2D miR_HR1_12
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Foxj3
|
ENSMUSG00000032998.10 | forkhead box J3 |
Tbl1xr1
|
ENSMUSG00000027630.8 | transducin (beta)-like 1X-linked receptor 1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Tbl1xr1 | mm10_v2_chr3_+_22076644_22076681 | 0.50 | 1.0e-01 | Click! |
Foxj3 | mm10_v2_chr4_+_119539716_119539779 | 0.30 | 3.5e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr5_-_135251209 | 2.26 |
ENSMUST00000062572.2
|
Fzd9
|
frizzled homolog 9 (Drosophila) |
chr1_+_130865669 | 1.86 |
ENSMUST00000038829.5
|
Faim3
|
Fas apoptotic inhibitory molecule 3 |
chr7_+_19965365 | 1.74 |
ENSMUST00000094753.4
|
Ceacam20
|
carcinoembryonic antigen-related cell adhesion molecule 20 |
chr11_+_69045640 | 1.72 |
ENSMUST00000108666.1
ENSMUST00000021277.5 |
Aurkb
|
aurora kinase B |
chr5_+_34525797 | 1.70 |
ENSMUST00000125817.1
ENSMUST00000067638.7 |
Sh3bp2
|
SH3-domain binding protein 2 |
chr5_+_110330697 | 1.69 |
ENSMUST00000112481.1
|
Pole
|
polymerase (DNA directed), epsilon |
chr10_+_4611971 | 1.61 |
ENSMUST00000105590.1
ENSMUST00000067086.7 |
Esr1
|
estrogen receptor 1 (alpha) |
chr10_+_4710119 | 1.56 |
ENSMUST00000105588.1
ENSMUST00000105589.1 |
Esr1
|
estrogen receptor 1 (alpha) |
chr6_+_21986887 | 1.56 |
ENSMUST00000151315.1
|
Cped1
|
cadherin-like and PC-esterase domain containing 1 |
chr3_+_159495408 | 1.55 |
ENSMUST00000120272.1
ENSMUST00000029825.7 ENSMUST00000106041.2 |
Depdc1a
|
DEP domain containing 1a |
chr8_-_53638945 | 1.51 |
ENSMUST00000047768.4
|
Neil3
|
nei like 3 (E. coli) |
chr10_-_85957775 | 1.41 |
ENSMUST00000001834.3
|
Rtcb
|
RNA 2',3'-cyclic phosphate and 5'-OH ligase |
chr18_-_74207771 | 1.38 |
ENSMUST00000040188.8
ENSMUST00000177604.1 |
Ska1
|
spindle and kinetochore associated complex subunit 1 |
chr6_+_134929089 | 1.37 |
ENSMUST00000183867.1
ENSMUST00000184991.1 ENSMUST00000183905.1 |
RP23-45G16.5
|
RP23-45G16.5 |
chr3_+_135212557 | 1.35 |
ENSMUST00000062893.7
|
Cenpe
|
centromere protein E |
chr14_-_47418407 | 1.33 |
ENSMUST00000043296.3
|
Dlgap5
|
discs, large (Drosophila) homolog-associated protein 5 |
chr14_-_49525840 | 1.33 |
ENSMUST00000138884.1
ENSMUST00000074368.4 ENSMUST00000123534.1 |
Slc35f4
|
solute carrier family 35, member F4 |
chr14_-_65833963 | 1.33 |
ENSMUST00000022613.9
|
Esco2
|
establishment of cohesion 1 homolog 2 (S. cerevisiae) |
chr5_-_100572192 | 1.33 |
ENSMUST00000031264.5
|
Plac8
|
placenta-specific 8 |
chr4_+_44300876 | 1.30 |
ENSMUST00000045607.5
|
Melk
|
maternal embryonic leucine zipper kinase |
chr17_-_31129602 | 1.27 |
ENSMUST00000024827.4
|
Tff3
|
trefoil factor 3, intestinal |
chr2_+_118813995 | 1.27 |
ENSMUST00000134661.1
|
Knstrn
|
kinetochore-localized astrin/SPAG5 binding |
chr8_-_123318553 | 1.24 |
ENSMUST00000118395.1
ENSMUST00000035495.8 |
Fanca
|
Fanconi anemia, complementation group A |
chr8_+_13339656 | 1.22 |
ENSMUST00000170909.1
|
Tfdp1
|
transcription factor Dp 1 |
chr1_+_136467958 | 1.20 |
ENSMUST00000047817.6
|
Kif14
|
kinesin family member 14 |
chr9_-_48911067 | 1.20 |
ENSMUST00000003826.7
|
Htr3a
|
5-hydroxytryptamine (serotonin) receptor 3A |
chr11_-_40733373 | 1.18 |
ENSMUST00000020579.8
|
Hmmr
|
hyaluronan mediated motility receptor (RHAMM) |
chrX_-_102157065 | 1.16 |
ENSMUST00000056904.2
|
Ercc6l
|
excision repair cross-complementing rodent repair deficiency complementation group 6 like |
chr4_-_118437331 | 1.14 |
ENSMUST00000006565.6
|
Cdc20
|
cell division cycle 20 |
chr6_-_113501818 | 1.10 |
ENSMUST00000101059.1
|
Prrt3
|
proline-rich transmembrane protein 3 |
chr1_+_40515362 | 1.10 |
ENSMUST00000027237.5
|
Il18rap
|
interleukin 18 receptor accessory protein |
chr4_+_126556935 | 1.09 |
ENSMUST00000048391.8
|
Clspn
|
claspin |
chr14_-_47411666 | 1.07 |
ENSMUST00000111778.3
|
Dlgap5
|
discs, large (Drosophila) homolog-associated protein 5 |
chr8_-_33747724 | 1.07 |
ENSMUST00000179364.1
|
Smim18
|
small integral membrane protein 18 |
chr9_+_65890237 | 1.07 |
ENSMUST00000045802.6
|
2810417H13Rik
|
RIKEN cDNA 2810417H13 gene |
chr5_-_74065736 | 1.07 |
ENSMUST00000145016.1
|
Usp46
|
ubiquitin specific peptidase 46 |
chr7_+_45699843 | 1.05 |
ENSMUST00000003360.7
|
Car11
|
carbonic anhydrase 11 |
chr6_+_134929118 | 1.04 |
ENSMUST00000185152.1
ENSMUST00000184504.1 |
RP23-45G16.5
|
RP23-45G16.5 |
chr11_-_6520894 | 1.04 |
ENSMUST00000003459.3
|
Myo1g
|
myosin IG |
chr2_+_29124106 | 1.04 |
ENSMUST00000129544.1
|
Setx
|
senataxin |
chr11_+_58778089 | 1.03 |
ENSMUST00000081533.2
|
Olfr315
|
olfactory receptor 315 |
chr1_-_169531447 | 1.03 |
ENSMUST00000111368.1
|
Nuf2
|
NUF2, NDC80 kinetochore complex component, homolog (S. cerevisiae) |
chr1_-_169531343 | 1.02 |
ENSMUST00000028000.7
|
Nuf2
|
NUF2, NDC80 kinetochore complex component, homolog (S. cerevisiae) |
chr3_+_134828993 | 1.01 |
ENSMUST00000029822.4
|
Tacr3
|
tachykinin receptor 3 |
chr17_-_26095487 | 1.00 |
ENSMUST00000025007.5
|
Nme4
|
NME/NM23 nucleoside diphosphate kinase 4 |
chr1_+_164062070 | 1.00 |
ENSMUST00000097491.3
ENSMUST00000027871.7 |
Sell
|
selectin, lymphocyte |
chr16_+_37011758 | 1.00 |
ENSMUST00000071452.5
ENSMUST00000054034.6 |
Polq
|
polymerase (DNA directed), theta |
chr2_+_152962485 | 1.00 |
ENSMUST00000099197.2
ENSMUST00000103155.3 |
Ttll9
|
tubulin tyrosine ligase-like family, member 9 |
chr8_-_22185758 | 0.99 |
ENSMUST00000046916.7
|
Ckap2
|
cytoskeleton associated protein 2 |
chr2_-_33086366 | 0.99 |
ENSMUST00000049618.2
|
Garnl3
|
GTPase activating RANGAP domain-like 3 |
chr14_+_115042752 | 0.99 |
ENSMUST00000134140.2
|
Mir17hg
|
Mir17 host gene 1 (non-protein coding) |
chrX_-_97377190 | 0.98 |
ENSMUST00000037353.3
|
Eda2r
|
ectodysplasin A2 receptor |
chr1_-_71103146 | 0.96 |
ENSMUST00000027393.7
|
Bard1
|
BRCA1 associated RING domain 1 |
chr11_-_99024179 | 0.96 |
ENSMUST00000068031.7
|
Top2a
|
topoisomerase (DNA) II alpha |
chrX_+_107255878 | 0.96 |
ENSMUST00000101294.2
ENSMUST00000118820.1 ENSMUST00000120971.1 |
Gpr174
|
G protein-coupled receptor 174 |
chr16_+_17144600 | 0.95 |
ENSMUST00000115702.1
|
Ydjc
|
YdjC homolog (bacterial) |
chr6_+_124830217 | 0.93 |
ENSMUST00000131847.1
ENSMUST00000151674.1 |
Cdca3
|
cell division cycle associated 3 |
chr2_-_5012716 | 0.92 |
ENSMUST00000027980.7
|
Mcm10
|
minichromosome maintenance deficient 10 (S. cerevisiae) |
chr4_-_117182623 | 0.92 |
ENSMUST00000065896.2
|
Kif2c
|
kinesin family member 2C |
chr7_+_127296291 | 0.92 |
ENSMUST00000106306.2
ENSMUST00000120857.1 |
Itgal
|
integrin alpha L |
chr4_-_130574150 | 0.91 |
ENSMUST00000105993.3
|
Nkain1
|
Na+/K+ transporting ATPase interacting 1 |
chrX_-_162964557 | 0.90 |
ENSMUST00000038769.2
|
S100g
|
S100 calcium binding protein G |
chr6_+_41538218 | 0.90 |
ENSMUST00000103291.1
|
Trbc1
|
T cell receptor beta, constant region 1 |
chr16_+_31422268 | 0.89 |
ENSMUST00000089759.2
|
Bdh1
|
3-hydroxybutyrate dehydrogenase, type 1 |
chr7_-_3845050 | 0.88 |
ENSMUST00000108615.3
ENSMUST00000119469.1 |
Pira2
|
paired-Ig-like receptor A2 |
chr19_+_30232921 | 0.88 |
ENSMUST00000025797.5
|
Mbl2
|
mannose-binding lectin (protein C) 2 |
chr3_-_15426427 | 0.88 |
ENSMUST00000099201.3
|
Sirpb1a
|
signal-regulatory protein beta 1A |
chr2_-_21205342 | 0.87 |
ENSMUST00000027992.2
|
Enkur
|
enkurin, TRPC channel interacting protein |
chr7_+_43408187 | 0.86 |
ENSMUST00000005592.6
|
Siglecg
|
sialic acid binding Ig-like lectin G |
chr15_+_78430086 | 0.86 |
ENSMUST00000162808.1
|
Kctd17
|
potassium channel tetramerisation domain containing 17 |
chr4_+_45018583 | 0.84 |
ENSMUST00000133157.1
ENSMUST00000029999.8 ENSMUST00000107814.3 |
Polr1e
|
polymerase (RNA) I polypeptide E |
chr5_-_89457763 | 0.83 |
ENSMUST00000049209.8
|
Gc
|
group specific component |
chrX_+_136741821 | 0.83 |
ENSMUST00000089350.4
|
BC065397
|
cDNA sequence BC065397 |
chr8_+_20136455 | 0.83 |
ENSMUST00000179299.1
ENSMUST00000096485.4 |
Gm21811
|
predicted gene, 21811 |
chr15_+_3270767 | 0.82 |
ENSMUST00000082424.4
ENSMUST00000159158.1 ENSMUST00000159216.1 ENSMUST00000160311.1 |
Sepp1
|
selenoprotein P, plasma, 1 |
chr6_+_70726430 | 0.82 |
ENSMUST00000103410.1
|
Igkc
|
immunoglobulin kappa constant |
chr5_-_88526496 | 0.81 |
ENSMUST00000164073.1
|
Igj
|
immunoglobulin joining chain |
chr11_+_46810792 | 0.81 |
ENSMUST00000068877.6
|
Timd4
|
T cell immunoglobulin and mucin domain containing 4 |
chr1_+_9547948 | 0.81 |
ENSMUST00000144177.1
|
Adhfe1
|
alcohol dehydrogenase, iron containing, 1 |
chr13_-_19824234 | 0.80 |
ENSMUST00000065335.2
|
Gpr141
|
G protein-coupled receptor 141 |
chr8_+_46010596 | 0.79 |
ENSMUST00000110381.2
|
Lrp2bp
|
Lrp2 binding protein |
chr7_-_19280032 | 0.79 |
ENSMUST00000032560.4
|
Ppm1n
|
protein phosphatase, Mg2+/Mn2+ dependent, 1N (putative) |
chr10_+_88091070 | 0.77 |
ENSMUST00000048621.7
|
Pmch
|
pro-melanin-concentrating hormone |
chr7_+_88278085 | 0.76 |
ENSMUST00000032779.5
ENSMUST00000128791.1 |
Ctsc
|
cathepsin C |
chr5_+_129715488 | 0.76 |
ENSMUST00000119576.1
ENSMUST00000042191.5 ENSMUST00000118420.1 ENSMUST00000154358.1 ENSMUST00000121339.1 ENSMUST00000119604.1 ENSMUST00000136108.1 ENSMUST00000121813.1 ENSMUST00000119985.1 ENSMUST00000138812.1 |
Mrps17
|
mitochondrial ribosomal protein S17 |
chr4_+_108579445 | 0.76 |
ENSMUST00000102744.3
|
Orc1
|
origin recognition complex, subunit 1 |
chr6_-_90224438 | 0.75 |
ENSMUST00000076086.2
|
Vmn1r53
|
vomeronasal 1 receptor 53 |
chr16_-_19200350 | 0.75 |
ENSMUST00000103749.2
|
Iglc2
|
immunoglobulin lambda constant 2 |
chr2_+_119618717 | 0.75 |
ENSMUST00000028771.7
|
Nusap1
|
nucleolar and spindle associated protein 1 |
chr8_-_84773381 | 0.75 |
ENSMUST00000109764.1
|
Nfix
|
nuclear factor I/X |
chrX_+_134059315 | 0.74 |
ENSMUST00000144483.1
|
Cstf2
|
cleavage stimulation factor, 3' pre-RNA subunit 2 |
chr6_-_147087023 | 0.74 |
ENSMUST00000100780.2
|
Mansc4
|
MANSC domain containing 4 |
chr5_+_98854434 | 0.74 |
ENSMUST00000031278.4
|
Bmp3
|
bone morphogenetic protein 3 |
chr2_-_113848655 | 0.74 |
ENSMUST00000102545.1
ENSMUST00000110948.1 |
Arhgap11a
|
Rho GTPase activating protein 11A |
chr13_+_104229366 | 0.74 |
ENSMUST00000022227.6
|
Cenpk
|
centromere protein K |
chr4_-_116821501 | 0.74 |
ENSMUST00000055436.3
|
Hpdl
|
4-hydroxyphenylpyruvate dioxygenase-like |
chr12_-_113422730 | 0.74 |
ENSMUST00000177715.1
ENSMUST00000103426.1 |
Ighm
|
immunoglobulin heavy constant mu |
chr18_-_47333311 | 0.73 |
ENSMUST00000126684.1
ENSMUST00000156422.1 |
Sema6a
|
sema domain, transmembrane domain (TM), and cytoplasmic domain, (semaphorin) 6A |
chr7_+_78895903 | 0.73 |
ENSMUST00000107425.1
ENSMUST00000107421.1 ENSMUST00000107423.1 |
Aen
|
apoptosis enhancing nuclease |
chr7_-_120145286 | 0.72 |
ENSMUST00000033207.4
|
Zp2
|
zona pellucida glycoprotein 2 |
chr2_-_152830266 | 0.72 |
ENSMUST00000140436.1
|
Bcl2l1
|
BCL2-like 1 |
chr1_-_16104163 | 0.72 |
ENSMUST00000149566.1
|
Rpl7
|
ribosomal protein L7 |
chr4_+_123282778 | 0.72 |
ENSMUST00000106243.1
ENSMUST00000106241.1 ENSMUST00000080178.6 |
Pabpc4
|
poly(A) binding protein, cytoplasmic 4 |
chr7_-_25132473 | 0.72 |
ENSMUST00000108418.4
ENSMUST00000108415.3 ENSMUST00000098679.3 ENSMUST00000175774.2 ENSMUST00000108417.3 ENSMUST00000108416.3 ENSMUST00000108414.1 ENSMUST00000108413.1 ENSMUST00000176408.1 |
Pou2f2
|
POU domain, class 2, transcription factor 2 |
chr19_-_37330613 | 0.72 |
ENSMUST00000131070.1
|
Ide
|
insulin degrading enzyme |
chr1_+_66386968 | 0.72 |
ENSMUST00000145419.1
|
Map2
|
microtubule-associated protein 2 |
chr8_+_19682268 | 0.72 |
ENSMUST00000153710.1
ENSMUST00000127799.1 |
Gm6483
|
predicted gene 6483 |
chr2_+_118598209 | 0.71 |
ENSMUST00000038341.7
|
Bub1b
|
budding uninhibited by benzimidazoles 1 homolog, beta (S. cerevisiae) |
chr6_+_58596584 | 0.71 |
ENSMUST00000031822.6
|
Abcg2
|
ATP-binding cassette, sub-family G (WHITE), member 2 |
chr7_+_127296251 | 0.71 |
ENSMUST00000117762.1
|
Itgal
|
integrin alpha L |
chr14_+_65806066 | 0.71 |
ENSMUST00000139644.1
|
Pbk
|
PDZ binding kinase |
chr11_-_60811228 | 0.71 |
ENSMUST00000018744.8
|
Shmt1
|
serine hydroxymethyltransferase 1 (soluble) |
chr13_+_4059565 | 0.71 |
ENSMUST00000041768.6
|
Akr1c14
|
aldo-keto reductase family 1, member C14 |
chr2_-_164638789 | 0.70 |
ENSMUST00000109336.1
|
Wfdc16
|
WAP four-disulfide core domain 16 |
chr11_-_87108656 | 0.70 |
ENSMUST00000051395.8
|
Prr11
|
proline rich 11 |
chr3_+_108383829 | 0.70 |
ENSMUST00000090561.3
ENSMUST00000102629.1 ENSMUST00000128089.1 |
Psrc1
|
proline/serine-rich coiled-coil 1 |
chr7_-_62420139 | 0.69 |
ENSMUST00000094340.3
|
Mkrn3
|
makorin, ring finger protein, 3 |
chr2_-_152830615 | 0.69 |
ENSMUST00000146380.1
ENSMUST00000134902.1 ENSMUST00000134357.1 ENSMUST00000109820.3 |
Bcl2l1
|
BCL2-like 1 |
chr18_+_34625009 | 0.69 |
ENSMUST00000166044.1
|
Kif20a
|
kinesin family member 20A |
chr9_-_60522017 | 0.69 |
ENSMUST00000140824.1
|
Thsd4
|
thrombospondin, type I, domain containing 4 |
chr1_+_158362261 | 0.69 |
ENSMUST00000046110.9
|
Astn1
|
astrotactin 1 |
chr14_-_87141114 | 0.69 |
ENSMUST00000168889.1
|
Diap3
|
diaphanous homolog 3 (Drosophila) |
chr18_+_68337504 | 0.68 |
ENSMUST00000172148.1
|
Mc5r
|
melanocortin 5 receptor |
chr7_+_75643223 | 0.68 |
ENSMUST00000137959.1
|
Akap13
|
A kinase (PRKA) anchor protein 13 |
chr7_+_80294450 | 0.68 |
ENSMUST00000163812.2
ENSMUST00000047558.7 ENSMUST00000174199.1 ENSMUST00000173824.1 ENSMUST00000174172.1 |
Prc1
|
protein regulator of cytokinesis 1 |
chr2_-_65567505 | 0.68 |
ENSMUST00000100069.2
|
Scn3a
|
sodium channel, voltage-gated, type III, alpha |
chr6_-_125191535 | 0.68 |
ENSMUST00000043848.4
|
Ncapd2
|
non-SMC condensin I complex, subunit D2 |
chr4_-_82885148 | 0.68 |
ENSMUST00000048430.3
|
Cer1
|
cerberus 1 homolog (Xenopus laevis) |
chr11_+_102248842 | 0.67 |
ENSMUST00000100392.4
|
BC030867
|
cDNA sequence BC030867 |
chr16_-_17144415 | 0.67 |
ENSMUST00000115709.1
|
Ccdc116
|
coiled-coil domain containing 116 |
chr6_-_136781718 | 0.67 |
ENSMUST00000078095.6
ENSMUST00000032338.7 |
Gucy2c
|
guanylate cyclase 2c |
chr7_-_7247328 | 0.67 |
ENSMUST00000170922.1
|
Vmn2r29
|
vomeronasal 2, receptor 29 |
chr7_+_19518731 | 0.67 |
ENSMUST00000078908.4
|
Nkpd1
|
NTPase, KAP family P-loop domain containing 1 |
chr4_+_126556994 | 0.67 |
ENSMUST00000147675.1
|
Clspn
|
claspin |
chr5_+_86071734 | 0.67 |
ENSMUST00000031171.7
|
Stap1
|
signal transducing adaptor family member 1 |
chr6_+_123229843 | 0.66 |
ENSMUST00000112554.2
ENSMUST00000024118.4 ENSMUST00000117130.1 |
Clec4n
|
C-type lectin domain family 4, member n |
chr2_+_112239468 | 0.66 |
ENSMUST00000028554.3
|
Lpcat4
|
lysophosphatidylcholine acyltransferase 4 |
chr8_-_27202542 | 0.66 |
ENSMUST00000038174.6
|
Got1l1
|
glutamic-oxaloacetic transaminase 1-like 1 |
chr2_-_73386396 | 0.66 |
ENSMUST00000112044.1
ENSMUST00000112043.1 ENSMUST00000076463.5 |
Gpr155
|
G protein-coupled receptor 155 |
chr3_+_138143846 | 0.65 |
ENSMUST00000159481.1
|
Trmt10a
|
tRNA methyltransferase 10A |
chr10_+_62947011 | 0.65 |
ENSMUST00000131422.1
|
Dna2
|
DNA replication helicase 2 homolog (yeast) |
chr2_-_113848601 | 0.65 |
ENSMUST00000110949.2
|
Arhgap11a
|
Rho GTPase activating protein 11A |
chr6_-_69631933 | 0.64 |
ENSMUST00000177697.1
|
Igkv4-54
|
immunoglobulin kappa chain variable 4-54 |
chr1_+_6730135 | 0.64 |
ENSMUST00000155921.1
|
St18
|
suppression of tumorigenicity 18 |
chr2_+_84988194 | 0.64 |
ENSMUST00000028466.5
|
Prg3
|
proteoglycan 3 |
chr10_+_51480632 | 0.64 |
ENSMUST00000102894.3
ENSMUST00000105482.1 ENSMUST00000105481.1 |
Gp49a
Lilrb4
|
glycoprotein 49 A leukocyte immunoglobulin-like receptor, subfamily B, member 4 |
chr12_-_72917760 | 0.64 |
ENSMUST00000110489.2
|
4930447C04Rik
|
RIKEN cDNA 4930447C04 gene |
chr2_-_181156993 | 0.64 |
ENSMUST00000055990.7
|
Eef1a2
|
eukaryotic translation elongation factor 1 alpha 2 |
chr1_-_130661613 | 0.64 |
ENSMUST00000027657.7
|
C4bp
|
complement component 4 binding protein |
chr18_-_47368830 | 0.64 |
ENSMUST00000019791.7
ENSMUST00000115449.2 |
Sema6a
|
sema domain, transmembrane domain (TM), and cytoplasmic domain, (semaphorin) 6A |
chr6_+_41546730 | 0.63 |
ENSMUST00000103299.1
|
Trbc2
|
T cell receptor beta, constant 2 |
chr2_-_103372725 | 0.63 |
ENSMUST00000139065.1
|
A930006I01Rik
|
RIKEN cDNA A930006I01 gene |
chr5_-_107972864 | 0.63 |
ENSMUST00000153172.1
|
Fam69a
|
family with sequence similarity 69, member A |
chr13_-_100786402 | 0.63 |
ENSMUST00000174038.1
ENSMUST00000091295.7 ENSMUST00000072119.8 |
Ccnb1
|
cyclin B1 |
chr17_+_34238896 | 0.63 |
ENSMUST00000095342.3
|
H2-Ob
|
histocompatibility 2, O region beta locus |
chr17_+_84626458 | 0.62 |
ENSMUST00000025101.8
|
Dync2li1
|
dynein cytoplasmic 2 light intermediate chain 1 |
chr5_+_139406387 | 0.62 |
ENSMUST00000052176.8
|
C130050O18Rik
|
RIKEN cDNA C130050O18 gene |
chr4_-_43499608 | 0.62 |
ENSMUST00000136005.1
ENSMUST00000054538.6 |
Arhgef39
|
Rho guanine nucleotide exchange factor (GEF) 39 |
chr3_-_116712696 | 0.61 |
ENSMUST00000169530.1
|
Slc35a3
|
solute carrier family 35 (UDP-N-acetylglucosamine (UDP-GlcNAc) transporter), member 3 |
chr11_+_82101836 | 0.61 |
ENSMUST00000000194.3
|
Ccl12
|
chemokine (C-C motif) ligand 12 |
chr10_+_23949516 | 0.61 |
ENSMUST00000045152.4
|
Taar3
|
trace amine-associated receptor 3 |
chr1_-_138175283 | 0.61 |
ENSMUST00000182755.1
ENSMUST00000183262.1 ENSMUST00000027645.7 ENSMUST00000112036.2 ENSMUST00000182283.1 |
Ptprc
|
protein tyrosine phosphatase, receptor type, C |
chr1_+_107511489 | 0.61 |
ENSMUST00000064916.2
|
Serpinb2
|
serine (or cysteine) peptidase inhibitor, clade B, member 2 |
chr7_+_30699783 | 0.60 |
ENSMUST00000013227.7
|
2200002J24Rik
|
RIKEN cDNA 2200002J24 gene |
chr11_+_59542686 | 0.60 |
ENSMUST00000101148.2
|
Nlrp3
|
NLR family, pyrin domain containing 3 |
chr1_-_138175238 | 0.60 |
ENSMUST00000182536.1
|
Ptprc
|
protein tyrosine phosphatase, receptor type, C |
chr11_+_115564434 | 0.60 |
ENSMUST00000021085.4
|
Nup85
|
nucleoporin 85 |
chrX_-_97377150 | 0.60 |
ENSMUST00000113832.1
|
Eda2r
|
ectodysplasin A2 receptor |
chr4_-_117178726 | 0.60 |
ENSMUST00000153953.1
ENSMUST00000106436.1 |
Kif2c
|
kinesin family member 2C |
chr12_-_103773592 | 0.60 |
ENSMUST00000078869.5
|
Serpina1d
|
serine (or cysteine) peptidase inhibitor, clade A, member 1D |
chr9_+_65587187 | 0.60 |
ENSMUST00000047099.5
ENSMUST00000131483.1 ENSMUST00000141046.1 |
Pif1
|
PIF1 5'-to-3' DNA helicase homolog (S. cerevisiae) |
chr2_+_3713449 | 0.60 |
ENSMUST00000027965.4
|
Fam107b
|
family with sequence similarity 107, member B |
chr4_-_126202335 | 0.59 |
ENSMUST00000142125.1
ENSMUST00000106141.2 |
Thrap3
|
thyroid hormone receptor associated protein 3 |
chr7_-_48881596 | 0.59 |
ENSMUST00000119223.1
|
E2f8
|
E2F transcription factor 8 |
chr1_+_173630847 | 0.59 |
ENSMUST00000056071.7
|
Pyhin1
|
pyrin and HIN domain family, member 1 |
chr10_-_18785011 | 0.59 |
ENSMUST00000055107.6
|
Gm4922
|
predicted gene 4922 |
chr12_+_117843873 | 0.59 |
ENSMUST00000176735.1
ENSMUST00000177339.1 |
Cdca7l
|
cell division cycle associated 7 like |
chr13_-_74376566 | 0.58 |
ENSMUST00000091481.2
|
Zfp72
|
zinc finger protein 72 |
chrY_+_90784738 | 0.58 |
ENSMUST00000179483.1
|
Erdr1
|
erythroid differentiation regulator 1 |
chr15_-_102350692 | 0.58 |
ENSMUST00000041208.7
|
Aaas
|
achalasia, adrenocortical insufficiency, alacrimia |
chr2_+_93642307 | 0.58 |
ENSMUST00000042078.3
ENSMUST00000111254.1 |
Alx4
|
aristaless-like homeobox 4 |
chr12_+_78691516 | 0.58 |
ENSMUST00000077968.4
|
Fam71d
|
family with sequence similarity 71, member D |
chr10_-_121311034 | 0.58 |
ENSMUST00000064107.5
|
Tbc1d30
|
TBC1 domain family, member 30 |
chr5_+_123252087 | 0.58 |
ENSMUST00000121964.1
|
Wdr66
|
WD repeat domain 66 |
chrX_+_109196750 | 0.58 |
ENSMUST00000139259.1
ENSMUST00000060013.3 |
Gm6377
|
predicted gene 6377 |
chr2_-_66410064 | 0.58 |
ENSMUST00000112366.1
|
Scn1a
|
sodium channel, voltage-gated, type I, alpha |
chr17_+_35194405 | 0.57 |
ENSMUST00000025262.5
|
Ltb
|
lymphotoxin B |
chr2_+_121506715 | 0.57 |
ENSMUST00000028676.5
|
Wdr76
|
WD repeat domain 76 |
chr11_-_11808923 | 0.57 |
ENSMUST00000109664.1
ENSMUST00000150714.1 ENSMUST00000047689.4 ENSMUST00000171938.1 ENSMUST00000171080.1 |
Fignl1
|
fidgetin-like 1 |
chr5_-_148392810 | 0.57 |
ENSMUST00000138257.1
|
Slc7a1
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 1 |
chr1_+_158362330 | 0.57 |
ENSMUST00000170718.1
|
Astn1
|
astrotactin 1 |
chr17_-_17883920 | 0.57 |
ENSMUST00000061516.7
|
Fpr1
|
formyl peptide receptor 1 |
chr5_-_137858034 | 0.57 |
ENSMUST00000110978.2
|
Pilrb1
|
paired immunoglobin-like type 2 receptor beta 1 |
chr1_-_85270543 | 0.57 |
ENSMUST00000093506.5
ENSMUST00000064341.8 |
C130026I21Rik
|
RIKEN cDNA C130026I21 gene |
chr1_-_65123108 | 0.57 |
ENSMUST00000050047.3
ENSMUST00000148020.1 |
D630023F18Rik
|
RIKEN cDNA D630023F18 gene |
chr9_-_44526397 | 0.57 |
ENSMUST00000062215.7
|
Cxcr5
|
chemokine (C-X-C motif) receptor 5 |
chr7_-_4445595 | 0.57 |
ENSMUST00000119485.1
|
Rdh13
|
retinol dehydrogenase 13 (all-trans and 9-cis) |
chr2_+_118814195 | 0.56 |
ENSMUST00000110842.1
|
Knstrn
|
kinetochore-localized astrin/SPAG5 binding |
chr8_+_84723003 | 0.56 |
ENSMUST00000098571.4
|
G430095P16Rik
|
RIKEN cDNA G430095P16 gene |
chr15_+_4375462 | 0.56 |
ENSMUST00000061925.4
|
Plcxd3
|
phosphatidylinositol-specific phospholipase C, X domain containing 3 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 2.4 | GO:1990523 | bone regeneration(GO:1990523) |
0.6 | 1.9 | GO:0045004 | DNA replication proofreading(GO:0045004) |
0.6 | 3.4 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.5 | 1.5 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.5 | 1.4 | GO:0033624 | negative regulation of integrin activation(GO:0033624) |
0.5 | 1.4 | GO:0002344 | peripheral B cell selection(GO:0002343) B cell affinity maturation(GO:0002344) |
0.5 | 1.8 | GO:0046898 | response to cycloheximide(GO:0046898) |
0.4 | 2.2 | GO:2000473 | regulation of hematopoietic stem cell migration(GO:2000471) positive regulation of hematopoietic stem cell migration(GO:2000473) |
0.4 | 2.4 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.4 | 1.4 | GO:0002587 | negative regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002587) |
0.4 | 1.8 | GO:2000434 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
0.4 | 1.1 | GO:0031554 | regulation of DNA-templated transcription, termination(GO:0031554) |
0.3 | 1.7 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.3 | 1.4 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.3 | 1.0 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.3 | 1.0 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
0.3 | 1.6 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.3 | 1.0 | GO:0019389 | glucuronoside metabolic process(GO:0019389) |
0.3 | 1.0 | GO:0001180 | transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
0.3 | 1.6 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.3 | 0.9 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.3 | 3.7 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.3 | 1.5 | GO:0051309 | female meiosis chromosome separation(GO:0051309) |
0.3 | 0.9 | GO:0010705 | meiotic DNA double-strand break processing involved in reciprocal meiotic recombination(GO:0010705) |
0.3 | 0.5 | GO:1903538 | meiotic cell cycle process involved in oocyte maturation(GO:1903537) regulation of meiotic cell cycle process involved in oocyte maturation(GO:1903538) |
0.3 | 0.8 | GO:0071727 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.2 | 1.2 | GO:0003404 | optic vesicle morphogenesis(GO:0003404) |
0.2 | 1.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.2 | 1.0 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.2 | 1.0 | GO:0045575 | basophil activation(GO:0045575) |
0.2 | 1.9 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.2 | 0.7 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
0.2 | 0.7 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.2 | 0.7 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
0.2 | 1.4 | GO:0031120 | snRNA pseudouridine synthesis(GO:0031120) |
0.2 | 0.7 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.2 | 1.1 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
0.2 | 0.7 | GO:0070904 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
0.2 | 1.3 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.2 | 1.3 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
0.2 | 0.6 | GO:0007144 | female meiosis I(GO:0007144) |
0.2 | 0.8 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.2 | 1.1 | GO:2000501 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) |
0.2 | 1.9 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
0.2 | 1.3 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.2 | 0.8 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.2 | 0.6 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
0.2 | 0.8 | GO:0046073 | dTMP biosynthetic process(GO:0006231) dTMP metabolic process(GO:0046073) |
0.2 | 0.6 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
0.2 | 0.2 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
0.2 | 0.8 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.2 | 0.8 | GO:0097393 | post-embryonic appendage morphogenesis(GO:0035120) post-embryonic limb morphogenesis(GO:0035127) post-embryonic forelimb morphogenesis(GO:0035128) telomeric repeat-containing RNA transcription(GO:0097393) telomeric repeat-containing RNA transcription from RNA pol II promoter(GO:0097394) regulation of telomeric RNA transcription from RNA pol II promoter(GO:1901580) negative regulation of telomeric RNA transcription from RNA pol II promoter(GO:1901581) positive regulation of telomeric RNA transcription from RNA pol II promoter(GO:1901582) |
0.2 | 1.1 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.2 | 0.4 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.2 | 0.6 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
0.2 | 1.9 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.2 | 0.6 | GO:1990166 | protein localization to site of double-strand break(GO:1990166) |
0.2 | 0.7 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.2 | 0.9 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.2 | 0.7 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
0.2 | 0.5 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.2 | 1.7 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.2 | 0.5 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.2 | 0.5 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.2 | 0.5 | GO:0070543 | response to linoleic acid(GO:0070543) |
0.2 | 0.7 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.2 | 0.2 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
0.2 | 0.6 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.2 | 2.1 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.2 | 0.3 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.2 | 0.3 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.2 | 1.8 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.2 | 0.3 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.2 | 0.5 | GO:0002223 | stimulatory C-type lectin receptor signaling pathway(GO:0002223) |
0.2 | 0.6 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.2 | 0.5 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.2 | 0.5 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.2 | 0.5 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
0.2 | 0.6 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.1 | 1.0 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
0.1 | 0.4 | GO:0032826 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.1 | 0.6 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
0.1 | 2.8 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.1 | 0.1 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
0.1 | 1.6 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.1 | 0.7 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.1 | 0.9 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.1 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.1 | 0.4 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.1 | 0.4 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
0.1 | 0.8 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 0.3 | GO:0000912 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
0.1 | 0.4 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.1 | 4.0 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
0.1 | 0.1 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.1 | 0.5 | GO:0019323 | pentose catabolic process(GO:0019323) |
0.1 | 0.4 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
0.1 | 0.4 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 1.0 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.1 | 0.5 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
0.1 | 0.4 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
0.1 | 2.1 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.1 | 0.9 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.1 | 0.1 | GO:2000328 | regulation of T-helper 17 cell lineage commitment(GO:2000328) |
0.1 | 0.5 | GO:0048690 | regulation of sprouting of injured axon(GO:0048686) regulation of axon extension involved in regeneration(GO:0048690) |
0.1 | 0.6 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
0.1 | 0.3 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
0.1 | 0.5 | GO:2000426 | negative regulation of apoptotic cell clearance(GO:2000426) |
0.1 | 1.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.1 | 1.4 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
0.1 | 0.3 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
0.1 | 0.8 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.1 | 0.4 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
0.1 | 0.1 | GO:2000458 | astrocyte chemotaxis(GO:0035700) regulation of astrocyte chemotaxis(GO:2000458) |
0.1 | 0.1 | GO:0060067 | cervix development(GO:0060067) |
0.1 | 0.4 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
0.1 | 0.2 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.1 | 0.4 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) |
0.1 | 0.5 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.5 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 1.7 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.1 | 1.2 | GO:1903504 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
0.1 | 0.1 | GO:0039519 | modulation by virus of host autophagy(GO:0039519) |
0.1 | 0.5 | GO:1904009 | response to monosodium glutamate(GO:1904008) cellular response to monosodium glutamate(GO:1904009) |
0.1 | 0.1 | GO:0002101 | tRNA wobble cytosine modification(GO:0002101) |
0.1 | 0.9 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.1 | 0.1 | GO:0031064 | negative regulation of histone deacetylation(GO:0031064) |
0.1 | 0.4 | GO:0030450 | regulation of complement activation, classical pathway(GO:0030450) |
0.1 | 0.3 | GO:2000295 | regulation of hydrogen peroxide catabolic process(GO:2000295) |
0.1 | 1.3 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.1 | 0.7 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
0.1 | 0.3 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
0.1 | 0.6 | GO:0015788 | UDP-N-acetylglucosamine transport(GO:0015788) |
0.1 | 1.1 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.1 | 0.5 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.1 | 0.3 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.1 | 0.3 | GO:0009597 | detection of virus(GO:0009597) |
0.1 | 0.3 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
0.1 | 0.1 | GO:0035723 | interleukin-15-mediated signaling pathway(GO:0035723) cellular response to interleukin-15(GO:0071350) |
0.1 | 0.1 | GO:0060915 | fibroblast growth factor receptor signaling pathway involved in mammary gland specification(GO:0060595) mammary gland bud formation(GO:0060615) branch elongation involved in salivary gland morphogenesis(GO:0060667) mesenchymal cell differentiation involved in lung development(GO:0060915) |
0.1 | 0.2 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.1 | 0.4 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
0.1 | 1.3 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.1 | 0.1 | GO:0031591 | wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
0.1 | 0.8 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 0.6 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.1 | 1.5 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.1 | 0.4 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.3 | GO:0032672 | regulation of interleukin-3 production(GO:0032672) |
0.1 | 0.1 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.1 | 0.8 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
0.1 | 0.2 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
0.1 | 0.7 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.8 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.1 | 0.4 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.4 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
0.1 | 0.4 | GO:0060613 | fat pad development(GO:0060613) |
0.1 | 1.0 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 0.6 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
0.1 | 0.7 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.1 | 0.3 | GO:0072382 | minus-end-directed vesicle transport along microtubule(GO:0072382) |
0.1 | 0.2 | GO:2001034 | positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
0.1 | 0.9 | GO:0009644 | response to high light intensity(GO:0009644) |
0.1 | 0.5 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.1 | 0.3 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.1 | 0.3 | GO:0051030 | snRNA transport(GO:0051030) |
0.1 | 0.3 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.1 | 0.4 | GO:0090472 | dibasic protein processing(GO:0090472) |
0.1 | 2.5 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
0.1 | 0.4 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.1 | 0.3 | GO:0002644 | negative regulation of tolerance induction(GO:0002644) |
0.1 | 2.1 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
0.1 | 0.1 | GO:0006226 | dUMP biosynthetic process(GO:0006226) |
0.1 | 0.3 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
0.1 | 0.4 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
0.1 | 0.3 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.1 | 0.7 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.1 | 0.2 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
0.1 | 0.4 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.1 | 0.5 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
0.1 | 0.3 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.1 | 0.7 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.1 | 0.5 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.1 | 0.8 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.1 | 0.8 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.1 | 0.6 | GO:2001280 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
0.1 | 0.3 | GO:0090425 | hepatocyte cell migration(GO:0002194) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) positive regulation of forebrain neuron differentiation(GO:2000979) |
0.1 | 0.7 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.1 | 1.9 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.1 | 0.1 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.1 | 0.6 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
0.1 | 0.5 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 0.3 | GO:0090070 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
0.1 | 0.3 | GO:0070845 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
0.1 | 0.3 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.1 | 0.9 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.1 | 0.3 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.1 | 0.3 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
0.1 | 0.5 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.1 | 1.0 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 1.3 | GO:0002495 | antigen processing and presentation of peptide antigen via MHC class II(GO:0002495) |
0.1 | 0.1 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.1 | 0.5 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.1 | 0.3 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
0.1 | 0.3 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.3 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
0.1 | 0.3 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.1 | 0.3 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.1 | 0.3 | GO:0019405 | alditol catabolic process(GO:0019405) |
0.1 | 1.7 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.1 | 0.2 | GO:0071317 | cellular response to isoquinoline alkaloid(GO:0071317) |
0.1 | 0.3 | GO:2001201 | regulation of transforming growth factor-beta secretion(GO:2001201) |
0.1 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.3 | GO:0046110 | xanthine catabolic process(GO:0009115) xanthine metabolic process(GO:0046110) |
0.1 | 0.2 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
0.1 | 0.2 | GO:0009223 | pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.1 | 0.1 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.1 | 0.2 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.1 | 0.2 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.4 | GO:0044805 | late nucleophagy(GO:0044805) |
0.1 | 0.1 | GO:0000478 | endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
0.1 | 0.1 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.1 | 0.6 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.1 | 0.5 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.1 | 0.4 | GO:0051126 | negative regulation of actin nucleation(GO:0051126) |
0.1 | 0.2 | GO:0003345 | proepicardium cell migration involved in pericardium morphogenesis(GO:0003345) |
0.1 | 1.0 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.1 | 0.4 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 0.2 | GO:0070671 | response to interleukin-12(GO:0070671) |
0.1 | 0.3 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.1 | 0.2 | GO:1901738 | regulation of vitamin A metabolic process(GO:1901738) |
0.1 | 0.5 | GO:0098838 | reduced folate transmembrane transport(GO:0098838) |
0.1 | 0.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.1 | 0.4 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 1.7 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.1 | 1.8 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.1 | 0.8 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.1 | 0.3 | GO:0043369 | CD4-positive or CD8-positive, alpha-beta T cell lineage commitment(GO:0043369) |
0.1 | 0.2 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.1 | 0.2 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.1 | 1.1 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.1 | 0.1 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.1 | 0.2 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.1 | 0.3 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.2 | GO:0002863 | positive regulation of inflammatory response to antigenic stimulus(GO:0002863) |
0.1 | 0.2 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.1 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.1 | 0.2 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.1 | 0.4 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
0.1 | 0.2 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.1 | 0.3 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 0.4 | GO:0001550 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
0.1 | 0.2 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.1 | 0.1 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.1 | 0.5 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.1 | 0.2 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
0.1 | 0.5 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.1 | 0.2 | GO:0002305 | gamma-delta intraepithelial T cell differentiation(GO:0002304) CD8-positive, gamma-delta intraepithelial T cell differentiation(GO:0002305) |
0.1 | 1.1 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.5 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.1 | 0.4 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.1 | 0.2 | GO:2001267 | regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001267) |
0.1 | 0.1 | GO:0019614 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
0.1 | 0.3 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.1 | 0.2 | GO:0048338 | neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) positive regulation of cardiac ventricle development(GO:1904414) |
0.1 | 0.6 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.1 | 0.2 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.1 | 0.8 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
0.1 | 0.3 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.5 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.1 | 0.5 | GO:1903056 | regulation of melanosome organization(GO:1903056) |
0.1 | 0.3 | GO:1904253 | positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
0.1 | 1.1 | GO:0035634 | response to stilbenoid(GO:0035634) |
0.1 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.1 | 0.3 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.1 | 0.2 | GO:1904776 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
0.1 | 1.1 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
0.1 | 0.3 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.1 | 1.8 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.1 | 0.2 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.1 | 0.6 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.1 | 0.2 | GO:0016132 | brassinosteroid metabolic process(GO:0016131) brassinosteroid biosynthetic process(GO:0016132) |
0.1 | 1.7 | GO:0030488 | tRNA methylation(GO:0030488) |
0.1 | 0.3 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
0.1 | 0.2 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.1 | 0.6 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.1 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.1 | 0.8 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.1 | 0.1 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
0.1 | 1.1 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
0.1 | 0.3 | GO:0010920 | negative regulation of inositol phosphate biosynthetic process(GO:0010920) |
0.1 | 0.2 | GO:0021781 | glial cell fate commitment(GO:0021781) |
0.1 | 1.6 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.1 | 0.7 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.1 | 0.3 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.1 | 0.1 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.1 | 0.1 | GO:0009253 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
0.1 | 0.2 | GO:0031622 | positive regulation of fever generation(GO:0031622) |
0.1 | 0.2 | GO:0010845 | positive regulation of reciprocal meiotic recombination(GO:0010845) |
0.1 | 0.3 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
0.1 | 0.2 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.1 | 0.1 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
0.1 | 2.0 | GO:0006284 | base-excision repair(GO:0006284) |
0.1 | 3.0 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
0.1 | 0.1 | GO:0002780 | antimicrobial peptide biosynthetic process(GO:0002777) antibacterial peptide biosynthetic process(GO:0002780) |
0.1 | 0.5 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.1 | 0.2 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.1 | 0.7 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.1 | 0.2 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
0.1 | 0.5 | GO:0043650 | dicarboxylic acid biosynthetic process(GO:0043650) |
0.1 | 0.6 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.1 | 0.5 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.1 | 0.3 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
0.1 | 0.7 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.1 | 0.2 | GO:0016062 | adaptation of rhodopsin mediated signaling(GO:0016062) light adaption(GO:0036367) |
0.1 | 0.3 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.1 | 0.2 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.1 | 1.7 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.1 | 0.2 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
0.1 | 0.5 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.1 | 0.1 | GO:0060631 | regulation of meiosis I(GO:0060631) |
0.1 | 0.4 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.1 | 0.3 | GO:0035247 | peptidyl-arginine omega-N-methylation(GO:0035247) |
0.1 | 0.2 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.1 | 0.2 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.1 | 0.2 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.1 | 0.6 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
0.1 | 0.2 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
0.1 | 0.4 | GO:0015862 | uridine transport(GO:0015862) |
0.1 | 0.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.1 | 0.3 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
0.1 | 0.6 | GO:1904867 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
0.1 | 0.2 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 0.5 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
0.1 | 0.4 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.1 | 0.2 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.1 | 0.4 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.2 | GO:0015855 | nucleobase transport(GO:0015851) pyrimidine nucleobase transport(GO:0015855) |
0.1 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.1 | 0.1 | GO:0034093 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.1 | 0.1 | GO:0048382 | mesendoderm development(GO:0048382) |
0.1 | 1.5 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.1 | 0.7 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.1 | 0.1 | GO:0031392 | regulation of prostaglandin biosynthetic process(GO:0031392) regulation of unsaturated fatty acid biosynthetic process(GO:2001279) |
0.1 | 0.7 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
0.1 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 2.3 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.1 | 0.1 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.1 | 0.1 | GO:0032765 | positive regulation of mast cell cytokine production(GO:0032765) Fc-epsilon receptor signaling pathway(GO:0038095) |
0.1 | 0.4 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.1 | 0.3 | GO:1904923 | regulation of mitophagy in response to mitochondrial depolarization(GO:1904923) |
0.1 | 0.2 | GO:0044330 | canonical Wnt signaling pathway involved in positive regulation of wound healing(GO:0044330) canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) lactic acid secretion(GO:0046722) regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
0.1 | 0.2 | GO:0097401 | synaptic vesicle lumen acidification(GO:0097401) |
0.1 | 0.3 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.1 | 0.5 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 0.8 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.1 | 0.3 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
0.1 | 0.3 | GO:2001023 | regulation of response to drug(GO:2001023) |
0.1 | 0.1 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.1 | 1.2 | GO:0000305 | response to oxygen radical(GO:0000305) |
0.1 | 0.2 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.1 | 0.1 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.1 | 0.2 | GO:0051977 | lysophospholipid transport(GO:0051977) |
0.1 | 0.3 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.1 | 0.2 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
0.1 | 0.1 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.1 | 0.5 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 0.3 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 0.2 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.2 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.1 | 0.7 | GO:0060338 | regulation of type I interferon-mediated signaling pathway(GO:0060338) |
0.1 | 0.4 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.1 | 0.1 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
0.0 | 0.0 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
0.0 | 0.1 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
0.0 | 0.2 | GO:1904749 | regulation of protein localization to nucleolus(GO:1904749) |
0.0 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.0 | GO:0072300 | positive regulation of metanephric glomerulus development(GO:0072300) |
0.0 | 1.2 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.0 | 0.4 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.0 | 1.0 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.2 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.0 | 0.6 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.7 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.0 | 0.1 | GO:0015825 | L-serine transport(GO:0015825) |
0.0 | 0.2 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.2 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.0 | 0.3 | GO:0038031 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.0 | 0.4 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.0 | 0.1 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
0.0 | 0.3 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 0.1 | GO:1900149 | positive regulation of Schwann cell migration(GO:1900149) |
0.0 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.3 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.0 | 0.2 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.0 | 0.2 | GO:0098700 | neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.0 | 0.3 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 0.0 | GO:0046051 | UTP metabolic process(GO:0046051) |
0.0 | 0.5 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.2 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.0 | 0.0 | GO:0051542 | elastin biosynthetic process(GO:0051542) |
0.0 | 0.8 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.1 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
0.0 | 0.1 | GO:0060460 | subthalamic nucleus development(GO:0021763) left lung development(GO:0060459) left lung morphogenesis(GO:0060460) superior vena cava morphogenesis(GO:0060578) |
0.0 | 0.2 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.0 | 0.6 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.2 | GO:0009750 | response to fructose(GO:0009750) |
0.0 | 1.7 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.1 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.0 | 0.4 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.1 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) |
0.0 | 0.3 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.0 | 0.2 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.0 | 0.0 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
0.0 | 0.2 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.0 | 0.5 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.0 | 0.1 | GO:0090427 | activation of meiosis(GO:0090427) |
0.0 | 0.3 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.2 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.0 | 0.2 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.0 | 1.5 | GO:0006414 | translational elongation(GO:0006414) |
0.0 | 0.1 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.0 | 0.1 | GO:0007208 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) positive regulation of phosphatidylinositol biosynthetic process(GO:0010513) |
0.0 | 0.5 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.0 | 0.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
0.0 | 0.3 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.3 | GO:1901660 | calcium ion export(GO:1901660) |
0.0 | 0.4 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.0 | 0.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.3 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.0 | 0.5 | GO:0051573 | negative regulation of histone H3-K9 methylation(GO:0051573) |
0.0 | 0.1 | GO:0006409 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.0 | 0.3 | GO:0072619 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
0.0 | 0.1 | GO:0046060 | dATP metabolic process(GO:0046060) |
0.0 | 0.2 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
0.0 | 0.3 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.2 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.0 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.0 | 0.1 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.0 | 0.3 | GO:0031297 | replication fork processing(GO:0031297) |
0.0 | 1.5 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.0 | 0.2 | GO:2000587 | negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.0 | 0.2 | GO:0003349 | epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
0.0 | 0.3 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.0 | 0.3 | GO:0002551 | mast cell chemotaxis(GO:0002551) |
0.0 | 0.2 | GO:0097475 | motor neuron migration(GO:0097475) |
0.0 | 0.2 | GO:0001842 | neural fold formation(GO:0001842) |
0.0 | 0.2 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.0 | 0.7 | GO:0006301 | postreplication repair(GO:0006301) |
0.0 | 0.4 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.0 | 0.1 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.0 | 0.4 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 1.2 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 1.2 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 0.4 | GO:0044036 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.0 | 0.2 | GO:0060022 | hard palate development(GO:0060022) |
0.0 | 0.4 | GO:0042119 | neutrophil activation(GO:0042119) |
0.0 | 0.4 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.0 | 0.2 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.0 | GO:1901355 | response to rapamycin(GO:1901355) |
0.0 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.7 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.0 | 0.1 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.0 | 0.1 | GO:0021933 | radial glia guided migration of cerebellar granule cell(GO:0021933) |
0.0 | 0.6 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.0 | 0.3 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.1 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.0 | 0.6 | GO:0008210 | estrogen metabolic process(GO:0008210) |
0.0 | 0.2 | GO:2000790 | regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
0.0 | 0.1 | GO:0052203 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.0 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.0 | 0.2 | GO:0051231 | spindle elongation(GO:0051231) |
0.0 | 1.5 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.0 | GO:2000812 | regulation of barbed-end actin filament capping(GO:2000812) |
0.0 | 0.3 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.0 | 0.2 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.1 | GO:0034616 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
0.0 | 0.3 | GO:1990573 | potassium ion import across plasma membrane(GO:1990573) |
0.0 | 0.1 | GO:0031296 | B cell costimulation(GO:0031296) |
0.0 | 0.9 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.1 | GO:0044268 | multicellular organismal protein metabolic process(GO:0044268) |
0.0 | 0.1 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.0 | 0.0 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.0 | 0.1 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
0.0 | 1.2 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.0 | 0.3 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.7 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.1 | GO:1904719 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.3 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.0 | 0.0 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.0 | 0.2 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.0 | 0.2 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.3 | GO:0002857 | positive regulation of natural killer cell mediated immune response to tumor cell(GO:0002857) positive regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002860) |
0.0 | 0.0 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.1 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.0 | 0.1 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.0 | 0.6 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.0 | 0.1 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
0.0 | 0.3 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.0 | 0.2 | GO:0006071 | glycerol metabolic process(GO:0006071) |
0.0 | 0.2 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.0 | 0.2 | GO:0030035 | microspike assembly(GO:0030035) |
0.0 | 0.2 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.0 | 0.2 | GO:0010878 | cholesterol storage(GO:0010878) |
0.0 | 0.1 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.0 | 0.4 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.0 | 0.1 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
0.0 | 0.1 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.0 | 0.1 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.0 | 0.3 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.2 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.0 | 0.5 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.2 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
0.0 | 0.1 | GO:0006592 | ornithine biosynthetic process(GO:0006592) |
0.0 | 0.1 | GO:0007356 | thorax and anterior abdomen determination(GO:0007356) |
0.0 | 0.0 | GO:0072719 | cellular response to cisplatin(GO:0072719) |
0.0 | 0.2 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.0 | 0.3 | GO:0071173 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
0.0 | 0.1 | GO:0046112 | nucleobase biosynthetic process(GO:0046112) |
0.0 | 0.1 | GO:0035063 | nuclear speck organization(GO:0035063) |
0.0 | 0.1 | GO:0006657 | CDP-choline pathway(GO:0006657) |
0.0 | 0.1 | GO:0051938 | L-glutamate import(GO:0051938) L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.0 | 0.2 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
0.0 | 0.1 | GO:0043380 | regulation of memory T cell differentiation(GO:0043380) |
0.0 | 0.2 | GO:0032048 | cardiolipin metabolic process(GO:0032048) |
0.0 | 0.2 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
0.0 | 0.2 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.0 | 0.1 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
0.0 | 0.2 | GO:0044786 | cell cycle DNA replication(GO:0044786) |
0.0 | 0.4 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.0 | 0.4 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.2 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.2 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.0 | 0.1 | GO:1904305 | negative regulation of gastro-intestinal system smooth muscle contraction(GO:1904305) negative regulation of small intestine smooth muscle contraction(GO:1904348) |
0.0 | 0.4 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.0 | 0.1 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.1 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
0.0 | 0.2 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.1 | GO:0016556 | mRNA modification(GO:0016556) |
0.0 | 0.4 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
0.0 | 0.4 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.0 | 0.2 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
0.0 | 0.5 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 0.3 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.0 | 0.3 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.0 | 0.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.0 | 0.4 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.0 | 0.3 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 1.2 | GO:0051225 | spindle assembly(GO:0051225) |
0.0 | 0.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.0 | 0.1 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.0 | 0.2 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.4 | GO:0098953 | receptor diffusion trapping(GO:0098953) postsynaptic neurotransmitter receptor diffusion trapping(GO:0098970) neurotransmitter receptor diffusion trapping(GO:0099628) |
0.0 | 0.2 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.0 | 0.1 | GO:0015786 | UDP-glucose transport(GO:0015786) |
0.0 | 0.1 | GO:0002360 | T cell lineage commitment(GO:0002360) |
0.0 | 0.2 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.0 | 0.1 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.0 | 0.2 | GO:0051198 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
0.0 | 0.1 | GO:0061591 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
0.0 | 0.2 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
0.0 | 0.2 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.0 | 0.1 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.0 | 0.7 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
0.0 | 0.3 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.0 | 0.1 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.0 | 0.4 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.0 | 0.1 | GO:0051096 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
0.0 | 0.3 | GO:0090128 | regulation of synapse maturation(GO:0090128) |
0.0 | 0.5 | GO:0050832 | defense response to fungus(GO:0050832) |
0.0 | 0.3 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.0 | 0.1 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.0 | 0.8 | GO:0002381 | immunoglobulin production involved in immunoglobulin mediated immune response(GO:0002381) |
0.0 | 0.0 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.0 | 0.6 | GO:0001782 | B cell homeostasis(GO:0001782) |
0.0 | 0.1 | GO:0071105 | response to interleukin-11(GO:0071105) |
0.0 | 0.1 | GO:0061386 | closure of optic fissure(GO:0061386) |
0.0 | 0.2 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
0.0 | 0.1 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
0.0 | 0.5 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.1 | GO:0051444 | negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
0.0 | 0.1 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
0.0 | 0.2 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.7 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.0 | 0.9 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.1 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
0.0 | 0.5 | GO:0007099 | centriole replication(GO:0007099) centriole assembly(GO:0098534) |
0.0 | 0.5 | GO:0006261 | DNA-dependent DNA replication(GO:0006261) |
0.0 | 0.1 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
0.0 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.0 | 0.1 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
0.0 | 0.0 | GO:0060368 | regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060368) |
0.0 | 0.3 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
0.0 | 0.0 | GO:0018158 | protein oxidation(GO:0018158) |
0.0 | 0.4 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.2 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
0.0 | 0.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.0 | 0.1 | GO:0034334 | adherens junction maintenance(GO:0034334) |
0.0 | 0.0 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.0 | 0.2 | GO:0014820 | tonic smooth muscle contraction(GO:0014820) artery smooth muscle contraction(GO:0014824) |
0.0 | 0.3 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.0 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 0.1 | GO:0060912 | cardiac cell fate specification(GO:0060912) |
0.0 | 0.1 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
0.0 | 0.1 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.0 | 0.3 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.0 | 0.1 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
0.0 | 0.2 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
0.0 | 0.1 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.0 | 0.4 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.0 | 0.2 | GO:0043696 | dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
0.0 | 0.1 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
0.0 | 0.3 | GO:0072189 | ureter development(GO:0072189) |
0.0 | 0.1 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.0 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.0 | 0.2 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.1 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.3 | GO:0001773 | myeloid dendritic cell activation(GO:0001773) |
0.0 | 0.1 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
0.0 | 0.0 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.0 | 0.0 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
0.0 | 0.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.3 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.0 | 0.4 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.0 | 0.5 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.0 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.1 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.0 | 0.1 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
0.0 | 0.4 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
0.0 | 0.3 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.0 | 0.1 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.2 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.0 | 0.3 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.0 | 0.1 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.0 | 0.1 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.2 | GO:1990000 | amyloid fibril formation(GO:1990000) |
0.0 | 0.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.0 | 0.0 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.0 | 0.1 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
0.0 | 0.0 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.0 | 0.2 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.0 | 0.6 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
0.0 | 0.1 | GO:0044027 | DNA hypermethylation(GO:0044026) hypermethylation of CpG island(GO:0044027) |
0.0 | 0.1 | GO:0009073 | tyrosine biosynthetic process(GO:0006571) aromatic amino acid family biosynthetic process(GO:0009073) aromatic amino acid family biosynthetic process, prephenate pathway(GO:0009095) |
0.0 | 0.1 | GO:0061205 | alveolar primary septum development(GO:0061143) paramesonephric duct development(GO:0061205) |
0.0 | 0.1 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.0 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
0.0 | 0.0 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.0 | 0.1 | GO:0048105 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
0.0 | 0.2 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 0.3 | GO:0001510 | RNA methylation(GO:0001510) |
0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.0 | 0.0 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.0 | 0.0 | GO:0003245 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
0.0 | 0.1 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.3 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.0 | 0.5 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
0.0 | 0.4 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.0 | 0.5 | GO:0030501 | positive regulation of bone mineralization(GO:0030501) |
0.0 | 0.0 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.0 | 0.0 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.0 | 0.2 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
0.0 | 0.2 | GO:0046794 | multi-organism transport(GO:0044766) transport of virus(GO:0046794) multi-organism localization(GO:1902579) |
0.0 | 0.0 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.1 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.0 | 0.1 | GO:0010623 | programmed cell death involved in cell development(GO:0010623) |
0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.1 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
0.0 | 0.2 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.0 | 0.3 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
0.0 | 0.0 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.0 | 0.1 | GO:0060809 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
0.0 | 0.1 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.0 | 0.3 | GO:0034122 | negative regulation of toll-like receptor signaling pathway(GO:0034122) |
0.0 | 0.1 | GO:0016445 | somatic diversification of immunoglobulins(GO:0016445) |
0.0 | 0.1 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
0.0 | 0.1 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 0.5 | GO:0032435 | negative regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032435) |
0.0 | 0.3 | GO:0019236 | response to pheromone(GO:0019236) |
0.0 | 0.3 | GO:0070918 | dsRNA fragmentation(GO:0031050) production of small RNA involved in gene silencing by RNA(GO:0070918) |
0.0 | 0.3 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.2 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.0 | 0.1 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
0.0 | 0.2 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.0 | 0.4 | GO:0031123 | RNA 3'-end processing(GO:0031123) |
0.0 | 0.1 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
0.0 | 0.1 | GO:0098543 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
0.0 | 0.1 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) |
0.0 | 0.1 | GO:0009452 | 7-methylguanosine mRNA capping(GO:0006370) 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
0.0 | 0.1 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.0 | 0.3 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.0 | 0.0 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.0 | 0.0 | GO:0032415 | regulation of sodium:proton antiporter activity(GO:0032415) positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.0 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.0 | 0.0 | GO:0071174 | mitotic spindle checkpoint(GO:0071174) |
0.0 | 0.2 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.1 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
0.0 | 0.1 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.1 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.0 | 0.1 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) |
0.0 | 0.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.0 | 0.1 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.0 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.2 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.0 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.2 | GO:0055012 | ventricular cardiac muscle cell differentiation(GO:0055012) |
0.0 | 0.0 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.0 | 0.1 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
0.0 | 0.3 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.0 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
0.0 | 0.2 | GO:0043486 | histone exchange(GO:0043486) |
0.0 | 0.1 | GO:0006968 | cellular defense response(GO:0006968) |
0.0 | 0.0 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.0 | 0.1 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.0 | 0.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.0 | 0.0 | GO:0051659 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) maintenance of mitochondrion location(GO:0051659) |
0.0 | 0.1 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.0 | 0.0 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.0 | 0.0 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.0 | 0.1 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.2 | GO:0035455 | response to interferon-alpha(GO:0035455) |
0.0 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.0 | 0.2 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.0 | 0.0 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
0.0 | 0.1 | GO:0014005 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.0 | GO:0042977 | regulation of activation of JAK2 kinase activity(GO:0010534) activation of JAK2 kinase activity(GO:0042977) negative regulation of activation of JAK2 kinase activity(GO:1902569) |
0.0 | 0.0 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.0 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
0.0 | 0.8 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.0 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
0.0 | 0.1 | GO:0030261 | chromosome condensation(GO:0030261) |
0.0 | 1.1 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
0.0 | 0.0 | GO:0043323 | positive regulation of natural killer cell degranulation(GO:0043323) |
0.0 | 0.3 | GO:1901224 | positive regulation of NIK/NF-kappaB signaling(GO:1901224) |
0.0 | 0.2 | GO:0006337 | nucleosome disassembly(GO:0006337) |
0.0 | 1.1 | GO:0051028 | mRNA transport(GO:0051028) |
0.0 | 0.2 | GO:0000338 | protein deneddylation(GO:0000338) |
0.0 | 0.2 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
0.0 | 0.1 | GO:0036124 | histone H3-K9 trimethylation(GO:0036124) |
0.0 | 0.0 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.0 | 0.1 | GO:1900120 | regulation of receptor binding(GO:1900120) |
0.0 | 0.0 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
0.0 | 0.1 | GO:0044376 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
0.0 | 0.0 | GO:2000780 | negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
0.0 | 0.3 | GO:0042773 | ATP synthesis coupled electron transport(GO:0042773) |
0.0 | 0.1 | GO:0006531 | aspartate metabolic process(GO:0006531) |
0.0 | 0.5 | GO:0031114 | negative regulation of microtubule depolymerization(GO:0007026) regulation of microtubule depolymerization(GO:0031114) |
0.0 | 0.1 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
0.0 | 0.0 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
0.0 | 0.1 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.2 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.0 | 0.0 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.0 | 0.1 | GO:0036337 | Fas signaling pathway(GO:0036337) |
0.0 | 0.0 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.0 | 0.0 | GO:0099550 | trans-synaptic signalling, modulating synaptic transmission(GO:0099550) |
0.0 | 0.2 | GO:0007007 | inner mitochondrial membrane organization(GO:0007007) |
0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.0 | GO:2000616 | negative regulation of histone H3-K9 acetylation(GO:2000616) |
0.0 | 0.0 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.0 | 0.1 | GO:0021593 | rhombomere morphogenesis(GO:0021593) rhombomere 3 morphogenesis(GO:0021658) |
0.0 | 0.1 | GO:0000097 | sulfur amino acid biosynthetic process(GO:0000097) |
0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.3 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.1 | GO:0009264 | deoxyribonucleotide catabolic process(GO:0009264) |
0.0 | 0.1 | GO:0006477 | protein sulfation(GO:0006477) |
0.0 | 0.2 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.0 | 0.1 | GO:0015671 | oxygen transport(GO:0015671) |
0.0 | 0.1 | GO:0019321 | pentose metabolic process(GO:0019321) |
0.0 | 0.0 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.1 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.0 | 0.1 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.1 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.0 | 0.1 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
0.0 | 0.2 | GO:0010972 | negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
0.0 | 0.1 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.0 | GO:0070488 | neutrophil aggregation(GO:0070488) |
0.0 | 0.0 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.1 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.0 | 0.0 | GO:0014877 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.0 | 0.1 | GO:1903432 | regulation of TORC1 signaling(GO:1903432) |
0.0 | 0.0 | GO:0003360 | brainstem development(GO:0003360) |
0.0 | 0.2 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.0 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.0 | 0.0 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
0.0 | 0.0 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.1 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.0 | 1.7 | GO:0000377 | RNA splicing, via transesterification reactions with bulged adenosine as nucleophile(GO:0000377) mRNA splicing, via spliceosome(GO:0000398) |
0.0 | 0.0 | GO:0016240 | autophagosome docking(GO:0016240) |
0.0 | 0.0 | GO:1904627 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
0.0 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.0 | 0.0 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.0 | GO:0090399 | replicative senescence(GO:0090399) |
0.0 | 0.1 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.0 | 0.6 | GO:0031109 | microtubule polymerization or depolymerization(GO:0031109) |
0.0 | 0.1 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.0 | 0.0 | GO:0051305 | meiotic chromosome movement towards spindle pole(GO:0016344) chromosome movement towards spindle pole(GO:0051305) |
0.0 | 0.0 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
0.0 | 0.0 | GO:0048070 | regulation of developmental pigmentation(GO:0048070) |
0.0 | 0.0 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 0.5 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.0 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.0 | 0.1 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.0 | 0.1 | GO:0038203 | TORC2 signaling(GO:0038203) |
0.0 | 0.1 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.0 | 0.0 | GO:0015810 | C4-dicarboxylate transport(GO:0015740) aspartate transport(GO:0015810) |
0.0 | 0.0 | GO:0019478 | leucine metabolic process(GO:0006551) D-amino acid catabolic process(GO:0019478) |
0.0 | 0.0 | GO:0000052 | citrulline metabolic process(GO:0000052) |
0.0 | 0.1 | GO:0036371 | protein localization to M-band(GO:0036309) protein localization to T-tubule(GO:0036371) |
0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.0 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.0 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.0 | 0.0 | GO:1901563 | response to camptothecin(GO:1901563) |
0.0 | 0.1 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.0 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
0.0 | 0.0 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.0 | 0.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.0 | 0.0 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
0.0 | 0.2 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.0 | 0.0 | GO:0035268 | protein mannosylation(GO:0035268) |
0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 5.2 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
0.5 | 1.9 | GO:0034687 | integrin alphaL-beta2 complex(GO:0034687) |
0.5 | 2.7 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.4 | 3.0 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
0.4 | 5.1 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.4 | 2.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.4 | 1.2 | GO:0000799 | nuclear condensin complex(GO:0000799) |
0.4 | 2.3 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.4 | 1.8 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.3 | 1.0 | GO:0071920 | cleavage body(GO:0071920) |
0.3 | 1.2 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.3 | 0.9 | GO:1990423 | RZZ complex(GO:1990423) |
0.2 | 1.7 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.2 | 0.7 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
0.2 | 1.3 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.2 | 0.8 | GO:1990421 | subtelomeric heterochromatin(GO:1990421) nuclear subtelomeric heterochromatin(GO:1990707) |
0.2 | 0.2 | GO:0000811 | GINS complex(GO:0000811) |
0.2 | 0.5 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
0.2 | 1.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.2 | 0.5 | GO:0043512 | inhibin A complex(GO:0043512) |
0.2 | 1.9 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.2 | 1.2 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.2 | 1.7 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.2 | 0.5 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.2 | 0.8 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.2 | 2.0 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.2 | 0.8 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.2 | 0.5 | GO:0098842 | postsynaptic early endosome(GO:0098842) |
0.2 | 0.5 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.2 | 2.3 | GO:0042555 | MCM complex(GO:0042555) |
0.2 | 1.4 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.2 | 0.9 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.2 | 0.8 | GO:0001652 | granular component(GO:0001652) |
0.2 | 0.9 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.2 | 1.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.2 | 1.1 | GO:0000796 | condensin complex(GO:0000796) |
0.2 | 0.5 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
0.2 | 0.5 | GO:0043540 | 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase complex(GO:0043540) |
0.1 | 2.6 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.1 | 1.0 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 0.9 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 1.5 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 2.2 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 0.5 | GO:0008623 | CHRAC(GO:0008623) |
0.1 | 1.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 1.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 0.4 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
0.1 | 0.5 | GO:0099569 | presynaptic cytoskeleton(GO:0099569) |
0.1 | 0.4 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 0.5 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.1 | 1.5 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.1 | 8.2 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.1 | 1.0 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
0.1 | 4.0 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.1 | 0.2 | GO:0044317 | rod spherule(GO:0044317) |
0.1 | 0.9 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 0.5 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 0.9 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 0.8 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
0.1 | 2.4 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 2.8 | GO:0001891 | phagocytic cup(GO:0001891) |
0.1 | 0.5 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 0.3 | GO:0097233 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
0.1 | 0.3 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.1 | 0.9 | GO:0042629 | mast cell granule(GO:0042629) |
0.1 | 0.3 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.1 | 0.4 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.3 | GO:1990047 | spindle matrix(GO:1990047) |
0.1 | 0.4 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
0.1 | 0.6 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
0.1 | 0.9 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 0.3 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.1 | 0.9 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.1 | 2.9 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 0.3 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
0.1 | 1.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 0.7 | GO:0000243 | commitment complex(GO:0000243) |
0.1 | 0.5 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 1.3 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 0.2 | GO:0030681 | ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.1 | 3.7 | GO:0015935 | small ribosomal subunit(GO:0015935) cytosolic small ribosomal subunit(GO:0022627) |
0.1 | 1.2 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.1 | 4.4 | GO:0044391 | ribosomal subunit(GO:0044391) |
0.1 | 0.3 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.7 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 0.7 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.1 | 1.3 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 0.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.1 | 0.8 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.1 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.6 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 0.4 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 0.4 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.1 | 0.7 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.1 | 0.6 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.1 | 0.4 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 1.0 | GO:0070938 | contractile ring(GO:0070938) |
0.1 | 1.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 0.7 | GO:0071439 | clathrin complex(GO:0071439) |
0.1 | 0.6 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 0.2 | GO:0098833 | presynaptic endocytic zone(GO:0098833) presynaptic endocytic zone membrane(GO:0098835) |
0.1 | 0.4 | GO:0031673 | H zone(GO:0031673) |
0.1 | 0.5 | GO:0008278 | cohesin complex(GO:0008278) |
0.1 | 0.2 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.1 | 1.0 | GO:0051233 | spindle midzone(GO:0051233) |
0.1 | 0.3 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.1 | 0.8 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.1 | 0.5 | GO:0042382 | paraspeckles(GO:0042382) |
0.1 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 2.4 | GO:0035861 | site of double-strand break(GO:0035861) |
0.1 | 0.2 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
0.1 | 0.2 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.1 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.1 | 0.2 | GO:1990923 | PET complex(GO:1990923) |
0.1 | 0.2 | GO:0018444 | translation release factor complex(GO:0018444) |
0.1 | 0.3 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 2.1 | GO:0005657 | replication fork(GO:0005657) |
0.1 | 0.1 | GO:0044305 | calyx of Held(GO:0044305) |
0.1 | 0.3 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.6 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 1.0 | GO:0032040 | small-subunit processome(GO:0032040) |
0.1 | 0.4 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.1 | 0.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 2.4 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.1 | 1.1 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
0.1 | 0.4 | GO:0000801 | central element(GO:0000801) |
0.1 | 4.1 | GO:0000776 | kinetochore(GO:0000776) |
0.1 | 0.2 | GO:0036019 | endolysosome(GO:0036019) |
0.1 | 0.6 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.3 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 1.0 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
0.0 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.9 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.5 | GO:0097433 | dense body(GO:0097433) |
0.0 | 0.2 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.0 | 0.3 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
0.0 | 0.3 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 1.7 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.7 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.3 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.0 | 0.2 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
0.0 | 0.3 | GO:0008091 | spectrin(GO:0008091) |
0.0 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.0 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.0 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.0 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 3.6 | GO:0000793 | condensed chromosome(GO:0000793) |
0.0 | 0.4 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.7 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.3 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 0.2 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.0 | 0.6 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.8 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.7 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.2 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.0 | 0.3 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 0.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 2.8 | GO:0031970 | organelle envelope lumen(GO:0031970) |
0.0 | 0.9 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
0.0 | 0.1 | GO:0070442 | integrin alphaIIb-beta3 complex(GO:0070442) |
0.0 | 0.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.1 | GO:0097450 | astrocyte end-foot(GO:0097450) |
0.0 | 1.4 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 1.8 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.3 | GO:0097449 | astrocyte projection(GO:0097449) |
0.0 | 0.2 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.5 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 1.5 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.3 | GO:0045275 | respiratory chain complex III(GO:0045275) |
0.0 | 0.3 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 1.3 | GO:0030684 | preribosome(GO:0030684) |
0.0 | 0.9 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 0.1 | GO:1902636 | kinociliary basal body(GO:1902636) |
0.0 | 0.5 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.3 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.0 | 0.5 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.0 | 0.1 | GO:1990415 | Pex17p-Pex14p docking complex(GO:1990415) peroxisomal importomer complex(GO:1990429) |
0.0 | 0.1 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 0.9 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 1.2 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.1 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.0 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.1 | GO:0031251 | PAN complex(GO:0031251) |
0.0 | 0.3 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.1 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
0.0 | 0.2 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.4 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 1.3 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.0 | 0.2 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 0.4 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.2 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.3 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.0 | 1.3 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.3 | GO:1990635 | proximal dendrite(GO:1990635) |
0.0 | 0.5 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.1 | GO:0044307 | dendritic branch(GO:0044307) |
0.0 | 0.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.2 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.0 | 0.2 | GO:0071010 | prespliceosome(GO:0071010) |
0.0 | 0.2 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 1.5 | GO:0005643 | nuclear pore(GO:0005643) |
0.0 | 0.3 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.4 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.1 | GO:0060187 | cell pole(GO:0060187) |
0.0 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
0.0 | 0.3 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.3 | GO:0005652 | nuclear lamina(GO:0005652) |
0.0 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 0.1 | GO:0097526 | spliceosomal tri-snRNP complex(GO:0097526) |
0.0 | 0.8 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 0.6 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 3.2 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.1 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 1.9 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.2 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.0 | GO:0034657 | GID complex(GO:0034657) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.2 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.0 | 0.1 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.0 | 0.7 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.2 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 1.8 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.6 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.8 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.1 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
0.0 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.1 | GO:0060091 | kinocilium(GO:0060091) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.0 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.2 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.1 | GO:0098831 | presynaptic active zone cytoplasmic component(GO:0098831) |
0.0 | 0.7 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.5 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.1 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.1 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
0.0 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.0 | 0.3 | GO:0042627 | chylomicron(GO:0042627) |
0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
0.0 | 0.1 | GO:0022624 | proteasome accessory complex(GO:0022624) |
0.0 | 0.3 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.2 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.1 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
0.0 | 0.0 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.0 | 0.0 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.5 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 0.0 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.0 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
0.0 | 0.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.0 | GO:0071942 | XPC complex(GO:0071942) |
0.0 | 0.6 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 1.0 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.0 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
0.0 | 0.1 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.0 | GO:0014802 | terminal cisterna(GO:0014802) |
0.0 | 0.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.5 | GO:0043034 | costamere(GO:0043034) |
0.0 | 5.2 | GO:0005813 | centrosome(GO:0005813) |
0.0 | 0.0 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.0 | 0.9 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.2 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.0 | 1.0 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 0.1 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.0 | 0.0 | GO:0005685 | U1 snRNP(GO:0005685) |
0.0 | 0.2 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.0 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.2 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
0.0 | 0.0 | GO:0035841 | new growing cell tip(GO:0035841) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.2 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) |
0.5 | 2.9 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.5 | 1.9 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
0.4 | 1.6 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.4 | 1.1 | GO:0001147 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
0.3 | 1.0 | GO:0033680 | ATP-dependent DNA/RNA helicase activity(GO:0033680) |
0.3 | 2.9 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.3 | 0.9 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
0.3 | 1.3 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.3 | 0.9 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.3 | 1.5 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.3 | 5.3 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.3 | 1.4 | GO:0043515 | kinetochore binding(GO:0043515) |
0.3 | 1.2 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
0.3 | 0.8 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.3 | 0.8 | GO:1902271 | D3 vitamins binding(GO:1902271) |
0.3 | 1.0 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
0.3 | 2.3 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
0.2 | 1.0 | GO:0005124 | scavenger receptor binding(GO:0005124) |
0.2 | 1.2 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
0.2 | 0.7 | GO:0019863 | IgE binding(GO:0019863) |
0.2 | 0.7 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
0.2 | 0.9 | GO:0005499 | vitamin D binding(GO:0005499) |
0.2 | 0.7 | GO:0008520 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
0.2 | 0.7 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.2 | 0.7 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.2 | 0.8 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.2 | 1.2 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.2 | 1.4 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.2 | 0.4 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.2 | 1.3 | GO:0015616 | DNA translocase activity(GO:0015616) |
0.2 | 1.5 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
0.2 | 1.9 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.2 | 0.5 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.2 | 1.3 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.2 | 1.5 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.2 | 0.5 | GO:0035717 | chemokine (C-C motif) ligand 7 binding(GO:0035717) |
0.2 | 0.2 | GO:0004854 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.2 | 1.6 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.2 | 0.7 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
0.2 | 2.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.2 | 1.2 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.2 | 0.5 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
0.2 | 2.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.2 | 0.5 | GO:0050429 | calcium-dependent phospholipase C activity(GO:0050429) |
0.2 | 1.0 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
0.2 | 0.5 | GO:0005151 | interleukin-1, Type II receptor binding(GO:0005151) interleukin-1 receptor antagonist activity(GO:0005152) interleukin-1 Type I receptor antagonist activity(GO:0045352) interleukin-1 Type II receptor antagonist activity(GO:0045353) |
0.2 | 1.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.2 | 0.5 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.2 | 0.6 | GO:0001087 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
0.2 | 0.9 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
0.2 | 1.2 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.2 | 1.2 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.1 | 0.4 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.1 | 0.6 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 0.9 | GO:0001179 | RNA polymerase I transcription factor binding(GO:0001179) |
0.1 | 1.1 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.1 | 0.4 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
0.1 | 0.9 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.1 | 0.5 | GO:0016623 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
0.1 | 0.3 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.1 | 0.7 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 0.4 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.8 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.1 | 1.0 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
0.1 | 1.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 0.5 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.1 | 0.5 | GO:0004308 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 0.6 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.5 | GO:0000010 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
0.1 | 0.6 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.5 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.1 | 0.3 | GO:0000401 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
0.1 | 1.3 | GO:0051378 | serotonin binding(GO:0051378) |
0.1 | 0.9 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
0.1 | 0.4 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.1 | 0.9 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.1 | 0.3 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.1 | 0.5 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.1 | 0.6 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.1 | 1.7 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 0.4 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
0.1 | 0.4 | GO:0008802 | betaine-aldehyde dehydrogenase activity(GO:0008802) |
0.1 | 0.6 | GO:0005534 | galactose binding(GO:0005534) |
0.1 | 1.0 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
0.1 | 0.1 | GO:1903136 | cuprous ion binding(GO:1903136) |
0.1 | 0.3 | GO:0003692 | left-handed Z-DNA binding(GO:0003692) |
0.1 | 1.0 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.2 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.1 | 0.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.3 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
0.1 | 0.9 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.4 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
0.1 | 0.6 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
0.1 | 0.3 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.3 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
0.1 | 0.4 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.1 | 0.4 | GO:0031014 | troponin T binding(GO:0031014) |
0.1 | 0.6 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.1 | 0.6 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
0.1 | 0.9 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.1 | 0.3 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.1 | 0.3 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
0.1 | 0.1 | GO:0003681 | bent DNA binding(GO:0003681) |
0.1 | 0.6 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.1 | 0.4 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
0.1 | 2.4 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
0.1 | 0.7 | GO:0043559 | insulin binding(GO:0043559) |
0.1 | 0.5 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.1 | 0.3 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.1 | 0.5 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
0.1 | 0.3 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) |
0.1 | 13.8 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 0.3 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.1 | 2.0 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.1 | 0.3 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.1 | 0.2 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 0.5 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
0.1 | 0.7 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.1 | 0.3 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 1.9 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.1 | 0.3 | GO:0086038 | calcium:sodium antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086038) |
0.1 | 0.2 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.1 | 0.7 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 0.8 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.1 | 0.5 | GO:0099583 | neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
0.1 | 0.2 | GO:0055105 | ubiquitin-protein transferase inhibitor activity(GO:0055105) |
0.1 | 0.4 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
0.1 | 2.0 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.1 | 0.2 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.1 | 0.5 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 0.2 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.1 | 0.3 | GO:0004510 | tryptophan 5-monooxygenase activity(GO:0004510) |
0.1 | 0.5 | GO:0008518 | reduced folate carrier activity(GO:0008518) |
0.1 | 0.2 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.1 | 0.3 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
0.1 | 0.7 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.1 | 0.1 | GO:0004087 | carbamoyl-phosphate synthase (ammonia) activity(GO:0004087) carbamoyl-phosphate synthase (glutamine-hydrolyzing) activity(GO:0004088) |
0.1 | 0.7 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.1 | 0.4 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.1 | 0.3 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.5 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 0.2 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
0.1 | 0.2 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
0.1 | 1.8 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.1 | 0.2 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.1 | 0.1 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.1 | 0.2 | GO:0052870 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) |
0.1 | 0.2 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.1 | 1.7 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 0.4 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
0.1 | 0.2 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
0.1 | 0.3 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
0.1 | 0.4 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.1 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
0.1 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 0.4 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.1 | 2.1 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.1 | 0.2 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
0.1 | 0.3 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
0.1 | 0.2 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
0.1 | 1.1 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 1.6 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.1 | 0.4 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 0.9 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.2 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
0.1 | 0.2 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
0.1 | 0.2 | GO:0001729 | ceramide kinase activity(GO:0001729) |
0.1 | 0.2 | GO:0045159 | myosin II binding(GO:0045159) |
0.1 | 0.3 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.1 | 0.5 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.1 | 0.2 | GO:0019150 | D-ribulokinase activity(GO:0019150) |
0.1 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.2 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
0.1 | 1.2 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.1 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.1 | 0.3 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.1 | 0.3 | GO:0004488 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.1 | 1.1 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 1.4 | GO:0031402 | sodium ion binding(GO:0031402) |
0.1 | 0.2 | GO:0047598 | sterol delta7 reductase activity(GO:0009918) 7-dehydrocholesterol reductase activity(GO:0047598) |
0.1 | 0.5 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.1 | 0.4 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.1 | 0.3 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.1 | 0.2 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
0.1 | 1.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 1.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.1 | 0.2 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.1 | 0.2 | GO:0097677 | STAT family protein binding(GO:0097677) |
0.1 | 0.5 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.1 | 0.2 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
0.1 | 0.3 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
0.1 | 0.2 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
0.1 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 0.5 | GO:0034711 | inhibin binding(GO:0034711) |
0.1 | 0.2 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
0.1 | 0.7 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.1 | 0.2 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 0.6 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 0.2 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
0.1 | 0.6 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.4 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.1 | 0.5 | GO:0003678 | DNA helicase activity(GO:0003678) |
0.1 | 0.1 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.1 | 0.1 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.1 | 0.3 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 3.2 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.1 | 0.4 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.1 | 0.2 | GO:0035827 | rubidium ion transmembrane transporter activity(GO:0035827) |
0.1 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.1 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.1 | 0.2 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.1 | 0.3 | GO:0043532 | angiostatin binding(GO:0043532) |
0.1 | 0.2 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.1 | 0.2 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.1 | 0.5 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.1 | 1.5 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
0.1 | 0.7 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.1 | 0.3 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.1 | 3.7 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.1 | 0.5 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.2 | GO:0004686 | elongation factor-2 kinase activity(GO:0004686) |
0.1 | 0.2 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
0.1 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.1 | 0.3 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.1 | GO:0051429 | corticotropin-releasing hormone receptor binding(GO:0051429) |
0.1 | 0.6 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.1 | 0.5 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.1 | 0.2 | GO:0003979 | UDP-glucose 6-dehydrogenase activity(GO:0003979) |
0.1 | 0.2 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 0.4 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.3 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.1 | 0.7 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.4 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.0 | 0.2 | GO:0008761 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) |
0.0 | 0.7 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 1.1 | GO:0005402 | sugar:proton symporter activity(GO:0005351) cation:sugar symporter activity(GO:0005402) |
0.0 | 0.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.0 | 0.2 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.0 | 0.2 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.0 | 0.4 | GO:0031811 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
0.0 | 0.2 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 1.0 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.0 | 0.7 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
0.0 | 0.3 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
0.0 | 0.3 | GO:0046625 | sphingolipid binding(GO:0046625) |
0.0 | 0.2 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 0.3 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.0 | 0.2 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
0.0 | 0.2 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 1.1 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.7 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.8 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.3 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.2 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.0 | 1.2 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.2 | GO:0048185 | activin binding(GO:0048185) |
0.0 | 0.2 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.0 | 0.3 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.6 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.0 | 0.0 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.0 | 0.3 | GO:0016503 | pheromone receptor activity(GO:0016503) |
0.0 | 0.9 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 0.1 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.1 | GO:0032551 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.0 | 0.5 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.2 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.0 | 0.1 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) L-tyrosine transmembrane transporter activity(GO:0005302) |
0.0 | 0.4 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.2 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
0.0 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.6 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.6 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
0.0 | 0.1 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.0 | 0.2 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.0 | 0.2 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.2 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.7 | GO:0051861 | glycolipid binding(GO:0051861) |
0.0 | 0.1 | GO:0001846 | opsonin binding(GO:0001846) |
0.0 | 1.3 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.2 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 0.3 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.0 | 0.3 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.5 | GO:0050693 | LBD domain binding(GO:0050693) |
0.0 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.7 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.0 | 1.8 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.2 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.2 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.0 | 0.1 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
0.0 | 0.2 | GO:0050544 | icosanoid binding(GO:0050542) arachidonic acid binding(GO:0050544) fatty acid derivative binding(GO:1901567) |
0.0 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.2 | GO:0052655 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
0.0 | 0.1 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.0 | 0.3 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.1 | GO:0005008 | hepatocyte growth factor-activated receptor activity(GO:0005008) |
0.0 | 0.1 | GO:0005333 | norepinephrine transmembrane transporter activity(GO:0005333) |
0.0 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.1 | GO:0015526 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.0 | 0.2 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.0 | 0.1 | GO:0051381 | histamine binding(GO:0051381) |
0.0 | 0.1 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
0.0 | 0.9 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.1 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.1 | GO:1902379 | chemoattractant activity involved in axon guidance(GO:1902379) |
0.0 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
0.0 | 0.0 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
0.0 | 1.1 | GO:0042287 | MHC protein binding(GO:0042287) |
0.0 | 0.4 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
0.0 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.2 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
0.0 | 0.2 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.3 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.0 | 0.2 | GO:0004875 | complement receptor activity(GO:0004875) |
0.0 | 0.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.7 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.0 | 0.3 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
0.0 | 0.1 | GO:0047256 | beta-galactosyl-N-acetylglucosaminylgalactosylglucosyl-ceramide beta-1,3-acetylglucosaminyltransferase activity(GO:0008457) lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase activity(GO:0047256) |
0.0 | 0.0 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
0.0 | 0.1 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
0.0 | 0.1 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.0 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.5 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.1 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.2 | GO:0016405 | CoA-ligase activity(GO:0016405) |
0.0 | 0.3 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.1 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
0.0 | 0.2 | GO:0038051 | glucocorticoid receptor activity(GO:0004883) transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
0.0 | 1.0 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.1 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
0.0 | 0.4 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.4 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 3.2 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 0.3 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.0 | 0.4 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.8 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.0 | 0.3 | GO:0005549 | odorant binding(GO:0005549) |
0.0 | 0.1 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
0.0 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.2 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.7 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 0.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.5 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.0 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.3 | GO:0052813 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
0.0 | 1.7 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.1 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.3 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.1 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
0.0 | 0.3 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.0 | 0.1 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
0.0 | 0.6 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.1 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
0.0 | 0.1 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.1 | GO:0070990 | snRNP binding(GO:0070990) |
0.0 | 0.1 | GO:0008940 | nitrate reductase activity(GO:0008940) |
0.0 | 0.1 | GO:1990955 | G-rich single-stranded DNA binding(GO:1990955) |
0.0 | 0.5 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.1 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
0.0 | 0.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.1 | GO:0000295 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
0.0 | 0.4 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.0 | 0.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.0 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.2 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.2 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.3 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.3 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.1 | GO:0001093 | TFIIB-class transcription factor binding(GO:0001093) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.1 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
0.0 | 0.8 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.0 | GO:0070052 | collagen V binding(GO:0070052) |
0.0 | 0.1 | GO:0070287 | ferritin receptor activity(GO:0070287) |
0.0 | 0.1 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.3 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.6 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
0.0 | 0.1 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.0 | 0.1 | GO:0004482 | mRNA (guanine-N7-)-methyltransferase activity(GO:0004482) |
0.0 | 0.3 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.0 | 0.2 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.2 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
0.0 | 1.2 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 0.3 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.2 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.3 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.9 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.1 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.3 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.0 | 0.0 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.1 | GO:0018738 | S-formylglutathione hydrolase activity(GO:0018738) |
0.0 | 0.1 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.0 | 0.2 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 1.3 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 1.5 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.0 | 0.0 | GO:0015172 | acidic amino acid transmembrane transporter activity(GO:0015172) |
0.0 | 0.7 | GO:0004527 | exonuclease activity(GO:0004527) |
0.0 | 1.0 | GO:1990782 | protein tyrosine kinase binding(GO:1990782) |
0.0 | 2.4 | GO:0004721 | phosphoprotein phosphatase activity(GO:0004721) |
0.0 | 1.2 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.2 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 2.3 | GO:0004386 | helicase activity(GO:0004386) |
0.0 | 0.1 | GO:0015091 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
0.0 | 0.3 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.0 | 0.1 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
0.0 | 0.1 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.0 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.2 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.2 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.0 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.0 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.4 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.0 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.0 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.0 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) |
0.0 | 0.1 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 0.1 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.1 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.1 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.0 | 0.2 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
0.0 | 0.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 0.1 | GO:0036468 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
0.0 | 0.8 | GO:0009055 | electron carrier activity(GO:0009055) |
0.0 | 0.4 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.0 | 0.6 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
0.0 | 0.1 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.1 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.1 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.0 | 0.1 | GO:0035173 | histone kinase activity(GO:0035173) |
0.0 | 0.3 | GO:0008374 | O-acyltransferase activity(GO:0008374) |
0.0 | 3.3 | GO:0008017 | microtubule binding(GO:0008017) |
0.0 | 0.1 | GO:0042328 | heparan sulfate N-acetylglucosaminyltransferase activity(GO:0042328) |
0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.1 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
0.0 | 0.2 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.1 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.4 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.1 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
0.0 | 0.0 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.1 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.0 | 0.3 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.0 | 0.0 | GO:0004043 | L-aminoadipate-semialdehyde dehydrogenase activity(GO:0004043) |
0.0 | 0.2 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.7 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
0.0 | 0.0 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.1 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.0 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
0.0 | 0.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 0.1 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.0 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.0 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.1 | GO:0047275 | glucosaminylgalactosylglucosylceramide beta-galactosyltransferase activity(GO:0047275) |
0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.0 | 0.2 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.0 | 2.1 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.4 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.1 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
0.0 | 0.2 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 0.0 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
0.0 | 0.5 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.3 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.1 | GO:0016893 | endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016893) |
0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.1 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.0 | 0.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.2 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.0 | 0.1 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.0 | 0.0 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.1 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.3 | GO:0008009 | chemokine activity(GO:0008009) |
0.0 | 0.0 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) CoA-transferase activity(GO:0008410) |
0.0 | 0.1 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 0.1 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.0 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.0 | 0.1 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.0 | 0.4 | GO:0030506 | ankyrin binding(GO:0030506) |
0.0 | 0.0 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.0 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 1.2 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.0 | GO:0001156 | TFIIIC-class transcription factor binding(GO:0001156) |
0.0 | 0.3 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.0 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 0.9 | GO:0017048 | Rho GTPase binding(GO:0017048) |
0.0 | 0.1 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.0 | 0.0 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.1 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.0 | 0.2 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.0 | 0.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.2 | 11.6 | PID PLK1 PATHWAY | PLK1 signaling events |
0.2 | 7.3 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 1.9 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.1 | 0.8 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 4.9 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 3.5 | PID AURORA A PATHWAY | Aurora A signaling |
0.1 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.1 | 3.2 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 3.3 | PID ATR PATHWAY | ATR signaling pathway |
0.1 | 2.8 | PID BARD1 PATHWAY | BARD1 signaling events |
0.1 | 1.9 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.1 | 2.8 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.1 | 0.1 | PID SHP2 PATHWAY | SHP2 signaling |
0.1 | 0.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 0.5 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.1 | 3.7 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.1 | 2.6 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.1 | 0.5 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 3.4 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.9 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 4.6 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.5 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 1.4 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.2 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.9 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 2.6 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.0 | 1.6 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 0.1 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.7 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.5 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.0 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.8 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.5 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.9 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 1.0 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 1.7 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 1.5 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.7 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 0.8 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.1 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.0 | 1.8 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.7 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.5 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.5 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 1.4 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.0 | 0.1 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.0 | 0.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.4 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.4 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 0.2 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.4 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.7 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.4 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.2 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.2 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.4 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.3 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.3 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.1 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.3 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.3 | 1.3 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.2 | 8.7 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.2 | 0.6 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.2 | 1.4 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.2 | 1.6 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.2 | 2.9 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.2 | 19.8 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.2 | 0.4 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.1 | 0.4 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.1 | 0.7 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 1.6 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.1 | 12.8 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 0.7 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.1 | 2.7 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.1 | 0.3 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.1 | 5.3 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.1 | 4.2 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.1 | 1.1 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.1 | 1.0 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 1.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 1.9 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.1 | 2.1 | REACTOME KINESINS | Genes involved in Kinesins |
0.1 | 2.1 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.1 | 0.5 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.1 | 2.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.1 | 2.1 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 2.1 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.1 | 2.0 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
0.1 | 1.8 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 0.5 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.1 | 0.3 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.1 | 1.0 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 0.1 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.1 | 1.1 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.1 | 0.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 1.4 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.1 | 1.0 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
0.1 | 0.1 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.1 | 0.6 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.1 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 0.5 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.1 | 0.7 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.1 | 0.5 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.1 | 2.8 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.1 | 0.1 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
0.1 | 0.5 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.1 | 1.4 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 1.4 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.0 | 0.9 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 1.2 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.0 | 0.9 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.0 | 0.4 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.4 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 0.6 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.1 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.4 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.9 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 1.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.7 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.5 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.0 | 0.5 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 2.2 | REACTOME ORC1 REMOVAL FROM CHROMATIN | Genes involved in Orc1 removal from chromatin |
0.0 | 0.4 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 3.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.0 | 0.3 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.3 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.4 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.2 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.0 | 0.4 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.8 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.0 | 0.0 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 0.4 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.7 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.4 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 1.4 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.7 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.1 | REACTOME G2 M CHECKPOINTS | Genes involved in G2/M Checkpoints |
0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.2 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.0 | 0.5 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.5 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 1.6 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 1.6 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 0.2 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.3 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.4 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 0.1 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.6 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.8 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.3 | REACTOME BASE EXCISION REPAIR | Genes involved in Base Excision Repair |
0.0 | 0.2 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 0.9 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 0.9 | REACTOME TCA CYCLE AND RESPIRATORY ELECTRON TRANSPORT | Genes involved in The citric acid (TCA) cycle and respiratory electron transport |
0.0 | 0.1 | REACTOME SIGNALING BY THE B CELL RECEPTOR BCR | Genes involved in Signaling by the B Cell Receptor (BCR) |
0.0 | 1.7 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.1 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.0 | 1.7 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 1.5 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.6 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.0 | 0.1 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.2 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 1.6 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 0.7 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.0 | 0.2 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.0 | 1.4 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.0 | REACTOME CELL CYCLE CHECKPOINTS | Genes involved in Cell Cycle Checkpoints |
0.0 | 0.2 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
0.0 | 0.3 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.1 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.3 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 0.6 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.1 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.0 | 0.1 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
0.0 | 0.5 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.3 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.1 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.9 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.0 | 0.0 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 0.2 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.2 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 0.1 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.1 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.2 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.0 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.0 | 0.3 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.4 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |