2D miR_HR1_12
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Bptf
|
ENSMUSG00000040481.10 | bromodomain PHD finger transcription factor |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Bptf | mm10_v2_chr11_-_107131922_107131954 | 0.75 | 4.6e-03 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr4_-_132757162 | 1.97 |
ENSMUST00000030709.8
|
Smpdl3b
|
sphingomyelin phosphodiesterase, acid-like 3B |
| chr12_-_103904887 | 1.87 |
ENSMUST00000074051.5
|
Serpina1c
|
serine (or cysteine) peptidase inhibitor, clade A, member 1C |
| chr11_-_60811228 | 1.83 |
ENSMUST00000018744.8
|
Shmt1
|
serine hydroxymethyltransferase 1 (soluble) |
| chr12_-_103863551 | 1.75 |
ENSMUST00000085056.6
ENSMUST00000072876.5 ENSMUST00000124717.1 |
Serpina1a
|
serine (or cysteine) peptidase inhibitor, clade A, member 1A |
| chr13_-_100786402 | 1.64 |
ENSMUST00000174038.1
ENSMUST00000091295.7 ENSMUST00000072119.8 |
Ccnb1
|
cyclin B1 |
| chr8_-_41215146 | 1.58 |
ENSMUST00000034003.4
|
Fgl1
|
fibrinogen-like protein 1 |
| chr12_-_103956891 | 1.56 |
ENSMUST00000085054.4
|
Serpina1e
|
serine (or cysteine) peptidase inhibitor, clade A, member 1E |
| chr8_-_84773381 | 1.53 |
ENSMUST00000109764.1
|
Nfix
|
nuclear factor I/X |
| chr14_-_47411666 | 1.52 |
ENSMUST00000111778.3
|
Dlgap5
|
discs, large (Drosophila) homolog-associated protein 5 |
| chr1_+_130865669 | 1.48 |
ENSMUST00000038829.5
|
Faim3
|
Fas apoptotic inhibitory molecule 3 |
| chr6_+_134929118 | 1.27 |
ENSMUST00000185152.1
ENSMUST00000184504.1 |
RP23-45G16.5
|
RP23-45G16.5 |
| chr4_-_89282152 | 1.26 |
ENSMUST00000060501.4
|
Cdkn2a
|
cyclin-dependent kinase inhibitor 2A |
| chr18_-_34751502 | 1.21 |
ENSMUST00000060710.7
|
Cdc25c
|
cell division cycle 25C |
| chr12_-_103738158 | 1.21 |
ENSMUST00000095450.4
|
Serpina1b
|
serine (or cysteine) preptidase inhibitor, clade A, member 1B |
| chr9_-_123260776 | 1.21 |
ENSMUST00000068140.4
|
Tmem158
|
transmembrane protein 158 |
| chr2_+_110017879 | 1.15 |
ENSMUST00000150183.2
|
Ccdc34
|
coiled-coil domain containing 34 |
| chr6_+_134929089 | 1.14 |
ENSMUST00000183867.1
ENSMUST00000184991.1 ENSMUST00000183905.1 |
RP23-45G16.5
|
RP23-45G16.5 |
| chr4_-_117182623 | 1.12 |
ENSMUST00000065896.2
|
Kif2c
|
kinesin family member 2C |
| chr1_-_44101661 | 1.10 |
ENSMUST00000152239.1
|
Tex30
|
testis expressed 30 |
| chr12_+_33429605 | 1.05 |
ENSMUST00000020877.7
|
Twistnb
|
TWIST neighbor |
| chr2_+_152847961 | 1.03 |
ENSMUST00000164120.1
ENSMUST00000178997.1 ENSMUST00000109816.1 |
Tpx2
|
TPX2, microtubule-associated protein homolog (Xenopus laevis) |
| chr5_+_96209463 | 1.03 |
ENSMUST00000117766.1
|
Mrpl1
|
mitochondrial ribosomal protein L1 |
| chr14_-_47418407 | 1.02 |
ENSMUST00000043296.3
|
Dlgap5
|
discs, large (Drosophila) homolog-associated protein 5 |
| chr2_+_150909565 | 1.02 |
ENSMUST00000028948.4
|
Gins1
|
GINS complex subunit 1 (Psf1 homolog) |
| chr9_-_48911067 | 0.99 |
ENSMUST00000003826.7
|
Htr3a
|
5-hydroxytryptamine (serotonin) receptor 3A |
| chr13_-_49652714 | 0.99 |
ENSMUST00000021818.7
|
Cenpp
|
centromere protein P |
| chr2_-_113848655 | 0.94 |
ENSMUST00000102545.1
ENSMUST00000110948.1 |
Arhgap11a
|
Rho GTPase activating protein 11A |
| chr2_+_152847993 | 0.93 |
ENSMUST00000028969.8
|
Tpx2
|
TPX2, microtubule-associated protein homolog (Xenopus laevis) |
| chr14_+_70545251 | 0.93 |
ENSMUST00000047218.3
|
Reep4
|
receptor accessory protein 4 |
| chr10_-_69352886 | 0.89 |
ENSMUST00000119827.1
ENSMUST00000020099.5 |
Cdk1
|
cyclin-dependent kinase 1 |
| chr8_+_13339656 | 0.85 |
ENSMUST00000170909.1
|
Tfdp1
|
transcription factor Dp 1 |
| chr7_+_78895903 | 0.84 |
ENSMUST00000107425.1
ENSMUST00000107421.1 ENSMUST00000107423.1 |
Aen
|
apoptosis enhancing nuclease |
| chr2_+_110017806 | 0.84 |
ENSMUST00000028580.5
|
Ccdc34
|
coiled-coil domain containing 34 |
| chrX_-_102157065 | 0.82 |
ENSMUST00000056904.2
|
Ercc6l
|
excision repair cross-complementing rodent repair deficiency complementation group 6 like |
| chrX_+_134308084 | 0.79 |
ENSMUST00000081064.5
ENSMUST00000101251.1 ENSMUST00000129782.1 |
Cenpi
|
centromere protein I |
| chr4_-_132732514 | 0.77 |
ENSMUST00000045550.4
|
Xkr8
|
X Kell blood group precursor related family member 8 homolog |
| chr1_-_33669745 | 0.77 |
ENSMUST00000027312.9
|
Prim2
|
DNA primase, p58 subunit |
| chr3_-_95357156 | 0.77 |
ENSMUST00000107171.3
ENSMUST00000015841.5 ENSMUST00000107170.2 |
Setdb1
|
SET domain, bifurcated 1 |
| chr1_-_119913162 | 0.76 |
ENSMUST00000037906.5
|
Tmem177
|
transmembrane protein 177 |
| chr18_+_4994600 | 0.76 |
ENSMUST00000140448.1
|
Svil
|
supervillin |
| chr12_-_65172560 | 0.74 |
ENSMUST00000052201.8
|
Mis18bp1
|
MIS18 binding protein 1 |
| chr4_+_138775735 | 0.74 |
ENSMUST00000030528.2
|
Pla2g2d
|
phospholipase A2, group IID |
| chr6_-_67339661 | 0.74 |
ENSMUST00000117441.1
|
Il12rb2
|
interleukin 12 receptor, beta 2 |
| chr15_-_81960851 | 0.73 |
ENSMUST00000071462.6
ENSMUST00000023112.5 |
Pmm1
|
phosphomannomutase 1 |
| chr12_-_103773592 | 0.72 |
ENSMUST00000078869.5
|
Serpina1d
|
serine (or cysteine) peptidase inhibitor, clade A, member 1D |
| chr2_+_119618717 | 0.72 |
ENSMUST00000028771.7
|
Nusap1
|
nucleolar and spindle associated protein 1 |
| chr5_+_92925400 | 0.72 |
ENSMUST00000172706.1
|
Shroom3
|
shroom family member 3 |
| chr4_-_117178726 | 0.72 |
ENSMUST00000153953.1
ENSMUST00000106436.1 |
Kif2c
|
kinesin family member 2C |
| chr2_-_127133909 | 0.71 |
ENSMUST00000110387.3
|
Ncaph
|
non-SMC condensin I complex, subunit H |
| chrX_+_36795642 | 0.69 |
ENSMUST00000016463.3
|
Slc25a5
|
solute carrier family 25 (mitochondrial carrier, adenine nucleotide translocator), member 5 |
| chr1_-_178337774 | 0.68 |
ENSMUST00000037748.7
|
Hnrnpu
|
heterogeneous nuclear ribonucleoprotein U |
| chr1_+_34005872 | 0.68 |
ENSMUST00000182296.1
|
Dst
|
dystonin |
| chr18_+_34751803 | 0.67 |
ENSMUST00000181453.1
ENSMUST00000181641.1 |
2010110K18Rik
|
RIKEN cDNA 2010110K18 gene |
| chr1_+_134962553 | 0.67 |
ENSMUST00000027687.7
|
Ube2t
|
ubiquitin-conjugating enzyme E2T (putative) |
| chr5_-_72587544 | 0.67 |
ENSMUST00000031124.4
|
Gm5868
|
predicted gene 5868 |
| chr19_-_4191035 | 0.67 |
ENSMUST00000045864.2
|
Tbc1d10c
|
TBC1 domain family, member 10c |
| chr15_+_102296256 | 0.66 |
ENSMUST00000064924.4
|
Espl1
|
extra spindle poles-like 1 (S. cerevisiae) |
| chr5_-_110779937 | 0.65 |
ENSMUST00000112426.1
|
Pus1
|
pseudouridine synthase 1 |
| chr5_+_123749696 | 0.63 |
ENSMUST00000031366.7
|
Kntc1
|
kinetochore associated 1 |
| chr13_-_106936907 | 0.63 |
ENSMUST00000080856.7
|
Ipo11
|
importin 11 |
| chr1_-_105659008 | 0.62 |
ENSMUST00000070699.8
|
Pign
|
phosphatidylinositol glycan anchor biosynthesis, class N |
| chr8_+_20136455 | 0.62 |
ENSMUST00000179299.1
ENSMUST00000096485.4 |
Gm21811
|
predicted gene, 21811 |
| chr18_-_47333311 | 0.61 |
ENSMUST00000126684.1
ENSMUST00000156422.1 |
Sema6a
|
sema domain, transmembrane domain (TM), and cytoplasmic domain, (semaphorin) 6A |
| chr13_+_24415104 | 0.61 |
ENSMUST00000110391.2
|
Cmah
|
cytidine monophospho-N-acetylneuraminic acid hydroxylase |
| chr2_-_65567505 | 0.61 |
ENSMUST00000100069.2
|
Scn3a
|
sodium channel, voltage-gated, type III, alpha |
| chr13_-_24761440 | 0.61 |
ENSMUST00000176890.1
ENSMUST00000175689.1 |
Gmnn
|
geminin |
| chr11_-_11808923 | 0.60 |
ENSMUST00000109664.1
ENSMUST00000150714.1 ENSMUST00000047689.4 ENSMUST00000171938.1 ENSMUST00000171080.1 |
Fignl1
|
fidgetin-like 1 |
| chr15_+_77084367 | 0.60 |
ENSMUST00000181870.1
|
1700109K24Rik
|
RIKEN cDNA 1700109K24 gene |
| chr6_-_131388417 | 0.59 |
ENSMUST00000032309.6
ENSMUST00000087865.2 |
Ybx3
|
Y box protein 3 |
| chr12_+_41024090 | 0.59 |
ENSMUST00000132121.1
|
Immp2l
|
IMP2 inner mitochondrial membrane peptidase-like (S. cerevisiae) |
| chr3_+_69004969 | 0.59 |
ENSMUST00000136502.1
ENSMUST00000107803.1 |
Smc4
|
structural maintenance of chromosomes 4 |
| chr2_-_65567465 | 0.59 |
ENSMUST00000066432.5
|
Scn3a
|
sodium channel, voltage-gated, type III, alpha |
| chr6_+_113531675 | 0.58 |
ENSMUST00000036340.5
ENSMUST00000101051.2 |
Fancd2
|
Fanconi anemia, complementation group D2 |
| chr5_-_135251209 | 0.58 |
ENSMUST00000062572.2
|
Fzd9
|
frizzled homolog 9 (Drosophila) |
| chr7_-_80534998 | 0.58 |
ENSMUST00000170315.1
ENSMUST00000081314.4 |
Blm
|
Bloom syndrome, RecQ helicase-like |
| chr4_-_126201117 | 0.57 |
ENSMUST00000136157.1
|
Thrap3
|
thyroid hormone receptor associated protein 3 |
| chr3_+_69004711 | 0.57 |
ENSMUST00000042901.8
|
Smc4
|
structural maintenance of chromosomes 4 |
| chr12_-_72917760 | 0.57 |
ENSMUST00000110489.2
|
4930447C04Rik
|
RIKEN cDNA 4930447C04 gene |
| chr3_+_67430096 | 0.57 |
ENSMUST00000077271.6
ENSMUST00000161009.1 |
Gfm1
|
G elongation factor, mitochondrial 1 |
| chr4_-_126202335 | 0.56 |
ENSMUST00000142125.1
ENSMUST00000106141.2 |
Thrap3
|
thyroid hormone receptor associated protein 3 |
| chr7_+_45575100 | 0.56 |
ENSMUST00000140077.1
|
Bcat2
|
branched chain aminotransferase 2, mitochondrial |
| chr16_-_46155077 | 0.56 |
ENSMUST00000059524.5
|
Gm4737
|
predicted gene 4737 |
| chr1_-_39651165 | 0.56 |
ENSMUST00000053355.4
|
Creg2
|
cellular repressor of E1A-stimulated genes 2 |
| chr2_+_28468056 | 0.56 |
ENSMUST00000038600.3
|
Mrps2
|
mitochondrial ribosomal protein S2 |
| chr5_+_76656512 | 0.55 |
ENSMUST00000086909.4
|
Gm10430
|
predicted gene 10430 |
| chr3_+_124321031 | 0.55 |
ENSMUST00000058994.4
|
Tram1l1
|
translocation associated membrane protein 1-like 1 |
| chr11_-_90390895 | 0.55 |
ENSMUST00000004051.7
|
Hlf
|
hepatic leukemia factor |
| chr8_-_107588392 | 0.54 |
ENSMUST00000044106.4
|
Psmd7
|
proteasome (prosome, macropain) 26S subunit, non-ATPase, 7 |
| chr18_+_14706145 | 0.54 |
ENSMUST00000040860.1
|
Psma8
|
proteasome (prosome, macropain) subunit, alpha type, 8 |
| chr8_-_27202542 | 0.54 |
ENSMUST00000038174.6
|
Got1l1
|
glutamic-oxaloacetic transaminase 1-like 1 |
| chr7_-_118116171 | 0.54 |
ENSMUST00000131374.1
|
Rps15a
|
ribosomal protein S15A |
| chr6_+_117900311 | 0.53 |
ENSMUST00000177743.1
ENSMUST00000167182.1 |
Hnrnpf
|
heterogeneous nuclear ribonucleoprotein F |
| chr5_-_65335564 | 0.52 |
ENSMUST00000172780.1
|
Rfc1
|
replication factor C (activator 1) 1 |
| chr15_-_76639840 | 0.52 |
ENSMUST00000166974.1
ENSMUST00000168185.1 |
Tonsl
|
tonsoku-like, DNA repair protein |
| chr11_-_69761963 | 0.52 |
ENSMUST00000102586.3
|
Slc35g3
|
solute carrier family 35, member G3 |
| chr4_+_140701466 | 0.52 |
ENSMUST00000038893.5
ENSMUST00000138808.1 |
Rcc2
|
regulator of chromosome condensation 2 |
| chr6_-_115037824 | 0.52 |
ENSMUST00000174848.1
ENSMUST00000032461.5 |
Tamm41
|
TAM41, mitochondrial translocator assembly and maintenance protein, homolog (S. cerevisiae) |
| chr10_-_24836165 | 0.52 |
ENSMUST00000020169.7
|
Enpp3
|
ectonucleotide pyrophosphatase/phosphodiesterase 3 |
| chr10_+_79960145 | 0.52 |
ENSMUST00000045247.7
|
Wdr18
|
WD repeat domain 18 |
| chr15_-_102350692 | 0.52 |
ENSMUST00000041208.7
|
Aaas
|
achalasia, adrenocortical insufficiency, alacrimia |
| chr6_-_30390997 | 0.51 |
ENSMUST00000152391.2
ENSMUST00000115184.1 ENSMUST00000080812.7 ENSMUST00000102992.3 |
Zc3hc1
|
zinc finger, C3HC type 1 |
| chr17_+_32036098 | 0.51 |
ENSMUST00000081339.6
|
Rrp1b
|
ribosomal RNA processing 1 homolog B (S. cerevisiae) |
| chr1_+_6734827 | 0.50 |
ENSMUST00000139838.1
|
St18
|
suppression of tumorigenicity 18 |
| chr5_+_98854434 | 0.50 |
ENSMUST00000031278.4
|
Bmp3
|
bone morphogenetic protein 3 |
| chr11_+_106276715 | 0.50 |
ENSMUST00000044462.3
|
Tcam1
|
testicular cell adhesion molecule 1 |
| chr16_+_37011758 | 0.50 |
ENSMUST00000071452.5
ENSMUST00000054034.6 |
Polq
|
polymerase (DNA directed), theta |
| chr10_+_7667503 | 0.49 |
ENSMUST00000040135.8
|
Nup43
|
nucleoporin 43 |
| chr8_-_111300222 | 0.49 |
ENSMUST00000038739.4
|
Rfwd3
|
ring finger and WD repeat domain 3 |
| chr5_-_148371525 | 0.49 |
ENSMUST00000138596.1
|
Slc7a1
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 1 |
| chr7_+_102441685 | 0.49 |
ENSMUST00000033283.9
|
Rrm1
|
ribonucleotide reductase M1 |
| chr7_-_35556304 | 0.49 |
ENSMUST00000040962.5
|
Nudt19
|
nudix (nucleoside diphosphate linked moiety X)-type motif 19 |
| chr7_-_19280032 | 0.48 |
ENSMUST00000032560.4
|
Ppm1n
|
protein phosphatase, Mg2+/Mn2+ dependent, 1N (putative) |
| chr11_-_34833631 | 0.48 |
ENSMUST00000093191.2
|
Spdl1
|
spindle apparatus coiled-coil protein 1 |
| chrX_+_169685191 | 0.48 |
ENSMUST00000112104.1
ENSMUST00000112107.1 |
Mid1
|
midline 1 |
| chrX_-_157598642 | 0.48 |
ENSMUST00000112522.2
ENSMUST00000179062.1 |
Mbtps2
Yy2
|
membrane-bound transcription factor peptidase, site 2 Yy2 transcription factor |
| chr8_+_57488053 | 0.48 |
ENSMUST00000180690.1
|
2500002B13Rik
|
RIKEN cDNA 2500002B13 gene |
| chr2_+_71873224 | 0.48 |
ENSMUST00000006669.5
|
Pdk1
|
pyruvate dehydrogenase kinase, isoenzyme 1 |
| chr3_+_67374091 | 0.48 |
ENSMUST00000077916.5
|
Mlf1
|
myeloid leukemia factor 1 |
| chr2_+_107290590 | 0.47 |
ENSMUST00000037012.2
|
Kcna4
|
potassium voltage-gated channel, shaker-related subfamily, member 4 |
| chr11_-_35834492 | 0.46 |
ENSMUST00000018992.3
|
Rars
|
arginyl-tRNA synthetase |
| chr11_-_94973447 | 0.46 |
ENSMUST00000100551.4
ENSMUST00000152042.1 |
Sgca
|
sarcoglycan, alpha (dystrophin-associated glycoprotein) |
| chr14_+_31208309 | 0.46 |
ENSMUST00000169169.1
|
Tnnc1
|
troponin C, cardiac/slow skeletal |
| chrX_-_48513518 | 0.46 |
ENSMUST00000114945.2
ENSMUST00000037349.7 |
Aifm1
|
apoptosis-inducing factor, mitochondrion-associated 1 |
| chr8_-_57487801 | 0.46 |
ENSMUST00000034022.3
|
Sap30
|
sin3 associated polypeptide |
| chr2_-_59948155 | 0.46 |
ENSMUST00000153136.1
|
Baz2b
|
bromodomain adjacent to zinc finger domain, 2B |
| chr4_+_117019400 | 0.45 |
ENSMUST00000106448.2
ENSMUST00000106447.2 |
Eif2b3
|
eukaryotic translation initiation factor 2B, subunit 3 |
| chr2_+_156065180 | 0.45 |
ENSMUST00000038860.5
|
Spag4
|
sperm associated antigen 4 |
| chr16_-_57606816 | 0.45 |
ENSMUST00000114371.3
|
Cmss1
|
cms small ribosomal subunit 1 |
| chr6_-_28449251 | 0.45 |
ENSMUST00000164519.2
ENSMUST00000171089.2 ENSMUST00000031718.7 |
Pax4
|
paired box gene 4 |
| chr4_+_123282778 | 0.45 |
ENSMUST00000106243.1
ENSMUST00000106241.1 ENSMUST00000080178.6 |
Pabpc4
|
poly(A) binding protein, cytoplasmic 4 |
| chr16_-_4559720 | 0.45 |
ENSMUST00000005862.7
|
Tfap4
|
transcription factor AP4 |
| chr7_+_75643223 | 0.45 |
ENSMUST00000137959.1
|
Akap13
|
A kinase (PRKA) anchor protein 13 |
| chr8_+_106893616 | 0.44 |
ENSMUST00000047629.5
|
Cirh1a
|
cirrhosis, autosomal recessive 1A (human) |
| chr1_-_195176707 | 0.44 |
ENSMUST00000082321.3
|
Cr2
|
complement receptor 2 |
| chr1_-_44101982 | 0.44 |
ENSMUST00000127923.1
|
Tex30
|
testis expressed 30 |
| chr11_+_69015911 | 0.44 |
ENSMUST00000021278.7
ENSMUST00000161455.1 ENSMUST00000116359.2 |
Ctc1
|
CTS telomere maintenance complex component 1 |
| chr8_+_69808672 | 0.43 |
ENSMUST00000036074.8
ENSMUST00000123453.1 |
Gmip
|
Gem-interacting protein |
| chr9_-_89092835 | 0.43 |
ENSMUST00000167113.1
|
Trim43b
|
tripartite motif-containing 43B |
| chr8_+_70152754 | 0.43 |
ENSMUST00000072500.6
ENSMUST00000164040.1 ENSMUST00000110146.2 ENSMUST00000110143.1 ENSMUST00000110141.2 ENSMUST00000110140.1 |
2310045N01Rik
Mef2b
|
RIKEN cDNA 2310045N01 gene myocyte enhancer factor 2B |
| chr5_+_23850590 | 0.43 |
ENSMUST00000181574.1
|
2700038G22Rik
|
RIKEN cDNA 2700038G22 gene |
| chr7_-_133123160 | 0.42 |
ENSMUST00000166439.1
|
Ctbp2
|
C-terminal binding protein 2 |
| chr5_-_36586239 | 0.42 |
ENSMUST00000130417.1
ENSMUST00000124036.1 |
Tbc1d14
|
TBC1 domain family, member 14 |
| chr11_-_106779483 | 0.42 |
ENSMUST00000021060.5
|
Polg2
|
polymerase (DNA directed), gamma 2, accessory subunit |
| chr13_-_77131276 | 0.42 |
ENSMUST00000159300.1
|
Ankrd32
|
ankyrin repeat domain 32 |
| chr17_-_94749874 | 0.42 |
ENSMUST00000171284.1
|
Mettl4
|
methyltransferase like 4 |
| chr2_-_28916412 | 0.41 |
ENSMUST00000050776.2
ENSMUST00000113849.1 |
Barhl1
|
BarH-like 1 (Drosophila) |
| chr17_+_84626458 | 0.41 |
ENSMUST00000025101.8
|
Dync2li1
|
dynein cytoplasmic 2 light intermediate chain 1 |
| chr15_-_58324161 | 0.41 |
ENSMUST00000022985.1
|
Klhl38
|
kelch-like 38 |
| chr19_-_40402267 | 0.41 |
ENSMUST00000099467.3
ENSMUST00000099466.3 ENSMUST00000165212.1 ENSMUST00000165469.1 |
Sorbs1
|
sorbin and SH3 domain containing 1 |
| chr6_+_57702601 | 0.41 |
ENSMUST00000072954.1
ENSMUST00000050077.8 |
Lancl2
|
LanC (bacterial lantibiotic synthetase component C)-like 2 |
| chr12_-_31634592 | 0.41 |
ENSMUST00000020979.7
ENSMUST00000177962.1 |
Bcap29
|
B cell receptor associated protein 29 |
| chr19_-_37330613 | 0.41 |
ENSMUST00000131070.1
|
Ide
|
insulin degrading enzyme |
| chr6_+_106769120 | 0.41 |
ENSMUST00000113247.1
ENSMUST00000113249.1 ENSMUST00000057578.9 ENSMUST00000113248.1 |
Trnt1
|
tRNA nucleotidyl transferase, CCA-adding, 1 |
| chr3_-_30599863 | 0.40 |
ENSMUST00000047630.6
|
Actrt3
|
actin related protein T3 |
| chr11_-_116027961 | 0.40 |
ENSMUST00000106454.1
|
H3f3b
|
H3 histone, family 3B |
| chr8_-_46124146 | 0.40 |
ENSMUST00000170416.1
|
Snx25
|
sorting nexin 25 |
| chr1_+_87594545 | 0.40 |
ENSMUST00000165109.1
ENSMUST00000070898.5 |
Neu2
|
neuraminidase 2 |
| chr18_+_36760214 | 0.40 |
ENSMUST00000049323.7
|
Wdr55
|
WD repeat domain 55 |
| chr2_-_59882541 | 0.40 |
ENSMUST00000102751.2
|
Wdsub1
|
WD repeat, SAM and U-box domain containing 1 |
| chr7_-_101903783 | 0.39 |
ENSMUST00000106969.1
|
Tomt
|
transmembrane O-methyltransferase |
| chr10_+_93540626 | 0.39 |
ENSMUST00000092215.5
|
Ccdc38
|
coiled-coil domain containing 38 |
| chr4_+_136172367 | 0.39 |
ENSMUST00000061721.5
|
E2f2
|
E2F transcription factor 2 |
| chr9_-_107985863 | 0.39 |
ENSMUST00000048568.4
|
Fam212a
|
family with sequence similarity 212, member A |
| chr7_+_140137559 | 0.39 |
ENSMUST00000036977.8
|
Mtg1
|
mitochondrial GTPase 1 homolog (S. cerevisiae) |
| chr3_+_81999461 | 0.39 |
ENSMUST00000107736.1
|
Asic5
|
acid-sensing (proton-gated) ion channel family member 5 |
| chr4_-_150909428 | 0.39 |
ENSMUST00000128075.1
ENSMUST00000105674.1 ENSMUST00000105673.1 |
Park7
|
Parkinson disease (autosomal recessive, early onset) 7 |
| chr18_+_69593361 | 0.39 |
ENSMUST00000114978.2
ENSMUST00000114977.1 |
Tcf4
|
transcription factor 4 |
| chr2_+_92185438 | 0.39 |
ENSMUST00000128781.2
|
Phf21a
|
PHD finger protein 21A |
| chr7_-_64374071 | 0.38 |
ENSMUST00000163289.1
|
Fan1
|
FANCD2/FANCI-associated nuclease 1 |
| chr16_-_4077778 | 0.38 |
ENSMUST00000006137.8
|
Trap1
|
TNF receptor-associated protein 1 |
| chr4_-_149137536 | 0.38 |
ENSMUST00000176124.1
ENSMUST00000177408.1 ENSMUST00000105695.1 ENSMUST00000030813.3 |
Apitd1
|
apoptosis-inducing, TAF9-like domain 1 |
| chr7_-_133122615 | 0.38 |
ENSMUST00000167218.1
|
Ctbp2
|
C-terminal binding protein 2 |
| chr7_+_140967221 | 0.38 |
ENSMUST00000106042.2
|
Ifitm1
|
interferon induced transmembrane protein 1 |
| chr2_-_59882556 | 0.38 |
ENSMUST00000128671.1
ENSMUST00000028368.7 ENSMUST00000140475.1 |
Wdsub1
|
WD repeat, SAM and U-box domain containing 1 |
| chr9_+_83548309 | 0.37 |
ENSMUST00000113215.3
|
Sh3bgrl2
|
SH3 domain binding glutamic acid-rich protein like 2 |
| chr5_-_143895025 | 0.37 |
ENSMUST00000079624.5
ENSMUST00000110717.2 |
Ankrd61
|
ankyrin repeat domain 61 |
| chr15_+_82252397 | 0.37 |
ENSMUST00000136948.1
|
1500009C09Rik
|
RIKEN cDNA 1500009C09 gene |
| chr13_-_40730416 | 0.37 |
ENSMUST00000021787.5
|
Tfap2a
|
transcription factor AP-2, alpha |
| chr16_-_11909398 | 0.37 |
ENSMUST00000127972.1
ENSMUST00000121750.1 ENSMUST00000096272.4 ENSMUST00000073371.6 |
Cpped1
|
calcineurin-like phosphoesterase domain containing 1 |
| chr6_-_147087023 | 0.37 |
ENSMUST00000100780.2
|
Mansc4
|
MANSC domain containing 4 |
| chr19_+_12798574 | 0.37 |
ENSMUST00000025601.6
|
Lpxn
|
leupaxin |
| chr17_-_86145139 | 0.36 |
ENSMUST00000095187.3
|
Srbd1
|
S1 RNA binding domain 1 |
| chr17_+_7925990 | 0.36 |
ENSMUST00000036370.7
|
Tagap
|
T cell activation Rho GTPase activating protein |
| chrX_+_159532674 | 0.36 |
ENSMUST00000057180.6
|
A830080D01Rik
|
RIKEN cDNA A830080D01 gene |
| chr11_-_100712429 | 0.35 |
ENSMUST00000006973.5
ENSMUST00000103118.3 |
Kat2a
|
K(lysine) acetyltransferase 2A |
| chrX_-_97377190 | 0.35 |
ENSMUST00000037353.3
|
Eda2r
|
ectodysplasin A2 receptor |
| chr19_+_44333092 | 0.35 |
ENSMUST00000058856.8
|
Scd4
|
stearoyl-coenzyme A desaturase 4 |
| chr4_-_127061126 | 0.35 |
ENSMUST00000106102.2
|
Zmym1
|
zinc finger, MYM domain containing 1 |
| chr5_+_69556924 | 0.35 |
ENSMUST00000087228.4
ENSMUST00000031113.6 |
Guf1
|
GUF1 GTPase homolog (S. cerevisiae) |
| chr4_-_127061085 | 0.35 |
ENSMUST00000136186.1
ENSMUST00000106099.1 |
Zmym1
|
zinc finger, MYM domain containing 1 |
| chr5_-_149051300 | 0.35 |
ENSMUST00000110505.1
|
Hmgb1
|
high mobility group box 1 |
| chr1_-_128359610 | 0.35 |
ENSMUST00000027601.4
|
Mcm6
|
minichromosome maintenance deficient 6 (MIS5 homolog, S. pombe) (S. cerevisiae) |
| chr3_+_116878227 | 0.34 |
ENSMUST00000040260.6
|
Frrs1
|
ferric-chelate reductase 1 |
| chr2_-_109278274 | 0.34 |
ENSMUST00000081631.3
|
Mettl15
|
methyltransferase like 15 |
| chr3_+_138143888 | 0.34 |
ENSMUST00000161141.1
|
Trmt10a
|
tRNA methyltransferase 10A |
| chr13_-_74062262 | 0.34 |
ENSMUST00000036456.6
|
Cep72
|
centrosomal protein 72 |
| chr8_-_72435043 | 0.34 |
ENSMUST00000109974.1
|
Calr3
|
calreticulin 3 |
| chr15_-_103215285 | 0.34 |
ENSMUST00000122182.1
ENSMUST00000108813.3 ENSMUST00000127191.1 |
Cbx5
|
chromobox 5 |
| chr17_-_34305715 | 0.34 |
ENSMUST00000174074.1
|
Gm20513
|
predicted gene 20513 |
| chr2_+_68104671 | 0.33 |
ENSMUST00000042456.3
|
B3galt1
|
UDP-Gal:betaGlcNAc beta 1,3-galactosyltransferase, polypeptide 1 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.6 | GO:0031660 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
| 0.5 | 1.4 | GO:2000371 | regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.5 | 1.8 | GO:0046073 | dTMP biosynthetic process(GO:0006231) dTMP metabolic process(GO:0046073) |
| 0.4 | 0.8 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.4 | 1.8 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.3 | 1.7 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.3 | 2.0 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.3 | 1.0 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.3 | 0.9 | GO:0045819 | plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
| 0.2 | 0.7 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
| 0.2 | 1.2 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.2 | 0.7 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.2 | 0.7 | GO:2000284 | glycolate metabolic process(GO:0009441) enzyme active site formation via L-cysteine sulfinic acid(GO:0018323) primary alcohol biosynthetic process(GO:0034309) cellular response to glyoxal(GO:0036471) glycolate biosynthetic process(GO:0046295) negative regulation of TRAIL-activated apoptotic signaling pathway(GO:1903122) regulation of pyrroline-5-carboxylate reductase activity(GO:1903167) positive regulation of pyrroline-5-carboxylate reductase activity(GO:1903168) regulation of tyrosine 3-monooxygenase activity(GO:1903176) positive regulation of tyrosine 3-monooxygenase activity(GO:1903178) L-dopa metabolic process(GO:1903184) L-dopa biosynthetic process(GO:1903185) glyoxal metabolic process(GO:1903189) regulation of L-dopa biosynthetic process(GO:1903195) positive regulation of L-dopa biosynthetic process(GO:1903197) regulation of L-dopa decarboxylase activity(GO:1903198) positive regulation of L-dopa decarboxylase activity(GO:1903200) positive regulation of cellular amino acid biosynthetic process(GO:2000284) |
| 0.2 | 0.7 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.2 | 0.7 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.2 | 0.7 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
| 0.2 | 0.8 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.2 | 0.6 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.2 | 0.8 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.2 | 0.6 | GO:0010705 | meiotic DNA double-strand break processing involved in reciprocal meiotic recombination(GO:0010705) |
| 0.2 | 0.7 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.2 | 0.5 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.2 | 0.5 | GO:0006592 | ornithine biosynthetic process(GO:0006592) |
| 0.2 | 1.0 | GO:0031120 | snRNA pseudouridine synthesis(GO:0031120) |
| 0.2 | 1.2 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.2 | 1.0 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.2 | 0.7 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
| 0.2 | 0.2 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.2 | 0.5 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
| 0.2 | 0.6 | GO:0046381 | CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.1 | 0.4 | GO:0097534 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
| 0.1 | 2.1 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.1 | 0.6 | GO:1990414 | negative regulation of mitotic recombination(GO:0045950) replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.1 | 0.6 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.7 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.1 | 1.0 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 | 0.4 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.4 | GO:0090646 | mitochondrial tRNA processing(GO:0090646) |
| 0.1 | 0.5 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.1 | 0.4 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
| 0.1 | 0.4 | GO:0021623 | oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) positive regulation of tooth mineralization(GO:0070172) |
| 0.1 | 0.9 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 0.5 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.1 | 0.4 | GO:0071929 | alpha-tubulin acetylation(GO:0071929) |
| 0.1 | 1.2 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.1 | 0.5 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 | 0.5 | GO:0002587 | negative regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002587) |
| 0.1 | 0.7 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 0.1 | 0.3 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.1 | 0.3 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.1 | 0.3 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 0.1 | 1.0 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.1 | 0.4 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.1 | 0.2 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
| 0.1 | 0.5 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.3 | GO:0019405 | hexitol metabolic process(GO:0006059) alditol catabolic process(GO:0019405) fructose biosynthetic process(GO:0046370) |
| 0.1 | 0.3 | GO:0010716 | regulation of collagen catabolic process(GO:0010710) negative regulation of extracellular matrix disassembly(GO:0010716) |
| 0.1 | 0.3 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 0.1 | 0.3 | GO:0034147 | regulation of granuloma formation(GO:0002631) negative regulation of granuloma formation(GO:0002632) regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) tolerance induction to lipopolysaccharide(GO:0072573) |
| 0.1 | 1.6 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 | 0.4 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.1 | 0.3 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 | 0.2 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 0.4 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
| 0.1 | 0.8 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 | 0.6 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.1 | 0.7 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.1 | 0.1 | GO:0060067 | cervix development(GO:0060067) |
| 0.1 | 0.6 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.1 | 0.7 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.1 | 0.4 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.1 | 0.6 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.1 | 0.7 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.1 | 0.2 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.1 | 0.3 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.1 | 0.3 | GO:0030091 | protein repair(GO:0030091) |
| 0.1 | 0.5 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.1 | 0.4 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 | 0.7 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.1 | 0.8 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 | 0.3 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.1 | 0.6 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 | 0.2 | GO:0007521 | muscle cell fate determination(GO:0007521) |
| 0.1 | 0.2 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.1 | 0.4 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.1 | 0.2 | GO:0051030 | snRNA transport(GO:0051030) |
| 0.1 | 0.2 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.1 | 0.5 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 0.1 | 0.2 | GO:0019343 | cysteine biosynthetic process via cystathionine(GO:0019343) |
| 0.1 | 0.6 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.1 | 1.6 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.1 | 0.6 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.1 | 0.3 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.1 | 0.5 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.1 | 0.4 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 | 0.4 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.1 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 0.5 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
| 0.1 | 0.6 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.1 | 2.1 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
| 0.1 | 0.2 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
| 0.1 | 0.4 | GO:0019614 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.1 | 0.2 | GO:1903978 | regulation of microglial cell activation(GO:1903978) |
| 0.1 | 0.9 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.1 | 1.1 | GO:0035634 | response to stilbenoid(GO:0035634) |
| 0.1 | 0.6 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.1 | 0.1 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.1 | 0.2 | GO:0042450 | arginine biosynthetic process via ornithine(GO:0042450) |
| 0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.8 | GO:0051307 | meiotic chromosome separation(GO:0051307) |
| 0.1 | 0.2 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.1 | 0.2 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.1 | 0.2 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.1 | 0.5 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 0.1 | 0.2 | GO:0002101 | tRNA wobble cytosine modification(GO:0002101) |
| 0.1 | 0.4 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.1 | 0.2 | GO:0000478 | endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
| 0.0 | 0.2 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 0.0 | 0.2 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.0 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 | 0.3 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.1 | GO:0072720 | cellular response to UV-A(GO:0071492) response to dithiothreitol(GO:0072720) |
| 0.0 | 0.1 | GO:0090285 | negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.0 | 0.8 | GO:0015809 | arginine transport(GO:0015809) |
| 0.0 | 2.5 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.0 | 0.3 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.0 | 0.1 | GO:0042275 | error-free postreplication DNA repair(GO:0042275) |
| 0.0 | 0.1 | GO:0033577 | protein glycosylation in endoplasmic reticulum(GO:0033577) |
| 0.0 | 0.6 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 | 0.4 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.0 | 0.4 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.0 | 0.3 | GO:0071313 | cellular response to caffeine(GO:0071313) |
| 0.0 | 0.2 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.0 | 1.3 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.0 | 0.1 | GO:0046368 | GDP-L-fucose metabolic process(GO:0046368) |
| 0.0 | 0.1 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.0 | 0.1 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
| 0.0 | 0.3 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 0.8 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.0 | 1.2 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 0.0 | 0.0 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
| 0.0 | 0.5 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.0 | 0.1 | GO:1902460 | transforming growth factor beta activation(GO:0036363) regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.0 | 0.2 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 1.1 | GO:0071173 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.0 | 0.1 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.0 | 0.4 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.0 | 0.1 | GO:0016131 | brassinosteroid metabolic process(GO:0016131) brassinosteroid biosynthetic process(GO:0016132) |
| 0.0 | 0.5 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.3 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.0 | 0.5 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.3 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.1 | GO:0021603 | cranial nerve formation(GO:0021603) |
| 0.0 | 0.2 | GO:0045905 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 | 0.3 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.2 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.1 | GO:0070671 | response to interleukin-12(GO:0070671) |
| 0.0 | 0.1 | GO:0017085 | response to insecticide(GO:0017085) |
| 0.0 | 0.3 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
| 0.0 | 0.3 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) |
| 0.0 | 0.7 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.0 | 0.1 | GO:0003349 | epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.0 | 0.2 | GO:0021681 | cerebellar granular layer development(GO:0021681) |
| 0.0 | 0.2 | GO:0048165 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.0 | 0.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.0 | 0.1 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
| 0.0 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
| 0.0 | 0.1 | GO:0090004 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.0 | 0.4 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.2 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
| 0.0 | 0.3 | GO:0042983 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.0 | 0.5 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 0.3 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.0 | 0.1 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.0 | 0.2 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.0 | 0.1 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 0.0 | 0.3 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.0 | 0.3 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.0 | 0.1 | GO:0030450 | regulation of complement activation, classical pathway(GO:0030450) |
| 0.0 | 0.2 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.0 | 0.1 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.0 | 0.3 | GO:1904636 | response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.0 | 0.2 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 0.2 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.0 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.0 | 2.8 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
| 0.0 | 0.1 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
| 0.0 | 0.1 | GO:0009757 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
| 0.0 | 0.2 | GO:0036337 | Fas signaling pathway(GO:0036337) |
| 0.0 | 0.1 | GO:0034627 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.0 | 0.3 | GO:0061038 | uterus morphogenesis(GO:0061038) |
| 0.0 | 0.7 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.3 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.0 | 0.3 | GO:1903350 | response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
| 0.0 | 0.2 | GO:0009313 | ganglioside catabolic process(GO:0006689) oligosaccharide catabolic process(GO:0009313) |
| 0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 | 0.2 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.0 | 0.4 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 | 0.2 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.0 | 0.4 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
| 0.0 | 0.1 | GO:0052200 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to immune response of other organism involved in symbiotic interaction(GO:0052564) response to host immune response(GO:0052572) response to host(GO:0075136) |
| 0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.0 | 0.1 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.0 | 0.1 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) positive regulation of protein lipidation(GO:1903061) |
| 0.0 | 0.6 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.5 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.0 | 0.1 | GO:0021539 | subthalamus development(GO:0021539) |
| 0.0 | 0.1 | GO:0032824 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
| 0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.0 | 0.2 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.3 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.0 | 0.1 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.0 | 0.4 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 | 0.8 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.4 | GO:1900746 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) |
| 0.0 | 0.1 | GO:2000143 | negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 0.0 | 0.0 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.0 | 0.2 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.0 | 0.3 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
| 0.0 | 0.4 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.0 | 0.9 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.0 | 0.2 | GO:0035655 | interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
| 0.0 | 0.4 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
| 0.0 | 0.3 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.0 | 0.2 | GO:0036371 | protein localization to M-band(GO:0036309) protein localization to T-tubule(GO:0036371) regulation of SA node cell action potential(GO:0098907) |
| 0.0 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.0 | 0.0 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
| 0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.5 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.1 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.2 | GO:0043312 | neutrophil degranulation(GO:0043312) |
| 0.0 | 0.2 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.0 | 0.1 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.0 | 0.3 | GO:0006301 | postreplication repair(GO:0006301) |
| 0.0 | 0.2 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.0 | 0.3 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 | 0.2 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.0 | 0.2 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 | 0.1 | GO:0006548 | histidine catabolic process(GO:0006548) |
| 0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.0 | 0.2 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
| 0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.0 | 0.1 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
| 0.0 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.0 | 0.5 | GO:0048643 | positive regulation of skeletal muscle tissue development(GO:0048643) |
| 0.0 | 0.6 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.3 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
| 0.0 | 0.1 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.0 | 0.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.2 | GO:0006855 | drug transmembrane transport(GO:0006855) |
| 0.0 | 0.1 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 | 0.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.2 | GO:0098598 | learned vocalization behavior or vocal learning(GO:0098598) |
| 0.0 | 0.3 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.1 | GO:0015840 | glycerol transport(GO:0015793) urea transport(GO:0015840) |
| 0.0 | 0.2 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.0 | 0.1 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.0 | 0.1 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.0 | 0.1 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.2 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.0 | 0.2 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.0 | 0.0 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.0 | 0.1 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.0 | 0.0 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.0 | GO:0098971 | anterograde dendritic transport of neurotransmitter receptor complex(GO:0098971) |
| 0.0 | 1.0 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.0 | 0.0 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
| 0.0 | 0.3 | GO:0001967 | suckling behavior(GO:0001967) |
| 0.0 | 0.1 | GO:0071421 | manganese ion transmembrane transport(GO:0071421) |
| 0.0 | 0.4 | GO:0033687 | osteoblast proliferation(GO:0033687) |
| 0.0 | 0.0 | GO:0090238 | lysophospholipid transport(GO:0051977) positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.0 | 0.0 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
| 0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.0 | 0.1 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.0 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.0 | 0.7 | GO:0008156 | negative regulation of DNA replication(GO:0008156) |
| 0.0 | 0.5 | GO:1901099 | negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
| 0.0 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.0 | 0.1 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.0 | 0.0 | GO:0097476 | spinal cord motor neuron migration(GO:0097476) |
| 0.0 | 0.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.2 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.0 | 0.5 | GO:0006414 | translational elongation(GO:0006414) |
| 0.0 | 0.2 | GO:0016191 | synaptic vesicle uncoating(GO:0016191) |
| 0.0 | 0.4 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.1 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.0 | 0.2 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
| 0.0 | 0.0 | GO:2000382 | zygotic specification of dorsal/ventral axis(GO:0007352) positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) positive regulation of mesoderm development(GO:2000382) |
| 0.0 | 0.7 | GO:1904377 | positive regulation of protein localization to plasma membrane(GO:1903078) positive regulation of protein localization to cell periphery(GO:1904377) |
| 0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 0.2 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 | 0.1 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.0 | 0.2 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
| 0.0 | 0.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.0 | 0.0 | GO:0070104 | negative regulation of interleukin-6-mediated signaling pathway(GO:0070104) |
| 0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.2 | GO:0051310 | metaphase plate congression(GO:0051310) |
| 0.0 | 0.4 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.8 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.0 | 0.0 | GO:1900369 | negative regulation of RNA interference(GO:1900369) |
| 0.0 | 0.5 | GO:0034394 | protein localization to cell surface(GO:0034394) |
| 0.0 | 0.1 | GO:1990748 | cellular oxidant detoxification(GO:0098869) cellular detoxification(GO:1990748) |
| 0.0 | 0.1 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.0 | 0.3 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 | 0.1 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.0 | 0.1 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.0 | 0.0 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.0 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 | 0.2 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.3 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.4 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.0 | GO:0046877 | tachykinin receptor signaling pathway(GO:0007217) regulation of saliva secretion(GO:0046877) positive regulation of saliva secretion(GO:0046878) |
| 0.0 | 0.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 | 0.1 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
| 0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.0 | 0.0 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.0 | 0.5 | GO:0002066 | columnar/cuboidal epithelial cell development(GO:0002066) |
| 0.0 | 0.4 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.0 | 0.0 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.6 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.3 | 1.0 | GO:0000811 | GINS complex(GO:0000811) |
| 0.2 | 2.0 | GO:0005818 | aster(GO:0005818) |
| 0.2 | 0.7 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 0.2 | 0.6 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.2 | 0.6 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.2 | 0.6 | GO:1990047 | spindle matrix(GO:1990047) |
| 0.2 | 0.5 | GO:0035101 | FACT complex(GO:0035101) |
| 0.2 | 1.2 | GO:0001652 | granular component(GO:0001652) |
| 0.2 | 1.2 | GO:0000796 | condensin complex(GO:0000796) |
| 0.2 | 0.5 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.2 | 0.8 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.1 | 1.0 | GO:0031429 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
| 0.1 | 0.8 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.1 | 0.4 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 2.5 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 0.7 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.1 | 0.5 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
| 0.1 | 0.7 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 0.7 | GO:0031673 | H zone(GO:0031673) |
| 0.1 | 0.2 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 0.8 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.1 | 0.5 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.1 | 0.3 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.1 | 0.5 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 0.6 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.1 | 0.6 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.1 | 0.8 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 0.7 | GO:0000801 | central element(GO:0000801) |
| 0.1 | 0.7 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 0.1 | 0.5 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.1 | 0.2 | GO:0070985 | TFIIK complex(GO:0070985) |
| 0.1 | 0.6 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.1 | 1.0 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.1 | 1.1 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.1 | 0.8 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 0.4 | GO:0033503 | HULC complex(GO:0033503) |
| 0.1 | 0.5 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 0.6 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.1 | 2.1 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.1 | 0.8 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 0.5 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 0.9 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.1 | 0.2 | GO:0098835 | presynaptic endocytic zone(GO:0098833) presynaptic endocytic zone membrane(GO:0098835) |
| 0.1 | 1.0 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.1 | 0.2 | GO:0031251 | PAN complex(GO:0031251) |
| 0.1 | 0.6 | GO:0045275 | respiratory chain complex III(GO:0045275) |
| 0.0 | 0.4 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 1.7 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.1 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.0 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 1.2 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.0 | 0.8 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.4 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
| 0.0 | 0.6 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.5 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.0 | 0.2 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.0 | 0.3 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.4 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 0.3 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.0 | 1.6 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.1 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.4 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.0 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.0 | 0.3 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 0.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 0.4 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.0 | 0.3 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.0 | 0.1 | GO:1990415 | Pex17p-Pex14p docking complex(GO:1990415) peroxisomal importomer complex(GO:1990429) |
| 0.0 | 0.7 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.0 | 0.5 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 2.8 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 0.1 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.0 | 0.1 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.0 | 0.5 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.1 | GO:0022624 | proteasome accessory complex(GO:0022624) |
| 0.0 | 0.1 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
| 0.0 | 0.3 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 1.2 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 1.4 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 2.3 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| 0.0 | 1.2 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.4 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.4 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.1 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.0 | 0.2 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.2 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 1.1 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.5 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.0 | 0.2 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.2 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.4 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.1 | GO:0033165 | interphotoreceptor matrix(GO:0033165) |
| 0.0 | 0.5 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.0 | 0.8 | GO:0097546 | ciliary base(GO:0097546) |
| 0.0 | 0.2 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.6 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.3 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.3 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 0.1 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 1.4 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
| 0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.3 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.2 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.1 | GO:0070826 | paraferritin complex(GO:0070826) |
| 0.0 | 0.8 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 1.1 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.9 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.2 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.5 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.1 | GO:0005749 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 0.0 | 0.1 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.0 | 0.6 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.3 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.0 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
| 0.0 | 0.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.0 | 3.1 | GO:0031965 | nuclear membrane(GO:0031965) |
| 0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 0.8 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.3 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.4 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.8 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) serine binding(GO:0070905) |
| 0.4 | 1.6 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.3 | 1.3 | GO:0055105 | ubiquitin-protein transferase inhibitor activity(GO:0055105) |
| 0.3 | 0.9 | GO:0000401 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
| 0.2 | 1.7 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.2 | 0.7 | GO:0036470 | tyrosine 3-monooxygenase activator activity(GO:0036470) L-dopa decarboxylase activator activity(GO:0036478) |
| 0.2 | 2.0 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.2 | 0.6 | GO:0030338 | CMP-N-acetylneuraminate monooxygenase activity(GO:0030338) |
| 0.2 | 0.5 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.2 | 0.5 | GO:0019202 | glutamate 5-kinase activity(GO:0004349) glutamate-5-semialdehyde dehydrogenase activity(GO:0004350) delta1-pyrroline-5-carboxylate synthetase activity(GO:0017084) amino acid kinase activity(GO:0019202) |
| 0.2 | 0.7 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.2 | 0.6 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.1 | 0.9 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
| 0.1 | 1.0 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.1 | 0.6 | GO:0047275 | glucosaminylgalactosylglucosylceramide beta-galactosyltransferase activity(GO:0047275) |
| 0.1 | 0.4 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.1 | 0.4 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.1 | 0.7 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 0.1 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.1 | 0.5 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 0.7 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.1 | 0.5 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 0.6 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.1 | 0.5 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.1 | 0.5 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 0.3 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.1 | 0.3 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
| 0.1 | 0.4 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) |
| 0.1 | 0.6 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 1.8 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.1 | 0.8 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.1 | 0.6 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 0.8 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.1 | 0.3 | GO:0004686 | elongation factor-2 kinase activity(GO:0004686) |
| 0.1 | 0.3 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
| 0.1 | 0.5 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.4 | GO:0001087 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
| 0.1 | 0.5 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 0.8 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
| 0.1 | 0.6 | GO:0052654 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
| 0.1 | 0.3 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.1 | 0.3 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.1 | 0.3 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.1 | 2.3 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.1 | 1.0 | GO:0051378 | serotonin binding(GO:0051378) |
| 0.1 | 0.8 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 0.4 | GO:0038051 | glucocorticoid receptor activity(GO:0004883) transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.1 | 1.0 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.1 | 0.3 | GO:0086038 | calcium:sodium antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086038) |
| 0.1 | 0.8 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.1 | 0.7 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.1 | 0.2 | GO:0004998 | transferrin receptor activity(GO:0004998) |
| 0.1 | 0.6 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.1 | 1.0 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.1 | 0.3 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.1 | 6.8 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.1 | 0.3 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.1 | 0.2 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.1 | 0.4 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.1 | 0.4 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.1 | 0.7 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) ATP transmembrane transporter activity(GO:0005347) purine nucleotide transmembrane transporter activity(GO:0015216) ADP transmembrane transporter activity(GO:0015217) |
| 0.1 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.7 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.1 | 0.3 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.1 | 0.7 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.1 | 0.3 | GO:0008761 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) |
| 0.1 | 0.3 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.1 | 0.2 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.1 | 1.1 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.8 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.1 | 0.2 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 0.3 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.1 | 0.2 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.1 | 0.3 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.1 | 1.3 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.4 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 0.3 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.1 | 0.4 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.3 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.0 | 1.2 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.2 | GO:0004510 | tryptophan 5-monooxygenase activity(GO:0004510) |
| 0.0 | 0.2 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.0 | 0.4 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
| 0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 0.2 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 0.2 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.0 | 0.3 | GO:0004875 | complement receptor activity(GO:0004875) |
| 0.0 | 1.4 | GO:0031420 | alkali metal ion binding(GO:0031420) |
| 0.0 | 0.1 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.0 | 0.3 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.0 | 0.1 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
| 0.0 | 0.5 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.7 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.7 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.2 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.1 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.0 | 0.3 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.1 | GO:0047598 | sterol delta7 reductase activity(GO:0009918) 7-dehydrocholesterol reductase activity(GO:0047598) |
| 0.0 | 0.1 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
| 0.0 | 0.1 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
| 0.0 | 0.1 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 0.0 | 0.3 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.0 | 0.4 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.0 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.2 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.2 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.0 | 0.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.7 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.0 | 2.9 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.0 | 0.2 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.0 | 0.2 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.0 | 0.2 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.4 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.1 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.0 | 0.7 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.3 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.1 | GO:0008457 | beta-galactosyl-N-acetylglucosaminylgalactosylglucosyl-ceramide beta-1,3-acetylglucosaminyltransferase activity(GO:0008457) lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase activity(GO:0047256) |
| 0.0 | 0.1 | GO:0004373 | glycogen (starch) synthase activity(GO:0004373) |
| 0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 0.2 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.1 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.0 | 0.1 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.6 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 0.8 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.0 | 0.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 0.2 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.0 | 0.4 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.4 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 1.0 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.0 | 0.8 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 0.3 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 5.3 | GO:0004721 | phosphoprotein phosphatase activity(GO:0004721) |
| 0.0 | 0.8 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.0 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.0 | 0.3 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.0 | 0.1 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
| 0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 0.1 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
| 0.0 | 0.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.8 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.0 | 0.3 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.2 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.0 | 0.2 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.0 | 0.2 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.5 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.0 | 3.4 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.0 | 0.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.3 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.0 | 0.1 | GO:0051381 | histamine binding(GO:0051381) |
| 0.0 | 0.8 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.3 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.0 | 0.5 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.0 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.2 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.4 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.0 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.5 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.1 | GO:0035473 | lipase binding(GO:0035473) |
| 0.0 | 0.1 | GO:0010181 | FMN binding(GO:0010181) |
| 0.0 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 0.2 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.0 | 0.3 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
| 0.0 | 0.9 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.5 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.8 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 0.1 | GO:0052723 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.2 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.0 | 0.2 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.1 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.0 | 0.5 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.4 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.2 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.1 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.0 | 0.0 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
| 0.0 | 0.0 | GO:0004923 | interleukin-6 receptor activity(GO:0004915) leukemia inhibitory factor receptor activity(GO:0004923) interleukin-6 binding(GO:0019981) |
| 0.0 | 0.1 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
| 0.0 | 0.5 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.0 | 0.5 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 0.1 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
| 0.0 | 0.4 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.0 | 0.1 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.0 | 0.0 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 2.8 | GO:0008017 | microtubule binding(GO:0008017) |
| 0.0 | 0.0 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.1 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
| 0.0 | 0.2 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 1.2 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.1 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.0 | 0.0 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 1.6 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.1 | 4.5 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 4.2 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.1 | 3.9 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 2.6 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 0.5 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.1 | 0.8 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 1.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.9 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.8 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 2.7 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.7 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 1.4 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 1.4 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.9 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 0.7 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.7 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.4 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.3 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 1.0 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.7 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.4 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.2 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 3.9 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.1 | 1.7 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 1.6 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.1 | 1.3 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.1 | 0.6 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.1 | 1.9 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 0.9 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.1 | 0.7 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.1 | 5.2 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.1 | 0.8 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 0.5 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
| 0.0 | 0.7 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 2.4 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
| 0.0 | 1.4 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 1.3 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.0 | 0.5 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.7 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.0 | 0.1 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.0 | 0.1 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.0 | 0.8 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.4 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.2 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 0.4 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 0.8 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.5 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.0 | 1.4 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.6 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 1.7 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 1.7 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.6 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.5 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.0 | 0.6 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.6 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.5 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.6 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.7 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.0 | 0.5 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.4 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.3 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 1.8 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.0 | 0.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.8 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
| 0.0 | 0.1 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.0 | 0.2 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 0.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 0.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.7 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.2 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.0 | 1.0 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.3 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.3 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.0 | 0.1 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.6 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.0 | 0.5 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.2 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 0.1 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.3 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.5 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
| 0.0 | 0.8 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 2.2 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.1 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 0.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |