO:1902861) |
0.1 | 1.6 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.1 | 0.7 | GO:0002159 | desmosome assembly(GO:0002159) |
0.1 | 0.3 | GO:0016240 | autophagosome docking(GO:0016240) |
0.1 | 0.9 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.1 | 0.4 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.1 | 0.6 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.1 | 0.6 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.1 | 0.7 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.1 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.1 | 0.6 | GO:0014004 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
0.1 | 0.6 | GO:0042363 | vitamin catabolic process(GO:0009111) fat-soluble vitamin catabolic process(GO:0042363) |
0.1 | 1.3 | GO:0031268 | pseudopodium organization(GO:0031268) |
0.1 | 0.3 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
0.1 | 0.9 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.1 | 0.9 | GO:0051665 | membrane raft localization(GO:0051665) |
0.1 | 1.0 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.1 | 2.7 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
0.1 | 0.4 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.1 | 0.2 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.1 | 1.6 | GO:1901299 | negative regulation of hydrogen peroxide-mediated programmed cell death(GO:1901299) |
0.1 | 0.8 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.1 | 0.5 | GO:0071639 | positive regulation of monocyte chemotactic protein-1 production(GO:0071639) |
0.1 | 0.8 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.1 | 0.4 | GO:1903575 | cornified envelope assembly(GO:1903575) |
0.1 | 0.4 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.1 | 0.3 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.1 | 0.8 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 0.4 | GO:2000158 | positive regulation of ubiquitin-specific protease activity(GO:2000158) |
0.1 | 0.9 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.1 | 0.7 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.1 | 1.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.5 | GO:1902167 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902167) |
0.1 | 0.5 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.1 | 0.6 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.1 | 0.2 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.1 | 1.4 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.1 | 0.4 | GO:1902896 | terminal web assembly(GO:1902896) |
0.1 | 1.9 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
0.1 | 0.2 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.1 | 0.2 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.1 | 0.5 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.1 | 0.4 | GO:0009816 | defense response, incompatible interaction(GO:0009814) defense response to bacterium, incompatible interaction(GO:0009816) regulation of defense response to bacterium, incompatible interaction(GO:1902477) |
0.1 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 3.6 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.1 | 0.1 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.1 | 0.5 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 0.3 | GO:1904719 | excitatory chemical synaptic transmission(GO:0098976) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
0.1 | 0.3 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.4 | GO:1990839 | response to endothelin(GO:1990839) |
0.1 | 0.2 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.1 | 0.3 | GO:1903445 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
0.1 | 0.3 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.1 | 0.3 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.1 | 0.3 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.1 | 0.3 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.1 | 0.1 | GO:2000458 | astrocyte chemotaxis(GO:0035700) regulation of astrocyte chemotaxis(GO:2000458) |
0.1 | 0.2 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.1 | 0.4 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.1 | 0.7 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
0.1 | 0.3 | GO:0021577 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) |
0.1 | 0.7 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.1 | 0.6 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.1 | 0.4 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.1 | 0.8 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
0.1 | 0.7 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.1 | 0.3 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.1 | 0.3 | GO:0060690 | epithelial cell differentiation involved in salivary gland development(GO:0060690) |
0.1 | 0.2 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.1 | 0.2 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.1 | 0.2 | GO:1901994 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
0.1 | 0.2 | GO:0045358 | negative regulation of interferon-beta biosynthetic process(GO:0045358) |
0.1 | 0.2 | GO:0060854 | patterning of lymph vessels(GO:0060854) |
0.1 | 0.4 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.1 | 0.3 | GO:0030576 | Cajal body organization(GO:0030576) |
0.1 | 0.2 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.1 | 0.3 | GO:0010286 | heat acclimation(GO:0010286) |
0.1 | 0.5 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.2 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.1 | 2.0 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
0.1 | 0.6 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.1 | 0.2 | GO:0071707 | immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
0.1 | 0.2 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.1 | 0.1 | GO:0035502 | metanephric part of ureteric bud development(GO:0035502) |
0.1 | 0.3 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
0.1 | 0.4 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.1 | 0.3 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.1 | 0.4 | GO:0044351 | macropinocytosis(GO:0044351) |
0.1 | 0.2 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.1 | 0.1 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
0.1 | 0.2 | GO:0072434 | signal transduction involved in G2 DNA damage checkpoint(GO:0072425) signal transduction involved in mitotic G2 DNA damage checkpoint(GO:0072434) |
0.1 | 0.1 | GO:0071336 | hair follicle cell proliferation(GO:0071335) regulation of hair follicle cell proliferation(GO:0071336) |
0.1 | 0.6 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.7 | GO:0046449 | allantoin metabolic process(GO:0000255) creatinine metabolic process(GO:0046449) |
0.1 | 0.2 | GO:2000349 | regulation of granuloma formation(GO:0002631) negative regulation of granuloma formation(GO:0002632) negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) tolerance induction to lipopolysaccharide(GO:0072573) negative regulation of CD40 signaling pathway(GO:2000349) |
0.1 | 0.1 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.1 | 0.6 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.1 | 0.6 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.1 | 0.4 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.1 | 0.2 | GO:0006154 | adenosine catabolic process(GO:0006154) |
0.1 | 0.4 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.1 | 0.1 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.1 | 0.3 | GO:0030043 | actin filament fragmentation(GO:0030043) |
0.1 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.1 | 0.3 | GO:0015860 | purine nucleoside transmembrane transport(GO:0015860) nucleoside transmembrane transport(GO:1901642) |
0.1 | 0.2 | GO:0018008 | N-terminal peptidyl-glycine N-myristoylation(GO:0018008) |
0.1 | 0.3 | GO:1903758 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
0.1 | 0.9 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.1 | 0.3 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 1.2 | GO:0033005 | positive regulation of mast cell activation(GO:0033005) |
0.1 | 0.2 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.1 | 0.3 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.1 | 0.1 | GO:2000987 | regulation of fear response(GO:1903365) positive regulation of fear response(GO:1903367) regulation of behavioral fear response(GO:2000822) positive regulation of behavioral fear response(GO:2000987) |
0.1 | 0.3 | GO:0031657 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.1 | 0.2 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.1 | 0.2 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 0.1 | GO:0061357 | positive regulation of Wnt protein secretion(GO:0061357) |
0.1 | 0.1 | GO:0033864 | regulation of renal output by angiotensin(GO:0002019) positive regulation of NAD(P)H oxidase activity(GO:0033864) |
0.1 | 0.5 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.1 | 0.3 | GO:0048165 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
0.1 | 0.3 | GO:0070944 | neutrophil mediated cytotoxicity(GO:0070942) neutrophil mediated killing of symbiont cell(GO:0070943) neutrophil mediated killing of bacterium(GO:0070944) neutrophil mediated killing of gram-negative bacterium(GO:0070945) neutrophil extravasation(GO:0072672) |
0.1 | 0.4 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.1 | 0.3 | GO:0034505 | tooth mineralization(GO:0034505) |
0.1 | 1.0 | GO:0006991 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.1 | 0.1 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.1 | 0.2 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.1 | 0.5 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) |
0.1 | 0.6 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.1 | 0.1 | GO:0042119 | neutrophil activation(GO:0042119) |
0.1 | 0.5 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.1 | 0.4 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.1 | 0.4 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
0.1 | 0.1 | GO:0045354 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
0.1 | 0.6 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.1 | 0.2 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.1 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) elastin biosynthetic process(GO:0051542) |
0.1 | 0.2 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.1 | 0.2 | GO:1903003 | positive regulation of protein deubiquitination(GO:1903003) |
0.1 | 0.3 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.1 | 0.7 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.1 | 0.4 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 0.2 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
0.1 | 0.1 | GO:1904057 | negative regulation of sensory perception of pain(GO:1904057) |
0.1 | 0.2 | GO:0035822 | meiotic gene conversion(GO:0006311) male meiosis chromosome segregation(GO:0007060) gene conversion(GO:0035822) |
0.1 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.1 | 0.2 | GO:0043181 | vacuolar sequestering(GO:0043181) |
0.1 | 0.4 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.1 | 0.2 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
0.1 | 0.3 | GO:2000252 | negative regulation of feeding behavior(GO:2000252) |
0.1 | 0.2 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
0.1 | 0.2 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
0.1 | 0.3 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.2 | GO:0071449 | response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
0.1 | 0.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 0.3 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.1 | 0.3 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.1 | 0.5 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.1 | 0.3 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
0.1 | 1.3 | GO:0001516 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
0.1 | 1.2 | GO:0010884 | positive regulation of lipid storage(GO:0010884) |
0.1 | 0.4 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.1 | 0.3 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
0.1 | 0.4 | GO:0032570 | response to progesterone(GO:0032570) |
0.1 | 0.2 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.1 | 0.2 | GO:0010840 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) circadian sleep/wake cycle, wakefulness(GO:0042746) |
0.1 | 1.3 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.1 | 0.7 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 0.6 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.1 | 0.2 | GO:2000043 | endodermal cell fate determination(GO:0007493) stem cell fate specification(GO:0048866) regulation of cardiac cell fate specification(GO:2000043) |
0.1 | 0.4 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 0.6 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
0.1 | 0.2 | GO:1990167 | protein K27-linked deubiquitination(GO:1990167) protein K33-linked deubiquitination(GO:1990168) |
0.1 | 1.1 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
0.1 | 1.0 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.1 | 0.4 | GO:0030432 | peristalsis(GO:0030432) |
0.1 | 0.4 | GO:0006621 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.1 | 0.9 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.1 | 0.2 | GO:0006222 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.1 | 0.2 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.1 | 0.1 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.1 | 0.3 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
0.1 | 0.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.1 | 0.1 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.1 | 0.6 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.1 | 0.5 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.1 | 0.2 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.1 | 0.2 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.1 | 0.4 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.1 | 0.5 | GO:0071731 | response to nitric oxide(GO:0071731) cellular response to nitric oxide(GO:0071732) |
0.1 | 0.4 | GO:0060613 | female meiosis I(GO:0007144) fat pad development(GO:0060613) |
0.1 | 0.6 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
0.1 | 0.2 | GO:0046368 | GDP-L-fucose metabolic process(GO:0046368) |
0.1 | 0.2 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.1 | 0.3 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
0.1 | 0.4 | GO:0014842 | skeletal muscle satellite cell proliferation(GO:0014841) regulation of skeletal muscle satellite cell proliferation(GO:0014842) skeletal muscle cell proliferation(GO:0014856) regulation of skeletal muscle cell proliferation(GO:0014857) |
0.1 | 0.2 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.1 | 0.8 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.1 | 0.3 | GO:0016266 | O-glycan processing(GO:0016266) |
0.1 | 0.3 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.1 | 0.7 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.0 | 0.2 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.0 | 0.4 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.0 | 0.2 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.0 | 0.3 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 0.5 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.0 | 0.6 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.0 | 0.1 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
0.0 | 0.4 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.0 | GO:0002730 | dendritic cell cytokine production(GO:0002371) regulation of dendritic cell cytokine production(GO:0002730) negative regulation of T-helper 1 cell differentiation(GO:0045626) |
0.0 | 0.5 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.0 | 0.3 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.0 | 0.2 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 0.1 | GO:0060809 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
0.0 | 0.2 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
0.0 | 0.3 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
0.0 | 0.1 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.0 | 0.3 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.3 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.0 | 0.3 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.7 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.0 | 0.3 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.0 | 0.3 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
0.0 | 0.4 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.1 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.0 | 0.1 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.0 | 0.4 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 0.6 | GO:0002230 | positive regulation of defense response to virus by host(GO:0002230) |
0.0 | 0.3 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.0 | 0.5 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.0 | 0.7 | GO:0046697 | decidualization(GO:0046697) |
0.0 | 0.1 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.1 | GO:1902220 | positive regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902220) |
0.0 | 0.1 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.0 | 0.3 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) regulation of establishment of protein localization to plasma membrane(GO:0090003) |
0.0 | 0.4 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.0 | 0.3 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.2 | GO:0051012 | microtubule sliding(GO:0051012) negative regulation of nonmotile primary cilium assembly(GO:1902856) |
0.0 | 1.1 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.2 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.0 | 1.3 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
0.0 | 0.7 | GO:0045026 | plasma membrane fusion(GO:0045026) |
0.0 | 0.4 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.1 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.0 | 0.2 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
0.0 | 0.4 | GO:0006544 | glycine metabolic process(GO:0006544) |
0.0 | 0.4 | GO:0043173 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) nucleotide salvage(GO:0043173) |
0.0 | 0.8 | GO:0045730 | respiratory burst(GO:0045730) |
0.0 | 0.3 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.5 | GO:0036035 | osteoclast development(GO:0036035) |
0.0 | 0.1 | GO:0072014 | proximal tubule development(GO:0072014) |
0.0 | 0.1 | GO:0036414 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
0.0 | 0.4 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.0 | 0.2 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.0 | 0.2 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
0.0 | 0.3 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.0 | 1.4 | GO:1903078 | positive regulation of protein localization to plasma membrane(GO:1903078) |
0.0 | 0.3 | GO:0055098 | response to low-density lipoprotein particle(GO:0055098) |
0.0 | 0.2 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
0.0 | 0.5 | GO:0031000 | response to caffeine(GO:0031000) |
0.0 | 1.5 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.2 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.0 | 0.2 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.0 | 0.2 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.2 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 1.1 | GO:0001562 | response to protozoan(GO:0001562) |
0.0 | 0.9 | GO:0060074 | synapse maturation(GO:0060074) |
0.0 | 0.2 | GO:0009992 | cellular water homeostasis(GO:0009992) |
0.0 | 0.2 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.0 | 0.2 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
0.0 | 0.4 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.0 | 0.4 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 1.1 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.6 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.0 | 0.4 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.1 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.0 | 0.1 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.0 | 0.1 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
0.0 | 0.1 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.0 | 0.1 | GO:1904959 | regulation of electron carrier activity(GO:1904732) regulation of cytochrome-c oxidase activity(GO:1904959) |
0.0 | 0.3 | GO:0015961 | diadenosine polyphosphate catabolic process(GO:0015961) |
0.0 | 0.5 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.4 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.0 | 0.3 | GO:0060346 | bone trabecula formation(GO:0060346) |
0.0 | 0.2 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.0 | 0.2 | GO:0070572 | positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
0.0 | 0.4 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
0.0 | 0.3 | GO:0032740 | positive regulation of interleukin-17 production(GO:0032740) |
0.0 | 0.1 | GO:1903919 | regulation of actin filament severing(GO:1903918) negative regulation of actin filament severing(GO:1903919) |
0.0 | 0.0 | GO:0090427 | activation of meiosis(GO:0090427) |
0.0 | 0.1 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.0 | 0.2 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.1 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.0 | 0.1 | GO:0002580 | regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) |
0.0 | 0.2 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.0 | 0.5 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
0.0 | 2.2 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
0.0 | 0.2 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
0.0 | 0.1 | GO:0060099 | regulation of phagocytosis, engulfment(GO:0060099) |
0.0 | 0.1 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
0.0 | 0.2 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.4 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.0 | 0.2 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
0.0 | 0.1 | GO:0060467 | negative regulation of fertilization(GO:0060467) prevention of polyspermy(GO:0060468) |
0.0 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
0.0 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.0 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.0 | 0.8 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.0 | 0.3 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.0 | 0.3 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.5 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.1 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.0 | 0.2 | GO:0060278 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
0.0 | 0.1 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
0.0 | 0.2 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.0 | 0.9 | GO:0034113 | heterotypic cell-cell adhesion(GO:0034113) |
0.0 | 0.2 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.0 | 0.1 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.0 | 0.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.1 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.0 | 0.0 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.0 | 0.5 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.0 | 0.2 | GO:0044146 | negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
0.0 | 0.0 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.0 | 2.1 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.0 | 0.1 | GO:1901896 | protein localization to nuclear pore(GO:0090204) positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.0 | 0.1 | GO:1904453 | regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.1 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.0 | 0.1 | GO:0035936 | testosterone secretion(GO:0035936) regulation of testosterone secretion(GO:2000843) |
0.0 | 0.3 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.0 | 0.9 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.1 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.0 | 0.7 | GO:0071625 | vocalization behavior(GO:0071625) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.1 | GO:0060722 | spongiotrophoblast cell proliferation(GO:0060720) cell proliferation involved in embryonic placenta development(GO:0060722) |
0.0 | 0.4 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
0.0 | 0.1 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
0.0 | 0.1 | GO:0016598 | protein arginylation(GO:0016598) |
0.0 | 0.2 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.3 | GO:0030238 | male sex determination(GO:0030238) |
0.0 | 0.1 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 1.1 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
0.0 | 0.1 | GO:1900477 | negative regulation of G1/S transition of mitotic cell cycle by negative regulation of transcription from RNA polymerase II promoter(GO:1900477) |
0.0 | 0.2 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.0 | 0.2 | GO:0042095 | interferon-gamma biosynthetic process(GO:0042095) regulation of interferon-gamma biosynthetic process(GO:0045072) positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
0.0 | 0.2 | GO:0006693 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
0.0 | 0.3 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.0 | 0.1 | GO:0070164 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.2 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.0 | 0.4 | GO:0060218 | hematopoietic stem cell differentiation(GO:0060218) |
0.0 | 0.4 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.1 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.0 | 0.1 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
0.0 | 0.2 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
0.0 | 0.0 | GO:0032682 | negative regulation of chemokine production(GO:0032682) |
0.0 | 0.2 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.0 | 0.1 | GO:0034443 | regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) |
0.0 | 0.5 | GO:0031295 | T cell costimulation(GO:0031295) |
0.0 | 0.2 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
0.0 | 0.7 | GO:0051931 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
0.0 | 0.4 | GO:0051084 | 'de novo' posttranslational protein folding(GO:0051084) |
0.0 | 0.1 | GO:0001982 | baroreceptor response to decreased systemic arterial blood pressure(GO:0001982) negative regulation of glycogen catabolic process(GO:0045818) |
0.0 | 0.2 | GO:0006705 | mineralocorticoid biosynthetic process(GO:0006705) |
0.0 | 0.2 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.0 | 0.4 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.0 | 0.1 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
0.0 | 0.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.1 | GO:0008358 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) P granule organization(GO:0030719) |
0.0 | 0.1 | GO:1900115 | sequestering of extracellular ligand from receptor(GO:0035581) sequestering of BMP in extracellular matrix(GO:0035582) protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) extracellular regulation of signal transduction(GO:1900115) extracellular negative regulation of signal transduction(GO:1900116) |
0.0 | 0.1 | GO:0006657 | CDP-choline pathway(GO:0006657) |
0.0 | 0.0 | GO:1900365 | positive regulation of mRNA polyadenylation(GO:1900365) |
0.0 | 0.2 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.0 | 0.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.0 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.0 | 0.2 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) positive regulation of protein localization to synapse(GO:1902474) |
0.0 | 0.1 | GO:0006788 | heme oxidation(GO:0006788) |
0.0 | 0.3 | GO:0002446 | neutrophil mediated immunity(GO:0002446) |
0.0 | 0.1 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
0.0 | 0.4 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
0.0 | 0.6 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
0.0 | 0.8 | GO:0050994 | regulation of lipid catabolic process(GO:0050994) |
0.0 | 0.2 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.0 | 0.1 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.3 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.0 | 0.1 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
0.0 | 0.2 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
0.0 | 0.3 | GO:0052697 | flavonoid metabolic process(GO:0009812) flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
0.0 | 0.3 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
0.0 | 0.5 | GO:0060065 | uterus development(GO:0060065) |
0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.0 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.0 | 0.2 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
0.0 | 2.6 | GO:0030509 | BMP signaling pathway(GO:0030509) |
0.0 | 0.2 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.3 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
0.0 | 0.1 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
0.0 | 0.2 | GO:0040031 | snRNA modification(GO:0040031) |
0.0 | 0.1 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
0.0 | 0.2 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.0 | 0.2 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.2 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
0.0 | 0.0 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
0.0 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.3 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
0.0 | 0.3 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
0.0 | 0.2 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.0 | 0.1 | GO:0001980 | regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
0.0 | 1.4 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
0.0 | 0.5 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.3 | GO:0007603 | phototransduction, visible light(GO:0007603) |
0.0 | 0.1 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.0 | 0.4 | GO:0050907 | detection of chemical stimulus involved in sensory perception(GO:0050907) |
0.0 | 0.2 | GO:0050927 | positive regulation of positive chemotaxis(GO:0050927) |
0.0 | 0.1 | GO:0016093 | polyprenol metabolic process(GO:0016093) |
0.0 | 0.1 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.0 | 0.2 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.3 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.1 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.0 | 0.1 | GO:0002070 | epithelial cell maturation(GO:0002070) |
0.0 | 0.2 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.0 | 0.6 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
0.0 | 0.4 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.0 | 0.1 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.0 | 0.0 | GO:0032095 | regulation of response to food(GO:0032095) |
0.0 | 0.0 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.0 | 0.5 | GO:0045669 | positive regulation of osteoblast differentiation(GO:0045669) |
0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.0 | 0.3 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.0 | 0.1 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
0.0 | 0.2 | GO:0060137 | parturition(GO:0007567) maternal process involved in parturition(GO:0060137) |
0.0 | 0.1 | GO:0002335 | mature B cell differentiation(GO:0002335) |
0.0 | 0.3 | GO:0008356 | asymmetric cell division(GO:0008356) |
0.0 | 0.2 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.1 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
0.0 | 0.2 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.0 | 0.1 | GO:0038066 | p38MAPK cascade(GO:0038066) |
0.0 | 0.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0051014 | actin filament severing(GO:0051014) |
0.0 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.0 | 0.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.1 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.2 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.0 | 0.1 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.3 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
0.0 | 0.1 | GO:0015874 | norepinephrine transport(GO:0015874) |
0.0 | 0.2 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.0 | 0.2 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.2 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 0.1 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
0.0 | 0.1 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.0 | 0.1 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.0 | 0.3 | GO:0007595 | lactation(GO:0007595) |
0.0 | 0.5 | GO:0071800 | podosome assembly(GO:0071800) |
0.0 | 0.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.0 | 0.3 | GO:0030104 | water homeostasis(GO:0030104) |
0.0 | 0.2 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
0.0 | 0.1 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.1 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.0 | 0.1 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
0.0 | 0.2 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.0 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.0 | 0.2 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
0.0 | 0.1 | GO:0097066 | response to thyroid hormone(GO:0097066) |
0.0 | 0.1 | GO:0008228 | opsonization(GO:0008228) |
0.0 | 0.1 | GO:0002328 | lymphoid progenitor cell differentiation(GO:0002320) pro-B cell differentiation(GO:0002328) |
0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.0 | GO:1903048 | regulation of acetylcholine-gated cation channel activity(GO:1903048) |
0.0 | 0.0 | GO:0009405 | pathogenesis(GO:0009405) |
0.0 | 0.1 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.0 | 0.2 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.0 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.6 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.0 | 0.0 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.0 | 0.1 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.3 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.0 | 0.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.0 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.0 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.0 | 0.2 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.1 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.0 | 1.8 | GO:0008360 | regulation of cell shape(GO:0008360) |
0.0 | 0.0 | GO:0021938 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) notochord regression(GO:0060032) |
0.0 | 0.1 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.1 | GO:0050766 | positive regulation of phagocytosis(GO:0050766) |
0.0 | 0.1 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.0 | 0.2 | GO:0071545 | inositol phosphate dephosphorylation(GO:0046855) inositol phosphate catabolic process(GO:0071545) |
0.0 | 0.4 | GO:0006641 | triglyceride metabolic process(GO:0006641) |
0.0 | 0.1 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
0.0 | 0.1 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
0.0 | 0.1 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.0 | 0.2 | GO:0043124 | negative regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043124) |
0.0 | 0.1 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.1 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
0.0 | 0.0 | GO:0099527 | postsynapse to nucleus signaling pathway(GO:0099527) |
0.0 | 0.3 | GO:0001707 | mesoderm formation(GO:0001707) |
0.0 | 0.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.0 | 0.0 | GO:0010513 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) positive regulation of phosphatidylinositol biosynthetic process(GO:0010513) positive regulation of phospholipid biosynthetic process(GO:0071073) |
0.0 | 0.1 | GO:0040018 | positive regulation of multicellular organism growth(GO:0040018) |
0.0 | 0.2 | GO:0005980 | polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.1 | GO:0001830 | trophectodermal cell fate commitment(GO:0001830) |
0.0 | 0.1 | GO:1903392 | negative regulation of adherens junction organization(GO:1903392) |
0.0 | 0.1 | GO:0021794 | thalamus development(GO:0021794) |
0.0 | 0.2 | GO:2001222 | regulation of neuron migration(GO:2001222) |
0.0 | 0.1 | GO:0080184 | response to stilbenoid(GO:0035634) response to phenylpropanoid(GO:0080184) |
0.0 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.1 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.0 | GO:0032733 | positive regulation of interleukin-10 production(GO:0032733) |
0.0 | 0.0 | GO:1903033 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
0.0 | 0.2 | GO:0015914 | phospholipid transport(GO:0015914) |
0.0 | 0.0 | GO:0006363 | transcription initiation from RNA polymerase I promoter(GO:0006361) termination of RNA polymerase I transcription(GO:0006363) |
0.0 | 0.2 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.0 | 0.0 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 3.2 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.4 | 1.4 | GO:1902636 | kinociliary basal body(GO:1902636) |
0.3 | 3.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.3 | 2.3 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.3 | 0.9 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
0.3 | 0.8 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
0.3 | 3.0 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.2 | 0.9 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.2 | 1.8 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.2 | 0.7 | GO:0034667 | integrin alpha3-beta1 complex(GO:0034667) |
0.2 | 0.6 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
0.2 | 2.7 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.2 | 0.2 | GO:0098830 | presynaptic endosome(GO:0098830) |
0.2 | 1.4 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.2 | 0.8 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.2 | 1.5 | GO:0097342 | ripoptosome(GO:0097342) |
0.2 | 1.0 | GO:0044305 | calyx of Held(GO:0044305) |
0.2 | 0.6 | GO:0044299 | C-fiber(GO:0044299) |
0.2 | 1.2 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.2 | 0.5 | GO:0044393 | microspike(GO:0044393) |
0.2 | 1.9 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.2 | 0.5 | GO:0048179 | activin receptor complex(GO:0048179) |
0.2 | 0.5 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
0.1 | 1.5 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.1 | 0.1 | GO:0097381 | photoreceptor disc membrane(GO:0097381) |
0.1 | 1.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 0.6 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.1 | 0.6 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 1.9 | GO:0045179 | apical cortex(GO:0045179) |
0.1 | 0.4 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
0.1 | 0.5 | GO:0032021 | NELF complex(GO:0032021) |
0.1 | 1.0 | GO:0005787 | signal peptidase complex(GO:0005787) |
0.1 | 0.4 | GO:0034685 | integrin alphav-beta6 complex(GO:0034685) |
0.1 | 2.7 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 1.1 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
0.1 | 2.5 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.1 | 0.8 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 0.3 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.1 | 2.4 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.1 | 1.9 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.6 | GO:1990462 | omegasome(GO:1990462) |
0.1 | 2.9 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.1 | 0.7 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.1 | 0.5 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.1 | 0.2 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.1 | 0.5 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.1 | 0.3 | GO:0036019 | endolysosome(GO:0036019) |
0.1 | 2.3 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.1 | 0.9 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
0.1 | 0.3 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.1 | 0.6 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.1 | 0.3 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 1.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.1 | 0.3 | GO:0032783 | ELL-EAF complex(GO:0032783) |
0.1 | 2.1 | GO:0097225 | sperm midpiece(GO:0097225) |
0.1 | 0.6 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 1.3 | GO:0042627 | chylomicron(GO:0042627) |
0.1 | 0.3 | GO:0044194 | cytolytic granule(GO:0044194) |
0.1 | 0.3 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 0.3 | GO:0098888 | extrinsic component of presynaptic membrane(GO:0098888) |
0.1 | 1.7 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.1 | 0.6 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.1 | 2.3 | GO:0045095 | keratin filament(GO:0045095) |
0.1 | 0.8 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.1 | 0.7 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
0.1 | 0.9 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.5 | GO:0031983 | vesicle lumen(GO:0031983) |
0.1 | 0.4 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.1 | 1.0 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 0.5 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.1 | GO:0030666 | endocytic vesicle membrane(GO:0030666) |
0.1 | 0.7 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 0.3 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.1 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 1.2 | GO:0043186 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.1 | 1.4 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 0.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.1 | 0.3 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 0.5 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.1 | 1.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.1 | 0.4 | GO:0005796 | Golgi lumen(GO:0005796) |
0.1 | 2.0 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.5 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.1 | 1.3 | GO:0000242 | pericentriolar material(GO:0000242) |
0.1 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.3 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
0.1 | 0.3 | GO:0070826 | paraferritin complex(GO:0070826) |
0.1 | 1.2 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.3 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.1 | 1.5 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 1.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 1.8 | GO:0008305 | integrin complex(GO:0008305) |
0.1 | 0.8 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 1.6 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.1 | 0.5 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.2 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 0.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.2 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
0.0 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 0.4 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.4 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 0.3 | GO:0042599 | lamellar body(GO:0042599) |
0.0 | 0.9 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.1 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
0.0 | 0.5 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.2 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.4 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 0.3 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
0.0 | 0.6 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.4 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.7 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.9 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 0.3 | GO:0031527 | filopodium membrane(GO:0031527) |
0.0 | 0.5 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.0 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
0.0 | 0.7 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.2 | GO:0042581 | specific granule(GO:0042581) |
0.0 | 1.2 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 1.2 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.2 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
0.0 | 0.2 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.0 | 0.1 | GO:0099631 | postsynaptic endocytic zone cytoplasmic component(GO:0099631) |
0.0 | 0.2 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
0.0 | 1.6 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.1 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
0.0 | 1.5 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 1.1 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.0 | 4.5 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 0.6 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.3 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.4 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 1.1 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.5 | GO:0044453 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
0.0 | 0.1 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
0.0 | 0.1 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
0.0 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.1 | GO:1990795 | lateral part of cell(GO:0097574) basolateral part of cell(GO:1990794) rod bipolar cell terminal bouton(GO:1990795) photoreceptor cell terminal bouton(GO:1990796) |
0.0 | 0.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.3 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.9 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.5 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.4 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 0.3 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.4 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.0 | 0.3 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.5 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.9 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.3 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.1 | GO:0098636 | protein complex involved in cell adhesion(GO:0098636) |
0.0 | 0.1 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.4 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.5 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.1 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
0.0 | 0.1 | GO:0032807 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) DNA ligase IV complex(GO:0032807) |
0.0 | 2.3 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
0.0 | 0.3 | GO:0030126 | COPI vesicle coat(GO:0030126) COPI-coated vesicle membrane(GO:0030663) |
0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.1 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.0 | 0.7 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.4 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.2 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.0 | 0.1 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
0.0 | 0.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.2 | GO:0044754 | secondary lysosome(GO:0005767) autolysosome(GO:0044754) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.4 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.0 | GO:0016011 | dystroglycan complex(GO:0016011) |
0.0 | 0.1 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 1.0 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.4 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.1 | GO:0043224 | nuclear SCF ubiquitin ligase complex(GO:0043224) |
0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.1 | GO:0005605 | basal lamina(GO:0005605) |
0.0 | 0.2 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.9 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 0.4 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
0.0 | 0.1 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.0 | 0.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.0 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 0.4 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 0.1 | GO:0097449 | astrocyte projection(GO:0097449) |
0.0 | 2.1 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 20.0 | GO:0005615 | extracellular space(GO:0005615) |
0.0 | 0.0 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.3 | GO:0030673 | axolemma(GO:0030673) |
0.0 | 1.6 | GO:0005923 | bicellular tight junction(GO:0005923) occluding junction(GO:0070160) |
0.0 | 0.0 | GO:0097165 | nuclear stress granule(GO:0097165) |
0.0 | 2.4 | GO:0009897 | external side of plasma membrane(GO:0009897) |
0.0 | 0.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.0 | 0.1 | GO:0005861 | troponin complex(GO:0005861) |
0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.1 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) |
0.0 | 0.9 | GO:0001669 | acrosomal vesicle(GO:0001669) |
0.0 | 0.2 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.2 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.7 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.0 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.7 | 2.0 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.6 | 2.3 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
0.6 | 4.4 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.5 | 2.5 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.5 | 3.8 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
0.5 | 1.4 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.4 | 1.3 | GO:0071568 | UFM1 transferase activity(GO:0071568) |
0.4 | 3.0 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
0.4 | 1.3 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.4 | 1.6 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.4 | 1.8 | GO:0042610 | CD8 receptor binding(GO:0042610) |
0.4 | 1.1 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.3 | 2.9 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.3 | 0.9 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
0.3 | 0.9 | GO:0048030 | disaccharide binding(GO:0048030) |
0.3 | 0.9 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.3 | 1.7 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.3 | 2.0 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.3 | 1.1 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.3 | 1.7 | GO:0002046 | opsin binding(GO:0002046) |
0.3 | 1.0 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
0.3 | 0.8 | GO:0035500 | MH2 domain binding(GO:0035500) |
0.3 | 0.5 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.2 | 1.0 | GO:0016454 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
0.2 | 2.7 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.2 | 0.5 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.2 | 0.9 | GO:0070976 | TIR domain binding(GO:0070976) |
0.2 | 0.7 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
0.2 | 0.7 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.2 | 0.7 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.2 | 0.6 | GO:0004903 | growth hormone receptor activity(GO:0004903) |
0.2 | 0.9 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.2 | 0.6 | GO:0035717 | chemokine (C-C motif) ligand 7 binding(GO:0035717) |
0.2 | 0.6 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.2 | 0.8 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
0.2 | 0.8 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.2 | 0.6 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.2 | 0.9 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
0.2 | 2.0 | GO:0051870 | methotrexate binding(GO:0051870) |
0.2 | 0.7 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.2 | 0.7 | GO:0019970 | interleukin-11 receptor activity(GO:0004921) interleukin-11 binding(GO:0019970) |
0.2 | 1.5 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.2 | 1.0 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.2 | 0.7 | GO:0042806 | fucose binding(GO:0042806) |
0.2 | 0.8 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.2 | 0.7 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
0.2 | 0.5 | GO:0045159 | myosin II binding(GO:0045159) |
0.2 | 0.8 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
0.2 | 0.5 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
0.2 | 1.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.2 | 0.9 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.2 | 0.5 | GO:0035651 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
0.2 | 0.6 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.2 | 1.1 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.2 | 0.6 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.2 | 0.8 | GO:0004925 | prolactin receptor activity(GO:0004925) |
0.1 | 4.8 | GO:0008009 | chemokine activity(GO:0008009) |
0.1 | 0.4 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 0.7 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 1.0 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.1 | 0.7 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.1 | 1.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.1 | 1.1 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.1 | 0.7 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.1 | 1.1 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 0.4 | GO:0071820 | N-box binding(GO:0071820) |
0.1 | 0.5 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 0.8 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.1 | 4.2 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.1 | 0.4 | GO:0098918 | structural constituent of synapse(GO:0098918) structural constituent of postsynaptic actin cytoskeleton(GO:0098973) |
0.1 | 0.9 | GO:0038187 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.1 | 0.9 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
0.1 | 0.5 | GO:0015410 | manganese-transporting ATPase activity(GO:0015410) |
0.1 | 0.8 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.4 | GO:0019002 | GMP binding(GO:0019002) |
0.1 | 0.5 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.1 | 0.7 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.7 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.1 | 0.7 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.6 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
0.1 | 0.9 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.1 | 3.4 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 0.7 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.1 | 3.5 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.1 | 0.5 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.1 | 0.3 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
0.1 | 1.5 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.1 | 0.7 | GO:0099609 | microtubule lateral binding(GO:0099609) |
0.1 | 0.4 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
0.1 | 0.6 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.1 | 0.7 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 0.5 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 0.4 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.1 | 0.5 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
0.1 | 1.6 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.1 | 0.6 | GO:0042834 | peptidoglycan binding(GO:0042834) |
0.1 | 0.1 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
0.1 | 3.9 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.1 | 0.4 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.1 | 1.1 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.1 | 0.5 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.3 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.1 | 0.3 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.1 | 0.3 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
0.1 | 0.3 | GO:0030617 | transforming growth factor beta receptor, inhibitory cytoplasmic mediator activity(GO:0030617) |
0.1 | 1.0 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.1 | 1.7 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.1 | 0.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.1 | 0.3 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 0.3 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.1 | 2.2 | GO:0031489 | myosin V binding(GO:0031489) |
0.1 | 0.4 | GO:0032810 | sterol response element binding(GO:0032810) |
0.1 | 0.9 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.1 | 0.4 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
0.1 | 0.4 | GO:0016972 | thiol oxidase activity(GO:0016972) |
0.1 | 0.4 | GO:0046403 | polynucleotide 3'-phosphatase activity(GO:0046403) |
0.1 | 0.4 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 1.2 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 1.7 | GO:0001618 | virus receptor activity(GO:0001618) |
0.1 | 1.0 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.1 | 0.2 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
0.1 | 0.2 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.1 | 0.7 | GO:0032564 | dATP binding(GO:0032564) |
0.1 | 0.3 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.1 | 0.8 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 0.9 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 0.6 | GO:0001851 | complement component C3b binding(GO:0001851) |
0.1 | 0.2 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 0.2 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.1 | 0.2 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
0.1 | 0.5 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.2 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 0.4 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.1 | 0.2 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
0.1 | 0.3 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.1 | 0.5 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.1 | 0.3 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.1 | 0.3 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
0.1 | 1.0 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.1 | 0.3 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
0.1 | 0.5 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.3 | GO:0033883 | pyridoxal phosphatase activity(GO:0033883) |
0.1 | 0.6 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 3.1 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.1 | 0.4 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.1 | 0.2 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 0.3 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
0.1 | 0.2 | GO:0019107 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
0.1 | 0.5 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 1.1 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.1 | 0.5 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.1 | 0.3 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.1 | 2.6 | GO:0045309 | protein phosphorylated amino acid binding(GO:0045309) |
0.1 | 0.7 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.1 | 0.6 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 0.2 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
0.1 | 0.3 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
0.1 | 0.3 | GO:0047710 | bis(5'-adenosyl)-triphosphatase activity(GO:0047710) |
0.1 | 0.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.2 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 0.3 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.1 | 0.6 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
0.1 | 0.8 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 0.6 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 0.4 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.1 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 0.6 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) potassium-transporting ATPase activity(GO:0008556) |
0.1 | 0.4 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.1 | 2.0 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 0.2 | GO:0031896 | V2 vasopressin receptor binding(GO:0031896) |
0.1 | 0.2 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.1 | 1.0 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.1 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 0.2 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.1 | 0.5 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.1 | 0.7 | GO:0052813 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
0.1 | 0.2 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.1 | 0.3 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.1 | 0.3 | GO:0015100 | cadmium ion transmembrane transporter activity(GO:0015086) lead ion transmembrane transporter activity(GO:0015094) vanadium ion transmembrane transporter activity(GO:0015100) ferrous iron uptake transmembrane transporter activity(GO:0015639) |
0.1 | 0.2 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
0.1 | 0.3 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 0.2 | GO:0005333 | norepinephrine transmembrane transporter activity(GO:0005333) |
0.1 | 0.7 | GO:0019841 | retinol binding(GO:0019841) |
0.1 | 2.7 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.1 | 1.3 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.1 | 0.1 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
0.1 | 0.6 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.1 | 2.4 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 0.2 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.1 | 0.1 | GO:0031433 | telethonin binding(GO:0031433) |
0.1 | 0.2 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
0.1 | 1.6 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.1 | 2.0 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.1 | 0.4 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.1 | 0.2 | GO:0005008 | hepatocyte growth factor-activated receptor activity(GO:0005008) |
0.1 | 0.3 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.1 | 1.1 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.2 | GO:0004368 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.1 | 1.1 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.1 | 0.5 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 1.2 | GO:0022829 | wide pore channel activity(GO:0022829) |
0.1 | 0.2 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
0.1 | 0.6 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.1 | GO:0004816 | asparagine-tRNA ligase activity(GO:0004816) |
0.0 | 0.7 | GO:0005542 | folic acid binding(GO:0005542) |
0.0 | 1.7 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.2 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.0 | 0.8 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) |
0.0 | 0.3 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.0 | 0.3 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.0 | 0.6 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.1 | GO:0005171 | hepatocyte growth factor receptor binding(GO:0005171) |
0.0 | 0.4 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 0.5 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.7 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.2 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.2 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
0.0 | 0.2 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
0.0 | 0.4 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 1.3 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.0 | 0.4 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.5 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.0 | 0.3 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) |
0.0 | 0.4 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.4 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.0 | 1.9 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.4 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 1.2 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.2 | GO:0016918 | retinal binding(GO:0016918) |
0.0 | 0.3 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.0 | 0.6 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 1.6 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.0 | 0.5 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.0 | 0.5 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.1 | GO:0005110 | frizzled-2 binding(GO:0005110) |
0.0 | 0.2 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.0 | 0.3 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.2 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.0 | 0.2 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.0 | 0.3 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.8 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.1 | GO:0070012 | oligopeptidase activity(GO:0070012) |
0.0 | 1.0 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 1.5 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 0.6 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.3 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.5 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.1 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
0.0 | 1.8 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.5 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 1.0 | GO:0043236 | laminin binding(GO:0043236) |
0.0 | 0.0 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.0 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.4 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.8 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.6 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.1 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
0.0 | 5.3 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.0 | 0.1 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.0 | 0.4 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.0 | 0.2 | GO:0015185 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.0 | 0.1 | GO:0030549 | acetylcholine receptor activator activity(GO:0030549) |
0.0 | 0.2 | GO:0016004 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.4 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.8 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.7 | GO:0005549 | odorant binding(GO:0005549) |
0.0 | 0.8 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.4 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.2 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.1 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.0 | 0.2 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
0.0 | 0.8 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.2 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.1 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
0.0 | 0.2 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
0.0 | 0.2 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.5 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.2 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
0.0 | 0.1 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.2 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.0 | 0.4 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.4 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.1 | GO:0001847 | opsonin receptor activity(GO:0001847) |
0.0 | 1.1 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.6 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.0 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.2 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.5 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 0.4 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.0 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.1 | GO:0060590 | ATPase regulator activity(GO:0060590) |
0.0 | 0.2 | GO:1990459 | transferrin receptor binding(GO:1990459) |
0.0 | 0.1 | GO:0030977 | taurine binding(GO:0030977) |
0.0 | 0.4 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.7 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.0 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.0 | 0.0 | GO:0070001 | aspartic-type peptidase activity(GO:0070001) |
0.0 | 0.2 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.1 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.2 | GO:0016595 | glutamate binding(GO:0016595) |
0.0 | 0.2 | GO:0015149 | hexose transmembrane transporter activity(GO:0015149) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.1 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
0.0 | 0.1 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.0 | 0.2 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.1 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
0.0 | 0.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.1 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 0.7 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.4 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.2 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.1 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.0 | 0.1 | GO:1903136 | cuprous ion binding(GO:1903136) |
0.0 | 0.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.2 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.0 | 0.9 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 1.0 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.0 | 0.1 | GO:0031014 | troponin T binding(GO:0031014) |
0.0 | 0.6 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.2 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
0.0 | 0.8 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.8 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 0.3 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 0.2 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.2 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
0.0 | 0.2 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.0 | 0.5 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.1 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.0 | 0.2 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.2 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.0 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.3 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.4 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
0.0 | 0.2 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.3 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.0 | 0.2 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.0 | 0.0 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.0 | 0.4 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.0 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.4 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
0.0 | 0.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.2 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.2 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.0 | 0.1 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
0.0 | 0.1 | GO:0015250 | water channel activity(GO:0015250) |
0.0 | 0.7 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.0 | 0.1 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.0 | 0.1 | GO:0008106 | alcohol dehydrogenase (NADP+) activity(GO:0008106) |
0.0 | 0.2 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.2 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
0.0 | 0.1 | GO:0004064 | arylesterase activity(GO:0004064) |
0.0 | 0.0 | GO:0098809 | nitrite reductase activity(GO:0098809) |
0.0 | 0.5 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.3 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.2 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.3 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.3 | 9.1 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.2 | 2.8 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.1 | 1.7 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 7.0 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 4.4 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 2.4 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 1.6 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.1 | 0.3 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.1 | 1.7 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 1.3 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 2.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 0.5 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.1 | 4.0 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.1 | 2.2 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.1 | 2.2 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.1 | 1.8 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 0.7 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 1.4 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 0.3 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 1.4 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 1.1 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 1.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 2.2 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.0 | ST STAT3 PATHWAY | STAT3 Pathway |
0.0 | 2.5 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 3.3 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.9 | PID IFNG PATHWAY | IFN-gamma pathway |
0.0 | 0.8 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 1.3 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.7 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.9 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.2 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 1.4 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.2 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 1.0 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 1.3 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.5 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 1.3 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 1.5 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 2.6 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.8 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.6 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 1.2 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.3 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 1.1 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.2 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.6 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.8 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 0.3 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.4 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.2 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.3 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.4 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.4 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.2 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.6 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.3 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.2 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.0 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 1.6 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.1 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 0.6 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.3 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 1.1 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.2 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.2 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 2.4 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.3 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.2 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 0.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 6.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.3 | 0.8 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.3 | 4.6 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.2 | 0.2 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.2 | 4.5 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.2 | 2.0 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.2 | 2.3 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.2 | 2.2 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.1 | 1.7 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.1 | 1.7 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 2.8 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 1.5 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 4.7 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.1 | 1.5 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.1 | 1.0 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.1 | 1.3 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 0.7 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.1 | 1.6 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.1 | 1.1 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.1 | 2.2 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 2.2 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 3.6 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.1 | 1.7 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 1.7 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 0.3 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.1 | 3.5 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.1 | 1.7 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.1 | 2.9 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.1 | 0.5 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.1 | 1.0 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.1 | 0.4 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.1 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.1 | 0.9 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 2.0 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.1 | 1.8 | REACTOME KINESINS | Genes involved in Kinesins |
0.1 | 0.3 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.1 | 1.7 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 0.7 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.7 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.1 | 2.0 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 0.9 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.1 | 0.8 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 2.4 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.1 | 0.3 | REACTOME DEFENSINS | Genes involved in Defensins |
0.1 | 0.7 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.1 | 0.2 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.1 | 3.9 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
0.1 | 0.7 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.1 | 1.6 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.1 | 0.2 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
0.0 | 1.1 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.0 | 1.1 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 2.3 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.2 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 1.3 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.7 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.0 | 0.5 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.0 | 0.5 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 1.4 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
0.0 | 0.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.7 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.5 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 1.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.4 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.0 | 0.6 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.4 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.0 | 0.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.6 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 1.0 | REACTOME TCR SIGNALING | Genes involved in TCR signaling |
0.0 | 0.4 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.5 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.6 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.5 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.9 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.2 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 2.1 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 0.4 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 1.5 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.3 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 0.4 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.3 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.0 | 0.3 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.7 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.4 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.0 | 0.4 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.1 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.7 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.2 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.1 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
0.0 | 0.2 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.3 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.0 | 0.4 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.7 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.0 | 0.7 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.2 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
0.0 | 0.2 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.1 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.2 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.0 | 0.3 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 1.0 | REACTOME HEPARAN SULFATE HEPARIN HS GAG METABOLISM | Genes involved in Heparan sulfate/heparin (HS-GAG) metabolism |
0.0 | 0.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.5 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.5 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.5 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
0.0 | 0.2 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.4 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.5 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
0.0 | 0.3 | REACTOME MYD88 MAL CASCADE INITIATED ON PLASMA MEMBRANE | Genes involved in MyD88:Mal cascade initiated on plasma membrane |
0.0 | 0.3 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.3 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.0 | 0.1 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.0 | 0.8 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.0 | 0.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.2 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |