2D miR_HR1_12
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Hic2
|
ENSMUSG00000050240.8 | hypermethylated in cancer 2 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Hic2 | mm10_v2_chr16_+_17233560_17233664 | -0.40 | 2.0e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr13_-_71963713 | 3.86 |
ENSMUST00000077337.8
|
Irx1
|
Iroquois related homeobox 1 (Drosophila) |
chr2_+_70563435 | 3.12 |
ENSMUST00000123330.1
|
Gad1
|
glutamate decarboxylase 1 |
chrX_+_93286499 | 2.86 |
ENSMUST00000046565.7
ENSMUST00000113947.2 |
Arx
|
aristaless related homeobox |
chr7_-_100964371 | 2.80 |
ENSMUST00000060174.4
|
P2ry6
|
pyrimidinergic receptor P2Y, G-protein coupled, 6 |
chr4_+_115088708 | 2.68 |
ENSMUST00000171877.1
ENSMUST00000177647.1 ENSMUST00000106548.2 ENSMUST00000030488.2 |
Pdzk1ip1
|
PDZK1 interacting protein 1 |
chr1_+_74854954 | 2.67 |
ENSMUST00000160379.2
|
Cdk5r2
|
cyclin-dependent kinase 5, regulatory subunit 2 (p39) |
chr2_+_119351222 | 2.43 |
ENSMUST00000028780.3
|
Chac1
|
ChaC, cation transport regulator 1 |
chr11_+_43528759 | 2.35 |
ENSMUST00000050574.6
|
Ccnjl
|
cyclin J-like |
chr3_+_89229046 | 2.29 |
ENSMUST00000041142.3
|
Muc1
|
mucin 1, transmembrane |
chr16_-_17838173 | 2.23 |
ENSMUST00000118960.1
|
Car15
|
carbonic anhydrase 15 |
chr13_-_99900645 | 2.21 |
ENSMUST00000022150.6
|
Cartpt
|
CART prepropeptide |
chr1_-_134234492 | 2.19 |
ENSMUST00000169927.1
|
Adora1
|
adenosine A1 receptor |
chr2_-_172043466 | 2.14 |
ENSMUST00000087950.3
|
Cbln4
|
cerebellin 4 precursor protein |
chr15_+_99224976 | 2.07 |
ENSMUST00000041415.3
|
Kcnh3
|
potassium voltage-gated channel, subfamily H (eag-related), member 3 |
chr4_+_137277489 | 2.07 |
ENSMUST00000045747.4
|
Wnt4
|
wingless-related MMTV integration site 4 |
chr2_+_70562854 | 2.03 |
ENSMUST00000130998.1
|
Gad1
|
glutamate decarboxylase 1 |
chr11_-_120648104 | 2.02 |
ENSMUST00000026134.2
|
Myadml2
|
myeloid-associated differentiation marker-like 2 |
chr11_+_115154139 | 1.95 |
ENSMUST00000021076.5
|
Rab37
|
RAB37, member of RAS oncogene family |
chr19_-_5488271 | 1.94 |
ENSMUST00000124334.1
|
Mus81
|
MUS81 endonuclease homolog (yeast) |
chr7_+_122219469 | 1.74 |
ENSMUST00000033152.4
|
Chp2
|
calcineurin-like EF hand protein 2 |
chr12_+_109549157 | 1.70 |
ENSMUST00000128458.1
ENSMUST00000150851.1 |
Meg3
|
maternally expressed 3 |
chr5_+_30588078 | 1.70 |
ENSMUST00000066295.2
|
Kcnk3
|
potassium channel, subfamily K, member 3 |
chr11_+_78324200 | 1.66 |
ENSMUST00000102478.3
|
Aldoc
|
aldolase C, fructose-bisphosphate |
chr7_-_45092198 | 1.66 |
ENSMUST00000140449.1
ENSMUST00000117546.1 ENSMUST00000019683.3 |
Rcn3
|
reticulocalbin 3, EF-hand calcium binding domain |
chr9_-_22002599 | 1.64 |
ENSMUST00000115336.2
ENSMUST00000044926.5 |
Ccdc151
|
coiled-coil domain containing 151 |
chr19_+_5474681 | 1.64 |
ENSMUST00000165485.1
ENSMUST00000166253.1 ENSMUST00000167371.1 ENSMUST00000167855.1 ENSMUST00000070118.7 |
Efemp2
|
epidermal growth factor-containing fibulin-like extracellular matrix protein 2 |
chr5_+_81021583 | 1.64 |
ENSMUST00000121707.1
|
Lphn3
|
latrophilin 3 |
chr10_-_75797528 | 1.61 |
ENSMUST00000120177.1
|
Gstt1
|
glutathione S-transferase, theta 1 |
chr11_+_115887601 | 1.60 |
ENSMUST00000167507.2
|
Myo15b
|
myosin XVB |
chr11_-_109722214 | 1.59 |
ENSMUST00000020938.7
|
Fam20a
|
family with sequence similarity 20, member A |
chr1_-_134235420 | 1.56 |
ENSMUST00000038191.6
ENSMUST00000086465.4 |
Adora1
|
adenosine A1 receptor |
chr12_-_84698769 | 1.52 |
ENSMUST00000095550.2
|
Syndig1l
|
synapse differentiation inducing 1 like |
chr1_-_135167606 | 1.51 |
ENSMUST00000027682.8
|
Gpr37l1
|
G protein-coupled receptor 37-like 1 |
chr12_-_79007276 | 1.50 |
ENSMUST00000056660.6
ENSMUST00000174721.1 |
Tmem229b
|
transmembrane protein 229B |
chr19_-_42752710 | 1.48 |
ENSMUST00000076505.3
|
Pyroxd2
|
pyridine nucleotide-disulphide oxidoreductase domain 2 |
chr7_+_28540863 | 1.48 |
ENSMUST00000119180.2
|
Sycn
|
syncollin |
chr1_+_93006328 | 1.46 |
ENSMUST00000059676.4
|
Aqp12
|
aquaporin 12 |
chr6_-_78378851 | 1.43 |
ENSMUST00000089667.1
ENSMUST00000167492.1 |
Reg3d
|
regenerating islet-derived 3 delta |
chr7_-_101864093 | 1.41 |
ENSMUST00000106981.1
|
Folr1
|
folate receptor 1 (adult) |
chr11_-_43426192 | 1.41 |
ENSMUST00000101340.4
ENSMUST00000118368.1 ENSMUST00000020685.9 ENSMUST00000020687.8 |
Pttg1
|
pituitary tumor-transforming gene 1 |
chr7_+_113207465 | 1.40 |
ENSMUST00000047321.7
|
Arntl
|
aryl hydrocarbon receptor nuclear translocator-like |
chr7_-_45091713 | 1.40 |
ENSMUST00000141576.1
|
Rcn3
|
reticulocalbin 3, EF-hand calcium binding domain |
chr15_+_99591028 | 1.40 |
ENSMUST00000169082.1
|
Aqp5
|
aquaporin 5 |
chr11_-_89302545 | 1.39 |
ENSMUST00000061728.3
|
Nog
|
noggin |
chr17_-_26508463 | 1.39 |
ENSMUST00000025025.6
|
Dusp1
|
dual specificity phosphatase 1 |
chr2_-_30903255 | 1.38 |
ENSMUST00000102852.3
|
Ptges
|
prostaglandin E synthase |
chr17_-_31144271 | 1.37 |
ENSMUST00000024826.7
|
Tff2
|
trefoil factor 2 (spasmolytic protein 1) |
chr9_+_114978507 | 1.37 |
ENSMUST00000183104.1
|
Osbpl10
|
oxysterol binding protein-like 10 |
chr13_-_62888282 | 1.37 |
ENSMUST00000092888.4
|
Fbp1
|
fructose bisphosphatase 1 |
chr2_+_34874396 | 1.34 |
ENSMUST00000113068.2
ENSMUST00000047447.8 |
Cutal
|
cutA divalent cation tolerance homolog-like |
chr7_+_25306085 | 1.33 |
ENSMUST00000119703.1
ENSMUST00000108409.1 |
Tmem145
|
transmembrane protein 145 |
chr12_-_119238794 | 1.32 |
ENSMUST00000026360.8
|
Itgb8
|
integrin beta 8 |
chr4_-_134704235 | 1.32 |
ENSMUST00000054096.6
ENSMUST00000038628.3 |
Man1c1
|
mannosidase, alpha, class 1C, member 1 |
chr15_-_98296083 | 1.32 |
ENSMUST00000169721.1
ENSMUST00000023722.5 |
Zfp641
|
zinc finger protein 641 |
chr6_-_55133014 | 1.32 |
ENSMUST00000003568.8
|
Crhr2
|
corticotropin releasing hormone receptor 2 |
chr11_+_87760533 | 1.30 |
ENSMUST00000039627.5
ENSMUST00000100644.3 |
Bzrap1
|
benzodiazepine receptor associated protein 1 |
chr7_-_45092130 | 1.30 |
ENSMUST00000148175.1
|
Rcn3
|
reticulocalbin 3, EF-hand calcium binding domain |
chr5_+_141241490 | 1.29 |
ENSMUST00000085774.4
|
Sdk1
|
sidekick homolog 1 (chicken) |
chr1_+_171411343 | 1.29 |
ENSMUST00000160486.1
|
Usf1
|
upstream transcription factor 1 |
chr2_-_26092149 | 1.28 |
ENSMUST00000114159.2
|
Nacc2
|
nucleus accumbens associated 2, BEN and BTB (POZ) domain containing |
chr2_+_106695594 | 1.25 |
ENSMUST00000016530.7
|
Mpped2
|
metallophosphoesterase domain containing 2 |
chr2_+_34874486 | 1.25 |
ENSMUST00000028228.3
|
Cutal
|
cutA divalent cation tolerance homolog-like |
chr13_-_92131494 | 1.24 |
ENSMUST00000099326.3
ENSMUST00000146492.1 |
Rasgrf2
|
RAS protein-specific guanine nucleotide-releasing factor 2 |
chr19_-_6996025 | 1.20 |
ENSMUST00000041686.3
ENSMUST00000180765.1 |
Nudt22
|
nudix (nucleoside diphosphate linked moiety X)-type motif 22 |
chr17_-_29549588 | 1.18 |
ENSMUST00000114683.2
ENSMUST00000168339.1 |
Tmem217
|
transmembrane protein 217 |
chr10_-_109010955 | 1.18 |
ENSMUST00000105276.1
ENSMUST00000064054.7 |
Syt1
|
synaptotagmin I |
chr11_+_115877497 | 1.18 |
ENSMUST00000144032.1
|
Myo15b
|
myosin XVB |
chr1_+_134193432 | 1.17 |
ENSMUST00000038445.6
|
Mybph
|
myosin binding protein H |
chr4_-_129227883 | 1.17 |
ENSMUST00000106051.1
|
C77080
|
expressed sequence C77080 |
chr16_-_32797413 | 1.16 |
ENSMUST00000115116.1
ENSMUST00000041123.8 |
Muc20
|
mucin 20 |
chr7_+_19411086 | 1.16 |
ENSMUST00000003643.1
|
Ckm
|
creatine kinase, muscle |
chr4_-_138367966 | 1.16 |
ENSMUST00000030535.3
|
Cda
|
cytidine deaminase |
chr2_-_181671622 | 1.15 |
ENSMUST00000054491.5
|
Sox18
|
SRY-box containing gene 18 |
chr6_+_78370877 | 1.15 |
ENSMUST00000096904.3
|
Reg3b
|
regenerating islet-derived 3 beta |
chr4_+_136247932 | 1.14 |
ENSMUST00000102533.4
ENSMUST00000143942.1 |
Tcea3
|
transcription elongation factor A (SII), 3 |
chr1_+_195017399 | 1.14 |
ENSMUST00000181273.1
|
A330023F24Rik
|
RIKEN cDNA A330023F24 gene |
chr1_+_171411305 | 1.13 |
ENSMUST00000161241.1
ENSMUST00000159207.1 |
Usf1
|
upstream transcription factor 1 |
chr11_+_104231390 | 1.13 |
ENSMUST00000106992.3
|
Mapt
|
microtubule-associated protein tau |
chr5_-_53707532 | 1.12 |
ENSMUST00000031093.3
|
Cckar
|
cholecystokinin A receptor |
chr4_-_149454971 | 1.12 |
ENSMUST00000030848.2
|
Rbp7
|
retinol binding protein 7, cellular |
chr17_+_36943025 | 1.11 |
ENSMUST00000173072.1
|
Rnf39
|
ring finger protein 39 |
chr6_+_88724828 | 1.11 |
ENSMUST00000089449.2
|
Mgll
|
monoglyceride lipase |
chr19_-_6941428 | 1.10 |
ENSMUST00000025909.4
ENSMUST00000099774.3 |
Gpr137
|
G protein-coupled receptor 137 |
chr5_+_140607334 | 1.10 |
ENSMUST00000031555.1
|
Lfng
|
LFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
chr6_+_34384218 | 1.09 |
ENSMUST00000038383.7
ENSMUST00000115051.1 |
Akr1b10
|
aldo-keto reductase family 1, member B10 (aldose reductase) |
chr11_+_96931387 | 1.09 |
ENSMUST00000107633.1
|
Prr15l
|
proline rich 15-like |
chr10_-_128401218 | 1.07 |
ENSMUST00000042666.5
|
Slc39a5
|
solute carrier family 39 (metal ion transporter), member 5 |
chr12_+_112678803 | 1.07 |
ENSMUST00000174780.1
ENSMUST00000169593.1 ENSMUST00000173942.1 |
Zbtb42
|
zinc finger and BTB domain containing 42 |
chr1_-_4496400 | 1.07 |
ENSMUST00000027035.3
|
Sox17
|
SRY-box containing gene 17 |
chrX_-_7574120 | 1.06 |
ENSMUST00000045924.7
ENSMUST00000115742.2 ENSMUST00000150787.1 |
Ppp1r3f
|
protein phosphatase 1, regulatory (inhibitor) subunit 3F |
chr8_-_69089200 | 1.06 |
ENSMUST00000037478.6
|
Slc18a1
|
solute carrier family 18 (vesicular monoamine), member 1 |
chr15_-_83724979 | 1.05 |
ENSMUST00000171496.1
ENSMUST00000043634.5 ENSMUST00000076060.5 ENSMUST00000016907.7 |
Scube1
|
signal peptide, CUB domain, EGF-like 1 |
chr15_-_75747922 | 1.05 |
ENSMUST00000062002.4
|
Mafa
|
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein A (avian) |
chr10_+_69151427 | 1.05 |
ENSMUST00000167286.1
|
Rhobtb1
|
Rho-related BTB domain containing 1 |
chr18_-_34007206 | 1.04 |
ENSMUST00000025234.5
|
Epb4.1l4a
|
erythrocyte protein band 4.1-like 4a |
chr17_+_29549783 | 1.03 |
ENSMUST00000048677.7
|
Tbc1d22b
|
TBC1 domain family, member 22B |
chr5_+_129908538 | 1.03 |
ENSMUST00000178355.1
|
Nupr1l
|
nuclear protein transcriptional regulator 1 like |
chr14_+_118854695 | 1.03 |
ENSMUST00000100314.3
|
Cldn10
|
claudin 10 |
chrX_-_73880831 | 1.02 |
ENSMUST00000102871.3
|
L1cam
|
L1 cell adhesion molecule |
chr8_+_124576105 | 1.02 |
ENSMUST00000093033.5
ENSMUST00000133086.1 |
Capn9
|
calpain 9 |
chr9_-_101034857 | 1.01 |
ENSMUST00000142676.1
ENSMUST00000149322.1 |
Pccb
|
propionyl Coenzyme A carboxylase, beta polypeptide |
chr2_-_30415767 | 1.00 |
ENSMUST00000102855.1
ENSMUST00000028207.6 |
Crat
|
carnitine acetyltransferase |
chr2_-_27247260 | 0.98 |
ENSMUST00000102886.3
ENSMUST00000129975.1 |
Sardh
|
sarcosine dehydrogenase |
chr5_-_52471534 | 0.98 |
ENSMUST00000059428.5
|
Ccdc149
|
coiled-coil domain containing 149 |
chr19_-_46672883 | 0.98 |
ENSMUST00000026012.7
|
Cyp17a1
|
cytochrome P450, family 17, subfamily a, polypeptide 1 |
chr4_-_154160632 | 0.98 |
ENSMUST00000105639.3
ENSMUST00000030896.8 |
Tprgl
|
transformation related protein 63 regulated like |
chr6_-_72362382 | 0.98 |
ENSMUST00000114095.1
ENSMUST00000069595.6 ENSMUST00000069580.5 |
Rnf181
|
ring finger protein 181 |
chr4_+_152338887 | 0.97 |
ENSMUST00000005175.4
|
Chd5
|
chromodomain helicase DNA binding protein 5 |
chr12_+_109544498 | 0.97 |
ENSMUST00000126289.1
|
Meg3
|
maternally expressed 3 |
chr6_-_125313844 | 0.97 |
ENSMUST00000032489.7
|
Ltbr
|
lymphotoxin B receptor |
chr11_+_75193783 | 0.96 |
ENSMUST00000102514.3
|
Rtn4rl1
|
reticulon 4 receptor-like 1 |
chr10_-_93310963 | 0.96 |
ENSMUST00000151153.1
|
Elk3
|
ELK3, member of ETS oncogene family |
chr9_-_101034892 | 0.95 |
ENSMUST00000035116.5
|
Pccb
|
propionyl Coenzyme A carboxylase, beta polypeptide |
chr19_+_10015016 | 0.94 |
ENSMUST00000137637.1
ENSMUST00000149967.1 |
Rab3il1
|
RAB3A interacting protein (rabin3)-like 1 |
chr19_+_38836561 | 0.94 |
ENSMUST00000037302.5
|
Tbc1d12
|
TBC1D12: TBC1 domain family, member 12 |
chr11_+_99041237 | 0.94 |
ENSMUST00000017637.6
|
Igfbp4
|
insulin-like growth factor binding protein 4 |
chr11_+_105975204 | 0.94 |
ENSMUST00000001964.7
|
Ace
|
angiotensin I converting enzyme (peptidyl-dipeptidase A) 1 |
chr1_+_59119822 | 0.93 |
ENSMUST00000180570.1
|
G730003C15Rik
|
RIKEN cDNA G730003C15 gene |
chr6_-_5496296 | 0.92 |
ENSMUST00000019721.4
|
Pdk4
|
pyruvate dehydrogenase kinase, isoenzyme 4 |
chr4_-_143299498 | 0.91 |
ENSMUST00000030317.7
|
Pdpn
|
podoplanin |
chr11_-_94601862 | 0.91 |
ENSMUST00000103164.3
|
Acsf2
|
acyl-CoA synthetase family member 2 |
chr4_-_140581774 | 0.91 |
ENSMUST00000147426.1
ENSMUST00000105797.2 |
Arhgef10l
|
Rho guanine nucleotide exchange factor (GEF) 10-like |
chr11_+_104132841 | 0.90 |
ENSMUST00000093925.4
|
Crhr1
|
corticotropin releasing hormone receptor 1 |
chrX_-_59134421 | 0.89 |
ENSMUST00000033473.5
|
Fgf13
|
fibroblast growth factor 13 |
chr15_+_87625214 | 0.89 |
ENSMUST00000068088.6
|
Fam19a5
|
family with sequence similarity 19, member A5 |
chr10_-_77902467 | 0.89 |
ENSMUST00000057608.4
|
Lrrc3
|
leucine rich repeat containing 3 |
chr7_+_80246375 | 0.89 |
ENSMUST00000058266.6
|
Ttll13
|
tubulin tyrosine ligase-like family, member 13 |
chr15_+_80671829 | 0.88 |
ENSMUST00000023044.5
|
Fam83f
|
family with sequence similarity 83, member F |
chr5_+_35057059 | 0.88 |
ENSMUST00000050709.3
|
Dok7
|
docking protein 7 |
chr4_+_82065855 | 0.88 |
ENSMUST00000151038.1
|
Gm5860
|
predicted gene 5860 |
chr8_+_122269569 | 0.88 |
ENSMUST00000055537.2
|
Gm22
|
predicted gene 22 |
chr11_+_98383811 | 0.88 |
ENSMUST00000008021.2
|
Tcap
|
titin-cap |
chr17_+_28207778 | 0.88 |
ENSMUST00000002327.5
|
Def6
|
differentially expressed in FDCP 6 |
chr2_+_29802626 | 0.88 |
ENSMUST00000080065.2
|
Slc27a4
|
solute carrier family 27 (fatty acid transporter), member 4 |
chr11_-_103363431 | 0.87 |
ENSMUST00000092557.5
|
Arhgap27
|
Rho GTPase activating protein 27 |
chr3_+_32817520 | 0.87 |
ENSMUST00000072312.5
ENSMUST00000108228.1 |
Usp13
|
ubiquitin specific peptidase 13 (isopeptidase T-3) |
chr11_+_104231515 | 0.87 |
ENSMUST00000106993.3
|
Mapt
|
microtubule-associated protein tau |
chr5_-_103977360 | 0.87 |
ENSMUST00000048118.8
|
Hsd17b13
|
hydroxysteroid (17-beta) dehydrogenase 13 |
chr7_-_35585577 | 0.87 |
ENSMUST00000069912.4
|
Rgs9bp
|
regulator of G-protein signalling 9 binding protein |
chr2_-_25095125 | 0.86 |
ENSMUST00000114373.1
|
Noxa1
|
NADPH oxidase activator 1 |
chr15_+_102102926 | 0.86 |
ENSMUST00000169627.1
ENSMUST00000046144.9 |
Tenc1
|
tensin like C1 domain-containing phosphatase |
chr2_-_25095149 | 0.86 |
ENSMUST00000044018.7
|
Noxa1
|
NADPH oxidase activator 1 |
chr14_+_70530819 | 0.86 |
ENSMUST00000047331.6
|
Lgi3
|
leucine-rich repeat LGI family, member 3 |
chr18_+_33464163 | 0.85 |
ENSMUST00000097634.3
|
Gm10549
|
predicted gene 10549 |
chr6_-_125494754 | 0.85 |
ENSMUST00000032492.8
|
Cd9
|
CD9 antigen |
chr11_+_66957894 | 0.85 |
ENSMUST00000127166.1
|
9130409J20Rik
|
RIKEN cDNA 9130409J20 gene |
chr8_+_54077532 | 0.85 |
ENSMUST00000033919.4
|
Vegfc
|
vascular endothelial growth factor C |
chr17_+_72918298 | 0.85 |
ENSMUST00000024857.6
|
Lbh
|
limb-bud and heart |
chr17_-_24533709 | 0.85 |
ENSMUST00000061764.7
|
Rab26
|
RAB26, member RAS oncogene family |
chr4_-_143299463 | 0.84 |
ENSMUST00000119654.1
|
Pdpn
|
podoplanin |
chr6_-_87690819 | 0.84 |
ENSMUST00000162547.1
|
1810020O05Rik
|
Riken cDNA 1810020O05 gene |
chr19_-_4615453 | 0.84 |
ENSMUST00000053597.2
|
Lrfn4
|
leucine rich repeat and fibronectin type III domain containing 4 |
chr2_-_25500613 | 0.83 |
ENSMUST00000040042.4
|
C8g
|
complement component 8, gamma polypeptide |
chr2_+_118663235 | 0.83 |
ENSMUST00000099557.3
|
Pak6
|
p21 protein (Cdc42/Rac)-activated kinase 6 |
chr10_-_60831571 | 0.83 |
ENSMUST00000077925.5
|
Unc5b
|
unc-5 homolog B (C. elegans) |
chr3_+_98280427 | 0.83 |
ENSMUST00000090746.2
ENSMUST00000120541.1 |
Hmgcs2
|
3-hydroxy-3-methylglutaryl-Coenzyme A synthase 2 |
chr12_+_61523889 | 0.82 |
ENSMUST00000119481.1
ENSMUST00000055815.7 |
Lrfn5
|
leucine rich repeat and fibronectin type III domain containing 5 |
chr11_+_16752203 | 0.82 |
ENSMUST00000102884.3
ENSMUST00000020329.6 |
Egfr
|
epidermal growth factor receptor |
chr18_+_51117754 | 0.81 |
ENSMUST00000116639.2
|
Prr16
|
proline rich 16 |
chr8_-_105943382 | 0.81 |
ENSMUST00000038896.7
|
Lcat
|
lecithin cholesterol acyltransferase |
chr7_-_126584220 | 0.81 |
ENSMUST00000128970.1
ENSMUST00000116269.2 |
Cln3
|
ceroid lipofuscinosis, neuronal 3, juvenile (Batten, Spielmeyer-Vogt disease) |
chr8_+_62951195 | 0.81 |
ENSMUST00000118003.1
|
Spock3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan 3 |
chr4_-_117929466 | 0.81 |
ENSMUST00000097913.2
|
Artn
|
artemin |
chr4_+_140906344 | 0.81 |
ENSMUST00000030765.6
|
Padi2
|
peptidyl arginine deiminase, type II |
chr11_+_4236411 | 0.80 |
ENSMUST00000075221.2
|
Osm
|
oncostatin M |
chr17_-_63499983 | 0.80 |
ENSMUST00000024761.6
|
Fbxl17
|
F-box and leucine-rich repeat protein 17 |
chr15_-_98898483 | 0.79 |
ENSMUST00000023737.4
|
Dhh
|
desert hedgehog |
chr17_+_35821675 | 0.78 |
ENSMUST00000003635.6
|
Ier3
|
immediate early response 3 |
chr5_+_24428208 | 0.78 |
ENSMUST00000115049.2
|
Slc4a2
|
solute carrier family 4 (anion exchanger), member 2 |
chr9_+_104569671 | 0.78 |
ENSMUST00000057742.8
|
Cpne4
|
copine IV |
chr1_+_162639148 | 0.78 |
ENSMUST00000028020.9
|
Myoc
|
myocilin |
chr6_-_116716888 | 0.78 |
ENSMUST00000056623.6
|
Tmem72
|
transmembrane protein 72 |
chr3_+_105452326 | 0.78 |
ENSMUST00000098761.3
|
Kcnd3
|
potassium voltage-gated channel, Shal-related family, member 3 |
chr1_+_59256906 | 0.77 |
ENSMUST00000160662.1
ENSMUST00000114248.2 |
Cdk15
|
cyclin-dependent kinase 15 |
chr17_-_25433775 | 0.77 |
ENSMUST00000159610.1
ENSMUST00000159048.1 ENSMUST00000078496.5 |
Cacna1h
|
calcium channel, voltage-dependent, T type, alpha 1H subunit |
chr15_-_81697256 | 0.77 |
ENSMUST00000072910.5
|
Chadl
|
chondroadherin-like |
chr5_+_30466044 | 0.76 |
ENSMUST00000031078.3
ENSMUST00000114743.1 |
1700001C02Rik
|
RIKEN cDNA 1700001C02 gene |
chr18_-_62179948 | 0.76 |
ENSMUST00000053640.3
|
Adrb2
|
adrenergic receptor, beta 2 |
chrX_+_101377267 | 0.76 |
ENSMUST00000052130.7
|
Gjb1
|
gap junction protein, beta 1 |
chr4_+_43632185 | 0.75 |
ENSMUST00000107874.2
|
Npr2
|
natriuretic peptide receptor 2 |
chr17_+_70561739 | 0.75 |
ENSMUST00000097288.2
|
Dlgap1
|
discs, large (Drosophila) homolog-associated protein 1 |
chr18_+_37725706 | 0.75 |
ENSMUST00000066149.6
|
Pcdhga9
|
protocadherin gamma subfamily A, 9 |
chr9_+_104569754 | 0.75 |
ENSMUST00000077190.6
|
Cpne4
|
copine IV |
chr11_+_97050811 | 0.75 |
ENSMUST00000168565.1
|
Osbpl7
|
oxysterol binding protein-like 7 |
chr8_+_4248188 | 0.75 |
ENSMUST00000110993.1
|
Gm14378
|
predicted gene 14378 |
chr11_+_104231573 | 0.75 |
ENSMUST00000132977.1
ENSMUST00000132245.1 ENSMUST00000100347.4 |
Mapt
|
microtubule-associated protein tau |
chr6_+_88724667 | 0.75 |
ENSMUST00000163271.1
|
Mgll
|
monoglyceride lipase |
chr5_-_139813237 | 0.74 |
ENSMUST00000110832.1
|
Tmem184a
|
transmembrane protein 184a |
chr17_+_79051906 | 0.74 |
ENSMUST00000040789.4
|
Qpct
|
glutaminyl-peptide cyclotransferase (glutaminyl cyclase) |
chr6_+_55336424 | 0.74 |
ENSMUST00000004774.3
|
Aqp1
|
aquaporin 1 |
chr7_-_31126945 | 0.74 |
ENSMUST00000098548.4
|
Scn1b
|
sodium channel, voltage-gated, type I, beta |
chr9_-_49486209 | 0.74 |
ENSMUST00000055096.4
|
Ttc12
|
tetratricopeptide repeat domain 12 |
chr10_+_13501001 | 0.73 |
ENSMUST00000060212.6
ENSMUST00000121465.2 |
Fuca2
|
fucosidase, alpha-L- 2, plasma |
chr5_+_81021202 | 0.73 |
ENSMUST00000117253.1
ENSMUST00000120128.1 |
Lphn3
|
latrophilin 3 |
chr11_-_96829904 | 0.73 |
ENSMUST00000107657.1
|
Nfe2l1
|
nuclear factor, erythroid derived 2,-like 1 |
chr10_-_76345254 | 0.73 |
ENSMUST00000036033.7
ENSMUST00000160048.1 ENSMUST00000105417.3 |
Dip2a
|
DIP2 disco-interacting protein 2 homolog A (Drosophila) |
chrX_-_59568068 | 0.73 |
ENSMUST00000119833.1
ENSMUST00000131319.1 |
Fgf13
|
fibroblast growth factor 13 |
chr10_+_127048235 | 0.73 |
ENSMUST00000165764.1
|
Cyp27b1
|
cytochrome P450, family 27, subfamily b, polypeptide 1 |
chr4_+_86575668 | 0.73 |
ENSMUST00000091064.6
|
Rraga
|
Ras-related GTP binding A |
chr3_-_89245829 | 0.72 |
ENSMUST00000041022.8
|
Trim46
|
tripartite motif-containing 46 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 3.7 | GO:0042323 | positive regulation of nucleobase-containing compound transport(GO:0032241) regulation of nucleoside transport(GO:0032242) negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
1.0 | 3.9 | GO:0072272 | proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
0.9 | 2.8 | GO:0021759 | globus pallidus development(GO:0021759) |
0.7 | 2.2 | GO:0048866 | stem cell fate specification(GO:0048866) |
0.7 | 0.7 | GO:0035377 | transepithelial water transport(GO:0035377) |
0.7 | 5.2 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.7 | 2.2 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
0.7 | 2.1 | GO:0072162 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) renal vesicle induction(GO:0072034) metanephric mesenchymal cell differentiation(GO:0072162) negative regulation of male gonad development(GO:2000019) |
0.7 | 2.7 | GO:0021586 | pons maturation(GO:0021586) |
0.6 | 1.7 | GO:1904328 | regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
0.5 | 1.6 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
0.5 | 1.6 | GO:0042197 | dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
0.5 | 2.0 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.5 | 2.4 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) late viral transcription(GO:0019086) |
0.5 | 2.8 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.5 | 1.4 | GO:0046351 | disaccharide biosynthetic process(GO:0046351) |
0.5 | 1.4 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
0.4 | 1.3 | GO:0021558 | trochlear nerve development(GO:0021558) |
0.4 | 1.3 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
0.4 | 3.1 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
0.4 | 1.3 | GO:1900477 | negative regulation of G1/S transition of mitotic cell cycle by negative regulation of transcription from RNA polymerase II promoter(GO:1900477) |
0.4 | 1.3 | GO:0097021 | lymphocyte migration into lymphoid organs(GO:0097021) |
0.4 | 2.4 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.4 | 1.2 | GO:0086047 | membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
0.4 | 1.9 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.4 | 1.2 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.4 | 1.1 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.4 | 1.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.4 | 1.1 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
0.4 | 0.7 | GO:0060435 | bronchiole development(GO:0060435) |
0.3 | 1.4 | GO:2001106 | regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
0.3 | 3.0 | GO:1900034 | regulation of cellular response to heat(GO:1900034) |
0.3 | 0.9 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
0.3 | 0.9 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.3 | 1.8 | GO:2001016 | positive regulation of skeletal muscle cell differentiation(GO:2001016) |
0.3 | 1.2 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
0.3 | 0.9 | GO:0035995 | skeletal muscle myosin thick filament assembly(GO:0030241) detection of muscle stretch(GO:0035995) |
0.3 | 0.9 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
0.3 | 0.5 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.3 | 0.8 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.3 | 0.8 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.3 | 1.8 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.3 | 0.8 | GO:0003099 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
0.2 | 0.7 | GO:0050883 | regulation of sulfur amino acid metabolic process(GO:0031335) musculoskeletal movement, spinal reflex action(GO:0050883) |
0.2 | 1.6 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
0.2 | 1.2 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
0.2 | 0.9 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.2 | 1.1 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
0.2 | 0.4 | GO:0061033 | secretion by lung epithelial cell involved in lung growth(GO:0061033) |
0.2 | 0.9 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
0.2 | 1.1 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.2 | 2.4 | GO:0006751 | glutathione catabolic process(GO:0006751) |
0.2 | 0.2 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
0.2 | 1.7 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.2 | 0.8 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.2 | 1.0 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
0.2 | 0.4 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.2 | 0.8 | GO:0070459 | prolactin secretion(GO:0070459) |
0.2 | 2.0 | GO:0070166 | enamel mineralization(GO:0070166) |
0.2 | 0.6 | GO:0035627 | ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
0.2 | 1.4 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.2 | 1.6 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.2 | 1.0 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.2 | 0.6 | GO:1905204 | cardiac muscle tissue regeneration(GO:0061026) negative regulation of connective tissue replacement(GO:1905204) |
0.2 | 0.6 | GO:0061763 | multivesicular body-lysosome fusion(GO:0061763) |
0.2 | 0.5 | GO:1901074 | regulation of engulfment of apoptotic cell(GO:1901074) |
0.2 | 0.7 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.2 | 0.7 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.2 | 0.5 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.2 | 0.7 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) Harderian gland development(GO:0070384) |
0.2 | 1.0 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.2 | 0.9 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
0.2 | 1.2 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.2 | 1.3 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) negative regulation of serotonin uptake(GO:0051612) |
0.2 | 0.5 | GO:2001013 | adherens junction maintenance(GO:0034334) epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.2 | 1.3 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.2 | 1.2 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) |
0.2 | 0.7 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.2 | 0.8 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.2 | 0.5 | GO:0016115 | sesquiterpenoid metabolic process(GO:0006714) terpenoid catabolic process(GO:0016115) |
0.2 | 0.9 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
0.2 | 0.9 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.2 | 0.5 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.2 | 0.3 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
0.2 | 1.4 | GO:0061713 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) cellular response to folic acid(GO:0071231) |
0.2 | 1.4 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
0.2 | 1.7 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.1 | 0.4 | GO:0034971 | histone H3-R17 methylation(GO:0034971) |
0.1 | 1.2 | GO:0032261 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
0.1 | 0.7 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.1 | 0.4 | GO:0006127 | glycerophosphate shuttle(GO:0006127) glycerol-3-phosphate catabolic process(GO:0046168) |
0.1 | 0.4 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) |
0.1 | 0.7 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
0.1 | 1.0 | GO:0097186 | amelogenesis(GO:0097186) |
0.1 | 1.0 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.1 | 0.4 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
0.1 | 0.9 | GO:0030913 | paranodal junction assembly(GO:0030913) |
0.1 | 1.4 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.1 | 0.6 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.6 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.5 | GO:2000544 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
0.1 | 0.5 | GO:1903288 | positive regulation of potassium ion import(GO:1903288) |
0.1 | 0.4 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.1 | 1.3 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
0.1 | 1.5 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.5 | GO:2000256 | endomitotic cell cycle(GO:0007113) thrombopoietin-mediated signaling pathway(GO:0038163) positive regulation of male germ cell proliferation(GO:2000256) |
0.1 | 0.9 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.1 | 0.5 | GO:0090126 | protein complex assembly involved in synapse maturation(GO:0090126) |
0.1 | 1.2 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.1 | 0.4 | GO:2000642 | negative regulation of early endosome to late endosome transport(GO:2000642) |
0.1 | 1.7 | GO:0021940 | positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
0.1 | 2.7 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
0.1 | 1.4 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
0.1 | 0.4 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
0.1 | 0.8 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.6 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.1 | 0.5 | GO:0030070 | insulin processing(GO:0030070) |
0.1 | 0.8 | GO:0021571 | rhombomere 5 development(GO:0021571) |
0.1 | 0.6 | GO:0070305 | response to cGMP(GO:0070305) cellular response to cGMP(GO:0071321) |
0.1 | 2.0 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.1 | 0.4 | GO:0060785 | regulation of apoptosis involved in tissue homeostasis(GO:0060785) |
0.1 | 0.7 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.1 | 0.4 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.1 | 0.2 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.1 | 0.8 | GO:1904672 | regulation of somatic stem cell population maintenance(GO:1904672) |
0.1 | 3.4 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.1 | 0.5 | GO:0061760 | antifungal innate immune response(GO:0061760) |
0.1 | 0.4 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
0.1 | 0.9 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.1 | 0.5 | GO:0010593 | negative regulation of lamellipodium assembly(GO:0010593) |
0.1 | 0.8 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.1 | 1.7 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
0.1 | 0.3 | GO:1901079 | positive regulation of relaxation of muscle(GO:1901079) |
0.1 | 0.6 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.1 | 0.7 | GO:0033762 | response to glucagon(GO:0033762) |
0.1 | 0.2 | GO:1904457 | positive regulation of neuronal action potential(GO:1904457) |
0.1 | 0.3 | GO:0060290 | transdifferentiation(GO:0060290) |
0.1 | 1.6 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.1 | 0.5 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.1 | 0.4 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.1 | 0.3 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.1 | 0.6 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.1 | 0.5 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.1 | 0.7 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.1 | 0.4 | GO:1903896 | positive regulation of IRE1-mediated unfolded protein response(GO:1903896) |
0.1 | 0.5 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 0.3 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.1 | 0.9 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.1 | 0.2 | GO:0044805 | late nucleophagy(GO:0044805) |
0.1 | 0.8 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.1 | 0.7 | GO:0046514 | ceramide catabolic process(GO:0046514) |
0.1 | 0.3 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 0.5 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.1 | 0.5 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.1 | 0.6 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.1 | 1.0 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.1 | 0.3 | GO:0017055 | negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) |
0.1 | 0.3 | GO:0071544 | diphosphoinositol polyphosphate catabolic process(GO:0071544) |
0.1 | 0.4 | GO:1904936 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
0.1 | 0.3 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
0.1 | 1.3 | GO:0019236 | response to pheromone(GO:0019236) |
0.1 | 0.6 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.1 | 0.3 | GO:0072720 | response to sorbitol(GO:0072708) response to dithiothreitol(GO:0072720) |
0.1 | 0.5 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.1 | 0.8 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
0.1 | 0.8 | GO:0036476 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.1 | 1.1 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.1 | 0.6 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.1 | 0.9 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
0.1 | 1.3 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.1 | 0.3 | GO:0035106 | operant conditioning(GO:0035106) |
0.1 | 0.2 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
0.1 | 0.6 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) negative regulation of ATP biosynthetic process(GO:2001170) |
0.1 | 0.4 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.3 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.1 | 0.5 | GO:0070474 | positive regulation of uterine smooth muscle contraction(GO:0070474) |
0.1 | 0.9 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 1.9 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.1 | 1.1 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
0.1 | 0.4 | GO:0038032 | termination of G-protein coupled receptor signaling pathway(GO:0038032) |
0.1 | 0.4 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.1 | 1.0 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.2 | GO:0002305 | gamma-delta intraepithelial T cell differentiation(GO:0002304) CD8-positive, gamma-delta intraepithelial T cell differentiation(GO:0002305) |
0.1 | 0.3 | GO:0080144 | amino acid homeostasis(GO:0080144) |
0.1 | 0.5 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.1 | 0.8 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.1 | 0.5 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 1.1 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 0.2 | GO:1903897 | regulation of PERK-mediated unfolded protein response(GO:1903897) |
0.1 | 0.3 | GO:0009816 | defense response to bacterium, incompatible interaction(GO:0009816) regulation of defense response to bacterium, incompatible interaction(GO:1902477) |
0.1 | 0.4 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
0.1 | 0.2 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
0.1 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.1 | 0.3 | GO:0015671 | oxygen transport(GO:0015671) |
0.1 | 0.2 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.5 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 1.0 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.1 | 2.5 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
0.1 | 0.7 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.1 | 0.3 | GO:0035617 | stress granule disassembly(GO:0035617) plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.1 | 0.9 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.1 | 0.3 | GO:0022009 | central nervous system vasculogenesis(GO:0022009) |
0.1 | 0.2 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.7 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.1 | 0.8 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.4 | GO:0038161 | prolactin signaling pathway(GO:0038161) negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
0.1 | 0.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 0.2 | GO:0097535 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
0.1 | 0.2 | GO:0045976 | negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
0.1 | 0.2 | GO:1901738 | regulation of isoprenoid metabolic process(GO:0019747) regulation of vitamin A metabolic process(GO:1901738) |
0.1 | 0.8 | GO:0048484 | enteric nervous system development(GO:0048484) |
0.1 | 0.3 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.1 | 0.2 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.1 | 0.2 | GO:0009804 | coumarin metabolic process(GO:0009804) phenylpropanoid catabolic process(GO:0046271) |
0.1 | 0.5 | GO:0090074 | lung vasculature development(GO:0060426) negative regulation of protein homodimerization activity(GO:0090074) |
0.1 | 1.2 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
0.1 | 0.6 | GO:0071872 | response to epinephrine(GO:0071871) cellular response to epinephrine stimulus(GO:0071872) negative regulation of relaxation of cardiac muscle(GO:1901898) |
0.1 | 0.2 | GO:0070829 | heterochromatin maintenance(GO:0070829) |
0.1 | 0.1 | GO:0072236 | metanephric loop of Henle development(GO:0072236) |
0.1 | 0.2 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
0.1 | 1.2 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
0.1 | 0.3 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.1 | 0.2 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.1 | 0.2 | GO:0007525 | somatic muscle development(GO:0007525) |
0.1 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.3 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.1 | 0.2 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) regulation of collateral sprouting in absence of injury(GO:0048696) |
0.1 | 1.2 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.1 | 0.2 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.1 | 0.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.6 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.1 | 0.2 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.1 | 0.2 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.0 | 0.2 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 1.5 | GO:0090662 | ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.0 | 0.4 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.0 | 0.2 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.0 | 0.2 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.1 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) negative regulation of negative chemotaxis(GO:0050925) |
0.0 | 0.2 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.0 | 0.1 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) |
0.0 | 0.1 | GO:0060754 | regulation of mast cell chemotaxis(GO:0060753) positive regulation of mast cell chemotaxis(GO:0060754) |
0.0 | 0.1 | GO:2000040 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
0.0 | 0.2 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.4 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.0 | 0.5 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.6 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.0 | 0.2 | GO:2000828 | post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
0.0 | 0.1 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.4 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.3 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
0.0 | 0.3 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.9 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.0 | 1.0 | GO:0045047 | protein targeting to ER(GO:0045047) |
0.0 | 0.3 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.0 | 1.1 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.1 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
0.0 | 0.3 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.0 | 0.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.6 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.1 | GO:0033684 | regulation of luteinizing hormone secretion(GO:0033684) |
0.0 | 0.1 | GO:0090650 | rRNA export from nucleus(GO:0006407) memory T cell differentiation(GO:0043379) response to oxygen-glucose deprivation(GO:0090649) cellular response to oxygen-glucose deprivation(GO:0090650) |
0.0 | 0.5 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.0 | 1.2 | GO:0001706 | endoderm formation(GO:0001706) |
0.0 | 0.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 0.3 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.0 | 0.3 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.2 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.0 | 1.1 | GO:0001516 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
0.0 | 0.2 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
0.0 | 0.6 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.0 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.0 | 0.4 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 0.1 | GO:0071707 | immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
0.0 | 0.6 | GO:0046415 | urate metabolic process(GO:0046415) |
0.0 | 0.1 | GO:0021830 | substrate-independent telencephalic tangential migration(GO:0021826) interneuron migration from the subpallium to the cortex(GO:0021830) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
0.0 | 0.5 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.5 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.0 | 0.5 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.0 | 0.3 | GO:0032274 | gonadotropin secretion(GO:0032274) |
0.0 | 0.2 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.6 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
0.0 | 0.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.0 | 0.1 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
0.0 | 0.6 | GO:0086027 | AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) |
0.0 | 0.2 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.0 | 0.7 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.0 | 0.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.0 | 0.1 | GO:0030043 | actin filament fragmentation(GO:0030043) |
0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
0.0 | 0.3 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.2 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) |
0.0 | 0.1 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.0 | 0.1 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.0 | 0.1 | GO:0099550 | trans-synaptic signalling, modulating synaptic transmission(GO:0099550) |
0.0 | 0.3 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.6 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.5 | GO:0033198 | response to ATP(GO:0033198) |
0.0 | 0.3 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.0 | 0.4 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.6 | GO:0097435 | fibril organization(GO:0097435) |
0.0 | 0.9 | GO:0048535 | lymph node development(GO:0048535) |
0.0 | 0.1 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.0 | 0.8 | GO:0095500 | acetylcholine receptor signaling pathway(GO:0095500) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
0.0 | 0.1 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.0 | 0.5 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.0 | 0.1 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
0.0 | 0.7 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
0.0 | 0.1 | GO:0046381 | CMP-N-acetylneuraminate metabolic process(GO:0046381) |
0.0 | 0.4 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.3 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.0 | 0.3 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.2 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.0 | 0.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.0 | 0.1 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
0.0 | 0.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.0 | 0.1 | GO:0048050 | post-embryonic camera-type eye development(GO:0031077) post-embryonic eye morphogenesis(GO:0048050) post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.0 | 0.0 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.1 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.0 | 0.5 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.6 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.0 | 0.1 | GO:1904717 | striatal medium spiny neuron differentiation(GO:0021773) regulation of AMPA glutamate receptor clustering(GO:1904717) |
0.0 | 0.2 | GO:0050957 | equilibrioception(GO:0050957) |
0.0 | 0.5 | GO:0042730 | fibrinolysis(GO:0042730) |
0.0 | 0.1 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.0 | 0.1 | GO:0046368 | GDP-L-fucose metabolic process(GO:0046368) |
0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.5 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.1 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.0 | 0.1 | GO:0071313 | cellular response to caffeine(GO:0071313) |
0.0 | 0.3 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.0 | 0.1 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) histone H3-S28 phosphorylation(GO:0043988) |
0.0 | 0.3 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.2 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.1 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.5 | GO:0045026 | plasma membrane fusion(GO:0045026) |
0.0 | 0.1 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.0 | 0.5 | GO:0048820 | hair follicle maturation(GO:0048820) |
0.0 | 0.1 | GO:2000768 | glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
0.0 | 0.4 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.3 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.0 | 0.9 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
0.0 | 0.1 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.0 | 0.2 | GO:0001977 | renal system process involved in regulation of blood volume(GO:0001977) |
0.0 | 0.4 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
0.0 | 0.4 | GO:0071625 | vocalization behavior(GO:0071625) |
0.0 | 1.2 | GO:0045143 | homologous chromosome segregation(GO:0045143) |
0.0 | 0.3 | GO:0046498 | S-adenosylhomocysteine metabolic process(GO:0046498) |
0.0 | 0.7 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.0 | 0.3 | GO:0030252 | growth hormone secretion(GO:0030252) |
0.0 | 0.1 | GO:0015817 | histidine transport(GO:0015817) |
0.0 | 0.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.0 | 0.1 | GO:1904776 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.8 | GO:0030834 | regulation of actin filament depolymerization(GO:0030834) |
0.0 | 0.5 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
0.0 | 0.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.0 | 0.1 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 0.4 | GO:0050892 | intestinal absorption(GO:0050892) |
0.0 | 0.3 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.0 | 0.3 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.0 | 0.3 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.0 | 0.4 | GO:0043551 | regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
0.0 | 0.2 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.9 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
0.0 | 0.1 | GO:0072189 | ureter development(GO:0072189) |
0.0 | 0.1 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.0 | 0.3 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.9 | GO:0007586 | digestion(GO:0007586) |
0.0 | 0.1 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.0 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.4 | GO:0030318 | melanocyte differentiation(GO:0030318) |
0.0 | 0.3 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
0.0 | 0.2 | GO:0018149 | peptide cross-linking(GO:0018149) |
0.0 | 0.2 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
0.0 | 0.0 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.0 | 0.4 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.0 | 0.1 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
0.0 | 0.7 | GO:0003382 | epithelial cell morphogenesis(GO:0003382) |
0.0 | 0.7 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.0 | 1.1 | GO:0051453 | regulation of intracellular pH(GO:0051453) |
0.0 | 0.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.0 | 0.1 | GO:0046543 | development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
0.0 | 0.2 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
0.0 | 0.1 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
0.0 | 0.1 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.0 | 0.1 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
0.0 | 0.1 | GO:2001183 | negative regulation of interleukin-12 secretion(GO:2001183) |
0.0 | 0.2 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.6 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.0 | 0.2 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.0 | 0.3 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
0.0 | 0.2 | GO:0032369 | negative regulation of lipid transport(GO:0032369) |
0.0 | 0.1 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.0 | 0.4 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
0.0 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.1 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
0.0 | 0.2 | GO:0097345 | mitochondrial outer membrane permeabilization(GO:0097345) |
0.0 | 0.2 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.1 | GO:0031063 | regulation of histone deacetylation(GO:0031063) |
0.0 | 0.0 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.0 | 0.2 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.0 | 0.1 | GO:0001865 | NK T cell differentiation(GO:0001865) |
0.0 | 0.5 | GO:0015914 | phospholipid transport(GO:0015914) |
0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.0 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
0.0 | 0.6 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.0 | 0.2 | GO:0042036 | negative regulation of cytokine biosynthetic process(GO:0042036) |
0.0 | 0.2 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
0.0 | 0.3 | GO:0030199 | collagen fibril organization(GO:0030199) |
0.0 | 0.1 | GO:0019336 | phenol-containing compound catabolic process(GO:0019336) |
0.0 | 0.1 | GO:0098707 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
0.0 | 0.0 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.0 | 0.3 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 2.7 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.5 | 2.5 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.3 | 3.0 | GO:0045298 | tubulin complex(GO:0045298) |
0.2 | 0.7 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.2 | 0.9 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.2 | 0.9 | GO:0097450 | astrocyte end-foot(GO:0097450) |
0.2 | 4.6 | GO:0043196 | varicosity(GO:0043196) |
0.2 | 0.8 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.2 | 0.7 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.2 | 3.8 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.2 | 2.0 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.2 | 2.4 | GO:0016589 | NURF complex(GO:0016589) |
0.2 | 1.7 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.2 | 2.4 | GO:0033391 | chromatoid body(GO:0033391) |
0.1 | 0.7 | GO:1990130 | Iml1 complex(GO:1990130) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.1 | 0.7 | GO:1990769 | proximal neuron projection(GO:1990769) |
0.1 | 5.6 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.4 | GO:0098855 | HCN channel complex(GO:0098855) |
0.1 | 0.4 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 1.2 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.4 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
0.1 | 1.0 | GO:0005787 | signal peptidase complex(GO:0005787) |
0.1 | 0.5 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 2.7 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.1 | 2.9 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.1 | 0.6 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.1 | 0.5 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.1 | 2.2 | GO:0005922 | connexon complex(GO:0005922) |
0.1 | 1.4 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 0.3 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
0.1 | 0.8 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 0.4 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.1 | 1.2 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.4 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.5 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 0.4 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
0.1 | 2.3 | GO:0034706 | sodium channel complex(GO:0034706) |
0.1 | 0.4 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 0.8 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 4.3 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.1 | 0.6 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.1 | 1.6 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.1 | 1.7 | GO:0097225 | sperm midpiece(GO:0097225) |
0.1 | 0.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.4 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 0.6 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.1 | 2.1 | GO:0042588 | zymogen granule(GO:0042588) |
0.1 | 0.5 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 0.3 | GO:0042583 | chromaffin granule(GO:0042583) |
0.1 | 1.2 | GO:0005605 | basal lamina(GO:0005605) |
0.1 | 1.1 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.1 | 3.0 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 4.2 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.1 | 0.9 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 2.3 | GO:0008305 | integrin complex(GO:0008305) |
0.1 | 1.2 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 0.7 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.1 | 0.6 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.2 | GO:1990696 | USH2 complex(GO:1990696) |
0.1 | 0.2 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.1 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
0.0 | 0.4 | GO:0042599 | lamellar body(GO:0042599) |
0.0 | 0.8 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.7 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.7 | GO:0034704 | calcium channel complex(GO:0034704) |
0.0 | 0.6 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.0 | 0.5 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.5 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
0.0 | 0.8 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 2.2 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.5 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.0 | 0.9 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 0.6 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.3 | GO:0044305 | calyx of Held(GO:0044305) |
0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
0.0 | 0.3 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.9 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.2 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.9 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 0.3 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.5 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.1 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.5 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.4 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.5 | GO:0031105 | septin complex(GO:0031105) |
0.0 | 0.6 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 3.3 | GO:0044853 | plasma membrane raft(GO:0044853) |
0.0 | 0.1 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.0 | 0.2 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.0 | 0.5 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.8 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.0 | 0.4 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.0 | 0.4 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.2 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.7 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 0.6 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.5 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.2 | GO:0001533 | cornified envelope(GO:0001533) |
0.0 | 0.3 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.7 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.2 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.6 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 2.7 | GO:0005903 | brush border(GO:0005903) |
0.0 | 0.3 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.7 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.1 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
0.0 | 1.7 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 1.6 | GO:0030175 | filopodium(GO:0030175) |
0.0 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 0.0 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
0.0 | 0.1 | GO:0036449 | cortical microtubule cytoskeleton(GO:0030981) microtubule minus-end(GO:0036449) |
0.0 | 5.1 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.0 | 1.6 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.7 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.4 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.6 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.4 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.4 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.5 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 0.4 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 3.9 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 0.1 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.0 | 1.2 | GO:0008021 | synaptic vesicle(GO:0008021) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 2.5 | GO:0043404 | corticotrophin-releasing factor receptor activity(GO:0015056) corticotropin-releasing hormone receptor activity(GO:0043404) |
0.7 | 5.2 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.7 | 2.0 | GO:0004658 | propionyl-CoA carboxylase activity(GO:0004658) |
0.5 | 1.6 | GO:0016824 | hydrolase activity, acting on acid halide bonds(GO:0016824) hydrolase activity, acting on acid halide bonds, in C-halide compounds(GO:0019120) alkylhalidase activity(GO:0047651) |
0.5 | 2.6 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
0.5 | 3.4 | GO:0099609 | microtubule lateral binding(GO:0099609) |
0.5 | 3.7 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.5 | 1.4 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.5 | 1.4 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.4 | 1.3 | GO:0046997 | sarcosine dehydrogenase activity(GO:0008480) oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
0.4 | 1.7 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.4 | 1.3 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.4 | 1.7 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.4 | 1.3 | GO:0030116 | glial cell-derived neurotrophic factor receptor binding(GO:0030116) |
0.4 | 1.2 | GO:0070401 | NADP+ binding(GO:0070401) |
0.4 | 2.4 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.4 | 1.6 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
0.4 | 1.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.4 | 1.1 | GO:2001069 | glycogen binding(GO:2001069) |
0.4 | 4.6 | GO:0015250 | water channel activity(GO:0015250) |
0.3 | 1.4 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.3 | 1.0 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.3 | 2.5 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.3 | 1.2 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
0.3 | 1.2 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.3 | 0.8 | GO:0019002 | GMP binding(GO:0019002) |
0.3 | 1.0 | GO:0004092 | carnitine O-acetyltransferase activity(GO:0004092) |
0.2 | 1.7 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.2 | 0.7 | GO:0015928 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
0.2 | 1.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.2 | 3.6 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.2 | 1.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.2 | 0.9 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.2 | 0.9 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.2 | 0.7 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
0.2 | 0.7 | GO:0071820 | N-box binding(GO:0071820) |
0.2 | 0.9 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.2 | 1.8 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.2 | 0.6 | GO:0004962 | endothelin receptor activity(GO:0004962) |
0.2 | 2.7 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.2 | 0.8 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.2 | 1.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.2 | 1.7 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.2 | 1.3 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.2 | 0.5 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
0.2 | 1.1 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.2 | 2.3 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.2 | 0.9 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.2 | 0.7 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.2 | 2.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.2 | 0.8 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.2 | 0.5 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.2 | 0.6 | GO:0070976 | TIR domain binding(GO:0070976) |
0.2 | 0.6 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.2 | 0.9 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.2 | 0.8 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.1 | 0.4 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.1 | 1.2 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.1 | 0.4 | GO:0004368 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.1 | 1.3 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 1.4 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 2.2 | GO:0044548 | S100 protein binding(GO:0044548) |
0.1 | 2.0 | GO:0019841 | retinol binding(GO:0019841) |
0.1 | 0.7 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 0.6 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.1 | 0.4 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
0.1 | 0.5 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.1 | 0.8 | GO:0005113 | patched binding(GO:0005113) |
0.1 | 2.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.1 | 0.8 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 1.4 | GO:0051870 | methotrexate binding(GO:0051870) |
0.1 | 1.0 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 0.5 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) |
0.1 | 0.7 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.1 | 0.4 | GO:0072541 | peroxynitrite reductase activity(GO:0072541) |
0.1 | 0.5 | GO:0004308 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 1.0 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.1 | 4.3 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.1 | 0.5 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.1 | 0.5 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.1 | 1.0 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 1.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.1 | 1.0 | GO:0035374 | chondroitin sulfate binding(GO:0035374) |
0.1 | 2.5 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.1 | 0.5 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.1 | 0.7 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 0.4 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.6 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 1.4 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.4 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.1 | 0.3 | GO:0002153 | steroid receptor RNA activator RNA binding(GO:0002153) |
0.1 | 0.4 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.1 | 0.4 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.1 | 0.7 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
0.1 | 0.4 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.1 | 0.4 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.1 | 0.5 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.6 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 1.2 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 1.3 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.1 | 0.3 | GO:0001566 | phorbol ester receptor activity(GO:0001565) non-kinase phorbol ester receptor activity(GO:0001566) |
0.1 | 1.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.5 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.1 | 0.7 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.1 | 0.3 | GO:0005008 | hepatocyte growth factor-activated receptor activity(GO:0005008) |
0.1 | 0.3 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.1 | 1.1 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.1 | 0.2 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
0.1 | 0.5 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.1 | 0.3 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
0.1 | 0.2 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.1 | 1.4 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
0.1 | 0.3 | GO:0004096 | catalase activity(GO:0004096) oxygen transporter activity(GO:0005344) |
0.1 | 0.9 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.1 | 0.3 | GO:0005093 | Rab GDP-dissociation inhibitor activity(GO:0005093) |
0.1 | 0.3 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.1 | 1.2 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.1 | 0.2 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 0.4 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.1 | 0.5 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.1 | 1.6 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.1 | 0.1 | GO:0004998 | transferrin receptor activity(GO:0004998) |
0.1 | 0.3 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
0.1 | 0.6 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 0.6 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.1 | 0.6 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.1 | 0.4 | GO:0002046 | opsin binding(GO:0002046) |
0.1 | 0.3 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 0.3 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 1.1 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.1 | 0.4 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.1 | 0.2 | GO:0048763 | ryanodine-sensitive calcium-release channel activity(GO:0005219) calcium-induced calcium release activity(GO:0048763) |
0.1 | 0.3 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.1 | 0.3 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.1 | 0.5 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.1 | 0.4 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 0.2 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
0.1 | 0.3 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.1 | GO:0004903 | growth hormone receptor activity(GO:0004903) |
0.0 | 0.1 | GO:0070736 | protein-glycine ligase activity, initiating(GO:0070736) |
0.0 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.0 | 0.3 | GO:0034432 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
0.0 | 0.8 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.2 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) D-glucose transmembrane transporter activity(GO:0055056) |
0.0 | 0.5 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 2.1 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.4 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.4 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.5 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.2 | GO:0032810 | sterol response element binding(GO:0032810) |
0.0 | 0.4 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 2.7 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.7 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.4 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.0 | 0.3 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.0 | 0.1 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
0.0 | 0.3 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.0 | 0.4 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.3 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
0.0 | 0.5 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.0 | 0.5 | GO:0060229 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
0.0 | 0.2 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 0.7 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 1.3 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.2 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.3 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.1 | GO:0004637 | phosphoribosylamine-glycine ligase activity(GO:0004637) |
0.0 | 0.4 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.4 | GO:0051378 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin binding(GO:0051378) |
0.0 | 1.1 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.0 | 1.0 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
0.0 | 0.4 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.0 | 0.5 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.5 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.3 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.0 | 0.5 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.3 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.1 | GO:0004335 | galactokinase activity(GO:0004335) |
0.0 | 2.2 | GO:0005507 | copper ion binding(GO:0005507) |
0.0 | 1.9 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.0 | 0.3 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.4 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.9 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.4 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.1 | GO:0008431 | vitamin E binding(GO:0008431) |
0.0 | 1.0 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
0.0 | 1.0 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 0.2 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.0 | 0.3 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.2 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.0 | 0.1 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.0 | 0.6 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 0.1 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.4 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.2 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 1.2 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
0.0 | 0.3 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.4 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
0.0 | 0.1 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.0 | 0.6 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.6 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.5 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.2 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.0 | 0.2 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 2.7 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.3 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 0.1 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.1 | GO:0019864 | IgG binding(GO:0019864) |
0.0 | 0.3 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.1 | GO:0043423 | NMDA glutamate receptor activity(GO:0004972) 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.4 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.5 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 2.5 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.1 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 0.9 | GO:0019213 | deacetylase activity(GO:0019213) |
0.0 | 0.4 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.2 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.7 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
0.0 | 0.1 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.0 | 0.6 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.5 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.0 | 0.3 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 0.3 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
0.0 | 0.1 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.0 | 1.0 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 1.3 | GO:0019838 | growth factor binding(GO:0019838) |
0.0 | 0.2 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 1.0 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.3 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.4 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.2 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.0 | GO:0008940 | nitrate reductase activity(GO:0008940) |
0.0 | 0.5 | GO:0019955 | cytokine binding(GO:0019955) |
0.0 | 0.2 | GO:0005549 | odorant binding(GO:0005549) |
0.0 | 0.0 | GO:0047288 | monosialoganglioside sialyltransferase activity(GO:0047288) |
0.0 | 0.1 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.1 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.1 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.0 | 0.1 | GO:0001637 | G-protein coupled chemoattractant receptor activity(GO:0001637) chemokine receptor activity(GO:0004950) |
0.0 | 0.1 | GO:0048039 | ubiquinone binding(GO:0048039) |
0.0 | 0.1 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 2.6 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 1.5 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 1.1 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 1.6 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 4.7 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.1 | 3.0 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.1 | 0.9 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.1 | 1.6 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 2.7 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.1 | 0.4 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.1 | 1.0 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 1.3 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.1 | 1.4 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.1 | 2.2 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 1.1 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.2 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.9 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.8 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 1.2 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 1.8 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 1.5 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 1.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.2 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.6 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 1.0 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 1.0 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.0 | 1.1 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 2.7 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 1.0 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.0 | 1.2 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.7 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.3 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 1.6 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 1.1 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.0 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 1.2 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 1.2 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.2 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 0.5 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 1.6 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.5 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.2 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.0 | 6.1 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.3 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.6 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.6 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.0 | 0.3 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.5 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.4 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.2 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.4 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.5 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.3 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 1.0 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.7 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.3 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.3 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 0.2 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.6 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.3 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.2 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.3 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.1 | PID BARD1 PATHWAY | BARD1 signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 0.4 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.3 | 6.5 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.3 | 2.8 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.3 | 6.2 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.2 | 1.2 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 0.3 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.1 | 1.4 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 2.2 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 0.3 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.1 | 1.0 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.1 | 2.8 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.1 | 1.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 1.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.1 | 0.9 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 0.9 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.1 | 0.7 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 1.5 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 0.9 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.1 | 1.1 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.1 | 1.0 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.1 | 0.4 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 1.6 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.1 | 3.5 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.1 | 1.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 1.2 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 0.9 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.1 | 1.3 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 0.4 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.1 | 0.9 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.1 | 0.1 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.1 | 1.7 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 0.9 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 0.8 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.1 | 1.5 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.1 | 1.6 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.1 | 1.6 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.1 | 0.4 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.1 | 2.4 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 1.1 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 2.3 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 4.8 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.8 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
0.0 | 0.8 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.3 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 1.3 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.0 | 0.4 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.4 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.0 | 0.8 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.0 | 0.7 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.3 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
0.0 | 1.4 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.6 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 1.3 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 1.0 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.4 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
0.0 | 0.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 1.1 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 1.3 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.5 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
0.0 | 0.2 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.0 | 0.2 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.5 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
0.0 | 1.1 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
0.0 | 0.9 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
0.0 | 0.9 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.7 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.2 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.0 | 0.7 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.9 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 0.5 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.6 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.6 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
0.0 | 0.6 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.0 | 0.7 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.3 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 0.8 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.0 | 0.7 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 0.2 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.2 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.8 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.4 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.3 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.0 | 0.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.4 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 1.4 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.0 | 0.5 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.4 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.3 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.3 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 2.8 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.3 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.6 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.5 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.1 | REACTOME SLC MEDIATED TRANSMEMBRANE TRANSPORT | Genes involved in SLC-mediated transmembrane transport |
0.0 | 0.4 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.0 | 0.1 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |