avrg: 2D miR_HR1_12
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Gtf2i
|
ENSMUSG00000060261.9 | general transcription factor II I |
Gtf2f1
|
ENSMUSG00000002658.9 | general transcription factor IIF, polypeptide 1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Gtf2f1 | mm10_v2_chr17_-_57011271_57011326 | -0.84 | 5.8e-04 | Click! |
Gtf2i | mm10_v2_chr5_-_134314678_134314760 | -0.50 | 1.0e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr15_-_76521902 | 4.06 |
ENSMUST00000164703.1
ENSMUST00000096365.3 |
Scrt1
|
scratch homolog 1, zinc finger protein (Drosophila) |
chr16_-_42340595 | 3.42 |
ENSMUST00000102817.4
|
Gap43
|
growth associated protein 43 |
chr17_+_26933070 | 2.48 |
ENSMUST00000073724.5
|
Phf1
|
PHD finger protein 1 |
chr4_+_138454305 | 2.35 |
ENSMUST00000050918.3
|
Camk2n1
|
calcium/calmodulin-dependent protein kinase II inhibitor 1 |
chr16_+_20733104 | 2.33 |
ENSMUST00000115423.1
ENSMUST00000007171.6 |
Chrd
|
chordin |
chr2_-_94264713 | 2.26 |
ENSMUST00000129661.1
|
E530001K10Rik
|
RIKEN cDNA E530001K10 gene |
chr4_+_54947976 | 2.25 |
ENSMUST00000098070.3
|
Zfp462
|
zinc finger protein 462 |
chr5_+_30913398 | 2.14 |
ENSMUST00000031055.5
|
Emilin1
|
elastin microfibril interfacer 1 |
chr1_-_74885322 | 2.04 |
ENSMUST00000159232.1
ENSMUST00000068631.3 |
Fev
|
FEV (ETS oncogene family) |
chr17_+_37045980 | 2.02 |
ENSMUST00000174456.1
|
Gabbr1
|
gamma-aminobutyric acid (GABA) B receptor, 1 |
chr11_+_93098404 | 2.00 |
ENSMUST00000107859.1
ENSMUST00000042943.6 ENSMUST00000107861.1 ENSMUST00000107858.2 |
Car10
|
carbonic anhydrase 10 |
chr11_+_87760533 | 1.86 |
ENSMUST00000039627.5
ENSMUST00000100644.3 |
Bzrap1
|
benzodiazepine receptor associated protein 1 |
chr8_-_113848615 | 1.78 |
ENSMUST00000093113.4
|
Adamts18
|
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 18 |
chr6_-_48445825 | 1.77 |
ENSMUST00000114561.2
|
Zfp467
|
zinc finger protein 467 |
chr8_+_62951195 | 1.76 |
ENSMUST00000118003.1
|
Spock3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan 3 |
chrX_-_38252398 | 1.69 |
ENSMUST00000089056.3
ENSMUST00000089054.4 ENSMUST00000066498.7 |
Tmem255a
|
transmembrane protein 255A |
chr6_+_107529717 | 1.68 |
ENSMUST00000049285.8
|
Lrrn1
|
leucine rich repeat protein 1, neuronal |
chr11_+_69966896 | 1.65 |
ENSMUST00000151515.1
|
Cldn7
|
claudin 7 |
chr2_-_94264745 | 1.58 |
ENSMUST00000134563.1
|
E530001K10Rik
|
RIKEN cDNA E530001K10 gene |
chr11_+_96931387 | 1.58 |
ENSMUST00000107633.1
|
Prr15l
|
proline rich 15-like |
chr11_+_95009852 | 1.56 |
ENSMUST00000055947.3
|
Samd14
|
sterile alpha motif domain containing 14 |
chrX_+_142681398 | 1.56 |
ENSMUST00000112889.1
ENSMUST00000101198.2 ENSMUST00000112891.1 ENSMUST00000087333.2 |
Tmem164
|
transmembrane protein 164 |
chr15_+_10358556 | 1.54 |
ENSMUST00000022858.7
|
Agxt2
|
alanine-glyoxylate aminotransferase 2 |
chr7_+_127712709 | 1.54 |
ENSMUST00000047393.5
|
Ctf1
|
cardiotrophin 1 |
chr6_-_48445678 | 1.54 |
ENSMUST00000114556.1
|
Zfp467
|
zinc finger protein 467 |
chr3_+_159839729 | 1.53 |
ENSMUST00000068952.5
|
Wls
|
wntless homolog (Drosophila) |
chr11_-_69605829 | 1.53 |
ENSMUST00000047889.6
|
Atp1b2
|
ATPase, Na+/K+ transporting, beta 2 polypeptide |
chr9_+_50575273 | 1.50 |
ENSMUST00000059081.6
ENSMUST00000180021.1 |
Il18
|
interleukin 18 |
chr2_-_164857671 | 1.50 |
ENSMUST00000059954.7
|
Pltp
|
phospholipid transfer protein |
chr15_-_75567176 | 1.49 |
ENSMUST00000156032.1
ENSMUST00000127095.1 |
Ly6h
|
lymphocyte antigen 6 complex, locus H |
chr2_-_129699833 | 1.46 |
ENSMUST00000028883.5
|
Pdyn
|
prodynorphin |
chr9_+_104569671 | 1.46 |
ENSMUST00000057742.8
|
Cpne4
|
copine IV |
chr1_-_168431896 | 1.44 |
ENSMUST00000176540.1
|
Pbx1
|
pre B cell leukemia homeobox 1 |
chr6_-_48445373 | 1.40 |
ENSMUST00000114563.1
ENSMUST00000114558.1 ENSMUST00000101443.3 ENSMUST00000114564.1 |
Zfp467
|
zinc finger protein 467 |
chr9_+_104569754 | 1.40 |
ENSMUST00000077190.6
|
Cpne4
|
copine IV |
chrX_+_8271381 | 1.39 |
ENSMUST00000033512.4
|
Slc38a5
|
solute carrier family 38, member 5 |
chr11_-_97699634 | 1.39 |
ENSMUST00000103148.1
ENSMUST00000169807.1 |
Pcgf2
|
polycomb group ring finger 2 |
chr16_-_22439570 | 1.37 |
ENSMUST00000170393.1
|
Etv5
|
ets variant gene 5 |
chr8_+_62951361 | 1.37 |
ENSMUST00000119068.1
|
Spock3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan 3 |
chr14_-_124677089 | 1.36 |
ENSMUST00000095529.3
|
Fgf14
|
fibroblast growth factor 14 |
chr12_-_11436607 | 1.36 |
ENSMUST00000072299.5
|
Vsnl1
|
visinin-like 1 |
chr14_-_46390501 | 1.36 |
ENSMUST00000100676.2
|
Bmp4
|
bone morphogenetic protein 4 |
chr1_-_134235420 | 1.36 |
ENSMUST00000038191.6
ENSMUST00000086465.4 |
Adora1
|
adenosine A1 receptor |
chr14_+_70890099 | 1.35 |
ENSMUST00000022699.8
|
Gfra2
|
glial cell line derived neurotrophic factor family receptor alpha 2 |
chr7_+_44310213 | 1.34 |
ENSMUST00000107938.1
|
Shank1
|
SH3/ankyrin domain gene 1 |
chr5_+_57718021 | 1.34 |
ENSMUST00000094783.3
ENSMUST00000068110.7 |
Pcdh7
|
protocadherin 7 |
chr11_-_69560186 | 1.33 |
ENSMUST00000004036.5
|
Efnb3
|
ephrin B3 |
chr15_+_10358525 | 1.32 |
ENSMUST00000110540.1
ENSMUST00000110541.1 ENSMUST00000110542.1 |
Agxt2
|
alanine-glyoxylate aminotransferase 2 |
chr11_+_93099284 | 1.31 |
ENSMUST00000092780.3
ENSMUST00000107863.2 |
Car10
|
carbonic anhydrase 10 |
chr17_+_37046555 | 1.29 |
ENSMUST00000172789.1
|
Gabbr1
|
gamma-aminobutyric acid (GABA) B receptor, 1 |
chr15_-_100599983 | 1.29 |
ENSMUST00000073837.6
|
Pou6f1
|
POU domain, class 6, transcription factor 1 |
chrX_+_164162167 | 1.25 |
ENSMUST00000131543.1
|
Ace2
|
angiotensin I converting enzyme (peptidyl-dipeptidase A) 2 |
chr7_+_140093388 | 1.24 |
ENSMUST00000026540.8
|
Prap1
|
proline-rich acidic protein 1 |
chr4_+_139380658 | 1.23 |
ENSMUST00000165860.1
ENSMUST00000097822.3 |
Ubr4
|
ubiquitin protein ligase E3 component n-recognin 4 |
chr3_-_89387132 | 1.22 |
ENSMUST00000107433.1
|
Zbtb7b
|
zinc finger and BTB domain containing 7B |
chr16_+_38089001 | 1.21 |
ENSMUST00000023507.6
|
Gsk3b
|
glycogen synthase kinase 3 beta |
chr7_-_100662315 | 1.20 |
ENSMUST00000151123.1
ENSMUST00000107047.2 |
Plekhb1
|
pleckstrin homology domain containing, family B (evectins) member 1 |
chr11_-_114795888 | 1.20 |
ENSMUST00000000206.3
|
Btbd17
|
BTB (POZ) domain containing 17 |
chr9_+_120539801 | 1.18 |
ENSMUST00000047687.7
|
Entpd3
|
ectonucleoside triphosphate diphosphohydrolase 3 |
chr5_+_30588078 | 1.18 |
ENSMUST00000066295.2
|
Kcnk3
|
potassium channel, subfamily K, member 3 |
chr4_-_148500449 | 1.17 |
ENSMUST00000030840.3
|
Angptl7
|
angiopoietin-like 7 |
chr14_+_55854115 | 1.16 |
ENSMUST00000168479.1
|
Nynrin
|
NYN domain and retroviral integrase containing |
chr1_-_172206684 | 1.14 |
ENSMUST00000155109.1
|
Pea15a
|
phosphoprotein enriched in astrocytes 15A |
chr1_+_188953744 | 1.13 |
ENSMUST00000127077.1
|
Ush2a
|
Usher syndrome 2A (autosomal recessive, mild) |
chr3_-_90465858 | 1.13 |
ENSMUST00000029540.6
|
Npr1
|
natriuretic peptide receptor 1 |
chr7_-_4546567 | 1.12 |
ENSMUST00000065957.5
|
Syt5
|
synaptotagmin V |
chr11_+_75193783 | 1.12 |
ENSMUST00000102514.3
|
Rtn4rl1
|
reticulon 4 receptor-like 1 |
chr7_-_127824469 | 1.10 |
ENSMUST00000106267.3
|
Stx1b
|
syntaxin 1B |
chr16_-_22439719 | 1.09 |
ENSMUST00000079601.6
|
Etv5
|
ets variant gene 5 |
chr14_-_46390576 | 1.09 |
ENSMUST00000074077.5
|
Bmp4
|
bone morphogenetic protein 4 |
chr6_+_55336424 | 1.09 |
ENSMUST00000004774.3
|
Aqp1
|
aquaporin 1 |
chr2_-_181314500 | 1.08 |
ENSMUST00000103045.3
|
Stmn3
|
stathmin-like 3 |
chr7_+_45705088 | 1.08 |
ENSMUST00000080885.3
|
Dbp
|
D site albumin promoter binding protein |
chr11_-_100939540 | 1.08 |
ENSMUST00000127638.1
|
Stat3
|
signal transducer and activator of transcription 3 |
chr13_-_99900645 | 1.06 |
ENSMUST00000022150.6
|
Cartpt
|
CART prepropeptide |
chr11_+_95010277 | 1.05 |
ENSMUST00000124735.1
|
Samd14
|
sterile alpha motif domain containing 14 |
chr14_-_52316323 | 1.05 |
ENSMUST00000135523.1
|
Sall2
|
sal-like 2 (Drosophila) |
chr17_+_8801742 | 1.05 |
ENSMUST00000089085.2
|
Pde10a
|
phosphodiesterase 10A |
chr15_-_84447037 | 1.04 |
ENSMUST00000080751.2
|
1810041L15Rik
|
RIKEN cDNA 1810041L15 gene |
chr6_+_45060036 | 1.03 |
ENSMUST00000114641.1
|
Cntnap2
|
contactin associated protein-like 2 |
chr5_+_137288273 | 1.02 |
ENSMUST00000024099.4
ENSMUST00000085934.3 |
Ache
|
acetylcholinesterase |
chr8_-_90348126 | 1.01 |
ENSMUST00000176034.1
ENSMUST00000176616.1 |
Tox3
|
TOX high mobility group box family member 3 |
chrX_+_93286499 | 1.00 |
ENSMUST00000046565.7
ENSMUST00000113947.2 |
Arx
|
aristaless related homeobox |
chr7_-_143460989 | 0.99 |
ENSMUST00000167912.1
ENSMUST00000037287.6 |
Cdkn1c
|
cyclin-dependent kinase inhibitor 1C (P57) |
chrX_+_8271133 | 0.98 |
ENSMUST00000127103.1
ENSMUST00000115591.1 |
Slc38a5
|
solute carrier family 38, member 5 |
chr3_-_89393294 | 0.98 |
ENSMUST00000142119.1
ENSMUST00000029677.8 ENSMUST00000148361.1 |
Zbtb7b
|
zinc finger and BTB domain containing 7B |
chr5_-_139814025 | 0.98 |
ENSMUST00000146780.1
|
Tmem184a
|
transmembrane protein 184a |
chr11_+_69765970 | 0.97 |
ENSMUST00000108642.1
ENSMUST00000156932.1 |
Zbtb4
|
zinc finger and BTB domain containing 4 |
chr8_-_89044162 | 0.97 |
ENSMUST00000034090.6
|
Sall1
|
sal-like 1 (Drosophila) |
chrX_+_48343758 | 0.96 |
ENSMUST00000037596.6
|
Bcorl1
|
BCL6 co-repressor-like 1 |
chrX_+_8271642 | 0.96 |
ENSMUST00000115590.1
|
Slc38a5
|
solute carrier family 38, member 5 |
chr7_-_126949499 | 0.95 |
ENSMUST00000106339.1
ENSMUST00000052937.5 |
Asphd1
|
aspartate beta-hydroxylase domain containing 1 |
chr14_-_29721835 | 0.95 |
ENSMUST00000022567.7
|
Cacna2d3
|
calcium channel, voltage-dependent, alpha2/delta subunit 3 |
chr15_-_102257306 | 0.94 |
ENSMUST00000135466.1
|
Rarg
|
retinoic acid receptor, gamma |
chr7_+_141079759 | 0.94 |
ENSMUST00000066873.4
ENSMUST00000163041.1 |
Pkp3
|
plakophilin 3 |
chr4_+_141239499 | 0.94 |
ENSMUST00000141834.2
|
Arhgef19
|
Rho guanine nucleotide exchange factor (GEF) 19 |
chr9_+_78230644 | 0.94 |
ENSMUST00000098537.3
|
Gsta1
|
glutathione S-transferase, alpha 1 (Ya) |
chr1_-_172206775 | 0.93 |
ENSMUST00000013842.5
ENSMUST00000111247.1 |
Pea15a
|
phosphoprotein enriched in astrocytes 15A |
chr15_-_55906917 | 0.93 |
ENSMUST00000039769.5
|
Sntb1
|
syntrophin, basic 1 |
chr5_-_44799643 | 0.92 |
ENSMUST00000070748.5
|
Ldb2
|
LIM domain binding 2 |
chr2_+_79635416 | 0.91 |
ENSMUST00000111788.1
|
Ssfa2
|
sperm specific antigen 2 |
chr12_-_84698769 | 0.90 |
ENSMUST00000095550.2
|
Syndig1l
|
synapse differentiation inducing 1 like |
chr11_+_69120404 | 0.90 |
ENSMUST00000024543.2
|
Hes7
|
hairy and enhancer of split 7 (Drosophila) |
chr11_-_100939457 | 0.87 |
ENSMUST00000138438.1
|
Stat3
|
signal transducer and activator of transcription 3 |
chr5_-_122989260 | 0.87 |
ENSMUST00000118027.1
|
Kdm2b
|
lysine (K)-specific demethylase 2B |
chr2_+_79635352 | 0.86 |
ENSMUST00000111785.2
|
Ssfa2
|
sperm specific antigen 2 |
chr5_-_113015473 | 0.86 |
ENSMUST00000065167.4
|
Adrbk2
|
adrenergic receptor kinase, beta 2 |
chr5_-_139814231 | 0.85 |
ENSMUST00000044002.4
|
Tmem184a
|
transmembrane protein 184a |
chr8_-_90908415 | 0.84 |
ENSMUST00000098517.1
|
Gm6658
|
predicted gene 6658 |
chr7_+_113207465 | 0.83 |
ENSMUST00000047321.7
|
Arntl
|
aryl hydrocarbon receptor nuclear translocator-like |
chr9_+_59589288 | 0.83 |
ENSMUST00000121266.1
ENSMUST00000118164.1 |
Celf6
|
CUGBP, Elav-like family member 6 |
chr6_+_125321409 | 0.83 |
ENSMUST00000176442.1
ENSMUST00000177329.1 |
Scnn1a
|
sodium channel, nonvoltage-gated 1 alpha |
chr15_-_79164477 | 0.83 |
ENSMUST00000040019.4
|
Sox10
|
SRY-box containing gene 10 |
chr5_-_134747241 | 0.83 |
ENSMUST00000015138.9
|
Eln
|
elastin |
chr2_+_143546144 | 0.83 |
ENSMUST00000028905.9
|
Pcsk2
|
proprotein convertase subtilisin/kexin type 2 |
chr5_+_107403496 | 0.82 |
ENSMUST00000049146.5
|
Ephx4
|
epoxide hydrolase 4 |
chr11_-_102296618 | 0.82 |
ENSMUST00000107132.2
ENSMUST00000073234.2 |
Atxn7l3
|
ataxin 7-like 3 |
chr2_-_164857542 | 0.82 |
ENSMUST00000109316.1
ENSMUST00000156255.1 ENSMUST00000128110.1 ENSMUST00000109317.3 |
Pltp
|
phospholipid transfer protein |
chr1_+_131599239 | 0.82 |
ENSMUST00000027690.6
|
Avpr1b
|
arginine vasopressin receptor 1B |
chr15_+_57694651 | 0.81 |
ENSMUST00000096430.4
|
Zhx2
|
zinc fingers and homeoboxes 2 |
chr4_+_41762309 | 0.81 |
ENSMUST00000108042.2
|
Il11ra1
|
interleukin 11 receptor, alpha chain 1 |
chr13_+_42709482 | 0.81 |
ENSMUST00000066928.5
ENSMUST00000148891.1 |
Phactr1
|
phosphatase and actin regulator 1 |
chr14_+_59625281 | 0.79 |
ENSMUST00000053949.5
|
Shisa2
|
shisa homolog 2 (Xenopus laevis) |
chr4_+_43046014 | 0.79 |
ENSMUST00000180426.1
|
Gm26881
|
predicted gene, 26881 |
chr6_-_52191695 | 0.78 |
ENSMUST00000101395.2
|
Hoxa4
|
homeobox A4 |
chr11_+_98664341 | 0.78 |
ENSMUST00000017348.2
|
Gsdma
|
gasdermin A |
chr8_-_90348343 | 0.78 |
ENSMUST00000109621.3
|
Tox3
|
TOX high mobility group box family member 3 |
chr11_-_100939357 | 0.78 |
ENSMUST00000092671.5
ENSMUST00000103114.1 |
Stat3
|
signal transducer and activator of transcription 3 |
chr7_-_4164796 | 0.77 |
ENSMUST00000076831.6
|
Cdc42ep5
|
CDC42 effector protein (Rho GTPase binding) 5 |
chr5_+_30281377 | 0.77 |
ENSMUST00000101448.3
|
Drc1
|
dynein regulatory complex subunit 1 |
chr5_+_102845007 | 0.76 |
ENSMUST00000070000.4
|
Arhgap24
|
Rho GTPase activating protein 24 |
chr6_-_55175019 | 0.76 |
ENSMUST00000003569.5
|
Inmt
|
indolethylamine N-methyltransferase |
chr3_-_27710413 | 0.75 |
ENSMUST00000046157.4
|
Fndc3b
|
fibronectin type III domain containing 3B |
chr11_+_117484368 | 0.75 |
ENSMUST00000092394.3
|
Gm11733
|
predicted gene 11733 |
chr17_+_37045963 | 0.74 |
ENSMUST00000025338.9
|
Gabbr1
|
gamma-aminobutyric acid (GABA) B receptor, 1 |
chr7_+_25268387 | 0.74 |
ENSMUST00000169392.1
|
Cic
|
capicua homolog (Drosophila) |
chr16_-_74411292 | 0.74 |
ENSMUST00000117200.1
|
Robo2
|
roundabout homolog 2 (Drosophila) |
chr10_+_42583787 | 0.74 |
ENSMUST00000105497.1
ENSMUST00000144806.1 |
Ostm1
|
osteopetrosis associated transmembrane protein 1 |
chr16_-_74411776 | 0.74 |
ENSMUST00000116586.2
|
Robo2
|
roundabout homolog 2 (Drosophila) |
chr11_-_101175440 | 0.74 |
ENSMUST00000062759.3
|
Ccr10
|
chemokine (C-C motif) receptor 10 |
chr6_+_125321333 | 0.73 |
ENSMUST00000081440.7
|
Scnn1a
|
sodium channel, nonvoltage-gated 1 alpha |
chr6_-_56362356 | 0.73 |
ENSMUST00000044505.7
ENSMUST00000166102.1 ENSMUST00000164037.1 ENSMUST00000114327.2 |
Pde1c
|
phosphodiesterase 1C |
chr11_+_101176041 | 0.73 |
ENSMUST00000103109.3
|
Cntnap1
|
contactin associated protein-like 1 |
chr14_+_51984857 | 0.72 |
ENSMUST00000100639.4
ENSMUST00000182909.1 ENSMUST00000182760.1 ENSMUST00000182061.1 ENSMUST00000182193.1 |
Arhgef40
|
Rho guanine nucleotide exchange factor (GEF) 40 |
chr7_+_19094594 | 0.72 |
ENSMUST00000049454.5
|
Six5
|
sine oculis-related homeobox 5 |
chr6_-_113343975 | 0.72 |
ENSMUST00000155543.1
ENSMUST00000032409.8 |
Camk1
|
calcium/calmodulin-dependent protein kinase I |
chr7_-_44816586 | 0.72 |
ENSMUST00000047356.8
|
Atf5
|
activating transcription factor 5 |
chr12_-_12941827 | 0.72 |
ENSMUST00000043396.7
|
Mycn
|
v-myc myelocytomatosis viral related oncogene, neuroblastoma derived (avian) |
chr13_-_3945349 | 0.72 |
ENSMUST00000058610.7
|
Ucn3
|
urocortin 3 |
chr18_+_75820174 | 0.72 |
ENSMUST00000058997.7
|
Zbtb7c
|
zinc finger and BTB domain containing 7C |
chr2_+_129592914 | 0.71 |
ENSMUST00000103203.1
|
Sirpa
|
signal-regulatory protein alpha |
chr1_-_168432270 | 0.71 |
ENSMUST00000072863.4
|
Pbx1
|
pre B cell leukemia homeobox 1 |
chr3_+_97032416 | 0.71 |
ENSMUST00000132256.1
ENSMUST00000072600.6 |
Gja5
|
gap junction protein, alpha 5 |
chr11_-_69695802 | 0.71 |
ENSMUST00000108649.1
ENSMUST00000174159.1 ENSMUST00000181810.1 |
BC096441
Tnfsf12
|
cDNA sequence BC096441 tumor necrosis factor (ligand) superfamily, member 12 |
chr19_+_5474681 | 0.71 |
ENSMUST00000165485.1
ENSMUST00000166253.1 ENSMUST00000167371.1 ENSMUST00000167855.1 ENSMUST00000070118.7 |
Efemp2
|
epidermal growth factor-containing fibulin-like extracellular matrix protein 2 |
chr4_-_43045686 | 0.71 |
ENSMUST00000107956.1
ENSMUST00000107957.1 |
Fam214b
|
family with sequence similarity 214, member B |
chr4_+_133011506 | 0.70 |
ENSMUST00000105915.1
ENSMUST00000105916.1 |
Ahdc1
|
AT hook, DNA binding motif, containing 1 |
chr11_+_104132841 | 0.70 |
ENSMUST00000093925.4
|
Crhr1
|
corticotropin releasing hormone receptor 1 |
chr5_-_100719675 | 0.70 |
ENSMUST00000112908.1
ENSMUST00000045617.8 |
Hpse
|
heparanase |
chr1_-_158958367 | 0.70 |
ENSMUST00000159861.2
|
Pappa2
|
pappalysin 2 |
chr17_-_91092715 | 0.70 |
ENSMUST00000160800.2
ENSMUST00000159778.1 ENSMUST00000160844.3 |
Nrxn1
|
neurexin I |
chr15_-_75566608 | 0.70 |
ENSMUST00000163116.1
ENSMUST00000023241.5 |
Ly6h
|
lymphocyte antigen 6 complex, locus H |
chr18_-_60648290 | 0.70 |
ENSMUST00000143275.2
|
Synpo
|
synaptopodin |
chr4_-_43046196 | 0.69 |
ENSMUST00000036462.5
|
Fam214b
|
family with sequence similarity 214, member B |
chr5_-_36398090 | 0.69 |
ENSMUST00000037370.7
ENSMUST00000070720.6 |
Sorcs2
|
sortilin-related VPS10 domain containing receptor 2 |
chr11_+_16752203 | 0.69 |
ENSMUST00000102884.3
ENSMUST00000020329.6 |
Egfr
|
epidermal growth factor receptor |
chr2_+_91082362 | 0.69 |
ENSMUST00000169852.1
|
Spi1
|
spleen focus forming virus (SFFV) proviral integration oncogene |
chr11_+_115154139 | 0.69 |
ENSMUST00000021076.5
|
Rab37
|
RAB37, member of RAS oncogene family |
chr12_+_112678803 | 0.68 |
ENSMUST00000174780.1
ENSMUST00000169593.1 ENSMUST00000173942.1 |
Zbtb42
|
zinc finger and BTB domain containing 42 |
chr17_+_33919332 | 0.68 |
ENSMUST00000025161.7
|
Tapbp
|
TAP binding protein |
chr2_-_59160644 | 0.68 |
ENSMUST00000077687.5
|
Ccdc148
|
coiled-coil domain containing 148 |
chr3_+_89421619 | 0.68 |
ENSMUST00000094378.3
ENSMUST00000137793.1 |
Shc1
|
src homology 2 domain-containing transforming protein C1 |
chr11_-_94474088 | 0.68 |
ENSMUST00000107786.1
ENSMUST00000107791.1 ENSMUST00000103166.2 ENSMUST00000107792.1 ENSMUST00000100561.3 ENSMUST00000107793.1 ENSMUST00000107788.1 ENSMUST00000107790.1 ENSMUST00000107789.1 ENSMUST00000107785.1 ENSMUST00000021234.8 |
Cacna1g
|
calcium channel, voltage-dependent, T type, alpha 1G subunit |
chr2_+_169633517 | 0.68 |
ENSMUST00000109157.1
|
Tshz2
|
teashirt zinc finger family member 2 |
chr10_-_30842765 | 0.67 |
ENSMUST00000019924.8
|
Hey2
|
hairy/enhancer-of-split related with YRPW motif 2 |
chr7_-_100932140 | 0.67 |
ENSMUST00000107032.1
|
Arhgef17
|
Rho guanine nucleotide exchange factor (GEF) 17 |
chr1_+_195017399 | 0.67 |
ENSMUST00000181273.1
|
A330023F24Rik
|
RIKEN cDNA A330023F24 gene |
chr11_+_105292637 | 0.67 |
ENSMUST00000100335.3
ENSMUST00000021038.4 |
Mrc2
|
mannose receptor, C type 2 |
chr6_-_122340499 | 0.66 |
ENSMUST00000160843.1
|
Phc1
|
polyhomeotic-like 1 (Drosophila) |
chr1_-_184033998 | 0.66 |
ENSMUST00000050306.5
|
1700056E22Rik
|
RIKEN cDNA 1700056E22 gene |
chr5_+_119670658 | 0.66 |
ENSMUST00000079719.4
|
Tbx3
|
T-box 3 |
chr2_+_103970221 | 0.66 |
ENSMUST00000111140.2
ENSMUST00000111139.2 |
Lmo2
|
LIM domain only 2 |
chr13_-_92131494 | 0.66 |
ENSMUST00000099326.3
ENSMUST00000146492.1 |
Rasgrf2
|
RAS protein-specific guanine nucleotide-releasing factor 2 |
chr9_+_22071002 | 0.66 |
ENSMUST00000180419.1
|
Gm16845
|
predicted gene, 16845 |
chr8_+_54077532 | 0.66 |
ENSMUST00000033919.4
|
Vegfc
|
vascular endothelial growth factor C |
chr11_+_117115133 | 0.66 |
ENSMUST00000021177.8
|
Sec14l1
|
SEC14-like 1 (S. cerevisiae) |
chr3_-_89393629 | 0.65 |
ENSMUST00000124783.1
ENSMUST00000126027.1 |
Zbtb7b
|
zinc finger and BTB domain containing 7B |
chr2_+_70562854 | 0.65 |
ENSMUST00000130998.1
|
Gad1
|
glutamate decarboxylase 1 |
chrX_+_103356464 | 0.65 |
ENSMUST00000116547.2
|
Chic1
|
cysteine-rich hydrophobic domain 1 |
chr6_+_125009113 | 0.65 |
ENSMUST00000054553.4
|
Zfp384
|
zinc finger protein 384 |
chr6_+_125009232 | 0.65 |
ENSMUST00000112428.1
|
Zfp384
|
zinc finger protein 384 |
chr11_-_96824008 | 0.64 |
ENSMUST00000142065.1
ENSMUST00000167110.1 ENSMUST00000169828.1 ENSMUST00000126949.1 |
Nfe2l1
|
nuclear factor, erythroid derived 2,-like 1 |
chr4_+_41760454 | 0.64 |
ENSMUST00000108040.1
|
Il11ra1
|
interleukin 11 receptor, alpha chain 1 |
chr7_-_19166119 | 0.64 |
ENSMUST00000094790.3
|
Gipr
|
gastric inhibitory polypeptide receptor |
chr14_+_51984826 | 0.64 |
ENSMUST00000093813.5
|
Arhgef40
|
Rho guanine nucleotide exchange factor (GEF) 40 |
chr15_-_102257449 | 0.64 |
ENSMUST00000043172.8
|
Rarg
|
retinoic acid receptor, gamma |
chr11_-_95076797 | 0.64 |
ENSMUST00000145671.1
ENSMUST00000120375.1 |
Itga3
|
integrin alpha 3 |
chr13_+_96542602 | 0.63 |
ENSMUST00000179226.1
|
Col4a3bp
|
collagen, type IV, alpha 3 (Goodpasture antigen) binding protein |
chr18_-_16809233 | 0.63 |
ENSMUST00000025166.7
|
Cdh2
|
cadherin 2 |
chr13_+_38345716 | 0.63 |
ENSMUST00000171970.1
|
Bmp6
|
bone morphogenetic protein 6 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 2.9 | GO:0009436 | glyoxylate catabolic process(GO:0009436) L-alanine metabolic process(GO:0042851) |
0.8 | 2.5 | GO:1905072 | cardiac jelly development(GO:1905072) |
0.8 | 6.4 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.7 | 2.9 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
0.7 | 2.7 | GO:1902728 | positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
0.6 | 4.3 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.6 | 1.7 | GO:0061357 | positive regulation of Wnt protein secretion(GO:0061357) |
0.5 | 1.6 | GO:0060932 | atrioventricular bundle cell differentiation(GO:0003167) His-Purkinje system cell differentiation(GO:0060932) |
0.5 | 2.1 | GO:1903288 | positive regulation of potassium ion import(GO:1903288) |
0.5 | 1.5 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
0.5 | 2.0 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) |
0.5 | 2.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.5 | 1.4 | GO:0042323 | positive regulation of nucleobase-containing compound transport(GO:0032241) regulation of nucleoside transport(GO:0032242) negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
0.4 | 1.8 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
0.4 | 2.2 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.4 | 2.2 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.4 | 1.3 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.4 | 2.1 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.4 | 1.2 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
0.4 | 0.8 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.4 | 1.1 | GO:0021759 | globus pallidus development(GO:0021759) |
0.4 | 1.1 | GO:0035377 | transepithelial water transport(GO:0035377) |
0.4 | 1.1 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
0.4 | 2.1 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.3 | 1.4 | GO:0090126 | protein complex assembly involved in synapse maturation(GO:0090126) |
0.3 | 1.6 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.3 | 0.3 | GO:0036395 | pancreatic amylase secretion(GO:0036395) regulation of pancreatic amylase secretion(GO:1902276) |
0.3 | 0.3 | GO:0086048 | membrane depolarization during bundle of His cell action potential(GO:0086048) |
0.3 | 1.3 | GO:0015801 | aromatic amino acid transport(GO:0015801) tryptophan transport(GO:0015827) |
0.3 | 1.9 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.3 | 2.8 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.3 | 0.9 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.3 | 1.8 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.3 | 1.5 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.3 | 0.3 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
0.3 | 0.9 | GO:0046021 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
0.3 | 1.1 | GO:1904451 | regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
0.3 | 1.4 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.3 | 2.5 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.3 | 1.1 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.3 | 0.8 | GO:0046968 | positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) peptide antigen transport(GO:0046968) |
0.3 | 1.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.3 | 3.0 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.3 | 1.4 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.3 | 1.3 | GO:0051012 | microtubule sliding(GO:0051012) |
0.3 | 1.1 | GO:1904048 | regulation of spontaneous neurotransmitter secretion(GO:1904048) |
0.3 | 1.3 | GO:0002159 | desmosome assembly(GO:0002159) |
0.3 | 1.0 | GO:1905167 | positive regulation of lysosomal protein catabolic process(GO:1905167) |
0.3 | 1.3 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.3 | 0.8 | GO:0010814 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
0.2 | 1.5 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.2 | 0.2 | GO:1900170 | negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
0.2 | 1.4 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.2 | 0.7 | GO:1902530 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
0.2 | 2.2 | GO:0046959 | habituation(GO:0046959) |
0.2 | 2.2 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.2 | 3.5 | GO:0015816 | glycine transport(GO:0015816) |
0.2 | 1.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.2 | 1.9 | GO:0051611 | regulation of serotonin uptake(GO:0051611) |
0.2 | 0.4 | GO:0015675 | nickel cation transport(GO:0015675) |
0.2 | 0.4 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.2 | 0.8 | GO:0030070 | insulin processing(GO:0030070) |
0.2 | 0.6 | GO:0072138 | mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
0.2 | 0.8 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.2 | 0.4 | GO:0034443 | regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) |
0.2 | 0.8 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.2 | 1.2 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.2 | 0.6 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.2 | 1.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.2 | 0.8 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
0.2 | 1.0 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.2 | 0.4 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.2 | 0.6 | GO:0061090 | positive regulation of sequestering of zinc ion(GO:0061090) |
0.2 | 0.6 | GO:2000016 | negative regulation of determination of dorsal identity(GO:2000016) |
0.2 | 0.4 | GO:0035483 | gastric emptying(GO:0035483) |
0.2 | 0.4 | GO:0031959 | mineralocorticoid receptor signaling pathway(GO:0031959) |
0.2 | 0.9 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.2 | 0.2 | GO:0051610 | serotonin uptake(GO:0051610) |
0.2 | 1.1 | GO:0099525 | presynaptic dense core granule exocytosis(GO:0099525) |
0.2 | 0.5 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.2 | 0.9 | GO:0060849 | regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
0.2 | 0.5 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
0.2 | 0.5 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.2 | 0.4 | GO:0003431 | growth plate cartilage chondrocyte differentiation(GO:0003418) growth plate cartilage chondrocyte development(GO:0003431) |
0.2 | 0.7 | GO:0098886 | modification of dendritic spine(GO:0098886) |
0.2 | 0.9 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.2 | 0.7 | GO:0070459 | prolactin secretion(GO:0070459) |
0.2 | 0.8 | GO:1990839 | response to endothelin(GO:1990839) |
0.2 | 0.7 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.2 | 1.2 | GO:0072086 | specification of loop of Henle identity(GO:0072086) |
0.2 | 0.5 | GO:0006710 | androgen catabolic process(GO:0006710) estradiol secretion(GO:0035938) regulation of estradiol secretion(GO:2000864) |
0.2 | 0.8 | GO:0042938 | dipeptide transport(GO:0042938) |
0.2 | 0.3 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.2 | 0.5 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
0.2 | 0.7 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.2 | 0.5 | GO:1904978 | regulation of endosome organization(GO:1904978) positive regulation of endosome organization(GO:1904980) |
0.2 | 0.6 | GO:0090194 | negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
0.2 | 0.5 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
0.2 | 1.0 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
0.2 | 0.5 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.2 | 0.2 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.2 | 2.3 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
0.2 | 0.6 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.1 | 1.2 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.1 | GO:2000295 | regulation of hydrogen peroxide catabolic process(GO:2000295) |
0.1 | 0.4 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
0.1 | 0.4 | GO:1904306 | positive regulation of eating behavior(GO:1904000) positive regulation of gastro-intestinal system smooth muscle contraction(GO:1904306) positive regulation of small intestine smooth muscle contraction(GO:1904349) |
0.1 | 0.7 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.1 | 1.2 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
0.1 | 0.9 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.1 | 0.4 | GO:1903048 | regulation of acetylcholine-gated cation channel activity(GO:1903048) |
0.1 | 0.4 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.1 | 0.6 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
0.1 | 0.4 | GO:0035585 | calcium-mediated signaling using extracellular calcium source(GO:0035585) |
0.1 | 0.7 | GO:1905169 | protein localization to phagocytic vesicle(GO:1905161) regulation of protein localization to phagocytic vesicle(GO:1905169) positive regulation of protein localization to phagocytic vesicle(GO:1905171) |
0.1 | 0.4 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.1 | 0.4 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
0.1 | 0.8 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.4 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.1 | 0.4 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) regulation of establishment of T cell polarity(GO:1903903) |
0.1 | 0.1 | GO:0038190 | neuropilin signaling pathway(GO:0038189) VEGF-activated neuropilin signaling pathway(GO:0038190) positive regulation of retinal ganglion cell axon guidance(GO:1902336) |
0.1 | 0.4 | GO:0098976 | excitatory chemical synaptic transmission(GO:0098976) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
0.1 | 0.3 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
0.1 | 0.4 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.1 | 0.5 | GO:1903575 | cornified envelope assembly(GO:1903575) |
0.1 | 0.4 | GO:0060005 | vestibular reflex(GO:0060005) |
0.1 | 0.9 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.1 | 0.5 | GO:0061386 | closure of optic fissure(GO:0061386) |
0.1 | 0.7 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.1 | 0.1 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.1 | 0.6 | GO:0032915 | positive regulation of transforming growth factor beta2 production(GO:0032915) |
0.1 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.2 | GO:0002476 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) |
0.1 | 0.5 | GO:1904936 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
0.1 | 0.2 | GO:1902568 | positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
0.1 | 0.1 | GO:1902996 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.1 | 0.5 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.1 | 0.6 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.1 | 3.0 | GO:0095500 | acetylcholine receptor signaling pathway(GO:0095500) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
0.1 | 0.8 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.1 | 0.8 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.1 | 0.4 | GO:0001978 | regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.1 | 0.4 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.1 | 0.9 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.1 | 0.8 | GO:0002483 | antigen processing and presentation of endogenous peptide antigen(GO:0002483) antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
0.1 | 0.7 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.3 | GO:0035666 | TRIF-dependent toll-like receptor signaling pathway(GO:0035666) |
0.1 | 0.1 | GO:0048382 | mesendoderm development(GO:0048382) |
0.1 | 0.4 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.1 | 0.3 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.1 | 0.6 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.1 | 0.4 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
0.1 | 0.6 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.1 | 0.6 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
0.1 | 0.4 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.1 | 0.3 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) |
0.1 | 0.1 | GO:0032962 | positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
0.1 | 0.7 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.1 | 0.5 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.1 | 0.2 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
0.1 | 0.7 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.1 | 1.5 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.1 | 1.1 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.1 | 0.3 | GO:0098971 | anterograde dendritic transport of neurotransmitter receptor complex(GO:0098971) |
0.1 | 0.5 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.1 | 1.9 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.1 | 0.3 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
0.1 | 0.6 | GO:0061312 | BMP signaling pathway involved in heart development(GO:0061312) |
0.1 | 0.6 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
0.1 | 0.3 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.1 | 0.3 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
0.1 | 1.0 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.1 | 0.7 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.1 | 0.9 | GO:0071231 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) cellular response to folic acid(GO:0071231) |
0.1 | 0.3 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 1.3 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.1 | 0.2 | GO:0010808 | positive regulation of synaptic vesicle priming(GO:0010808) |
0.1 | 0.3 | GO:0090649 | response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
0.1 | 0.6 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.3 | GO:0035799 | ureter maturation(GO:0035799) |
0.1 | 0.2 | GO:1902022 | L-lysine transport(GO:1902022) |
0.1 | 0.6 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.1 | 0.3 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
0.1 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.1 | 0.3 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.1 | 0.4 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.1 | GO:2001045 | negative regulation of integrin-mediated signaling pathway(GO:2001045) |
0.1 | 0.2 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.1 | 0.4 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.1 | 0.7 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.1 | 0.7 | GO:0043084 | penile erection(GO:0043084) |
0.1 | 1.2 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.1 | 0.5 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
0.1 | 4.9 | GO:2001222 | regulation of neuron migration(GO:2001222) |
0.1 | 1.4 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.1 | 0.2 | GO:2000847 | negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.1 | 0.6 | GO:1904672 | regulation of somatic stem cell population maintenance(GO:1904672) |
0.1 | 0.6 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
0.1 | 1.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.2 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.1 | 0.4 | GO:0061056 | sclerotome development(GO:0061056) |
0.1 | 0.6 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.1 | 0.4 | GO:0006780 | uroporphyrinogen III biosynthetic process(GO:0006780) |
0.1 | 0.2 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
0.1 | 0.2 | GO:0071579 | regulation of zinc ion transport(GO:0071579) |
0.1 | 0.4 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
0.1 | 0.4 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.4 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.1 | 0.4 | GO:0003180 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
0.1 | 0.1 | GO:1904444 | regulation of establishment of Sertoli cell barrier(GO:1904444) |
0.1 | 0.7 | GO:0014842 | regulation of skeletal muscle satellite cell proliferation(GO:0014842) |
0.1 | 0.8 | GO:0071493 | cellular response to UV-B(GO:0071493) |
0.1 | 0.3 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) dendritic cell cytokine production(GO:0002371) regulation of dendritic cell cytokine production(GO:0002730) |
0.1 | 0.8 | GO:0003264 | cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) |
0.1 | 0.3 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.1 | 0.2 | GO:2001171 | positive regulation of ATP biosynthetic process(GO:2001171) |
0.1 | 0.6 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.1 | 0.9 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.1 | 0.2 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
0.1 | 1.4 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.1 | 0.3 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.1 | 0.1 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
0.1 | 0.2 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.1 | 0.4 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
0.1 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.1 | 0.6 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.1 | 0.5 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.1 | 0.4 | GO:0001970 | positive regulation of activation of membrane attack complex(GO:0001970) |
0.1 | 3.3 | GO:0055078 | sodium ion homeostasis(GO:0055078) |
0.1 | 1.2 | GO:1901629 | regulation of presynaptic membrane organization(GO:1901629) |
0.1 | 0.2 | GO:0071725 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.1 | 0.5 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.1 | 0.2 | GO:0097374 | proprioception(GO:0019230) sensory neuron axon guidance(GO:0097374) |
0.1 | 0.6 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.1 | 0.8 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.1 | 0.7 | GO:0010226 | response to lithium ion(GO:0010226) |
0.1 | 0.2 | GO:0048664 | neuron fate determination(GO:0048664) |
0.1 | 1.8 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
0.1 | 0.5 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.1 | 0.5 | GO:0060022 | hard palate development(GO:0060022) |
0.1 | 1.7 | GO:0006991 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.1 | 0.4 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.1 | 0.8 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.1 | 0.3 | GO:1904565 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
0.1 | 1.5 | GO:0035634 | response to stilbenoid(GO:0035634) |
0.1 | 0.2 | GO:1901675 | negative regulation of histone H3-K27 acetylation(GO:1901675) |
0.1 | 0.1 | GO:2000503 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.1 | 0.7 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.3 | GO:0032218 | riboflavin transport(GO:0032218) |
0.1 | 0.1 | GO:0060596 | mammary placode formation(GO:0060596) |
0.1 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.1 | 0.3 | GO:0036114 | medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
0.1 | 0.2 | GO:0035106 | operant conditioning(GO:0035106) |
0.1 | 0.4 | GO:0098961 | dendritic transport of ribonucleoprotein complex(GO:0098961) dendritic transport of messenger ribonucleoprotein complex(GO:0098963) anterograde dendritic transport of messenger ribonucleoprotein complex(GO:0098964) |
0.1 | 0.1 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
0.1 | 0.2 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.1 | 0.1 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 2.6 | GO:0070207 | protein homotrimerization(GO:0070207) |
0.1 | 0.3 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
0.1 | 0.3 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.1 | 0.2 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
0.1 | 0.4 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.1 | GO:0055095 | lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
0.1 | 0.5 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.1 | 0.4 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.6 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
0.1 | 0.1 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.1 | 0.4 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.1 | 0.5 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 0.5 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.1 | 0.3 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.1 | 0.1 | GO:1902966 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
0.1 | 1.4 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
0.1 | 0.3 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
0.1 | 0.3 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 1.0 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.1 | 0.3 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 0.2 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.1 | 1.8 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
0.1 | 0.4 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.1 | 0.4 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
0.1 | 0.3 | GO:1904720 | regulation of mRNA cleavage(GO:0031437) negative regulation of mRNA cleavage(GO:0031438) regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904720) negative regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904721) |
0.1 | 0.3 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 0.3 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.1 | 0.1 | GO:0009804 | coumarin metabolic process(GO:0009804) |
0.1 | 0.5 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.4 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.1 | 0.3 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
0.1 | 0.9 | GO:0010225 | response to UV-C(GO:0010225) |
0.1 | 0.2 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
0.1 | 0.7 | GO:0030238 | male sex determination(GO:0030238) |
0.1 | 0.3 | GO:0070474 | positive regulation of uterine smooth muscle contraction(GO:0070474) |
0.1 | 0.2 | GO:0086103 | G-protein coupled receptor signaling pathway involved in heart process(GO:0086103) |
0.1 | 0.3 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 0.2 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
0.1 | 0.2 | GO:1905053 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
0.1 | 0.6 | GO:0042976 | activation of Janus kinase activity(GO:0042976) |
0.1 | 0.2 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
0.1 | 0.2 | GO:0017055 | negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) |
0.1 | 1.4 | GO:0030325 | adrenal gland development(GO:0030325) |
0.1 | 0.3 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.1 | 0.4 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
0.1 | 0.2 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.1 | 0.9 | GO:0046697 | decidualization(GO:0046697) |
0.1 | 0.3 | GO:0003093 | regulation of glomerular filtration(GO:0003093) |
0.1 | 0.4 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.1 | 0.1 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
0.1 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.1 | GO:0021886 | hypothalamus gonadotrophin-releasing hormone neuron differentiation(GO:0021886) hypothalamus gonadotrophin-releasing hormone neuron development(GO:0021888) |
0.1 | 0.2 | GO:0050904 | diapedesis(GO:0050904) |
0.1 | 0.9 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.1 | 0.2 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.1 | 0.2 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
0.1 | 0.2 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.1 | 0.8 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.2 | GO:0061763 | multivesicular body-lysosome fusion(GO:0061763) |
0.1 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.1 | 0.8 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.1 | 0.2 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.1 | 0.3 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
0.1 | 0.1 | GO:0061438 | renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) |
0.1 | 0.1 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
0.1 | 0.4 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.2 | GO:0043323 | positive regulation of natural killer cell degranulation(GO:0043323) |
0.0 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 1.1 | GO:0051450 | myoblast proliferation(GO:0051450) |
0.0 | 0.3 | GO:0032700 | negative regulation of interleukin-17 production(GO:0032700) |
0.0 | 0.3 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.0 | 0.2 | GO:0032423 | regulation of mismatch repair(GO:0032423) |
0.0 | 0.4 | GO:0008228 | opsonization(GO:0008228) |
0.0 | 0.3 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.0 | 0.5 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
0.0 | 0.8 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.0 | 0.1 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) |
0.0 | 0.4 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.5 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.0 | 0.4 | GO:2000169 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.0 | 0.1 | GO:0007161 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) calcium-independent cell-matrix adhesion(GO:0007161) |
0.0 | 0.5 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.0 | 0.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.0 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.0 | 0.3 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.0 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.0 | 0.4 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
0.0 | 2.5 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.4 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.0 | 0.8 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.4 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.0 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.0 | 0.9 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.0 | 0.2 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
0.0 | 0.1 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
0.0 | 0.2 | GO:0051775 | response to redox state(GO:0051775) |
0.0 | 0.9 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.0 | 0.2 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.0 | 0.5 | GO:0052696 | flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
0.0 | 0.2 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.0 | 0.1 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
0.0 | 0.0 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.0 | 0.2 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.0 | 0.0 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.0 | 0.1 | GO:0042823 | pyridoxal phosphate biosynthetic process(GO:0042823) |
0.0 | 0.5 | GO:0097369 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.2 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.5 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.2 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.0 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.0 | 0.1 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
0.0 | 0.2 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.0 | 0.1 | GO:0061038 | uterus morphogenesis(GO:0061038) |
0.0 | 0.2 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.0 | 0.2 | GO:0070633 | transepithelial transport(GO:0070633) |
0.0 | 1.2 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.1 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.0 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.0 | 0.1 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.0 | 0.1 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.0 | 0.5 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.2 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.0 | 0.1 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
0.0 | 0.3 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.0 | 0.1 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.0 | 0.2 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.0 | 1.5 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.0 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 0.0 | GO:0046010 | positive regulation of circadian sleep/wake cycle, sleep(GO:0045938) positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
0.0 | 0.1 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.0 | 0.3 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.0 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.0 | 0.3 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) amino acid salvage(GO:0043102) L-methionine salvage(GO:0071267) |
0.0 | 0.1 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
0.0 | 0.4 | GO:1901550 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.3 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.1 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
0.0 | 0.7 | GO:0033198 | response to ATP(GO:0033198) |
0.0 | 0.2 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
0.0 | 0.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.0 | 0.1 | GO:0071846 | actin filament debranching(GO:0071846) |
0.0 | 0.2 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.0 | 0.2 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
0.0 | 0.1 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.0 | 0.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.3 | GO:0032261 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
0.0 | 0.3 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.1 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.3 | GO:0042501 | serine phosphorylation of STAT protein(GO:0042501) |
0.0 | 0.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.5 | GO:0099612 | protein localization to axon(GO:0099612) |
0.0 | 0.1 | GO:0090285 | negative regulation of protein glycosylation in Golgi(GO:0090285) |
0.0 | 0.3 | GO:0048520 | positive regulation of behavior(GO:0048520) |
0.0 | 0.7 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.0 | 0.1 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.0 | 0.0 | GO:0000117 | regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
0.0 | 0.1 | GO:0035482 | defecation(GO:0030421) gastric motility(GO:0035482) |
0.0 | 0.2 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.0 | 0.5 | GO:0019236 | response to pheromone(GO:0019236) |
0.0 | 0.1 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
0.0 | 0.5 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.0 | 0.2 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.0 | 0.1 | GO:0019660 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.0 | 0.2 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.2 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.0 | 0.3 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.0 | 0.1 | GO:0032470 | positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) |
0.0 | 0.1 | GO:0060379 | cardiac muscle cell myoblast differentiation(GO:0060379) |
0.0 | 0.5 | GO:0021930 | cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
0.0 | 0.3 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.0 | 0.1 | GO:0014824 | artery smooth muscle contraction(GO:0014824) |
0.0 | 0.3 | GO:0010155 | regulation of proton transport(GO:0010155) |
0.0 | 0.3 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
0.0 | 0.1 | GO:0002344 | peripheral B cell selection(GO:0002343) B cell affinity maturation(GO:0002344) |
0.0 | 0.2 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.0 | 0.4 | GO:0006568 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
0.0 | 0.1 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
0.0 | 4.3 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
0.0 | 0.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.1 | GO:0021825 | substrate-dependent cerebral cortex tangential migration(GO:0021825) |
0.0 | 0.2 | GO:2000271 | positive regulation of endothelial cell differentiation(GO:0045603) positive regulation of fibroblast apoptotic process(GO:2000271) |
0.0 | 0.3 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.2 | GO:2000303 | regulation of ceramide biosynthetic process(GO:2000303) |
0.0 | 0.0 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.2 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.0 | 0.0 | GO:0048371 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.0 | 0.1 | GO:0034351 | regulation of glial cell apoptotic process(GO:0034350) negative regulation of glial cell apoptotic process(GO:0034351) |
0.0 | 0.1 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
0.0 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.0 | 1.7 | GO:2001238 | positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
0.0 | 0.0 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.1 | GO:0007320 | insemination(GO:0007320) |
0.0 | 0.1 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
0.0 | 0.6 | GO:0097576 | autophagosome maturation(GO:0097352) vacuole fusion(GO:0097576) |
0.0 | 0.5 | GO:0046688 | response to copper ion(GO:0046688) |
0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.1 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.7 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.1 | GO:0003127 | detection of nodal flow(GO:0003127) detection of endogenous stimulus(GO:0009726) |
0.0 | 0.2 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.0 | 0.1 | GO:0014735 | regulation of muscle atrophy(GO:0014735) |
0.0 | 0.0 | GO:0060372 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
0.0 | 0.2 | GO:1903208 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.0 | 0.5 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.1 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.0 | 0.1 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
0.0 | 0.3 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
0.0 | 0.1 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
0.0 | 0.0 | GO:0046958 | nonassociative learning(GO:0046958) |
0.0 | 0.4 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.0 | 0.1 | GO:0045924 | regulation of female receptivity(GO:0045924) positive regulation of female receptivity(GO:0045925) |
0.0 | 0.1 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.0 | 0.3 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.8 | GO:0035774 | positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
0.0 | 0.1 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
0.0 | 0.5 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.1 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.0 | 0.2 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.0 | 0.2 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.0 | 0.3 | GO:0014046 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
0.0 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.0 | 0.7 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
0.0 | 0.1 | GO:0019085 | early viral transcription(GO:0019085) |
0.0 | 0.3 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.1 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.0 | 0.2 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
0.0 | 0.5 | GO:0044243 | collagen catabolic process(GO:0030574) multicellular organism catabolic process(GO:0044243) |
0.0 | 0.2 | GO:0060736 | prostate gland growth(GO:0060736) |
0.0 | 0.2 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.1 | GO:0002014 | vasoconstriction of artery involved in ischemic response to lowering of systemic arterial blood pressure(GO:0002014) |
0.0 | 0.2 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.0 | 0.4 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
0.0 | 0.4 | GO:0009648 | photoperiodism(GO:0009648) entrainment of circadian clock by photoperiod(GO:0043153) |
0.0 | 0.1 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
0.0 | 0.0 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.0 | 0.1 | GO:0021594 | rhombomere formation(GO:0021594) rhombomere 3 formation(GO:0021660) rhombomere 5 morphogenesis(GO:0021664) rhombomere 5 formation(GO:0021666) |
0.0 | 0.1 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.0 | 0.3 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.2 | GO:0032098 | regulation of appetite(GO:0032098) |
0.0 | 0.4 | GO:0033005 | positive regulation of mast cell activation(GO:0033005) |
0.0 | 0.3 | GO:0050856 | regulation of T cell receptor signaling pathway(GO:0050856) |
0.0 | 0.2 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.1 | GO:0060307 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) |
0.0 | 0.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.0 | 0.1 | GO:0006713 | glucocorticoid catabolic process(GO:0006713) |
0.0 | 0.1 | GO:0001830 | trophectodermal cell fate commitment(GO:0001830) |
0.0 | 0.2 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.0 | 0.1 | GO:0061760 | antifungal innate immune response(GO:0061760) |
0.0 | 0.3 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.1 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
0.0 | 0.4 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.0 | 0.2 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.0 | 0.2 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.0 | 0.0 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.0 | 0.2 | GO:0060056 | mammary gland involution(GO:0060056) |
0.0 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.0 | 0.1 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.1 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.0 | 0.0 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
0.0 | 0.1 | GO:0001928 | regulation of exocyst assembly(GO:0001928) |
0.0 | 0.1 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.0 | 0.7 | GO:0048278 | vesicle docking(GO:0048278) |
0.0 | 0.1 | GO:0050917 | sensory perception of sweet taste(GO:0050916) sensory perception of umami taste(GO:0050917) |
0.0 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.3 | GO:0014002 | astrocyte development(GO:0014002) |
0.0 | 0.1 | GO:1903817 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
0.0 | 0.1 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 0.2 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.0 | 0.6 | GO:0006482 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
0.0 | 0.1 | GO:1903033 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
0.0 | 0.3 | GO:0002369 | T cell cytokine production(GO:0002369) |
0.0 | 0.4 | GO:0008206 | bile acid metabolic process(GO:0008206) |
0.0 | 0.1 | GO:1990743 | protein sialylation(GO:1990743) |
0.0 | 0.2 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.0 | 0.0 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
0.0 | 0.1 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.0 | 0.0 | GO:0034334 | adherens junction maintenance(GO:0034334) |
0.0 | 0.1 | GO:0045987 | positive regulation of smooth muscle contraction(GO:0045987) |
0.0 | 0.8 | GO:0016574 | histone ubiquitination(GO:0016574) |
0.0 | 0.2 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
0.0 | 0.2 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.1 | GO:0071481 | cellular response to X-ray(GO:0071481) |
0.0 | 0.2 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.0 | 0.1 | GO:0099526 | presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
0.0 | 0.1 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.0 | 0.2 | GO:0031424 | keratinization(GO:0031424) |
0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.2 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.0 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.0 | 0.9 | GO:0009247 | glycolipid biosynthetic process(GO:0009247) |
0.0 | 0.2 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.1 | GO:0071442 | regulation of histone H3-K14 acetylation(GO:0071440) positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.0 | 0.4 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.0 | 0.7 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
0.0 | 0.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.0 | 0.1 | GO:0072619 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
0.0 | 0.4 | GO:0001919 | regulation of receptor recycling(GO:0001919) |
0.0 | 0.1 | GO:0034141 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.0 | 0.0 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.0 | 0.7 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
0.0 | 0.8 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
0.0 | 0.1 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.0 | 0.3 | GO:0001960 | negative regulation of cytokine-mediated signaling pathway(GO:0001960) |
0.0 | 0.1 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.3 | GO:0097009 | energy homeostasis(GO:0097009) |
0.0 | 0.4 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.0 | 0.0 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.0 | 0.1 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.0 | 0.2 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
0.0 | 0.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.2 | GO:1902186 | regulation of viral release from host cell(GO:1902186) |
0.0 | 0.2 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.0 | 0.0 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.0 | 0.1 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
0.0 | 0.1 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.2 | GO:0010884 | positive regulation of lipid storage(GO:0010884) |
0.0 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.1 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) negative regulation of mRNA polyadenylation(GO:1900364) |
0.0 | 0.1 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.0 | 0.0 | GO:0006788 | heme oxidation(GO:0006788) |
0.0 | 0.1 | GO:0060690 | epithelial cell differentiation involved in salivary gland development(GO:0060690) |
0.0 | 0.0 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.0 | 0.0 | GO:0072038 | mesenchymal stem cell maintenance involved in nephron morphogenesis(GO:0072038) |
0.0 | 0.1 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.3 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.1 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.0 | 0.1 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.3 | GO:0008593 | regulation of Notch signaling pathway(GO:0008593) |
0.0 | 0.2 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.3 | GO:0009409 | response to cold(GO:0009409) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 4.3 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
0.4 | 1.2 | GO:0034667 | integrin alpha3-beta1 complex(GO:0034667) |
0.3 | 1.6 | GO:1990769 | proximal neuron projection(GO:1990769) |
0.3 | 1.1 | GO:1990795 | lateral part of cell(GO:0097574) basolateral part of cell(GO:1990794) rod bipolar cell terminal bouton(GO:1990795) |
0.3 | 1.1 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.3 | 3.2 | GO:0043083 | synaptic cleft(GO:0043083) |
0.3 | 2.1 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.3 | 1.1 | GO:1990696 | USH2 complex(GO:1990696) |
0.3 | 2.6 | GO:0001739 | sex chromatin(GO:0001739) |
0.2 | 0.9 | GO:0005914 | spot adherens junction(GO:0005914) |
0.2 | 0.2 | GO:1902737 | dendritic filopodium(GO:1902737) |
0.2 | 0.9 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.2 | 0.8 | GO:0071953 | elastic fiber(GO:0071953) |
0.2 | 1.6 | GO:0042825 | TAP complex(GO:0042825) |
0.2 | 1.8 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
0.2 | 0.7 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.2 | 3.8 | GO:0031527 | filopodium membrane(GO:0031527) |
0.2 | 0.5 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
0.2 | 1.2 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.2 | 1.7 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.2 | 1.3 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.2 | 0.5 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
0.1 | 0.4 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.1 | 0.4 | GO:0098855 | HCN channel complex(GO:0098855) |
0.1 | 0.3 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
0.1 | 2.4 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.4 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
0.1 | 0.5 | GO:0090537 | CERF complex(GO:0090537) |
0.1 | 3.1 | GO:0034706 | sodium channel complex(GO:0034706) |
0.1 | 4.4 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.5 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.1 | 1.2 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 0.4 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
0.1 | 0.3 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.1 | 0.3 | GO:0038045 | large latent transforming growth factor-beta complex(GO:0038045) |
0.1 | 0.4 | GO:0035339 | SPOTS complex(GO:0035339) |
0.1 | 0.3 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
0.1 | 0.2 | GO:0002141 | stereocilia ankle link(GO:0002141) stereocilia ankle link complex(GO:0002142) |
0.1 | 0.5 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.1 | 0.8 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 0.8 | GO:0031983 | vesicle lumen(GO:0031983) |
0.1 | 1.0 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 0.5 | GO:0098831 | presynaptic active zone cytoplasmic component(GO:0098831) |
0.1 | 2.2 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.1 | 0.3 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 0.6 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 2.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.1 | 0.1 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.1 | 1.1 | GO:0043194 | axon initial segment(GO:0043194) |
0.1 | 2.1 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.8 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 0.2 | GO:0005584 | collagen type I trimer(GO:0005584) |
0.1 | 0.2 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 0.5 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 1.3 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.1 | 0.5 | GO:0097444 | spine apparatus(GO:0097444) |
0.1 | 0.2 | GO:0036019 | endolysosome(GO:0036019) |
0.1 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.1 | 1.1 | GO:0033391 | chromatoid body(GO:0033391) |
0.1 | 0.4 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.1 | 0.4 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.1 | 1.8 | GO:0033270 | paranode region of axon(GO:0033270) |
0.1 | 0.1 | GO:1990257 | piccolo-bassoon transport vesicle(GO:1990257) |
0.1 | 1.3 | GO:0005922 | connexon complex(GO:0005922) |
0.1 | 2.4 | GO:0008305 | integrin complex(GO:0008305) |
0.1 | 1.3 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.1 | 1.0 | GO:0031105 | septin complex(GO:0031105) |
0.1 | 0.4 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.1 | 0.7 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 0.2 | GO:0043219 | lateral loop(GO:0043219) |
0.1 | 0.2 | GO:0071546 | pi-body(GO:0071546) |
0.1 | 0.8 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 1.6 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.1 | 0.6 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.1 | 0.2 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
0.1 | 1.7 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 0.4 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.1 | 0.2 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.1 | 0.5 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.1 | 0.5 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 0.5 | GO:0002177 | manchette(GO:0002177) |
0.1 | 0.4 | GO:0098837 | postsynaptic recycling endosome(GO:0098837) |
0.1 | 4.2 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.1 | 0.3 | GO:0031673 | H zone(GO:0031673) |
0.1 | 0.3 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.7 | GO:0030897 | HOPS complex(GO:0030897) |
0.1 | 0.5 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.1 | 0.7 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.1 | 0.5 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.4 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.8 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.3 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.0 | 1.4 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 1.8 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.5 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.3 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.1 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
0.0 | 0.2 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.4 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.1 | GO:0099631 | postsynaptic endocytic zone(GO:0098843) postsynaptic endocytic zone cytoplasmic component(GO:0099631) |
0.0 | 0.2 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.0 | 0.4 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.2 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
0.0 | 0.5 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.7 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.0 | 0.3 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.3 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.0 | 1.0 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.0 | 0.4 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.2 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.1 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
0.0 | 0.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.3 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
0.0 | 0.1 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.0 | 0.3 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 1.9 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 0.1 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.2 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.4 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.2 | GO:0044754 | autolysosome(GO:0044754) |
0.0 | 0.8 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.0 | 0.3 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 0.1 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
0.0 | 0.2 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.0 | 1.5 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 0.1 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
0.0 | 0.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
0.0 | 0.9 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 2.5 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.1 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
0.0 | 0.5 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.9 | GO:0032994 | protein-lipid complex(GO:0032994) |
0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.3 | GO:0001533 | cornified envelope(GO:0001533) |
0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.2 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 3.3 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.1 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.0 | 1.9 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
0.0 | 0.1 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.4 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.3 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.2 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 6.9 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 0.8 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.6 | GO:0014704 | intercalated disc(GO:0014704) |
0.0 | 0.4 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 3.1 | GO:0030141 | secretory granule(GO:0030141) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.4 | GO:0032590 | dendrite membrane(GO:0032590) |
0.0 | 0.4 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 0.1 | GO:0097165 | nuclear stress granule(GO:0097165) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 2.0 | GO:0005770 | late endosome(GO:0005770) |
0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.0 | 0.2 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.1 | GO:0043218 | compact myelin(GO:0043218) |
0.0 | 0.2 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.1 | GO:0033655 | host cell cytoplasm(GO:0030430) host cell cytoplasm part(GO:0033655) |
0.0 | 0.3 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.4 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.0 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.1 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.0 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.1 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.0 | 0.5 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 12.6 | GO:0005615 | extracellular space(GO:0005615) |
0.0 | 0.0 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.3 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.0 | 0.4 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.0 | GO:0048179 | activin receptor complex(GO:0048179) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 4.3 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.6 | 2.8 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
0.5 | 2.7 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.5 | 1.4 | GO:0005118 | sevenless binding(GO:0005118) |
0.5 | 1.4 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
0.5 | 3.6 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.4 | 2.2 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.4 | 1.7 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.4 | 1.7 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
0.4 | 3.1 | GO:0045545 | syndecan binding(GO:0045545) |
0.4 | 3.0 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.4 | 1.5 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.4 | 1.5 | GO:0004921 | interleukin-11 receptor activity(GO:0004921) interleukin-11 binding(GO:0019970) |
0.3 | 2.7 | GO:0039706 | co-receptor binding(GO:0039706) |
0.3 | 1.8 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.3 | 0.8 | GO:0016964 | alpha-2 macroglobulin receptor activity(GO:0016964) |
0.3 | 3.3 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
0.3 | 0.8 | GO:0042936 | dipeptide transporter activity(GO:0042936) |
0.3 | 1.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.3 | 0.8 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
0.3 | 0.8 | GO:0043404 | corticotrophin-releasing factor receptor activity(GO:0015056) corticotropin-releasing hormone receptor activity(GO:0043404) |
0.3 | 1.0 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.2 | 2.5 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.2 | 0.5 | GO:0051429 | corticotropin-releasing hormone receptor binding(GO:0051429) |
0.2 | 0.2 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
0.2 | 0.7 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.2 | 1.6 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.2 | 2.3 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.2 | 0.7 | GO:0035939 | microsatellite binding(GO:0035939) |
0.2 | 1.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.2 | 1.5 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.2 | 1.3 | GO:0097001 | ceramide binding(GO:0097001) |
0.2 | 3.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.2 | 0.6 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.2 | 1.4 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
0.2 | 0.8 | GO:0086077 | gap junction channel activity involved in AV node cell-bundle of His cell electrical coupling(GO:0086077) |
0.2 | 0.8 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.2 | 1.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.2 | 0.6 | GO:0034189 | very-low-density lipoprotein particle binding(GO:0034189) glycoprotein transporter activity(GO:0034437) |
0.2 | 0.7 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
0.2 | 0.5 | GO:0070615 | nucleosome-dependent ATPase activity(GO:0070615) |
0.2 | 1.4 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.2 | 0.7 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.2 | 1.2 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.2 | 0.5 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
0.2 | 1.3 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.2 | 1.1 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
0.2 | 1.4 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.2 | 0.6 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.2 | 1.7 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.2 | 0.8 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.2 | 0.6 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.1 | 0.4 | GO:0030617 | transforming growth factor beta receptor, inhibitory cytoplasmic mediator activity(GO:0030617) |
0.1 | 0.9 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.1 | 0.4 | GO:0048030 | disaccharide binding(GO:0048030) |
0.1 | 1.4 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.1 | 0.4 | GO:0045159 | myosin II binding(GO:0045159) |
0.1 | 0.9 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 0.4 | GO:0004903 | growth hormone receptor activity(GO:0004903) |
0.1 | 0.4 | GO:0070737 | protein-glycine ligase activity, elongating(GO:0070737) |
0.1 | 0.8 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 0.4 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.1 | 0.4 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.1 | 0.5 | GO:0043532 | angiostatin binding(GO:0043532) |
0.1 | 1.0 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
0.1 | 0.6 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 2.9 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.4 | GO:0003977 | UDP-N-acetylglucosamine diphosphorylase activity(GO:0003977) |
0.1 | 0.9 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 1.4 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 0.4 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
0.1 | 0.4 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
0.1 | 0.4 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.1 | 0.4 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
0.1 | 0.4 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.1 | 0.4 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.1 | 0.4 | GO:0035651 | AP-1 adaptor complex binding(GO:0035650) AP-3 adaptor complex binding(GO:0035651) |
0.1 | 0.8 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.1 | 0.3 | GO:0019002 | GMP binding(GO:0019002) |
0.1 | 1.0 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.1 | 0.3 | GO:0004771 | sterol esterase activity(GO:0004771) retinyl-palmitate esterase activity(GO:0050253) |
0.1 | 1.8 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.1 | 1.3 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.1 | 0.5 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 0.8 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
0.1 | 0.9 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 2.0 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 1.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.4 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.1 | 0.3 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
0.1 | 0.3 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.1 | 0.6 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.1 | 0.8 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.1 | 0.3 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 0.4 | GO:0050436 | microfibril binding(GO:0050436) |
0.1 | 0.4 | GO:0004092 | carnitine O-acetyltransferase activity(GO:0004092) |
0.1 | 0.5 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
0.1 | 0.7 | GO:0099609 | microtubule lateral binding(GO:0099609) |
0.1 | 0.4 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.1 | 0.7 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.1 | 0.4 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.6 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 0.3 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 1.2 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.4 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.1 | 0.4 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
0.1 | 0.3 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
0.1 | 0.6 | GO:0048495 | Roundabout binding(GO:0048495) |
0.1 | 0.9 | GO:0051870 | methotrexate binding(GO:0051870) |
0.1 | 0.6 | GO:0015925 | galactosidase activity(GO:0015925) |
0.1 | 1.0 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.1 | 0.2 | GO:0033265 | choline binding(GO:0033265) |
0.1 | 0.2 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.1 | 0.3 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 0.5 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 0.6 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.1 | 0.7 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 1.8 | GO:0031489 | myosin V binding(GO:0031489) |
0.1 | 0.3 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
0.1 | 3.5 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 1.2 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.1 | 0.7 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 0.5 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.3 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
0.1 | 0.2 | GO:0004051 | arachidonate 5-lipoxygenase activity(GO:0004051) |
0.1 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.1 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
0.1 | 0.6 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.1 | 0.3 | GO:0033765 | steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) |
0.1 | 0.2 | GO:0030549 | acetylcholine receptor activator activity(GO:0030549) |
0.1 | 1.9 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.1 | 0.5 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
0.1 | 0.3 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.3 | GO:0042610 | CD8 receptor binding(GO:0042610) |
0.1 | 0.5 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
0.1 | 2.0 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.3 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.1 | 0.4 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.1 | 3.9 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.1 | 0.3 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.1 | 0.4 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 1.2 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.1 | 1.8 | GO:0043236 | laminin binding(GO:0043236) |
0.1 | 0.4 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
0.1 | 1.9 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.1 | 0.4 | GO:0015099 | nickel cation transmembrane transporter activity(GO:0015099) |
0.1 | 0.7 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.1 | 1.2 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.1 | 0.4 | GO:0034711 | inhibin binding(GO:0034711) |
0.1 | 1.9 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 1.1 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.1 | 0.2 | GO:0047710 | bis(5'-adenosyl)-triphosphatase activity(GO:0047710) |
0.1 | 0.3 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.1 | 0.2 | GO:0031208 | POZ domain binding(GO:0031208) |
0.1 | 0.9 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.1 | 0.7 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.1 | 0.2 | GO:0005008 | hepatocyte growth factor-activated receptor activity(GO:0005008) |
0.1 | 0.2 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.1 | 0.2 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
0.1 | 0.9 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
0.1 | 0.2 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.1 | 7.2 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.1 | 0.2 | GO:0002153 | steroid receptor RNA activator RNA binding(GO:0002153) |
0.1 | 0.3 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.1 | 0.5 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
0.1 | 0.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 1.5 | GO:0005272 | sodium channel activity(GO:0005272) |
0.1 | 0.3 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 0.2 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
0.1 | 0.7 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
0.1 | 0.4 | GO:0035473 | lipase binding(GO:0035473) |
0.1 | 1.3 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 0.5 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.4 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
0.0 | 0.3 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
0.0 | 0.1 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.0 | 0.3 | GO:0019534 | toxin transporter activity(GO:0019534) |
0.0 | 0.2 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.0 | 0.5 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 1.9 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.4 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 1.8 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 0.6 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.0 | 0.3 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.8 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.0 | 0.7 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 1.9 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 0.2 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.0 | 0.2 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
0.0 | 0.3 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.3 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.3 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.0 | 0.5 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.6 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.0 | 0.7 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.4 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.0 | 0.2 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 0.6 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.0 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.0 | 0.2 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
0.0 | 0.2 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.3 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.8 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
0.0 | 0.3 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 1.1 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 0.3 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.2 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.1 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
0.0 | 0.7 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.3 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.4 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) |
0.0 | 3.5 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.4 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.0 | 0.8 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.5 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.0 | 0.3 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.2 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
0.0 | 0.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.0 | 0.3 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.5 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.0 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.0 | 0.3 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 1.1 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.7 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 1.0 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.2 | GO:0048101 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.0 | 0.2 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) aromatase activity(GO:0070330) |
0.0 | 0.3 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.9 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.6 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 0.5 | GO:0005351 | sugar:proton symporter activity(GO:0005351) cation:sugar symporter activity(GO:0005402) |
0.0 | 0.3 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.1 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
0.0 | 4.2 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.0 | 0.3 | GO:0060229 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
0.0 | 0.2 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
0.0 | 1.2 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.0 | 0.7 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.2 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.0 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.5 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 0.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.1 | GO:0097643 | amylin receptor activity(GO:0097643) |
0.0 | 0.7 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.3 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.2 | GO:0008312 | signal recognition particle binding(GO:0005047) 7S RNA binding(GO:0008312) |
0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.6 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 1.0 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.0 | 0.1 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.9 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.1 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.0 | 0.1 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.0 | 0.3 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.0 | 0.2 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
0.0 | 0.9 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.0 | 1.1 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) palmitoyl-CoA oxidase activity(GO:0016401) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.0 | 0.5 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.0 | 0.3 | GO:0051861 | glycolipid binding(GO:0051861) |
0.0 | 0.3 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.1 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
0.0 | 0.7 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.4 | GO:0015149 | hexose transmembrane transporter activity(GO:0015149) |
0.0 | 1.1 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.3 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 1.2 | GO:0045309 | protein phosphorylated amino acid binding(GO:0045309) |
0.0 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.2 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.0 | 0.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.0 | 0.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.0 | 0.2 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
0.0 | 1.5 | GO:0005178 | integrin binding(GO:0005178) |
0.0 | 0.5 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.3 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.0 | 1.1 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
0.0 | 0.2 | GO:0005549 | odorant binding(GO:0005549) |
0.0 | 0.5 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.0 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 0.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.0 | 0.0 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.1 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.0 | 0.2 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.2 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.0 | 0.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) calcium-induced calcium release activity(GO:0048763) |
0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.1 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
0.0 | 0.3 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.4 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.1 | GO:0015278 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
0.0 | 0.3 | GO:0030331 | estrogen receptor binding(GO:0030331) |
0.0 | 0.0 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.1 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.0 | 0.3 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.0 | 0.3 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.0 | 0.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.0 | 0.0 | GO:0030977 | taurine binding(GO:0030977) |
0.0 | 0.2 | GO:0005088 | Ras guanyl-nucleotide exchange factor activity(GO:0005088) |
0.0 | 0.3 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.1 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
0.0 | 0.4 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.0 | 0.0 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.0 | GO:0003979 | UDP-glucose 6-dehydrogenase activity(GO:0003979) |
0.0 | 0.0 | GO:0005093 | Rab GDP-dissociation inhibitor activity(GO:0005093) |
0.0 | 0.1 | GO:0004953 | icosanoid receptor activity(GO:0004953) prostanoid receptor activity(GO:0004954) |
0.0 | 1.1 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.1 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.1 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.0 | 0.1 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.0 | 0.2 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
0.0 | 0.0 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.1 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.2 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.1 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
0.0 | 0.3 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
0.0 | 0.0 | GO:0016726 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.0 | 0.2 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
0.0 | 0.1 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.1 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.3 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 8.1 | PID BMP PATHWAY | BMP receptor signaling |
0.1 | 4.6 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.1 | 0.4 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 0.8 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 4.0 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 4.4 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.1 | 3.9 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.1 | 2.2 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.1 | 3.1 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.1 | 1.4 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 1.9 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.1 | 1.4 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 2.9 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 2.2 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.1 | 0.5 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.1 | 1.7 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.1 | 1.0 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.1 | 1.0 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 4.6 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.1 | 1.5 | PID ARF 3PATHWAY | Arf1 pathway |
0.1 | 4.6 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 2.0 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.9 | PID EPO PATHWAY | EPO signaling pathway |
0.0 | 0.8 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.5 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 1.6 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.3 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.4 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.2 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.0 | 0.6 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.5 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 0.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.3 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 1.3 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 3.8 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.4 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.9 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.5 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.4 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.3 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.7 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.1 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 0.6 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 3.0 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.1 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.0 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.1 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.3 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.7 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.3 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.3 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 3.0 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.5 | PID TNF PATHWAY | TNF receptor signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 3.0 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.2 | 4.1 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.2 | 3.2 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.2 | 2.1 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.1 | 0.1 | REACTOME PI3K EVENTS IN ERBB2 SIGNALING | Genes involved in PI3K events in ERBB2 signaling |
0.1 | 2.4 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 2.9 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 1.1 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.1 | 3.8 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.1 | 1.0 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 2.2 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 5.2 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.1 | 3.4 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.1 | 0.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.1 | 2.0 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 0.9 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.1 | 1.3 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 0.8 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 3.0 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.1 | 0.7 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 1.4 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.1 | 0.6 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.1 | 0.8 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 0.7 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 1.1 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.1 | 1.0 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.1 | 1.0 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.1 | 1.5 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 1.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 3.1 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 0.2 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.1 | 0.4 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.1 | 0.2 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.1 | 0.8 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.5 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.5 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.0 | 0.9 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.4 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.0 | 0.4 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.0 | 0.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.7 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.0 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 1.2 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 1.1 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.5 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.0 | 0.4 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.8 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.0 | 0.1 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.4 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.0 | 1.0 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.9 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 1.5 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.4 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.0 | 0.3 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.4 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 1.5 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.4 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.4 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.6 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.0 | 0.8 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.2 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.0 | 0.9 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.0 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.5 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.0 | 0.5 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.2 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.0 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.8 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.2 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.6 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.0 | 0.3 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 0.5 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.0 | 0.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.9 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 2.7 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.0 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.0 | 0.7 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
0.0 | 0.6 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 0.1 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 1.3 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.1 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 0.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.2 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.7 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.4 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.1 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.0 | 0.2 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.0 | 0.2 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.0 | 0.5 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.2 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.2 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.3 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.0 | 0.2 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.0 | 0.4 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.6 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.6 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 0.3 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.0 | 0.3 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.0 | 0.5 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.6 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.0 | 0.1 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |