2D miR_HR1_12
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Nrf1
|
ENSMUSG00000058440.8 | nuclear respiratory factor 1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Nrf1 | mm10_v2_chr6_+_30047979_30048049 | 0.94 | 6.4e-06 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr11_-_40733373 | 22.25 |
ENSMUST00000020579.8
|
Hmmr
|
hyaluronan mediated motility receptor (RHAMM) |
chr12_-_11265768 | 14.47 |
ENSMUST00000166117.1
|
Gen1
|
Gen homolog 1, endonuclease (Drosophila) |
chr16_-_90727329 | 11.70 |
ENSMUST00000099554.4
|
Mis18a
|
MIS18 kinetochore protein homolog A (S. pombe) |
chr8_-_70234097 | 11.37 |
ENSMUST00000130319.1
|
Armc6
|
armadillo repeat containing 6 |
chr8_+_122568001 | 11.32 |
ENSMUST00000006760.2
|
Cdt1
|
chromatin licensing and DNA replication factor 1 |
chr1_-_191575534 | 10.65 |
ENSMUST00000027933.5
|
Dtl
|
denticleless homolog (Drosophila) |
chr5_+_106964319 | 10.59 |
ENSMUST00000031221.5
ENSMUST00000117196.2 ENSMUST00000076467.6 |
Cdc7
|
cell division cycle 7 (S. cerevisiae) |
chr11_-_11808923 | 10.50 |
ENSMUST00000109664.1
ENSMUST00000150714.1 ENSMUST00000047689.4 ENSMUST00000171938.1 ENSMUST00000171080.1 |
Fignl1
|
fidgetin-like 1 |
chr9_-_22389113 | 10.26 |
ENSMUST00000040912.7
|
Anln
|
anillin, actin binding protein |
chr6_-_126939524 | 9.67 |
ENSMUST00000144954.1
ENSMUST00000112221.1 ENSMUST00000112220.1 |
Rad51ap1
|
RAD51 associated protein 1 |
chr3_-_54735001 | 8.96 |
ENSMUST00000153224.1
|
Exosc8
|
exosome component 8 |
chr6_+_66535390 | 8.72 |
ENSMUST00000116605.1
|
Mad2l1
|
MAD2 mitotic arrest deficient-like 1 |
chr11_-_33163072 | 8.72 |
ENSMUST00000093201.6
ENSMUST00000101375.4 ENSMUST00000109354.3 ENSMUST00000075641.3 |
Npm1
|
nucleophosmin 1 |
chr16_-_4003750 | 8.68 |
ENSMUST00000171658.1
ENSMUST00000171762.1 |
Slx4
|
SLX4 structure-specific endonuclease subunit homolog (S. cerevisiae) |
chr5_-_77310049 | 8.61 |
ENSMUST00000047860.8
|
Noa1
|
nitric oxide associated 1 |
chr2_-_172370506 | 8.53 |
ENSMUST00000109139.1
ENSMUST00000028997.7 ENSMUST00000109140.3 |
Aurka
|
aurora kinase A |
chr17_-_24251382 | 8.33 |
ENSMUST00000115390.3
|
Ccnf
|
cyclin F |
chr2_+_157560078 | 8.27 |
ENSMUST00000153739.2
ENSMUST00000173595.1 ENSMUST00000109526.1 ENSMUST00000173839.1 ENSMUST00000173041.1 ENSMUST00000173793.1 ENSMUST00000172487.1 ENSMUST00000088484.5 |
Nnat
|
neuronatin |
chr6_+_66535418 | 8.20 |
ENSMUST00000101343.1
|
Mad2l1
|
MAD2 mitotic arrest deficient-like 1 |
chr7_-_140787826 | 8.17 |
ENSMUST00000026553.4
|
Syce1
|
synaptonemal complex central element protein 1 |
chr2_-_157007039 | 8.10 |
ENSMUST00000103129.2
ENSMUST00000103130.1 |
Dsn1
|
DSN1, MIND kinetochore complex component, homolog (S. cerevisiae) |
chr18_-_74207771 | 6.93 |
ENSMUST00000040188.8
ENSMUST00000177604.1 |
Ska1
|
spindle and kinetochore associated complex subunit 1 |
chr3_+_79629074 | 6.73 |
ENSMUST00000029388.8
|
4930579G24Rik
|
RIKEN cDNA 4930579G24 gene |
chr7_+_80294450 | 6.66 |
ENSMUST00000163812.2
ENSMUST00000047558.7 ENSMUST00000174199.1 ENSMUST00000173824.1 ENSMUST00000174172.1 |
Prc1
|
protein regulator of cytokinesis 1 |
chr13_-_68582087 | 6.56 |
ENSMUST00000045827.4
|
Mtrr
|
5-methyltetrahydrofolate-homocysteine methyltransferase reductase |
chr2_-_127133909 | 6.53 |
ENSMUST00000110387.3
|
Ncaph
|
non-SMC condensin I complex, subunit H |
chr2_-_157007015 | 6.47 |
ENSMUST00000146413.1
|
Dsn1
|
DSN1, MIND kinetochore complex component, homolog (S. cerevisiae) |
chr14_-_57826128 | 6.34 |
ENSMUST00000022536.2
|
Ska3
|
spindle and kinetochore associated complex subunit 3 |
chrX_+_134308084 | 6.32 |
ENSMUST00000081064.5
ENSMUST00000101251.1 ENSMUST00000129782.1 |
Cenpi
|
centromere protein I |
chr17_-_53689266 | 6.30 |
ENSMUST00000024736.7
|
Sgol1
|
shugoshin-like 1 (S. pombe) |
chr7_+_18991245 | 6.15 |
ENSMUST00000130268.1
ENSMUST00000059331.8 ENSMUST00000131087.1 |
Mypop
|
Myb-related transcription factor, partner of profilin |
chr15_+_88751649 | 6.12 |
ENSMUST00000041297.8
|
Zbed4
|
zinc finger, BED domain containing 4 |
chr17_-_35897073 | 6.10 |
ENSMUST00000150056.1
ENSMUST00000156817.1 ENSMUST00000146451.1 ENSMUST00000148482.1 |
2310061I04Rik
|
RIKEN cDNA 2310061I04 gene |
chr12_-_110696248 | 6.04 |
ENSMUST00000124156.1
|
Hsp90aa1
|
heat shock protein 90, alpha (cytosolic), class A member 1 |
chr13_-_55329723 | 6.04 |
ENSMUST00000021941.7
|
Mxd3
|
Max dimerization protein 3 |
chr7_+_44816088 | 5.97 |
ENSMUST00000057195.9
ENSMUST00000107891.1 |
Nup62
|
nucleoporin 62 |
chr10_-_80855187 | 5.85 |
ENSMUST00000035775.8
|
Lsm7
|
LSM7 homolog, U6 small nuclear RNA associated (S. cerevisiae) |
chr8_+_71406003 | 5.85 |
ENSMUST00000119976.1
ENSMUST00000120725.1 |
Ankle1
|
ankyrin repeat and LEM domain containing 1 |
chr8_-_70234401 | 5.84 |
ENSMUST00000019679.5
|
Armc6
|
armadillo repeat containing 6 |
chr17_-_46202576 | 5.82 |
ENSMUST00000024749.7
|
Polh
|
polymerase (DNA directed), eta (RAD 30 related) |
chr13_+_51645232 | 5.81 |
ENSMUST00000075853.5
|
Cks2
|
CDC28 protein kinase regulatory subunit 2 |
chr17_+_26917091 | 5.72 |
ENSMUST00000078961.4
|
Kifc5b
|
kinesin family member C5B |
chr3_-_36571952 | 5.63 |
ENSMUST00000029270.3
|
Ccna2
|
cyclin A2 |
chr10_-_5805412 | 5.60 |
ENSMUST00000019907.7
|
Fbxo5
|
F-box protein 5 |
chr17_-_71526819 | 5.54 |
ENSMUST00000024851.9
|
Ndc80
|
NDC80 homolog, kinetochore complex component (S. cerevisiae) |
chr8_-_22185758 | 5.50 |
ENSMUST00000046916.7
|
Ckap2
|
cytoskeleton associated protein 2 |
chr10_+_128232065 | 5.50 |
ENSMUST00000055539.4
ENSMUST00000105244.1 ENSMUST00000105243.2 ENSMUST00000125289.1 ENSMUST00000105242.1 |
Timeless
|
timeless circadian clock 1 |
chr11_+_40733936 | 5.49 |
ENSMUST00000127382.1
|
Nudcd2
|
NudC domain containing 2 |
chr7_+_24507057 | 5.47 |
ENSMUST00000071361.6
|
Zfp428
|
zinc finger protein 428 |
chrX_+_159414572 | 5.36 |
ENSMUST00000112471.2
|
Map7d2
|
MAP7 domain containing 2 |
chr2_+_119047116 | 5.33 |
ENSMUST00000152380.1
ENSMUST00000099542.2 |
Casc5
|
cancer susceptibility candidate 5 |
chr17_+_56304313 | 5.32 |
ENSMUST00000113035.1
ENSMUST00000113039.2 ENSMUST00000142387.1 |
Uhrf1
|
ubiquitin-like, containing PHD and RING finger domains, 1 |
chr19_+_41911851 | 5.19 |
ENSMUST00000011896.6
|
Pgam1
|
phosphoglycerate mutase 1 |
chr17_-_35897371 | 5.18 |
ENSMUST00000148721.1
|
2310061I04Rik
|
RIKEN cDNA 2310061I04 gene |
chr12_-_110696289 | 5.16 |
ENSMUST00000021698.6
|
Hsp90aa1
|
heat shock protein 90, alpha (cytosolic), class A member 1 |
chr17_-_35516780 | 5.15 |
ENSMUST00000160885.1
ENSMUST00000159009.1 ENSMUST00000161012.1 |
Tcf19
|
transcription factor 19 |
chr19_-_5964132 | 5.15 |
ENSMUST00000025752.7
ENSMUST00000165143.1 |
Pola2
|
polymerase (DNA directed), alpha 2 |
chr10_+_80855275 | 5.07 |
ENSMUST00000035597.8
|
Sppl2b
|
signal peptide peptidase like 2B |
chr15_-_31601506 | 4.85 |
ENSMUST00000161266.1
|
Cct5
|
chaperonin containing Tcp1, subunit 5 (epsilon) |
chr11_-_102925086 | 4.77 |
ENSMUST00000021311.9
|
Kif18b
|
kinesin family member 18B |
chr11_-_69921329 | 4.74 |
ENSMUST00000108613.3
ENSMUST00000043419.3 ENSMUST00000070996.4 |
Eif5a
|
eukaryotic translation initiation factor 5A |
chr15_-_98881255 | 4.62 |
ENSMUST00000024518.9
|
Rhebl1
|
Ras homolog enriched in brain like 1 |
chr2_+_119047129 | 4.58 |
ENSMUST00000153300.1
ENSMUST00000028799.5 |
Casc5
|
cancer susceptibility candidate 5 |
chr7_+_24507122 | 4.54 |
ENSMUST00000177205.1
|
Zfp428
|
zinc finger protein 428 |
chr2_-_128943985 | 4.54 |
ENSMUST00000028866.8
|
Zc3h8
|
zinc finger CCCH type containing 8 |
chr11_-_34833631 | 4.52 |
ENSMUST00000093191.2
|
Spdl1
|
spindle apparatus coiled-coil protein 1 |
chr7_+_24507006 | 4.52 |
ENSMUST00000176880.1
|
Zfp428
|
zinc finger protein 428 |
chr3_+_104638658 | 4.51 |
ENSMUST00000046212.1
|
Slc16a1
|
solute carrier family 16 (monocarboxylic acid transporters), member 1 |
chr7_+_24507099 | 4.49 |
ENSMUST00000177228.1
|
Zfp428
|
zinc finger protein 428 |
chr9_+_55326913 | 4.46 |
ENSMUST00000085754.3
ENSMUST00000034862.4 |
AI118078
|
expressed sequence AI118078 |
chr11_-_86544754 | 4.40 |
ENSMUST00000138810.1
ENSMUST00000058286.2 ENSMUST00000154617.1 |
Rps6kb1
|
ribosomal protein S6 kinase, polypeptide 1 |
chr12_+_78861693 | 4.40 |
ENSMUST00000071230.7
|
Eif2s1
|
eukaryotic translation initiation factor 2, subunit 1 alpha |
chrX_-_102157065 | 4.40 |
ENSMUST00000056904.2
|
Ercc6l
|
excision repair cross-complementing rodent repair deficiency complementation group 6 like |
chr9_-_106656081 | 4.37 |
ENSMUST00000023959.7
|
Grm2
|
glutamate receptor, metabotropic 2 |
chr11_+_40733639 | 4.36 |
ENSMUST00000020578.4
|
Nudcd2
|
NudC domain containing 2 |
chr3_-_108722281 | 4.36 |
ENSMUST00000029482.9
|
Gpsm2
|
G-protein signalling modulator 2 (AGS3-like, C. elegans) |
chr10_+_81070035 | 4.30 |
ENSMUST00000005057.6
|
Thop1
|
thimet oligopeptidase 1 |
chr15_-_51991679 | 4.26 |
ENSMUST00000022927.9
|
Rad21
|
RAD21 homolog (S. pombe) |
chr2_-_153015331 | 4.23 |
ENSMUST00000028972.8
|
Pdrg1
|
p53 and DNA damage regulated 1 |
chr3_+_40800013 | 4.21 |
ENSMUST00000026858.5
ENSMUST00000170825.1 |
Plk4
|
polo-like kinase 4 |
chr9_-_106447584 | 4.20 |
ENSMUST00000171678.1
ENSMUST00000048685.6 ENSMUST00000171925.1 |
Abhd14a
|
abhydrolase domain containing 14A |
chr4_-_120570252 | 4.14 |
ENSMUST00000030381.7
|
Ctps
|
cytidine 5'-triphosphate synthase |
chr15_-_99651580 | 4.10 |
ENSMUST00000171908.1
ENSMUST00000171702.1 ENSMUST00000109581.2 ENSMUST00000169810.1 ENSMUST00000023756.5 |
Racgap1
|
Rac GTPase-activating protein 1 |
chr15_-_31601786 | 4.08 |
ENSMUST00000022842.8
|
Cct5
|
chaperonin containing Tcp1, subunit 5 (epsilon) |
chr12_-_110696332 | 4.07 |
ENSMUST00000094361.4
|
Hsp90aa1
|
heat shock protein 90, alpha (cytosolic), class A member 1 |
chr17_+_34894515 | 4.06 |
ENSMUST00000052778.8
|
Zbtb12
|
zinc finger and BTB domain containing 12 |
chr7_-_122132844 | 4.03 |
ENSMUST00000106469.1
ENSMUST00000063587.6 ENSMUST00000106468.1 ENSMUST00000130149.1 ENSMUST00000098068.3 |
Palb2
|
partner and localizer of BRCA2 |
chr3_+_40800054 | 4.02 |
ENSMUST00000168287.1
|
Plk4
|
polo-like kinase 4 |
chr10_-_63244135 | 4.00 |
ENSMUST00000054837.3
|
1700120B22Rik
|
RIKEN cDNA 1700120B22 gene |
chr16_+_18498768 | 4.00 |
ENSMUST00000167778.1
ENSMUST00000139625.1 ENSMUST00000149035.1 ENSMUST00000090086.4 ENSMUST00000115601.1 ENSMUST00000147739.1 ENSMUST00000146673.1 |
Gnb1l
Gm16314
|
guanine nucleotide binding protein (G protein), beta polypeptide 1-like predicted gene 16314 |
chr15_-_94543472 | 3.99 |
ENSMUST00000134061.1
ENSMUST00000049151.3 |
Pus7l
|
pseudouridylate synthase 7 homolog (S. cerevisiae)-like |
chr3_-_69044697 | 3.99 |
ENSMUST00000136512.1
ENSMUST00000143454.1 ENSMUST00000107802.1 |
Trim59
|
tripartite motif-containing 59 |
chr9_+_110132015 | 3.91 |
ENSMUST00000088716.5
ENSMUST00000111969.1 ENSMUST00000035057.7 ENSMUST00000111966.1 ENSMUST00000111968.1 |
Smarcc1
|
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily c, member 1 |
chr18_+_80206775 | 3.91 |
ENSMUST00000145963.1
ENSMUST00000025464.7 ENSMUST00000125127.1 ENSMUST00000025463.7 |
Txnl4a
Gm16286
|
thioredoxin-like 4A predicted gene 16286 |
chr8_+_116921735 | 3.87 |
ENSMUST00000034205.4
|
Cenpn
|
centromere protein N |
chr3_+_69004969 | 3.83 |
ENSMUST00000136502.1
ENSMUST00000107803.1 |
Smc4
|
structural maintenance of chromosomes 4 |
chr2_+_32236579 | 3.81 |
ENSMUST00000036473.9
|
Pomt1
|
protein-O-mannosyltransferase 1 |
chr10_-_41809607 | 3.80 |
ENSMUST00000019951.9
|
Cep57l1
|
centrosomal protein 57-like 1 |
chr15_+_103240405 | 3.79 |
ENSMUST00000036004.9
ENSMUST00000087351.7 |
Hnrnpa1
|
heterogeneous nuclear ribonucleoprotein A1 |
chr9_-_21760275 | 3.77 |
ENSMUST00000098942.4
|
Spc24
|
SPC24, NDC80 kinetochore complex component, homolog (S. cerevisiae) |
chr15_-_76477269 | 3.75 |
ENSMUST00000023217.9
|
Bop1
|
block of proliferation 1 |
chr6_-_148946146 | 3.74 |
ENSMUST00000132696.1
|
Fam60a
|
family with sequence similarity 60, member A |
chr16_-_37654408 | 3.73 |
ENSMUST00000023514.3
|
Ndufb4
|
NADH dehydrogenase (ubiquinone) 1 beta subcomplex 4 |
chr14_-_56778301 | 3.72 |
ENSMUST00000022507.5
ENSMUST00000163924.1 |
Pspc1
|
paraspeckle protein 1 |
chr3_+_69004711 | 3.71 |
ENSMUST00000042901.8
|
Smc4
|
structural maintenance of chromosomes 4 |
chr9_-_20952838 | 3.70 |
ENSMUST00000004202.9
|
Dnmt1
|
DNA methyltransferase (cytosine-5) 1 |
chr7_+_126862431 | 3.70 |
ENSMUST00000132808.1
|
Hirip3
|
HIRA interacting protein 3 |
chr13_-_24761861 | 3.69 |
ENSMUST00000006898.3
ENSMUST00000110382.2 |
Gmnn
|
geminin |
chr10_+_20347788 | 3.69 |
ENSMUST00000169712.1
|
Mtfr2
|
mitochondrial fission regulator 2 |
chrX_-_111463149 | 3.67 |
ENSMUST00000096348.3
ENSMUST00000113428.2 |
Rps6ka6
|
ribosomal protein S6 kinase polypeptide 6 |
chr4_+_55350043 | 3.66 |
ENSMUST00000030134.8
|
Rad23b
|
RAD23b homolog (S. cerevisiae) |
chr13_-_69611421 | 3.65 |
ENSMUST00000091514.5
|
Srd5a1
|
steroid 5 alpha-reductase 1 |
chr10_+_71347829 | 3.64 |
ENSMUST00000118381.1
ENSMUST00000121446.1 |
Ipmk
|
inositol polyphosphate multikinase |
chr4_+_107367757 | 3.63 |
ENSMUST00000139560.1
|
Ndc1
|
NDC1 transmembrane nucleoporin |
chr17_+_83350925 | 3.61 |
ENSMUST00000096766.4
ENSMUST00000112363.2 ENSMUST00000049503.8 |
Eml4
|
echinoderm microtubule associated protein like 4 |
chr2_-_157135112 | 3.60 |
ENSMUST00000139263.1
|
Samhd1
|
SAM domain and HD domain, 1 |
chr8_-_126475062 | 3.60 |
ENSMUST00000170518.1
|
Gm17296
|
predicted gene, 17296 |
chr8_+_88137844 | 3.60 |
ENSMUST00000034079.7
ENSMUST00000121949.1 |
Heatr3
|
HEAT repeat containing 3 |
chrX_-_93632113 | 3.58 |
ENSMUST00000006856.2
|
Pola1
|
polymerase (DNA directed), alpha 1 |
chr13_-_14613017 | 3.57 |
ENSMUST00000015816.3
|
Mrpl32
|
mitochondrial ribosomal protein L32 |
chr12_+_11265867 | 3.56 |
ENSMUST00000020931.5
|
Smc6
|
structural maintenance of chromosomes 6 |
chr11_+_115564434 | 3.55 |
ENSMUST00000021085.4
|
Nup85
|
nucleoporin 85 |
chr9_+_106477269 | 3.48 |
ENSMUST00000047721.8
|
Rrp9
|
RRP9, small subunit (SSU) processome component, homolog (yeast) |
chr11_+_101119938 | 3.43 |
ENSMUST00000043680.8
|
Tubg1
|
tubulin, gamma 1 |
chr4_-_132353605 | 3.36 |
ENSMUST00000155129.1
|
Rcc1
|
regulator of chromosome condensation 1 |
chrX_-_111463043 | 3.35 |
ENSMUST00000065976.5
|
Rps6ka6
|
ribosomal protein S6 kinase polypeptide 6 |
chr14_-_47276790 | 3.33 |
ENSMUST00000111792.1
ENSMUST00000111791.1 ENSMUST00000111790.1 |
Wdhd1
|
WD repeat and HMG-box DNA binding protein 1 |
chr2_+_167062934 | 3.33 |
ENSMUST00000125674.1
|
1500012F01Rik
|
RIKEN cDNA 1500012F01 gene |
chr12_+_113156403 | 3.33 |
ENSMUST00000049271.8
|
4930427A07Rik
|
RIKEN cDNA 4930427A07 gene |
chr18_+_80206887 | 3.32 |
ENSMUST00000127234.1
|
Gm16286
|
predicted gene 16286 |
chr4_+_11558914 | 3.30 |
ENSMUST00000178703.1
ENSMUST00000095145.5 ENSMUST00000108306.2 ENSMUST00000070755.6 |
Rad54b
|
RAD54 homolog B (S. cerevisiae) |
chr4_+_150236685 | 3.30 |
ENSMUST00000150175.1
|
Eno1
|
enolase 1, alpha non-neuron |
chr6_-_88627422 | 3.29 |
ENSMUST00000120933.2
ENSMUST00000169512.1 |
Kbtbd12
|
kelch repeat and BTB (POZ) domain containing 12 |
chr17_-_75551838 | 3.28 |
ENSMUST00000112507.3
|
Fam98a
|
family with sequence similarity 98, member A |
chr7_+_24547150 | 3.27 |
ENSMUST00000063249.8
|
Xrcc1
|
X-ray repair complementing defective repair in Chinese hamster cells 1 |
chrX_-_111463103 | 3.26 |
ENSMUST00000137712.2
|
Rps6ka6
|
ribosomal protein S6 kinase polypeptide 6 |
chr13_+_68582213 | 3.26 |
ENSMUST00000051784.8
|
Fastkd3
|
FAST kinase domains 3 |
chr8_-_35495487 | 3.25 |
ENSMUST00000033927.6
|
Eri1
|
exoribonuclease 1 |
chr5_+_129846980 | 3.24 |
ENSMUST00000171300.1
|
Sumf2
|
sulfatase modifying factor 2 |
chr17_+_66123520 | 3.24 |
ENSMUST00000163605.2
|
Ddx11
|
DEAD/H (Asp-Glu-Ala-Asp/His) box helicase 11 |
chr12_+_116405397 | 3.20 |
ENSMUST00000084828.3
|
Ncapg2
|
non-SMC condensin II complex, subunit G2 |
chr14_+_70545251 | 3.19 |
ENSMUST00000047218.3
|
Reep4
|
receptor accessory protein 4 |
chr11_+_86544982 | 3.19 |
ENSMUST00000108030.2
ENSMUST00000020821.3 ENSMUST00000069503.6 ENSMUST00000167178.2 |
Tubd1
|
tubulin, delta 1 |
chr4_-_155761042 | 3.18 |
ENSMUST00000030903.5
|
Atad3a
|
ATPase family, AAA domain containing 3A |
chr9_-_53248106 | 3.18 |
ENSMUST00000065630.6
|
Ddx10
|
DEAD (Asp-Glu-Ala-Asp) box polypeptide 10 |
chr1_+_139422196 | 3.18 |
ENSMUST00000039867.7
|
Zbtb41
|
zinc finger and BTB domain containing 41 homolog |
chr17_-_28622479 | 3.17 |
ENSMUST00000130643.1
|
Srpk1
|
serine/arginine-rich protein specific kinase 1 |
chr7_+_45897429 | 3.17 |
ENSMUST00000140243.1
|
Tmem143
|
transmembrane protein 143 |
chr3_-_89418287 | 3.17 |
ENSMUST00000029679.3
|
Cks1b
|
CDC28 protein kinase 1b |
chr13_-_74062262 | 3.16 |
ENSMUST00000036456.6
|
Cep72
|
centrosomal protein 72 |
chr7_-_45896677 | 3.15 |
ENSMUST00000039049.7
|
Syngr4
|
synaptogyrin 4 |
chr14_+_101653967 | 3.15 |
ENSMUST00000002289.6
|
Uchl3
|
ubiquitin carboxyl-terminal esterase L3 (ubiquitin thiolesterase) |
chr5_+_121397936 | 3.15 |
ENSMUST00000042163.8
|
Naa25
|
N(alpha)-acetyltransferase 25, NatB auxiliary subunit |
chrX_+_75096039 | 3.12 |
ENSMUST00000131155.1
ENSMUST00000132000.1 |
Dkc1
|
dyskeratosis congenita 1, dyskerin |
chr1_+_55237177 | 3.11 |
ENSMUST00000061334.8
|
Mars2
|
methionine-tRNA synthetase 2 (mitochondrial) |
chr6_+_86365673 | 3.11 |
ENSMUST00000071492.7
|
Fam136a
|
family with sequence similarity 136, member A |
chr19_-_47050823 | 3.10 |
ENSMUST00000026032.5
|
Pcgf6
|
polycomb group ring finger 6 |
chr4_-_150909428 | 3.08 |
ENSMUST00000128075.1
ENSMUST00000105674.1 ENSMUST00000105673.1 |
Park7
|
Parkinson disease (autosomal recessive, early onset) 7 |
chr8_-_116921365 | 3.08 |
ENSMUST00000128304.1
|
Cmc2
|
COX assembly mitochondrial protein 2 |
chr11_-_69921190 | 3.06 |
ENSMUST00000108607.1
|
Eif5a
|
eukaryotic translation initiation factor 5A |
chr13_+_24831661 | 3.06 |
ENSMUST00000038039.2
|
Tdp2
|
tyrosyl-DNA phosphodiesterase 2 |
chr10_+_71347736 | 3.06 |
ENSMUST00000079252.6
|
Ipmk
|
inositol polyphosphate multikinase |
chr17_-_25727364 | 3.06 |
ENSMUST00000170070.1
ENSMUST00000048054.7 |
Chtf18
|
CTF18, chromosome transmission fidelity factor 18 |
chr10_-_80406811 | 3.06 |
ENSMUST00000020372.5
|
Uqcr11
|
ubiquinol-cytochrome c reductase, complex III subunit XI |
chr10_-_127288851 | 3.05 |
ENSMUST00000156208.1
ENSMUST00000026476.6 |
Mbd6
|
methyl-CpG binding domain protein 6 |
chr10_-_127288999 | 3.04 |
ENSMUST00000119078.1
|
Mbd6
|
methyl-CpG binding domain protein 6 |
chr4_+_123016590 | 3.00 |
ENSMUST00000102649.3
|
Trit1
|
tRNA isopentenyltransferase 1 |
chr6_+_42264983 | 2.99 |
ENSMUST00000031895.6
|
Casp2
|
caspase 2 |
chrX_-_48513518 | 2.98 |
ENSMUST00000114945.2
ENSMUST00000037349.7 |
Aifm1
|
apoptosis-inducing factor, mitochondrion-associated 1 |
chr10_-_117792663 | 2.97 |
ENSMUST00000167943.1
ENSMUST00000064848.5 |
Nup107
|
nucleoporin 107 |
chr14_+_73142863 | 2.97 |
ENSMUST00000171767.1
ENSMUST00000163533.1 |
Rcbtb2
|
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
chr9_+_108936648 | 2.97 |
ENSMUST00000026743.8
|
Uqcrc1
|
ubiquinol-cytochrome c reductase core protein 1 |
chr7_+_140137559 | 2.96 |
ENSMUST00000036977.8
|
Mtg1
|
mitochondrial GTPase 1 homolog (S. cerevisiae) |
chr2_-_146511899 | 2.93 |
ENSMUST00000131824.1
|
Ralgapa2
|
Ral GTPase activating protein, alpha subunit 2 (catalytic) |
chr18_-_73815392 | 2.93 |
ENSMUST00000025439.3
|
Me2
|
malic enzyme 2, NAD(+)-dependent, mitochondrial |
chr14_+_8080315 | 2.90 |
ENSMUST00000023924.3
|
Rpp14
|
ribonuclease P 14 subunit |
chr4_-_86612009 | 2.88 |
ENSMUST00000125481.1
ENSMUST00000070607.7 |
Haus6
|
HAUS augmin-like complex, subunit 6 |
chr17_-_31512253 | 2.88 |
ENSMUST00000166626.1
|
Wdr4
|
WD repeat domain 4 |
chr13_-_25020289 | 2.87 |
ENSMUST00000021772.2
|
Mrs2
|
MRS2 magnesium homeostasis factor homolog (S. cerevisiae) |
chr11_-_69980468 | 2.87 |
ENSMUST00000143175.1
|
Elp5
|
elongator acetyltransferase complex subunit 5 |
chr4_+_150236816 | 2.85 |
ENSMUST00000080926.6
|
Eno1
|
enolase 1, alpha non-neuron |
chr17_-_48432723 | 2.82 |
ENSMUST00000046549.3
|
Apobec2
|
apolipoprotein B mRNA editing enzyme, catalytic polypeptide 2 |
chr7_-_45896656 | 2.81 |
ENSMUST00000120299.1
|
Syngr4
|
synaptogyrin 4 |
chr10_+_63100156 | 2.81 |
ENSMUST00000044059.3
|
Atoh7
|
atonal homolog 7 (Drosophila) |
chr13_+_76098734 | 2.81 |
ENSMUST00000091466.3
|
Ttc37
|
tetratricopeptide repeat domain 37 |
chr10_-_82623190 | 2.81 |
ENSMUST00000183363.1
ENSMUST00000079648.5 ENSMUST00000185168.1 |
1190007I07Rik
|
RIKEN cDNA 1190007I07 gene |
chr12_+_86678685 | 2.81 |
ENSMUST00000021681.3
|
Vash1
|
vasohibin 1 |
chr11_+_77930800 | 2.80 |
ENSMUST00000093995.3
ENSMUST00000000646.7 |
Sez6
|
seizure related gene 6 |
chr10_-_80039674 | 2.80 |
ENSMUST00000004786.9
|
Polr2e
|
polymerase (RNA) II (DNA directed) polypeptide E |
chr1_-_86359455 | 2.78 |
ENSMUST00000027438.6
|
Ncl
|
nucleolin |
chr1_+_45795485 | 2.77 |
ENSMUST00000147308.1
|
Wdr75
|
WD repeat domain 75 |
chr16_-_45742888 | 2.76 |
ENSMUST00000128348.1
ENSMUST00000066983.6 |
Abhd10
|
abhydrolase domain containing 10 |
chr17_+_46202740 | 2.74 |
ENSMUST00000087031.5
|
Xpo5
|
exportin 5 |
chr16_+_94370786 | 2.74 |
ENSMUST00000147046.1
ENSMUST00000149885.1 ENSMUST00000127667.1 ENSMUST00000119131.1 ENSMUST00000145883.1 |
Ttc3
|
tetratricopeptide repeat domain 3 |
chr2_+_24949747 | 2.73 |
ENSMUST00000028350.3
|
Zmynd19
|
zinc finger, MYND domain containing 19 |
chr11_+_98026695 | 2.72 |
ENSMUST00000092425.4
|
Rpl19
|
ribosomal protein L19 |
chr7_-_35647441 | 2.69 |
ENSMUST00000118501.1
|
Pdcd5
|
programmed cell death 5 |
chr7_+_97371604 | 2.68 |
ENSMUST00000098300.4
|
Alg8
|
asparagine-linked glycosylation 8 (alpha-1,3-glucosyltransferase) |
chr12_-_108275409 | 2.67 |
ENSMUST00000136175.1
|
Ccdc85c
|
coiled-coil domain containing 85C |
chr1_-_131138232 | 2.66 |
ENSMUST00000016670.7
|
Dyrk3
|
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 3 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
4.2 | 38.2 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
4.2 | 12.5 | GO:0000448 | cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
3.8 | 15.3 | GO:0051316 | attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
3.8 | 11.3 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
3.5 | 14.1 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
3.3 | 9.9 | GO:1904170 | regulation of bleb assembly(GO:1904170) |
3.0 | 9.0 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
2.9 | 17.7 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
2.9 | 8.7 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
2.9 | 8.7 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
2.6 | 10.6 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
2.2 | 6.5 | GO:2000373 | regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
2.1 | 6.3 | GO:1903198 | glycolate metabolic process(GO:0009441) enzyme active site formation via L-cysteine sulfinic acid(GO:0018323) primary alcohol biosynthetic process(GO:0034309) cellular response to glyoxal(GO:0036471) glycolate biosynthetic process(GO:0046295) negative regulation of TRAIL-activated apoptotic signaling pathway(GO:1903122) regulation of pyrroline-5-carboxylate reductase activity(GO:1903167) positive regulation of pyrroline-5-carboxylate reductase activity(GO:1903168) regulation of tyrosine 3-monooxygenase activity(GO:1903176) positive regulation of tyrosine 3-monooxygenase activity(GO:1903178) L-dopa metabolic process(GO:1903184) L-dopa biosynthetic process(GO:1903185) glyoxal metabolic process(GO:1903189) regulation of L-dopa biosynthetic process(GO:1903195) positive regulation of L-dopa biosynthetic process(GO:1903197) regulation of L-dopa decarboxylase activity(GO:1903198) positive regulation of L-dopa decarboxylase activity(GO:1903200) positive regulation of cellular amino acid biosynthetic process(GO:2000284) |
2.0 | 14.2 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
2.0 | 11.7 | GO:0045905 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
1.9 | 11.7 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
1.8 | 5.4 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
1.8 | 1.8 | GO:0090172 | microtubule cytoskeleton organization involved in homologous chromosome segregation(GO:0090172) |
1.6 | 6.3 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
1.5 | 4.6 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
1.5 | 3.0 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
1.4 | 7.2 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
1.4 | 5.8 | GO:0006203 | dGTP catabolic process(GO:0006203) dATP catabolic process(GO:0046061) |
1.4 | 18.6 | GO:0019985 | translesion synthesis(GO:0019985) |
1.4 | 4.2 | GO:0016078 | tRNA catabolic process(GO:0016078) |
1.4 | 9.8 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
1.4 | 8.4 | GO:0090070 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
1.4 | 2.8 | GO:2000232 | regulation of rRNA processing(GO:2000232) |
1.4 | 4.1 | GO:0070843 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
1.3 | 5.3 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
1.3 | 1.3 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
1.3 | 5.0 | GO:1904851 | positive regulation of establishment of protein localization to telomere(GO:1904851) |
1.2 | 2.4 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
1.2 | 3.6 | GO:0006272 | leading strand elongation(GO:0006272) |
1.2 | 8.3 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
1.2 | 3.6 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
1.2 | 4.7 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
1.2 | 13.0 | GO:1904869 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
1.2 | 8.1 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
1.1 | 4.6 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
1.1 | 3.4 | GO:1904098 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
1.1 | 3.3 | GO:1903632 | positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) |
1.1 | 7.7 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
1.1 | 4.4 | GO:1904776 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
1.1 | 3.3 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
1.1 | 3.3 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
1.1 | 3.2 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
1.1 | 6.4 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) positive regulation of glucose mediated signaling pathway(GO:1902661) |
1.0 | 3.1 | GO:0002842 | positive regulation of T cell mediated immune response to tumor cell(GO:0002842) |
1.0 | 5.1 | GO:0051031 | tRNA transport(GO:0051031) |
1.0 | 3.0 | GO:0000915 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
1.0 | 2.9 | GO:0002276 | basophil activation involved in immune response(GO:0002276) |
1.0 | 2.9 | GO:2000812 | regulation of barbed-end actin filament capping(GO:2000812) |
1.0 | 3.9 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
1.0 | 6.8 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.9 | 5.7 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.9 | 6.6 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
0.9 | 2.8 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.9 | 2.8 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
0.9 | 2.8 | GO:0019389 | glucuronoside metabolic process(GO:0019389) |
0.9 | 2.7 | GO:0099578 | regulation of translation at synapse, modulating synaptic transmission(GO:0099547) regulation of translation at postsynapse, modulating synaptic transmission(GO:0099578) positive regulation of intracellular transport of viral material(GO:1901254) |
0.9 | 4.4 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
0.9 | 2.7 | GO:0016132 | brassinosteroid metabolic process(GO:0016131) brassinosteroid biosynthetic process(GO:0016132) |
0.9 | 2.6 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.9 | 5.2 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
0.8 | 2.5 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.8 | 3.4 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.8 | 3.3 | GO:0070829 | heterochromatin maintenance(GO:0070829) |
0.8 | 2.5 | GO:0071929 | alpha-tubulin acetylation(GO:0071929) |
0.8 | 2.4 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
0.8 | 8.1 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.8 | 10.3 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.8 | 4.6 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.8 | 3.8 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
0.8 | 0.8 | GO:0032056 | positive regulation of translation in response to stress(GO:0032056) |
0.8 | 4.5 | GO:0035879 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.7 | 0.7 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.7 | 8.7 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.7 | 3.6 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
0.7 | 4.3 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.7 | 9.7 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
0.7 | 2.7 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.7 | 2.7 | GO:0099527 | postsynapse to nucleus signaling pathway(GO:0099527) |
0.7 | 2.7 | GO:0032805 | positive regulation of low-density lipoprotein particle receptor catabolic process(GO:0032805) |
0.7 | 4.6 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.6 | 5.2 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.6 | 4.4 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.6 | 1.9 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
0.6 | 25.2 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.6 | 2.4 | GO:0001835 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.6 | 1.1 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.6 | 1.1 | GO:0071707 | immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
0.6 | 4.4 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.6 | 1.7 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.5 | 3.8 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.5 | 4.3 | GO:0098762 | meiotic prophase I(GO:0007128) prophase(GO:0051324) meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
0.5 | 2.7 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.5 | 1.6 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.5 | 5.7 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.5 | 4.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.5 | 5.7 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.5 | 1.5 | GO:0007172 | signal complex assembly(GO:0007172) |
0.5 | 2.0 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.5 | 2.0 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.5 | 10.5 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.5 | 1.5 | GO:0042780 | tRNA 3'-end processing(GO:0042780) mitochondrial tRNA processing(GO:0090646) |
0.5 | 2.0 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.5 | 2.0 | GO:0032053 | ciliary basal body organization(GO:0032053) |
0.5 | 2.0 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.5 | 4.4 | GO:0038203 | TORC2 signaling(GO:0038203) |
0.5 | 0.5 | GO:0032253 | dense core granule localization(GO:0032253) dense core granule transport(GO:1901950) regulation of dense core granule transport(GO:1904809) positive regulation of dense core granule transport(GO:1904811) |
0.5 | 2.4 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
0.5 | 2.4 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.5 | 3.9 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.5 | 1.9 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
0.5 | 1.4 | GO:0009173 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.5 | 0.5 | GO:0043634 | polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
0.5 | 4.7 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.5 | 4.2 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.5 | 1.9 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.5 | 6.5 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.5 | 1.4 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.5 | 1.4 | GO:0048298 | regulation of isotype switching to IgA isotypes(GO:0048296) positive regulation of isotype switching to IgA isotypes(GO:0048298) |
0.5 | 1.8 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.5 | 1.8 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
0.4 | 2.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.4 | 4.0 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.4 | 3.5 | GO:1905216 | positive regulation of RNA binding(GO:1905216) |
0.4 | 1.3 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.4 | 1.8 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.4 | 3.9 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
0.4 | 0.9 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.4 | 2.1 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.4 | 1.7 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.4 | 1.3 | GO:2000793 | left ventricular cardiac muscle tissue morphogenesis(GO:0003220) positive regulation of follicle-stimulating hormone secretion(GO:0046881) cell proliferation involved in heart valve development(GO:2000793) |
0.4 | 2.9 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.4 | 1.6 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.4 | 1.6 | GO:0060025 | regulation of synaptic activity(GO:0060025) |
0.4 | 1.2 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) protein K27-linked deubiquitination(GO:1990167) |
0.4 | 2.8 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.4 | 1.2 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.4 | 4.4 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.4 | 2.7 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.4 | 2.3 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
0.4 | 3.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.4 | 3.8 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.4 | 2.3 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
0.4 | 3.4 | GO:0036093 | germ cell proliferation(GO:0036093) |
0.4 | 1.5 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.4 | 9.1 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.4 | 0.8 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
0.4 | 3.4 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.4 | 1.1 | GO:0046168 | glycerol-3-phosphate catabolic process(GO:0046168) |
0.4 | 1.1 | GO:2000584 | regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
0.4 | 1.5 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
0.4 | 1.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.4 | 1.1 | GO:1902949 | positive regulation of tau-protein kinase activity(GO:1902949) |
0.4 | 0.7 | GO:0060844 | Notch signaling pathway involved in heart induction(GO:0003137) regulation of Notch signaling pathway involved in heart induction(GO:0035480) positive regulation of Notch signaling pathway involved in heart induction(GO:0035481) arterial endothelial cell fate commitment(GO:0060844) blood vessel endothelial cell fate commitment(GO:0060846) endothelial cell fate specification(GO:0060847) Notch signaling pathway involved in arterial endothelial cell fate commitment(GO:0060853) regulation of heart induction(GO:0090381) blood vessel endothelial cell fate specification(GO:0097101) positive regulation of heart induction(GO:1901321) |
0.4 | 2.9 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.4 | 0.4 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
0.4 | 2.5 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.4 | 1.1 | GO:0016598 | protein arginylation(GO:0016598) |
0.4 | 1.4 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.4 | 2.8 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.3 | 0.7 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.3 | 8.0 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.3 | 2.7 | GO:0009452 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
0.3 | 1.3 | GO:0044376 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
0.3 | 1.0 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.3 | 1.0 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
0.3 | 6.0 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.3 | 2.6 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.3 | 1.7 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.3 | 7.9 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
0.3 | 4.9 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.3 | 4.6 | GO:0070673 | response to interleukin-18(GO:0070673) |
0.3 | 1.3 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.3 | 4.1 | GO:0006241 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.3 | 1.0 | GO:0019230 | proprioception(GO:0019230) |
0.3 | 1.6 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.3 | 8.1 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.3 | 0.3 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.3 | 0.9 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
0.3 | 1.5 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.3 | 0.6 | GO:0021508 | floor plate formation(GO:0021508) |
0.3 | 1.2 | GO:0010635 | regulation of mitochondrial fusion(GO:0010635) negative regulation of mitochondrial fusion(GO:0010637) |
0.3 | 8.2 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.3 | 1.8 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.3 | 3.0 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.3 | 3.9 | GO:0006337 | nucleosome disassembly(GO:0006337) |
0.3 | 2.1 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.3 | 0.9 | GO:0051935 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
0.3 | 3.0 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.3 | 1.2 | GO:0071267 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) amino acid salvage(GO:0043102) L-methionine salvage(GO:0071267) |
0.3 | 1.2 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.3 | 0.9 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.3 | 5.5 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.3 | 1.7 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.3 | 0.6 | GO:0051329 | interphase(GO:0051325) mitotic interphase(GO:0051329) |
0.3 | 3.1 | GO:0031571 | mitotic G1 DNA damage checkpoint(GO:0031571) |
0.3 | 1.7 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.3 | 1.4 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.3 | 0.8 | GO:1990859 | cellular response to endothelin(GO:1990859) |
0.3 | 3.6 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
0.3 | 3.3 | GO:0016926 | protein desumoylation(GO:0016926) |
0.3 | 4.4 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.3 | 1.4 | GO:0042117 | monocyte activation(GO:0042117) |
0.3 | 0.6 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
0.3 | 3.5 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.3 | 1.1 | GO:0033750 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
0.3 | 1.9 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.3 | 1.3 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.3 | 0.5 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.3 | 0.8 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) |
0.3 | 3.5 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.3 | 3.4 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.3 | 2.8 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.3 | 2.0 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
0.3 | 1.5 | GO:0071484 | cellular response to light intensity(GO:0071484) cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
0.2 | 12.2 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.2 | 0.7 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.2 | 14.7 | GO:0007019 | microtubule depolymerization(GO:0007019) |
0.2 | 1.0 | GO:0070542 | response to fatty acid(GO:0070542) |
0.2 | 0.7 | GO:0061354 | hypophysis morphogenesis(GO:0048850) cervix development(GO:0060067) lateral sprouting involved in mammary gland duct morphogenesis(GO:0060599) planar cell polarity pathway involved in outflow tract morphogenesis(GO:0061347) planar cell polarity pathway involved in ventricular septum morphogenesis(GO:0061348) planar cell polarity pathway involved in cardiac right atrium morphogenesis(GO:0061349) planar cell polarity pathway involved in cardiac muscle tissue morphogenesis(GO:0061350) planar cell polarity pathway involved in pericardium morphogenesis(GO:0061354) regulation of cell proliferation in midbrain(GO:1904933) |
0.2 | 1.7 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.2 | 0.2 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.2 | 0.7 | GO:0031296 | B cell costimulation(GO:0031296) |
0.2 | 1.6 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.2 | 0.9 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.2 | 2.8 | GO:0021554 | optic nerve development(GO:0021554) |
0.2 | 0.7 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
0.2 | 1.4 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.2 | 2.5 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.2 | 6.8 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.2 | 1.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.2 | 0.7 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.2 | 10.0 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.2 | 11.7 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.2 | 0.9 | GO:1902172 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
0.2 | 1.3 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.2 | 2.4 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.2 | 0.7 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.2 | 0.4 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.2 | 0.7 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) |
0.2 | 1.1 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
0.2 | 1.7 | GO:0006265 | DNA topological change(GO:0006265) |
0.2 | 1.1 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.2 | 1.1 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.2 | 1.3 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
0.2 | 0.6 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
0.2 | 1.3 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.2 | 1.7 | GO:1990035 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
0.2 | 4.1 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.2 | 0.8 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.2 | 6.4 | GO:0016572 | histone phosphorylation(GO:0016572) |
0.2 | 1.4 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.2 | 1.4 | GO:1903350 | response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
0.2 | 1.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.2 | 1.2 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.2 | 3.8 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.2 | 1.2 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.2 | 1.6 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.2 | 6.7 | GO:0010259 | multicellular organism aging(GO:0010259) |
0.2 | 1.6 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.2 | 1.4 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.2 | 2.9 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.2 | 1.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.2 | 0.8 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.2 | 0.9 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.2 | 3.0 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.2 | 0.6 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
0.2 | 2.1 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
0.2 | 1.5 | GO:0000012 | single strand break repair(GO:0000012) |
0.2 | 1.9 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.2 | 1.8 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.2 | 1.5 | GO:0071168 | protein localization to chromatin(GO:0071168) |
0.2 | 0.7 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.2 | 3.3 | GO:0071173 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
0.2 | 0.4 | GO:0090151 | establishment of protein localization to mitochondrial membrane(GO:0090151) |
0.2 | 0.9 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.2 | 0.5 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.2 | 1.1 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.2 | 0.7 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) histone arginine methylation(GO:0034969) peptidyl-arginine N-methylation(GO:0035246) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.2 | 1.7 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.2 | 1.0 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.2 | 1.4 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
0.2 | 8.2 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
0.2 | 0.7 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.2 | 0.8 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.2 | 0.5 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
0.2 | 1.0 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.2 | 2.2 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.2 | 2.0 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.2 | 0.5 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.2 | 0.6 | GO:0051697 | protein delipidation(GO:0051697) |
0.2 | 0.5 | GO:0001302 | replicative cell aging(GO:0001302) |
0.2 | 0.6 | GO:0097298 | regulation of nucleus size(GO:0097298) |
0.2 | 0.8 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
0.2 | 1.0 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) negative regulation of mRNA polyadenylation(GO:1900364) |
0.2 | 0.9 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.2 | 0.6 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
0.2 | 0.6 | GO:2001245 | negative regulation of phospholipid biosynthetic process(GO:0071072) regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.2 | 0.5 | GO:0097402 | neuroblast migration(GO:0097402) |
0.2 | 0.9 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.2 | 0.5 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
0.2 | 3.2 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.2 | 0.8 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.2 | 0.3 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
0.2 | 0.5 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
0.2 | 0.9 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.2 | 0.6 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.2 | 0.5 | GO:0035627 | ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
0.2 | 0.6 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.1 | 0.6 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 4.3 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
0.1 | 3.0 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
0.1 | 4.6 | GO:0038202 | TORC1 signaling(GO:0038202) |
0.1 | 1.0 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.1 | 1.2 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.1 | 1.0 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 0.4 | GO:2000978 | negative regulation of forebrain neuron differentiation(GO:2000978) |
0.1 | 2.3 | GO:0051900 | regulation of mitochondrial depolarization(GO:0051900) |
0.1 | 1.9 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 7.6 | GO:0051703 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
0.1 | 3.9 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
0.1 | 1.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.1 | 2.4 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.1 | 0.9 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.1 | 4.5 | GO:0006414 | translational elongation(GO:0006414) |
0.1 | 0.4 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.1 | 1.7 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.1 | 0.6 | GO:0016240 | autophagosome docking(GO:0016240) |
0.1 | 0.7 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
0.1 | 1.4 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.1 | 0.4 | GO:1903294 | regulation of glutamate secretion, neurotransmission(GO:1903294) positive regulation of glutamate secretion, neurotransmission(GO:1903296) |
0.1 | 0.8 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 1.2 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.1 | 1.2 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.1 | 4.2 | GO:1990542 | mitochondrial transmembrane transport(GO:1990542) |
0.1 | 1.1 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.1 | 0.9 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.1 | 0.7 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.1 | 3.4 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.1 | 1.5 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.1 | 0.5 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.1 | 2.8 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.1 | 0.4 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) camera-type eye photoreceptor cell fate commitment(GO:0060220) |
0.1 | 0.5 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
0.1 | 0.5 | GO:0010286 | heat acclimation(GO:0010286) |
0.1 | 0.4 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.1 | 21.4 | GO:0002244 | hematopoietic progenitor cell differentiation(GO:0002244) |
0.1 | 0.9 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.1 | 1.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 0.3 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
0.1 | 0.9 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.1 | 6.8 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.1 | 0.5 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.1 | 0.6 | GO:0072368 | regulation of lipid transport by negative regulation of transcription from RNA polymerase II promoter(GO:0072368) |
0.1 | 1.2 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.1 | 15.4 | GO:0000377 | RNA splicing, via transesterification reactions(GO:0000375) RNA splicing, via transesterification reactions with bulged adenosine as nucleophile(GO:0000377) mRNA splicing, via spliceosome(GO:0000398) |
0.1 | 0.5 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.1 | 11.2 | GO:0006352 | DNA-templated transcription, initiation(GO:0006352) |
0.1 | 3.0 | GO:0070918 | dsRNA fragmentation(GO:0031050) production of miRNAs involved in gene silencing by miRNA(GO:0035196) production of small RNA involved in gene silencing by RNA(GO:0070918) |
0.1 | 1.9 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.1 | 0.9 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.1 | 0.6 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.1 | 1.3 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.1 | 1.1 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.1 | 0.9 | GO:0016180 | snRNA processing(GO:0016180) |
0.1 | 1.5 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.1 | 0.4 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
0.1 | 0.3 | GO:0098928 | presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
0.1 | 0.8 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.1 | 5.6 | GO:0031110 | regulation of microtubule polymerization or depolymerization(GO:0031110) |
0.1 | 4.5 | GO:0050850 | positive regulation of calcium-mediated signaling(GO:0050850) |
0.1 | 0.9 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.1 | 0.3 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.1 | 1.0 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.1 | 0.6 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.1 | 2.6 | GO:0014047 | glutamate secretion(GO:0014047) |
0.1 | 1.8 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.1 | 3.6 | GO:0006400 | tRNA modification(GO:0006400) |
0.1 | 3.1 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.1 | 8.3 | GO:0042254 | ribosome biogenesis(GO:0042254) |
0.1 | 1.4 | GO:0035646 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
0.1 | 0.9 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.1 | 1.8 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.1 | 0.7 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 2.9 | GO:0000070 | mitotic sister chromatid segregation(GO:0000070) |
0.1 | 1.4 | GO:0070193 | synaptonemal complex organization(GO:0070193) |
0.1 | 0.2 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.1 | 1.8 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.1 | 0.9 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.1 | 0.7 | GO:0016266 | O-glycan processing(GO:0016266) |
0.1 | 0.5 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
0.1 | 1.8 | GO:0030262 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.1 | 0.7 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.1 | 1.9 | GO:0007099 | centriole replication(GO:0007099) |
0.1 | 3.1 | GO:0042755 | eating behavior(GO:0042755) |
0.1 | 0.3 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.1 | 0.3 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
0.1 | 0.6 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
0.1 | 1.2 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
0.1 | 0.4 | GO:0070178 | D-serine metabolic process(GO:0070178) |
0.1 | 9.3 | GO:0045333 | cellular respiration(GO:0045333) |
0.1 | 1.0 | GO:0009303 | rRNA transcription(GO:0009303) |
0.1 | 0.7 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.1 | 1.3 | GO:0015809 | arginine transport(GO:0015809) |
0.1 | 0.6 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
0.1 | 0.8 | GO:1905206 | positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.1 | 0.8 | GO:0042756 | drinking behavior(GO:0042756) |
0.1 | 1.1 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.1 | 0.7 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
0.1 | 0.9 | GO:0051444 | negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
0.1 | 0.5 | GO:0010996 | response to auditory stimulus(GO:0010996) |
0.1 | 0.5 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
0.1 | 2.4 | GO:0014003 | oligodendrocyte development(GO:0014003) |
0.1 | 0.4 | GO:0051013 | microtubule severing(GO:0051013) |
0.1 | 0.6 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
0.1 | 0.9 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.1 | 1.8 | GO:2000191 | regulation of fatty acid transport(GO:2000191) |
0.1 | 1.0 | GO:0040001 | establishment of mitotic spindle localization(GO:0040001) |
0.1 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.1 | 0.2 | GO:0042275 | error-free postreplication DNA repair(GO:0042275) |
0.1 | 0.9 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.1 | 1.3 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
0.1 | 0.4 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.1 | 0.3 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.1 | 0.7 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
0.1 | 0.4 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 2.0 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
0.1 | 0.3 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.1 | 1.3 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
0.1 | 0.1 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
0.1 | 3.4 | GO:0051225 | spindle assembly(GO:0051225) |
0.1 | 1.3 | GO:0001516 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
0.1 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.1 | 2.4 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.1 | 0.7 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.1 | 1.4 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 1.3 | GO:0008033 | tRNA processing(GO:0008033) |
0.1 | 0.6 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.1 | 0.4 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.1 | 0.2 | GO:1900034 | regulation of cellular response to heat(GO:1900034) |
0.1 | 2.7 | GO:0006801 | superoxide metabolic process(GO:0006801) |
0.1 | 0.8 | GO:0031017 | exocrine pancreas development(GO:0031017) |
0.1 | 1.0 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
0.1 | 0.3 | GO:0051026 | chiasma assembly(GO:0051026) |
0.1 | 0.9 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.1 | 2.4 | GO:0048286 | lung alveolus development(GO:0048286) |
0.1 | 0.3 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.1 | 0.5 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.1 | 0.8 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.1 | 1.9 | GO:0000724 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
0.1 | 0.2 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.1 | 1.8 | GO:0006611 | protein export from nucleus(GO:0006611) |
0.1 | 0.2 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
0.1 | 2.3 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
0.1 | 1.6 | GO:1902108 | regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902108) |
0.1 | 0.2 | GO:1902528 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
0.1 | 0.2 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.1 | 1.0 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.1 | 1.7 | GO:2001022 | positive regulation of response to DNA damage stimulus(GO:2001022) |
0.1 | 0.7 | GO:0015781 | pyrimidine nucleotide-sugar transport(GO:0015781) |
0.1 | 0.6 | GO:0019359 | nicotinamide nucleotide biosynthetic process(GO:0019359) |
0.1 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
0.1 | 0.8 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.1 | 0.5 | GO:0070986 | left/right axis specification(GO:0070986) |
0.0 | 0.7 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 5.6 | GO:0071229 | cellular response to acid chemical(GO:0071229) |
0.0 | 2.1 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.0 | 0.4 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
0.0 | 0.2 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 1.0 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
0.0 | 1.2 | GO:0034308 | primary alcohol metabolic process(GO:0034308) |
0.0 | 0.4 | GO:0046541 | saliva secretion(GO:0046541) |
0.0 | 1.6 | GO:0001662 | behavioral fear response(GO:0001662) |
0.0 | 2.7 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.0 | 0.5 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.0 | 0.4 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.3 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.2 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.0 | 2.5 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 0.3 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
0.0 | 0.6 | GO:0033273 | response to vitamin(GO:0033273) |
0.0 | 0.2 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.2 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 1.2 | GO:0008156 | negative regulation of DNA replication(GO:0008156) |
0.0 | 0.8 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
0.0 | 0.6 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.0 | 1.1 | GO:0006302 | double-strand break repair(GO:0006302) |
0.0 | 0.5 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.0 | 1.1 | GO:0035690 | cellular response to drug(GO:0035690) |
0.0 | 0.5 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
0.0 | 0.3 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.4 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.5 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
0.0 | 1.9 | GO:0032729 | positive regulation of interferon-gamma production(GO:0032729) |
0.0 | 0.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.0 | 0.3 | GO:0006360 | transcription from RNA polymerase I promoter(GO:0006360) |
0.0 | 0.2 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.2 | GO:0036120 | cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.0 | 0.3 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.0 | 0.4 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
0.0 | 0.1 | GO:2000474 | opioid receptor signaling pathway(GO:0038003) regulation of opioid receptor signaling pathway(GO:2000474) |
0.0 | 0.6 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.6 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.0 | 0.1 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 0.4 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
0.0 | 0.9 | GO:0021696 | cerebellar cortex morphogenesis(GO:0021696) |
0.0 | 0.6 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
0.0 | 0.2 | GO:0098792 | xenophagy(GO:0098792) |
0.0 | 0.8 | GO:0007528 | neuromuscular junction development(GO:0007528) |
0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.3 | GO:0010884 | positive regulation of lipid storage(GO:0010884) |
0.0 | 0.5 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
0.0 | 0.7 | GO:0007520 | myoblast fusion(GO:0007520) |
0.0 | 0.2 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.2 | GO:0060148 | positive regulation of posttranscriptional gene silencing(GO:0060148) |
0.0 | 0.1 | GO:0071800 | podosome assembly(GO:0071800) |
0.0 | 0.2 | GO:0007398 | ectoderm development(GO:0007398) |
0.0 | 0.1 | GO:0046326 | positive regulation of glucose import(GO:0046326) |
0.0 | 0.2 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.0 | 2.3 | GO:0006457 | protein folding(GO:0006457) |
0.0 | 0.5 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.9 | GO:0006413 | translational initiation(GO:0006413) |
0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.5 | GO:0031929 | TOR signaling(GO:0031929) |
0.0 | 0.2 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.2 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.2 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.2 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
0.0 | 0.1 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
0.0 | 0.2 | GO:0007097 | nuclear migration(GO:0007097) establishment of nucleus localization(GO:0040023) |
0.0 | 0.1 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
0.0 | 0.6 | GO:0006757 | glycolytic process(GO:0006096) ATP generation from ADP(GO:0006757) |
0.0 | 0.0 | GO:0002302 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
3.6 | 14.6 | GO:0000939 | nuclear MIS12/MIND complex(GO:0000818) condensed chromosome inner kinetochore(GO:0000939) |
3.6 | 10.8 | GO:0042585 | germinal vesicle(GO:0042585) |
3.5 | 17.4 | GO:0097226 | sperm mitochondrial sheath(GO:0097226) |
3.3 | 6.5 | GO:0000799 | nuclear condensin complex(GO:0000799) |
2.4 | 14.7 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
1.9 | 13.0 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
1.8 | 5.4 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
1.8 | 23.3 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
1.8 | 10.7 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
1.7 | 8.7 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
1.7 | 8.7 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
1.6 | 4.9 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
1.6 | 17.7 | GO:0005642 | annulate lamellae(GO:0005642) |
1.5 | 4.6 | GO:0035061 | interchromatin granule(GO:0035061) |
1.5 | 10.7 | GO:0000796 | condensin complex(GO:0000796) |
1.5 | 10.7 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
1.4 | 11.5 | GO:0031415 | NatA complex(GO:0031415) |
1.4 | 8.2 | GO:0098536 | deuterosome(GO:0098536) |
1.3 | 5.0 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
1.2 | 13.3 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
1.1 | 8.0 | GO:0001652 | granular component(GO:0001652) |
1.1 | 4.4 | GO:0097450 | astrocyte end-foot(GO:0097450) |
1.1 | 7.7 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
1.0 | 8.2 | GO:0001940 | male pronucleus(GO:0001940) |
1.0 | 5.1 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.9 | 9.5 | GO:0070545 | PeBoW complex(GO:0070545) |
0.9 | 2.8 | GO:0055087 | Ski complex(GO:0055087) |
0.9 | 13.0 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.9 | 5.5 | GO:0000235 | astral microtubule(GO:0000235) |
0.9 | 8.2 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.9 | 3.7 | GO:0071942 | XPC complex(GO:0071942) |
0.9 | 8.2 | GO:0000801 | central element(GO:0000801) |
0.9 | 4.5 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.9 | 2.7 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
0.8 | 4.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.8 | 4.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.8 | 8.9 | GO:0070938 | contractile ring(GO:0070938) |
0.8 | 7.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.8 | 3.1 | GO:0019034 | viral replication complex(GO:0019034) |
0.8 | 7.8 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.8 | 8.4 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.8 | 3.8 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.7 | 5.8 | GO:0042382 | paraspeckles(GO:0042382) |
0.7 | 2.0 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
0.6 | 2.5 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.6 | 4.4 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.6 | 1.9 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.6 | 4.4 | GO:0097255 | R2TP complex(GO:0097255) |
0.6 | 4.9 | GO:0070652 | HAUS complex(GO:0070652) |
0.6 | 3.0 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.6 | 6.0 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.6 | 4.2 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.6 | 5.9 | GO:0016272 | prefoldin complex(GO:0016272) |
0.6 | 1.8 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.6 | 27.9 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.6 | 3.5 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.6 | 4.6 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.6 | 2.9 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.6 | 6.7 | GO:1990635 | proximal dendrite(GO:1990635) |
0.6 | 2.2 | GO:0070552 | BRISC complex(GO:0070552) |
0.5 | 3.3 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.5 | 3.3 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.5 | 7.6 | GO:0010369 | chromocenter(GO:0010369) |
0.5 | 5.4 | GO:0032797 | SMN complex(GO:0032797) |
0.5 | 0.5 | GO:1990257 | piccolo-bassoon transport vesicle(GO:1990257) |
0.5 | 5.9 | GO:0031931 | TORC1 complex(GO:0031931) |
0.5 | 3.7 | GO:0005827 | polar microtubule(GO:0005827) |
0.5 | 1.6 | GO:0031251 | PAN complex(GO:0031251) |
0.5 | 2.1 | GO:0032021 | NELF complex(GO:0032021) |
0.5 | 8.0 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.5 | 2.9 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.5 | 5.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.5 | 2.4 | GO:0034719 | pICln-Sm protein complex(GO:0034715) SMN-Sm protein complex(GO:0034719) |
0.5 | 4.2 | GO:0000243 | commitment complex(GO:0000243) |
0.5 | 6.0 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.5 | 9.3 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.4 | 3.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.4 | 55.5 | GO:0000776 | kinetochore(GO:0000776) |
0.4 | 1.3 | GO:0001939 | female pronucleus(GO:0001939) |
0.4 | 2.2 | GO:0031523 | Myb complex(GO:0031523) |
0.4 | 6.0 | GO:0001741 | XY body(GO:0001741) |
0.4 | 25.9 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.4 | 1.7 | GO:0030681 | ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.4 | 2.9 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.4 | 1.7 | GO:0005688 | U6 snRNP(GO:0005688) |
0.4 | 6.6 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.4 | 1.6 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.4 | 1.2 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
0.4 | 1.6 | GO:1902636 | kinociliary basal body(GO:1902636) |
0.4 | 1.1 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
0.4 | 1.1 | GO:0035101 | FACT complex(GO:0035101) |
0.4 | 1.8 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.4 | 3.7 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) |
0.3 | 1.4 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
0.3 | 2.0 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.3 | 1.7 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.3 | 1.0 | GO:0098833 | presynaptic endocytic zone(GO:0098833) presynaptic endocytic zone membrane(GO:0098835) |
0.3 | 4.0 | GO:0042555 | MCM complex(GO:0042555) |
0.3 | 2.7 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.3 | 1.0 | GO:0031533 | mRNA cap methyltransferase complex(GO:0031533) |
0.3 | 3.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.3 | 1.6 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.3 | 2.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.3 | 2.3 | GO:0089701 | U2AF(GO:0089701) |
0.3 | 41.8 | GO:0015934 | large ribosomal subunit(GO:0015934) |
0.3 | 2.9 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.3 | 0.6 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.3 | 0.9 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
0.3 | 1.5 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.3 | 3.6 | GO:0070852 | cell body fiber(GO:0070852) |
0.3 | 4.2 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.3 | 1.2 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.3 | 1.2 | GO:1903349 | omegasome membrane(GO:1903349) |
0.3 | 2.9 | GO:0045120 | pronucleus(GO:0045120) |
0.3 | 1.2 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.3 | 2.9 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.3 | 0.6 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.3 | 1.7 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.3 | 3.7 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.3 | 0.5 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
0.3 | 1.3 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.3 | 1.8 | GO:0005686 | U2 snRNP(GO:0005686) |
0.2 | 12.9 | GO:0022626 | cytosolic ribosome(GO:0022626) |
0.2 | 9.4 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.2 | 1.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.2 | 2.9 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.2 | 0.7 | GO:0070069 | cytochrome complex(GO:0070069) |
0.2 | 4.1 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.2 | 3.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.2 | 2.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.2 | 2.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.2 | 1.4 | GO:0033010 | paranodal junction(GO:0033010) |
0.2 | 8.5 | GO:0000791 | euchromatin(GO:0000791) |
0.2 | 1.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.2 | 4.4 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.2 | 1.1 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.2 | 2.0 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.2 | 1.7 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.2 | 13.0 | GO:0005643 | nuclear pore(GO:0005643) |
0.2 | 0.6 | GO:0042642 | actomyosin, myosin complex part(GO:0042642) |
0.2 | 6.0 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.2 | 0.8 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.2 | 0.6 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.2 | 3.2 | GO:0035102 | PRC1 complex(GO:0035102) |
0.2 | 2.8 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.2 | 2.9 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.2 | 1.9 | GO:0038201 | TOR complex(GO:0038201) |
0.2 | 3.2 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.2 | 8.4 | GO:0045171 | intercellular bridge(GO:0045171) |
0.2 | 2.6 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.2 | 2.4 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
0.2 | 2.4 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.2 | 8.5 | GO:0030684 | preribosome(GO:0030684) |
0.2 | 0.7 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.2 | 8.4 | GO:0016235 | aggresome(GO:0016235) |
0.2 | 0.7 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.2 | 0.9 | GO:0044327 | dendritic spine head(GO:0044327) |
0.2 | 14.1 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.2 | 3.0 | GO:0016580 | Sin3 complex(GO:0016580) |
0.2 | 0.3 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
0.2 | 2.4 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.2 | 2.7 | GO:0032039 | integrator complex(GO:0032039) |
0.2 | 2.3 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.2 | 5.3 | GO:0070469 | respiratory chain(GO:0070469) |
0.2 | 0.5 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
0.2 | 0.9 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.2 | 2.0 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.2 | 3.1 | GO:0030056 | hemidesmosome(GO:0030056) |
0.1 | 0.4 | GO:0005607 | laminin-2 complex(GO:0005607) |
0.1 | 1.5 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.1 | 0.7 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.9 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.7 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 1.1 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 1.1 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 3.6 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 2.8 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 1.8 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
0.1 | 0.5 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.1 | 0.4 | GO:0044317 | rod spherule(GO:0044317) |
0.1 | 0.7 | GO:0097361 | CIA complex(GO:0097361) |
0.1 | 0.5 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.1 | 0.4 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
0.1 | 2.1 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.1 | 10.9 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.1 | 2.7 | GO:0035267 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.1 | 1.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 0.4 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.1 | 2.7 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.1 | 2.4 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.1 | 1.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.1 | 4.4 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 4.5 | GO:0099738 | cell cortex region(GO:0099738) |
0.1 | 0.7 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.1 | 0.7 | GO:0070847 | core mediator complex(GO:0070847) |
0.1 | 1.9 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.4 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 2.0 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.1 | 0.6 | GO:0005652 | nuclear lamina(GO:0005652) |
0.1 | 0.6 | GO:0032437 | cuticular plate(GO:0032437) |
0.1 | 0.4 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.1 | 0.5 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 0.8 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.1 | 0.7 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.1 | 3.2 | GO:0002102 | podosome(GO:0002102) |
0.1 | 0.9 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 64.6 | GO:0005730 | nucleolus(GO:0005730) |
0.1 | 1.1 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.1 | 1.7 | GO:0015030 | Cajal body(GO:0015030) |
0.1 | 0.5 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
0.1 | 0.8 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.1 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
0.1 | 1.3 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 3.7 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.1 | 0.3 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 1.4 | GO:0000145 | exocyst(GO:0000145) |
0.1 | 0.6 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 3.9 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.1 | 2.3 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.8 | GO:0031209 | SCAR complex(GO:0031209) |
0.1 | 1.0 | GO:0097225 | sperm midpiece(GO:0097225) |
0.1 | 2.0 | GO:0032153 | cell division site(GO:0032153) cell division site part(GO:0032155) |
0.1 | 2.7 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.1 | 2.1 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 0.4 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
0.1 | 0.4 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 1.2 | GO:0097440 | apical dendrite(GO:0097440) |
0.1 | 4.8 | GO:0016528 | sarcoplasm(GO:0016528) |
0.1 | 1.3 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.1 | 0.3 | GO:0097422 | tubular endosome(GO:0097422) |
0.1 | 3.7 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 1.0 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 1.0 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.1 | 2.1 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.1 | 0.2 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.1 | 4.4 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.1 | 4.8 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.1 | 2.6 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.4 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.6 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.7 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.2 | GO:0043601 | replisome(GO:0030894) nuclear replisome(GO:0043601) |
0.0 | 1.0 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.7 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.8 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.8 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 0.8 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
0.0 | 1.1 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.0 | 2.2 | GO:0016605 | PML body(GO:0016605) |
0.0 | 9.3 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 2.4 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.0 | 2.7 | GO:0030175 | filopodium(GO:0030175) |
0.0 | 0.3 | GO:0097433 | dense body(GO:0097433) |
0.0 | 4.7 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 3.6 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
0.0 | 0.3 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.6 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 0.2 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.3 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.2 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 1.1 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
0.0 | 0.1 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.0 | 0.3 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.0 | 0.7 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 1.1 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 1.3 | GO:0001669 | acrosomal vesicle(GO:0001669) |
0.0 | 0.1 | GO:0045252 | dihydrolipoyl dehydrogenase complex(GO:0045240) oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 1.1 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.6 | GO:0005681 | spliceosomal complex(GO:0005681) |
0.0 | 17.9 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 3.1 | GO:0000228 | nuclear chromosome(GO:0000228) |
0.0 | 0.7 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.6 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
3.0 | 8.9 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
2.9 | 17.4 | GO:0002135 | CTP binding(GO:0002135) |
2.9 | 23.2 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
2.2 | 9.0 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
2.1 | 6.3 | GO:0036470 | tyrosine 3-monooxygenase activator activity(GO:0036470) L-dopa decarboxylase activator activity(GO:0036478) |
1.8 | 10.8 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
1.7 | 5.2 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
1.6 | 9.7 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
1.6 | 9.5 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
1.5 | 4.6 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
1.5 | 13.5 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
1.5 | 4.4 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
1.5 | 4.4 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
1.2 | 3.6 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
1.2 | 2.4 | GO:0097677 | STAT family protein binding(GO:0097677) |
1.1 | 26.2 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
1.1 | 3.2 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
1.0 | 4.1 | GO:0003883 | CTP synthase activity(GO:0003883) |
1.0 | 4.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
1.0 | 4.1 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
1.0 | 9.1 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
1.0 | 6.0 | GO:0051425 | PTB domain binding(GO:0051425) |
1.0 | 2.9 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
1.0 | 4.9 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
1.0 | 2.9 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
1.0 | 9.5 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.9 | 4.7 | GO:0043515 | kinetochore binding(GO:0043515) |
0.9 | 8.5 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.9 | 7.4 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.9 | 8.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.9 | 2.7 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.9 | 3.5 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.9 | 2.7 | GO:0034189 | very-low-density lipoprotein particle binding(GO:0034189) |
0.9 | 2.7 | GO:0009918 | sterol delta7 reductase activity(GO:0009918) 7-dehydrocholesterol reductase activity(GO:0047598) |
0.9 | 7.8 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.8 | 13.4 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.8 | 22.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.8 | 3.3 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.8 | 5.8 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.8 | 2.4 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.8 | 2.3 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
0.8 | 4.5 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.7 | 2.2 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.7 | 2.2 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.7 | 5.2 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.7 | 5.0 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.7 | 3.6 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.7 | 4.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.7 | 2.7 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.6 | 5.2 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.6 | 2.5 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
0.6 | 5.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.6 | 7.6 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.6 | 6.3 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.6 | 2.5 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.6 | 1.9 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
0.6 | 2.5 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.6 | 1.8 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
0.6 | 1.8 | GO:0004816 | asparagine-tRNA ligase activity(GO:0004816) |
0.6 | 0.6 | GO:0032138 | single base insertion or deletion binding(GO:0032138) |
0.6 | 1.7 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
0.6 | 2.9 | GO:1990188 | euchromatin binding(GO:1990188) |
0.6 | 4.6 | GO:0043199 | sulfate binding(GO:0043199) |
0.6 | 5.2 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
0.6 | 3.4 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.6 | 1.7 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.6 | 1.7 | GO:0004492 | methylmalonyl-CoA decarboxylase activity(GO:0004492) |
0.6 | 3.9 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.6 | 13.4 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.6 | 1.7 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
0.5 | 4.4 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.5 | 3.3 | GO:0032356 | oxidized DNA binding(GO:0032356) 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
0.5 | 0.5 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.5 | 1.6 | GO:0001002 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
0.5 | 3.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.5 | 1.5 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
0.5 | 2.5 | GO:0000150 | recombinase activity(GO:0000150) |
0.5 | 1.5 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.5 | 0.5 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.5 | 2.4 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.5 | 0.5 | GO:0008169 | C-methyltransferase activity(GO:0008169) |
0.5 | 2.4 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.5 | 3.3 | GO:0015616 | DNA translocase activity(GO:0015616) |
0.5 | 3.8 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.5 | 2.8 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.5 | 3.3 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.5 | 4.6 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.5 | 0.9 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.5 | 1.8 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.4 | 3.6 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.4 | 1.3 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.4 | 1.8 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.4 | 0.9 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
0.4 | 2.6 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.4 | 6.4 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.4 | 1.7 | GO:0000700 | mismatch base pair DNA N-glycosylase activity(GO:0000700) uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.4 | 1.6 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.4 | 1.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.4 | 4.4 | GO:0070990 | snRNP binding(GO:0070990) |
0.4 | 6.0 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.4 | 4.4 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.4 | 2.0 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.4 | 7.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.4 | 1.1 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
0.4 | 1.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.4 | 1.5 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
0.4 | 1.9 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.4 | 3.9 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.4 | 1.8 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.3 | 8.4 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.3 | 30.3 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.3 | 2.0 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.3 | 2.7 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.3 | 1.4 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.3 | 3.0 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.3 | 1.0 | GO:0004482 | mRNA (guanine-N7-)-methyltransferase activity(GO:0004482) |
0.3 | 2.6 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.3 | 2.0 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.3 | 19.9 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.3 | 1.6 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.3 | 9.4 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.3 | 5.5 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.3 | 9.6 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.3 | 3.2 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.3 | 0.9 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.3 | 6.6 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.3 | 0.9 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
0.3 | 1.2 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.3 | 9.1 | GO:0070840 | dynein complex binding(GO:0070840) |
0.3 | 2.7 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.3 | 1.2 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.3 | 10.3 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.3 | 5.5 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.3 | 26.5 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.3 | 4.0 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.3 | 2.8 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.3 | 0.3 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.3 | 1.6 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.3 | 5.8 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.3 | 1.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.3 | 1.8 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.3 | 1.8 | GO:0000339 | RNA cap binding(GO:0000339) |
0.3 | 1.0 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.3 | 6.5 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.3 | 2.8 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.2 | 2.5 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.2 | 1.0 | GO:0015266 | protein channel activity(GO:0015266) |
0.2 | 6.2 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.2 | 5.9 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.2 | 2.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.2 | 1.4 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.2 | 1.2 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.2 | 2.3 | GO:0004521 | endoribonuclease activity(GO:0004521) |
0.2 | 1.6 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.2 | 36.0 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.2 | 0.7 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.2 | 1.6 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.2 | 0.9 | GO:0003681 | bent DNA binding(GO:0003681) |
0.2 | 1.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.2 | 1.6 | GO:0015288 | porin activity(GO:0015288) |
0.2 | 1.7 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.2 | 1.2 | GO:0008494 | translation activator activity(GO:0008494) |
0.2 | 0.8 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.2 | 0.6 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.2 | 1.2 | GO:0097001 | ceramide binding(GO:0097001) |
0.2 | 0.4 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.2 | 2.7 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.2 | 13.1 | GO:0019894 | kinesin binding(GO:0019894) |
0.2 | 17.4 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.2 | 1.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.2 | 5.2 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.2 | 4.9 | GO:0016675 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.2 | 0.7 | GO:1902379 | chemoattractant activity involved in axon guidance(GO:1902379) |
0.2 | 1.3 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.2 | 1.6 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.2 | 6.6 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.2 | 1.1 | GO:0070728 | leucine binding(GO:0070728) |
0.2 | 0.5 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.2 | 0.8 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
0.2 | 2.5 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.2 | 1.3 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
0.2 | 0.5 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
0.2 | 0.5 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.2 | 0.3 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.2 | 0.6 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
0.2 | 1.7 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.2 | 0.5 | GO:0070122 | isopeptidase activity(GO:0070122) ubiquitin-like protein-specific isopeptidase activity(GO:0070138) SUMO-specific isopeptidase activity(GO:0070140) |
0.2 | 0.6 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.2 | 1.4 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.2 | 1.7 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.2 | 3.2 | GO:0008143 | poly(A) binding(GO:0008143) |
0.2 | 1.2 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
0.2 | 0.5 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.1 | 0.4 | GO:0031403 | lithium ion binding(GO:0031403) |
0.1 | 1.0 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 6.3 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.1 | 1.5 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 0.7 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 2.7 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 0.7 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.1 | 2.1 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.1 | 2.3 | GO:0070628 | proteasome binding(GO:0070628) |
0.1 | 1.7 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 0.5 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.1 | 2.3 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.1 | 0.8 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.1 | 2.5 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.1 | 0.5 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.1 | 0.4 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
0.1 | 1.0 | GO:0000182 | rDNA binding(GO:0000182) |
0.1 | 8.2 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
0.1 | 0.6 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.1 | 0.6 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.1 | 3.4 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.1 | 1.1 | GO:0008649 | rRNA methyltransferase activity(GO:0008649) |
0.1 | 2.5 | GO:0000049 | tRNA binding(GO:0000049) |
0.1 | 0.8 | GO:1990405 | protein antigen binding(GO:1990405) |
0.1 | 4.3 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.1 | 1.3 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.1 | 1.2 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.1 | 0.6 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 2.4 | GO:0016279 | lysine N-methyltransferase activity(GO:0016278) protein-lysine N-methyltransferase activity(GO:0016279) |
0.1 | 1.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.1 | 1.2 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
0.1 | 0.7 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.1 | 0.7 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 0.3 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.1 | 2.4 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.1 | 2.1 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.1 | 6.4 | GO:0004004 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) |
0.1 | 0.6 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
0.1 | 0.7 | GO:0001851 | complement component C3b binding(GO:0001851) |
0.1 | 0.5 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 1.6 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.1 | 0.4 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
0.1 | 0.2 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.1 | 2.3 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.1 | 6.7 | GO:0004386 | helicase activity(GO:0004386) |
0.1 | 8.4 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.1 | 0.6 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.1 | 0.6 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.1 | 0.7 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 1.9 | GO:0030332 | cyclin binding(GO:0030332) |
0.1 | 1.4 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 1.1 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.1 | 0.9 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.1 | 0.6 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.1 | 1.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 1.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.9 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 1.6 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.1 | 1.9 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 0.6 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 0.8 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 3.5 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.1 | 0.6 | GO:0009374 | biotin binding(GO:0009374) |
0.1 | 0.5 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 2.1 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) |
0.1 | 0.7 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.1 | 1.6 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
0.1 | 1.1 | GO:0008173 | RNA methyltransferase activity(GO:0008173) |
0.1 | 1.0 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 0.5 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.4 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.1 | 0.3 | GO:0034584 | piRNA binding(GO:0034584) |
0.1 | 1.5 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.1 | 2.8 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.1 | 0.6 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.1 | 1.2 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.1 | 0.3 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 0.9 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
0.1 | 0.2 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.1 | 3.1 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.1 | 75.4 | GO:0003723 | RNA binding(GO:0003723) |
0.1 | 1.7 | GO:0051393 | alpha-actinin binding(GO:0051393) |
0.1 | 0.4 | GO:0039706 | co-receptor binding(GO:0039706) |
0.1 | 2.4 | GO:0004519 | endonuclease activity(GO:0004519) |
0.1 | 1.1 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.1 | 2.9 | GO:0097472 | cyclin-dependent protein kinase activity(GO:0097472) |
0.1 | 1.0 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.1 | 1.2 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.1 | 0.7 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.1 | 0.4 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.1 | 1.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 0.4 | GO:0005499 | vitamin D binding(GO:0005499) |
0.1 | 0.9 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.1 | 0.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.1 | 0.9 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.0 | 0.9 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 2.1 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.6 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
0.0 | 0.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.0 | 0.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.5 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 1.0 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 0.6 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.7 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.9 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 2.6 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.4 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
0.0 | 0.3 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.0 | 0.1 | GO:0016898 | D-lactate dehydrogenase (cytochrome) activity(GO:0004458) oxidoreductase activity, acting on the CH-OH group of donors, cytochrome as acceptor(GO:0016898) |
0.0 | 2.0 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 1.0 | GO:0016878 | acid-thiol ligase activity(GO:0016878) |
0.0 | 3.7 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.5 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 1.8 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.1 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 1.2 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 1.6 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.0 | 0.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.6 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
0.0 | 0.6 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.0 | 1.1 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.6 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 1.3 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 0.3 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.0 | 0.6 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 11.9 | GO:0004674 | protein serine/threonine kinase activity(GO:0004674) |
0.0 | 0.1 | GO:0034602 | oxoglutarate dehydrogenase (NAD+) activity(GO:0034602) |
0.0 | 6.5 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.0 | 2.1 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.0 | 0.3 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.3 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
0.0 | 0.1 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 5.0 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) ubiquitin-like protein ligase activity(GO:0061659) |
0.0 | 0.2 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.0 | 0.7 | GO:0005272 | sodium channel activity(GO:0005272) |
0.0 | 0.8 | GO:0032947 | protein complex scaffold(GO:0032947) |
0.0 | 0.1 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 3.5 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
0.0 | 0.2 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
0.0 | 1.7 | GO:0005516 | calmodulin binding(GO:0005516) |
0.0 | 0.3 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.0 | 0.2 | GO:0019825 | oxygen binding(GO:0019825) |
0.0 | 0.2 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 0.3 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.1 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 1.4 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
1.1 | 54.8 | PID AURORA B PATHWAY | Aurora B signaling |
1.0 | 17.4 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.5 | 29.4 | PID PLK1 PATHWAY | PLK1 signaling events |
0.4 | 1.8 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.4 | 6.7 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.4 | 3.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.2 | 0.2 | PID MYC PATHWAY | C-MYC pathway |
0.2 | 3.8 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.2 | 15.4 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.2 | 22.8 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.2 | 6.3 | PID ATR PATHWAY | ATR signaling pathway |
0.2 | 5.0 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.2 | 7.8 | PID ATM PATHWAY | ATM pathway |
0.2 | 2.8 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.2 | 2.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.2 | 4.1 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.2 | 7.6 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.1 | 4.0 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 6.5 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.1 | 0.9 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 1.2 | PID BARD1 PATHWAY | BARD1 signaling events |
0.1 | 9.6 | PID NOTCH PATHWAY | Notch signaling pathway |
0.1 | 5.0 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.1 | 0.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 4.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 4.3 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.1 | 5.2 | PID E2F PATHWAY | E2F transcription factor network |
0.1 | 5.6 | PID P53 REGULATION PATHWAY | p53 pathway |
0.1 | 1.0 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.1 | 0.9 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 1.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.1 | 1.3 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 2.0 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.1 | 0.9 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.1 | 2.6 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.1 | 4.7 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.1 | 3.4 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.1 | 2.3 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.1 | 1.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 0.4 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 0.9 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 0.5 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.1 | 0.8 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 3.5 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.1 | 3.5 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.1 | 4.3 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 2.3 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.1 | 0.8 | PID CDC42 PATHWAY | CDC42 signaling events |
0.1 | 1.9 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 1.4 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.5 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 1.5 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 1.3 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.4 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 0.8 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.4 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.4 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.2 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.7 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.6 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.4 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.0 | 22.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
1.4 | 20.4 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
1.2 | 12.4 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
1.1 | 2.2 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
1.1 | 10.9 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
1.0 | 20.1 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.9 | 92.5 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.8 | 4.5 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.7 | 7.7 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.7 | 15.1 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.6 | 14.6 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.6 | 10.6 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.6 | 13.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.5 | 5.9 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.5 | 16.6 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.5 | 17.0 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.5 | 4.1 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.5 | 26.4 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.5 | 5.8 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.5 | 20.5 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.5 | 6.1 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.5 | 3.6 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.4 | 11.7 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.4 | 31.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.4 | 4.5 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.4 | 3.2 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
0.4 | 3.0 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.4 | 2.2 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
0.4 | 3.3 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.4 | 5.3 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.4 | 5.3 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.3 | 8.6 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.3 | 2.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.3 | 5.4 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.3 | 1.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.3 | 18.8 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.3 | 6.6 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.3 | 18.3 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.3 | 2.5 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.2 | 4.5 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.2 | 10.9 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.2 | 10.8 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.2 | 13.7 | REACTOME MITOTIC G2 G2 M PHASES | Genes involved in Mitotic G2-G2/M phases |
0.2 | 5.1 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.2 | 10.4 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
0.2 | 12.7 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
0.2 | 5.2 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.2 | 4.1 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.2 | 1.7 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.2 | 3.2 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.2 | 2.3 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.2 | 2.7 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.2 | 0.5 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
0.2 | 2.2 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.2 | 15.6 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.2 | 3.0 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.2 | 3.8 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 2.6 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.1 | 2.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 2.6 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 3.9 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.1 | 0.6 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 0.4 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.1 | 1.6 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.1 | 5.3 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 2.3 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.1 | 3.7 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.1 | 1.7 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.1 | 0.9 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.1 | 1.2 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 0.9 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 1.2 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.1 | 1.9 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 3.1 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.1 | 1.4 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.1 | 0.6 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.1 | 4.7 | REACTOME TRANSLATION | Genes involved in Translation |
0.1 | 2.7 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 0.7 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.1 | 5.4 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.1 | 2.0 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.1 | 0.4 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
0.1 | 1.0 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 1.3 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 2.2 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
0.1 | 1.6 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 1.1 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 2.4 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 1.9 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.1 | 0.7 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 1.6 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.1 | 0.8 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.1 | 0.8 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.0 | 0.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.5 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.0 | 0.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.0 | 0.5 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.0 | 0.5 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.7 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 1.0 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.5 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.9 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.3 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.8 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.6 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.6 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.8 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.4 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 0.5 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.0 | 0.6 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.8 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.8 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.4 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.1 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.0 | 0.2 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.1 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.2 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |