avrg: 2D miR_HR1_12
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Nhlh1
|
ENSMUSG00000051251.3 | nescient helix loop helix 1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Nhlh1 | mm10_v2_chr1_-_172057573_172057598 | -0.16 | 6.2e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr4_+_137277489 | 2.15 |
ENSMUST00000045747.4
|
Wnt4
|
wingless-related MMTV integration site 4 |
chr2_+_70562007 | 1.94 |
ENSMUST00000094934.4
|
Gad1
|
glutamate decarboxylase 1 |
chr9_+_103112072 | 1.67 |
ENSMUST00000035155.6
|
Rab6b
|
RAB6B, member RAS oncogene family |
chr9_-_121759788 | 1.55 |
ENSMUST00000181325.1
|
E530011L22Rik
|
RIKEN cDNA E530011L22 gene |
chr19_-_10457447 | 1.49 |
ENSMUST00000171400.2
|
Lrrc10b
|
leucine rich repeat containing 10B |
chr11_+_69965396 | 1.45 |
ENSMUST00000018713.6
|
Cldn7
|
claudin 7 |
chr7_-_19796789 | 1.31 |
ENSMUST00000108449.2
ENSMUST00000043822.7 |
Cblc
|
Casitas B-lineage lymphoma c |
chr11_-_109722214 | 1.30 |
ENSMUST00000020938.7
|
Fam20a
|
family with sequence similarity 20, member A |
chr2_+_70562147 | 1.08 |
ENSMUST00000148210.1
|
Gad1
|
glutamate decarboxylase 1 |
chr12_-_17176888 | 1.07 |
ENSMUST00000170580.1
|
Kcnf1
|
potassium voltage-gated channel, subfamily F, member 1 |
chr15_+_80671829 | 1.03 |
ENSMUST00000023044.5
|
Fam83f
|
family with sequence similarity 83, member F |
chr4_+_58943575 | 0.91 |
ENSMUST00000107554.1
|
Zkscan16
|
zinc finger with KRAB and SCAN domains 16 |
chr11_+_68556186 | 0.91 |
ENSMUST00000053211.6
|
Mfsd6l
|
major facilitator superfamily domain containing 6-like |
chr6_+_49367739 | 0.89 |
ENSMUST00000060561.8
ENSMUST00000121903.1 ENSMUST00000134786.1 |
Fam221a
|
family with sequence similarity 221, member A |
chr1_-_84696182 | 0.87 |
ENSMUST00000049126.6
|
Dner
|
delta/notch-like EGF-related receptor |
chr16_-_10785525 | 0.86 |
ENSMUST00000038099.4
|
Socs1
|
suppressor of cytokine signaling 1 |
chr13_-_71963713 | 0.86 |
ENSMUST00000077337.8
|
Irx1
|
Iroquois related homeobox 1 (Drosophila) |
chr4_+_95967322 | 0.85 |
ENSMUST00000107083.1
|
Hook1
|
hook homolog 1 (Drosophila) |
chr12_-_73546383 | 0.84 |
ENSMUST00000042975.5
|
Tmem30b
|
transmembrane protein 30B |
chr8_+_22808275 | 0.82 |
ENSMUST00000068068.4
|
1700041G16Rik
|
RIKEN cDNA 1700041G16 gene |
chr2_+_164403194 | 0.82 |
ENSMUST00000017151.1
|
Rbpjl
|
recombination signal binding protein for immunoglobulin kappa J region-like |
chr11_+_61022560 | 0.80 |
ENSMUST00000089184.4
|
Kcnj12
|
potassium inwardly-rectifying channel, subfamily J, member 12 |
chr12_+_108334341 | 0.78 |
ENSMUST00000021684.4
|
Cyp46a1
|
cytochrome P450, family 46, subfamily a, polypeptide 1 |
chr9_+_121760000 | 0.77 |
ENSMUST00000093772.3
|
Zfp651
|
zinc finger protein 651 |
chr12_-_103457195 | 0.74 |
ENSMUST00000044687.6
|
Ifi27l2b
|
interferon, alpha-inducible protein 27 like 2B |
chr11_-_120648104 | 0.72 |
ENSMUST00000026134.2
|
Myadml2
|
myeloid-associated differentiation marker-like 2 |
chr10_+_81633694 | 0.71 |
ENSMUST00000140345.1
ENSMUST00000126323.1 |
Ankrd24
|
ankyrin repeat domain 24 |
chr17_+_26933070 | 0.70 |
ENSMUST00000073724.5
|
Phf1
|
PHD finger protein 1 |
chr1_+_174501796 | 0.69 |
ENSMUST00000030039.7
|
Fmn2
|
formin 2 |
chr2_+_70562854 | 0.67 |
ENSMUST00000130998.1
|
Gad1
|
glutamate decarboxylase 1 |
chr12_-_119238794 | 0.67 |
ENSMUST00000026360.8
|
Itgb8
|
integrin beta 8 |
chr7_+_49975228 | 0.66 |
ENSMUST00000107603.1
|
Nell1
|
NEL-like 1 |
chr4_+_104367549 | 0.65 |
ENSMUST00000106830.2
|
Dab1
|
disabled 1 |
chr18_+_74442551 | 0.64 |
ENSMUST00000121875.1
|
Myo5b
|
myosin VB |
chr16_-_22439570 | 0.64 |
ENSMUST00000170393.1
|
Etv5
|
ets variant gene 5 |
chr17_-_24689901 | 0.63 |
ENSMUST00000007236.4
|
Syngr3
|
synaptogyrin 3 |
chr9_-_57836706 | 0.63 |
ENSMUST00000164010.1
ENSMUST00000171444.1 ENSMUST00000098686.3 |
Arid3b
|
AT rich interactive domain 3B (BRIGHT-like) |
chr4_+_137862237 | 0.62 |
ENSMUST00000102518.3
|
Ece1
|
endothelin converting enzyme 1 |
chr16_-_22439719 | 0.62 |
ENSMUST00000079601.6
|
Etv5
|
ets variant gene 5 |
chr16_+_20733104 | 0.62 |
ENSMUST00000115423.1
ENSMUST00000007171.6 |
Chrd
|
chordin |
chr1_+_90915064 | 0.62 |
ENSMUST00000027528.6
|
Mlph
|
melanophilin |
chr6_+_34384218 | 0.61 |
ENSMUST00000038383.7
ENSMUST00000115051.1 |
Akr1b10
|
aldo-keto reductase family 1, member B10 (aldose reductase) |
chr10_+_121641794 | 0.60 |
ENSMUST00000120642.1
ENSMUST00000132744.1 |
D930020B18Rik
|
RIKEN cDNA D930020B18 gene |
chr16_+_32735886 | 0.59 |
ENSMUST00000132475.1
ENSMUST00000096106.3 |
Muc4
|
mucin 4 |
chr15_-_71727815 | 0.58 |
ENSMUST00000022953.8
|
Fam135b
|
family with sequence similarity 135, member B |
chr3_-_84304762 | 0.58 |
ENSMUST00000107692.1
|
Trim2
|
tripartite motif-containing 2 |
chr3_-_84479418 | 0.57 |
ENSMUST00000091002.1
|
Fhdc1
|
FH2 domain containing 1 |
chr4_-_130275542 | 0.57 |
ENSMUST00000154846.1
ENSMUST00000105996.1 |
Serinc2
|
serine incorporator 2 |
chr14_+_33923582 | 0.57 |
ENSMUST00000168727.1
|
Gdf10
|
growth differentiation factor 10 |
chr7_+_122289297 | 0.57 |
ENSMUST00000064989.5
ENSMUST00000064921.4 |
Prkcb
|
protein kinase C, beta |
chr2_+_158375638 | 0.57 |
ENSMUST00000109488.1
|
Snhg11
|
small nucleolar RNA host gene 11 |
chr11_+_80810175 | 0.57 |
ENSMUST00000040865.8
|
Tmem98
|
transmembrane protein 98 |
chr9_-_53706211 | 0.56 |
ENSMUST00000068449.3
|
Rab39
|
RAB39, member RAS oncogene family |
chr7_+_49974864 | 0.55 |
ENSMUST00000081872.5
ENSMUST00000151721.1 |
Nell1
|
NEL-like 1 |
chr1_+_43092588 | 0.55 |
ENSMUST00000039080.3
|
8430432A02Rik
|
RIKEN cDNA 8430432A02 gene |
chr4_+_120666562 | 0.54 |
ENSMUST00000094814.4
|
Cited4
|
Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 |
chr8_+_125669818 | 0.54 |
ENSMUST00000053078.3
|
Map10
|
microtubule-associated protein 10 |
chr9_+_114978507 | 0.54 |
ENSMUST00000183104.1
|
Osbpl10
|
oxysterol binding protein-like 10 |
chr3_-_89093358 | 0.53 |
ENSMUST00000090929.5
ENSMUST00000052539.6 |
Rusc1
|
RUN and SH3 domain containing 1 |
chr2_-_93334467 | 0.52 |
ENSMUST00000111265.2
|
Tspan18
|
tetraspanin 18 |
chr7_+_6439836 | 0.52 |
ENSMUST00000168341.1
|
Olfr1344
|
olfactory receptor 1344 |
chr10_-_81291227 | 0.52 |
ENSMUST00000045744.6
|
Tjp3
|
tight junction protein 3 |
chr5_+_35757875 | 0.52 |
ENSMUST00000101280.3
ENSMUST00000054598.5 ENSMUST00000114205.1 ENSMUST00000114206.2 |
Ablim2
|
actin-binding LIM protein 2 |
chr2_+_25395866 | 0.51 |
ENSMUST00000028328.2
|
Entpd2
|
ectonucleoside triphosphate diphosphohydrolase 2 |
chr4_-_140246751 | 0.51 |
ENSMUST00000039331.8
|
Igsf21
|
immunoglobulin superfamily, member 21 |
chr12_+_26469204 | 0.51 |
ENSMUST00000020969.3
|
Cmpk2
|
cytidine monophosphate (UMP-CMP) kinase 2, mitochondrial |
chr4_-_148149684 | 0.51 |
ENSMUST00000126615.1
|
Fbxo6
|
F-box protein 6 |
chr7_-_31126945 | 0.51 |
ENSMUST00000098548.4
|
Scn1b
|
sodium channel, voltage-gated, type I, beta |
chr5_+_144545883 | 0.50 |
ENSMUST00000071782.6
|
Nptx2
|
neuronal pentraxin 2 |
chr2_-_80447625 | 0.50 |
ENSMUST00000028389.3
|
Frzb
|
frizzled-related protein |
chr6_-_148444336 | 0.50 |
ENSMUST00000060095.8
ENSMUST00000100772.3 |
Tmtc1
|
transmembrane and tetratricopeptide repeat containing 1 |
chr4_+_139380658 | 0.49 |
ENSMUST00000165860.1
ENSMUST00000097822.3 |
Ubr4
|
ubiquitin protein ligase E3 component n-recognin 4 |
chr8_-_41374602 | 0.49 |
ENSMUST00000110417.1
ENSMUST00000034000.8 ENSMUST00000143057.1 |
Asah1
|
N-acylsphingosine amidohydrolase 1 |
chr11_+_96929260 | 0.49 |
ENSMUST00000054311.5
ENSMUST00000107636.3 |
Prr15l
|
proline rich 15-like |
chr6_+_125349699 | 0.49 |
ENSMUST00000032491.8
|
Tnfrsf1a
|
tumor necrosis factor receptor superfamily, member 1a |
chr13_-_23622502 | 0.48 |
ENSMUST00000062045.2
|
Hist1h1e
|
histone cluster 1, H1e |
chr7_-_45759527 | 0.48 |
ENSMUST00000075571.7
|
Sult2b1
|
sulfotransferase family, cytosolic, 2B, member 1 |
chr11_-_99986593 | 0.48 |
ENSMUST00000105050.2
|
Krtap16-1
|
keratin associated protein 16-1 |
chr7_-_100658394 | 0.48 |
ENSMUST00000138830.1
ENSMUST00000107044.3 ENSMUST00000116287.2 |
Plekhb1
|
pleckstrin homology domain containing, family B (evectins) member 1 |
chr9_+_100643605 | 0.48 |
ENSMUST00000041418.6
|
Stag1
|
stromal antigen 1 |
chr6_+_30723541 | 0.47 |
ENSMUST00000115127.1
|
Mest
|
mesoderm specific transcript |
chr4_-_130275213 | 0.47 |
ENSMUST00000122374.1
|
Serinc2
|
serine incorporator 2 |
chr8_-_84011442 | 0.47 |
ENSMUST00000056686.5
|
2210011C24Rik
|
RIKEN cDNA 2210011C24 gene |
chr5_-_37717122 | 0.47 |
ENSMUST00000094836.4
|
Stk32b
|
serine/threonine kinase 32B |
chr10_-_30803075 | 0.46 |
ENSMUST00000068567.4
|
Ncoa7
|
nuclear receptor coactivator 7 |
chrX_+_135839034 | 0.46 |
ENSMUST00000173804.1
ENSMUST00000113136.1 |
Gprasp2
|
G protein-coupled receptor associated sorting protein 2 |
chr17_+_80127447 | 0.46 |
ENSMUST00000039205.4
|
Galm
|
galactose mutarotase |
chr15_+_89059712 | 0.45 |
ENSMUST00000161372.1
ENSMUST00000162424.1 |
Panx2
|
pannexin 2 |
chr11_+_96929367 | 0.45 |
ENSMUST00000062172.5
|
Prr15l
|
proline rich 15-like |
chr11_-_106487796 | 0.45 |
ENSMUST00000001059.2
ENSMUST00000106799.1 ENSMUST00000106800.1 |
Ern1
|
endoplasmic reticulum (ER) to nucleus signalling 1 |
chr18_+_74442500 | 0.45 |
ENSMUST00000074157.6
|
Myo5b
|
myosin VB |
chr18_-_35655185 | 0.45 |
ENSMUST00000097619.1
|
Prob1
|
proline rich basic protein 1 |
chr2_-_103303179 | 0.44 |
ENSMUST00000090475.3
|
Ehf
|
ets homologous factor |
chr7_-_66427469 | 0.44 |
ENSMUST00000015278.7
|
Aldh1a3
|
aldehyde dehydrogenase family 1, subfamily A3 |
chrX_+_93286499 | 0.44 |
ENSMUST00000046565.7
ENSMUST00000113947.2 |
Arx
|
aristaless related homeobox |
chr9_-_62510498 | 0.44 |
ENSMUST00000164246.2
|
Coro2b
|
coronin, actin binding protein, 2B |
chr7_+_140093388 | 0.44 |
ENSMUST00000026540.8
|
Prap1
|
proline-rich acidic protein 1 |
chr5_-_138996087 | 0.44 |
ENSMUST00000110897.1
|
Pdgfa
|
platelet derived growth factor, alpha |
chr6_-_86397098 | 0.43 |
ENSMUST00000153723.1
ENSMUST00000032065.8 |
Pcyox1
|
prenylcysteine oxidase 1 |
chr7_-_141100526 | 0.43 |
ENSMUST00000097958.2
|
Sigirr
|
single immunoglobulin and toll-interleukin 1 receptor (TIR) domain |
chr18_+_62180119 | 0.43 |
ENSMUST00000067743.1
|
Gm9949
|
predicted gene 9949 |
chr1_+_136683375 | 0.43 |
ENSMUST00000181524.1
|
Gm19705
|
predicted gene, 19705 |
chr11_-_59182810 | 0.43 |
ENSMUST00000108793.2
|
Gjc2
|
gap junction protein, gamma 2 |
chr9_+_100643448 | 0.43 |
ENSMUST00000146312.1
ENSMUST00000129269.1 |
Stag1
|
stromal antigen 1 |
chr15_-_75566811 | 0.43 |
ENSMUST00000065417.8
|
Ly6h
|
lymphocyte antigen 6 complex, locus H |
chr2_-_172043466 | 0.43 |
ENSMUST00000087950.3
|
Cbln4
|
cerebellin 4 precursor protein |
chr17_+_33638056 | 0.43 |
ENSMUST00000052079.7
|
Pram1
|
PML-RAR alpha-regulated adaptor molecule 1 |
chr12_-_79007276 | 0.42 |
ENSMUST00000056660.6
ENSMUST00000174721.1 |
Tmem229b
|
transmembrane protein 229B |
chr11_+_113619318 | 0.42 |
ENSMUST00000146390.2
ENSMUST00000106630.1 |
Sstr2
|
somatostatin receptor 2 |
chr7_+_43995833 | 0.42 |
ENSMUST00000007156.4
|
Klk1b11
|
kallikrein 1-related peptidase b11 |
chr5_-_110343009 | 0.42 |
ENSMUST00000058016.9
ENSMUST00000112478.3 |
P2rx2
|
purinergic receptor P2X, ligand-gated ion channel, 2 |
chr3_-_54915867 | 0.42 |
ENSMUST00000070342.3
|
Sertm1
|
serine rich and transmembrane domain containing 1 |
chr9_-_62537036 | 0.42 |
ENSMUST00000048043.5
|
Coro2b
|
coronin, actin binding protein, 2B |
chr6_-_5256226 | 0.42 |
ENSMUST00000125686.1
ENSMUST00000031773.2 |
Pon3
|
paraoxonase 3 |
chr1_+_120340569 | 0.42 |
ENSMUST00000037286.8
|
C1ql2
|
complement component 1, q subcomponent-like 2 |
chr1_-_14918862 | 0.41 |
ENSMUST00000041447.4
|
Trpa1
|
transient receptor potential cation channel, subfamily A, member 1 |
chr6_-_126166726 | 0.41 |
ENSMUST00000112244.2
ENSMUST00000050484.7 |
Ntf3
|
neurotrophin 3 |
chr17_-_6827990 | 0.41 |
ENSMUST00000181895.1
|
Gm2885
|
predicted gene 2885 |
chr7_-_100658364 | 0.41 |
ENSMUST00000107043.1
|
Plekhb1
|
pleckstrin homology domain containing, family B (evectins) member 1 |
chr2_-_24048857 | 0.41 |
ENSMUST00000114497.1
|
Hnmt
|
histamine N-methyltransferase |
chr1_+_75546522 | 0.41 |
ENSMUST00000138814.1
|
Slc4a3
|
solute carrier family 4 (anion exchanger), member 3 |
chr10_-_27616895 | 0.40 |
ENSMUST00000092639.5
|
Lama2
|
laminin, alpha 2 |
chr16_+_21794384 | 0.40 |
ENSMUST00000180830.1
|
1300002E11Rik
|
RIKEN cDNA 1300002E11 gene |
chr15_-_54278420 | 0.40 |
ENSMUST00000079772.3
|
Tnfrsf11b
|
tumor necrosis factor receptor superfamily, member 11b (osteoprotegerin) |
chr11_-_106487833 | 0.40 |
ENSMUST00000106801.1
|
Ern1
|
endoplasmic reticulum (ER) to nucleus signalling 1 |
chr1_-_166409773 | 0.40 |
ENSMUST00000135673.1
ENSMUST00000079972.6 ENSMUST00000169324.1 ENSMUST00000111411.2 ENSMUST00000128861.1 |
Pogk
|
pogo transposable element with KRAB domain |
chr7_+_139212974 | 0.40 |
ENSMUST00000016124.8
|
Lrrc27
|
leucine rich repeat containing 27 |
chr3_-_57847478 | 0.39 |
ENSMUST00000120289.1
ENSMUST00000066882.8 |
Pfn2
|
profilin 2 |
chr1_-_190978954 | 0.39 |
ENSMUST00000047409.6
|
Vash2
|
vasohibin 2 |
chr5_+_66745835 | 0.39 |
ENSMUST00000101164.4
ENSMUST00000118242.1 ENSMUST00000119854.1 ENSMUST00000117601.1 |
Limch1
|
LIM and calponin homology domains 1 |
chr11_-_60913775 | 0.39 |
ENSMUST00000019075.3
|
Gm16515
|
predicted gene, Gm16515 |
chr13_+_64161862 | 0.39 |
ENSMUST00000021929.8
|
Habp4
|
hyaluronic acid binding protein 4 |
chr7_+_4119525 | 0.39 |
ENSMUST00000119661.1
ENSMUST00000129423.1 |
Ttyh1
|
tweety homolog 1 (Drosophila) |
chr4_-_46536096 | 0.39 |
ENSMUST00000102924.2
|
Trim14
|
tripartite motif-containing 14 |
chr5_+_102768771 | 0.39 |
ENSMUST00000112852.1
|
Arhgap24
|
Rho GTPase activating protein 24 |
chr2_-_172940299 | 0.39 |
ENSMUST00000009143.7
|
Bmp7
|
bone morphogenetic protein 7 |
chr11_-_3931789 | 0.38 |
ENSMUST00000109992.1
ENSMUST00000109988.1 |
Tcn2
|
transcobalamin 2 |
chr12_+_112678803 | 0.38 |
ENSMUST00000174780.1
ENSMUST00000169593.1 ENSMUST00000173942.1 |
Zbtb42
|
zinc finger and BTB domain containing 42 |
chr6_+_7555053 | 0.38 |
ENSMUST00000090679.2
ENSMUST00000184986.1 |
Tac1
|
tachykinin 1 |
chr19_-_3686549 | 0.38 |
ENSMUST00000025856.10
ENSMUST00000176867.1 |
Lrp5
|
low density lipoprotein receptor-related protein 5 |
chr14_+_59625281 | 0.38 |
ENSMUST00000053949.5
|
Shisa2
|
shisa homolog 2 (Xenopus laevis) |
chr7_+_4119556 | 0.38 |
ENSMUST00000079415.5
|
Ttyh1
|
tweety homolog 1 (Drosophila) |
chr18_-_60624201 | 0.38 |
ENSMUST00000155195.2
|
Synpo
|
synaptopodin |
chr19_-_58454435 | 0.38 |
ENSMUST00000169850.1
|
Gfra1
|
glial cell line derived neurotrophic factor family receptor alpha 1 |
chr14_+_45219993 | 0.37 |
ENSMUST00000146150.1
|
Gpr137c
|
G protein-coupled receptor 137C |
chr6_-_124768330 | 0.37 |
ENSMUST00000135626.1
|
Eno2
|
enolase 2, gamma neuronal |
chr4_-_46536134 | 0.37 |
ENSMUST00000046897.6
|
Trim14
|
tripartite motif-containing 14 |
chr12_-_87102522 | 0.37 |
ENSMUST00000110177.2
ENSMUST00000021420.7 |
Ngb
|
neuroglobin |
chr6_+_47244359 | 0.37 |
ENSMUST00000060839.6
|
Cntnap2
|
contactin associated protein-like 2 |
chr12_+_113014502 | 0.37 |
ENSMUST00000084891.4
|
Pacs2
|
phosphofurin acidic cluster sorting protein 2 |
chr3_+_125404292 | 0.37 |
ENSMUST00000144344.1
|
Ndst4
|
N-deacetylase/N-sulfotransferase (heparin glucosaminyl) 4 |
chr15_-_75566608 | 0.37 |
ENSMUST00000163116.1
ENSMUST00000023241.5 |
Ly6h
|
lymphocyte antigen 6 complex, locus H |
chr18_-_44662251 | 0.37 |
ENSMUST00000164666.1
|
Mcc
|
mutated in colorectal cancers |
chr4_+_54947976 | 0.36 |
ENSMUST00000098070.3
|
Zfp462
|
zinc finger protein 462 |
chr5_+_30588078 | 0.36 |
ENSMUST00000066295.2
|
Kcnk3
|
potassium channel, subfamily K, member 3 |
chr5_+_150952607 | 0.36 |
ENSMUST00000078856.6
|
Kl
|
klotho |
chr2_+_24367565 | 0.36 |
ENSMUST00000102942.1
|
Psd4
|
pleckstrin and Sec7 domain containing 4 |
chr11_+_53519920 | 0.36 |
ENSMUST00000147912.1
|
Sept8
|
septin 8 |
chr17_-_56716788 | 0.36 |
ENSMUST00000067931.5
|
Vmac
|
vimentin-type intermediate filament associated coiled-coil protein |
chr13_-_62858364 | 0.36 |
ENSMUST00000021907.7
|
Fbp2
|
fructose bisphosphatase 2 |
chr6_-_56362356 | 0.36 |
ENSMUST00000044505.7
ENSMUST00000166102.1 ENSMUST00000164037.1 ENSMUST00000114327.2 |
Pde1c
|
phosphodiesterase 1C |
chr7_-_27333602 | 0.36 |
ENSMUST00000118583.1
ENSMUST00000118961.1 ENSMUST00000121175.1 |
Ltbp4
|
latent transforming growth factor beta binding protein 4 |
chr7_-_30457515 | 0.35 |
ENSMUST00000045817.7
|
Kirrel2
|
kin of IRRE like 2 (Drosophila) |
chr5_-_100719675 | 0.35 |
ENSMUST00000112908.1
ENSMUST00000045617.8 |
Hpse
|
heparanase |
chr7_-_16874845 | 0.35 |
ENSMUST00000181501.1
|
9330104G04Rik
|
RIKEN cDNA 9330104G04 gene |
chr3_+_125404072 | 0.35 |
ENSMUST00000173932.1
|
Ndst4
|
N-deacetylase/N-sulfotransferase (heparin glucosaminyl) 4 |
chr4_-_130275523 | 0.35 |
ENSMUST00000146478.1
|
Serinc2
|
serine incorporator 2 |
chr8_+_40862379 | 0.34 |
ENSMUST00000098816.3
ENSMUST00000057784.8 ENSMUST00000141505.1 |
Slc7a2
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 2 |
chr11_-_109298121 | 0.34 |
ENSMUST00000020920.3
|
Rgs9
|
regulator of G-protein signaling 9 |
chr6_-_5298455 | 0.34 |
ENSMUST00000057792.8
|
Pon2
|
paraoxonase 2 |
chr5_+_24428208 | 0.34 |
ENSMUST00000115049.2
|
Slc4a2
|
solute carrier family 4 (anion exchanger), member 2 |
chr3_+_127791374 | 0.34 |
ENSMUST00000171621.1
|
Tifa
|
TRAF-interacting protein with forkhead-associated domain |
chr2_-_103303158 | 0.34 |
ENSMUST00000111176.2
|
Ehf
|
ets homologous factor |
chr5_-_37336870 | 0.34 |
ENSMUST00000031005.4
|
Evc
|
Ellis van Creveld gene syndrome |
chr7_-_30861470 | 0.34 |
ENSMUST00000052700.3
|
Ffar1
|
free fatty acid receptor 1 |
chr1_+_36511867 | 0.34 |
ENSMUST00000001166.7
ENSMUST00000097776.3 |
Cnnm3
|
cyclin M3 |
chr19_+_53529100 | 0.34 |
ENSMUST00000038287.6
|
Dusp5
|
dual specificity phosphatase 5 |
chr4_-_8239034 | 0.34 |
ENSMUST00000066674.7
|
Car8
|
carbonic anhydrase 8 |
chr14_-_29721835 | 0.34 |
ENSMUST00000022567.7
|
Cacna2d3
|
calcium channel, voltage-dependent, alpha2/delta subunit 3 |
chr11_-_3931960 | 0.34 |
ENSMUST00000109990.1
ENSMUST00000020710.4 ENSMUST00000109989.3 ENSMUST00000109991.1 ENSMUST00000109993.2 |
Tcn2
|
transcobalamin 2 |
chr8_+_53511695 | 0.34 |
ENSMUST00000033920.4
|
Aga
|
aspartylglucosaminidase |
chr3_-_129969989 | 0.34 |
ENSMUST00000146340.1
|
Ccdc109b
|
coiled-coil domain containing 109B |
chr1_+_87124946 | 0.34 |
ENSMUST00000044878.3
|
Akp3
|
alkaline phosphatase 3, intestine, not Mn requiring |
chr6_-_29179584 | 0.33 |
ENSMUST00000159200.1
|
Prrt4
|
proline-rich transmembrane protein 4 |
chr10_+_34483400 | 0.33 |
ENSMUST00000019913.7
ENSMUST00000170771.1 |
Frk
|
fyn-related kinase |
chr4_-_127330799 | 0.33 |
ENSMUST00000046532.3
|
Gjb3
|
gap junction protein, beta 3 |
chr7_-_31054815 | 0.33 |
ENSMUST00000071697.4
ENSMUST00000108110.3 |
Fxyd1
|
FXYD domain-containing ion transport regulator 1 |
chr7_+_117380937 | 0.33 |
ENSMUST00000032892.5
|
Xylt1
|
xylosyltransferase 1 |
chr5_+_35757951 | 0.33 |
ENSMUST00000114204.1
ENSMUST00000129347.1 |
Ablim2
|
actin-binding LIM protein 2 |
chr3_-_8667033 | 0.33 |
ENSMUST00000042412.3
|
Hey1
|
hairy/enhancer-of-split related with YRPW motif 1 |
chrX_-_57338598 | 0.33 |
ENSMUST00000033468.4
ENSMUST00000114736.1 |
Arhgef6
|
Rac/Cdc42 guanine nucleotide exchange factor (GEF) 6 |
chr3_+_100489508 | 0.33 |
ENSMUST00000122898.1
|
Gm12474
|
predicted gene 12474 |
chr7_-_127993831 | 0.33 |
ENSMUST00000033056.3
|
Pycard
|
PYD and CARD domain containing |
chr11_-_72489904 | 0.33 |
ENSMUST00000045303.3
|
Spns2
|
spinster homolog 2 |
chrX_+_159627265 | 0.33 |
ENSMUST00000112456.2
|
Sh3kbp1
|
SH3-domain kinase binding protein 1 |
chr11_-_115367667 | 0.33 |
ENSMUST00000123428.1
ENSMUST00000044152.6 ENSMUST00000106542.2 |
Hid1
|
HID1 domain containing |
chr7_-_19166119 | 0.33 |
ENSMUST00000094790.3
|
Gipr
|
gastric inhibitory polypeptide receptor |
chr10_+_69213084 | 0.33 |
ENSMUST00000163497.1
ENSMUST00000164212.1 ENSMUST00000067908.7 |
Rhobtb1
|
Rho-related BTB domain containing 1 |
chr10_+_70097102 | 0.33 |
ENSMUST00000147545.1
|
Ccdc6
|
coiled-coil domain containing 6 |
chr11_-_109298066 | 0.33 |
ENSMUST00000106706.1
|
Rgs9
|
regulator of G-protein signaling 9 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.2 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.5 | 3.7 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.2 | 0.7 | GO:0021577 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) |
0.2 | 0.7 | GO:0070649 | meiotic chromosome movement towards spindle pole(GO:0016344) formin-nucleated actin cable assembly(GO:0070649) |
0.2 | 0.9 | GO:0072272 | proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
0.2 | 0.9 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.2 | 1.4 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.2 | 0.6 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
0.2 | 1.1 | GO:0032439 | endosome localization(GO:0032439) |
0.2 | 1.1 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.2 | 0.5 | GO:0046077 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate metabolic process(GO:0009138) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
0.2 | 0.5 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
0.2 | 0.5 | GO:0001997 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
0.2 | 0.5 | GO:0034959 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
0.2 | 0.5 | GO:1900477 | negative regulation of G1/S transition of mitotic cell cycle by negative regulation of transcription from RNA polymerase II promoter(GO:1900477) |
0.1 | 0.4 | GO:0060166 | olfactory pit development(GO:0060166) |
0.1 | 0.4 | GO:0021759 | globus pallidus development(GO:0021759) |
0.1 | 0.4 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
0.1 | 0.4 | GO:0043311 | positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
0.1 | 0.4 | GO:0009804 | coumarin metabolic process(GO:0009804) phenylpropanoid catabolic process(GO:0046271) |
0.1 | 0.7 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 0.7 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
0.1 | 0.7 | GO:0098886 | modification of dendritic spine(GO:0098886) |
0.1 | 0.7 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 0.5 | GO:0015671 | oxygen transport(GO:0015671) |
0.1 | 0.4 | GO:0036118 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.1 | 0.4 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.1 | 0.4 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
0.1 | 0.4 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.1 | 0.7 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.4 | GO:0046351 | disaccharide biosynthetic process(GO:0046351) |
0.1 | 1.3 | GO:0070166 | enamel mineralization(GO:0070166) |
0.1 | 1.4 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.1 | 0.3 | GO:1902022 | L-lysine transport(GO:1902022) |
0.1 | 0.3 | GO:0002582 | myeloid dendritic cell activation involved in immune response(GO:0002277) positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
0.1 | 0.4 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.1 | 0.3 | GO:0034443 | regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.1 | 0.3 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.4 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.1 | 0.5 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.1 | 0.5 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.1 | 0.2 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
0.1 | 0.6 | GO:0002838 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
0.1 | 1.2 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.1 | 0.5 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.1 | 0.4 | GO:1904395 | positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.1 | 0.3 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
0.1 | 0.3 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
0.1 | 0.5 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.1 | 0.2 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.1 | 0.3 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
0.1 | 0.5 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
0.1 | 0.3 | GO:0034334 | adherens junction maintenance(GO:0034334) |
0.1 | 0.7 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.1 | 0.3 | GO:0098923 | retrograde trans-synaptic signaling by soluble gas(GO:0098923) trans-synaptic signaling by nitric oxide(GO:0099548) |
0.1 | 0.4 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.1 | 0.3 | GO:0021941 | negative regulation of cerebellar granule cell precursor proliferation(GO:0021941) |
0.1 | 1.6 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.1 | 0.3 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
0.1 | 0.4 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.1 | 0.4 | GO:0052805 | histamine metabolic process(GO:0001692) imidazole-containing compound catabolic process(GO:0052805) |
0.1 | 0.8 | GO:0030432 | peristalsis(GO:0030432) |
0.1 | 0.9 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.1 | 0.5 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.1 | 1.4 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.1 | 0.8 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
0.1 | 0.4 | GO:1990839 | response to endothelin(GO:1990839) |
0.1 | 0.2 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
0.1 | 1.1 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.1 | 0.8 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.1 | 0.4 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.1 | 0.1 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
0.1 | 0.4 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.1 | 0.3 | GO:0044861 | protein transport into plasma membrane raft(GO:0044861) |
0.1 | 0.6 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.1 | 0.3 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.1 | 0.2 | GO:0070268 | cornification(GO:0070268) |
0.1 | 0.5 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
0.1 | 0.6 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
0.1 | 0.3 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.1 | 0.5 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.1 | 0.7 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.1 | 0.1 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.1 | 0.2 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 0.2 | GO:0071314 | cellular response to cocaine(GO:0071314) |
0.1 | 0.3 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.1 | 0.2 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
0.1 | 0.9 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
0.1 | 0.5 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.1 | 0.3 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.1 | 0.3 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.1 | 0.3 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
0.1 | 0.2 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
0.1 | 2.5 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.1 | 0.2 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.1 | 0.2 | GO:2001106 | regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
0.1 | 0.1 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.1 | 0.3 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.8 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.1 | 0.2 | GO:0070459 | prolactin secretion(GO:0070459) |
0.1 | 0.6 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.1 | 0.2 | GO:0009405 | pathogenesis(GO:0009405) |
0.1 | 0.2 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) positive regulation of protein lipidation(GO:1903061) |
0.1 | 0.3 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.1 | 0.1 | GO:0021836 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) chemorepulsion involved in postnatal olfactory bulb interneuron migration(GO:0021836) |
0.1 | 0.2 | GO:0061187 | regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
0.1 | 0.2 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
0.1 | 0.2 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 0.2 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.1 | 0.2 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.1 | 0.3 | GO:1903208 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.1 | 0.5 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
0.1 | 0.3 | GO:0060697 | positive regulation of phospholipid catabolic process(GO:0060697) |
0.1 | 0.2 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.1 | 0.2 | GO:1905034 | regulation of antifungal innate immune response(GO:1905034) negative regulation of antifungal innate immune response(GO:1905035) |
0.1 | 0.2 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.1 | 0.1 | GO:0048880 | sensory system development(GO:0048880) |
0.1 | 0.3 | GO:0030913 | paranodal junction assembly(GO:0030913) |
0.1 | 0.5 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.1 | 0.1 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
0.0 | 0.1 | GO:2000872 | positive regulation of progesterone secretion(GO:2000872) |
0.0 | 0.1 | GO:0007308 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) positive regulation of mitochondrial fusion(GO:0010636) P granule organization(GO:0030719) |
0.0 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.4 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.3 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.0 | 0.1 | GO:2000850 | negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.0 | 0.2 | GO:0003349 | epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
0.0 | 0.4 | GO:0042033 | chemokine biosynthetic process(GO:0042033) regulation of chemokine biosynthetic process(GO:0045073) |
0.0 | 0.1 | GO:0044849 | estrous cycle(GO:0044849) |
0.0 | 0.2 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.0 | 0.3 | GO:0021571 | rhombomere 5 development(GO:0021571) central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.0 | 0.5 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
0.0 | 0.1 | GO:0010752 | regulation of cGMP-mediated signaling(GO:0010752) |
0.0 | 0.5 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.1 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.0 | 0.0 | GO:1904220 | regulation of serine C-palmitoyltransferase activity(GO:1904220) |
0.0 | 0.1 | GO:0032470 | positive regulation of endoplasmic reticulum calcium ion concentration(GO:0032470) |
0.0 | 0.1 | GO:1904879 | positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
0.0 | 0.0 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) |
0.0 | 0.7 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.1 | GO:0010593 | negative regulation of lamellipodium assembly(GO:0010593) |
0.0 | 0.2 | GO:0031659 | positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.0 | 0.5 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.2 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
0.0 | 0.2 | GO:0030070 | insulin processing(GO:0030070) |
0.0 | 0.0 | GO:0003133 | BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
0.0 | 0.2 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
0.0 | 0.4 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.6 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
0.0 | 0.2 | GO:0070197 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.2 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) |
0.0 | 0.2 | GO:0046666 | retinal cell programmed cell death(GO:0046666) |
0.0 | 0.3 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
0.0 | 0.2 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
0.0 | 0.4 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.0 | 0.5 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.8 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
0.0 | 0.5 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.0 | 0.2 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.2 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.2 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
0.0 | 0.3 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.0 | 0.2 | GO:0034757 | negative regulation of iron ion transport(GO:0034757) negative regulation of iron ion transmembrane transport(GO:0034760) |
0.0 | 1.8 | GO:0007032 | endosome organization(GO:0007032) |
0.0 | 0.5 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.3 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.1 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.2 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.0 | 0.1 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
0.0 | 0.1 | GO:1904109 | positive regulation of intracellular lipid transport(GO:0032379) positive regulation of intracellular sterol transport(GO:0032382) positive regulation of intracellular cholesterol transport(GO:0032385) lipid hydroperoxide transport(GO:1901373) positive regulation of cholesterol import(GO:1904109) positive regulation of sterol import(GO:2000911) |
0.0 | 0.1 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.0 | 0.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.1 | GO:0021934 | hindbrain tangential cell migration(GO:0021934) |
0.0 | 0.2 | GO:0071543 | diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
0.0 | 0.1 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.0 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
0.0 | 0.3 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.0 | 0.1 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
0.0 | 0.2 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.2 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
0.0 | 0.1 | GO:2000041 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
0.0 | 0.2 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.4 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
0.0 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.0 | 0.3 | GO:0075044 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.7 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
0.0 | 0.2 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
0.0 | 0.0 | GO:0035801 | adrenal cortex development(GO:0035801) adrenal cortex formation(GO:0035802) |
0.0 | 0.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.0 | 0.1 | GO:0072566 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
0.0 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.0 | 0.1 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) determination of digestive tract left/right asymmetry(GO:0071907) |
0.0 | 0.1 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.0 | 0.2 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.0 | 0.8 | GO:1905144 | acetylcholine receptor signaling pathway(GO:0095500) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
0.0 | 0.5 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.4 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.3 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.2 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.6 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.2 | GO:0003096 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
0.0 | 0.3 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.0 | 0.1 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
0.0 | 0.1 | GO:0046541 | saliva secretion(GO:0046541) |
0.0 | 0.1 | GO:0001830 | trophectodermal cell fate commitment(GO:0001830) |
0.0 | 0.2 | GO:0098909 | regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
0.0 | 0.3 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.0 | 0.2 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.0 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.0 | 0.8 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.2 | GO:0060174 | limb bud formation(GO:0060174) |
0.0 | 0.2 | GO:0032252 | secretory granule localization(GO:0032252) |
0.0 | 0.1 | GO:2000744 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
0.0 | 0.3 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.0 | 0.1 | GO:0042938 | dipeptide transport(GO:0042938) |
0.0 | 0.5 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.0 | 0.2 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.0 | 0.1 | GO:0021938 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) notochord regression(GO:0060032) |
0.0 | 0.9 | GO:0010107 | potassium ion import(GO:0010107) |
0.0 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.0 | 0.1 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.0 | 0.2 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.5 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.2 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.0 | 0.6 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.3 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.0 | 0.3 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.0 | 0.2 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.0 | 0.1 | GO:0090204 | protein localization to nuclear pore(GO:0090204) |
0.0 | 0.1 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
0.0 | 0.3 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
0.0 | 0.2 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.0 | 0.2 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.0 | 0.3 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.0 | 0.2 | GO:0086023 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.0 | 0.1 | GO:0014894 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.1 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.0 | 0.2 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.1 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
0.0 | 0.2 | GO:0051958 | methotrexate transport(GO:0051958) |
0.0 | 0.3 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.0 | 0.1 | GO:0010808 | positive regulation of synaptic vesicle priming(GO:0010808) |
0.0 | 0.3 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.0 | 0.2 | GO:0072501 | cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 0.1 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.0 | 0.1 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.0 | 0.1 | GO:0032274 | gonadotropin secretion(GO:0032274) |
0.0 | 0.1 | GO:0097527 | necroptotic signaling pathway(GO:0097527) positive regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000451) |
0.0 | 0.6 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.1 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.4 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
0.0 | 0.2 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.3 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.1 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.0 | 0.3 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.0 | 0.1 | GO:0046882 | negative regulation of gonadotropin secretion(GO:0032277) negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.0 | 0.1 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
0.0 | 0.1 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
0.0 | 0.1 | GO:0009992 | cellular water homeostasis(GO:0009992) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.2 | GO:1990118 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.0 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.0 | 0.1 | GO:0010635 | regulation of mitochondrial fusion(GO:0010635) negative regulation of mitochondrial fusion(GO:0010637) |
0.0 | 0.1 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
0.0 | 0.1 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
0.0 | 0.8 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
0.0 | 0.2 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.1 | GO:0097112 | synaptic transmission, glycinergic(GO:0060012) gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.0 | 0.3 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.0 | 0.1 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.0 | 0.3 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.0 | 0.1 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.0 | 0.1 | GO:1901053 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
0.0 | 0.1 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.0 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
0.0 | 0.0 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.0 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.1 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.0 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 0.1 | GO:0003373 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
0.0 | 0.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.5 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.0 | 0.1 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.1 | GO:0098722 | asymmetric neuroblast division(GO:0055059) asymmetric stem cell division(GO:0098722) |
0.0 | 0.1 | GO:0039019 | pronephric nephron development(GO:0039019) |
0.0 | 0.3 | GO:1903206 | negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
0.0 | 0.0 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.0 | 0.2 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.5 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
0.0 | 0.3 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
0.0 | 0.1 | GO:0060482 | lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
0.0 | 0.2 | GO:0034086 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
0.0 | 0.2 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.5 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
0.0 | 0.2 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 1.0 | GO:0051453 | regulation of intracellular pH(GO:0051453) |
0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.0 | GO:0042322 | negative regulation of circadian sleep/wake cycle, REM sleep(GO:0042322) |
0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.0 | 0.1 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
0.0 | 0.0 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.0 | 0.3 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.0 | 0.1 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.0 | 0.0 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.0 | 0.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.0 | 0.1 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
0.0 | 0.4 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.0 | 0.2 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
0.0 | 0.1 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.0 | 0.4 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.1 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) negative regulation of biomineral tissue development(GO:0070168) |
0.0 | 0.7 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.1 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.0 | 0.2 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.0 | 0.1 | GO:0014842 | regulation of skeletal muscle satellite cell proliferation(GO:0014842) regulation of skeletal muscle cell proliferation(GO:0014857) |
0.0 | 0.0 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.0 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.1 | GO:0072189 | ureter development(GO:0072189) |
0.0 | 0.2 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
0.0 | 0.2 | GO:0043306 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
0.0 | 0.1 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) |
0.0 | 0.5 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.0 | 0.2 | GO:0034312 | diol biosynthetic process(GO:0034312) |
0.0 | 0.0 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.0 | 0.6 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
0.0 | 0.3 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.0 | 0.0 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.0 | 0.1 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.0 | 0.1 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.1 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
0.0 | 0.4 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.0 | GO:1904776 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.4 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
0.0 | 0.1 | GO:1990144 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
0.0 | 0.2 | GO:0030903 | notochord development(GO:0030903) |
0.0 | 0.1 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
0.0 | 0.4 | GO:0003170 | heart valve development(GO:0003170) |
0.0 | 0.4 | GO:0010633 | negative regulation of epithelial cell migration(GO:0010633) |
0.0 | 0.1 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.0 | 0.0 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.0 | 0.1 | GO:0043482 | pigment accumulation(GO:0043476) cellular pigment accumulation(GO:0043482) |
0.0 | 0.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.3 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.0 | 0.1 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
0.0 | 0.0 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
0.0 | 0.0 | GO:0098928 | presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
0.0 | 0.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.0 | 0.1 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.0 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.4 | GO:0070695 | FHF complex(GO:0070695) |
0.2 | 1.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.2 | 0.6 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.1 | 0.5 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 0.6 | GO:1990037 | Lewy body core(GO:1990037) |
0.1 | 0.6 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.1 | 0.7 | GO:0097444 | spine apparatus(GO:0097444) |
0.1 | 3.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.2 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.3 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.1 | 1.1 | GO:0045179 | apical cortex(GO:0045179) |
0.1 | 0.2 | GO:0038045 | large latent transforming growth factor-beta complex(GO:0038045) |
0.1 | 0.2 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 0.2 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.1 | 0.3 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
0.1 | 0.4 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 0.5 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 0.3 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 0.3 | GO:0070820 | tertiary granule(GO:0070820) |
0.1 | 0.2 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
0.1 | 0.9 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.1 | 0.2 | GO:0000802 | transverse filament(GO:0000802) |
0.0 | 0.1 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.0 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.0 | 0.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.4 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.4 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.0 | 0.4 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.8 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.5 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.1 | GO:0034657 | GID complex(GO:0034657) |
0.0 | 0.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.8 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 1.1 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.8 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.4 | GO:0001533 | cornified envelope(GO:0001533) |
0.0 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.9 | GO:0005605 | basal lamina(GO:0005605) |
0.0 | 0.1 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
0.0 | 0.2 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.2 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.1 | GO:1990696 | USH2 complex(GO:1990696) |
0.0 | 0.5 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.3 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.2 | GO:0098837 | postsynaptic recycling endosome(GO:0098837) |
0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.0 | 0.1 | GO:0044753 | amphisome(GO:0044753) |
0.0 | 0.3 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.1 | GO:0097447 | dendritic tree(GO:0097447) |
0.0 | 0.8 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.6 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 2.1 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.4 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.4 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.6 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.2 | GO:0097165 | nuclear stress granule(GO:0097165) |
0.0 | 0.1 | GO:0032783 | ELL-EAF complex(GO:0032783) |
0.0 | 0.3 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.1 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
0.0 | 1.9 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.0 | 0.4 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.0 | 0.8 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.1 | GO:0098855 | HCN channel complex(GO:0098855) |
0.0 | 0.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.4 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.0 | 0.6 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.3 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.1 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.0 | 0.4 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.0 | 1.3 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.0 | 0.4 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.7 | GO:0008305 | integrin complex(GO:0008305) |
0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.3 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.1 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) catenin-TCF7L2 complex(GO:0071664) |
0.0 | 0.5 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.2 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 1.2 | GO:0005902 | microvillus(GO:0005902) |
0.0 | 0.4 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 0.1 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.0 | 0.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.0 | 1.0 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.5 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.0 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.1 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
0.0 | 0.3 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 0.3 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.1 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
0.0 | 0.0 | GO:0034774 | secretory granule lumen(GO:0034774) cytoplasmic membrane-bounded vesicle lumen(GO:0060205) |
0.0 | 0.2 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 0.3 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 0.5 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 0.1 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.1 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.4 | GO:0014704 | intercalated disc(GO:0014704) |
0.0 | 0.0 | GO:0098636 | protein complex involved in cell adhesion(GO:0098636) |
0.0 | 0.0 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.0 | 0.2 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.0 | 0.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 3.3 | GO:0098857 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
0.0 | 1.5 | GO:0031225 | anchored component of membrane(GO:0031225) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 3.7 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.3 | 0.8 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.2 | 0.6 | GO:0070401 | NADP+ binding(GO:0070401) |
0.2 | 0.8 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
0.2 | 0.8 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
0.2 | 0.5 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.2 | 0.5 | GO:0051380 | norepinephrine binding(GO:0051380) |
0.2 | 0.5 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.1 | 0.6 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.5 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.1 | 1.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.1 | 0.5 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.1 | 0.4 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
0.1 | 0.8 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 0.3 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.1 | 0.3 | GO:0035939 | microsatellite binding(GO:0035939) |
0.1 | 0.8 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.1 | 0.3 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 0.7 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.3 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
0.1 | 0.3 | GO:0005118 | sevenless binding(GO:0005118) |
0.1 | 1.4 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.1 | 0.3 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.1 | 0.5 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 2.6 | GO:0031489 | myosin V binding(GO:0031489) |
0.1 | 0.7 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 0.5 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.1 | 0.5 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.5 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.1 | 0.4 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 0.3 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.1 | 0.4 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.1 | 0.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.1 | 0.2 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.1 | 0.3 | GO:0050436 | microfibril binding(GO:0050436) |
0.1 | 1.7 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.1 | 0.7 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 0.2 | GO:0004335 | galactokinase activity(GO:0004335) |
0.1 | 0.3 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.1 | 0.3 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.3 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
0.1 | 1.5 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
0.1 | 0.4 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.3 | GO:0043682 | copper-exporting ATPase activity(GO:0004008) copper-transporting ATPase activity(GO:0043682) |
0.1 | 0.3 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
0.1 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
0.1 | 0.3 | GO:0047710 | bis(5'-adenosyl)-triphosphatase activity(GO:0047710) |
0.1 | 0.8 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.3 | GO:0004510 | tryptophan 5-monooxygenase activity(GO:0004510) |
0.1 | 0.6 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.1 | 0.1 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.1 | 0.3 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.4 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.1 | 0.5 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.2 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
0.1 | 0.4 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.2 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
0.1 | 0.2 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.1 | 0.9 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 0.7 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.1 | 0.7 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) |
0.1 | 0.7 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.1 | 0.3 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.1 | 0.5 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.1 | 0.2 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.1 | 0.1 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.1 | 0.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.1 | 0.2 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.1 | 0.2 | GO:0001129 | RNA polymerase II transcription factor activity, TBP-class protein binding, involved in preinitiation complex assembly(GO:0001129) RNA polymerase II transcription factor activity, TBP-class protein binding(GO:0001132) |
0.0 | 0.2 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.5 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.0 | 0.4 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 0.3 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.0 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.0 | 0.4 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.0 | 0.9 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.9 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.1 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
0.0 | 0.2 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 0.5 | GO:0004579 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.2 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.0 | 1.2 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.1 | GO:0033814 | propanoyl-CoA C-acyltransferase activity(GO:0033814) propionyl-CoA C2-trimethyltridecanoyltransferase activity(GO:0050632) phosphatidylethanolamine transporter activity(GO:1904121) |
0.0 | 0.3 | GO:0009374 | biotin binding(GO:0009374) |
0.0 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.0 | 0.5 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.5 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.2 | GO:0034432 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
0.0 | 0.1 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.0 | 0.2 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.0 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.3 | GO:0032564 | dATP binding(GO:0032564) |
0.0 | 0.4 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.0 | 0.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.0 | 0.1 | GO:0048030 | disaccharide binding(GO:0048030) |
0.0 | 0.1 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.0 | 0.5 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.0 | 0.1 | GO:0070976 | TIR domain binding(GO:0070976) |
0.0 | 0.1 | GO:0001729 | ceramide kinase activity(GO:0001729) |
0.0 | 0.3 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.0 | 0.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 1.0 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.8 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.2 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.0 | 0.1 | GO:0031013 | troponin I binding(GO:0031013) |
0.0 | 0.1 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
0.0 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 1.3 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 1.4 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 1.3 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.5 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.2 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.1 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
0.0 | 0.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.2 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.2 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 1.0 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.2 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.0 | 0.3 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 1.1 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.1 | GO:0047936 | glucose 1-dehydrogenase [NAD(P)] activity(GO:0047936) |
0.0 | 0.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.4 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.0 | 0.6 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.2 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.2 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.2 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
0.0 | 0.4 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.3 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.0 | 0.1 | GO:0019778 | Atg12 activating enzyme activity(GO:0019778) Atg8 activating enzyme activity(GO:0019779) |
0.0 | 0.1 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
0.0 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 1.0 | GO:0015662 | ATPase activity, coupled to transmembrane movement of ions, phosphorylative mechanism(GO:0015662) |
0.0 | 0.3 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.1 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.0 | 0.3 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.3 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.6 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.0 | 0.3 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.7 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.9 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.1 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.2 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.3 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.1 | GO:0046997 | sarcosine dehydrogenase activity(GO:0008480) oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
0.0 | 0.4 | GO:0045125 | bioactive lipid receptor activity(GO:0045125) |
0.0 | 0.1 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 0.2 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.1 | GO:0016842 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) amidine-lyase activity(GO:0016842) |
0.0 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.2 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.0 | 0.2 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.3 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.1 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 0.5 | GO:0001968 | fibronectin binding(GO:0001968) |
0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 1.0 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.4 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.9 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 0.1 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.0 | 0.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.5 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.2 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 0.4 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.1 | GO:0015185 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.0 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) type II activin receptor binding(GO:0070699) |
0.0 | 0.3 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 1.7 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.4 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.5 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.1 | GO:0015526 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.2 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
0.0 | 0.1 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
0.0 | 0.1 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.0 | 0.3 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.1 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
0.0 | 0.4 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.7 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.3 | GO:0005088 | Ras guanyl-nucleotide exchange factor activity(GO:0005088) |
0.0 | 0.0 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 0.1 | GO:0015250 | water channel activity(GO:0015250) |
0.0 | 0.1 | GO:0030275 | LRR domain binding(GO:0030275) |
0.0 | 0.0 | GO:0016454 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.3 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 0.3 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 0.6 | GO:0005179 | hormone activity(GO:0005179) |
0.0 | 0.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.2 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
0.0 | 0.5 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.0 | 0.5 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 1.1 | GO:0005178 | integrin binding(GO:0005178) |
0.0 | 0.1 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.1 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.0 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.6 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.7 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 2.0 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.4 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 1.1 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.4 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 1.3 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.7 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 1.0 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.5 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.3 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.7 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.3 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 2.6 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 1.0 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.3 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.6 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.1 | PID IGF1 PATHWAY | IGF1 pathway |
0.0 | 0.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.4 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.5 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.4 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.6 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 0.9 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.7 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.4 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.2 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.4 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.3 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 1.0 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 0.1 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.1 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.2 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
0.2 | 3.8 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.2 | 1.1 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
0.1 | 0.9 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 0.9 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 0.8 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.0 | 0.5 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.5 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.6 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.3 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.5 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.0 | 1.4 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.1 | REACTOME DEFENSINS | Genes involved in Defensins |
0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.7 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.0 | 0.4 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 1.0 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.4 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 1.0 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.9 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.4 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.4 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.0 | 0.9 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.6 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 0.5 | REACTOME SHC MEDIATED CASCADE | Genes involved in SHC-mediated cascade |
0.0 | 0.2 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.4 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.3 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.1 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.0 | 0.9 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 0.2 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.0 | 0.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.3 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.3 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.3 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.7 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.0 | 0.7 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.5 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.2 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.1 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 0.3 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.1 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.5 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 0.1 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.0 | 0.1 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.3 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.1 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 0.0 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.3 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.5 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 1.2 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.2 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |