avrg: 2D miR_HR1_12
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Zfx
|
ENSMUSG00000079509.4 | zinc finger protein X-linked |
|
Zfp711
|
ENSMUSG00000025529.8 | zinc finger protein 711 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Zfx | mm10_v2_chrX_-_94123359_94123412 | 0.77 | 3.3e-03 | Click! |
| Zfp711 | mm10_v2_chrX_+_112604274_112604274 | 0.70 | 1.1e-02 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr11_+_3202684 | 3.64 |
ENSMUST00000125637.1
|
Eif4enif1
|
eukaryotic translation initiation factor 4E nuclear import factor 1 |
| chr2_-_33130565 | 3.55 |
ENSMUST00000124000.1
|
Garnl3
|
GTPase activating RANGAP domain-like 3 |
| chr2_+_31245801 | 3.38 |
ENSMUST00000000199.7
|
Ncs1
|
neuronal calcium sensor 1 |
| chr5_+_30666886 | 3.28 |
ENSMUST00000144742.1
|
Cenpa
|
centromere protein A |
| chrX_-_94123087 | 3.24 |
ENSMUST00000113925.1
|
Zfx
|
zinc finger protein X-linked |
| chr2_-_181135103 | 3.13 |
ENSMUST00000149964.2
ENSMUST00000103050.3 ENSMUST00000081528.6 ENSMUST00000049792.8 ENSMUST00000103048.3 ENSMUST00000103047.3 ENSMUST00000129073.1 ENSMUST00000144592.1 ENSMUST00000139458.1 ENSMUST00000154164.1 ENSMUST00000123336.1 ENSMUST00000129361.1 ENSMUST00000103051.2 |
Kcnq2
|
potassium voltage-gated channel, subfamily Q, member 2 |
| chr2_+_139678178 | 3.12 |
ENSMUST00000184404.1
ENSMUST00000099307.3 |
Ism1
|
isthmin 1 homolog (zebrafish) |
| chr1_-_71103146 | 2.89 |
ENSMUST00000027393.7
|
Bard1
|
BRCA1 associated RING domain 1 |
| chr1_-_37719782 | 2.89 |
ENSMUST00000160589.1
|
2010300C02Rik
|
RIKEN cDNA 2010300C02 gene |
| chr7_-_38107490 | 2.77 |
ENSMUST00000108023.3
|
Ccne1
|
cyclin E1 |
| chr7_-_62420139 | 2.70 |
ENSMUST00000094340.3
|
Mkrn3
|
makorin, ring finger protein, 3 |
| chr10_-_69352886 | 2.70 |
ENSMUST00000119827.1
ENSMUST00000020099.5 |
Cdk1
|
cyclin-dependent kinase 1 |
| chr2_-_73386396 | 2.68 |
ENSMUST00000112044.1
ENSMUST00000112043.1 ENSMUST00000076463.5 |
Gpr155
|
G protein-coupled receptor 155 |
| chr6_+_35177610 | 2.66 |
ENSMUST00000170234.1
|
Nup205
|
nucleoporin 205 |
| chr9_-_31913462 | 2.65 |
ENSMUST00000116615.3
|
Barx2
|
BarH-like homeobox 2 |
| chr5_-_72587544 | 2.55 |
ENSMUST00000031124.4
|
Gm5868
|
predicted gene 5868 |
| chr8_+_84723003 | 2.54 |
ENSMUST00000098571.4
|
G430095P16Rik
|
RIKEN cDNA G430095P16 gene |
| chr11_+_60105079 | 2.48 |
ENSMUST00000132012.1
|
Rai1
|
retinoic acid induced 1 |
| chr12_-_108275409 | 2.47 |
ENSMUST00000136175.1
|
Ccdc85c
|
coiled-coil domain containing 85C |
| chr7_-_4752972 | 2.45 |
ENSMUST00000183971.1
ENSMUST00000182173.1 ENSMUST00000182738.1 ENSMUST00000184143.1 ENSMUST00000182111.1 ENSMUST00000182048.1 ENSMUST00000063324.7 |
Cox6b2
|
cytochrome c oxidase subunit VIb polypeptide 2 |
| chr7_+_79660196 | 2.37 |
ENSMUST00000035977.7
|
Ticrr
|
TOPBP1-interacting checkpoint and replication regulator |
| chr1_+_191063001 | 2.37 |
ENSMUST00000076952.5
ENSMUST00000139340.1 ENSMUST00000078259.6 |
Nsl1
|
NSL1, MIND kinetochore complex component, homolog (S. cerevisiae) |
| chr9_-_70421533 | 2.19 |
ENSMUST00000034742.6
|
Ccnb2
|
cyclin B2 |
| chr5_-_8422582 | 2.19 |
ENSMUST00000168500.1
ENSMUST00000002368.9 |
Dbf4
|
DBF4 homolog (S. cerevisiae) |
| chr5_-_8422695 | 2.18 |
ENSMUST00000171808.1
|
Dbf4
|
DBF4 homolog (S. cerevisiae) |
| chr4_-_117125618 | 2.15 |
ENSMUST00000183310.1
|
Btbd19
|
BTB (POZ) domain containing 19 |
| chr12_-_112929415 | 2.11 |
ENSMUST00000075827.3
|
Jag2
|
jagged 2 |
| chr5_+_65764073 | 2.11 |
ENSMUST00000138239.1
ENSMUST00000087264.3 |
N4bp2
|
NEDD4 binding protein 2 |
| chr8_+_122568001 | 2.09 |
ENSMUST00000006760.2
|
Cdt1
|
chromatin licensing and DNA replication factor 1 |
| chr11_+_120458093 | 2.09 |
ENSMUST00000058370.7
ENSMUST00000175970.1 ENSMUST00000176120.1 |
Ccdc137
|
coiled-coil domain containing 137 |
| chr2_-_157079212 | 2.08 |
ENSMUST00000069098.6
|
Soga1
|
suppressor of glucose, autophagy associated 1 |
| chr15_+_82275197 | 2.07 |
ENSMUST00000116423.1
|
Sept3
|
septin 3 |
| chr2_-_102400257 | 2.05 |
ENSMUST00000152929.1
|
Trim44
|
tripartite motif-containing 44 |
| chr19_-_10101501 | 2.03 |
ENSMUST00000025567.7
|
Fads2
|
fatty acid desaturase 2 |
| chr11_-_120824098 | 1.99 |
ENSMUST00000055655.7
|
Fasn
|
fatty acid synthase |
| chr7_+_80294450 | 1.97 |
ENSMUST00000163812.2
ENSMUST00000047558.7 ENSMUST00000174199.1 ENSMUST00000173824.1 ENSMUST00000174172.1 |
Prc1
|
protein regulator of cytokinesis 1 |
| chr9_+_72662473 | 1.95 |
ENSMUST00000184450.1
ENSMUST00000183375.1 |
Nedd4
|
neural precursor cell expressed, developmentally down-regulated 4 |
| chr2_+_130274437 | 1.93 |
ENSMUST00000141872.1
|
Nop56
|
NOP56 ribonucleoprotein |
| chr1_+_66175272 | 1.93 |
ENSMUST00000156636.2
|
Map2
|
microtubule-associated protein 2 |
| chr9_+_55326913 | 1.93 |
ENSMUST00000085754.3
ENSMUST00000034862.4 |
AI118078
|
expressed sequence AI118078 |
| chr11_+_78178105 | 1.90 |
ENSMUST00000147819.1
|
Tlcd1
|
TLC domain containing 1 |
| chr2_+_25372315 | 1.89 |
ENSMUST00000028329.6
ENSMUST00000114293.2 ENSMUST00000100323.2 |
Sapcd2
|
suppressor APC domain containing 2 |
| chr11_+_72042455 | 1.87 |
ENSMUST00000021164.3
|
Fam64a
|
family with sequence similarity 64, member A |
| chr4_-_116123618 | 1.85 |
ENSMUST00000102704.3
ENSMUST00000102705.3 |
Rad54l
|
RAD54 like (S. cerevisiae) |
| chr1_-_9700209 | 1.85 |
ENSMUST00000088658.4
|
Mybl1
|
myeloblastosis oncogene-like 1 |
| chr18_-_10030017 | 1.85 |
ENSMUST00000116669.1
ENSMUST00000092096.6 |
Usp14
|
ubiquitin specific peptidase 14 |
| chr7_-_4778141 | 1.83 |
ENSMUST00000094892.5
|
Il11
|
interleukin 11 |
| chr4_-_89282152 | 1.83 |
ENSMUST00000060501.4
|
Cdkn2a
|
cyclin-dependent kinase inhibitor 2A |
| chrX_+_73639414 | 1.82 |
ENSMUST00000019701.8
|
Dusp9
|
dual specificity phosphatase 9 |
| chr11_-_33163072 | 1.80 |
ENSMUST00000093201.6
ENSMUST00000101375.4 ENSMUST00000109354.3 ENSMUST00000075641.3 |
Npm1
|
nucleophosmin 1 |
| chr17_-_45685973 | 1.79 |
ENSMUST00000145873.1
|
Tmem63b
|
transmembrane protein 63b |
| chr4_-_82885148 | 1.78 |
ENSMUST00000048430.3
|
Cer1
|
cerberus 1 homolog (Xenopus laevis) |
| chr12_+_117843873 | 1.77 |
ENSMUST00000176735.1
ENSMUST00000177339.1 |
Cdca7l
|
cell division cycle associated 7 like |
| chr16_+_48994185 | 1.77 |
ENSMUST00000117994.1
ENSMUST00000048374.5 |
C330027C09Rik
|
RIKEN cDNA C330027C09 gene |
| chr10_+_111473186 | 1.76 |
ENSMUST00000065917.8
|
Nap1l1
|
nucleosome assembly protein 1-like 1 |
| chrX_+_13071470 | 1.76 |
ENSMUST00000169594.2
|
Usp9x
|
ubiquitin specific peptidase 9, X chromosome |
| chr6_-_87981482 | 1.76 |
ENSMUST00000056403.5
|
H1fx
|
H1 histone family, member X |
| chr17_-_45686120 | 1.75 |
ENSMUST00000143907.1
ENSMUST00000127065.1 |
Tmem63b
|
transmembrane protein 63b |
| chr2_+_32587057 | 1.74 |
ENSMUST00000102818.4
|
St6galnac4
|
ST6 (alpha-N-acetyl-neuraminyl-2,3-beta-galactosyl-1,3)-N-acetylgalactosaminide alpha-2,6-sialyltransferase 4 |
| chr15_-_82244716 | 1.73 |
ENSMUST00000089155.4
ENSMUST00000089157.3 |
Cenpm
|
centromere protein M |
| chr19_+_34922351 | 1.73 |
ENSMUST00000087341.5
|
Kif20b
|
kinesin family member 20B |
| chr4_-_149774238 | 1.73 |
ENSMUST00000105686.2
|
Slc25a33
|
solute carrier family 25, member 33 |
| chr13_-_43304153 | 1.71 |
ENSMUST00000055341.5
|
Gfod1
|
glucose-fructose oxidoreductase domain containing 1 |
| chr7_+_143052739 | 1.70 |
ENSMUST00000037941.9
|
Cd81
|
CD81 antigen |
| chr11_+_3202908 | 1.70 |
ENSMUST00000179770.1
ENSMUST00000110048.1 |
Eif4enif1
|
eukaryotic translation initiation factor 4E nuclear import factor 1 |
| chr1_+_180641330 | 1.69 |
ENSMUST00000085804.5
|
Lin9
|
lin-9 homolog (C. elegans) |
| chr6_+_66535390 | 1.69 |
ENSMUST00000116605.1
|
Mad2l1
|
MAD2 mitotic arrest deficient-like 1 |
| chr15_+_93398344 | 1.68 |
ENSMUST00000109256.3
ENSMUST00000068457.7 ENSMUST00000049122.8 ENSMUST00000165935.1 |
Pphln1
|
periphilin 1 |
| chr5_-_77310049 | 1.67 |
ENSMUST00000047860.8
|
Noa1
|
nitric oxide associated 1 |
| chr17_+_35220834 | 1.66 |
ENSMUST00000118793.1
|
Gm16181
|
predicted gene 16181 |
| chr14_+_73142863 | 1.66 |
ENSMUST00000171767.1
ENSMUST00000163533.1 |
Rcbtb2
|
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
| chr19_-_47050823 | 1.66 |
ENSMUST00000026032.5
|
Pcgf6
|
polycomb group ring finger 6 |
| chr11_+_51619731 | 1.66 |
ENSMUST00000127405.1
|
Nhp2
|
NHP2 ribonucleoprotein |
| chr2_-_154603658 | 1.65 |
ENSMUST00000109703.2
|
Pxmp4
|
peroxisomal membrane protein 4 |
| chr6_+_4902913 | 1.65 |
ENSMUST00000175889.1
ENSMUST00000168998.2 |
Ppp1r9a
|
protein phosphatase 1, regulatory (inhibitor) subunit 9A |
| chr1_+_179803376 | 1.64 |
ENSMUST00000097454.2
|
Gm10518
|
predicted gene 10518 |
| chr2_+_24949747 | 1.63 |
ENSMUST00000028350.3
|
Zmynd19
|
zinc finger, MYND domain containing 19 |
| chr3_+_34020075 | 1.62 |
ENSMUST00000001620.8
ENSMUST00000167354.1 |
Fxr1
|
fragile X mental retardation gene 1, autosomal homolog |
| chr19_+_18670780 | 1.62 |
ENSMUST00000025632.9
|
2410127L17Rik
|
RIKEN cDNA 2410127L17 gene |
| chr7_+_141061274 | 1.61 |
ENSMUST00000048002.5
|
B4galnt4
|
beta-1,4-N-acetyl-galactosaminyl transferase 4 |
| chr2_+_112239468 | 1.61 |
ENSMUST00000028554.3
|
Lpcat4
|
lysophosphatidylcholine acyltransferase 4 |
| chr10_+_40883469 | 1.59 |
ENSMUST00000019975.7
|
Wasf1
|
WAS protein family, member 1 |
| chr18_+_67464849 | 1.59 |
ENSMUST00000025411.7
|
Slmo1
|
slowmo homolog 1 (Drosophila) |
| chr4_+_46450892 | 1.59 |
ENSMUST00000102926.4
|
Anp32b
|
acidic (leucine-rich) nuclear phosphoprotein 32 family, member B |
| chr1_-_55088156 | 1.57 |
ENSMUST00000127861.1
ENSMUST00000144077.1 |
Hspd1
|
heat shock protein 1 (chaperonin) |
| chr17_+_46297917 | 1.57 |
ENSMUST00000166617.1
ENSMUST00000170271.1 |
Dlk2
|
delta-like 2 homolog (Drosophila) |
| chr15_-_81960851 | 1.56 |
ENSMUST00000071462.6
ENSMUST00000023112.5 |
Pmm1
|
phosphomannomutase 1 |
| chr12_+_111166485 | 1.56 |
ENSMUST00000139162.1
|
Traf3
|
TNF receptor-associated factor 3 |
| chr1_+_74713551 | 1.55 |
ENSMUST00000027356.5
|
Cyp27a1
|
cytochrome P450, family 27, subfamily a, polypeptide 1 |
| chr4_-_58911902 | 1.55 |
ENSMUST00000134848.1
ENSMUST00000107557.2 ENSMUST00000149301.1 |
AI314180
|
expressed sequence AI314180 |
| chr2_+_164960809 | 1.55 |
ENSMUST00000124372.1
|
Slc12a5
|
solute carrier family 12, member 5 |
| chr7_-_122132844 | 1.55 |
ENSMUST00000106469.1
ENSMUST00000063587.6 ENSMUST00000106468.1 ENSMUST00000130149.1 ENSMUST00000098068.3 |
Palb2
|
partner and localizer of BRCA2 |
| chr2_+_130274424 | 1.53 |
ENSMUST00000103198.4
|
Nop56
|
NOP56 ribonucleoprotein |
| chr10_+_4611971 | 1.53 |
ENSMUST00000105590.1
ENSMUST00000067086.7 |
Esr1
|
estrogen receptor 1 (alpha) |
| chr7_-_127026479 | 1.53 |
ENSMUST00000032916.4
|
Maz
|
MYC-associated zinc finger protein (purine-binding transcription factor) |
| chr1_-_55088024 | 1.53 |
ENSMUST00000027123.8
|
Hspd1
|
heat shock protein 1 (chaperonin) |
| chr11_-_120784183 | 1.52 |
ENSMUST00000026156.7
|
Rfng
|
RFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
| chr17_-_34628005 | 1.51 |
ENSMUST00000166040.2
|
Ppt2
|
palmitoyl-protein thioesterase 2 |
| chr14_-_87141206 | 1.51 |
ENSMUST00000022599.7
|
Diap3
|
diaphanous homolog 3 (Drosophila) |
| chr18_-_70530313 | 1.51 |
ENSMUST00000043286.8
|
Poli
|
polymerase (DNA directed), iota |
| chr2_+_150909565 | 1.50 |
ENSMUST00000028948.4
|
Gins1
|
GINS complex subunit 1 (Psf1 homolog) |
| chr14_-_87141114 | 1.50 |
ENSMUST00000168889.1
|
Diap3
|
diaphanous homolog 3 (Drosophila) |
| chr15_-_78773452 | 1.49 |
ENSMUST00000018313.5
|
Mfng
|
MFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
| chr16_-_17144415 | 1.49 |
ENSMUST00000115709.1
|
Ccdc116
|
coiled-coil domain containing 116 |
| chr15_-_76710486 | 1.48 |
ENSMUST00000036852.7
|
Recql4
|
RecQ protein-like 4 |
| chr5_-_134688568 | 1.48 |
ENSMUST00000015137.3
|
Limk1
|
LIM-domain containing, protein kinase |
| chr17_-_74294834 | 1.48 |
ENSMUST00000078459.6
|
Memo1
|
mediator of cell motility 1 |
| chrX_+_99821021 | 1.48 |
ENSMUST00000096363.2
|
Tmem28
|
transmembrane protein 28 |
| chr11_-_72207413 | 1.47 |
ENSMUST00000108505.1
|
4933427D14Rik
|
RIKEN cDNA 4933427D14 gene |
| chr6_+_66535418 | 1.46 |
ENSMUST00000101343.1
|
Mad2l1
|
MAD2 mitotic arrest deficient-like 1 |
| chr11_+_50237002 | 1.45 |
ENSMUST00000180443.1
|
Gm26542
|
predicted gene, 26542 |
| chr10_+_128377086 | 1.45 |
ENSMUST00000014642.3
|
Ankrd52
|
ankyrin repeat domain 52 |
| chr18_+_10725651 | 1.45 |
ENSMUST00000165555.1
|
Mib1
|
mindbomb homolog 1 (Drosophila) |
| chr2_+_181680284 | 1.45 |
ENSMUST00000103042.3
|
Tcea2
|
transcription elongation factor A (SII), 2 |
| chr11_-_5099084 | 1.44 |
ENSMUST00000063232.6
|
Ewsr1
|
Ewing sarcoma breakpoint region 1 |
| chr11_-_120990871 | 1.42 |
ENSMUST00000154483.1
|
Csnk1d
|
casein kinase 1, delta |
| chr8_-_53638945 | 1.41 |
ENSMUST00000047768.4
|
Neil3
|
nei like 3 (E. coli) |
| chr11_-_119547744 | 1.41 |
ENSMUST00000026670.4
|
Nptx1
|
neuronal pentraxin 1 |
| chr9_+_65587149 | 1.41 |
ENSMUST00000134538.1
ENSMUST00000136205.1 |
Pif1
|
PIF1 5'-to-3' DNA helicase homolog (S. cerevisiae) |
| chr13_+_12395362 | 1.40 |
ENSMUST00000059270.8
|
Heatr1
|
HEAT repeat containing 1 |
| chr8_-_84687839 | 1.40 |
ENSMUST00000001975.4
|
Nacc1
|
nucleus accumbens associated 1, BEN and BTB (POZ) domain containing |
| chr7_-_80401707 | 1.40 |
ENSMUST00000120753.1
|
Furin
|
furin (paired basic amino acid cleaving enzyme) |
| chr12_+_109459843 | 1.39 |
ENSMUST00000173812.1
|
Dlk1
|
delta-like 1 homolog (Drosophila) |
| chr2_-_181135220 | 1.39 |
ENSMUST00000016491.7
|
Kcnq2
|
potassium voltage-gated channel, subfamily Q, member 2 |
| chr10_+_80261457 | 1.39 |
ENSMUST00000156935.1
|
Dazap1
|
DAZ associated protein 1 |
| chr11_-_69822144 | 1.38 |
ENSMUST00000045771.6
|
Spem1
|
sperm maturation 1 |
| chr11_+_117849223 | 1.38 |
ENSMUST00000081387.4
|
Birc5
|
baculoviral IAP repeat-containing 5 |
| chr11_+_77930800 | 1.37 |
ENSMUST00000093995.3
ENSMUST00000000646.7 |
Sez6
|
seizure related gene 6 |
| chr17_-_35000848 | 1.37 |
ENSMUST00000166828.3
|
D17H6S56E-5
|
DNA segment, Chr 17, human D6S56E 5 |
| chr5_-_96161990 | 1.36 |
ENSMUST00000155901.1
|
Cnot6l
|
CCR4-NOT transcription complex, subunit 6-like |
| chrX_-_7947763 | 1.36 |
ENSMUST00000154244.1
|
Hdac6
|
histone deacetylase 6 |
| chr9_+_92542223 | 1.35 |
ENSMUST00000070522.7
ENSMUST00000160359.1 |
Plod2
|
procollagen lysine, 2-oxoglutarate 5-dioxygenase 2 |
| chr18_+_24709436 | 1.35 |
ENSMUST00000037097.7
|
Fhod3
|
formin homology 2 domain containing 3 |
| chr2_+_25242929 | 1.35 |
ENSMUST00000114355.1
ENSMUST00000060818.1 |
Rnf208
|
ring finger protein 208 |
| chr9_+_70679016 | 1.35 |
ENSMUST00000144537.1
|
Adam10
|
a disintegrin and metallopeptidase domain 10 |
| chr19_-_4191035 | 1.34 |
ENSMUST00000045864.2
|
Tbc1d10c
|
TBC1 domain family, member 10c |
| chr15_-_98934522 | 1.34 |
ENSMUST00000077577.7
|
Tuba1b
|
tubulin, alpha 1B |
| chr17_-_31658729 | 1.33 |
ENSMUST00000166526.1
ENSMUST00000014684.4 |
U2af1
|
U2 small nuclear ribonucleoprotein auxiliary factor (U2AF) 1 |
| chr7_+_29309429 | 1.33 |
ENSMUST00000137848.1
|
Dpf1
|
D4, zinc and double PHD fingers family 1 |
| chr5_-_34169409 | 1.33 |
ENSMUST00000060049.6
ENSMUST00000042954.7 |
Haus3
Poln
|
HAUS augmin-like complex, subunit 3 DNA polymerase N |
| chr8_-_123318553 | 1.33 |
ENSMUST00000118395.1
ENSMUST00000035495.8 |
Fanca
|
Fanconi anemia, complementation group A |
| chr11_-_11808923 | 1.33 |
ENSMUST00000109664.1
ENSMUST00000150714.1 ENSMUST00000047689.4 ENSMUST00000171938.1 ENSMUST00000171080.1 |
Fignl1
|
fidgetin-like 1 |
| chr11_+_78301529 | 1.32 |
ENSMUST00000045026.3
|
Spag5
|
sperm associated antigen 5 |
| chr6_+_124830217 | 1.32 |
ENSMUST00000131847.1
ENSMUST00000151674.1 |
Cdca3
|
cell division cycle associated 3 |
| chr16_+_35983424 | 1.32 |
ENSMUST00000173555.1
|
Kpna1
|
karyopherin (importin) alpha 1 |
| chr3_+_82358056 | 1.32 |
ENSMUST00000091014.4
|
Map9
|
microtubule-associated protein 9 |
| chr7_+_29289300 | 1.32 |
ENSMUST00000048187.4
|
Ppp1r14a
|
protein phosphatase 1, regulatory (inhibitor) subunit 14A |
| chr9_-_78480736 | 1.31 |
ENSMUST00000156988.1
|
Eef1a1
|
eukaryotic translation elongation factor 1 alpha 1 |
| chr7_-_97417730 | 1.31 |
ENSMUST00000043077.7
|
Thrsp
|
thyroid hormone responsive |
| chr8_-_84969412 | 1.31 |
ENSMUST00000147812.1
|
Rnaseh2a
|
ribonuclease H2, large subunit |
| chr8_+_109868586 | 1.31 |
ENSMUST00000179721.1
ENSMUST00000034175.4 |
Phlpp2
|
PH domain and leucine rich repeat protein phosphatase 2 |
| chr10_+_79793553 | 1.30 |
ENSMUST00000046945.6
ENSMUST00000105379.2 |
Palm
|
paralemmin |
| chr16_-_4003750 | 1.30 |
ENSMUST00000171658.1
ENSMUST00000171762.1 |
Slx4
|
SLX4 structure-specific endonuclease subunit homolog (S. cerevisiae) |
| chr9_+_65587187 | 1.30 |
ENSMUST00000047099.5
ENSMUST00000131483.1 ENSMUST00000141046.1 |
Pif1
|
PIF1 5'-to-3' DNA helicase homolog (S. cerevisiae) |
| chr12_+_109452833 | 1.29 |
ENSMUST00000056110.8
|
Dlk1
|
delta-like 1 homolog (Drosophila) |
| chrX_+_100625737 | 1.28 |
ENSMUST00000048962.3
|
Kif4
|
kinesin family member 4 |
| chr9_-_78481724 | 1.28 |
ENSMUST00000042235.8
|
Eef1a1
|
eukaryotic translation elongation factor 1 alpha 1 |
| chr12_-_100520778 | 1.27 |
ENSMUST00000062957.6
|
Ttc7b
|
tetratricopeptide repeat domain 7B |
| chr19_+_4214238 | 1.26 |
ENSMUST00000046506.6
|
Clcf1
|
cardiotrophin-like cytokine factor 1 |
| chr11_+_29130733 | 1.26 |
ENSMUST00000020756.8
|
Pnpt1
|
polyribonucleotide nucleotidyltransferase 1 |
| chr2_+_30286406 | 1.26 |
ENSMUST00000138666.1
ENSMUST00000113634.2 |
Nup188
|
nucleoporin 188 |
| chr9_-_123260776 | 1.26 |
ENSMUST00000068140.4
|
Tmem158
|
transmembrane protein 158 |
| chr11_+_87595646 | 1.26 |
ENSMUST00000134216.1
|
Mtmr4
|
myotubularin related protein 4 |
| chr18_+_65581704 | 1.25 |
ENSMUST00000182979.1
|
Zfp532
|
zinc finger protein 532 |
| chrX_+_104482774 | 1.25 |
ENSMUST00000087867.5
|
Uprt
|
uracil phosphoribosyltransferase (FUR1) homolog (S. cerevisiae) |
| chr5_+_147077346 | 1.25 |
ENSMUST00000110557.1
|
Polr1d
|
polymerase (RNA) I polypeptide D |
| chr17_+_56040350 | 1.24 |
ENSMUST00000002914.8
|
Chaf1a
|
chromatin assembly factor 1, subunit A (p150) |
| chr17_-_34628380 | 1.24 |
ENSMUST00000167097.2
|
Ppt2
|
palmitoyl-protein thioesterase 2 |
| chr13_+_3478226 | 1.24 |
ENSMUST00000181708.1
ENSMUST00000180836.1 ENSMUST00000180567.1 |
2810429I04Rik
|
RIKEN cDNA 2810429I04 gene |
| chr11_+_76217608 | 1.23 |
ENSMUST00000040806.4
|
Dbil5
|
diazepam binding inhibitor-like 5 |
| chr8_-_95888510 | 1.23 |
ENSMUST00000034097.7
|
Got2
|
glutamate oxaloacetate transaminase 2, mitochondrial |
| chr12_+_87026286 | 1.23 |
ENSMUST00000146292.1
|
Tmem63c
|
transmembrane protein 63c |
| chr4_+_21931291 | 1.23 |
ENSMUST00000029908.7
|
Faxc
|
failed axon connections homolog (Drosophila) |
| chr14_-_57664954 | 1.23 |
ENSMUST00000089482.5
|
Xpo4
|
exportin 4 |
| chr11_+_3202612 | 1.22 |
ENSMUST00000110049.1
|
Eif4enif1
|
eukaryotic translation initiation factor 4E nuclear import factor 1 |
| chr4_+_11156411 | 1.22 |
ENSMUST00000029865.3
|
Trp53inp1
|
transformation related protein 53 inducible nuclear protein 1 |
| chr1_+_156558759 | 1.22 |
ENSMUST00000173929.1
|
Abl2
|
v-abl Abelson murine leukemia viral oncogene 2 (arg, Abelson-related gene) |
| chr9_+_59680144 | 1.22 |
ENSMUST00000123914.1
|
Gramd2
|
GRAM domain containing 2 |
| chr5_+_144768536 | 1.22 |
ENSMUST00000128550.1
|
Trrap
|
transformation/transcription domain-associated protein |
| chr1_+_172312367 | 1.22 |
ENSMUST00000039506.9
|
Igsf8
|
immunoglobulin superfamily, member 8 |
| chr14_-_60251473 | 1.22 |
ENSMUST00000041905.6
|
Nupl1
|
nucleoporin like 1 |
| chr2_+_163054682 | 1.21 |
ENSMUST00000018005.3
|
Mybl2
|
myeloblastosis oncogene-like 2 |
| chr2_-_102400863 | 1.21 |
ENSMUST00000102573.1
|
Trim44
|
tripartite motif-containing 44 |
| chr14_-_47276790 | 1.21 |
ENSMUST00000111792.1
ENSMUST00000111791.1 ENSMUST00000111790.1 |
Wdhd1
|
WD repeat and HMG-box DNA binding protein 1 |
| chr6_+_35177386 | 1.21 |
ENSMUST00000043815.9
|
Nup205
|
nucleoporin 205 |
| chr14_+_73143046 | 1.20 |
ENSMUST00000170677.1
ENSMUST00000167401.1 |
Rcbtb2
|
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
| chr19_-_41802028 | 1.20 |
ENSMUST00000026150.8
ENSMUST00000177495.1 ENSMUST00000163265.1 |
Arhgap19
|
Rho GTPase activating protein 19 |
| chr16_-_55895279 | 1.20 |
ENSMUST00000099705.3
|
Nxpe3
|
neurexophilin and PC-esterase domain family, member 3 |
| chr10_+_40883819 | 1.20 |
ENSMUST00000105509.1
|
Wasf1
|
WAS protein family, member 1 |
| chr17_-_34627365 | 1.20 |
ENSMUST00000064953.8
ENSMUST00000170345.1 ENSMUST00000171121.2 ENSMUST00000168391.2 ENSMUST00000169067.2 |
Ppt2
|
palmitoyl-protein thioesterase 2 |
| chr1_-_179803625 | 1.20 |
ENSMUST00000027768.7
|
Ahctf1
|
AT hook containing transcription factor 1 |
| chr17_-_28622479 | 1.20 |
ENSMUST00000130643.1
|
Srpk1
|
serine/arginine-rich protein specific kinase 1 |
| chr11_+_78178651 | 1.19 |
ENSMUST00000092880.7
ENSMUST00000127587.1 ENSMUST00000108338.1 |
Tlcd1
|
TLC domain containing 1 |
| chrX_+_164980592 | 1.19 |
ENSMUST00000101082.4
ENSMUST00000167446.1 ENSMUST00000057150.6 |
Fancb
|
Fanconi anemia, complementation group B |
| chr1_+_191718389 | 1.19 |
ENSMUST00000110856.1
ENSMUST00000130876.1 |
Lpgat1
|
lysophosphatidylglycerol acyltransferase 1 |
| chr5_+_33820695 | 1.18 |
ENSMUST00000075812.4
ENSMUST00000114397.2 ENSMUST00000155880.1 |
Whsc1
|
Wolf-Hirschhorn syndrome candidate 1 (human) |
| chr12_-_99883429 | 1.18 |
ENSMUST00000046485.3
|
Efcab11
|
EF-hand calcium binding domain 11 |
| chr13_-_24761440 | 1.18 |
ENSMUST00000176890.1
ENSMUST00000175689.1 |
Gmnn
|
geminin |
| chr12_+_117843489 | 1.18 |
ENSMUST00000021592.9
|
Cdca7l
|
cell division cycle associated 7 like |
| chr10_+_127677064 | 1.18 |
ENSMUST00000118612.1
ENSMUST00000048099.4 |
Tmem194
|
transmembrane protein 194 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 3.2 | GO:0000448 | cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
| 1.1 | 3.2 | GO:0070845 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 1.0 | 5.2 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 1.0 | 3.1 | GO:0002842 | positive regulation of T cell mediated immune response to tumor cell(GO:0002842) |
| 0.9 | 2.8 | GO:1904049 | negative regulation of spontaneous neurotransmitter secretion(GO:1904049) |
| 0.9 | 2.6 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.8 | 2.5 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
| 0.7 | 2.2 | GO:1904760 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 0.7 | 2.0 | GO:0010705 | meiotic DNA double-strand break processing involved in reciprocal meiotic recombination(GO:0010705) |
| 0.7 | 3.4 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.6 | 2.6 | GO:0099527 | postsynapse to nucleus signaling pathway(GO:0099527) |
| 0.6 | 3.2 | GO:1902412 | regulation of mitotic cytokinesis(GO:1902412) |
| 0.6 | 3.2 | GO:0032902 | nerve growth factor production(GO:0032902) |
| 0.6 | 1.9 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.6 | 1.2 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.6 | 2.4 | GO:0071047 | nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.6 | 4.2 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.6 | 5.2 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.6 | 3.4 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.6 | 3.9 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.5 | 8.2 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
| 0.5 | 4.9 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.5 | 4.3 | GO:2000232 | regulation of rRNA processing(GO:2000232) |
| 0.5 | 1.6 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.5 | 1.6 | GO:0006532 | aspartate biosynthetic process(GO:0006532) aspartate catabolic process(GO:0006533) |
| 0.5 | 2.1 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.5 | 1.6 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.5 | 3.1 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.5 | 1.5 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.5 | 5.4 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.5 | 2.9 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.5 | 2.4 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.5 | 1.5 | GO:2000793 | cell proliferation involved in heart valve development(GO:2000793) |
| 0.5 | 1.0 | GO:2000371 | regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.5 | 0.5 | GO:0032796 | uropod organization(GO:0032796) |
| 0.5 | 3.8 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.5 | 0.5 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.5 | 0.5 | GO:1904882 | establishment of RNA localization to telomere(GO:0097694) telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.5 | 1.8 | GO:0060857 | establishment of glial blood-brain barrier(GO:0060857) |
| 0.4 | 0.9 | GO:1904976 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.4 | 0.9 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.4 | 1.3 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.4 | 1.3 | GO:1901254 | regulation of translation at synapse, modulating synaptic transmission(GO:0099547) regulation of translation at postsynapse, modulating synaptic transmission(GO:0099578) positive regulation of intracellular transport of viral material(GO:1901254) |
| 0.4 | 1.7 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
| 0.4 | 1.7 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.4 | 1.7 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.4 | 1.3 | GO:0043397 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
| 0.4 | 1.3 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.4 | 1.7 | GO:0044268 | multicellular organismal protein metabolic process(GO:0044268) |
| 0.4 | 1.2 | GO:0006222 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.4 | 2.5 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.4 | 1.6 | GO:1904529 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.4 | 2.4 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.4 | 1.6 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
| 0.4 | 3.6 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.4 | 2.4 | GO:1903182 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.4 | 2.0 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.4 | 1.2 | GO:1900673 | olefin metabolic process(GO:1900673) |
| 0.4 | 1.2 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.4 | 1.2 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.4 | 1.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.4 | 2.6 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.4 | 0.4 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.4 | 1.1 | GO:0006272 | leading strand elongation(GO:0006272) |
| 0.4 | 1.1 | GO:0042823 | pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.4 | 0.4 | GO:1900369 | negative regulation of RNA interference(GO:1900369) |
| 0.4 | 2.2 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.4 | 1.4 | GO:0003349 | epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.4 | 2.5 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.4 | 1.1 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.4 | 1.4 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.4 | 1.1 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.4 | 1.4 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.4 | 2.8 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.4 | 1.1 | GO:1905223 | epicardium morphogenesis(GO:1905223) |
| 0.3 | 2.4 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.3 | 1.0 | GO:0031591 | wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
| 0.3 | 1.0 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.3 | 1.4 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.3 | 1.0 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.3 | 0.7 | GO:0051325 | interphase(GO:0051325) mitotic interphase(GO:0051329) |
| 0.3 | 2.0 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 0.3 | 1.0 | GO:0001180 | transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
| 0.3 | 0.7 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
| 0.3 | 1.0 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.3 | 1.9 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.3 | 1.3 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.3 | 0.9 | GO:0021636 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.3 | 0.6 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.3 | 2.8 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.3 | 2.5 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.3 | 0.9 | GO:0071929 | alpha-tubulin acetylation(GO:0071929) |
| 0.3 | 1.3 | GO:0060709 | glycogen cell differentiation involved in embryonic placenta development(GO:0060709) |
| 0.3 | 1.2 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.3 | 2.5 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.3 | 2.5 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.3 | 0.9 | GO:1903504 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.3 | 0.9 | GO:1902277 | negative regulation of pancreatic amylase secretion(GO:1902277) |
| 0.3 | 0.9 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.3 | 1.2 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.3 | 8.8 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.3 | 2.1 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 0.3 | 0.9 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.3 | 1.5 | GO:0009157 | pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 0.3 | 1.2 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.3 | 2.4 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.3 | 1.5 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.3 | 2.9 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.3 | 1.2 | GO:0070829 | heterochromatin maintenance(GO:0070829) |
| 0.3 | 0.9 | GO:0051316 | attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
| 0.3 | 4.6 | GO:1904874 | positive regulation of telomerase RNA localization to Cajal body(GO:1904874) |
| 0.3 | 0.6 | GO:1903972 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
| 0.3 | 1.4 | GO:1904352 | positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.3 | 1.4 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.3 | 0.5 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.3 | 1.4 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.3 | 0.8 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.3 | 0.3 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.3 | 0.8 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
| 0.3 | 0.8 | GO:0016072 | rRNA metabolic process(GO:0016072) |
| 0.3 | 0.8 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.3 | 1.9 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.3 | 1.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.3 | 2.1 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.3 | 1.3 | GO:0042117 | monocyte activation(GO:0042117) |
| 0.3 | 2.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.3 | 0.8 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.3 | 1.6 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.3 | 0.8 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.3 | 0.5 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 0.3 | 0.8 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.3 | 0.5 | GO:0015965 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.3 | 6.2 | GO:0031571 | mitotic G1 DNA damage checkpoint(GO:0031571) |
| 0.3 | 1.3 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.3 | 2.8 | GO:0099628 | receptor diffusion trapping(GO:0098953) postsynaptic neurotransmitter receptor diffusion trapping(GO:0098970) neurotransmitter receptor diffusion trapping(GO:0099628) |
| 0.3 | 1.0 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
| 0.3 | 0.8 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.3 | 1.5 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.3 | 0.5 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.3 | 0.8 | GO:0060821 | inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.3 | 1.5 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.3 | 2.5 | GO:0042637 | catagen(GO:0042637) |
| 0.3 | 1.0 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.3 | 1.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.3 | 0.3 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
| 0.2 | 0.2 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
| 0.2 | 0.2 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.2 | 0.5 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
| 0.2 | 1.7 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.2 | 0.7 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.2 | 1.2 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.2 | 4.7 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.2 | 1.0 | GO:0051595 | response to methylglyoxal(GO:0051595) |
| 0.2 | 0.2 | GO:1904809 | dense core granule localization(GO:0032253) dense core granule transport(GO:1901950) regulation of dense core granule transport(GO:1904809) positive regulation of dense core granule transport(GO:1904811) |
| 0.2 | 0.5 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.2 | 1.5 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.2 | 1.2 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.2 | 1.0 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.2 | 0.7 | GO:0048936 | neurofilament bundle assembly(GO:0033693) peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.2 | 4.6 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.2 | 0.7 | GO:2000229 | pancreatic stellate cell proliferation(GO:0072343) regulation of pancreatic stellate cell proliferation(GO:2000229) |
| 0.2 | 0.7 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 0.2 | 1.2 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
| 0.2 | 0.7 | GO:0031662 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
| 0.2 | 1.4 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.2 | 3.0 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.2 | 0.9 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.2 | 0.7 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.2 | 1.9 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.2 | 2.8 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
| 0.2 | 1.2 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
| 0.2 | 2.8 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 0.2 | 0.9 | GO:0070859 | positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
| 0.2 | 0.5 | GO:0033624 | negative regulation of integrin activation(GO:0033624) |
| 0.2 | 0.5 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.2 | 0.5 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.2 | 0.9 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
| 0.2 | 4.5 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
| 0.2 | 1.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.2 | 0.7 | GO:0019389 | glucuronoside metabolic process(GO:0019389) |
| 0.2 | 3.6 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.2 | 6.4 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.2 | 0.9 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
| 0.2 | 2.6 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.2 | 1.5 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.2 | 1.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.2 | 0.9 | GO:0018201 | peptidyl-glycine modification(GO:0018201) |
| 0.2 | 1.1 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
| 0.2 | 1.9 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.2 | 0.4 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.2 | 0.4 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
| 0.2 | 0.8 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.2 | 5.0 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.2 | 0.6 | GO:1990859 | cellular response to endothelin(GO:1990859) |
| 0.2 | 0.6 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.2 | 0.4 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
| 0.2 | 0.8 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.2 | 1.4 | GO:0060613 | fat pad development(GO:0060613) |
| 0.2 | 0.6 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.2 | 1.2 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.2 | 0.6 | GO:0016598 | protein arginylation(GO:0016598) |
| 0.2 | 0.6 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
| 0.2 | 0.8 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.2 | 0.6 | GO:0032826 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
| 0.2 | 0.8 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.2 | 0.8 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
| 0.2 | 0.4 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.2 | 1.6 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
| 0.2 | 1.4 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.2 | 0.4 | GO:2000584 | regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
| 0.2 | 1.4 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.2 | 0.8 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.2 | 1.0 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.2 | 0.4 | GO:0042762 | regulation of sulfur metabolic process(GO:0042762) |
| 0.2 | 4.9 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.2 | 0.8 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.2 | 3.5 | GO:0031577 | spindle checkpoint(GO:0031577) |
| 0.2 | 0.8 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.2 | 0.4 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.2 | 0.2 | GO:0032278 | positive regulation of gonadotropin secretion(GO:0032278) |
| 0.2 | 0.6 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.2 | 2.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.2 | 0.4 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.2 | 0.4 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.2 | 3.4 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.2 | 0.2 | GO:1904412 | regulation of cardiac ventricle development(GO:1904412) |
| 0.2 | 7.1 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.2 | 0.6 | GO:0003360 | brainstem development(GO:0003360) |
| 0.2 | 0.6 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.2 | 0.7 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
| 0.2 | 1.3 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.2 | 1.7 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.2 | 0.6 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.2 | 0.4 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.2 | 0.7 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
| 0.2 | 1.1 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.2 | 0.5 | GO:1902339 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.2 | 0.4 | GO:0071287 | cellular response to manganese ion(GO:0071287) |
| 0.2 | 0.5 | GO:0015881 | creatine transport(GO:0015881) |
| 0.2 | 0.5 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.2 | 0.2 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.2 | 3.2 | GO:0010766 | negative regulation of sodium ion transport(GO:0010766) |
| 0.2 | 0.2 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.2 | 0.2 | GO:0021559 | trigeminal nerve development(GO:0021559) |
| 0.2 | 0.9 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.2 | 4.6 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.2 | 5.6 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.2 | 0.4 | GO:0001743 | optic placode formation(GO:0001743) |
| 0.2 | 0.2 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.2 | 0.9 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
| 0.2 | 1.4 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.2 | 1.0 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.2 | 1.0 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.2 | 0.7 | GO:0031161 | phosphatidylinositol catabolic process(GO:0031161) |
| 0.2 | 0.7 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.2 | 0.5 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.2 | 1.7 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.2 | 1.0 | GO:0001757 | somite specification(GO:0001757) |
| 0.2 | 0.7 | GO:0046898 | response to cycloheximide(GO:0046898) |
| 0.2 | 0.8 | GO:0015788 | UDP-N-acetylglucosamine transport(GO:0015788) |
| 0.2 | 1.0 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.2 | 0.7 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.2 | 0.2 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.2 | 0.5 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 0.2 | 0.5 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.2 | 0.2 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.2 | 0.7 | GO:0097298 | regulation of nucleus size(GO:0097298) |
| 0.2 | 1.0 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.2 | 0.5 | GO:2000616 | negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.2 | 1.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.2 | 0.6 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.2 | 1.1 | GO:0016246 | RNA interference(GO:0016246) |
| 0.2 | 0.8 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.2 | 2.7 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.2 | 0.2 | GO:1901663 | quinone biosynthetic process(GO:1901663) |
| 0.2 | 0.5 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.2 | 0.6 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.2 | 0.8 | GO:1904953 | Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904953) |
| 0.2 | 2.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.2 | 0.9 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
| 0.2 | 0.5 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.2 | 1.7 | GO:0036315 | cellular response to sterol(GO:0036315) |
| 0.2 | 0.5 | GO:0003192 | mitral valve formation(GO:0003192) |
| 0.2 | 0.3 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.2 | 2.2 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.2 | 0.5 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.2 | 0.5 | GO:0032916 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) positive regulation of transforming growth factor beta3 production(GO:0032916) |
| 0.2 | 0.6 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.2 | 0.5 | GO:0060382 | regulation of DNA strand elongation(GO:0060382) |
| 0.2 | 0.2 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.2 | 0.6 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.2 | 0.6 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.2 | 1.2 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.2 | 0.8 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.2 | 1.1 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.2 | 0.8 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.2 | 0.6 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.2 | 0.6 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
| 0.1 | 0.7 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 | 0.4 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 4.2 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.1 | 0.3 | GO:1902415 | regulation of mRNA binding(GO:1902415) positive regulation of RNA binding(GO:1905216) |
| 0.1 | 1.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.3 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
| 0.1 | 0.4 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.1 | 0.6 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 | 0.3 | GO:2000620 | positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.1 | 0.3 | GO:0032570 | response to progesterone(GO:0032570) |
| 0.1 | 0.7 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.1 | 0.7 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.1 | 0.7 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.1 | 0.3 | GO:0043133 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
| 0.1 | 0.6 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 | 1.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 2.0 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.1 | 0.7 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
| 0.1 | 0.9 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.1 | 1.3 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 | 0.4 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
| 0.1 | 0.9 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.1 | 0.9 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 0.6 | GO:0019323 | pentose catabolic process(GO:0019323) |
| 0.1 | 2.3 | GO:0007091 | metaphase/anaphase transition of mitotic cell cycle(GO:0007091) |
| 0.1 | 1.1 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.1 | 3.4 | GO:0046852 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.1 | 0.3 | GO:0036120 | cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.1 | 0.4 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 0.6 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.1 | 0.1 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.1 | 0.6 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.1 | 0.7 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.1 | 0.7 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.1 | 0.5 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.1 | 0.3 | GO:0040010 | positive regulation of growth rate(GO:0040010) |
| 0.1 | 0.5 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.1 | 2.3 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.1 | 0.4 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.1 | 1.4 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 | 0.5 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.1 | 0.7 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.1 | 0.9 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 1.3 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 | 0.3 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 | 0.7 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.1 | 0.5 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 | 0.9 | GO:0015862 | uridine transport(GO:0015862) |
| 0.1 | 6.7 | GO:0006414 | translational elongation(GO:0006414) |
| 0.1 | 0.5 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
| 0.1 | 0.4 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.1 | 0.5 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.1 | 0.7 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.1 | 0.7 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 1.2 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.1 | 0.9 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.1 | 1.3 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.1 | 1.0 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.1 | 0.3 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 | 0.9 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.1 | 1.8 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
| 0.1 | 1.0 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 | 1.0 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.1 | 0.8 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
| 0.1 | 1.7 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.1 | 0.8 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.1 | 0.4 | GO:0051030 | snRNA transport(GO:0051030) |
| 0.1 | 0.5 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.1 | 0.3 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.1 | 0.4 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.1 | 0.5 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.1 | 0.4 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.1 | 0.4 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
| 0.1 | 0.4 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.1 | 0.6 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.1 | 0.5 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 2.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.1 | 0.5 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 | 0.1 | GO:0006531 | aspartate metabolic process(GO:0006531) |
| 0.1 | 0.5 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.1 | 0.5 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.7 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.1 | 0.2 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.1 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.1 | 2.7 | GO:0000070 | mitotic sister chromatid segregation(GO:0000070) |
| 0.1 | 0.2 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.1 | 0.6 | GO:0097680 | cellular hyperosmotic salinity response(GO:0071475) double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 | 0.6 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.1 | 4.8 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 | 0.5 | GO:1903027 | regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
| 0.1 | 0.8 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
| 0.1 | 1.5 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.1 | 0.5 | GO:2000317 | negative regulation of T-helper 17 type immune response(GO:2000317) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
| 0.1 | 1.3 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 | 0.4 | GO:1904100 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 0.1 | 0.7 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.1 | 0.5 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.1 | 13.6 | GO:0042254 | ribosome biogenesis(GO:0042254) |
| 0.1 | 0.8 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 | 0.1 | GO:0019405 | alditol catabolic process(GO:0019405) |
| 0.1 | 0.2 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.1 | 1.8 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.1 | 0.5 | GO:0001887 | selenium compound metabolic process(GO:0001887) selenocysteine metabolic process(GO:0016259) |
| 0.1 | 0.8 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.1 | 0.3 | GO:0099542 | trans-synaptic signaling by lipid(GO:0099541) trans-synaptic signaling by endocannabinoid(GO:0099542) |
| 0.1 | 0.5 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 1.6 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.6 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
| 0.1 | 0.2 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.1 | 0.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 0.7 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.1 | 0.3 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.1 | 0.3 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.1 | 0.2 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.1 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 0.1 | GO:0051542 | elastin biosynthetic process(GO:0051542) |
| 0.1 | 0.2 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 0.1 | 2.6 | GO:0060746 | parental behavior(GO:0060746) |
| 0.1 | 0.4 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 | 1.3 | GO:0044380 | protein localization to cytoskeleton(GO:0044380) |
| 0.1 | 0.4 | GO:0018202 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.1 | 0.2 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.1 | 0.7 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
| 0.1 | 1.0 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 | 1.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.1 | 0.4 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 | 0.4 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.1 | 0.4 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 | 4.5 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
| 0.1 | 0.3 | GO:0060220 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) camera-type eye photoreceptor cell fate commitment(GO:0060220) |
| 0.1 | 0.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.1 | 0.9 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
| 0.1 | 1.0 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.1 | 1.7 | GO:0031424 | keratinization(GO:0031424) |
| 0.1 | 0.5 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.1 | 1.6 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.1 | 2.4 | GO:0000305 | response to oxygen radical(GO:0000305) |
| 0.1 | 0.7 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.1 | 0.6 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.1 | 1.2 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
| 0.1 | 0.1 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 | 0.2 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 0.4 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.1 | 1.9 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.1 | 0.3 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.1 | 0.1 | GO:0003245 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.1 | 0.4 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.1 | 0.2 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 1.0 | GO:1902583 | intracellular transport of virus(GO:0075733) multi-organism intracellular transport(GO:1902583) |
| 0.1 | 0.3 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 | 0.4 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 1.1 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.1 | 0.4 | GO:0051866 | general adaptation syndrome(GO:0051866) |
| 0.1 | 0.2 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
| 0.1 | 0.4 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.1 | 0.4 | GO:0030202 | heparin metabolic process(GO:0030202) |
| 0.1 | 0.5 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.1 | 0.4 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 | 0.5 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.1 | 2.3 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.1 | 1.6 | GO:0051983 | regulation of chromosome segregation(GO:0051983) |
| 0.1 | 0.5 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 0.1 | GO:0032242 | regulation of nucleoside transport(GO:0032242) |
| 0.1 | 0.3 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 | 0.9 | GO:0080111 | DNA demethylation(GO:0080111) |
| 0.1 | 0.4 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.1 | 0.7 | GO:2000779 | regulation of double-strand break repair(GO:2000779) |
| 0.1 | 0.4 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 | 0.7 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
| 0.1 | 0.3 | GO:0090204 | protein localization to nuclear pore(GO:0090204) |
| 0.1 | 0.4 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.1 | 0.5 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
| 0.1 | 0.2 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.1 | 0.7 | GO:0006596 | polyamine biosynthetic process(GO:0006596) |
| 0.1 | 0.2 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.1 | 0.3 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.1 | 0.1 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.1 | 2.5 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.1 | 0.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.1 | 0.7 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.1 | 0.7 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.1 | 0.7 | GO:2001197 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.1 | 0.3 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.1 | 0.2 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.1 | 0.4 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 | 0.5 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.1 | 0.8 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.1 | 1.8 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.1 | 0.8 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.1 | 0.4 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.1 | 1.4 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.1 | 0.8 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 | 0.5 | GO:1902808 | positive regulation of cell cycle G1/S phase transition(GO:1902808) |
| 0.1 | 2.0 | GO:0046039 | GTP metabolic process(GO:0046039) |
| 0.1 | 0.3 | GO:1903998 | regulation of eating behavior(GO:1903998) |
| 0.1 | 1.0 | GO:0042053 | regulation of dopamine metabolic process(GO:0042053) regulation of catecholamine metabolic process(GO:0042069) |
| 0.1 | 0.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.1 | 0.3 | GO:2000547 | regulation of dendritic cell dendrite assembly(GO:2000547) |
| 0.1 | 1.6 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.1 | 6.6 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.1 | 0.9 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.1 | 4.5 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.1 | 0.1 | GO:0038001 | paracrine signaling(GO:0038001) |
| 0.1 | 0.5 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
| 0.1 | 0.5 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
| 0.1 | 0.3 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 0.3 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.1 | 0.3 | GO:0046032 | ADP catabolic process(GO:0046032) IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
| 0.1 | 0.2 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.1 | 0.6 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
| 0.1 | 0.3 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.1 | 1.5 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 | 0.7 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.1 | 0.2 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
| 0.1 | 0.5 | GO:0043628 | ncRNA 3'-end processing(GO:0043628) |
| 0.1 | 0.4 | GO:0033260 | nuclear DNA replication(GO:0033260) |
| 0.1 | 0.1 | GO:0072194 | kidney smooth muscle tissue development(GO:0072194) |
| 0.1 | 0.2 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 | 0.2 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.1 | 0.7 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.1 | 0.3 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
| 0.1 | 4.1 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.1 | 0.4 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 | 0.3 | GO:0046168 | glycerol-3-phosphate catabolic process(GO:0046168) |
| 0.1 | 0.3 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
| 0.1 | 0.9 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.1 | 0.2 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
| 0.1 | 0.3 | GO:0021648 | vestibulocochlear nerve morphogenesis(GO:0021648) |
| 0.1 | 0.6 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.1 | 0.1 | GO:2001279 | regulation of prostaglandin biosynthetic process(GO:0031392) positive regulation of prostaglandin biosynthetic process(GO:0031394) regulation of unsaturated fatty acid biosynthetic process(GO:2001279) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
| 0.1 | 0.3 | GO:0044861 | protein transport into plasma membrane raft(GO:0044861) |
| 0.1 | 2.6 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 0.3 | GO:0015825 | L-serine transport(GO:0015825) |
| 0.1 | 0.3 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 | 0.2 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 | 0.1 | GO:1901992 | positive regulation of mitotic cell cycle phase transition(GO:1901992) |
| 0.1 | 0.5 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
| 0.1 | 1.3 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.1 | 0.5 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.1 | 0.2 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
| 0.1 | 0.9 | GO:0032801 | receptor catabolic process(GO:0032801) |
| 0.1 | 0.2 | GO:0045659 | negative regulation of neutrophil differentiation(GO:0045659) |
| 0.1 | 0.9 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 0.2 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.1 | 0.1 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.1 | 0.2 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.1 | 0.3 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.1 | 1.8 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.1 | 0.7 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.1 | 1.0 | GO:0006241 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
| 0.1 | 0.2 | GO:0046060 | dATP metabolic process(GO:0046060) |
| 0.1 | 2.0 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.1 | 0.6 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.1 | 0.3 | GO:0035860 | esophagus smooth muscle contraction(GO:0014846) glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.1 | 2.8 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.1 | 0.9 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
| 0.1 | 0.2 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.1 | 0.2 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 | 0.9 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.1 | 0.5 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.1 | 0.2 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 0.1 | 0.9 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 | 0.1 | GO:1990535 | neuron projection maintenance(GO:1990535) |
| 0.1 | 0.4 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.1 | 0.6 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.1 | GO:0090647 | modulation of age-related behavioral decline(GO:0090647) |
| 0.1 | 0.3 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.1 | 0.4 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
| 0.1 | 0.8 | GO:0051352 | negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.1 | 0.4 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.1 | 0.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 0.8 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.1 | 0.2 | GO:0048691 | positive regulation of sprouting of injured axon(GO:0048687) positive regulation of axon extension involved in regeneration(GO:0048691) |
| 0.1 | 0.7 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 | 0.8 | GO:0060338 | regulation of type I interferon-mediated signaling pathway(GO:0060338) |
| 0.1 | 0.5 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.1 | 0.7 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 | 0.6 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
| 0.1 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.1 | 0.5 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.1 | 0.1 | GO:0034971 | histone H3-R17 methylation(GO:0034971) |
| 0.1 | 0.3 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.1 | 0.2 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.8 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.1 | 0.7 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.1 | 0.4 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.1 | 0.4 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.1 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.1 | 1.0 | GO:0007099 | centriole replication(GO:0007099) |
| 0.1 | 0.2 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
| 0.1 | 3.5 | GO:0031111 | negative regulation of microtubule polymerization or depolymerization(GO:0031111) |
| 0.1 | 0.2 | GO:0097401 | synaptic vesicle lumen acidification(GO:0097401) |
| 0.1 | 1.7 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.1 | 1.7 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
| 0.1 | 0.2 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) |
| 0.1 | 1.0 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.1 | 0.3 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.1 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.1 | 0.1 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.1 | 1.2 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
| 0.1 | 0.1 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.1 | 0.3 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.1 | 0.2 | GO:0070904 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.1 | 0.1 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.1 | 0.3 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.1 | 0.3 | GO:0015786 | UDP-glucose transport(GO:0015786) |
| 0.1 | 0.5 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
| 0.1 | 0.3 | GO:1902044 | regulation of Fas signaling pathway(GO:1902044) negative regulation of Fas signaling pathway(GO:1902045) |
| 0.1 | 0.5 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.1 | 0.3 | GO:0046416 | D-amino acid metabolic process(GO:0046416) D-serine metabolic process(GO:0070178) |
| 0.1 | 0.2 | GO:0010534 | regulation of activation of JAK2 kinase activity(GO:0010534) activation of JAK2 kinase activity(GO:0042977) negative regulation of activation of JAK2 kinase activity(GO:1902569) |
| 0.1 | 0.3 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.1 | 1.6 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.1 | 0.1 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.1 | 0.1 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.1 | 3.7 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.1 | 0.7 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 0.1 | 0.6 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.1 | 0.4 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.1 | 0.5 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
| 0.1 | 0.2 | GO:1901249 | regulation of lung goblet cell differentiation(GO:1901249) negative regulation of lung goblet cell differentiation(GO:1901250) |
| 0.1 | 0.1 | GO:1904305 | negative regulation of gastro-intestinal system smooth muscle contraction(GO:1904305) negative regulation of small intestine smooth muscle contraction(GO:1904348) |
| 0.1 | 0.1 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.1 | 0.1 | GO:0032690 | negative regulation of interleukin-1 alpha production(GO:0032690) negative regulation of interleukin-1 alpha secretion(GO:0050712) |
| 0.1 | 0.3 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 0.7 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.1 | 0.3 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
| 0.1 | 0.6 | GO:0006105 | succinate metabolic process(GO:0006105) |
| 0.1 | 0.2 | GO:0006562 | proline catabolic process(GO:0006562) proline catabolic process to glutamate(GO:0010133) |
| 0.1 | 0.2 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.1 | 0.6 | GO:0010259 | multicellular organism aging(GO:0010259) |
| 0.1 | 0.3 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.1 | 0.2 | GO:1903944 | regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.1 | 0.6 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.1 | 0.1 | GO:0036466 | synaptic vesicle recycling via endosome(GO:0036466) |
| 0.1 | 0.2 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.1 | 0.9 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
| 0.1 | 0.6 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.1 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.1 | 0.3 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.1 | 0.2 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
| 0.1 | 0.2 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) |
| 0.1 | 0.2 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.1 | 0.2 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.1 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 3.7 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.1 | 0.2 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
| 0.1 | 0.1 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
| 0.1 | 0.2 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
| 0.1 | 0.2 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 0.2 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.1 | 0.9 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.1 | 0.5 | GO:0032026 | response to magnesium ion(GO:0032026) |
| 0.1 | 0.3 | GO:0003283 | atrial septum development(GO:0003283) |
| 0.1 | 0.8 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.1 | 0.6 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.1 | 0.5 | GO:0034626 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 | 0.3 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.1 | 0.3 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.1 | 0.2 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.1 | 0.1 | GO:0030578 | PML body organization(GO:0030578) |
| 0.1 | 0.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 | 0.3 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.1 | 0.5 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.1 | 0.1 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.1 | 0.4 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.1 | 0.2 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 | 0.7 | GO:2001273 | regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.1 | 0.2 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
| 0.1 | 0.2 | GO:0097360 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.1 | 0.2 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.1 | 0.2 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.1 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.1 | 0.2 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 | 0.4 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.1 | 0.6 | GO:1901409 | positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.1 | 1.0 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
| 0.1 | 0.2 | GO:1904245 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 0.1 | 0.2 | GO:0009452 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.1 | 0.3 | GO:0014005 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.1 | 0.5 | GO:0001967 | suckling behavior(GO:0001967) |
| 0.1 | 0.3 | GO:0018342 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.1 | 0.4 | GO:1904292 | regulation of ERAD pathway(GO:1904292) |
| 0.1 | 0.2 | GO:0003165 | Purkinje myocyte development(GO:0003165) |
| 0.1 | 0.3 | GO:0070199 | establishment of protein localization to chromosome(GO:0070199) |
| 0.1 | 0.9 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
| 0.1 | 0.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.1 | 0.3 | GO:0052205 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.1 | 0.1 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.1 | 1.3 | GO:0043029 | T cell homeostasis(GO:0043029) |
| 0.1 | 0.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.1 | GO:0052564 | response to immune response of other organism involved in symbiotic interaction(GO:0052564) response to host immune response(GO:0052572) |
| 0.1 | 0.4 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 1.4 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 0.7 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.1 | 1.0 | GO:0071364 | response to epidermal growth factor(GO:0070849) cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.1 | 0.3 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.1 | 0.4 | GO:0015747 | urate transport(GO:0015747) |
| 0.1 | 0.3 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.1 | 0.2 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 0.1 | GO:1900104 | hyaluranon cable assembly(GO:0036118) extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.1 | 0.2 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
| 0.1 | 0.1 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.1 | 0.1 | GO:0099548 | trans-synaptic signaling by soluble gas(GO:0099543) trans-synaptic signaling by nitric oxide(GO:0099548) |
| 0.1 | 0.2 | GO:0036509 | trimming of terminal mannose on B branch(GO:0036509) |
| 0.1 | 0.2 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.1 | 0.3 | GO:1903351 | response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
| 0.0 | 0.9 | GO:0007614 | short-term memory(GO:0007614) |
| 0.0 | 0.2 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.0 | 0.2 | GO:0016332 | establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.0 | 0.4 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.0 | 0.3 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.8 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
| 0.0 | 0.2 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.0 | 1.1 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
| 0.0 | 0.6 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.0 | 0.3 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.0 | 0.3 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.9 | GO:1902547 | regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
| 0.0 | 0.1 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.0 | 0.1 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
| 0.0 | 0.2 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.0 | 0.2 | GO:0036367 | adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
| 0.0 | 0.2 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.0 | 0.1 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.0 | 0.5 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.0 | 0.2 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.0 | 0.3 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.0 | 0.9 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.0 | 0.7 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.0 | 0.2 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.0 | 1.5 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.8 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
| 0.0 | 0.0 | GO:0072103 | renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.0 | 1.6 | GO:0051646 | mitochondrion localization(GO:0051646) |
| 0.0 | 0.0 | GO:0061198 | fungiform papilla formation(GO:0061198) |
| 0.0 | 1.0 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.1 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
| 0.0 | 1.1 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.0 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.0 | 5.3 | GO:0000375 | RNA splicing, via transesterification reactions(GO:0000375) |
| 0.0 | 0.3 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.0 | 0.1 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.0 | 0.0 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.0 | 0.1 | GO:0046021 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 0.0 | 0.2 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.0 | 0.4 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 0.3 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.5 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.0 | 0.5 | GO:0015813 | L-glutamate transport(GO:0015813) |
| 0.0 | 0.5 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 | 1.3 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.0 | 0.3 | GO:0097484 | dendrite extension(GO:0097484) |
| 0.0 | 0.4 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.0 | GO:0036119 | response to platelet-derived growth factor(GO:0036119) |
| 0.0 | 0.0 | GO:1901608 | regulation of vesicle transport along microtubule(GO:1901608) |
| 0.0 | 0.1 | GO:0090399 | replicative senescence(GO:0090399) |
| 0.0 | 0.3 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 | 1.4 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
| 0.0 | 0.0 | GO:2000041 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
| 0.0 | 0.0 | GO:0046949 | fatty-acyl-CoA biosynthetic process(GO:0046949) |
| 0.0 | 0.5 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.2 | GO:0060174 | limb bud formation(GO:0060174) |
| 0.0 | 0.1 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.0 | 0.6 | GO:0034776 | response to histamine(GO:0034776) cellular response to histamine(GO:0071420) |
| 0.0 | 0.3 | GO:0030953 | astral microtubule organization(GO:0030953) |
| 0.0 | 0.3 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 | 0.6 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
| 0.0 | 0.3 | GO:0015840 | urea transport(GO:0015840) |
| 0.0 | 0.9 | GO:0043488 | regulation of mRNA stability(GO:0043488) |
| 0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.3 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.0 | 0.9 | GO:0046856 | phospholipid dephosphorylation(GO:0046839) phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 | 0.2 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.0 | 0.2 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.0 | 0.3 | GO:0031498 | chromatin disassembly(GO:0031498) |
| 0.0 | 0.3 | GO:0046834 | lipid phosphorylation(GO:0046834) |
| 0.0 | 0.2 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.1 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
| 0.0 | 0.5 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 | 2.1 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.0 | 0.3 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.0 | 0.4 | GO:0051608 | histamine transport(GO:0051608) |
| 0.0 | 0.3 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
| 0.0 | 0.1 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
| 0.0 | 0.2 | GO:0007184 | SMAD protein import into nucleus(GO:0007184) |
| 0.0 | 0.2 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 | 0.2 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.0 | 0.2 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.0 | 0.1 | GO:0098909 | regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
| 0.0 | 0.2 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.0 | GO:2000269 | fibroblast apoptotic process(GO:0044346) regulation of fibroblast apoptotic process(GO:2000269) |
| 0.0 | 0.4 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
| 0.0 | 0.2 | GO:0032966 | negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) |
| 0.0 | 0.4 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.0 | 0.3 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.7 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 | 0.5 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.3 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.0 | 0.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.0 | 0.0 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.0 | 0.1 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 1.1 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.0 | 0.1 | GO:0034334 | adherens junction maintenance(GO:0034334) |
| 0.0 | 0.3 | GO:0030224 | monocyte differentiation(GO:0030224) |
| 0.0 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.3 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
| 0.0 | 0.1 | GO:0060768 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) |
| 0.0 | 0.3 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.0 | 0.3 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.0 | 0.8 | GO:0008156 | negative regulation of DNA replication(GO:0008156) |
| 0.0 | 0.3 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.0 | 0.3 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.3 | GO:0060430 | lung saccule development(GO:0060430) |
| 0.0 | 0.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.1 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.0 | 0.2 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.3 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.1 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.0 | 0.0 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
| 0.0 | 0.2 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.0 | 0.1 | GO:0002344 | B cell selection(GO:0002339) peripheral B cell selection(GO:0002343) B cell affinity maturation(GO:0002344) |
| 0.0 | 0.4 | GO:0002260 | lymphocyte homeostasis(GO:0002260) |
| 0.0 | 0.2 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
| 0.0 | 0.6 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.0 | 0.5 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
| 0.0 | 0.2 | GO:2000489 | regulation of hepatic stellate cell activation(GO:2000489) positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.0 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.0 | 0.0 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.0 | 0.4 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.0 | 0.1 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.0 | 0.2 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.0 | 0.3 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.0 | 0.1 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
| 0.0 | 0.1 | GO:1904800 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) regulation of branching morphogenesis of a nerve(GO:2000172) negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.0 | 0.1 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.2 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 0.0 | 0.3 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.0 | 0.1 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.0 | 0.6 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 0.0 | 0.0 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.0 | 0.2 | GO:1900113 | regulation of histone H3-K9 trimethylation(GO:1900112) negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.3 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.0 | 0.4 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
| 0.0 | 0.2 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.0 | 0.3 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.1 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.7 | GO:0001662 | behavioral fear response(GO:0001662) |
| 0.0 | 0.2 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.2 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.5 | GO:0051281 | positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
| 0.0 | 0.2 | GO:0034661 | ncRNA catabolic process(GO:0034661) |
| 0.0 | 0.0 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.0 | 0.1 | GO:1904729 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
| 0.0 | 0.1 | GO:1904938 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
| 0.0 | 0.1 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.0 | 0.1 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.0 | 0.2 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.0 | 0.2 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
| 0.0 | 0.2 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 | 0.0 | GO:0040030 | regulation of molecular function, epigenetic(GO:0040030) |
| 0.0 | 0.2 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.0 | 0.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.0 | 0.6 | GO:0033173 | calcineurin-NFAT signaling cascade(GO:0033173) |
| 0.0 | 0.1 | GO:0001812 | antibody-dependent cellular cytotoxicity(GO:0001788) regulation of type I hypersensitivity(GO:0001810) positive regulation of type I hypersensitivity(GO:0001812) type I hypersensitivity(GO:0016068) |
| 0.0 | 0.0 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.0 | 0.4 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.0 | 0.1 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
| 0.0 | 1.6 | GO:0016579 | protein deubiquitination(GO:0016579) |
| 0.0 | 0.3 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.1 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.0 | 0.6 | GO:2000179 | positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.0 | 0.1 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.0 | 0.7 | GO:0032729 | positive regulation of interferon-gamma production(GO:0032729) |
| 0.0 | 0.3 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.0 | 0.2 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
| 0.0 | 0.4 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.2 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.3 | GO:0050850 | positive regulation of calcium-mediated signaling(GO:0050850) |
| 0.0 | 0.1 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.0 | 0.2 | GO:0048757 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.0 | 0.1 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.0 | 0.1 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
| 0.0 | 0.0 | GO:0036337 | Fas signaling pathway(GO:0036337) |
| 0.0 | 1.0 | GO:0098840 | protein transport along microtubule(GO:0098840) |
| 0.0 | 0.1 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
| 0.0 | 0.1 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
| 0.0 | 0.1 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
| 0.0 | 0.1 | GO:0060872 | semicircular canal development(GO:0060872) |
| 0.0 | 0.1 | GO:0001830 | trophectodermal cell fate commitment(GO:0001830) |
| 0.0 | 0.0 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.0 | 0.1 | GO:0051298 | centrosome duplication(GO:0051298) |
| 0.0 | 0.1 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.0 | 0.2 | GO:0007603 | phototransduction, visible light(GO:0007603) |
| 0.0 | 0.1 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.1 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.0 | 0.4 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.1 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.0 | 0.2 | GO:0030539 | male genitalia development(GO:0030539) |
| 0.0 | 0.1 | GO:0001510 | RNA methylation(GO:0001510) |
| 0.0 | 0.1 | GO:0042275 | error-free postreplication DNA repair(GO:0042275) |
| 0.0 | 0.0 | GO:1901989 | positive regulation of cell cycle phase transition(GO:1901989) |
| 0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 4.3 | GO:0006412 | translation(GO:0006412) |
| 0.0 | 0.0 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
| 0.0 | 0.0 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.0 | 0.1 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.0 | 0.1 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
| 0.0 | 0.1 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 | 0.2 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 | 0.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.0 | 0.0 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.0 | 0.1 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.0 | 0.1 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 | 0.0 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
| 0.0 | 0.0 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.0 | 0.0 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.0 | 0.0 | GO:0033574 | response to testosterone(GO:0033574) |
| 0.0 | 0.1 | GO:0006547 | histidine metabolic process(GO:0006547) |
| 0.0 | 0.4 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.0 | 0.0 | GO:0002644 | negative regulation of tolerance induction(GO:0002644) |
| 0.0 | 0.1 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
| 0.0 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.0 | 0.3 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
| 0.0 | 0.2 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.0 | 0.0 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
| 0.0 | 0.0 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.0 | 0.0 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.0 | 0.0 | GO:0021554 | optic nerve development(GO:0021554) |
| 0.0 | 0.2 | GO:0033622 | integrin activation(GO:0033622) |
| 0.0 | 0.1 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) |
| 0.0 | 0.1 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.0 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 | 0.1 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.0 | 0.1 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 | 0.1 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.0 | 0.1 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.5 | GO:0006352 | DNA-templated transcription, initiation(GO:0006352) |
| 0.0 | 0.1 | GO:0051567 | histone H3-K9 methylation(GO:0051567) |
| 0.0 | 0.8 | GO:0000086 | G2/M transition of mitotic cell cycle(GO:0000086) |
| 0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 0.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.1 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) sensory perception of umami taste(GO:0050917) |
| 0.0 | 0.1 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 | 0.7 | GO:1903749 | positive regulation of establishment of protein localization to mitochondrion(GO:1903749) |
| 0.0 | 0.0 | GO:0035376 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.0 | 0.2 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.1 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.0 | 0.0 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
| 0.0 | 0.1 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 0.1 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.0 | 0.0 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.0 | 0.1 | GO:0060009 | Sertoli cell development(GO:0060009) |
| 0.0 | 0.2 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
| 0.0 | 0.4 | GO:0045670 | regulation of osteoclast differentiation(GO:0045670) |
| 0.0 | 0.4 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 5.7 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 1.0 | 3.9 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.9 | 3.4 | GO:0099569 | presynaptic cytoskeleton(GO:0099569) |
| 0.7 | 5.4 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.6 | 3.0 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.6 | 3.0 | GO:0097226 | sperm mitochondrial sheath(GO:0097226) |
| 0.6 | 4.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.6 | 2.3 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.5 | 3.2 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.5 | 2.6 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.5 | 3.1 | GO:0044094 | host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
| 0.5 | 1.5 | GO:0071920 | cleavage body(GO:0071920) |
| 0.5 | 5.1 | GO:0000796 | condensin complex(GO:0000796) |
| 0.5 | 1.5 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.5 | 2.5 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.5 | 2.0 | GO:0001652 | granular component(GO:0001652) |
| 0.5 | 1.5 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.5 | 1.8 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.4 | 3.6 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.4 | 3.1 | GO:0005818 | aster(GO:0005818) |
| 0.4 | 2.7 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.4 | 2.6 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.4 | 0.4 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.4 | 3.4 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.4 | 1.7 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 0.4 | 1.2 | GO:0000811 | GINS complex(GO:0000811) |
| 0.4 | 0.4 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
| 0.4 | 2.4 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.4 | 2.4 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.4 | 2.0 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.4 | 2.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.4 | 4.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.4 | 6.5 | GO:0070938 | contractile ring(GO:0070938) |
| 0.4 | 1.1 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.4 | 2.6 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.4 | 1.4 | GO:0044307 | dendritic branch(GO:0044307) |
| 0.4 | 1.8 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.3 | 1.0 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.3 | 1.7 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.3 | 1.0 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.3 | 2.7 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.3 | 0.7 | GO:0044317 | rod spherule(GO:0044317) |
| 0.3 | 1.0 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.3 | 1.0 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.3 | 0.6 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.3 | 2.8 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.3 | 2.2 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.3 | 1.2 | GO:0031523 | Myb complex(GO:0031523) |
| 0.3 | 0.9 | GO:0042642 | actomyosin, myosin complex part(GO:0042642) |
| 0.3 | 0.9 | GO:0031415 | NatA complex(GO:0031415) |
| 0.3 | 1.8 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.3 | 0.9 | GO:0035101 | FACT complex(GO:0035101) |
| 0.3 | 2.5 | GO:0000801 | central element(GO:0000801) |
| 0.3 | 2.0 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.3 | 1.4 | GO:0030891 | VCB complex(GO:0030891) |
| 0.3 | 1.9 | GO:0001740 | Barr body(GO:0001740) |
| 0.3 | 1.4 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.3 | 2.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.3 | 1.9 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.3 | 0.5 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.3 | 2.7 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.3 | 2.9 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.3 | 12.5 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.3 | 1.9 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.3 | 2.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.3 | 1.3 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.3 | 2.3 | GO:0089701 | U2AF(GO:0089701) |
| 0.3 | 3.3 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.3 | 1.5 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.3 | 2.8 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.3 | 2.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.3 | 1.5 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.3 | 0.8 | GO:0031251 | PAN complex(GO:0031251) |
| 0.3 | 1.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.3 | 1.0 | GO:0005606 | laminin-1 complex(GO:0005606) |
| 0.2 | 2.5 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.2 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.2 | 1.7 | GO:0005638 | lamin filament(GO:0005638) |
| 0.2 | 17.4 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.2 | 0.9 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.2 | 0.5 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.2 | 0.7 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.2 | 2.7 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.2 | 1.7 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.2 | 0.9 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.2 | 0.6 | GO:0032783 | ELL-EAF complex(GO:0032783) |
| 0.2 | 1.1 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.2 | 0.6 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.2 | 0.4 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.2 | 2.5 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.2 | 15.1 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.2 | 3.0 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.2 | 4.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.2 | 3.6 | GO:0031045 | dense core granule(GO:0031045) |
| 0.2 | 1.2 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.2 | 1.0 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.2 | 0.4 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.2 | 9.2 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.2 | 2.1 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.2 | 0.4 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
| 0.2 | 2.5 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.2 | 0.6 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.2 | 1.3 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.2 | 2.6 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.2 | 11.7 | GO:0022626 | cytosolic ribosome(GO:0022626) |
| 0.2 | 0.9 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.2 | 0.7 | GO:0090537 | CERF complex(GO:0090537) |
| 0.2 | 1.8 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.2 | 2.5 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.2 | 1.9 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.2 | 1.2 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.2 | 0.4 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.2 | 0.5 | GO:0098833 | presynaptic endocytic zone(GO:0098833) presynaptic endocytic zone membrane(GO:0098835) |
| 0.2 | 2.8 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.2 | 0.9 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.2 | 0.7 | GO:1990429 | Pex17p-Pex14p docking complex(GO:1990415) peroxisomal importomer complex(GO:1990429) |
| 0.2 | 2.6 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.2 | 0.8 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.2 | 0.3 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.2 | 0.5 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.2 | 0.8 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.2 | 1.7 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.2 | 0.3 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.2 | 4.4 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.2 | 0.8 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.2 | 1.5 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.2 | 0.6 | GO:1990707 | subtelomeric heterochromatin(GO:1990421) nuclear subtelomeric heterochromatin(GO:1990707) |
| 0.2 | 0.5 | GO:0098842 | postsynaptic early endosome(GO:0098842) |
| 0.2 | 1.6 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.2 | 2.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.2 | 0.8 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.2 | 2.8 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
| 0.2 | 0.8 | GO:0071547 | piP-body(GO:0071547) |
| 0.2 | 0.8 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.2 | 2.7 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.2 | 0.6 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.1 | 4.8 | GO:0015935 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) small ribosomal subunit(GO:0015935) |
| 0.1 | 1.8 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 2.8 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.1 | 8.8 | GO:0005657 | replication fork(GO:0005657) |
| 0.1 | 0.8 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.1 | 1.0 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.1 | 5.0 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.1 | 1.6 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 0.8 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.1 | 3.9 | GO:1990752 | microtubule end(GO:1990752) |
| 0.1 | 1.7 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.1 | 0.5 | GO:1990032 | parallel fiber(GO:1990032) |
| 0.1 | 0.8 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.1 | 0.1 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.1 | 3.9 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.1 | 1.0 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 2.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 0.6 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.1 | 1.0 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.1 | 0.4 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.1 | 1.0 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 4.3 | GO:0043034 | costamere(GO:0043034) |
| 0.1 | 0.5 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.1 | 0.6 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.1 | 0.4 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.1 | 0.1 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.1 | 0.5 | GO:0071942 | XPC complex(GO:0071942) |
| 0.1 | 2.2 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.1 | 1.7 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 0.6 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.1 | 0.6 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.1 | 0.3 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 0.5 | GO:0034709 | methylosome(GO:0034709) |
| 0.1 | 0.6 | GO:0072487 | MSL complex(GO:0072487) |
| 0.1 | 1.0 | GO:0034719 | SMN complex(GO:0032797) SMN-Sm protein complex(GO:0034719) |
| 0.1 | 1.6 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 0.7 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.1 | 1.1 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 1.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 0.1 | 6.1 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 0.3 | GO:1990047 | spindle matrix(GO:1990047) |
| 0.1 | 0.5 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 0.5 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.1 | 5.3 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.1 | 0.5 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 0.4 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.1 | 1.1 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.1 | 9.3 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 2.1 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.1 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.1 | 0.7 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.1 | 2.2 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.1 | 1.0 | GO:0005883 | neurofilament(GO:0005883) |
| 0.1 | 3.3 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.1 | 0.3 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.1 | 0.5 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 0.4 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.1 | 0.7 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.1 | 1.6 | GO:0030684 | preribosome(GO:0030684) |
| 0.1 | 1.5 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
| 0.1 | 0.9 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 1.4 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.1 | 0.7 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.1 | 1.9 | GO:0000800 | lateral element(GO:0000800) |
| 0.1 | 2.0 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 1.8 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 0.3 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.1 | 1.0 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 0.7 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 0.6 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 12.7 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.1 | 0.6 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.1 | 0.4 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.1 | 1.4 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.1 | 1.3 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 0.3 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 5.5 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.1 | 5.7 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.1 | 0.3 | GO:1903095 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
| 0.1 | 0.3 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 1.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.1 | 0.9 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 0.2 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.1 | 1.0 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) clathrin-coated endocytic vesicle membrane(GO:0030669) |
| 0.1 | 1.1 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.1 | 0.6 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.1 | 0.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.1 | 0.4 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 0.2 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.1 | 0.9 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 10.1 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.1 | 1.3 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 0.5 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.1 | 0.6 | GO:0034464 | BBSome(GO:0034464) |
| 0.1 | 0.8 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 0.2 | GO:0042827 | platelet dense granule(GO:0042827) |
| 0.1 | 1.8 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.1 | 0.8 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 0.1 | GO:0097361 | CIA complex(GO:0097361) |
| 0.1 | 0.4 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.1 | 0.6 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 0.6 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 0.4 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.1 | 0.7 | GO:0001741 | XY body(GO:0001741) |
| 0.1 | 7.1 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.1 | 0.8 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 1.2 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.1 | 1.7 | GO:0032590 | dendrite membrane(GO:0032590) |
| 0.1 | 1.3 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.1 | 1.0 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.1 | 0.1 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
| 0.1 | 0.5 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.1 | 1.0 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 0.3 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.1 | 0.3 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.1 | 0.7 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.1 | 0.2 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.1 | 0.2 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
| 0.1 | 0.4 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.1 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 1.0 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.1 | 0.2 | GO:0008091 | spectrin(GO:0008091) |
| 0.1 | 0.7 | GO:0045120 | pronucleus(GO:0045120) |
| 0.1 | 0.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 0.9 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.1 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.1 | 1.1 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.1 | 0.2 | GO:0043512 | inhibin A complex(GO:0043512) |
| 0.1 | 0.4 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.1 | 0.5 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 0.4 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.1 | 0.5 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
| 0.1 | 0.5 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.1 | 0.2 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 0.4 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.1 | 0.7 | GO:0072546 | ER membrane protein complex(GO:0072546) |
| 0.1 | 0.4 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.1 | 0.1 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
| 0.1 | 0.6 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.1 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 0.5 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 15.1 | GO:0016607 | nuclear speck(GO:0016607) |
| 0.0 | 0.0 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.0 | 0.1 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.0 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.0 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.0 | 0.4 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.2 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.3 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 2.7 | GO:0030496 | midbody(GO:0030496) |
| 0.0 | 0.8 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 3.3 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.4 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 3.0 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.1 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.0 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.0 | 0.3 | GO:0045252 | dihydrolipoyl dehydrogenase complex(GO:0045240) oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.3 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.0 | 0.4 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.6 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 1.4 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 1.0 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.3 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.0 | 0.5 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.4 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 0.2 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 2.1 | GO:0034399 | nuclear periphery(GO:0034399) |
| 0.0 | 13.2 | GO:0005813 | centrosome(GO:0005813) |
| 0.0 | 0.1 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 0.0 | 21.4 | GO:0005730 | nucleolus(GO:0005730) |
| 0.0 | 0.2 | GO:0016012 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
| 0.0 | 0.2 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.0 | 0.2 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 1.6 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.2 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.0 | 0.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.1 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 1.8 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.8 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.0 | 1.1 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.2 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.1 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.0 | 2.0 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.3 | GO:0019814 | immunoglobulin complex(GO:0019814) |
| 0.0 | 0.2 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.1 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.0 | 0.1 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 0.1 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.0 | 0.2 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.2 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.4 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.0 | 0.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 0.0 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) spliceosomal tri-snRNP complex(GO:0097526) |
| 0.0 | 0.0 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
| 0.0 | 0.1 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.0 | 6.1 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.2 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 0.4 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
| 0.0 | 0.9 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.3 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.8 | GO:0000792 | heterochromatin(GO:0000792) |
| 0.0 | 0.1 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
| 0.0 | 0.1 | GO:0000221 | vacuolar proton-transporting V-type ATPase, V1 domain(GO:0000221) |
| 0.0 | 0.6 | GO:0030118 | clathrin coat(GO:0030118) |
| 0.0 | 0.5 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.0 | 0.1 | GO:1990696 | USH2 complex(GO:1990696) |
| 0.0 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
| 0.0 | 0.1 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.0 | 0.0 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
| 0.0 | 0.8 | GO:0044815 | DNA packaging complex(GO:0044815) |
| 0.0 | 0.1 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.2 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 0.1 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
| 0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.0 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.0 | 0.1 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.1 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 2.9 | GO:0033680 | ATP-dependent DNA/RNA helicase activity(GO:0033680) |
| 0.9 | 3.7 | GO:0055105 | ubiquitin-protein transferase inhibitor activity(GO:0055105) |
| 0.9 | 2.6 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.7 | 2.9 | GO:0050347 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
| 0.7 | 3.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.7 | 2.0 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.6 | 1.9 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.6 | 2.4 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.6 | 2.3 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.6 | 2.8 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.5 | 3.2 | GO:0002135 | CTP binding(GO:0002135) |
| 0.5 | 1.6 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.5 | 3.7 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.5 | 5.1 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.5 | 3.4 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.5 | 1.4 | GO:0035605 | peptidyl-cysteine S-nitrosylase activity(GO:0035605) |
| 0.5 | 1.4 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.5 | 11.4 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.5 | 1.4 | GO:0016855 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.4 | 1.3 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) |
| 0.4 | 1.3 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.4 | 3.9 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.4 | 2.6 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.4 | 1.3 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.4 | 3.4 | GO:0043559 | insulin binding(GO:0043559) |
| 0.4 | 1.3 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.4 | 2.1 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.4 | 1.2 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.4 | 3.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.4 | 2.4 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
| 0.4 | 1.6 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.4 | 2.7 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
| 0.4 | 2.3 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.4 | 1.9 | GO:0008761 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) |
| 0.4 | 1.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.4 | 2.3 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.4 | 1.1 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.4 | 1.5 | GO:0003681 | bent DNA binding(GO:0003681) |
| 0.4 | 1.9 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.4 | 0.4 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.4 | 1.1 | GO:0031403 | lithium ion binding(GO:0031403) |
| 0.4 | 3.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.4 | 1.1 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.4 | 1.1 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.4 | 1.8 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.4 | 0.7 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.3 | 1.0 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.3 | 0.7 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.3 | 1.0 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.3 | 2.7 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.3 | 2.7 | GO:0031811 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 0.3 | 1.0 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.3 | 1.3 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.3 | 1.0 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.3 | 2.2 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.3 | 1.2 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.3 | 1.6 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.3 | 1.9 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.3 | 1.2 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.3 | 1.2 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
| 0.3 | 1.2 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.3 | 1.8 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.3 | 1.2 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.3 | 1.8 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.3 | 1.5 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.3 | 2.7 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.3 | 1.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.3 | 0.9 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.3 | 0.9 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.3 | 2.9 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.3 | 2.9 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.3 | 4.0 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.3 | 1.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.3 | 1.1 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.3 | 0.6 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.3 | 0.8 | GO:0030613 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.3 | 0.8 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.3 | 0.8 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.3 | 0.8 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.3 | 2.5 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.3 | 0.8 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.3 | 0.8 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.3 | 0.8 | GO:0004637 | phosphoribosylamine-glycine ligase activity(GO:0004637) |
| 0.3 | 5.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.3 | 0.8 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
| 0.3 | 2.4 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.3 | 1.6 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.3 | 1.6 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.3 | 0.8 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
| 0.3 | 1.0 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.3 | 1.5 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.3 | 1.0 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.3 | 6.4 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.3 | 0.3 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.3 | 0.8 | GO:0030629 | U6 snRNA 3'-end binding(GO:0030629) |
| 0.2 | 1.5 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.2 | 2.5 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.2 | 1.7 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.2 | 0.7 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.2 | 0.5 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.2 | 0.5 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.2 | 1.9 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.2 | 0.7 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.2 | 1.0 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
| 0.2 | 1.7 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.2 | 0.7 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
| 0.2 | 0.5 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.2 | 1.2 | GO:1904315 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.2 | 1.4 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
| 0.2 | 1.9 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.2 | 0.9 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.2 | 0.5 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.2 | 2.5 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.2 | 0.9 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.2 | 1.1 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.2 | 0.7 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.2 | 2.7 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.2 | 0.7 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.2 | 0.7 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.2 | 3.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.2 | 1.3 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.2 | 1.8 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.2 | 0.7 | GO:0018738 | S-formylglutathione hydrolase activity(GO:0018738) |
| 0.2 | 4.4 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.2 | 0.4 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.2 | 0.9 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.2 | 5.2 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.2 | 4.1 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.2 | 0.9 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.2 | 1.1 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.2 | 5.1 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.2 | 0.9 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.2 | 3.8 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.2 | 1.7 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.2 | 1.7 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.2 | 5.4 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.2 | 2.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.2 | 4.5 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.2 | 0.4 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 0.2 | 0.8 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.2 | 0.6 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
| 0.2 | 1.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.2 | 0.6 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.2 | 1.4 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.2 | 2.2 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.2 | 0.6 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.2 | 1.0 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.2 | 1.0 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
| 0.2 | 0.6 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
| 0.2 | 0.6 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.2 | 2.1 | GO:0005522 | profilin binding(GO:0005522) |
| 0.2 | 1.3 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.2 | 2.9 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.2 | 0.4 | GO:0070404 | NADH binding(GO:0070404) |
| 0.2 | 0.6 | GO:0004473 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.2 | 0.6 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.2 | 0.7 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.2 | 0.9 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
| 0.2 | 1.5 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.2 | 0.6 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.2 | 0.9 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.2 | 0.9 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.2 | 1.3 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.2 | 0.5 | GO:0005308 | creatine transmembrane transporter activity(GO:0005308) |
| 0.2 | 0.2 | GO:0034437 | glycoprotein transporter activity(GO:0034437) |
| 0.2 | 1.4 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.2 | 29.9 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.2 | 0.9 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.2 | 0.9 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
| 0.2 | 0.7 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.2 | 1.2 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.2 | 0.7 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) |
| 0.2 | 0.2 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
| 0.2 | 1.4 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.2 | 0.2 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.2 | 1.9 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.2 | 0.5 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.2 | 1.0 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.2 | 0.5 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.2 | 1.0 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.2 | 2.2 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
| 0.2 | 0.5 | GO:1902271 | lithocholic acid binding(GO:1902121) D3 vitamins binding(GO:1902271) |
| 0.2 | 0.3 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.2 | 0.5 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.2 | 1.6 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.2 | 0.8 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
| 0.2 | 1.4 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.2 | 0.6 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.2 | 0.9 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.2 | 0.2 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
| 0.2 | 1.2 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.2 | 2.8 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.2 | 1.7 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.2 | 0.9 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.2 | 0.6 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.2 | 0.8 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.2 | 5.3 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.2 | 0.8 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.2 | 0.9 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.1 | 0.7 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 1.5 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.1 | 0.1 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.1 | 0.6 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.1 | 0.3 | GO:1990269 | RNA polymerase II C-terminal domain phosphoserine binding(GO:1990269) |
| 0.1 | 0.7 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.1 | 0.6 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 0.4 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.1 | 0.3 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.1 | 2.1 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.1 | 1.0 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.1 | 0.8 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
| 0.1 | 0.7 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.1 | 0.6 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.1 | 1.7 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.1 | 3.1 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.1 | 6.6 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.1 | 6.2 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.1 | 1.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.1 | 0.8 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.1 | 0.8 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.1 | 0.5 | GO:0004096 | catalase activity(GO:0004096) |
| 0.1 | 1.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.1 | 0.7 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.1 | 0.4 | GO:0034189 | very-low-density lipoprotein particle binding(GO:0034189) |
| 0.1 | 0.8 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.1 | 0.5 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.1 | 0.5 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
| 0.1 | 5.9 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.1 | 1.2 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.1 | 0.1 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.1 | 0.1 | GO:0070401 | NADP+ binding(GO:0070401) |
| 0.1 | 0.4 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
| 0.1 | 0.9 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 0.4 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.1 | 1.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.1 | 0.4 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.1 | 0.7 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.1 | 0.5 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.1 | 1.9 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 2.9 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.1 | 0.4 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.1 | 0.9 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.1 | 0.1 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.1 | 0.6 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.1 | 0.4 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.1 | 3.0 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 2.0 | GO:0016594 | glycine binding(GO:0016594) |
| 0.1 | 0.4 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
| 0.1 | 3.3 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.1 | 0.5 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 0.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.1 | 1.0 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.1 | 10.0 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.1 | 1.6 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.1 | 0.7 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.1 | 0.8 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.1 | 0.6 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.1 | 1.7 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.1 | 3.3 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 1.8 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.1 | 0.4 | GO:0005221 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) |
| 0.1 | 0.8 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.1 | 1.0 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.1 | 2.4 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 1.6 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.1 | 0.1 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.1 | 0.5 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.1 | 0.3 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 1.7 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 0.9 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.1 | 0.9 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.1 | 2.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.1 | 0.7 | GO:0001179 | RNA polymerase I transcription factor binding(GO:0001179) |
| 0.1 | 0.7 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.1 | 0.3 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.1 | 1.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.1 | 1.9 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 0.7 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.1 | 0.3 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.1 | 3.1 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.1 | 0.4 | GO:0042328 | heparan sulfate N-acetylglucosaminyltransferase activity(GO:0042328) |
| 0.1 | 2.1 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.1 | 0.3 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.1 | 3.1 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
| 0.1 | 5.8 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.1 | 0.3 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 1.0 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.1 | 0.5 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.6 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.1 | 0.1 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.1 | 1.1 | GO:0003678 | DNA helicase activity(GO:0003678) |
| 0.1 | 0.3 | GO:0004816 | asparagine-tRNA ligase activity(GO:0004816) |
| 0.1 | 1.0 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.1 | 0.3 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.1 | 2.5 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 1.0 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 0.7 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.1 | 0.2 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
| 0.1 | 0.3 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
| 0.1 | 0.8 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.1 | 3.2 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 0.7 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 0.5 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.1 | 1.7 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.1 | 0.8 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.1 | 0.3 | GO:0070540 | stearic acid binding(GO:0070540) |
| 0.1 | 0.7 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.5 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.6 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.1 | 0.3 | GO:0052901 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.1 | 0.3 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
| 0.1 | 0.3 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.1 | 0.4 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.1 | 0.9 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.1 | 0.8 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
| 0.1 | 0.3 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.1 | 0.3 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.1 | 0.2 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.1 | 0.3 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
| 0.1 | 0.9 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.1 | 0.5 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 0.3 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.1 | 0.7 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.1 | 1.4 | GO:0005402 | sugar:proton symporter activity(GO:0005351) cation:sugar symporter activity(GO:0005402) |
| 0.1 | 0.2 | GO:0019150 | D-ribulokinase activity(GO:0019150) |
| 0.1 | 1.0 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.4 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.1 | 1.8 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 1.1 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.3 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.1 | 0.2 | GO:0000700 | mismatch base pair DNA N-glycosylase activity(GO:0000700) |
| 0.1 | 0.2 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 0.2 | GO:0008940 | nitrate reductase activity(GO:0008940) |
| 0.1 | 0.5 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.1 | 0.2 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.1 | 0.5 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.1 | 8.0 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.1 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 0.4 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.1 | 0.5 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.1 | 3.4 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.1 | 1.2 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.1 | 0.9 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.1 | 0.2 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
| 0.1 | 1.3 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 0.2 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.1 | 0.5 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.1 | 1.5 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.1 | 0.2 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.1 | 1.1 | GO:0046527 | glucosyltransferase activity(GO:0046527) |
| 0.1 | 0.2 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 0.3 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.1 | 0.5 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 1.3 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.1 | 1.2 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.1 | 1.3 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 0.3 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.1 | 0.9 | GO:0004527 | exonuclease activity(GO:0004527) |
| 0.1 | 0.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.1 | 0.3 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.1 | 0.8 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.1 | 0.9 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.6 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
| 0.1 | 0.8 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 2.2 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.1 | 1.0 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 0.2 | GO:0098770 | FBXO family protein binding(GO:0098770) |
| 0.1 | 1.1 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.1 | 0.3 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.1 | 0.3 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.1 | 0.2 | GO:0004686 | elongation factor-2 kinase activity(GO:0004686) |
| 0.1 | 0.9 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.1 | 1.0 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.1 | 4.0 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.1 | 0.2 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
| 0.1 | 0.3 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.1 | 0.3 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
| 0.1 | 0.3 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.1 | 2.3 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.1 | 0.4 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 0.2 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.1 | 0.9 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.1 | 0.4 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.1 | 0.7 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 0.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 0.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 2.6 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
| 0.1 | 0.4 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.4 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.1 | 0.1 | GO:0001156 | TFIIIC-class transcription factor binding(GO:0001156) |
| 0.1 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 1.0 | GO:0015932 | nucleobase-containing compound transmembrane transporter activity(GO:0015932) |
| 0.1 | 0.3 | GO:0016416 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
| 0.1 | 0.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 1.5 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.1 | 0.2 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.1 | 0.8 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.1 | 0.7 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.1 | 1.1 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 0.3 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.1 | 1.8 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.1 | 1.1 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.1 | 0.9 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 0.5 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.1 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.1 | 0.4 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
| 0.1 | 0.3 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.1 | 0.2 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.1 | 0.2 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.1 | 0.1 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.1 | 0.1 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
| 0.1 | 0.2 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.1 | 0.2 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.1 | 0.2 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 0.1 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
| 0.1 | 0.5 | GO:0070717 | poly-purine tract binding(GO:0070717) |
| 0.1 | 0.2 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.0 | 0.8 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.0 | 0.0 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.0 | 0.9 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.2 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.0 | 0.7 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.2 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.0 | 0.1 | GO:0008649 | rRNA methyltransferase activity(GO:0008649) |
| 0.0 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.0 | 0.1 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.0 | 0.4 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.0 | 1.3 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.1 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 0.0 | 0.8 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 1.5 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.4 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.0 | 0.4 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 0.2 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 2.0 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.0 | 1.5 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.1 | GO:0004482 | mRNA (guanine-N7-)-methyltransferase activity(GO:0004482) |
| 0.0 | 0.3 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.0 | 0.4 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.0 | 4.8 | GO:0004386 | helicase activity(GO:0004386) |
| 0.0 | 2.9 | GO:0048365 | Rac GTPase binding(GO:0048365) |
| 0.0 | 0.2 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
| 0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.0 | 0.2 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.1 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.0 | 0.2 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
| 0.0 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.9 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.1 | GO:0019107 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
| 0.0 | 0.1 | GO:0004492 | methylmalonyl-CoA decarboxylase activity(GO:0004492) |
| 0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.2 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.0 | 0.6 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
| 0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 44.5 | GO:0003723 | RNA binding(GO:0003723) |
| 0.0 | 0.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.3 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.0 | 0.4 | GO:0004659 | prenyltransferase activity(GO:0004659) |
| 0.0 | 0.2 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.0 | 0.2 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.2 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.3 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.0 | 2.3 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.9 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.1 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.0 | 0.2 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.0 | GO:0001729 | ceramide kinase activity(GO:0001729) |
| 0.0 | 0.9 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.0 | 0.3 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.3 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 0.2 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 0.1 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.3 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 1.2 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.0 | 0.2 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.1 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
| 0.0 | 0.3 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.4 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
| 0.0 | 0.2 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.4 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 1.9 | GO:0032947 | protein complex scaffold(GO:0032947) |
| 0.0 | 0.1 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.0 | 0.9 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
| 0.0 | 0.3 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) inositol trisphosphate phosphatase activity(GO:0046030) |
| 0.0 | 0.1 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
| 0.0 | 0.2 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.0 | 0.1 | GO:0008802 | betaine-aldehyde dehydrogenase activity(GO:0008802) |
| 0.0 | 0.5 | GO:0071949 | FAD binding(GO:0071949) |
| 0.0 | 0.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.0 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.0 | 0.5 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.0 | 0.2 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 4.3 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.0 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.6 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.0 | 0.1 | GO:0019962 | interferon receptor activity(GO:0004904) type I interferon receptor activity(GO:0004905) type I interferon binding(GO:0019962) |
| 0.0 | 0.2 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.0 | 0.7 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.0 | 0.2 | GO:0019534 | toxin transporter activity(GO:0019534) |
| 0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.5 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.0 | 0.2 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 0.9 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.3 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.2 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.2 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.3 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 0.8 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
| 0.0 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.2 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.3 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 0.1 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.0 | 0.0 | GO:0030977 | taurine binding(GO:0030977) |
| 0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.0 | 0.0 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.0 | 0.1 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.0 | 0.1 | GO:0008173 | RNA methyltransferase activity(GO:0008173) |
| 0.0 | 0.0 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
| 0.0 | 0.1 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
| 0.0 | 0.6 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.0 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.0 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.0 | 0.1 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
| 0.0 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.1 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.0 | 0.5 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.0 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.0 | 0.1 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.0 | 0.3 | GO:0016706 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, 2-oxoglutarate as one donor, and incorporation of one atom each of oxygen into both donors(GO:0016706) |
| 0.0 | 0.1 | GO:0004911 | interleukin-2 receptor activity(GO:0004911) |
| 0.0 | 0.1 | GO:0016503 | pheromone receptor activity(GO:0016503) |
| 0.0 | 1.0 | GO:0003823 | antigen binding(GO:0003823) |
| 0.0 | 0.3 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 1.7 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.2 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
| 0.0 | 0.1 | GO:0052595 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
| 0.0 | 0.1 | GO:1902379 | chemoattractant activity involved in axon guidance(GO:1902379) |
| 0.0 | 0.2 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
| 0.0 | 0.1 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.0 | 0.4 | GO:0008276 | protein methyltransferase activity(GO:0008276) |
| 0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.4 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 0.3 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.0 | 0.1 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.2 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.0 | 0.8 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
| 0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.4 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.0 | 0.0 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
| 0.0 | 0.4 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.0 | GO:0070736 | protein-glycine ligase activity, initiating(GO:0070736) |
| 0.0 | 0.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.0 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
| 0.0 | 0.1 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.0 | 0.1 | GO:0004875 | complement receptor activity(GO:0004875) |
| 0.0 | 0.0 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.0 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.4 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 0.0 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.0 | 0.0 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.0 | 0.1 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.0 | 0.0 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.2 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.1 | GO:1901505 | carbohydrate derivative transporter activity(GO:1901505) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 4.5 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.4 | 6.7 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.4 | 13.3 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.3 | 0.9 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.3 | 0.3 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.2 | 12.1 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.2 | 5.7 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.2 | 6.6 | PID ATR PATHWAY | ATR signaling pathway |
| 0.2 | 23.6 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.2 | 3.7 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.2 | 8.4 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.2 | 1.9 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 10.6 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.1 | 0.9 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 0.7 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 3.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.1 | 1.2 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.1 | 0.4 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 6.4 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.1 | 1.5 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.1 | 2.6 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.1 | 2.7 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.1 | 1.7 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 4.3 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.1 | 7.0 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.1 | 1.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 5.2 | PID E2F PATHWAY | E2F transcription factor network |
| 0.1 | 0.7 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 0.4 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 4.1 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.1 | 0.4 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.1 | 2.8 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 3.3 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.1 | 5.2 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.1 | 0.2 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 1.0 | PID ATM PATHWAY | ATM pathway |
| 0.1 | 0.7 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.1 | 1.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.1 | 1.8 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 3.1 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.1 | 0.8 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.1 | 0.7 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.1 | 2.7 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.1 | 1.8 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 0.9 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 1.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.1 | 0.6 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.1 | 1.0 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.1 | 1.6 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.1 | 0.5 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.1 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 1.0 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.1 | 2.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.1 | 2.6 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.1 | 3.0 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.1 | 2.0 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 0.9 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.8 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 2.3 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.0 | 1.1 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.0 | 0.4 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 1.2 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.0 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.0 | 0.8 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 0.5 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.0 | 0.9 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.6 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.4 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 0.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.0 | 0.5 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.2 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.7 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.0 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.3 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.9 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 0.2 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.0 | 0.0 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 0.3 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.0 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.2 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 12.0 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.5 | 4.3 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.5 | 2.8 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.4 | 15.0 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.4 | 1.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.4 | 10.6 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.3 | 4.5 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.3 | 6.1 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.3 | 4.8 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.3 | 3.6 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.3 | 3.0 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.3 | 26.7 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.3 | 3.8 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.3 | 3.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.3 | 0.3 | REACTOME E2F MEDIATED REGULATION OF DNA REPLICATION | Genes involved in E2F mediated regulation of DNA replication |
| 0.2 | 0.2 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.2 | 26.0 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.2 | 4.7 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.2 | 5.6 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.2 | 4.7 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.2 | 6.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.2 | 3.9 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.2 | 4.7 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.2 | 11.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.2 | 4.4 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.2 | 3.9 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.2 | 4.5 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.2 | 3.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.2 | 1.9 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.2 | 4.7 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.2 | 2.4 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.2 | 0.2 | REACTOME TRAF6 MEDIATED INDUCTION OF NFKB AND MAP KINASES UPON TLR7 8 OR 9 ACTIVATION | Genes involved in TRAF6 mediated induction of NFkB and MAP kinases upon TLR7/8 or 9 activation |
| 0.2 | 0.8 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.2 | 0.3 | REACTOME HIV INFECTION | Genes involved in HIV Infection |
| 0.2 | 2.0 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.2 | 2.2 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.2 | 6.2 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.2 | 2.2 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.2 | 2.5 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.1 | 0.3 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.1 | 0.6 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 1.8 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 7.5 | REACTOME ORC1 REMOVAL FROM CHROMATIN | Genes involved in Orc1 removal from chromatin |
| 0.1 | 1.5 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.1 | 0.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 4.0 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 2.3 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.1 | 2.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 7.4 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.1 | 0.1 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
| 0.1 | 2.8 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.1 | 8.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.1 | 2.9 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.1 | 0.2 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
| 0.1 | 2.0 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.1 | 0.8 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.1 | 0.7 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
| 0.1 | 2.0 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
| 0.1 | 1.7 | REACTOME GLOBAL GENOMIC NER GG NER | Genes involved in Global Genomic NER (GG-NER) |
| 0.1 | 2.8 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.1 | 4.0 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 1.2 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.1 | 2.8 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.1 | 1.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.1 | 1.4 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.1 | 7.0 | REACTOME CHROMOSOME MAINTENANCE | Genes involved in Chromosome Maintenance |
| 0.1 | 2.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 1.6 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 0.8 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.1 | 5.1 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.1 | 1.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 1.6 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.1 | 0.6 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 2.3 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.1 | 1.9 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.1 | 1.2 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.1 | 2.4 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.1 | 1.3 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.1 | 1.8 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.1 | 2.9 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.1 | 0.7 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.1 | 3.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.1 | 2.1 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.1 | 3.1 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.1 | 1.7 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 1.8 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 2.1 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 1.8 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 0.9 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.1 | 0.6 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 3.0 | REACTOME RNA POL II PRE TRANSCRIPTION EVENTS | Genes involved in RNA Polymerase II Pre-transcription Events |
| 0.1 | 0.6 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.1 | 0.4 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.1 | 1.7 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.1 | 1.5 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.1 | 0.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 0.2 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.1 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.1 | 1.0 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.1 | 0.6 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.1 | 0.2 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.1 | 0.4 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.1 | 0.6 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.1 | 1.9 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.1 | 1.0 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
| 0.1 | 0.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.1 | 0.8 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.1 | 1.4 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 0.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 0.6 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.0 | 1.6 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 1.2 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.0 | 0.0 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 1.7 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.0 | 0.6 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 0.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.4 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 2.1 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.0 | 0.4 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.4 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.0 | 0.8 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.6 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 0.4 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.6 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.0 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 0.6 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.0 | 0.3 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
| 0.0 | 0.6 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.7 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
| 0.0 | 1.6 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 1.2 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.7 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 0.4 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
| 0.0 | 0.3 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 1.9 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.6 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.1 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.0 | 2.6 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 2.1 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
| 0.0 | 0.8 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.3 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 4.7 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.2 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 0.1 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
| 0.0 | 0.1 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
| 0.0 | 0.9 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.2 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 0.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 2.5 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 0.3 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 0.2 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.0 | 0.3 | REACTOME MEIOSIS | Genes involved in Meiosis |
| 0.0 | 0.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.5 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 0.1 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.1 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.4 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.2 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 0.2 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.0 | 0.5 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.0 | 0.1 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.0 | 0.1 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.0 | 0.2 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.8 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |