avrg: 12D miR HR13_24
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Mecp2
|
ENSMUSG00000031393.10 | methyl CpG binding protein 2 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Mecp2 | mm10_v2_chrX_-_74085586_74085652 | 0.50 | 1.2e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr19_+_7268296 | 2.08 |
ENSMUST00000066646.4
|
Rcor2
|
REST corepressor 2 |
chr12_-_108275409 | 1.72 |
ENSMUST00000136175.1
|
Ccdc85c
|
coiled-coil domain containing 85C |
chr15_-_82212796 | 1.68 |
ENSMUST00000179269.1
|
AI848285
|
expressed sequence AI848285 |
chr4_-_129121234 | 1.61 |
ENSMUST00000030572.3
|
Hpca
|
hippocalcin |
chr5_+_118169712 | 1.49 |
ENSMUST00000054836.6
|
Hrk
|
harakiri, BCL2 interacting protein (contains only BH3 domain) |
chr11_-_118909487 | 1.49 |
ENSMUST00000117731.1
ENSMUST00000106278.2 ENSMUST00000120061.1 ENSMUST00000017576.4 |
Rbfox3
|
RNA binding protein, fox-1 homolog (C. elegans) 3 |
chr7_+_141475459 | 1.43 |
ENSMUST00000138092.1
ENSMUST00000146305.1 |
Tspan4
|
tetraspanin 4 |
chr7_+_109010825 | 1.39 |
ENSMUST00000033341.5
|
Tub
|
tubby candidate gene |
chr4_-_89294608 | 1.36 |
ENSMUST00000107131.1
|
Cdkn2a
|
cyclin-dependent kinase inhibitor 2A |
chr5_-_33433976 | 1.34 |
ENSMUST00000173348.1
|
Nkx1-1
|
NK1 transcription factor related, locus 1 (Drosophila) |
chr14_-_67715585 | 1.30 |
ENSMUST00000163100.1
ENSMUST00000132705.1 ENSMUST00000124045.1 |
Cdca2
|
cell division cycle associated 2 |
chr6_+_128362919 | 1.24 |
ENSMUST00000073316.6
|
Foxm1
|
forkhead box M1 |
chr7_+_46396439 | 1.16 |
ENSMUST00000025202.6
|
Kcnc1
|
potassium voltage gated channel, Shaw-related subfamily, member 1 |
chrX_-_102252154 | 1.15 |
ENSMUST00000050551.3
|
Cited1
|
Cbp/p300-interacting transactivator with Glu/Asp-rich carboxy-terminal domain 1 |
chr1_-_57406443 | 1.15 |
ENSMUST00000160837.1
ENSMUST00000161780.1 |
Tyw5
|
tRNA-yW synthesizing protein 5 |
chr9_+_88327592 | 1.14 |
ENSMUST00000034992.6
|
Nt5e
|
5' nucleotidase, ecto |
chr9_+_21032038 | 1.11 |
ENSMUST00000019616.4
|
Icam5
|
intercellular adhesion molecule 5, telencephalin |
chr12_-_5375682 | 1.11 |
ENSMUST00000020958.8
|
Klhl29
|
kelch-like 29 |
chr2_+_71873224 | 1.06 |
ENSMUST00000006669.5
|
Pdk1
|
pyruvate dehydrogenase kinase, isoenzyme 1 |
chr6_-_85513586 | 1.01 |
ENSMUST00000095759.3
|
Egr4
|
early growth response 4 |
chr7_+_141475240 | 1.01 |
ENSMUST00000026585.7
|
Tspan4
|
tetraspanin 4 |
chr9_+_106453838 | 0.99 |
ENSMUST00000024260.6
|
Pcbp4
|
poly(rC) binding protein 4 |
chr12_-_36156781 | 0.98 |
ENSMUST00000020856.4
|
Bzw2
|
basic leucine zipper and W2 domains 2 |
chr5_-_115194283 | 0.97 |
ENSMUST00000112113.1
|
Cabp1
|
calcium binding protein 1 |
chr2_+_127336152 | 0.97 |
ENSMUST00000028846.6
|
Dusp2
|
dual specificity phosphatase 2 |
chr12_+_81026800 | 0.96 |
ENSMUST00000110347.2
ENSMUST00000021564.4 ENSMUST00000129362.1 |
Smoc1
|
SPARC related modular calcium binding 1 |
chr12_+_80518990 | 0.95 |
ENSMUST00000021558.6
|
Galnt16
|
UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase 16 |
chr4_+_123105146 | 0.95 |
ENSMUST00000002457.1
|
Bmp8b
|
bone morphogenetic protein 8b |
chr19_+_6084983 | 0.94 |
ENSMUST00000025704.2
|
Cdca5
|
cell division cycle associated 5 |
chr2_-_14055963 | 0.94 |
ENSMUST00000091429.5
ENSMUST00000114753.1 |
Ptpla
|
protein tyrosine phosphatase-like (proline instead of catalytic arginine), member a |
chr2_+_139678178 | 0.92 |
ENSMUST00000184404.1
ENSMUST00000099307.3 |
Ism1
|
isthmin 1 homolog (zebrafish) |
chr19_+_34922351 | 0.91 |
ENSMUST00000087341.5
|
Kif20b
|
kinesin family member 20B |
chr2_-_181135103 | 0.89 |
ENSMUST00000149964.2
ENSMUST00000103050.3 ENSMUST00000081528.6 ENSMUST00000049792.8 ENSMUST00000103048.3 ENSMUST00000103047.3 ENSMUST00000129073.1 ENSMUST00000144592.1 ENSMUST00000139458.1 ENSMUST00000154164.1 ENSMUST00000123336.1 ENSMUST00000129361.1 ENSMUST00000103051.2 |
Kcnq2
|
potassium voltage-gated channel, subfamily Q, member 2 |
chr13_+_55464237 | 0.89 |
ENSMUST00000046533.7
|
Prr7
|
proline rich 7 (synaptic) |
chr6_+_120666388 | 0.87 |
ENSMUST00000112686.1
|
Cecr2
|
cat eye syndrome chromosome region, candidate 2 |
chr15_-_55090422 | 0.86 |
ENSMUST00000110231.1
ENSMUST00000023059.6 |
Dscc1
|
defective in sister chromatid cohesion 1 homolog (S. cerevisiae) |
chr14_-_63509092 | 0.86 |
ENSMUST00000022522.8
|
Tdh
|
L-threonine dehydrogenase |
chr13_-_55488038 | 0.86 |
ENSMUST00000109921.2
ENSMUST00000109923.2 ENSMUST00000021950.8 |
Dbn1
|
drebrin 1 |
chr7_-_128418154 | 0.85 |
ENSMUST00000033133.5
|
Rgs10
|
regulator of G-protein signalling 10 |
chr14_+_64588112 | 0.85 |
ENSMUST00000181808.1
|
A930011O12Rik
|
RIKEN cDNA A930011O12 gene |
chr12_+_102948843 | 0.84 |
ENSMUST00000101099.5
|
Unc79
|
unc-79 homolog (C. elegans) |
chr18_-_77767752 | 0.84 |
ENSMUST00000048192.7
|
Haus1
|
HAUS augmin-like complex, subunit 1 |
chr2_-_14056029 | 0.84 |
ENSMUST00000074854.7
|
Ptpla
|
protein tyrosine phosphatase-like (proline instead of catalytic arginine), member a |
chr2_+_31245801 | 0.82 |
ENSMUST00000000199.7
|
Ncs1
|
neuronal calcium sensor 1 |
chr9_-_61946768 | 0.81 |
ENSMUST00000034815.7
|
Kif23
|
kinesin family member 23 |
chr8_-_92355764 | 0.81 |
ENSMUST00000180102.1
ENSMUST00000179421.1 ENSMUST00000179222.1 ENSMUST00000179029.1 |
4933436C20Rik
|
RIKEN cDNA 4933436C20 gene |
chr6_-_39557830 | 0.81 |
ENSMUST00000036877.3
ENSMUST00000154149.1 |
Dennd2a
|
DENN/MADD domain containing 2A |
chr15_+_26309039 | 0.80 |
ENSMUST00000140840.1
ENSMUST00000152841.1 |
March11
|
membrane-associated ring finger (C3HC4) 11 |
chr5_-_124249758 | 0.80 |
ENSMUST00000162812.1
|
Pitpnm2
|
phosphatidylinositol transfer protein, membrane-associated 2 |
chr7_+_65862029 | 0.80 |
ENSMUST00000055576.5
ENSMUST00000098391.4 |
Pcsk6
|
proprotein convertase subtilisin/kexin type 6 |
chr5_-_38159457 | 0.79 |
ENSMUST00000031009.4
|
Nsg1
|
neuron specific gene family member 1 |
chr12_-_108003414 | 0.79 |
ENSMUST00000109887.1
ENSMUST00000109891.2 |
Bcl11b
|
B cell leukemia/lymphoma 11B |
chr12_-_110889119 | 0.79 |
ENSMUST00000043716.8
|
Cinp
|
cyclin-dependent kinase 2 interacting protein |
chr7_-_25250720 | 0.78 |
ENSMUST00000116343.2
ENSMUST00000045847.8 |
Erf
|
Ets2 repressor factor |
chr16_+_48994185 | 0.78 |
ENSMUST00000117994.1
ENSMUST00000048374.5 |
C330027C09Rik
|
RIKEN cDNA C330027C09 gene |
chr11_+_102248842 | 0.78 |
ENSMUST00000100392.4
|
BC030867
|
cDNA sequence BC030867 |
chr4_+_127169131 | 0.77 |
ENSMUST00000046659.7
|
Dlgap3
|
discs, large (Drosophila) homolog-associated protein 3 |
chr18_+_34861200 | 0.77 |
ENSMUST00000165033.1
|
Egr1
|
early growth response 1 |
chr5_-_96161990 | 0.77 |
ENSMUST00000155901.1
|
Cnot6l
|
CCR4-NOT transcription complex, subunit 6-like |
chr19_-_15924560 | 0.76 |
ENSMUST00000162053.1
|
Psat1
|
phosphoserine aminotransferase 1 |
chr1_-_192855723 | 0.76 |
ENSMUST00000155579.1
|
Sertad4
|
SERTA domain containing 4 |
chr17_+_71183545 | 0.76 |
ENSMUST00000156570.1
|
Lpin2
|
lipin 2 |
chr7_-_34812677 | 0.76 |
ENSMUST00000078686.6
|
Chst8
|
carbohydrate (N-acetylgalactosamine 4-0) sulfotransferase 8 |
chr2_+_152847961 | 0.76 |
ENSMUST00000164120.1
ENSMUST00000178997.1 ENSMUST00000109816.1 |
Tpx2
|
TPX2, microtubule-associated protein homolog (Xenopus laevis) |
chr5_-_135251209 | 0.75 |
ENSMUST00000062572.2
|
Fzd9
|
frizzled homolog 9 (Drosophila) |
chr2_+_112239468 | 0.75 |
ENSMUST00000028554.3
|
Lpcat4
|
lysophosphatidylcholine acyltransferase 4 |
chr2_-_31845925 | 0.75 |
ENSMUST00000028188.7
|
Fibcd1
|
fibrinogen C domain containing 1 |
chr7_+_29289300 | 0.75 |
ENSMUST00000048187.4
|
Ppp1r14a
|
protein phosphatase 1, regulatory (inhibitor) subunit 14A |
chr18_+_67343564 | 0.74 |
ENSMUST00000025404.8
|
Cidea
|
cell death-inducing DNA fragmentation factor, alpha subunit-like effector A |
chr11_+_117849223 | 0.74 |
ENSMUST00000081387.4
|
Birc5
|
baculoviral IAP repeat-containing 5 |
chr4_+_129513581 | 0.74 |
ENSMUST00000062356.6
|
Marcksl1
|
MARCKS-like 1 |
chr12_-_11265768 | 0.74 |
ENSMUST00000166117.1
|
Gen1
|
Gen homolog 1, endonuclease (Drosophila) |
chr3_-_89322883 | 0.74 |
ENSMUST00000029673.5
|
Efna3
|
ephrin A3 |
chr6_-_8259098 | 0.73 |
ENSMUST00000012627.4
|
Rpa3
|
replication protein A3 |
chrX_+_73673150 | 0.73 |
ENSMUST00000033752.7
ENSMUST00000114467.2 |
Slc6a8
|
solute carrier family 6 (neurotransmitter transporter, creatine), member 8 |
chr7_+_126847908 | 0.72 |
ENSMUST00000147257.1
ENSMUST00000139174.1 |
Doc2a
|
double C2, alpha |
chr12_-_108003594 | 0.72 |
ENSMUST00000066060.4
|
Bcl11b
|
B cell leukemia/lymphoma 11B |
chr8_+_57511833 | 0.71 |
ENSMUST00000067925.6
|
Hmgb2
|
high mobility group box 2 |
chr10_-_69352886 | 0.71 |
ENSMUST00000119827.1
ENSMUST00000020099.5 |
Cdk1
|
cyclin-dependent kinase 1 |
chr16_+_14361552 | 0.71 |
ENSMUST00000100167.3
ENSMUST00000154748.1 ENSMUST00000134776.1 |
Abcc1
|
ATP-binding cassette, sub-family C (CFTR/MRP), member 1 |
chr12_-_112929415 | 0.71 |
ENSMUST00000075827.3
|
Jag2
|
jagged 2 |
chr5_+_76657673 | 0.71 |
ENSMUST00000128112.1
|
C530008M17Rik
|
RIKEN cDNA C530008M17 gene |
chr5_+_36868467 | 0.70 |
ENSMUST00000031003.7
|
Ppp2r2c
|
protein phosphatase 2 (formerly 2A), regulatory subunit B (PR 52), gamma isoform |
chr13_-_73937761 | 0.70 |
ENSMUST00000022053.8
|
Trip13
|
thyroid hormone receptor interactor 13 |
chr10_-_117792663 | 0.70 |
ENSMUST00000167943.1
ENSMUST00000064848.5 |
Nup107
|
nucleoporin 107 |
chr9_+_92542223 | 0.70 |
ENSMUST00000070522.7
ENSMUST00000160359.1 |
Plod2
|
procollagen lysine, 2-oxoglutarate 5-dioxygenase 2 |
chr15_-_27681498 | 0.70 |
ENSMUST00000100739.3
|
Fam105a
|
family with sequence similarity 105, member A |
chr11_-_77489666 | 0.70 |
ENSMUST00000037593.7
ENSMUST00000092892.3 |
Ankrd13b
|
ankyrin repeat domain 13b |
chr3_+_145758674 | 0.70 |
ENSMUST00000029845.8
|
Ddah1
|
dimethylarginine dimethylaminohydrolase 1 |
chr4_-_118437331 | 0.69 |
ENSMUST00000006565.6
|
Cdc20
|
cell division cycle 20 |
chr4_-_130574150 | 0.69 |
ENSMUST00000105993.3
|
Nkain1
|
Na+/K+ transporting ATPase interacting 1 |
chr14_-_57826128 | 0.68 |
ENSMUST00000022536.2
|
Ska3
|
spindle and kinetochore associated complex subunit 3 |
chr5_+_45669907 | 0.68 |
ENSMUST00000117396.1
|
Ncapg
|
non-SMC condensin I complex, subunit G |
chr2_-_166155624 | 0.67 |
ENSMUST00000109249.2
|
Sulf2
|
sulfatase 2 |
chr17_-_24658425 | 0.67 |
ENSMUST00000095544.4
|
Npw
|
neuropeptide W |
chr17_-_25433775 | 0.67 |
ENSMUST00000159610.1
ENSMUST00000159048.1 ENSMUST00000078496.5 |
Cacna1h
|
calcium channel, voltage-dependent, T type, alpha 1H subunit |
chr17_-_14978812 | 0.67 |
ENSMUST00000097399.4
|
Gm3417
|
predicted gene 3417 |
chr7_-_99182681 | 0.66 |
ENSMUST00000033001.4
|
Dgat2
|
diacylglycerol O-acyltransferase 2 |
chr2_+_152847993 | 0.66 |
ENSMUST00000028969.8
|
Tpx2
|
TPX2, microtubule-associated protein homolog (Xenopus laevis) |
chr11_+_76945719 | 0.66 |
ENSMUST00000125145.1
|
Blmh
|
bleomycin hydrolase |
chr2_-_173276144 | 0.66 |
ENSMUST00000139306.1
|
Pmepa1
|
prostate transmembrane protein, androgen induced 1 |
chr6_-_125191535 | 0.65 |
ENSMUST00000043848.4
|
Ncapd2
|
non-SMC condensin I complex, subunit D2 |
chr7_+_28169744 | 0.65 |
ENSMUST00000042405.6
|
Fbl
|
fibrillarin |
chr2_-_180104463 | 0.65 |
ENSMUST00000056480.3
|
Hrh3
|
histamine receptor H3 |
chr15_-_64382736 | 0.65 |
ENSMUST00000176384.1
ENSMUST00000175799.1 |
Asap1
|
ArfGAP with SH3 domain, ankyrin repeat and PH domain1 |
chr11_-_11808923 | 0.65 |
ENSMUST00000109664.1
ENSMUST00000150714.1 ENSMUST00000047689.4 ENSMUST00000171938.1 ENSMUST00000171080.1 |
Fignl1
|
fidgetin-like 1 |
chr2_+_109280738 | 0.64 |
ENSMUST00000028527.7
|
Kif18a
|
kinesin family member 18A |
chr5_+_30711564 | 0.64 |
ENSMUST00000114729.1
|
Dpysl5
|
dihydropyrimidinase-like 5 |
chr11_+_115381906 | 0.64 |
ENSMUST00000053288.5
|
Cdr2l
|
cerebellar degeneration-related protein 2-like |
chr2_-_166155272 | 0.64 |
ENSMUST00000088086.3
|
Sulf2
|
sulfatase 2 |
chr4_+_52439235 | 0.64 |
ENSMUST00000117280.1
ENSMUST00000102915.3 ENSMUST00000142227.1 |
Smc2
|
structural maintenance of chromosomes 2 |
chr15_-_64382908 | 0.64 |
ENSMUST00000177374.1
ENSMUST00000023008.9 ENSMUST00000110115.2 ENSMUST00000110114.3 |
Asap1
|
ArfGAP with SH3 domain, ankyrin repeat and PH domain1 |
chr7_-_141279121 | 0.63 |
ENSMUST00000167790.1
ENSMUST00000046156.6 |
Sct
|
secretin |
chr4_+_24496434 | 0.63 |
ENSMUST00000108222.2
ENSMUST00000138567.2 ENSMUST00000050446.6 |
Mms22l
|
MMS22-like, DNA repair protein |
chr12_+_102949450 | 0.63 |
ENSMUST00000179002.1
|
Unc79
|
unc-79 homolog (C. elegans) |
chr7_-_38107490 | 0.63 |
ENSMUST00000108023.3
|
Ccne1
|
cyclin E1 |
chr2_-_127133909 | 0.63 |
ENSMUST00000110387.3
|
Ncaph
|
non-SMC condensin I complex, subunit H |
chr5_-_114091358 | 0.62 |
ENSMUST00000150106.1
|
Svop
|
SV2 related protein |
chr11_-_75796048 | 0.62 |
ENSMUST00000021209.7
|
Doc2b
|
double C2, beta |
chr6_+_58640536 | 0.62 |
ENSMUST00000145161.1
ENSMUST00000114294.1 |
Abcg2
|
ATP-binding cassette, sub-family G (WHITE), member 2 |
chr2_+_167062934 | 0.62 |
ENSMUST00000125674.1
|
1500012F01Rik
|
RIKEN cDNA 1500012F01 gene |
chr5_+_110286306 | 0.62 |
ENSMUST00000007296.5
ENSMUST00000112482.1 |
Pole
|
polymerase (DNA directed), epsilon |
chr9_+_73113426 | 0.62 |
ENSMUST00000169399.1
ENSMUST00000034738.7 |
Rsl24d1
|
ribosomal L24 domain containing 1 |
chr1_+_180641330 | 0.62 |
ENSMUST00000085804.5
|
Lin9
|
lin-9 homolog (C. elegans) |
chr10_-_22731336 | 0.61 |
ENSMUST00000127698.1
|
Tbpl1
|
TATA box binding protein-like 1 |
chr17_-_45733843 | 0.61 |
ENSMUST00000178179.1
|
1600014C23Rik
|
RIKEN cDNA 1600014C23 gene |
chr9_+_119402444 | 0.61 |
ENSMUST00000035093.8
ENSMUST00000165044.1 |
Acvr2b
|
activin receptor IIB |
chr3_+_104638658 | 0.61 |
ENSMUST00000046212.1
|
Slc16a1
|
solute carrier family 16 (monocarboxylic acid transporters), member 1 |
chr18_-_7004717 | 0.61 |
ENSMUST00000079788.4
|
Mkx
|
mohawk homeobox |
chr5_-_96161742 | 0.61 |
ENSMUST00000129646.1
ENSMUST00000113005.2 ENSMUST00000154500.1 ENSMUST00000141383.1 |
Cnot6l
|
CCR4-NOT transcription complex, subunit 6-like |
chr6_-_24956106 | 0.61 |
ENSMUST00000127247.2
|
Tmem229a
|
transmembrane protein 229A |
chr2_-_102451792 | 0.61 |
ENSMUST00000099678.3
|
Fjx1
|
four jointed box 1 (Drosophila) |
chr5_+_88764983 | 0.60 |
ENSMUST00000031311.9
|
Dck
|
deoxycytidine kinase |
chr5_-_136244865 | 0.60 |
ENSMUST00000005188.9
|
Sh2b2
|
SH2B adaptor protein 2 |
chr6_+_21986438 | 0.60 |
ENSMUST00000115382.1
|
Cped1
|
cadherin-like and PC-esterase domain containing 1 |
chr15_-_102350692 | 0.60 |
ENSMUST00000041208.7
|
Aaas
|
achalasia, adrenocortical insufficiency, alacrimia |
chr9_+_59680144 | 0.60 |
ENSMUST00000123914.1
|
Gramd2
|
GRAM domain containing 2 |
chr11_-_63922257 | 0.60 |
ENSMUST00000094103.3
|
Hs3st3b1
|
heparan sulfate (glucosamine) 3-O-sulfotransferase 3B1 |
chr11_+_77930800 | 0.59 |
ENSMUST00000093995.3
ENSMUST00000000646.7 |
Sez6
|
seizure related gene 6 |
chr4_-_139352298 | 0.59 |
ENSMUST00000030513.6
ENSMUST00000155257.1 |
Mrto4
|
MRT4, mRNA turnover 4, homolog (S. cerevisiae) |
chr7_+_29303958 | 0.59 |
ENSMUST00000049977.6
|
Dpf1
|
D4, zinc and double PHD fingers family 1 |
chr7_-_127042420 | 0.59 |
ENSMUST00000032915.6
|
Kif22
|
kinesin family member 22 |
chr17_+_56304313 | 0.59 |
ENSMUST00000113035.1
ENSMUST00000113039.2 ENSMUST00000142387.1 |
Uhrf1
|
ubiquitin-like, containing PHD and RING finger domains, 1 |
chr13_+_46418266 | 0.59 |
ENSMUST00000037923.3
|
Rbm24
|
RNA binding motif protein 24 |
chr16_-_18811615 | 0.59 |
ENSMUST00000096990.3
|
Cdc45
|
cell division cycle 45 |
chr13_-_100775844 | 0.59 |
ENSMUST00000075550.3
|
Cenph
|
centromere protein H |
chr4_-_137796350 | 0.59 |
ENSMUST00000030551.4
|
Alpl
|
alkaline phosphatase, liver/bone/kidney |
chr9_+_44084944 | 0.58 |
ENSMUST00000176416.1
ENSMUST00000065461.7 |
Usp2
|
ubiquitin specific peptidase 2 |
chr13_+_54949388 | 0.58 |
ENSMUST00000026994.7
ENSMUST00000109994.2 |
Unc5a
|
unc-5 homolog A (C. elegans) |
chr16_+_17646464 | 0.58 |
ENSMUST00000056962.4
|
Ccdc74a
|
coiled-coil domain containing 74A |
chr14_-_118923070 | 0.58 |
ENSMUST00000047208.5
|
Dzip1
|
DAZ interacting protein 1 |
chr6_-_148946146 | 0.57 |
ENSMUST00000132696.1
|
Fam60a
|
family with sequence similarity 60, member A |
chr19_-_42431778 | 0.57 |
ENSMUST00000048630.6
|
Crtac1
|
cartilage acidic protein 1 |
chr2_-_181135220 | 0.57 |
ENSMUST00000016491.7
|
Kcnq2
|
potassium voltage-gated channel, subfamily Q, member 2 |
chr5_+_30666886 | 0.57 |
ENSMUST00000144742.1
|
Cenpa
|
centromere protein A |
chr8_+_70493156 | 0.57 |
ENSMUST00000008032.7
|
Crlf1
|
cytokine receptor-like factor 1 |
chr8_+_106893616 | 0.56 |
ENSMUST00000047629.5
|
Cirh1a
|
cirrhosis, autosomal recessive 1A (human) |
chr2_+_72476159 | 0.56 |
ENSMUST00000102691.4
|
Cdca7
|
cell division cycle associated 7 |
chr8_+_66860215 | 0.56 |
ENSMUST00000118009.1
|
Naf1
|
nuclear assembly factor 1 homolog (S. cerevisiae) |
chr7_+_118855735 | 0.56 |
ENSMUST00000098087.2
ENSMUST00000106547.1 |
Iqck
|
IQ motif containing K |
chr10_+_128933782 | 0.56 |
ENSMUST00000099112.2
|
Itga7
|
integrin alpha 7 |
chrX_-_102251852 | 0.56 |
ENSMUST00000101336.3
ENSMUST00000136277.1 |
Cited1
|
Cbp/p300-interacting transactivator with Glu/Asp-rich carboxy-terminal domain 1 |
chr1_+_55406163 | 0.55 |
ENSMUST00000042986.8
|
Plcl1
|
phospholipase C-like 1 |
chr7_+_141476374 | 0.55 |
ENSMUST00000117634.1
|
Tspan4
|
tetraspanin 4 |
chr11_-_4947991 | 0.55 |
ENSMUST00000093369.4
|
Nefh
|
neurofilament, heavy polypeptide |
chr9_+_111439063 | 0.55 |
ENSMUST00000111879.3
|
Dclk3
|
doublecortin-like kinase 3 |
chr13_-_100786402 | 0.55 |
ENSMUST00000174038.1
ENSMUST00000091295.7 ENSMUST00000072119.8 |
Ccnb1
|
cyclin B1 |
chr7_-_142095266 | 0.55 |
ENSMUST00000039926.3
|
Dusp8
|
dual specificity phosphatase 8 |
chr4_+_107802277 | 0.55 |
ENSMUST00000106733.2
ENSMUST00000030356.3 ENSMUST00000106732.2 ENSMUST00000126573.1 |
Lrp8
|
low density lipoprotein receptor-related protein 8, apolipoprotein e receptor |
chr9_-_97018823 | 0.54 |
ENSMUST00000055433.4
|
Spsb4
|
splA/ryanodine receptor domain and SOCS box containing 4 |
chr15_+_101224207 | 0.54 |
ENSMUST00000000543.4
|
Grasp
|
GRP1 (general receptor for phosphoinositides 1)-associated scaffold protein |
chr2_-_118373347 | 0.54 |
ENSMUST00000039160.2
|
Gpr176
|
G protein-coupled receptor 176 |
chr2_+_22895482 | 0.54 |
ENSMUST00000053729.7
|
Pdss1
|
prenyl (solanesyl) diphosphate synthase, subunit 1 |
chr15_-_79441802 | 0.54 |
ENSMUST00000122044.1
ENSMUST00000135519.1 |
Csnk1e
|
casein kinase 1, epsilon |
chr2_+_163054682 | 0.54 |
ENSMUST00000018005.3
|
Mybl2
|
myeloblastosis oncogene-like 2 |
chr2_-_32353247 | 0.54 |
ENSMUST00000078352.5
ENSMUST00000113352.2 ENSMUST00000113365.1 |
Dnm1
|
dynamin 1 |
chr10_+_20347788 | 0.54 |
ENSMUST00000169712.1
|
Mtfr2
|
mitochondrial fission regulator 2 |
chr2_-_34913976 | 0.54 |
ENSMUST00000028232.3
|
Phf19
|
PHD finger protein 19 |
chr17_+_78200240 | 0.54 |
ENSMUST00000112498.2
|
Crim1
|
cysteine rich transmembrane BMP regulator 1 (chordin like) |
chr12_-_54986328 | 0.54 |
ENSMUST00000038926.6
|
Baz1a
|
bromodomain adjacent to zinc finger domain 1A |
chr12_+_105336922 | 0.54 |
ENSMUST00000180503.1
|
2810011L19Rik
|
RIKEN cDNA 2810011L19 gene |
chr2_+_22895583 | 0.53 |
ENSMUST00000152170.1
|
Pdss1
|
prenyl (solanesyl) diphosphate synthase, subunit 1 |
chr9_+_60712989 | 0.53 |
ENSMUST00000038407.5
|
Larp6
|
La ribonucleoprotein domain family, member 6 |
chr9_+_111311674 | 0.53 |
ENSMUST00000078626.3
|
Trank1
|
tetratricopeptide repeat and ankyrin repeat containing 1 |
chr9_-_22389113 | 0.53 |
ENSMUST00000040912.7
|
Anln
|
anillin, actin binding protein |
chr13_+_55445301 | 0.53 |
ENSMUST00000001115.8
ENSMUST00000099482.3 |
Grk6
|
G protein-coupled receptor kinase 6 |
chr13_-_36117269 | 0.53 |
ENSMUST00000053265.6
|
Lyrm4
|
LYR motif containing 4 |
chr18_-_34720269 | 0.53 |
ENSMUST00000025224.7
|
Gfra3
|
glial cell line derived neurotrophic factor family receptor alpha 3 |
chr9_+_118606687 | 0.53 |
ENSMUST00000044165.7
|
Itga9
|
integrin alpha 9 |
chr17_-_34627365 | 0.53 |
ENSMUST00000064953.8
ENSMUST00000170345.1 ENSMUST00000171121.2 ENSMUST00000168391.2 ENSMUST00000169067.2 |
Ppt2
|
palmitoyl-protein thioesterase 2 |
chr18_+_4920509 | 0.53 |
ENSMUST00000126977.1
|
Svil
|
supervillin |
chr1_-_37719782 | 0.53 |
ENSMUST00000160589.1
|
2010300C02Rik
|
RIKEN cDNA 2010300C02 gene |
chr17_-_34627148 | 0.53 |
ENSMUST00000171376.1
ENSMUST00000169287.1 |
Ppt2
|
palmitoyl-protein thioesterase 2 |
chr2_+_91922178 | 0.53 |
ENSMUST00000170432.1
|
Chrm4
|
cholinergic receptor, muscarinic 4 |
chr8_+_75109528 | 0.53 |
ENSMUST00000164309.1
|
Mcm5
|
minichromosome maintenance deficient 5, cell division cycle 46 (S. cerevisiae) |
chr10_-_77113676 | 0.53 |
ENSMUST00000072755.4
ENSMUST00000105409.1 |
Col18a1
|
collagen, type XVIII, alpha 1 |
chr17_-_26201363 | 0.53 |
ENSMUST00000121959.1
|
Arhgdig
|
Rho GDP dissociation inhibitor (GDI) gamma |
chr7_+_122159422 | 0.53 |
ENSMUST00000033154.6
|
Plk1
|
polo-like kinase 1 |
chr2_+_173021902 | 0.52 |
ENSMUST00000029014.9
|
Rbm38
|
RNA binding motif protein 38 |
chr11_+_79660532 | 0.52 |
ENSMUST00000155381.1
|
Rab11fip4
|
RAB11 family interacting protein 4 (class II) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.6 | GO:0031283 | negative regulation of cGMP metabolic process(GO:0030824) negative regulation of cGMP biosynthetic process(GO:0030827) negative regulation of guanylate cyclase activity(GO:0031283) |
0.5 | 1.5 | GO:0097535 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
0.5 | 2.3 | GO:0071104 | response to interleukin-9(GO:0071104) |
0.5 | 1.4 | GO:0071163 | DNA replication preinitiation complex assembly(GO:0071163) |
0.4 | 1.3 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
0.4 | 1.2 | GO:0031591 | wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
0.4 | 1.1 | GO:0070650 | actin filament bundle distribution(GO:0070650) |
0.3 | 1.7 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
0.3 | 2.7 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.3 | 1.3 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
0.3 | 1.6 | GO:2000434 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
0.3 | 1.0 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.3 | 1.2 | GO:0051316 | attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
0.3 | 0.9 | GO:1903436 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
0.3 | 0.9 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.3 | 1.8 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.3 | 1.2 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.3 | 0.9 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
0.3 | 0.9 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.3 | 0.8 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
0.3 | 0.8 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
0.3 | 0.8 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.3 | 0.8 | GO:0072382 | minus-end-directed vesicle transport along microtubule(GO:0072382) |
0.3 | 0.3 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.3 | 1.3 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.3 | 0.8 | GO:0000912 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
0.3 | 0.8 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
0.3 | 0.8 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) positive regulation of metanephric glomerulus development(GO:0072300) |
0.3 | 0.8 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.3 | 1.3 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.3 | 0.8 | GO:1990523 | bone regeneration(GO:1990523) |
0.2 | 0.7 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
0.2 | 0.7 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.2 | 0.7 | GO:0045004 | DNA replication proofreading(GO:0045004) |
0.2 | 0.5 | GO:0003134 | BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
0.2 | 0.7 | GO:1903659 | transforming growth factor beta activation(GO:0036363) regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.2 | 1.6 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
0.2 | 1.3 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.2 | 0.6 | GO:0019389 | glucuronoside metabolic process(GO:0019389) |
0.2 | 0.6 | GO:0071929 | alpha-tubulin acetylation(GO:0071929) |
0.2 | 1.2 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
0.2 | 0.6 | GO:1902256 | apoptotic process involved in outflow tract morphogenesis(GO:0003275) regulation of apoptotic process involved in outflow tract morphogenesis(GO:1902256) |
0.2 | 1.8 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.2 | 0.2 | GO:2000232 | regulation of rRNA processing(GO:2000232) |
0.2 | 0.8 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.2 | 0.8 | GO:1903422 | negative regulation of synaptic vesicle recycling(GO:1903422) |
0.2 | 0.6 | GO:1990773 | regulation of matrix metallopeptidase secretion(GO:1904464) matrix metallopeptidase secretion(GO:1990773) |
0.2 | 0.6 | GO:0015881 | creatine transport(GO:0015881) |
0.2 | 0.6 | GO:1904245 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
0.2 | 0.2 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
0.2 | 1.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.2 | 0.9 | GO:0032902 | nerve growth factor production(GO:0032902) |
0.2 | 0.5 | GO:0017055 | negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) |
0.2 | 0.5 | GO:0031660 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
0.2 | 0.5 | GO:0035990 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.2 | 0.5 | GO:1904170 | regulation of bleb assembly(GO:1904170) |
0.2 | 0.7 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.2 | 1.4 | GO:0007144 | female meiosis I(GO:0007144) |
0.2 | 0.8 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.2 | 0.5 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
0.2 | 0.5 | GO:0010705 | meiotic DNA double-strand break processing involved in reciprocal meiotic recombination(GO:0010705) |
0.2 | 0.5 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.2 | 0.2 | GO:0036260 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
0.2 | 0.8 | GO:1902961 | positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
0.2 | 0.7 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
0.2 | 0.5 | GO:1904760 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
0.2 | 0.8 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.2 | 0.8 | GO:0015888 | thiamine transport(GO:0015888) |
0.2 | 0.5 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.2 | 0.6 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.2 | 0.3 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.2 | 0.2 | GO:0043396 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.2 | 1.1 | GO:0060613 | fat pad development(GO:0060613) |
0.2 | 0.5 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
0.2 | 0.6 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
0.2 | 0.8 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 0.9 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.1 | 0.9 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.1 | 0.7 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.6 | GO:0046075 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
0.1 | 0.4 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.1 | 0.6 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
0.1 | 0.7 | GO:0032298 | positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
0.1 | 0.4 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
0.1 | 0.9 | GO:0090070 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
0.1 | 0.7 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.1 | 0.1 | GO:0006273 | lagging strand elongation(GO:0006273) |
0.1 | 0.7 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.1 | 0.7 | GO:0030421 | defecation(GO:0030421) |
0.1 | 1.1 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
0.1 | 0.4 | GO:0001180 | transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
0.1 | 0.1 | GO:0006404 | RNA import into nucleus(GO:0006404) |
0.1 | 0.1 | GO:1990927 | calcium ion regulated lysosome exocytosis(GO:1990927) |
0.1 | 0.9 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.1 | 0.3 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.1 | 0.4 | GO:0021933 | radial glia guided migration of cerebellar granule cell(GO:0021933) |
0.1 | 0.4 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.1 | 1.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.1 | 0.5 | GO:0040038 | polar body extrusion after meiotic divisions(GO:0040038) |
0.1 | 0.1 | GO:0071035 | nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
0.1 | 0.4 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.1 | 0.7 | GO:0072191 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
0.1 | 0.8 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.1 | 0.1 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
0.1 | 0.8 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.1 | 1.4 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.1 | 0.9 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) |
0.1 | 0.4 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.1 | 0.2 | GO:0035989 | tendon development(GO:0035989) |
0.1 | 0.9 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.1 | 0.4 | GO:0002276 | basophil activation involved in immune response(GO:0002276) basophil activation(GO:0045575) |
0.1 | 0.5 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.1 | 0.4 | GO:0090427 | activation of meiosis(GO:0090427) |
0.1 | 1.0 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.1 | 0.5 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 3.6 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.1 | 0.1 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
0.1 | 0.5 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.1 | 0.4 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.1 | 0.4 | GO:0006106 | fumarate metabolic process(GO:0006106) aspartate biosynthetic process(GO:0006532) aspartate catabolic process(GO:0006533) |
0.1 | 1.7 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
0.1 | 0.5 | GO:0099527 | postsynapse to nucleus signaling pathway(GO:0099527) |
0.1 | 1.0 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.1 | 0.6 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 0.4 | GO:0002188 | translation reinitiation(GO:0002188) |
0.1 | 1.1 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
0.1 | 0.3 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.2 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
0.1 | 0.8 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.1 | 1.2 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.1 | 0.3 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.1 | 0.5 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.3 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
0.1 | 0.3 | GO:0010752 | regulation of cGMP-mediated signaling(GO:0010752) |
0.1 | 0.8 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.1 | 0.6 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.1 | 0.4 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.8 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
0.1 | 0.4 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.9 | GO:0097646 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
0.1 | 0.2 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.1 | 1.2 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.1 | 0.9 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
0.1 | 1.2 | GO:0001842 | neural fold formation(GO:0001842) |
0.1 | 0.5 | GO:0007207 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.1 | 0.5 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
0.1 | 0.4 | GO:0097360 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
0.1 | 0.8 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.1 | 0.3 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.1 | 1.1 | GO:1903405 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
0.1 | 0.3 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 0.5 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.1 | 0.7 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
0.1 | 0.5 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.1 | 2.9 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.1 | 2.1 | GO:0046033 | AMP metabolic process(GO:0046033) |
0.1 | 0.4 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
0.1 | 0.1 | GO:0090646 | mitochondrial tRNA processing(GO:0090646) |
0.1 | 0.3 | GO:0040010 | positive regulation of growth rate(GO:0040010) |
0.1 | 0.2 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.1 | 0.7 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.3 | GO:0019740 | regulation of nitrogen utilization(GO:0006808) nitrogen utilization(GO:0019740) regulation of cellular pH reduction(GO:0032847) |
0.1 | 0.5 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.1 | 0.3 | GO:2000567 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
0.1 | 0.1 | GO:0097324 | melanocyte migration(GO:0097324) |
0.1 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.1 | 1.2 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
0.1 | 1.7 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
0.1 | 0.2 | GO:0071350 | interleukin-15-mediated signaling pathway(GO:0035723) cellular response to interleukin-15(GO:0071350) |
0.1 | 0.2 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.1 | 0.4 | GO:0000019 | regulation of mitotic recombination(GO:0000019) |
0.1 | 0.2 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
0.1 | 0.4 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
0.1 | 0.2 | GO:0051030 | snRNA transport(GO:0051030) |
0.1 | 0.7 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.1 | 0.5 | GO:0060023 | soft palate development(GO:0060023) |
0.1 | 0.3 | GO:1901355 | response to rapamycin(GO:1901355) |
0.1 | 0.2 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.1 | 0.5 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.5 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.1 | 0.6 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
0.1 | 0.4 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.1 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
0.1 | 0.3 | GO:0010615 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
0.1 | 0.6 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
0.1 | 0.2 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.1 | 0.6 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.1 | GO:0021815 | modulation of microtubule cytoskeleton involved in cerebral cortex radial glia guided migration(GO:0021815) |
0.1 | 0.3 | GO:0060983 | epicardium-derived cardiac vascular smooth muscle cell differentiation(GO:0060983) |
0.1 | 0.4 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
0.1 | 0.2 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.1 | 0.1 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.1 | 0.7 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.4 | GO:0015786 | UDP-glucose transport(GO:0015786) |
0.1 | 0.3 | GO:1903760 | regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) |
0.1 | 0.5 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.1 | 0.3 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) |
0.1 | 0.6 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.1 | 0.4 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.1 | 0.3 | GO:0051944 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.1 | 3.8 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.1 | 0.8 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.1 | 0.3 | GO:0042637 | catagen(GO:0042637) |
0.1 | 0.3 | GO:0008355 | olfactory learning(GO:0008355) |
0.1 | 0.8 | GO:0006477 | protein sulfation(GO:0006477) |
0.1 | 0.9 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
0.1 | 1.7 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.1 | 0.3 | GO:1901608 | regulation of vesicle transport along microtubule(GO:1901608) |
0.1 | 0.2 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.1 | 0.3 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.1 | 0.2 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.1 | 0.2 | GO:0021649 | vestibulocochlear nerve structural organization(GO:0021649) ganglion morphogenesis(GO:0061552) dorsal root ganglion morphogenesis(GO:1904835) |
0.1 | 0.2 | GO:1905024 | regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905024) |
0.1 | 0.4 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.1 | 0.2 | GO:0060220 | camera-type eye photoreceptor cell fate commitment(GO:0060220) |
0.1 | 0.2 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 0.6 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.1 | 0.3 | GO:1902044 | regulation of Fas signaling pathway(GO:1902044) negative regulation of Fas signaling pathway(GO:1902045) |
0.1 | 0.2 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.1 | 0.5 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
0.1 | 0.2 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
0.1 | 0.4 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.1 | 0.3 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.1 | 0.3 | GO:1903504 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
0.1 | 0.5 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 0.5 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.1 | 0.2 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.1 | 0.5 | GO:0006547 | histidine metabolic process(GO:0006547) |
0.1 | 0.9 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.1 | 0.2 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
0.1 | 0.2 | GO:0016131 | brassinosteroid metabolic process(GO:0016131) brassinosteroid biosynthetic process(GO:0016132) |
0.1 | 0.2 | GO:0002946 | tRNA C5-cytosine methylation(GO:0002946) |
0.1 | 0.3 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.1 | 0.5 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
0.1 | 0.6 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.1 | 0.8 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.1 | 0.1 | GO:1904580 | regulation of intracellular mRNA localization(GO:1904580) |
0.1 | 0.3 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
0.1 | 0.7 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.2 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.1 | 0.2 | GO:0006868 | glutamine transport(GO:0006868) |
0.1 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.1 | 0.5 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.1 | 0.1 | GO:0090212 | regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) |
0.1 | 0.2 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
0.1 | 0.9 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.1 | 0.1 | GO:0034093 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.1 | 0.2 | GO:0015965 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
0.1 | 0.6 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.1 | 0.3 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
0.1 | 0.2 | GO:0042275 | error-free postreplication DNA repair(GO:0042275) |
0.1 | 0.1 | GO:1901970 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.1 | 0.1 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.1 | 0.3 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.1 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.1 | 0.3 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.1 | 0.3 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.1 | 0.6 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
0.1 | 0.3 | GO:0060849 | regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
0.1 | 0.3 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.1 | 0.3 | GO:0035552 | oxidative single-stranded DNA demethylation(GO:0035552) |
0.1 | 0.3 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.3 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.1 | 0.5 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.1 | 0.4 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.1 | 0.3 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.1 | 0.3 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.1 | 0.3 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.1 | 0.3 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
0.1 | 0.2 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.1 | 0.3 | GO:0061439 | renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) |
0.1 | 0.3 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.1 | 0.5 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
0.1 | 2.1 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
0.1 | 0.3 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.1 | 0.5 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.1 | 0.1 | GO:0032240 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
0.1 | 0.4 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.1 | 0.7 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.1 | 0.3 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.1 | 0.5 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.1 | 0.1 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.1 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.1 | 1.8 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.1 | 0.2 | GO:1904569 | regulation of selenocysteine incorporation(GO:1904569) |
0.1 | 0.1 | GO:0039533 | regulation of MDA-5 signaling pathway(GO:0039533) positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.1 | 0.7 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.1 | 0.1 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.1 | 0.4 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.1 | 0.4 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
0.1 | 0.3 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
0.1 | 0.2 | GO:0098971 | anterograde dendritic transport of neurotransmitter receptor complex(GO:0098971) |
0.1 | 0.3 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.1 | 0.4 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.1 | 0.4 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.1 | 0.2 | GO:0060667 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) coronal suture morphogenesis(GO:0060365) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) fibroblast growth factor receptor signaling pathway involved in mammary gland specification(GO:0060595) mammary gland bud formation(GO:0060615) branch elongation involved in salivary gland morphogenesis(GO:0060667) mesenchymal cell differentiation involved in lung development(GO:0060915) |
0.1 | 0.6 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.1 | 0.4 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
0.1 | 1.2 | GO:0031571 | mitotic G1 DNA damage checkpoint(GO:0031571) |
0.1 | 0.3 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.1 | 0.1 | GO:0061198 | fungiform papilla formation(GO:0061198) |
0.1 | 0.6 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.1 | 0.4 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.1 | 0.5 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 1.1 | GO:1990845 | adaptive thermogenesis(GO:1990845) |
0.1 | 0.2 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.1 | 0.6 | GO:0035879 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.1 | 0.1 | GO:1904616 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
0.1 | 0.2 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
0.1 | 0.8 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.1 | 0.3 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.1 | 0.1 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.1 | 0.1 | GO:0031635 | adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) |
0.1 | 0.3 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) |
0.1 | 0.3 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.1 | 0.4 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.1 | 0.2 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.1 | 1.2 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.1 | 0.5 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.1 | 0.4 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.1 | 0.5 | GO:0060872 | semicircular canal morphogenesis(GO:0048752) semicircular canal development(GO:0060872) |
0.1 | 0.4 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
0.1 | 0.2 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
0.1 | 0.5 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.2 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
0.1 | 0.1 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.1 | 0.2 | GO:0044268 | multicellular organismal protein metabolic process(GO:0044268) |
0.1 | 0.1 | GO:1900149 | positive regulation of Schwann cell migration(GO:1900149) |
0.1 | 0.2 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.1 | 0.1 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.1 | 0.1 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
0.1 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.1 | 0.4 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.1 | 0.3 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.1 | 0.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.1 | 0.2 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.1 | 0.8 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.1 | 0.3 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.1 | 1.9 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.1 | 0.1 | GO:0070494 | regulation of thrombin receptor signaling pathway(GO:0070494) negative regulation of thrombin receptor signaling pathway(GO:0070495) |
0.1 | 0.3 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.2 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.2 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
0.1 | 0.2 | GO:0045077 | negative regulation of interferon-gamma biosynthetic process(GO:0045077) |
0.1 | 0.1 | GO:0009223 | pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.1 | 0.1 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 0.3 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.1 | 0.2 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.1 | 0.3 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.1 | 0.1 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.1 | 0.3 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.2 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.2 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.1 | 0.2 | GO:0007521 | muscle cell fate determination(GO:0007521) |
0.1 | 0.2 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.1 | 0.2 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.1 | 0.3 | GO:0006108 | malate metabolic process(GO:0006108) |
0.1 | 0.1 | GO:0071314 | cellular response to cocaine(GO:0071314) |
0.1 | 0.3 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
0.1 | 0.2 | GO:0003050 | regulation of systemic arterial blood pressure by atrial natriuretic peptide(GO:0003050) |
0.1 | 0.4 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.1 | 0.2 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.1 | 0.3 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
0.1 | 1.0 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.1 | 0.1 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.1 | 0.4 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.1 | 0.4 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.1 | 0.9 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.1 | 0.4 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.1 | 0.9 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.1 | 0.2 | GO:0061536 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
0.1 | 0.2 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
0.1 | 0.2 | GO:0061215 | regulation of kidney size(GO:0035564) regulation of pronephros size(GO:0035565) hepatoblast differentiation(GO:0061017) mesonephros morphogenesis(GO:0061206) mesonephric nephron development(GO:0061215) mesonephric nephron morphogenesis(GO:0061228) mesenchymal stem cell maintenance involved in mesonephric nephron morphogenesis(GO:0061235) regulation of mesenchymal cell apoptotic process involved in mesonephric nephron morphogenesis(GO:0061295) negative regulation of mesenchymal cell apoptotic process involved in mesonephric nephron morphogenesis(GO:0061296) mesenchymal cell apoptotic process involved in mesonephric nephron morphogenesis(GO:1901146) |
0.1 | 0.9 | GO:0000052 | citrulline metabolic process(GO:0000052) |
0.1 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
0.1 | 0.2 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.1 | 0.2 | GO:0019343 | cysteine biosynthetic process via cystathionine(GO:0019343) |
0.0 | 0.0 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.2 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 1.2 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.0 | 0.2 | GO:0048686 | regulation of sprouting of injured axon(GO:0048686) regulation of axon extension involved in regeneration(GO:0048690) |
0.0 | 0.0 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.0 | 0.0 | GO:0007172 | signal complex assembly(GO:0007172) |
0.0 | 3.1 | GO:0006364 | rRNA processing(GO:0006364) |
0.0 | 0.3 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.2 | GO:0033078 | extrathymic T cell differentiation(GO:0033078) |
0.0 | 1.7 | GO:0042254 | ribosome biogenesis(GO:0042254) |
0.0 | 0.1 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.0 | 0.2 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.0 | 0.1 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
0.0 | 0.5 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.2 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
0.0 | 0.2 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.0 | 0.2 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
0.0 | 0.4 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
0.0 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 0.3 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.0 | 0.3 | GO:0030913 | paranodal junction assembly(GO:0030913) |
0.0 | 0.3 | GO:0072553 | terminal button organization(GO:0072553) |
0.0 | 0.4 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.3 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
0.0 | 0.8 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.1 | GO:2000371 | regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
0.0 | 0.2 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.0 | 0.1 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
0.0 | 0.1 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.0 | 0.1 | GO:0045645 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
0.0 | 0.2 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
0.0 | 0.2 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.2 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.0 | 1.0 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.0 | 0.0 | GO:0036292 | DNA rewinding(GO:0036292) |
0.0 | 0.2 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
0.0 | 0.1 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
0.0 | 0.2 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
0.0 | 0.2 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.0 | 0.1 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.2 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.0 | 0.2 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
0.0 | 0.3 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
0.0 | 0.2 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
0.0 | 0.1 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.0 | 0.3 | GO:0042891 | antibiotic transport(GO:0042891) |
0.0 | 0.2 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.0 | 0.0 | GO:1903181 | regulation of dopamine biosynthetic process(GO:1903179) positive regulation of dopamine biosynthetic process(GO:1903181) |
0.0 | 0.1 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.0 | 0.2 | GO:0032218 | riboflavin transport(GO:0032218) |
0.0 | 0.1 | GO:0097401 | synaptic vesicle lumen acidification(GO:0097401) |
0.0 | 0.0 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.0 | 0.1 | GO:0003032 | detection of oxygen(GO:0003032) |
0.0 | 0.2 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.0 | 0.3 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.6 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.0 | 0.5 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.0 | 0.1 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
0.0 | 0.3 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.0 | 0.1 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.0 | 0.5 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.2 | GO:0019042 | viral latency(GO:0019042) |
0.0 | 0.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.4 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 2.3 | GO:0051225 | spindle assembly(GO:0051225) |
0.0 | 0.0 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.0 | 0.1 | GO:0072737 | response to diamide(GO:0072737) cellular response to diamide(GO:0072738) |
0.0 | 0.0 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.0 | 0.2 | GO:0021539 | subthalamus development(GO:0021539) |
0.0 | 0.3 | GO:0060068 | vagina development(GO:0060068) |
0.0 | 0.2 | GO:0097503 | sialylation(GO:0097503) |
0.0 | 0.0 | GO:0018377 | protein myristoylation(GO:0018377) |
0.0 | 0.1 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.0 | 0.4 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.4 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.0 | 0.3 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.2 | GO:0030540 | female genitalia development(GO:0030540) |
0.0 | 0.1 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.0 | 0.2 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.0 | 0.2 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
0.0 | 0.1 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.0 | 0.2 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.1 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.0 | 0.0 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
0.0 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.3 | GO:0071173 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
0.0 | 0.8 | GO:0098534 | centriole replication(GO:0007099) centriole assembly(GO:0098534) |
0.0 | 0.2 | GO:0032796 | uropod organization(GO:0032796) |
0.0 | 0.6 | GO:0031297 | replication fork processing(GO:0031297) |
0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.2 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.0 | 0.5 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.0 | 0.2 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) negative regulation of axon guidance(GO:1902668) |
0.0 | 0.3 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.5 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.2 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.0 | 0.1 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
0.0 | 0.3 | GO:0014850 | response to muscle activity(GO:0014850) |
0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.3 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
0.0 | 0.1 | GO:0002270 | plasmacytoid dendritic cell activation(GO:0002270) |
0.0 | 0.1 | GO:0080111 | DNA demethylation(GO:0080111) |
0.0 | 0.5 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.0 | 0.6 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
0.0 | 1.4 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
0.0 | 0.2 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.0 | 0.1 | GO:1902100 | negative regulation of mitotic metaphase/anaphase transition(GO:0045841) mitotic spindle checkpoint(GO:0071174) negative regulation of metaphase/anaphase transition of cell cycle(GO:1902100) |
0.0 | 0.2 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.0 | 1.8 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.1 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.0 | 0.1 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.0 | 0.6 | GO:0000338 | protein deneddylation(GO:0000338) |
0.0 | 1.7 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.0 | 0.3 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
0.0 | 0.1 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.0 | 0.1 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.0 | 0.1 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.0 | 0.2 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.0 | 0.1 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.0 | 0.1 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
0.0 | 0.3 | GO:0070198 | protein localization to chromosome, telomeric region(GO:0070198) |
0.0 | 0.4 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.0 | 0.2 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.1 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
0.0 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.0 | 0.0 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
0.0 | 0.5 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.4 | GO:1901249 | regulation of lung goblet cell differentiation(GO:1901249) negative regulation of lung goblet cell differentiation(GO:1901250) |
0.0 | 0.2 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.0 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.2 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.0 | 0.1 | GO:0060715 | syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
0.0 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.2 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.0 | 0.4 | GO:0070673 | response to interleukin-18(GO:0070673) |
0.0 | 0.3 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.4 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.0 | 0.2 | GO:0019985 | translesion synthesis(GO:0019985) |
0.0 | 0.2 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
0.0 | 0.5 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.1 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
0.0 | 0.1 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.0 | 0.1 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
0.0 | 0.1 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.0 | 0.3 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 1.1 | GO:0006414 | translational elongation(GO:0006414) |
0.0 | 0.1 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.6 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.1 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.0 | 0.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.3 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.0 | 0.1 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
0.0 | 0.1 | GO:0098917 | retrograde trans-synaptic signaling(GO:0098917) |
0.0 | 0.2 | GO:0030261 | chromosome condensation(GO:0030261) |
0.0 | 0.4 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.3 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.0 | 0.1 | GO:0032053 | ciliary basal body organization(GO:0032053) |
0.0 | 0.1 | GO:1904528 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.0 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
0.0 | 0.1 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
0.0 | 0.4 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.0 | 0.2 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.8 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.5 | GO:0051298 | centrosome duplication(GO:0051298) |
0.0 | 0.4 | GO:0021511 | spinal cord patterning(GO:0021511) |
0.0 | 0.2 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
0.0 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.1 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
0.0 | 0.1 | GO:0035744 | T-helper 1 cell cytokine production(GO:0035744) regulation of T-helper 1 cell cytokine production(GO:2000554) positive regulation of T-helper 1 cell cytokine production(GO:2000556) |
0.0 | 0.1 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.0 | 0.2 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.8 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
0.0 | 0.2 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.1 | GO:1905214 | regulation of RNA binding(GO:1905214) |
0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.4 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.0 | 0.1 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
0.0 | 0.0 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.0 | 0.3 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.0 | 0.3 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
0.0 | 0.3 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.0 | 0.3 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.0 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.0 | 0.2 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.0 | 0.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.0 | 0.2 | GO:0042756 | drinking behavior(GO:0042756) |
0.0 | 0.2 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.0 | 0.1 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.3 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.5 | GO:0060972 | left/right pattern formation(GO:0060972) |
0.0 | 0.2 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.1 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
0.0 | 0.3 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.3 | GO:0021781 | glial cell fate commitment(GO:0021781) |
0.0 | 0.1 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.1 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.0 | 0.3 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.0 | 0.1 | GO:0045040 | outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.2 | GO:0098963 | dendritic transport of ribonucleoprotein complex(GO:0098961) dendritic transport of messenger ribonucleoprotein complex(GO:0098963) anterograde dendritic transport of messenger ribonucleoprotein complex(GO:0098964) |
0.0 | 0.1 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
0.0 | 0.1 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
0.0 | 0.1 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.0 | 0.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.0 | 0.2 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
0.0 | 0.2 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.0 | 0.1 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
0.0 | 0.1 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.3 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.3 | GO:0009147 | pyrimidine nucleoside triphosphate metabolic process(GO:0009147) |
0.0 | 0.3 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.0 | 0.1 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.0 | 0.2 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.0 | 0.1 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.0 | 0.2 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.2 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
0.0 | 0.1 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
0.0 | 0.2 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.0 | 0.2 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.2 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
0.0 | 0.1 | GO:0061760 | antifungal innate immune response(GO:0061760) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.1 | GO:0032916 | positive regulation of transforming growth factor beta3 production(GO:0032916) |
0.0 | 0.1 | GO:1904715 | negative regulation of chaperone-mediated autophagy(GO:1904715) |
0.0 | 0.2 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.2 | GO:0051306 | mitotic sister chromatid separation(GO:0051306) |
0.0 | 0.9 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.1 | GO:0052803 | imidazole-containing compound metabolic process(GO:0052803) |
0.0 | 0.1 | GO:0071107 | response to parathyroid hormone(GO:0071107) |
0.0 | 0.2 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.0 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.0 | 0.0 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
0.0 | 0.1 | GO:0030578 | PML body organization(GO:0030578) |
0.0 | 0.1 | GO:0014045 | establishment of endothelial blood-brain barrier(GO:0014045) |
0.0 | 0.4 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
0.0 | 0.2 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
0.0 | 0.1 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.0 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.0 | 0.9 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
0.0 | 0.2 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.0 | 0.1 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
0.0 | 0.3 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.0 | 0.2 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
0.0 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.1 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
0.0 | 0.2 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.0 | 0.2 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.4 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.0 | 0.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.1 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.0 | 0.3 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
0.0 | 0.3 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
0.0 | 0.1 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.0 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.0 | 0.6 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.0 | GO:0072716 | response to actinomycin D(GO:0072716) cellular response to actinomycin D(GO:0072717) |
0.0 | 0.1 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
0.0 | 0.2 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
0.0 | 0.0 | GO:0021938 | ventral midline development(GO:0007418) smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
0.0 | 0.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.2 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.0 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.0 | 0.2 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.0 | 0.2 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
0.0 | 0.1 | GO:1904048 | regulation of spontaneous neurotransmitter secretion(GO:1904048) |
0.0 | 0.0 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.0 | 0.7 | GO:1902808 | positive regulation of cell cycle G1/S phase transition(GO:1902808) |
0.0 | 0.1 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
0.0 | 0.4 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.0 | 0.1 | GO:0044861 | protein transport into plasma membrane raft(GO:0044861) |
0.0 | 0.1 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.0 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.0 | 0.1 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.0 | 0.2 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.0 | 0.2 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
0.0 | 0.1 | GO:0052203 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.0 | 0.3 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
0.0 | 0.1 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.1 | GO:0098707 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
0.0 | 0.4 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.0 | 0.5 | GO:0034724 | DNA replication-independent nucleosome organization(GO:0034724) |
0.0 | 0.4 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.0 | GO:0035510 | DNA dealkylation involved in DNA repair(GO:0006307) DNA dealkylation(GO:0035510) |
0.0 | 0.2 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.3 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
0.0 | 0.1 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) |
0.0 | 0.2 | GO:0071549 | cellular response to dexamethasone stimulus(GO:0071549) |
0.0 | 0.1 | GO:0001575 | globoside metabolic process(GO:0001575) |
0.0 | 0.2 | GO:0099628 | receptor diffusion trapping(GO:0098953) postsynaptic neurotransmitter receptor diffusion trapping(GO:0098970) neurotransmitter receptor diffusion trapping(GO:0099628) |
0.0 | 0.1 | GO:0008215 | spermine metabolic process(GO:0008215) |
0.0 | 0.1 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
0.0 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.0 | 0.1 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.0 | 0.1 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
0.0 | 0.0 | GO:1903874 | ferrous iron transmembrane transport(GO:1903874) |
0.0 | 0.1 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.1 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.6 | GO:0046677 | response to antibiotic(GO:0046677) |
0.0 | 0.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.3 | GO:0010586 | miRNA metabolic process(GO:0010586) |
0.0 | 0.1 | GO:2000489 | regulation of hepatic stellate cell activation(GO:2000489) |
0.0 | 0.3 | GO:0030224 | monocyte differentiation(GO:0030224) |
0.0 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.0 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.0 | 0.0 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
0.0 | 0.3 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.0 | 0.2 | GO:0006359 | regulation of transcription from RNA polymerase III promoter(GO:0006359) |
0.0 | 0.1 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.0 | 0.1 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.1 | GO:0048485 | sympathetic nervous system development(GO:0048485) |
0.0 | 0.1 | GO:0042117 | monocyte activation(GO:0042117) |
0.0 | 0.2 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.0 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.0 | 0.0 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.0 | 0.4 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
0.0 | 0.1 | GO:0009303 | rRNA transcription(GO:0009303) |
0.0 | 0.1 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.0 | 0.2 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.0 | 0.5 | GO:0097484 | dendrite extension(GO:0097484) |
0.0 | 0.0 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
0.0 | 0.1 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.0 | 0.1 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.0 | 0.3 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.0 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.0 | 0.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.2 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.5 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.1 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.0 | 0.1 | GO:0060426 | lung vasculature development(GO:0060426) |
0.0 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.3 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.0 | 0.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.0 | 0.8 | GO:0071346 | cellular response to interferon-gamma(GO:0071346) |
0.0 | 0.0 | GO:2000416 | regulation of eosinophil migration(GO:2000416) |
0.0 | 0.3 | GO:0045581 | negative regulation of T cell differentiation(GO:0045581) |
0.0 | 0.0 | GO:0009173 | UMP biosynthetic process(GO:0006222) pyrimidine nucleoside monophosphate metabolic process(GO:0009129) pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.0 | 0.4 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
0.0 | 0.5 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
0.0 | 0.0 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.0 | 0.0 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.0 | 0.0 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.2 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.2 | GO:0071539 | protein localization to centrosome(GO:0071539) |
0.0 | 0.0 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 0.1 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.0 | 0.0 | GO:0045606 | positive regulation of epidermal cell differentiation(GO:0045606) |
0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.0 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.0 | 0.1 | GO:1902031 | regulation of pentose-phosphate shunt(GO:0043456) regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.2 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.1 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.0 | 0.3 | GO:0071156 | regulation of cell cycle arrest(GO:0071156) |
0.0 | 0.0 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
0.0 | 0.0 | GO:0016246 | RNA interference(GO:0016246) |
0.0 | 0.1 | GO:0030974 | thiamine pyrophosphate transport(GO:0030974) |
0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.0 | 0.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.3 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.0 | 0.0 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 0.2 | GO:0070269 | pyroptosis(GO:0070269) |
0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.0 | GO:0016259 | selenium compound metabolic process(GO:0001887) selenocysteine metabolic process(GO:0016259) |
0.0 | 0.4 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.0 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.0 | 0.1 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.0 | 0.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.0 | 0.1 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.0 | 0.1 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.0 | 0.1 | GO:0051444 | negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
0.0 | 0.0 | GO:0099526 | presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
0.0 | 0.0 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.0 | 0.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.0 | 0.1 | GO:0010747 | positive regulation of plasma membrane long-chain fatty acid transport(GO:0010747) |
0.0 | 0.1 | GO:0010458 | exit from mitosis(GO:0010458) |
0.0 | 0.1 | GO:0006999 | nuclear pore organization(GO:0006999) |
0.0 | 0.2 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
0.0 | 0.0 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.0 | 0.3 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.2 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.0 | GO:0039020 | pronephric nephron tubule development(GO:0039020) pronephros morphogenesis(GO:0072114) |
0.0 | 0.0 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.5 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.2 | GO:0044705 | mating behavior(GO:0007617) multi-organism reproductive behavior(GO:0044705) |
0.0 | 0.0 | GO:0046040 | IMP metabolic process(GO:0046040) |
0.0 | 0.1 | GO:0038032 | termination of G-protein coupled receptor signaling pathway(GO:0038032) |
0.0 | 0.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.0 | 0.1 | GO:0071484 | cellular response to light intensity(GO:0071484) cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
0.0 | 0.1 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.0 | 0.2 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.0 | GO:0072180 | mesonephric duct development(GO:0072177) mesonephric duct morphogenesis(GO:0072180) mesonephric duct formation(GO:0072181) |
0.0 | 0.1 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.0 | 0.0 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.0 | 0.0 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.0 | 0.1 | GO:0006498 | N-terminal protein lipidation(GO:0006498) |
0.0 | 0.1 | GO:0051531 | NFAT protein import into nucleus(GO:0051531) |
0.0 | 0.0 | GO:0031054 | pre-miRNA processing(GO:0031054) |
0.0 | 0.5 | GO:0008033 | tRNA processing(GO:0008033) |
0.0 | 0.1 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.0 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.0 | 0.1 | GO:0044803 | multi-organism membrane organization(GO:0044803) |
0.0 | 0.0 | GO:1903027 | regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
0.0 | 0.0 | GO:0060967 | negative regulation of posttranscriptional gene silencing(GO:0060149) negative regulation of gene silencing by RNA(GO:0060967) |
0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.1 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.0 | 0.0 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.0 | GO:0044650 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.3 | GO:0000799 | nuclear condensin complex(GO:0000799) |
0.4 | 1.2 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.4 | 1.4 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
0.3 | 1.0 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
0.3 | 2.2 | GO:0000796 | condensin complex(GO:0000796) |
0.3 | 1.5 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.3 | 2.1 | GO:0001652 | granular component(GO:0001652) |
0.3 | 0.9 | GO:0035101 | FACT complex(GO:0035101) |
0.3 | 1.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.3 | 1.0 | GO:0090537 | CERF complex(GO:0090537) |
0.3 | 0.8 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
0.2 | 1.0 | GO:0008623 | CHRAC(GO:0008623) |
0.2 | 1.9 | GO:0005818 | aster(GO:0005818) |
0.2 | 1.9 | GO:0070652 | HAUS complex(GO:0070652) |
0.2 | 0.9 | GO:1902737 | dendritic filopodium(GO:1902737) |
0.2 | 0.6 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.2 | 0.6 | GO:0042025 | host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
0.2 | 1.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.2 | 0.9 | GO:0097226 | sperm mitochondrial sheath(GO:0097226) |
0.2 | 1.1 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.2 | 0.7 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.2 | 1.9 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.2 | 1.4 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.2 | 1.6 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.2 | 1.2 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.2 | 1.0 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.2 | 1.6 | GO:0044327 | dendritic spine head(GO:0044327) |
0.2 | 1.0 | GO:0098536 | deuterosome(GO:0098536) |
0.2 | 0.8 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.2 | 0.9 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 1.3 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.1 | 1.8 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.1 | 0.7 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 0.8 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
0.1 | 0.7 | GO:0030689 | Noc complex(GO:0030689) |
0.1 | 0.4 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 0.7 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.7 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.1 | 1.7 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.1 | 0.5 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.1 | 0.3 | GO:0044317 | rod spherule(GO:0044317) |
0.1 | 1.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.1 | 1.0 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.4 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
0.1 | 0.7 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.6 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.1 | 0.3 | GO:0031251 | PAN complex(GO:0031251) |
0.1 | 0.3 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.1 | 1.0 | GO:0008278 | cohesin complex(GO:0008278) |
0.1 | 0.5 | GO:0031523 | Myb complex(GO:0031523) |
0.1 | 1.6 | GO:0070938 | contractile ring(GO:0070938) |
0.1 | 0.7 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.1 | 0.3 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.1 | 0.1 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.1 | 0.4 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 1.1 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 0.3 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 0.6 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 1.3 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.1 | 0.4 | GO:0005745 | m-AAA complex(GO:0005745) |
0.1 | 0.4 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 0.3 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 0.8 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.1 | 7.3 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.1 | 1.3 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
0.1 | 1.5 | GO:0030686 | 90S preribosome(GO:0030686) |
0.1 | 2.0 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 0.5 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 0.7 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 0.6 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.1 | 0.6 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.1 | 2.7 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 0.4 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.1 | 0.6 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
0.1 | 0.4 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.1 | 0.6 | GO:0001740 | Barr body(GO:0001740) |
0.1 | 0.9 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 0.4 | GO:0005683 | U7 snRNP(GO:0005683) |
0.1 | 0.4 | GO:0099569 | presynaptic cytoskeleton(GO:0099569) |
0.1 | 0.5 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.1 | 0.5 | GO:0005587 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.1 | 0.3 | GO:0071920 | cleavage body(GO:0071920) |
0.1 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.1 | 0.3 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.1 | 0.2 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.1 | 0.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.3 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.1 | 0.3 | GO:1990032 | parallel fiber(GO:1990032) |
0.1 | 0.4 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 1.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 0.5 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
0.1 | 0.2 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 0.5 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 0.2 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
0.1 | 1.9 | GO:0071565 | nBAF complex(GO:0071565) |
0.1 | 1.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 3.6 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.1 | 3.6 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.3 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 1.3 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.1 | 0.2 | GO:0071564 | npBAF complex(GO:0071564) |
0.1 | 0.2 | GO:0031417 | NatC complex(GO:0031417) |
0.1 | 0.2 | GO:1903095 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
0.1 | 1.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.1 | 0.3 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
0.1 | 0.2 | GO:0098842 | postsynaptic early endosome(GO:0098842) |
0.1 | 1.6 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 2.6 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.1 | 0.3 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.1 | 0.6 | GO:0000801 | central element(GO:0000801) |
0.1 | 0.5 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 1.0 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.1 | 0.3 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.8 | GO:0042555 | MCM complex(GO:0042555) |
0.1 | 1.2 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.1 | 0.3 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.1 | 0.3 | GO:0005914 | spot adherens junction(GO:0005914) |
0.1 | 2.0 | GO:0015935 | small ribosomal subunit(GO:0015935) |
0.1 | 0.3 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.1 | 0.2 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
0.1 | 0.6 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.1 | 0.9 | GO:0043073 | germ cell nucleus(GO:0043073) |
0.1 | 1.0 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.1 | 0.5 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.1 | 0.2 | GO:1990696 | USH2 complex(GO:1990696) |
0.1 | 0.8 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.1 | 0.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.1 | 0.2 | GO:0035061 | interchromatin granule(GO:0035061) |
0.1 | 0.6 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.1 | 0.3 | GO:0098845 | postsynaptic endosome(GO:0098845) |
0.1 | 1.0 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.1 | 0.4 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.1 | 0.4 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 0.2 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.1 | 0.4 | GO:0001940 | male pronucleus(GO:0001940) |
0.1 | 0.6 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.1 | 0.3 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.1 | 1.3 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.1 | 2.1 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.1 | 0.6 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
0.1 | 0.3 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.1 | 0.2 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
0.1 | 0.9 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.2 | GO:0005673 | transcription factor TFIIE complex(GO:0005673) |
0.1 | 0.2 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
0.1 | 0.3 | GO:0071817 | MMXD complex(GO:0071817) |
0.1 | 0.2 | GO:0005584 | collagen type I trimer(GO:0005584) |
0.1 | 0.9 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.8 | GO:0005686 | U2 snRNP(GO:0005686) |
0.1 | 0.8 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.0 | 0.2 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
0.0 | 0.6 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.5 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.7 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.7 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.6 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.0 | 1.4 | GO:0033268 | node of Ranvier(GO:0033268) |
0.0 | 0.2 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 0.2 | GO:0000221 | vacuolar proton-transporting V-type ATPase, V1 domain(GO:0000221) |
0.0 | 0.2 | GO:1990769 | proximal neuron projection(GO:1990769) |
0.0 | 0.2 | GO:0008537 | proteasome activator complex(GO:0008537) |
0.0 | 0.2 | GO:0030870 | Mre11 complex(GO:0030870) |
0.0 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.5 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.1 | GO:0098833 | presynaptic endocytic zone(GO:0098833) presynaptic endocytic zone membrane(GO:0098835) |
0.0 | 0.1 | GO:0014802 | terminal cisterna(GO:0014802) |
0.0 | 0.3 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.0 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.7 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.1 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.0 | 0.2 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.0 | 0.4 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.1 | GO:0034272 | phosphatidylinositol 3-kinase complex, class III, type I(GO:0034271) phosphatidylinositol 3-kinase complex, class III, type II(GO:0034272) |
0.0 | 0.0 | GO:0097361 | CIA complex(GO:0097361) |
0.0 | 0.3 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.0 | 0.2 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.3 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.4 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.0 | 0.5 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.8 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.2 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 0.3 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 1.4 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.0 | 0.0 | GO:0005940 | septin ring(GO:0005940) |
0.0 | 1.1 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.3 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.3 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.5 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.0 | 0.1 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.2 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.0 | 1.5 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.5 | GO:1990635 | proximal dendrite(GO:1990635) |
0.0 | 0.5 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.2 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.0 | 3.1 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 0.4 | GO:0030532 | small nuclear ribonucleoprotein complex(GO:0030532) |
0.0 | 0.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.0 | 0.3 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.5 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.5 | GO:0070069 | cytochrome complex(GO:0070069) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.5 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.2 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.2 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.0 | 0.8 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.0 | 0.2 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 0.4 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.2 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.4 | GO:0005685 | U1 snRNP(GO:0005685) |
0.0 | 0.3 | GO:0097449 | astrocyte projection(GO:0097449) |
0.0 | 0.2 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.3 | GO:0031105 | septin complex(GO:0031105) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.3 | GO:0043596 | nuclear replication fork(GO:0043596) |
0.0 | 0.7 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.4 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.5 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 2.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.1 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
0.0 | 0.2 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.4 | GO:0005652 | nuclear lamina(GO:0005652) |
0.0 | 1.3 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.5 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.7 | GO:0005657 | replication fork(GO:0005657) |
0.0 | 0.2 | GO:0072687 | meiotic spindle(GO:0072687) |
0.0 | 3.0 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.4 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.1 | GO:0042642 | actomyosin, myosin complex part(GO:0042642) |
0.0 | 0.1 | GO:0070187 | telosome(GO:0070187) |
0.0 | 2.4 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 0.3 | GO:0032040 | small-subunit processome(GO:0032040) |
0.0 | 0.2 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.5 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.9 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.4 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
0.0 | 0.2 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.0 | 0.2 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
0.0 | 0.9 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 2.0 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.1 | GO:0031082 | BLOC complex(GO:0031082) |
0.0 | 0.3 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.3 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.1 | GO:0005595 | collagen type XII trimer(GO:0005595) anchoring collagen complex(GO:0030934) |
0.0 | 0.1 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
0.0 | 0.2 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
0.0 | 0.0 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.0 | 1.8 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.1 | GO:0032437 | cuticular plate(GO:0032437) |
0.0 | 0.1 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.0 | 1.0 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.2 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.2 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 0.2 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.2 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.4 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
0.0 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.6 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
0.0 | 0.2 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
0.0 | 0.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.5 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.1 | GO:0090544 | BAF-type complex(GO:0090544) |
0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.1 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.0 | 1.4 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.0 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.0 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.2 | GO:0001741 | XY body(GO:0001741) |
0.0 | 1.1 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
0.0 | 0.7 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.0 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 0.2 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.4 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.1 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
0.0 | 10.5 | GO:0005730 | nucleolus(GO:0005730) |
0.0 | 0.0 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.0 | 0.3 | GO:0000792 | heterochromatin(GO:0000792) |
0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.0 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
0.0 | 0.0 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.0 | 0.2 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.1 | GO:0036128 | CatSper complex(GO:0036128) |
0.0 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.0 | 0.1 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.0 | 0.0 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.1 | GO:0032432 | actin filament bundle(GO:0032432) |
0.0 | 0.1 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.0 | 0.0 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) postsynaptic endocytic zone cytoplasmic component(GO:0099631) |
0.0 | 0.1 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.4 | GO:0055105 | ubiquitin-protein transferase inhibitor activity(GO:0055105) |
0.3 | 1.0 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.3 | 1.2 | GO:0000010 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
0.3 | 1.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.3 | 1.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.3 | 1.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.3 | 0.3 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.3 | 1.6 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.3 | 0.8 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.2 | 0.7 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
0.2 | 0.7 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.2 | 1.2 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.2 | 0.7 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
0.2 | 0.6 | GO:0070052 | collagen V binding(GO:0070052) |
0.2 | 1.3 | GO:0002135 | CTP binding(GO:0002135) |
0.2 | 0.8 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
0.2 | 0.6 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
0.2 | 0.6 | GO:0005308 | creatine transmembrane transporter activity(GO:0005308) |
0.2 | 0.9 | GO:0043515 | kinetochore binding(GO:0043515) |
0.2 | 0.5 | GO:0002153 | steroid receptor RNA activator RNA binding(GO:0002153) |
0.2 | 0.7 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.2 | 2.3 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.2 | 2.4 | GO:0050693 | LBD domain binding(GO:0050693) |
0.2 | 0.5 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.2 | 0.5 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
0.1 | 0.1 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
0.1 | 0.1 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
0.1 | 0.6 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.1 | 0.4 | GO:0050252 | 2-acylglycerol O-acyltransferase activity(GO:0003846) retinol O-fatty-acyltransferase activity(GO:0050252) |
0.1 | 1.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 0.9 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.1 | 0.9 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
0.1 | 0.8 | GO:0097643 | amylin receptor activity(GO:0097643) |
0.1 | 0.4 | GO:0004952 | dopamine neurotransmitter receptor activity(GO:0004952) |
0.1 | 1.4 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.1 | 0.8 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.1 | 0.4 | GO:0004482 | mRNA (guanine-N7-)-methyltransferase activity(GO:0004482) |
0.1 | 0.9 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.1 | 0.8 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 1.3 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 0.8 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.5 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.1 | 0.6 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.1 | 0.8 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 1.0 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.1 | 1.5 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.5 | GO:0008802 | betaine-aldehyde dehydrogenase activity(GO:0008802) |
0.1 | 0.1 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.1 | 2.0 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
0.1 | 1.3 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.1 | 1.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 1.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 2.3 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 1.0 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.1 | 0.4 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.1 | 0.6 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
0.1 | 0.5 | GO:0001011 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
0.1 | 0.6 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 0.2 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.1 | 0.5 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
0.1 | 0.5 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.1 | 0.6 | GO:0008061 | chitin binding(GO:0008061) |
0.1 | 0.3 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.4 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
0.1 | 0.6 | GO:1990188 | euchromatin binding(GO:1990188) |
0.1 | 0.4 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
0.1 | 0.5 | GO:0099528 | G-protein coupled acetylcholine receptor activity(GO:0016907) G-protein coupled neurotransmitter receptor activity(GO:0099528) |
0.1 | 0.5 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.1 | 0.3 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
0.1 | 0.7 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.1 | 0.7 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.3 | GO:0001042 | RNA polymerase I core binding(GO:0001042) |
0.1 | 0.3 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.1 | 0.4 | GO:0031782 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.1 | 0.4 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.1 | 0.4 | GO:0038025 | reelin receptor activity(GO:0038025) |
0.1 | 0.2 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 0.3 | GO:0070736 | protein-glycine ligase activity, initiating(GO:0070736) |
0.1 | 0.4 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
0.1 | 0.6 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.1 | 1.3 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.1 | 0.3 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
0.1 | 0.6 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 0.4 | GO:0003883 | CTP synthase activity(GO:0003883) |
0.1 | 0.3 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
0.1 | 0.5 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
0.1 | 0.3 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.1 | 0.5 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 0.4 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 0.4 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.1 | 2.0 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 0.3 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
0.1 | 0.5 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.1 | 0.1 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.1 | 0.4 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.1 | 0.4 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
0.1 | 0.4 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 1.3 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.1 | 0.4 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.3 | GO:0001003 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
0.1 | 0.3 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.1 | 0.3 | GO:0050610 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
0.1 | 0.6 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.1 | 0.4 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
0.1 | 0.4 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.3 | GO:0008988 | rRNA (adenine-N6-)-methyltransferase activity(GO:0008988) |
0.1 | 0.7 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.1 | 0.2 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
0.1 | 0.4 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.4 | GO:0008761 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) |
0.1 | 0.4 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.4 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.1 | 0.5 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
0.1 | 0.2 | GO:0001147 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
0.1 | 0.5 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
0.1 | 0.7 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.1 | 0.6 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
0.1 | 0.7 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 0.6 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 0.2 | GO:0018738 | S-formylglutathione hydrolase activity(GO:0018738) |
0.1 | 0.3 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.1 | 0.2 | GO:0047598 | sterol delta7 reductase activity(GO:0009918) 7-dehydrocholesterol reductase activity(GO:0047598) |
0.1 | 0.6 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.7 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.1 | 0.8 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 0.2 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.1 | 0.9 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.1 | 0.4 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
0.1 | 12.1 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 0.5 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.1 | 1.2 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.6 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
0.1 | 0.2 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
0.1 | 0.5 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 0.2 | GO:0070540 | stearic acid binding(GO:0070540) |
0.1 | 0.6 | GO:0034711 | inhibin binding(GO:0034711) |
0.1 | 0.4 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.1 | 0.3 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
0.1 | 0.7 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.1 | 0.8 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.1 | 0.2 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.1 | 0.3 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.1 | 1.4 | GO:0008143 | poly(A) binding(GO:0008143) |
0.1 | 0.5 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.1 | 1.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.1 | 0.1 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.1 | 0.4 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.1 | 0.2 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
0.1 | 0.2 | GO:0004686 | elongation factor-2 kinase activity(GO:0004686) |
0.1 | 0.2 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
0.1 | 0.3 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 1.3 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
0.1 | 0.6 | GO:0000339 | RNA cap binding(GO:0000339) |
0.1 | 0.4 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
0.1 | 0.3 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.1 | 0.6 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.1 | 0.4 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
0.1 | 1.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.1 | 0.1 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.1 | 0.2 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.1 | 0.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.3 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.1 | 0.4 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 0.2 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
0.1 | 0.7 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.1 | 0.4 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
0.1 | 0.1 | GO:0001083 | transcription factor activity, RNA polymerase II basal transcription factor binding(GO:0001083) |
0.1 | 1.1 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 0.2 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.1 | 0.5 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.1 | 0.2 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
0.1 | 0.5 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.1 | 0.2 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.1 | 0.2 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.1 | 0.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 0.3 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.1 | 0.4 | GO:0015616 | DNA translocase activity(GO:0015616) |
0.1 | 0.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.3 | GO:0001032 | RNA polymerase III type 3 promoter DNA binding(GO:0001032) |
0.1 | 1.0 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.1 | 0.3 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.1 | 0.2 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.1 | 0.3 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.1 | 0.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.1 | 0.3 | GO:0043734 | DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
0.1 | 0.3 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.1 | 0.4 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 0.4 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.1 | 1.2 | GO:0008483 | transaminase activity(GO:0008483) |
0.1 | 0.4 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.1 | 0.3 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.5 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 0.2 | GO:0016708 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) iron-cytochrome-c reductase activity(GO:0047726) |
0.1 | 0.5 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.8 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.1 | 0.2 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
0.1 | 0.3 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 0.2 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.1 | 0.2 | GO:0035939 | microsatellite binding(GO:0035939) |
0.1 | 0.4 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.2 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 1.3 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.0 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.0 | 0.1 | GO:0032356 | oxidized DNA binding(GO:0032356) |
0.0 | 0.3 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.8 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.1 | GO:0031403 | lithium ion binding(GO:0031403) |
0.0 | 0.2 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.0 | 0.1 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.0 | 0.1 | GO:0008431 | vitamin E binding(GO:0008431) |
0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.1 | GO:0031687 | A2A adenosine receptor binding(GO:0031687) |
0.0 | 0.6 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 0.4 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.2 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.0 | 1.9 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.4 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.8 | GO:0030515 | snoRNA binding(GO:0030515) |
0.0 | 0.1 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.0 | 0.4 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.1 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
0.0 | 0.3 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
0.0 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 0.1 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
0.0 | 0.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.0 | 0.1 | GO:0097677 | STAT family protein binding(GO:0097677) |
0.0 | 0.0 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.1 | GO:0005119 | smoothened binding(GO:0005119) |
0.0 | 0.4 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.5 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.2 | GO:0047275 | glucosaminylgalactosylglucosylceramide beta-galactosyltransferase activity(GO:0047275) |
0.0 | 0.5 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.0 | 0.2 | GO:0086077 | gap junction channel activity involved in AV node cell-bundle of His cell electrical coupling(GO:0086077) |
0.0 | 0.1 | GO:0070615 | nucleosome-dependent ATPase activity(GO:0070615) |
0.0 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.0 | 0.2 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
0.0 | 0.2 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.0 | 0.6 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 2.3 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.3 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 1.8 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.3 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.3 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
0.0 | 0.2 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.0 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) single guanine insertion binding(GO:0032142) |
0.0 | 0.1 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
0.0 | 0.3 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.1 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.0 | 0.0 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
0.0 | 0.2 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.0 | 0.2 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.3 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.0 | 0.2 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.2 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.0 | 0.3 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.2 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
0.0 | 0.8 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.3 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.0 | 0.3 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.9 | GO:0045182 | translation regulator activity(GO:0045182) |
0.0 | 1.1 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 4.1 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.0 | 0.2 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.0 | 0.2 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.1 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
0.0 | 0.1 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
0.0 | 0.1 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
0.0 | 0.1 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.0 | 0.1 | GO:0052593 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
0.0 | 0.3 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.2 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.3 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
0.0 | 0.2 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.2 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.3 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
0.0 | 0.5 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 3.2 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.2 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 1.3 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.6 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.3 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.0 | 0.4 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.0 | 0.5 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.2 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.0 | 0.3 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.3 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 0.1 | GO:0071820 | N-box binding(GO:0071820) |
0.0 | 1.1 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 0.4 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.1 | GO:0000401 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
0.0 | 0.4 | GO:0015266 | protein channel activity(GO:0015266) |
0.0 | 0.3 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
0.0 | 0.1 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.0 | 0.2 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.3 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.0 | 0.4 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 5.7 | GO:0008168 | methyltransferase activity(GO:0008168) |
0.0 | 1.4 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.0 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
0.0 | 0.1 | GO:0003916 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.6 | GO:0048156 | tau protein binding(GO:0048156) |
0.0 | 0.3 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.2 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 1.8 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.3 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.0 | 1.1 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.7 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.0 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.0 | 0.4 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.3 | GO:0031811 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
0.0 | 0.2 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
0.0 | 0.1 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.0 | 0.4 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 0.2 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.4 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.2 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.0 | 1.4 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.2 | GO:0016653 | NADPH-hemoprotein reductase activity(GO:0003958) oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.0 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.5 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 0.2 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.1 | GO:0035276 | ethanol binding(GO:0035276) |
0.0 | 0.2 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
0.0 | 0.1 | GO:0035605 | peptidyl-cysteine S-nitrosylase activity(GO:0035605) |
0.0 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.2 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.0 | 0.6 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.2 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.0 | GO:0034437 | glycoprotein transporter activity(GO:0034437) |
0.0 | 0.3 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 1.0 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.1 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
0.0 | 0.1 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
0.0 | 0.2 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.0 | 0.1 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
0.0 | 0.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.4 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.1 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
0.0 | 0.5 | GO:0030506 | ankyrin binding(GO:0030506) |
0.0 | 0.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.0 | 0.5 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.6 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.1 | GO:0050664 | superoxide-generating NADPH oxidase activity(GO:0016175) oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
0.0 | 0.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.0 | 0.6 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.1 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.6 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.4 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.1 | GO:0070404 | NADH binding(GO:0070404) |
0.0 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.0 | 0.2 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.0 | 0.4 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.9 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.7 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.0 | 0.3 | GO:0019841 | retinol binding(GO:0019841) |
0.0 | 0.1 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.1 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
0.0 | 0.1 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 0.1 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.7 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
0.0 | 0.9 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 2.7 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.3 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
0.0 | 0.1 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 0.3 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016893) |
0.0 | 0.2 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
0.0 | 0.0 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.4 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.3 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.1 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
0.0 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.2 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.1 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.0 | 0.6 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.1 | GO:0036004 | GAF domain binding(GO:0036004) |
0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.7 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.0 | 0.2 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.1 | GO:0015234 | thiamine transmembrane transporter activity(GO:0015234) |
0.0 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.0 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.0 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.9 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.0 | 0.4 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.4 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.0 | 0.2 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.0 | 0.2 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.0 | 0.7 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.1 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.0 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.0 | 0.3 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.0 | 0.1 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
0.0 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.7 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.4 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 1.2 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.0 | 1.1 | GO:0008186 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 1.8 | GO:0005178 | integrin binding(GO:0005178) |
0.0 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.1 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.1 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.0 | 1.0 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.2 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 1.5 | GO:0044822 | mRNA binding(GO:0003729) poly(A) RNA binding(GO:0044822) |
0.0 | 0.2 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.2 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.3 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.0 | 0.0 | GO:0004962 | endothelin receptor activity(GO:0004962) |
0.0 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) activin-activated receptor activity(GO:0017002) |
0.0 | 0.2 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.0 | 0.1 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.0 | 0.1 | GO:0031404 | chloride ion binding(GO:0031404) |
0.0 | 0.1 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.2 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.0 | 0.1 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) RNA polymerase activity(GO:0034062) |
0.0 | 0.1 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.0 | 0.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.2 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.0 | GO:0004356 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) |
0.0 | 0.2 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.3 | GO:0016876 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.0 | 0.0 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) L-threonine ammonia-lyase activity(GO:0004794) |
0.0 | 0.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.2 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
0.0 | 0.7 | GO:0015179 | L-amino acid transmembrane transporter activity(GO:0015179) |
0.0 | 0.2 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.1 | GO:0004064 | arylesterase activity(GO:0004064) |
0.0 | 0.3 | GO:0008009 | chemokine activity(GO:0008009) |
0.0 | 0.1 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.1 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.1 | GO:0004382 | guanosine-diphosphatase activity(GO:0004382) |
0.0 | 0.7 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.0 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.2 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.0 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.0 | 0.0 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.7 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.0 | 0.0 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.0 | 0.0 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.0 | 0.0 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.5 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.2 | 3.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.1 | 7.1 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 7.0 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 4.9 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.1 | 0.8 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 0.6 | PID FGF PATHWAY | FGF signaling pathway |
0.1 | 0.3 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 2.1 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 2.2 | PID BARD1 PATHWAY | BARD1 signaling events |
0.1 | 2.3 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 4.2 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.1 | 2.5 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 1.5 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.1 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 0.6 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 0.0 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 1.0 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.1 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.7 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 3.3 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.3 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 1.1 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 1.2 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.7 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.5 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 2.0 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.2 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.2 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.9 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.3 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.4 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.5 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.0 | 1.0 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.4 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.2 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.4 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.4 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.6 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.7 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.5 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.0 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.6 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.7 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.0 | 0.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.2 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.3 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.8 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.6 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.1 | PID IL23 PATHWAY | IL23-mediated signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.4 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.2 | 0.4 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.2 | 0.2 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
0.2 | 1.9 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.2 | 6.1 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.2 | 0.5 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.1 | 1.5 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 1.9 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.1 | 1.6 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 3.9 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.1 | 2.3 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.1 | 1.5 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.1 | 2.3 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.1 | 0.1 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
0.1 | 0.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 1.4 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.1 | 2.7 | REACTOME KINESINS | Genes involved in Kinesins |
0.1 | 1.5 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.1 | 1.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.1 | 1.9 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.1 | 9.6 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 1.0 | REACTOME LAGGING STRAND SYNTHESIS | Genes involved in Lagging Strand Synthesis |
0.1 | 1.4 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF CYCLIN B | Genes involved in APC/C:Cdc20 mediated degradation of Cyclin B |
0.1 | 2.2 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 0.1 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.1 | 6.7 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 1.6 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.1 | 1.2 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 0.7 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.1 | 1.5 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.1 | 0.5 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.1 | 1.6 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.1 | 0.9 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 1.2 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 3.0 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 0.6 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.1 | 0.2 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 0.7 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.1 | 0.1 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.1 | 0.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 0.8 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.1 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 2.3 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 1.5 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.1 | 0.9 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.1 | 0.5 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 2.7 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.5 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.4 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.4 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.5 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.8 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.3 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.0 | 1.0 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 3.4 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.0 | 0.7 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.0 | 1.2 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 0.2 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 0.6 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.7 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.0 | 0.2 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.5 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.1 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
0.0 | 1.1 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 2.0 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.0 | 2.6 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
0.0 | 0.1 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
0.0 | 0.7 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.0 | 0.8 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.0 | 0.8 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.4 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.4 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.0 | 1.2 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.8 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.0 | 1.7 | REACTOME MITOTIC G2 G2 M PHASES | Genes involved in Mitotic G2-G2/M phases |
0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.2 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.0 | 0.0 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.0 | 0.2 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 0.3 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.6 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.0 | 0.5 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.0 | 1.0 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 0.4 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.5 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.0 | 0.0 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.2 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.3 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.0 | 0.4 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.2 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.0 | 0.6 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.2 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.0 | 0.2 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.0 | 0.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.2 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 0.5 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.0 | 0.2 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.4 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.4 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.4 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 0.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.8 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.0 | 1.8 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.3 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.0 | 0.3 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.2 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 0.1 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.0 | 0.1 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.0 | 0.0 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.3 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.1 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.5 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.3 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.0 | 0.8 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.0 | 0.0 | REACTOME E2F MEDIATED REGULATION OF DNA REPLICATION | Genes involved in E2F mediated regulation of DNA replication |
0.0 | 0.1 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.1 | REACTOME TRANSCRIPTION COUPLED NER TC NER | Genes involved in Transcription-coupled NER (TC-NER) |
0.0 | 0.4 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.1 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.0 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.2 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |