12D miR HR13_24
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Hnf4g
|
ENSMUSG00000017688.8 | hepatocyte nuclear factor 4, gamma |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Hnf4g | mm10_v2_chr3_+_3508024_3508069 | -0.37 | 2.6e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr4_-_89294608 | 1.47 |
ENSMUST00000107131.1
|
Cdkn2a
|
cyclin-dependent kinase inhibitor 2A |
| chr2_-_131042682 | 1.45 |
ENSMUST00000028787.5
ENSMUST00000110239.1 ENSMUST00000110234.1 |
Gfra4
|
glial cell line derived neurotrophic factor family receptor alpha 4 |
| chr15_+_82252397 | 1.41 |
ENSMUST00000136948.1
|
1500009C09Rik
|
RIKEN cDNA 1500009C09 gene |
| chr12_-_103863551 | 1.39 |
ENSMUST00000085056.6
ENSMUST00000072876.5 ENSMUST00000124717.1 |
Serpina1a
|
serine (or cysteine) peptidase inhibitor, clade A, member 1A |
| chr1_-_87101590 | 1.25 |
ENSMUST00000113270.2
|
Alpi
|
alkaline phosphatase, intestinal |
| chr19_-_4877882 | 1.20 |
ENSMUST00000006626.3
|
Actn3
|
actinin alpha 3 |
| chr9_+_64117147 | 1.13 |
ENSMUST00000034969.7
|
Lctl
|
lactase-like |
| chr17_-_31129602 | 1.12 |
ENSMUST00000024827.4
|
Tff3
|
trefoil factor 3, intestinal |
| chr12_-_103738158 | 1.11 |
ENSMUST00000095450.4
|
Serpina1b
|
serine (or cysteine) preptidase inhibitor, clade A, member 1B |
| chr9_+_46240696 | 1.09 |
ENSMUST00000034585.6
|
Apoa4
|
apolipoprotein A-IV |
| chr12_-_103773592 | 1.09 |
ENSMUST00000078869.5
|
Serpina1d
|
serine (or cysteine) peptidase inhibitor, clade A, member 1D |
| chr7_+_141291988 | 1.05 |
ENSMUST00000026569.4
|
Drd4
|
dopamine receptor D4 |
| chr6_-_40999479 | 1.04 |
ENSMUST00000166306.1
|
Gm2663
|
predicted gene 2663 |
| chr18_+_67343564 | 0.97 |
ENSMUST00000025404.8
|
Cidea
|
cell death-inducing DNA fragmentation factor, alpha subunit-like effector A |
| chr12_-_103956891 | 0.97 |
ENSMUST00000085054.4
|
Serpina1e
|
serine (or cysteine) peptidase inhibitor, clade A, member 1E |
| chr12_-_103904887 | 0.96 |
ENSMUST00000074051.5
|
Serpina1c
|
serine (or cysteine) peptidase inhibitor, clade A, member 1C |
| chr5_-_33433976 | 0.95 |
ENSMUST00000173348.1
|
Nkx1-1
|
NK1 transcription factor related, locus 1 (Drosophila) |
| chr6_-_85513586 | 0.93 |
ENSMUST00000095759.3
|
Egr4
|
early growth response 4 |
| chr17_-_12851893 | 0.89 |
ENSMUST00000162389.1
ENSMUST00000162119.1 ENSMUST00000159223.1 |
Mas1
|
MAS1 oncogene |
| chr5_+_76840597 | 0.88 |
ENSMUST00000120639.2
ENSMUST00000163347.1 ENSMUST00000121851.1 |
C530008M17Rik
|
RIKEN cDNA C530008M17 gene |
| chr17_-_24658425 | 0.88 |
ENSMUST00000095544.4
|
Npw
|
neuropeptide W |
| chr9_+_107935876 | 0.87 |
ENSMUST00000035700.8
|
Camkv
|
CaM kinase-like vesicle-associated |
| chr9_-_46235260 | 0.85 |
ENSMUST00000121916.1
ENSMUST00000034586.2 |
Apoc3
|
apolipoprotein C-III |
| chr5_-_145879857 | 0.85 |
ENSMUST00000035918.7
|
Cyp3a11
|
cytochrome P450, family 3, subfamily a, polypeptide 11 |
| chr4_-_43499608 | 0.82 |
ENSMUST00000136005.1
ENSMUST00000054538.6 |
Arhgef39
|
Rho guanine nucleotide exchange factor (GEF) 39 |
| chr10_+_13090788 | 0.82 |
ENSMUST00000121646.1
ENSMUST00000121325.1 ENSMUST00000121766.1 |
Plagl1
|
pleiomorphic adenoma gene-like 1 |
| chr4_+_126556935 | 0.80 |
ENSMUST00000048391.8
|
Clspn
|
claspin |
| chr1_-_71103146 | 0.80 |
ENSMUST00000027393.7
|
Bard1
|
BRCA1 associated RING domain 1 |
| chr12_+_109452833 | 0.80 |
ENSMUST00000056110.8
|
Dlk1
|
delta-like 1 homolog (Drosophila) |
| chr14_-_62292959 | 0.78 |
ENSMUST00000063169.8
|
Dleu7
|
deleted in lymphocytic leukemia, 7 |
| chr2_-_131043088 | 0.77 |
ENSMUST00000110240.3
ENSMUST00000066958.4 ENSMUST00000110235.1 |
Gfra4
|
glial cell line derived neurotrophic factor family receptor alpha 4 |
| chr9_+_44673227 | 0.77 |
ENSMUST00000034609.4
ENSMUST00000071219.5 |
Treh
|
trehalase (brush-border membrane glycoprotein) |
| chr6_+_71199827 | 0.77 |
ENSMUST00000067492.7
|
Fabp1
|
fatty acid binding protein 1, liver |
| chr1_+_91179822 | 0.77 |
ENSMUST00000097648.4
ENSMUST00000165855.1 |
Ramp1
|
receptor (calcitonin) activity modifying protein 1 |
| chr2_-_33131645 | 0.77 |
ENSMUST00000133135.1
|
Garnl3
|
GTPase activating RANGAP domain-like 3 |
| chr2_+_173153048 | 0.76 |
ENSMUST00000029017.5
|
Pck1
|
phosphoenolpyruvate carboxykinase 1, cytosolic |
| chr5_+_76657673 | 0.76 |
ENSMUST00000128112.1
|
C530008M17Rik
|
RIKEN cDNA C530008M17 gene |
| chr12_+_7977640 | 0.75 |
ENSMUST00000171271.1
ENSMUST00000037811.6 ENSMUST00000037520.7 |
Apob
|
apolipoprotein B |
| chr11_+_120949053 | 0.75 |
ENSMUST00000154187.1
ENSMUST00000100130.3 ENSMUST00000129473.1 ENSMUST00000168579.1 |
Slc16a3
|
solute carrier family 16 (monocarboxylic acid transporters), member 3 |
| chr15_-_101562889 | 0.74 |
ENSMUST00000023714.4
|
4732456N10Rik
|
RIKEN cDNA 4732456N10 gene |
| chr11_-_40733373 | 0.74 |
ENSMUST00000020579.8
|
Hmmr
|
hyaluronan mediated motility receptor (RHAMM) |
| chr9_-_46235631 | 0.74 |
ENSMUST00000118649.1
|
Apoc3
|
apolipoprotein C-III |
| chrX_+_49463926 | 0.74 |
ENSMUST00000130558.1
|
Arhgap36
|
Rho GTPase activating protein 36 |
| chr11_-_35798884 | 0.74 |
ENSMUST00000160726.2
|
Fbll1
|
fibrillarin-like 1 |
| chr19_+_39287074 | 0.72 |
ENSMUST00000003137.8
|
Cyp2c29
|
cytochrome P450, family 2, subfamily c, polypeptide 29 |
| chr3_+_122895072 | 0.68 |
ENSMUST00000023820.5
|
Fabp2
|
fatty acid binding protein 2, intestinal |
| chr9_-_21037775 | 0.67 |
ENSMUST00000180870.1
|
Gm26592
|
predicted gene, 26592 |
| chr2_+_118814195 | 0.66 |
ENSMUST00000110842.1
|
Knstrn
|
kinetochore-localized astrin/SPAG5 binding |
| chr7_-_141276729 | 0.66 |
ENSMUST00000167263.1
ENSMUST00000080654.5 |
Cdhr5
|
cadherin-related family member 5 |
| chr2_+_118813995 | 0.65 |
ENSMUST00000134661.1
|
Knstrn
|
kinetochore-localized astrin/SPAG5 binding |
| chr14_-_55758458 | 0.64 |
ENSMUST00000001497.7
|
Cideb
|
cell death-inducing DNA fragmentation factor, alpha subunit-like effector B |
| chr9_+_44084944 | 0.64 |
ENSMUST00000176416.1
ENSMUST00000065461.7 |
Usp2
|
ubiquitin specific peptidase 2 |
| chr10_+_39133981 | 0.63 |
ENSMUST00000019991.7
|
Tube1
|
epsilon-tubulin 1 |
| chr9_+_111311674 | 0.60 |
ENSMUST00000078626.3
|
Trank1
|
tetratricopeptide repeat and ankyrin repeat containing 1 |
| chr9_-_54661870 | 0.60 |
ENSMUST00000034822.5
|
Acsbg1
|
acyl-CoA synthetase bubblegum family member 1 |
| chr4_+_134510999 | 0.60 |
ENSMUST00000105866.2
|
Aunip
|
aurora kinase A and ninein interacting protein |
| chr17_+_55986494 | 0.59 |
ENSMUST00000011733.8
|
Fsd1
|
fibronectin type 3 and SPRY domain-containing protein |
| chr7_-_99238564 | 0.59 |
ENSMUST00000064231.7
|
Mogat2
|
monoacylglycerol O-acyltransferase 2 |
| chr4_-_131838231 | 0.58 |
ENSMUST00000030741.2
ENSMUST00000105987.2 |
Ptpru
|
protein tyrosine phosphatase, receptor type, U |
| chr19_+_38055002 | 0.58 |
ENSMUST00000096096.4
ENSMUST00000116506.1 ENSMUST00000169673.1 |
Cep55
|
centrosomal protein 55 |
| chrX_+_48108912 | 0.58 |
ENSMUST00000114998.1
ENSMUST00000115000.3 |
Xpnpep2
|
X-prolyl aminopeptidase (aminopeptidase P) 2, membrane-bound |
| chr8_-_22185758 | 0.58 |
ENSMUST00000046916.7
|
Ckap2
|
cytoskeleton associated protein 2 |
| chr8_+_70315759 | 0.57 |
ENSMUST00000165819.2
ENSMUST00000140239.1 |
Gdf1
Cers1
|
growth differentiation factor 1 ceramide synthase 1 |
| chr11_-_6230127 | 0.57 |
ENSMUST00000004505.2
|
Npc1l1
|
NPC1-like 1 |
| chr4_+_88773834 | 0.56 |
ENSMUST00000177806.1
|
Gm13290
|
predicted gene 13290 |
| chr12_-_108275409 | 0.56 |
ENSMUST00000136175.1
|
Ccdc85c
|
coiled-coil domain containing 85C |
| chr11_-_81968415 | 0.56 |
ENSMUST00000066197.6
|
Asic2
|
acid-sensing (proton-gated) ion channel 2 |
| chr13_-_100775844 | 0.56 |
ENSMUST00000075550.3
|
Cenph
|
centromere protein H |
| chr6_+_122513583 | 0.56 |
ENSMUST00000032210.7
ENSMUST00000148517.1 |
Mfap5
|
microfibrillar associated protein 5 |
| chr5_-_87337165 | 0.55 |
ENSMUST00000031195.2
|
Ugt2a3
|
UDP glucuronosyltransferase 2 family, polypeptide A3 |
| chr14_+_31208309 | 0.55 |
ENSMUST00000169169.1
|
Tnnc1
|
troponin C, cardiac/slow skeletal |
| chr12_-_8539545 | 0.55 |
ENSMUST00000095863.3
ENSMUST00000165657.1 |
Slc7a15
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 15 |
| chr17_+_48264270 | 0.54 |
ENSMUST00000059873.7
ENSMUST00000154335.1 ENSMUST00000136272.1 ENSMUST00000125426.1 ENSMUST00000153420.1 |
Treml4
|
triggering receptor expressed on myeloid cells-like 4 |
| chr3_-_27153861 | 0.54 |
ENSMUST00000108300.1
ENSMUST00000108298.2 |
Ect2
|
ect2 oncogene |
| chr1_-_38664947 | 0.54 |
ENSMUST00000039827.7
ENSMUST00000027250.7 |
Aff3
|
AF4/FMR2 family, member 3 |
| chr2_+_118814237 | 0.54 |
ENSMUST00000028803.7
ENSMUST00000126045.1 |
Knstrn
|
kinetochore-localized astrin/SPAG5 binding |
| chr3_+_92288566 | 0.53 |
ENSMUST00000090872.4
|
Sprr2a3
|
small proline-rich protein 2A3 |
| chr11_+_79591120 | 0.53 |
ENSMUST00000017783.6
|
Rab11fip4
|
RAB11 family interacting protein 4 (class II) |
| chr16_-_4719148 | 0.53 |
ENSMUST00000115851.3
|
Nmral1
|
NmrA-like family domain containing 1 |
| chr4_-_122961173 | 0.53 |
ENSMUST00000030408.5
ENSMUST00000127047.1 |
Mfsd2a
|
major facilitator superfamily domain containing 2A |
| chr11_+_102248842 | 0.52 |
ENSMUST00000100392.4
|
BC030867
|
cDNA sequence BC030867 |
| chr7_-_135528645 | 0.52 |
ENSMUST00000053716.7
|
Clrn3
|
clarin 3 |
| chr11_-_82991829 | 0.52 |
ENSMUST00000092840.4
ENSMUST00000038211.5 |
Slfn9
|
schlafen 9 |
| chr8_+_116921735 | 0.52 |
ENSMUST00000034205.4
|
Cenpn
|
centromere protein N |
| chr8_-_70892752 | 0.52 |
ENSMUST00000000809.2
|
Slc5a5
|
solute carrier family 5 (sodium iodide symporter), member 5 |
| chr9_-_54661666 | 0.52 |
ENSMUST00000128624.1
|
Acsbg1
|
acyl-CoA synthetase bubblegum family member 1 |
| chr8_-_107403197 | 0.52 |
ENSMUST00000003947.8
|
Nqo1
|
NAD(P)H dehydrogenase, quinone 1 |
| chr5_-_72587544 | 0.52 |
ENSMUST00000031124.4
|
Gm5868
|
predicted gene 5868 |
| chr10_-_80261004 | 0.51 |
ENSMUST00000105363.1
|
Gamt
|
guanidinoacetate methyltransferase |
| chr12_-_103457195 | 0.51 |
ENSMUST00000044687.6
|
Ifi27l2b
|
interferon, alpha-inducible protein 27 like 2B |
| chr10_+_128238034 | 0.51 |
ENSMUST00000105245.2
|
Timeless
|
timeless circadian clock 1 |
| chr15_-_82794236 | 0.50 |
ENSMUST00000006094.4
|
Cyp2d26
|
cytochrome P450, family 2, subfamily d, polypeptide 26 |
| chr16_-_4719078 | 0.49 |
ENSMUST00000120056.1
ENSMUST00000074970.7 |
Nmral1
|
NmrA-like family domain containing 1 |
| chr6_+_129397478 | 0.49 |
ENSMUST00000112081.2
ENSMUST00000112079.2 |
Clec1b
|
C-type lectin domain family 1, member b |
| chr16_+_33794345 | 0.48 |
ENSMUST00000023520.6
|
Muc13
|
mucin 13, epithelial transmembrane |
| chr16_+_33794008 | 0.48 |
ENSMUST00000115044.1
|
Muc13
|
mucin 13, epithelial transmembrane |
| chr2_-_181135103 | 0.48 |
ENSMUST00000149964.2
ENSMUST00000103050.3 ENSMUST00000081528.6 ENSMUST00000049792.8 ENSMUST00000103048.3 ENSMUST00000103047.3 ENSMUST00000129073.1 ENSMUST00000144592.1 ENSMUST00000139458.1 ENSMUST00000154164.1 ENSMUST00000123336.1 ENSMUST00000129361.1 ENSMUST00000103051.2 |
Kcnq2
|
potassium voltage-gated channel, subfamily Q, member 2 |
| chr7_+_4782940 | 0.48 |
ENSMUST00000013235.4
|
Tmem190
|
transmembrane protein 190 |
| chr14_+_64588112 | 0.48 |
ENSMUST00000181808.1
|
A930011O12Rik
|
RIKEN cDNA A930011O12 gene |
| chr16_-_18413452 | 0.48 |
ENSMUST00000165430.1
ENSMUST00000147720.1 |
Comt
|
catechol-O-methyltransferase |
| chr8_+_104733997 | 0.47 |
ENSMUST00000034346.8
ENSMUST00000164182.2 |
Ces2a
|
carboxylesterase 2A |
| chr19_+_37376359 | 0.47 |
ENSMUST00000012587.3
|
Kif11
|
kinesin family member 11 |
| chr11_+_76679757 | 0.47 |
ENSMUST00000062024.2
|
Tusc5
|
tumor suppressor candidate 5 |
| chr6_+_122513643 | 0.46 |
ENSMUST00000118626.1
|
Mfap5
|
microfibrillar associated protein 5 |
| chr7_+_88278085 | 0.46 |
ENSMUST00000032779.5
ENSMUST00000128791.1 |
Ctsc
|
cathepsin C |
| chr7_+_28458658 | 0.46 |
ENSMUST00000108288.3
ENSMUST00000055110.9 |
Lrfn1
|
leucine rich repeat and fibronectin type III domain containing 1 |
| chr2_+_119112793 | 0.46 |
ENSMUST00000140939.1
ENSMUST00000028795.3 |
Rad51
|
RAD51 homolog |
| chr4_+_119637704 | 0.46 |
ENSMUST00000024015.2
|
Guca2a
|
guanylate cyclase activator 2a (guanylin) |
| chr10_+_40883819 | 0.46 |
ENSMUST00000105509.1
|
Wasf1
|
WAS protein family, member 1 |
| chr16_-_55895279 | 0.46 |
ENSMUST00000099705.3
|
Nxpe3
|
neurexophilin and PC-esterase domain family, member 3 |
| chr7_+_64502090 | 0.45 |
ENSMUST00000137732.1
|
Apba2
|
amyloid beta (A4) precursor protein-binding, family A, member 2 |
| chr7_-_140154712 | 0.45 |
ENSMUST00000059241.7
|
Sprn
|
shadow of prion protein |
| chr17_-_24251382 | 0.45 |
ENSMUST00000115390.3
|
Ccnf
|
cyclin F |
| chr4_+_126556994 | 0.45 |
ENSMUST00000147675.1
|
Clspn
|
claspin |
| chr11_-_77894096 | 0.45 |
ENSMUST00000017597.4
|
Pipox
|
pipecolic acid oxidase |
| chr13_+_92425896 | 0.45 |
ENSMUST00000061594.6
|
Ankrd34b
|
ankyrin repeat domain 34B |
| chr8_-_92356103 | 0.44 |
ENSMUST00000034183.3
|
4933436C20Rik
|
RIKEN cDNA 4933436C20 gene |
| chr1_-_91413163 | 0.44 |
ENSMUST00000086851.1
|
Hes6
|
hairy and enhancer of split 6 |
| chrX_+_49470450 | 0.44 |
ENSMUST00000114904.3
|
Arhgap36
|
Rho GTPase activating protein 36 |
| chr18_-_74207771 | 0.44 |
ENSMUST00000040188.8
ENSMUST00000177604.1 |
Ska1
|
spindle and kinetochore associated complex subunit 1 |
| chr4_-_116123618 | 0.44 |
ENSMUST00000102704.3
ENSMUST00000102705.3 |
Rad54l
|
RAD54 like (S. cerevisiae) |
| chr13_-_73937761 | 0.44 |
ENSMUST00000022053.8
|
Trip13
|
thyroid hormone receptor interactor 13 |
| chr3_-_145032765 | 0.44 |
ENSMUST00000029919.5
|
Clca3
|
chloride channel calcium activated 3 |
| chr10_-_80844025 | 0.44 |
ENSMUST00000053986.7
|
Lingo3
|
leucine rich repeat and Ig domain containing 3 |
| chr8_-_53638945 | 0.44 |
ENSMUST00000047768.4
|
Neil3
|
nei like 3 (E. coli) |
| chrX_+_71050160 | 0.44 |
ENSMUST00000082088.3
ENSMUST00000114629.3 |
Mamld1
|
mastermind-like domain containing 1 |
| chr2_+_157560078 | 0.43 |
ENSMUST00000153739.2
ENSMUST00000173595.1 ENSMUST00000109526.1 ENSMUST00000173839.1 ENSMUST00000173041.1 ENSMUST00000173793.1 ENSMUST00000172487.1 ENSMUST00000088484.5 |
Nnat
|
neuronatin |
| chr17_-_25727364 | 0.43 |
ENSMUST00000170070.1
ENSMUST00000048054.7 |
Chtf18
|
CTF18, chromosome transmission fidelity factor 18 |
| chr15_-_36140393 | 0.43 |
ENSMUST00000172831.1
|
Rgs22
|
regulator of G-protein signalling 22 |
| chr2_+_3770673 | 0.42 |
ENSMUST00000177037.1
|
Fam107b
|
family with sequence similarity 107, member B |
| chr2_-_105399286 | 0.42 |
ENSMUST00000006128.6
|
Rcn1
|
reticulocalbin 1 |
| chr8_-_92355764 | 0.42 |
ENSMUST00000180102.1
ENSMUST00000179421.1 ENSMUST00000179222.1 ENSMUST00000179029.1 |
4933436C20Rik
|
RIKEN cDNA 4933436C20 gene |
| chr7_+_141061274 | 0.42 |
ENSMUST00000048002.5
|
B4galnt4
|
beta-1,4-N-acetyl-galactosaminyl transferase 4 |
| chr11_-_118909487 | 0.41 |
ENSMUST00000117731.1
ENSMUST00000106278.2 ENSMUST00000120061.1 ENSMUST00000017576.4 |
Rbfox3
|
RNA binding protein, fox-1 homolog (C. elegans) 3 |
| chr5_-_106574706 | 0.41 |
ENSMUST00000131029.1
ENSMUST00000124394.2 |
RP24-421H18.1
|
RP24-421H18.1 |
| chr6_-_85502858 | 0.41 |
ENSMUST00000161546.1
ENSMUST00000161078.1 |
Fbxo41
|
F-box protein 41 |
| chr13_+_21312198 | 0.41 |
ENSMUST00000004453.7
|
Gpx6
|
glutathione peroxidase 6 |
| chr17_-_25797032 | 0.41 |
ENSMUST00000165838.1
ENSMUST00000002344.6 |
Metrn
|
meteorin, glial cell differentiation regulator |
| chr2_-_157007015 | 0.41 |
ENSMUST00000146413.1
|
Dsn1
|
DSN1, MIND kinetochore complex component, homolog (S. cerevisiae) |
| chr19_-_5731697 | 0.41 |
ENSMUST00000025885.4
ENSMUST00000159693.1 |
Sssca1
|
Sjogren's syndrome/scleroderma autoantigen 1 homolog (human) |
| chr7_+_81114799 | 0.41 |
ENSMUST00000026820.4
|
Slc28a1
|
solute carrier family 28 (sodium-coupled nucleoside transporter), member 1 |
| chr9_-_70934808 | 0.41 |
ENSMUST00000034731.8
|
Lipc
|
lipase, hepatic |
| chr2_-_157007039 | 0.40 |
ENSMUST00000103129.2
ENSMUST00000103130.1 |
Dsn1
|
DSN1, MIND kinetochore complex component, homolog (S. cerevisiae) |
| chr13_+_46418266 | 0.40 |
ENSMUST00000037923.3
|
Rbm24
|
RNA binding motif protein 24 |
| chr8_+_72761868 | 0.40 |
ENSMUST00000058099.8
|
F2rl3
|
coagulation factor II (thrombin) receptor-like 3 |
| chr1_-_152386589 | 0.40 |
ENSMUST00000162371.1
|
Tsen15
|
tRNA splicing endonuclease 15 homolog (S. cerevisiae) |
| chr11_-_54068932 | 0.40 |
ENSMUST00000093109.4
ENSMUST00000018755.3 |
Pdlim4
|
PDZ and LIM domain 4 |
| chr4_+_88803254 | 0.39 |
ENSMUST00000179490.1
|
Gm13287
|
predicted gene 13287 |
| chr1_+_156558759 | 0.39 |
ENSMUST00000173929.1
|
Abl2
|
v-abl Abelson murine leukemia viral oncogene 2 (arg, Abelson-related gene) |
| chr4_+_107367757 | 0.39 |
ENSMUST00000139560.1
|
Ndc1
|
NDC1 transmembrane nucleoporin |
| chr7_+_81114816 | 0.39 |
ENSMUST00000119083.1
|
Slc28a1
|
solute carrier family 28 (sodium-coupled nucleoside transporter), member 1 |
| chr12_-_40134175 | 0.38 |
ENSMUST00000078481.7
ENSMUST00000002640.5 |
Scin
|
scinderin |
| chr11_+_29130733 | 0.38 |
ENSMUST00000020756.8
|
Pnpt1
|
polyribonucleotide nucleotidyltransferase 1 |
| chr8_-_84966008 | 0.37 |
ENSMUST00000109738.3
ENSMUST00000065049.8 ENSMUST00000128972.1 |
Rnaseh2a
|
ribonuclease H2, large subunit |
| chr17_-_35175995 | 0.37 |
ENSMUST00000173324.1
|
Aif1
|
allograft inflammatory factor 1 |
| chr18_+_34625009 | 0.37 |
ENSMUST00000166044.1
|
Kif20a
|
kinesin family member 20A |
| chr10_+_80855275 | 0.37 |
ENSMUST00000035597.8
|
Sppl2b
|
signal peptide peptidase like 2B |
| chr14_+_62292475 | 0.37 |
ENSMUST00000166879.1
|
Rnaseh2b
|
ribonuclease H2, subunit B |
| chr7_+_141746736 | 0.37 |
ENSMUST00000026590.8
|
Muc2
|
mucin 2 |
| chr7_+_3332918 | 0.36 |
ENSMUST00000092891.4
|
Cacng7
|
calcium channel, voltage-dependent, gamma subunit 7 |
| chrX_+_139800795 | 0.36 |
ENSMUST00000054889.3
|
Cldn2
|
claudin 2 |
| chr1_-_107278361 | 0.36 |
ENSMUST00000166100.1
ENSMUST00000027565.4 |
Serpinb3b
Serpinb3c
|
serine (or cysteine) peptidase inhibitor, clade B (ovalbumin), member 3B serine (or cysteine) peptidase inhibitor, clade B, member 3C |
| chr2_+_30281043 | 0.36 |
ENSMUST00000143119.2
|
RP23-395P6.9
|
RP23-395P6.9 |
| chrX_+_100729917 | 0.36 |
ENSMUST00000019503.7
|
Gdpd2
|
glycerophosphodiester phosphodiesterase domain containing 2 |
| chr10_+_77032230 | 0.36 |
ENSMUST00000136150.1
|
Slc19a1
|
solute carrier family 19 (folate transporter), member 1 |
| chr10_+_63100156 | 0.36 |
ENSMUST00000044059.3
|
Atoh7
|
atonal homolog 7 (Drosophila) |
| chr9_-_20959785 | 0.36 |
ENSMUST00000177754.1
|
Dnmt1
|
DNA methyltransferase (cytosine-5) 1 |
| chr6_-_35308110 | 0.36 |
ENSMUST00000031868.4
|
Slc13a4
|
solute carrier family 13 (sodium/sulfate symporters), member 4 |
| chr6_+_58640536 | 0.36 |
ENSMUST00000145161.1
ENSMUST00000114294.1 |
Abcg2
|
ATP-binding cassette, sub-family G (WHITE), member 2 |
| chr9_-_22389113 | 0.35 |
ENSMUST00000040912.7
|
Anln
|
anillin, actin binding protein |
| chr17_-_32917048 | 0.35 |
ENSMUST00000054174.7
|
Cyp4f14
|
cytochrome P450, family 4, subfamily f, polypeptide 14 |
| chr16_-_4003750 | 0.35 |
ENSMUST00000171658.1
ENSMUST00000171762.1 |
Slx4
|
SLX4 structure-specific endonuclease subunit homolog (S. cerevisiae) |
| chr1_-_9944103 | 0.34 |
ENSMUST00000182498.1
ENSMUST00000182742.1 ENSMUST00000182580.1 |
Snhg6
|
small nucleolar RNA host gene (non-protein coding) 6 |
| chr3_+_88043098 | 0.34 |
ENSMUST00000166021.1
ENSMUST00000029707.7 |
Gpatch4
|
G patch domain containing 4 |
| chr15_-_75678732 | 0.34 |
ENSMUST00000000958.8
|
Top1mt
|
DNA topoisomerase 1, mitochondrial |
| chr3_+_37613911 | 0.34 |
ENSMUST00000144981.1
ENSMUST00000129750.1 |
4930594O21Rik
|
RIKEN cDNA 4930594O21 gene |
| chr2_-_180104463 | 0.34 |
ENSMUST00000056480.3
|
Hrh3
|
histamine receptor H3 |
| chr4_+_11558914 | 0.34 |
ENSMUST00000178703.1
ENSMUST00000095145.5 ENSMUST00000108306.2 ENSMUST00000070755.6 |
Rad54b
|
RAD54 homolog B (S. cerevisiae) |
| chr2_+_167777467 | 0.33 |
ENSMUST00000139927.1
ENSMUST00000127441.1 |
Gm14321
|
predicted gene 14321 |
| chr14_+_68083853 | 0.33 |
ENSMUST00000022639.7
|
Nefl
|
neurofilament, light polypeptide |
| chr7_-_48881596 | 0.33 |
ENSMUST00000119223.1
|
E2f8
|
E2F transcription factor 8 |
| chr7_+_27258725 | 0.33 |
ENSMUST00000079258.6
|
Numbl
|
numb-like |
| chr1_+_91801453 | 0.33 |
ENSMUST00000007949.3
|
Twist2
|
twist basic helix-loop-helix transcription factor 2 |
| chr2_-_44927161 | 0.33 |
ENSMUST00000130991.1
|
Gtdc1
|
glycosyltransferase-like domain containing 1 |
| chr19_+_39060998 | 0.33 |
ENSMUST00000087236.4
|
Cyp2c65
|
cytochrome P450, family 2, subfamily c, polypeptide 65 |
| chr2_+_55437100 | 0.33 |
ENSMUST00000112633.2
ENSMUST00000112632.1 |
Kcnj3
|
potassium inwardly-rectifying channel, subfamily J, member 3 |
| chr18_+_34624621 | 0.33 |
ENSMUST00000167161.1
|
Kif20a
|
kinesin family member 20A |
| chr2_-_127521358 | 0.32 |
ENSMUST00000028850.8
ENSMUST00000103215.4 |
Kcnip3
|
Kv channel interacting protein 3, calsenilin |
| chr1_+_185454803 | 0.32 |
ENSMUST00000061093.6
|
Slc30a10
|
solute carrier family 30, member 10 |
| chr6_-_85502980 | 0.32 |
ENSMUST00000159062.1
|
Fbxo41
|
F-box protein 41 |
| chr11_+_58379036 | 0.32 |
ENSMUST00000013787.4
ENSMUST00000108826.2 |
Lypd8
|
LY6/PLAUR domain containing 8 |
| chr2_-_73386396 | 0.32 |
ENSMUST00000112044.1
ENSMUST00000112043.1 ENSMUST00000076463.5 |
Gpr155
|
G protein-coupled receptor 155 |
| chr7_+_27155114 | 0.32 |
ENSMUST00000108385.1
|
Cyp2t4
|
cytochrome P450, family 2, subfamily t, polypeptide 4 |
| chr10_-_80260959 | 0.32 |
ENSMUST00000020359.6
|
Gamt
|
guanidinoacetate methyltransferase |
| chr9_-_108428484 | 0.31 |
ENSMUST00000076592.2
|
Ccdc36
|
coiled-coil domain containing 36 |
| chr9_-_103228420 | 0.31 |
ENSMUST00000126359.1
|
Trf
|
transferrin |
| chr16_+_22892035 | 0.31 |
ENSMUST00000023583.5
|
Ahsg
|
alpha-2-HS-glycoprotein |
| chr2_+_181680284 | 0.31 |
ENSMUST00000103042.3
|
Tcea2
|
transcription elongation factor A (SII), 2 |
| chr3_+_94413244 | 0.31 |
ENSMUST00000166032.1
ENSMUST00000045245.5 |
Tdrkh
|
tudor and KH domain containing protein |
| chrX_-_150657392 | 0.31 |
ENSMUST00000151403.2
ENSMUST00000087253.4 ENSMUST00000112709.1 ENSMUST00000163969.1 ENSMUST00000087258.3 |
Tro
|
trophinin |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.3 | GO:0031448 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.4 | 1.6 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 0.4 | 1.1 | GO:0044240 | regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) multicellular organism lipid catabolic process(GO:0044240) |
| 0.3 | 1.7 | GO:2000434 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.3 | 0.8 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 0.3 | 1.0 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.3 | 0.8 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.3 | 0.8 | GO:0006114 | glycerol biosynthetic process(GO:0006114) positive regulation of transcription from RNA polymerase II promoter in response to acidic pH(GO:0061402) |
| 0.2 | 0.6 | GO:0051977 | lysophospholipid transport(GO:0051977) |
| 0.2 | 0.6 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.2 | 0.8 | GO:0051316 | attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
| 0.2 | 0.6 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) |
| 0.2 | 0.8 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.2 | 0.2 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) regulation of antimicrobial peptide production(GO:0002784) regulation of antibacterial peptide production(GO:0002786) positive regulation of antibacterial peptide production(GO:0002803) |
| 0.2 | 0.6 | GO:0019389 | glucuronoside metabolic process(GO:0019389) |
| 0.2 | 0.7 | GO:0015851 | nucleobase transport(GO:0015851) pyrimidine nucleobase transport(GO:0015855) |
| 0.2 | 0.6 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
| 0.2 | 0.5 | GO:1904976 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.2 | 0.9 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
| 0.2 | 0.5 | GO:0070844 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.1 | 0.4 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
| 0.1 | 0.4 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.1 | 0.7 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.1 | 0.4 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.1 | 2.6 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.1 | 0.4 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.1 | 1.9 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.1 | 0.5 | GO:0045963 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
| 0.1 | 0.4 | GO:1904170 | regulation of bleb assembly(GO:1904170) |
| 0.1 | 1.1 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
| 0.1 | 0.5 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.1 | 0.6 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 0.3 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 0.1 | 0.7 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.1 | 0.3 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
| 0.1 | 0.4 | GO:0035524 | proline transmembrane transport(GO:0035524) |
| 0.1 | 0.9 | GO:0097646 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
| 0.1 | 0.3 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.1 | 0.2 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.1 | 1.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.1 | 0.3 | GO:0045763 | negative regulation of cellular amino acid metabolic process(GO:0045763) regulation of glutamate metabolic process(GO:2000211) |
| 0.1 | 0.3 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.1 | 0.2 | GO:0000448 | cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
| 0.1 | 0.1 | GO:0033239 | negative regulation of cellular amine metabolic process(GO:0033239) |
| 0.1 | 0.4 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 0.1 | 1.3 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
| 0.1 | 0.4 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.1 | 0.2 | GO:0002775 | antimicrobial peptide production(GO:0002775) antibacterial peptide production(GO:0002778) |
| 0.1 | 0.8 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 | 0.4 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.5 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.1 | 0.9 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.1 | 0.5 | GO:0046490 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.1 | 0.2 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.1 | 0.2 | GO:0060490 | orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 0.1 | 1.2 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.1 | 0.2 | GO:1990764 | regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
| 0.1 | 0.7 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.1 | 0.2 | GO:0045004 | DNA replication proofreading(GO:0045004) |
| 0.1 | 0.7 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 | 0.7 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.1 | 0.4 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.1 | 0.3 | GO:0010916 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
| 0.1 | 0.2 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.1 | 0.2 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
| 0.1 | 0.2 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
| 0.1 | 0.2 | GO:0034093 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.1 | 0.3 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.1 | 0.2 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
| 0.1 | 0.3 | GO:0006113 | fermentation(GO:0006113) lactate biosynthetic process from pyruvate(GO:0019244) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.1 | 0.5 | GO:0098707 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
| 0.1 | 0.5 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 | 1.1 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.1 | 0.4 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.2 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.1 | 0.2 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
| 0.1 | 0.3 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
| 0.1 | 1.1 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.1 | 0.3 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.1 | 0.3 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.1 | 0.4 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.1 | 0.2 | GO:0070650 | actin filament bundle distribution(GO:0070650) |
| 0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 0.1 | GO:1901475 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.1 | 0.2 | GO:1900108 | inner medullary collecting duct development(GO:0072061) negative regulation of nodal signaling pathway(GO:1900108) |
| 0.1 | 0.2 | GO:0051935 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.1 | 0.5 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.1 | 0.3 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.1 | 0.2 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 | 0.2 | GO:1901376 | mycotoxin metabolic process(GO:0043385) mycotoxin catabolic process(GO:0043387) aflatoxin metabolic process(GO:0046222) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound metabolic process(GO:1901376) organic heteropentacyclic compound catabolic process(GO:1901377) |
| 0.1 | 0.6 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.1 | 0.3 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.1 | 0.2 | GO:0003349 | epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.1 | 0.2 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
| 0.1 | 0.5 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.1 | 0.5 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 | 0.5 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.1 | 0.3 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 0.1 | 0.4 | GO:0061718 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.1 | 1.3 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.1 | 0.2 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.1 | 0.6 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 | 0.3 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.1 | 0.2 | GO:2000568 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.1 | 0.3 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 | 0.4 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.1 | 0.2 | GO:0042823 | pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.1 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.1 | 0.2 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.1 | 0.5 | GO:0015705 | iodide transport(GO:0015705) |
| 0.1 | 0.3 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.1 | 0.2 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.1 | 0.2 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.0 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
| 0.0 | 0.6 | GO:0030299 | intestinal cholesterol absorption(GO:0030299) intestinal lipid absorption(GO:0098856) |
| 0.0 | 0.2 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) putrescine biosynthetic process(GO:0009446) |
| 0.0 | 0.2 | GO:0050812 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.0 | 0.2 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 | 0.2 | GO:0048296 | regulation of isotype switching to IgA isotypes(GO:0048296) positive regulation of isotype switching to IgA isotypes(GO:0048298) |
| 0.0 | 0.5 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.0 | 0.2 | GO:0099542 | trans-synaptic signaling by lipid(GO:0099541) trans-synaptic signaling by endocannabinoid(GO:0099542) |
| 0.0 | 0.2 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.0 | 0.2 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.0 | 0.2 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.0 | 0.3 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.0 | 0.3 | GO:0015862 | uridine transport(GO:0015862) |
| 0.0 | 0.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.7 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.0 | 0.2 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.0 | 1.4 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.0 | 0.3 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.0 | 0.1 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.0 | 0.3 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.4 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.0 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.0 | 0.3 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.0 | GO:0035744 | T-helper 1 cell cytokine production(GO:0035744) |
| 0.0 | 1.0 | GO:0045780 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.0 | 0.1 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
| 0.0 | 0.8 | GO:0050892 | intestinal absorption(GO:0050892) |
| 0.0 | 0.2 | GO:1900535 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.0 | 0.1 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 | 0.2 | GO:0032902 | nerve growth factor production(GO:0032902) |
| 0.0 | 0.5 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.5 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.4 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 0.0 | 0.1 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.0 | 0.1 | GO:2000418 | regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
| 0.0 | 0.2 | GO:0099527 | postsynapse to nucleus signaling pathway(GO:0099527) |
| 0.0 | 0.3 | GO:0072615 | interleukin-17 secretion(GO:0072615) |
| 0.0 | 0.7 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
| 0.0 | 0.3 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.0 | 0.1 | GO:0072244 | metanephric glomerular epithelium development(GO:0072244) |
| 0.0 | 0.0 | GO:0060382 | regulation of DNA strand elongation(GO:0060382) |
| 0.0 | 0.2 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.0 | 0.1 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.0 | 0.0 | GO:0034971 | histone H3-R17 methylation(GO:0034971) |
| 0.0 | 0.1 | GO:0015811 | L-cystine transport(GO:0015811) |
| 0.0 | 0.1 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
| 0.0 | 0.2 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 | 0.4 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 1.1 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
| 0.0 | 0.1 | GO:1903896 | positive regulation of IRE1-mediated unfolded protein response(GO:1903896) |
| 0.0 | 0.2 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.0 | 0.2 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.3 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.0 | 0.2 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.0 | 0.1 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 0.0 | 1.1 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
| 0.0 | 0.2 | GO:0003096 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.2 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
| 0.0 | 0.1 | GO:0032960 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) |
| 0.0 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.0 | 0.1 | GO:0018201 | peptidyl-glycine modification(GO:0018201) |
| 0.0 | 0.3 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.2 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.1 | GO:0046618 | drug export(GO:0046618) |
| 0.0 | 0.2 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.0 | 0.1 | GO:0051325 | interphase(GO:0051325) mitotic interphase(GO:0051329) |
| 0.0 | 0.3 | GO:0001539 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
| 0.0 | 0.1 | GO:0002270 | plasmacytoid dendritic cell activation(GO:0002270) |
| 0.0 | 0.3 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.0 | 0.3 | GO:0006703 | androgen biosynthetic process(GO:0006702) estrogen biosynthetic process(GO:0006703) |
| 0.0 | 0.2 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
| 0.0 | 0.2 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.0 | 0.2 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
| 0.0 | 0.1 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.0 | 0.2 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.0 | 0.0 | GO:0051958 | methotrexate transport(GO:0051958) |
| 0.0 | 0.3 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.2 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.0 | 0.1 | GO:2000521 | negative regulation of immunological synapse formation(GO:2000521) regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001188) negative regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001189) |
| 0.0 | 0.1 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.0 | 0.1 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.0 | 0.2 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.0 | 0.1 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.0 | 0.4 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.7 | GO:0097435 | fibril organization(GO:0097435) |
| 0.0 | 0.2 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.0 | 0.1 | GO:2000520 | regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) regulation of immunological synapse formation(GO:2000520) |
| 0.0 | 0.1 | GO:0031554 | regulation of DNA-templated transcription, termination(GO:0031554) |
| 0.0 | 0.1 | GO:0032298 | positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.0 | 0.1 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
| 0.0 | 0.1 | GO:0042275 | error-free postreplication DNA repair(GO:0042275) |
| 0.0 | 0.3 | GO:0099638 | endosome to plasma membrane protein transport(GO:0099638) |
| 0.0 | 0.3 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
| 0.0 | 0.2 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.0 | 0.1 | GO:0045659 | negative regulation of neutrophil differentiation(GO:0045659) |
| 0.0 | 0.2 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.0 | 0.1 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.0 | 0.3 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.2 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 | 0.1 | GO:0032053 | ciliary basal body organization(GO:0032053) |
| 0.0 | 0.1 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.0 | 0.2 | GO:2000232 | regulation of rRNA processing(GO:2000232) |
| 0.0 | 0.4 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 0.0 | 0.1 | GO:0010814 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.0 | 0.2 | GO:0035283 | cranial nerve formation(GO:0021603) central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.0 | 0.5 | GO:0015893 | drug transport(GO:0015893) |
| 0.0 | 0.2 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.4 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.0 | 0.1 | GO:2000489 | regulation of hepatic stellate cell activation(GO:2000489) |
| 0.0 | 0.3 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.2 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.0 | 0.1 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.2 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.0 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.0 | 0.3 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
| 0.0 | 0.3 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.0 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.0 | 0.3 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.0 | GO:0044598 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.3 | GO:1904867 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 0.0 | 0.1 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.0 | 0.2 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
| 0.0 | 0.4 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.0 | 0.5 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.4 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.1 | GO:0006290 | pyrimidine dimer repair(GO:0006290) cellular response to UV-C(GO:0071494) |
| 0.0 | 0.1 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
| 0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.0 | 0.1 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.0 | 0.1 | GO:0032796 | uropod organization(GO:0032796) |
| 0.0 | 0.1 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.0 | 0.1 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
| 0.0 | 0.1 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.0 | 0.1 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.1 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.0 | 0.1 | GO:2001201 | regulation of transforming growth factor-beta secretion(GO:2001201) |
| 0.0 | 0.1 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.0 | 0.3 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.2 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.0 | 0.1 | GO:0010845 | regulation of reciprocal meiotic recombination(GO:0010520) positive regulation of reciprocal meiotic recombination(GO:0010845) |
| 0.0 | 0.2 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
| 0.0 | 0.4 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.0 | 0.2 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 0.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.1 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
| 0.0 | 0.4 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.1 | GO:1900170 | negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 0.0 | 0.1 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) negative regulation of serotonin uptake(GO:0051612) |
| 0.0 | 0.1 | GO:0019062 | virion attachment to host cell(GO:0019062) receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.0 | 0.2 | GO:0001757 | somite specification(GO:0001757) |
| 0.0 | 0.3 | GO:0052695 | uronic acid metabolic process(GO:0006063) glucuronate metabolic process(GO:0019585) cellular glucuronidation(GO:0052695) |
| 0.0 | 0.1 | GO:1903028 | regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
| 0.0 | 0.0 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) |
| 0.0 | 0.3 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
| 0.0 | 0.8 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) regulation of microtubule depolymerization(GO:0031114) |
| 0.0 | 0.2 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.0 | 0.1 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.0 | 0.2 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.8 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.0 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.0 | 0.0 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.0 | 0.2 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.0 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.0 | 0.0 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.0 | 0.2 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
| 0.0 | 0.2 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 | 0.2 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.0 | 0.1 | GO:0009219 | pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide metabolic process(GO:0009219) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.0 | 0.1 | GO:1901675 | response to methylglyoxal(GO:0051595) negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.0 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.1 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 | 0.5 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.0 | 0.2 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 | 0.1 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 0.0 | 0.1 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.0 | 0.2 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.0 | 1.7 | GO:0030279 | negative regulation of ossification(GO:0030279) |
| 0.0 | 0.7 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.0 | 0.1 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.0 | 1.9 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
| 0.0 | 0.1 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.0 | 0.1 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.0 | 0.8 | GO:0001676 | long-chain fatty acid metabolic process(GO:0001676) |
| 0.0 | 0.1 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
| 0.0 | 0.2 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.0 | 0.4 | GO:0030574 | collagen catabolic process(GO:0030574) multicellular organism catabolic process(GO:0044243) |
| 0.0 | 0.3 | GO:0008272 | sulfate transport(GO:0008272) |
| 0.0 | 0.7 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.0 | 0.3 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.0 | 0.4 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.0 | 0.1 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.0 | 0.1 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.0 | 0.1 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.0 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.2 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
| 0.0 | 0.1 | GO:0009414 | response to water deprivation(GO:0009414) |
| 0.0 | 0.4 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.1 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
| 0.0 | 0.1 | GO:0030578 | PML body organization(GO:0030578) |
| 0.0 | 0.0 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.0 | 0.0 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.0 | 0.2 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.0 | 0.1 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
| 0.0 | 0.0 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.0 | 0.0 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.0 | 0.1 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 | 0.0 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
| 0.0 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 0.0 | GO:0036115 | fatty-acyl-CoA catabolic process(GO:0036115) |
| 0.0 | 0.1 | GO:0034627 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.0 | 0.0 | GO:0072053 | renal inner medulla development(GO:0072053) |
| 0.0 | 0.0 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.0 | 0.3 | GO:0001502 | cartilage condensation(GO:0001502) |
| 0.0 | 0.1 | GO:1903056 | regulation of melanosome organization(GO:1903056) |
| 0.0 | 0.3 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.4 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.0 | 0.0 | GO:0042420 | dopamine catabolic process(GO:0042420) |
| 0.0 | 0.0 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
| 0.0 | 0.0 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.0 | 0.2 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.0 | 0.1 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
| 0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.0 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.0 | 0.1 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.0 | 0.2 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 | 0.2 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.0 | 0.2 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.0 | 0.1 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.0 | 0.2 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.0 | 0.1 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.0 | 0.1 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.0 | 0.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.1 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
| 0.0 | 0.1 | GO:0001970 | positive regulation of activation of membrane attack complex(GO:0001970) |
| 0.0 | 0.4 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
| 0.0 | 0.4 | GO:0090662 | ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.0 | 0.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.0 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.0 | 0.7 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.0 | 0.0 | GO:0003072 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) regulation of blood vessel size by renin-angiotensin(GO:0002034) angiotensin-mediated drinking behavior(GO:0003051) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.0 | 0.2 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.3 | GO:0046785 | microtubule polymerization(GO:0046785) |
| 0.0 | 0.0 | GO:0060699 | regulation of endoribonuclease activity(GO:0060699) negative regulation of ribonuclease activity(GO:0060701) negative regulation of endoribonuclease activity(GO:0060702) |
| 0.0 | 0.1 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 0.0 | 0.2 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
| 0.0 | 0.2 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.0 | GO:0070560 | negative regulation of inositol phosphate biosynthetic process(GO:0010920) protein secretion by platelet(GO:0070560) |
| 0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.0 | 0.1 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
| 0.0 | 0.1 | GO:0046504 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.3 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.0 | 0.0 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.0 | 0.1 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 0.0 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) positive regulation of T-helper 17 cell differentiation(GO:2000321) |
| 0.0 | 0.1 | GO:0042427 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.0 | 0.0 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.0 | 0.0 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.0 | 0.0 | GO:0036367 | adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 0.0 | 0.1 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
| 0.0 | 0.0 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.0 | 0.1 | GO:0060605 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.0 | 0.0 | GO:1904529 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.0 | 0.1 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.0 | 0.3 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 | 0.0 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.2 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.1 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.0 | 0.0 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
| 0.0 | 0.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.1 | GO:0061072 | iris morphogenesis(GO:0061072) |
| 0.0 | 0.1 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.6 | GO:0031110 | regulation of microtubule polymerization or depolymerization(GO:0031110) |
| 0.0 | 0.0 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.0 | 0.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.4 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.0 | 0.0 | GO:0021577 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) |
| 0.0 | 0.2 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.4 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
| 0.0 | 0.1 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.0 | 0.0 | GO:0033753 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.0 | 0.2 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 | 0.1 | GO:0051798 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 2.6 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.2 | 1.4 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.2 | 1.5 | GO:0001652 | granular component(GO:0001652) |
| 0.2 | 0.8 | GO:0000939 | nuclear MIS12/MIND complex(GO:0000818) condensed chromosome inner kinetochore(GO:0000939) |
| 0.1 | 0.9 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 0.9 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.1 | 0.8 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.1 | 0.3 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.1 | 0.9 | GO:0042627 | chylomicron(GO:0042627) |
| 0.1 | 0.3 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.1 | 0.5 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.1 | 1.3 | GO:0045179 | apical cortex(GO:0045179) |
| 0.1 | 0.6 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.1 | 0.3 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 0.4 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 0.3 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.1 | 0.9 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 0.3 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 0.2 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.1 | 0.7 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.1 | 0.4 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.1 | 0.5 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 0.3 | GO:0071547 | piP-body(GO:0071547) |
| 0.1 | 0.5 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.1 | 1.0 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.1 | 0.4 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.1 | 0.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 0.2 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.1 | 0.2 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.1 | 0.4 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 0.3 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.1 | 0.2 | GO:0099569 | presynaptic cytoskeleton(GO:0099569) |
| 0.1 | 0.2 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.1 | 0.5 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 0.2 | GO:1990032 | parallel fiber(GO:1990032) |
| 0.1 | 0.5 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 0.8 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.2 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.3 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 0.2 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.0 | 1.8 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.1 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.0 | 0.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.0 | 0.3 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.2 | GO:0000221 | vacuolar proton-transporting V-type ATPase, V1 domain(GO:0000221) |
| 0.0 | 0.3 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.2 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
| 0.0 | 0.2 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.0 | 0.2 | GO:0031523 | Myb complex(GO:0031523) |
| 0.0 | 0.2 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.0 | 0.2 | GO:0060187 | cell pole(GO:0060187) |
| 0.0 | 0.3 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.5 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.0 | 0.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 1.5 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.0 | 0.5 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.2 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.0 | 0.2 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.0 | 0.2 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.0 | 0.3 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.4 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.2 | GO:1990769 | proximal neuron projection(GO:1990769) |
| 0.0 | 0.5 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.2 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.4 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.2 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 0.0 | 2.3 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.2 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.3 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.3 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.1 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
| 0.0 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.0 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.0 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.0 | 0.5 | GO:0000800 | lateral element(GO:0000800) |
| 0.0 | 0.0 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.0 | 0.4 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 0.5 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.3 | GO:0043203 | axon hillock(GO:0043203) |
| 0.0 | 0.1 | GO:0042585 | nuclear condensin complex(GO:0000799) germinal vesicle(GO:0042585) |
| 0.0 | 0.2 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.0 | 0.2 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.5 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.2 | GO:0043256 | laminin complex(GO:0043256) |
| 0.0 | 0.7 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.2 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.0 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.0 | 0.1 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.0 | 0.1 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
| 0.0 | 0.2 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.3 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.2 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 1.3 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 0.2 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.0 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 0.3 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.1 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 0.4 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.0 | 0.2 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.0 | 0.3 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.0 | 0.4 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.6 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.0 | 1.0 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.0 | 0.3 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.3 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 0.4 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 0.6 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 1.9 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.0 | 0.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
| 0.0 | 0.2 | GO:0032982 | myosin filament(GO:0032982) |
| 0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 2.7 | GO:0005903 | brush border(GO:0005903) |
| 0.0 | 0.9 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.0 | 0.4 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.0 | 0.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.6 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.2 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.5 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.2 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.0 | 0.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.3 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 0.0 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.0 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.0 | 0.9 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 0.1 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.2 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.2 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.0 | GO:0031251 | PAN complex(GO:0031251) |
| 0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.5 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 2.2 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
| 0.4 | 1.8 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.4 | 1.3 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.4 | 1.7 | GO:0055105 | ubiquitin-protein transferase inhibitor activity(GO:0055105) |
| 0.4 | 1.1 | GO:0004952 | dopamine neurotransmitter receptor activity(GO:0004952) |
| 0.3 | 1.1 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.3 | 0.8 | GO:0015389 | pyrimidine- and adenine-specific:sodium symporter activity(GO:0015389) |
| 0.3 | 0.8 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.3 | 1.0 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
| 0.2 | 1.5 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.2 | 1.3 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.2 | 0.6 | GO:0052871 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) |
| 0.2 | 0.6 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.2 | 0.5 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.2 | 1.0 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.2 | 0.7 | GO:0000010 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
| 0.2 | 0.5 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.2 | 0.9 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
| 0.1 | 0.9 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
| 0.1 | 0.6 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.1 | 0.3 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.1 | 1.0 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.1 | 0.7 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 0.6 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 0.6 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 0.5 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.1 | 0.7 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.1 | 0.7 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 0.7 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 0.1 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.1 | 0.3 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.1 | 0.6 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.1 | 0.5 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.1 | 1.2 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.1 | 0.5 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.1 | 0.4 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.1 | 0.2 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.1 | 0.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 0.5 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.1 | 0.3 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.1 | 0.5 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.1 | 0.3 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.1 | 0.7 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 0.5 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.1 | 1.1 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.1 | 0.2 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.1 | 0.5 | GO:0072510 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
| 0.1 | 1.2 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.1 | 0.4 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.1 | 0.3 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 0.3 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.3 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.2 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.1 | 0.3 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.1 | 1.0 | GO:0008649 | rRNA methyltransferase activity(GO:0008649) |
| 0.1 | 0.3 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.1 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.1 | 0.3 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.2 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.1 | 1.3 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.1 | 0.3 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.1 | 0.6 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.1 | 0.2 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.1 | 0.5 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.1 | 0.2 | GO:0031687 | A2A adenosine receptor binding(GO:0031687) |
| 0.1 | 0.2 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.1 | 0.4 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.1 | 0.4 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.1 | 0.2 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.1 | 0.2 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.1 | 0.2 | GO:0031403 | lithium ion binding(GO:0031403) |
| 0.1 | 0.6 | GO:0016503 | pheromone receptor activity(GO:0016503) |
| 0.1 | 0.2 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.0 | 5.3 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.6 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.3 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 1.3 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.3 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.0 | 0.3 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.1 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.0 | 0.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.3 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.1 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.0 | 0.2 | GO:0032138 | single base insertion or deletion binding(GO:0032138) |
| 0.0 | 0.2 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.0 | 0.3 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.0 | 0.4 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.0 | 0.2 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.0 | 0.4 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.4 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.0 | 0.3 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.0 | 0.2 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.0 | 0.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.2 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.0 | 0.3 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.4 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.0 | 0.1 | GO:0015184 | L-cystine transmembrane transporter activity(GO:0015184) |
| 0.0 | 0.4 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.0 | 0.1 | GO:0035717 | chemokine (C-C motif) ligand 7 binding(GO:0035717) |
| 0.0 | 0.2 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.0 | 0.6 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.2 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.0 | 0.3 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.0 | 0.3 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.0 | 0.2 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.0 | 0.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.2 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.0 | 0.3 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
| 0.0 | 1.2 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.3 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.0 | 0.1 | GO:0000401 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
| 0.0 | 0.1 | GO:0008431 | vitamin E binding(GO:0008431) |
| 0.0 | 0.3 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.3 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.0 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.0 | 0.2 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.0 | 0.0 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
| 0.0 | 0.1 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
| 0.0 | 0.5 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.2 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.0 | 0.1 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.0 | 0.1 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.0 | 0.4 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.0 | 0.2 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.0 | 0.1 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.0 | 0.1 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.0 | 1.2 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.0 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.0 | 0.1 | GO:0035240 | dopamine binding(GO:0035240) |
| 0.0 | 0.6 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.2 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
| 0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 0.1 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
| 0.0 | 0.1 | GO:0004883 | glucocorticoid receptor activity(GO:0004883) transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.0 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
| 0.0 | 0.2 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.0 | 0.2 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.2 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.0 | 0.7 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.1 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
| 0.0 | 0.2 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
| 0.0 | 0.2 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.0 | 0.1 | GO:0004637 | phosphoribosylamine-glycine ligase activity(GO:0004637) |
| 0.0 | 0.5 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.2 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 0.5 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.0 | 0.2 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.6 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.3 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.0 | 0.1 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.0 | 0.4 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.1 | GO:0097643 | amylin receptor activity(GO:0097643) |
| 0.0 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.1 | GO:0018738 | S-formylglutathione hydrolase activity(GO:0018738) |
| 0.0 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.0 | 0.6 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.1 | GO:0004051 | arachidonate 5-lipoxygenase activity(GO:0004051) |
| 0.0 | 0.1 | GO:0016726 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
| 0.0 | 0.2 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.1 | GO:0004488 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 0.0 | 3.4 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.2 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.0 | 0.1 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.0 | 0.1 | GO:0005124 | scavenger receptor binding(GO:0005124) |
| 0.0 | 0.4 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.4 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
| 0.0 | 0.1 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.0 | 0.1 | GO:0001160 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 0.0 | 0.3 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.0 | 0.1 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
| 0.0 | 0.2 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.1 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.0 | 0.1 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
| 0.0 | 0.2 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.2 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 0.4 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.0 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) oxidized purine DNA binding(GO:0032357) |
| 0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.1 | GO:0035605 | peptidyl-cysteine S-nitrosylase activity(GO:0035605) |
| 0.0 | 0.1 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.2 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.0 | 0.2 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.0 | 0.0 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
| 0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.1 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.0 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.0 | 0.1 | GO:0036468 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
| 0.0 | 0.3 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.2 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.0 | 0.0 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
| 0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.7 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.4 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.0 | 0.1 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 0.2 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.0 | 0.6 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.0 | 0.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.0 | 0.1 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
| 0.0 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.0 | 0.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.3 | GO:0015238 | drug transmembrane transporter activity(GO:0015238) |
| 0.0 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.3 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.0 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
| 0.0 | 0.1 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
| 0.0 | 0.0 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.0 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.0 | 0.0 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.0 | 0.1 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.3 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.5 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.0 | 0.1 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.0 | 0.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.5 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.4 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.0 | 0.1 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
| 0.0 | 0.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.9 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 0.6 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 2.2 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 0.8 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 2.4 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 0.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 2.2 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.0 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 1.1 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 1.1 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.0 | 0.5 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.3 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.2 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 0.9 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 1.3 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.6 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.6 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.4 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.6 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.9 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.8 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.1 | 0.1 | REACTOME CDK MEDIATED PHOSPHORYLATION AND REMOVAL OF CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
| 0.1 | 3.1 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.1 | 0.3 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.1 | 1.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 0.7 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.1 | 1.4 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.1 | 0.2 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 3.0 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.7 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.0 | 0.5 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.0 | 1.1 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 1.6 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 3.7 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.3 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.6 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 0.3 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.0 | 0.8 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.4 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.5 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.0 | 0.2 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.0 | 1.4 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.3 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.0 | 3.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 1.3 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.2 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 1.0 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 1.4 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.6 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.0 | 0.6 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.2 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.2 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 0.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.6 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.0 | 0.4 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 0.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 0.4 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.5 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.2 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 1.1 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.9 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.4 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
| 0.0 | 0.2 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 0.8 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.2 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.2 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.0 | 0.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.3 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.2 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 0.0 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.1 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.1 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.2 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.4 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.1 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.1 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.4 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |