avrg: 12D miR HR13_24
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Nfia
|
ENSMUSG00000028565.12 | nuclear factor I/A |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Nfia | mm10_v2_chr4_+_97772734_97772848 | -0.62 | 4.4e-02 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr7_-_128206346 | 2.07 |
ENSMUST00000033049.7
|
Cox6a2
|
cytochrome c oxidase subunit VIa polypeptide 2 |
chr4_+_82065855 | 1.66 |
ENSMUST00000151038.1
|
Gm5860
|
predicted gene 5860 |
chr11_+_96931387 | 1.02 |
ENSMUST00000107633.1
|
Prr15l
|
proline rich 15-like |
chr7_+_113207465 | 0.96 |
ENSMUST00000047321.7
|
Arntl
|
aryl hydrocarbon receptor nuclear translocator-like |
chr17_-_34972124 | 0.92 |
ENSMUST00000087328.2
ENSMUST00000179128.1 |
Hspa1a
|
heat shock protein 1A |
chr5_+_66968416 | 0.90 |
ENSMUST00000038188.7
|
Limch1
|
LIM and calponin homology domains 1 |
chr2_-_129699833 | 0.88 |
ENSMUST00000028883.5
|
Pdyn
|
prodynorphin |
chr10_-_24092320 | 0.87 |
ENSMUST00000092654.2
|
Taar8b
|
trace amine-associated receptor 8B |
chr7_-_46179929 | 0.86 |
ENSMUST00000033123.6
|
Abcc8
|
ATP-binding cassette, sub-family C (CFTR/MRP), member 8 |
chr16_-_23890805 | 0.84 |
ENSMUST00000004480.3
|
Sst
|
somatostatin |
chr6_+_78380700 | 0.83 |
ENSMUST00000101272.1
|
Reg3a
|
regenerating islet-derived 3 alpha |
chr3_+_138277489 | 0.77 |
ENSMUST00000004232.9
|
Adh1
|
alcohol dehydrogenase 1 (class I) |
chr13_-_71963713 | 0.77 |
ENSMUST00000077337.8
|
Irx1
|
Iroquois related homeobox 1 (Drosophila) |
chr17_+_34969912 | 0.77 |
ENSMUST00000173680.1
|
Gm20481
|
predicted gene 20481 |
chr11_+_54902917 | 0.77 |
ENSMUST00000149324.1
|
Gpx3
|
glutathione peroxidase 3 |
chr1_-_162898665 | 0.77 |
ENSMUST00000111510.1
ENSMUST00000045902.6 |
Fmo2
|
flavin containing monooxygenase 2 |
chr3_-_129332713 | 0.76 |
ENSMUST00000029658.7
|
Enpep
|
glutamyl aminopeptidase |
chr3_-_90514250 | 0.75 |
ENSMUST00000107340.1
ENSMUST00000060738.8 |
S100a1
|
S100 calcium binding protein A1 |
chr2_-_32387760 | 0.71 |
ENSMUST00000050785.8
|
Lcn2
|
lipocalin 2 |
chr16_+_36694024 | 0.70 |
ENSMUST00000119464.1
|
Ildr1
|
immunoglobulin-like domain containing receptor 1 |
chr1_-_134234492 | 0.69 |
ENSMUST00000169927.1
|
Adora1
|
adenosine A1 receptor |
chr1_-_158814469 | 0.69 |
ENSMUST00000161589.2
|
Pappa2
|
pappalysin 2 |
chrX_+_164436987 | 0.69 |
ENSMUST00000036858.4
|
Asb11
|
ankyrin repeat and SOCS box-containing 11 |
chr16_+_36693972 | 0.68 |
ENSMUST00000023617.6
ENSMUST00000089618.3 |
Ildr1
|
immunoglobulin-like domain containing receptor 1 |
chrX_-_108664891 | 0.67 |
ENSMUST00000178160.1
|
Gm379
|
predicted gene 379 |
chr1_+_132880273 | 0.66 |
ENSMUST00000027706.3
|
Lrrn2
|
leucine rich repeat protein 2, neuronal |
chr15_+_10314102 | 0.66 |
ENSMUST00000127467.1
|
Prlr
|
prolactin receptor |
chr7_-_101864093 | 0.66 |
ENSMUST00000106981.1
|
Folr1
|
folate receptor 1 (adult) |
chr13_-_23622502 | 0.65 |
ENSMUST00000062045.2
|
Hist1h1e
|
histone cluster 1, H1e |
chr12_-_44210061 | 0.64 |
ENSMUST00000015049.3
|
Dnajb9
|
DnaJ (Hsp40) homolog, subfamily B, member 9 |
chr15_-_101370125 | 0.63 |
ENSMUST00000077196.4
|
Krt80
|
keratin 80 |
chr19_-_7607103 | 0.62 |
ENSMUST00000079902.5
ENSMUST00000099729.3 ENSMUST00000159983.1 |
Lgals12
|
lectin, galactose binding, soluble 12 |
chr4_-_11386679 | 0.62 |
ENSMUST00000043781.7
ENSMUST00000108310.1 |
Esrp1
|
epithelial splicing regulatory protein 1 |
chr4_+_82065924 | 0.62 |
ENSMUST00000161588.1
|
Gm5860
|
predicted gene 5860 |
chr12_-_86988676 | 0.61 |
ENSMUST00000095521.2
|
Zdhhc22
|
zinc finger, DHHC-type containing 22 |
chr16_+_32735886 | 0.61 |
ENSMUST00000132475.1
ENSMUST00000096106.3 |
Muc4
|
mucin 4 |
chr10_+_75893398 | 0.59 |
ENSMUST00000009236.4
|
Derl3
|
Der1-like domain family, member 3 |
chr15_-_75747922 | 0.59 |
ENSMUST00000062002.4
|
Mafa
|
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein A (avian) |
chr19_+_16956110 | 0.59 |
ENSMUST00000087689.4
|
Prune2
|
prune homolog 2 (Drosophila) |
chr17_-_63863791 | 0.58 |
ENSMUST00000050753.3
|
A930002H24Rik
|
RIKEN cDNA A930002H24 gene |
chr11_+_3983636 | 0.58 |
ENSMUST00000078757.1
|
Gal3st1
|
galactose-3-O-sulfotransferase 1 |
chr17_-_34959232 | 0.58 |
ENSMUST00000165202.1
ENSMUST00000172753.1 |
Hspa1b
|
heat shock protein 1B |
chr4_-_11386394 | 0.57 |
ENSMUST00000155519.1
|
Esrp1
|
epithelial splicing regulatory protein 1 |
chr6_-_78468863 | 0.57 |
ENSMUST00000032089.2
|
Reg3g
|
regenerating islet-derived 3 gamma |
chr2_+_105127200 | 0.56 |
ENSMUST00000139585.1
|
Wt1
|
Wilms tumor 1 homolog |
chr17_-_6948283 | 0.56 |
ENSMUST00000024572.9
|
Rsph3b
|
radial spoke 3B homolog (Chlamydomonas) |
chr8_+_124576105 | 0.56 |
ENSMUST00000093033.5
ENSMUST00000133086.1 |
Capn9
|
calpain 9 |
chr5_+_66968559 | 0.56 |
ENSMUST00000127184.1
|
Limch1
|
LIM and calponin homology domains 1 |
chr7_+_35555367 | 0.56 |
ENSMUST00000181932.1
|
B230322F03Rik
|
RIKEN cDNA B230322F03 gene |
chr12_-_26456423 | 0.55 |
ENSMUST00000020970.7
|
Rsad2
|
radical S-adenosyl methionine domain containing 2 |
chr2_-_152830266 | 0.54 |
ENSMUST00000140436.1
|
Bcl2l1
|
BCL2-like 1 |
chr5_+_21372642 | 0.54 |
ENSMUST00000035799.5
|
Fgl2
|
fibrinogen-like protein 2 |
chr4_-_11386757 | 0.54 |
ENSMUST00000108313.1
ENSMUST00000108311.2 |
Esrp1
|
epithelial splicing regulatory protein 1 |
chr8_+_106603351 | 0.54 |
ENSMUST00000000312.5
ENSMUST00000167688.1 |
Cdh1
|
cadherin 1 |
chr7_+_131032061 | 0.54 |
ENSMUST00000084509.3
|
Dmbt1
|
deleted in malignant brain tumors 1 |
chr4_-_155992604 | 0.53 |
ENSMUST00000052185.3
|
B3galt6
|
UDP-Gal:betaGal beta 1,3-galactosyltransferase, polypeptide 6 |
chr11_+_67586520 | 0.53 |
ENSMUST00000108682.2
|
Gas7
|
growth arrest specific 7 |
chr4_+_106622424 | 0.52 |
ENSMUST00000047922.2
|
Ttc22
|
tetratricopeptide repeat domain 22 |
chr16_-_44016387 | 0.51 |
ENSMUST00000036174.3
|
Gramd1c
|
GRAM domain containing 1C |
chr13_+_38345716 | 0.51 |
ENSMUST00000171970.1
|
Bmp6
|
bone morphogenetic protein 6 |
chr7_+_141078188 | 0.50 |
ENSMUST00000106039.2
|
Pkp3
|
plakophilin 3 |
chr6_-_126166726 | 0.49 |
ENSMUST00000112244.2
ENSMUST00000050484.7 |
Ntf3
|
neurotrophin 3 |
chr11_+_3983704 | 0.49 |
ENSMUST00000063004.7
|
Gal3st1
|
galactose-3-O-sulfotransferase 1 |
chr14_+_55854115 | 0.48 |
ENSMUST00000168479.1
|
Nynrin
|
NYN domain and retroviral integrase containing |
chrX_-_106011874 | 0.48 |
ENSMUST00000033583.7
ENSMUST00000151689.1 |
Magt1
|
magnesium transporter 1 |
chr6_-_78378851 | 0.47 |
ENSMUST00000089667.1
ENSMUST00000167492.1 |
Reg3d
|
regenerating islet-derived 3 delta |
chr2_-_103303158 | 0.47 |
ENSMUST00000111176.2
|
Ehf
|
ets homologous factor |
chr11_-_89302545 | 0.46 |
ENSMUST00000061728.3
|
Nog
|
noggin |
chr4_+_102570065 | 0.45 |
ENSMUST00000097950.2
|
Pde4b
|
phosphodiesterase 4B, cAMP specific |
chr4_-_46536134 | 0.44 |
ENSMUST00000046897.6
|
Trim14
|
tripartite motif-containing 14 |
chr11_-_96747419 | 0.44 |
ENSMUST00000181758.1
|
2010300F17Rik
|
RIKEN cDNA 2010300F17 gene |
chr16_+_97356721 | 0.44 |
ENSMUST00000047275.6
|
Bace2
|
beta-site APP-cleaving enzyme 2 |
chrX_-_106011766 | 0.43 |
ENSMUST00000139421.1
ENSMUST00000113566.2 |
Magt1
|
magnesium transporter 1 |
chr3_+_89520152 | 0.43 |
ENSMUST00000000811.7
|
Kcnn3
|
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 3 |
chr1_+_88070765 | 0.43 |
ENSMUST00000073772.4
|
Ugt1a9
|
UDP glucuronosyltransferase 1 family, polypeptide A9 |
chr11_+_96464649 | 0.43 |
ENSMUST00000107663.3
|
Skap1
|
src family associated phosphoprotein 1 |
chr12_-_80132802 | 0.43 |
ENSMUST00000180643.1
|
2310015A10Rik
|
RIKEN cDNA 2310015A10 gene |
chr10_+_5639210 | 0.43 |
ENSMUST00000019906.4
|
Vip
|
vasoactive intestinal polypeptide |
chr2_-_152831665 | 0.43 |
ENSMUST00000156688.1
ENSMUST00000007803.5 |
Bcl2l1
|
BCL2-like 1 |
chr14_-_118052235 | 0.43 |
ENSMUST00000022725.2
|
Dct
|
dopachrome tautomerase |
chr17_+_26933070 | 0.42 |
ENSMUST00000073724.5
|
Phf1
|
PHD finger protein 1 |
chr15_+_40655020 | 0.42 |
ENSMUST00000053467.4
|
Zfpm2
|
zinc finger protein, multitype 2 |
chr4_+_128058962 | 0.42 |
ENSMUST00000184063.1
|
Csmd2
|
CUB and Sushi multiple domains 2 |
chr1_-_155099630 | 0.42 |
ENSMUST00000055322.4
|
Ier5
|
immediate early response 5 |
chr13_+_21735055 | 0.42 |
ENSMUST00000087714.4
|
Hist1h4j
|
histone cluster 1, H4j |
chr11_-_69695521 | 0.42 |
ENSMUST00000181261.1
|
Tnfsf12
|
tumor necrosis factor (ligand) superfamily, member 12 |
chr5_+_66745835 | 0.42 |
ENSMUST00000101164.4
ENSMUST00000118242.1 ENSMUST00000119854.1 ENSMUST00000117601.1 |
Limch1
|
LIM and calponin homology domains 1 |
chr4_+_40473130 | 0.42 |
ENSMUST00000179526.1
|
Tmem215
|
transmembrane protein 215 |
chr11_+_96929367 | 0.42 |
ENSMUST00000062172.5
|
Prr15l
|
proline rich 15-like |
chrX_-_38252398 | 0.42 |
ENSMUST00000089056.3
ENSMUST00000089054.4 ENSMUST00000066498.7 |
Tmem255a
|
transmembrane protein 255A |
chr17_+_6689072 | 0.41 |
ENSMUST00000160483.1
|
Sytl3
|
synaptotagmin-like 3 |
chr3_-_58525867 | 0.41 |
ENSMUST00000029385.7
|
Serp1
|
stress-associated endoplasmic reticulum protein 1 |
chr18_+_33464163 | 0.41 |
ENSMUST00000097634.3
|
Gm10549
|
predicted gene 10549 |
chr6_+_17306415 | 0.41 |
ENSMUST00000150901.1
|
Cav1
|
caveolin 1, caveolae protein |
chr13_+_21722057 | 0.41 |
ENSMUST00000110476.3
|
Hist1h2bm
|
histone cluster 1, H2bm |
chr10_+_69219357 | 0.41 |
ENSMUST00000172261.1
|
Rhobtb1
|
Rho-related BTB domain containing 1 |
chr11_+_96929260 | 0.40 |
ENSMUST00000054311.5
ENSMUST00000107636.3 |
Prr15l
|
proline rich 15-like |
chr11_+_95384662 | 0.40 |
ENSMUST00000021243.7
ENSMUST00000146556.1 |
Slc35b1
|
solute carrier family 35, member B1 |
chr5_+_24413406 | 0.40 |
ENSMUST00000049346.5
|
Asic3
|
acid-sensing (proton-gated) ion channel 3 |
chr2_-_170194033 | 0.40 |
ENSMUST00000180625.1
|
Gm17619
|
predicted gene, 17619 |
chr10_+_62133082 | 0.40 |
ENSMUST00000050103.1
|
Neurog3
|
neurogenin 3 |
chr16_-_21787796 | 0.39 |
ENSMUST00000023559.5
|
Ehhadh
|
enoyl-Coenzyme A, hydratase/3-hydroxyacyl Coenzyme A dehydrogenase |
chr1_+_87594545 | 0.39 |
ENSMUST00000165109.1
ENSMUST00000070898.5 |
Neu2
|
neuraminidase 2 |
chr17_+_7945653 | 0.39 |
ENSMUST00000097423.2
|
Rsph3a
|
radial spoke 3A homolog (Chlamydomonas) |
chr5_-_138994935 | 0.38 |
ENSMUST00000046901.7
ENSMUST00000076095.7 |
Pdgfa
|
platelet derived growth factor, alpha |
chr5_+_102768771 | 0.38 |
ENSMUST00000112852.1
|
Arhgap24
|
Rho GTPase activating protein 24 |
chr10_+_112163621 | 0.38 |
ENSMUST00000092176.1
|
Caps2
|
calcyphosphine 2 |
chr3_-_57847478 | 0.38 |
ENSMUST00000120289.1
ENSMUST00000066882.8 |
Pfn2
|
profilin 2 |
chr1_+_134182404 | 0.37 |
ENSMUST00000153856.1
ENSMUST00000082060.3 ENSMUST00000133701.1 ENSMUST00000132873.1 |
Chi3l1
|
chitinase 3-like 1 |
chr12_-_85374696 | 0.37 |
ENSMUST00000040766.7
|
Tmed10
|
transmembrane emp24-like trafficking protein 10 (yeast) |
chr11_-_100207507 | 0.37 |
ENSMUST00000007272.7
|
Krt14
|
keratin 14 |
chr16_+_23290464 | 0.36 |
ENSMUST00000115335.1
|
St6gal1
|
beta galactoside alpha 2,6 sialyltransferase 1 |
chr17_-_31637135 | 0.36 |
ENSMUST00000118504.1
ENSMUST00000078509.5 ENSMUST00000067801.6 |
Cbs
|
cystathionine beta-synthase |
chr1_+_75507077 | 0.36 |
ENSMUST00000037330.4
|
Inha
|
inhibin alpha |
chr7_-_45615484 | 0.36 |
ENSMUST00000033099.4
|
Fgf21
|
fibroblast growth factor 21 |
chr12_-_76795489 | 0.36 |
ENSMUST00000082431.3
|
Gpx2
|
glutathione peroxidase 2 |
chr16_+_30065333 | 0.36 |
ENSMUST00000023171.7
|
Hes1
|
hairy and enhancer of split 1 (Drosophila) |
chr3_-_129755305 | 0.35 |
ENSMUST00000029653.2
|
Egf
|
epidermal growth factor |
chr19_+_8850785 | 0.35 |
ENSMUST00000096257.2
|
Lrrn4cl
|
LRRN4 C-terminal like |
chr11_+_77462325 | 0.35 |
ENSMUST00000102493.1
|
Coro6
|
coronin 6 |
chr7_+_130936172 | 0.35 |
ENSMUST00000006367.7
|
Htra1
|
HtrA serine peptidase 1 |
chr7_-_109616548 | 0.35 |
ENSMUST00000077909.1
ENSMUST00000084738.3 |
St5
|
suppression of tumorigenicity 5 |
chr17_-_26508463 | 0.35 |
ENSMUST00000025025.6
|
Dusp1
|
dual specificity phosphatase 1 |
chr6_+_78425973 | 0.35 |
ENSMUST00000079926.5
|
Reg1
|
regenerating islet-derived 1 |
chr5_-_52471534 | 0.34 |
ENSMUST00000059428.5
|
Ccdc149
|
coiled-coil domain containing 149 |
chr9_+_111019284 | 0.34 |
ENSMUST00000035077.3
|
Ltf
|
lactotransferrin |
chr9_+_107975529 | 0.34 |
ENSMUST00000035216.4
|
Uba7
|
ubiquitin-like modifier activating enzyme 7 |
chr8_+_84415348 | 0.34 |
ENSMUST00000121390.1
ENSMUST00000122053.1 |
Cacna1a
|
calcium channel, voltage-dependent, P/Q type, alpha 1A subunit |
chr3_+_40950631 | 0.34 |
ENSMUST00000048490.6
|
Larp1b
|
La ribonucleoprotein domain family, member 1B |
chrX_-_44790179 | 0.34 |
ENSMUST00000060481.2
|
Dcaf12l1
|
DDB1 and CUL4 associated factor 12-like 1 |
chr18_+_37489465 | 0.34 |
ENSMUST00000055949.2
|
Pcdhb18
|
protocadherin beta 18 |
chr7_+_27195781 | 0.34 |
ENSMUST00000108379.1
ENSMUST00000179391.1 |
BC024978
|
cDNA sequence BC024978 |
chr19_-_24477356 | 0.33 |
ENSMUST00000099556.1
|
Fam122a
|
family with sequence similarity 122, member A |
chr4_+_133480126 | 0.33 |
ENSMUST00000051676.6
|
Fam46b
|
family with sequence similarity 46, member B |
chr11_+_78324200 | 0.33 |
ENSMUST00000102478.3
|
Aldoc
|
aldolase C, fructose-bisphosphate |
chr3_-_88027465 | 0.33 |
ENSMUST00000005014.2
|
Hapln2
|
hyaluronan and proteoglycan link protein 2 |
chr7_+_141079759 | 0.33 |
ENSMUST00000066873.4
ENSMUST00000163041.1 |
Pkp3
|
plakophilin 3 |
chr4_+_140906344 | 0.33 |
ENSMUST00000030765.6
|
Padi2
|
peptidyl arginine deiminase, type II |
chr10_-_89506631 | 0.33 |
ENSMUST00000058126.8
ENSMUST00000105296.2 |
Nr1h4
|
nuclear receptor subfamily 1, group H, member 4 |
chrX_+_164140447 | 0.33 |
ENSMUST00000073973.4
|
Ace2
|
angiotensin I converting enzyme (peptidyl-dipeptidase A) 2 |
chr3_+_90603767 | 0.32 |
ENSMUST00000001046.5
ENSMUST00000107330.1 |
S100a4
|
S100 calcium binding protein A4 |
chr17_+_46681038 | 0.32 |
ENSMUST00000002845.6
|
Mea1
|
male enhanced antigen 1 |
chr3_+_137623672 | 0.32 |
ENSMUST00000053855.7
|
Ddit4l
|
DNA-damage-inducible transcript 4-like |
chr10_-_105574435 | 0.32 |
ENSMUST00000061506.8
|
Tmtc2
|
transmembrane and tetratricopeptide repeat containing 2 |
chr4_-_156050465 | 0.32 |
ENSMUST00000184684.1
|
Ttll10
|
tubulin tyrosine ligase-like family, member 10 |
chr4_-_119422355 | 0.32 |
ENSMUST00000106316.1
ENSMUST00000030385.6 |
Ppcs
|
phosphopantothenoylcysteine synthetase |
chr10_+_75406911 | 0.31 |
ENSMUST00000039925.7
|
Upb1
|
ureidopropionase, beta |
chr9_-_59525446 | 0.31 |
ENSMUST00000055345.7
|
Tmem202
|
transmembrane protein 202 |
chr2_+_24336846 | 0.31 |
ENSMUST00000114487.2
|
Il1rn
|
interleukin 1 receptor antagonist |
chr18_+_20665250 | 0.31 |
ENSMUST00000075312.3
|
Ttr
|
transthyretin |
chr7_+_116504363 | 0.31 |
ENSMUST00000032895.8
|
Nucb2
|
nucleobindin 2 |
chr7_+_116504409 | 0.31 |
ENSMUST00000183175.1
|
Nucb2
|
nucleobindin 2 |
chrX_-_7574120 | 0.30 |
ENSMUST00000045924.7
ENSMUST00000115742.2 ENSMUST00000150787.1 |
Ppp1r3f
|
protein phosphatase 1, regulatory (inhibitor) subunit 3F |
chr4_-_45532470 | 0.30 |
ENSMUST00000147448.1
|
Shb
|
src homology 2 domain-containing transforming protein B |
chrX_-_44790146 | 0.30 |
ENSMUST00000115056.1
|
Dcaf12l1
|
DDB1 and CUL4 associated factor 12-like 1 |
chr15_-_74763567 | 0.30 |
ENSMUST00000040404.6
|
Ly6d
|
lymphocyte antigen 6 complex, locus D |
chr7_-_3665840 | 0.30 |
ENSMUST00000019878.7
|
Leng1
|
leukocyte receptor cluster (LRC) member 1 |
chr2_-_25621923 | 0.30 |
ENSMUST00000028308.4
ENSMUST00000142087.1 |
Tmem141
|
transmembrane protein 141 |
chr11_+_101087277 | 0.30 |
ENSMUST00000107302.1
ENSMUST00000107303.3 ENSMUST00000017945.8 ENSMUST00000149597.1 |
Mlx
|
MAX-like protein X |
chr7_-_127051948 | 0.30 |
ENSMUST00000051122.5
|
Zg16
|
zymogen granule protein 16 |
chr14_+_55853997 | 0.30 |
ENSMUST00000100529.3
|
Nynrin
|
NYN domain and retroviral integrase containing |
chr4_+_43059028 | 0.30 |
ENSMUST00000163653.1
ENSMUST00000107952.2 ENSMUST00000107953.2 |
Unc13b
|
unc-13 homolog B (C. elegans) |
chr19_+_5088534 | 0.30 |
ENSMUST00000025811.4
|
Yif1a
|
Yip1 interacting factor homolog A (S. cerevisiae) |
chr3_+_89229046 | 0.29 |
ENSMUST00000041142.3
|
Muc1
|
mucin 1, transmembrane |
chr13_+_42709482 | 0.29 |
ENSMUST00000066928.5
ENSMUST00000148891.1 |
Phactr1
|
phosphatase and actin regulator 1 |
chr11_+_100859492 | 0.29 |
ENSMUST00000107356.1
|
Stat5a
|
signal transducer and activator of transcription 5A |
chr2_-_152831112 | 0.29 |
ENSMUST00000128172.1
|
Bcl2l1
|
BCL2-like 1 |
chr11_+_100859351 | 0.29 |
ENSMUST00000004145.7
ENSMUST00000133036.1 |
Stat5a
|
signal transducer and activator of transcription 5A |
chr4_-_42661893 | 0.29 |
ENSMUST00000108006.3
|
Il11ra2
|
interleukin 11 receptor, alpha chain 2 |
chrX_-_164980279 | 0.29 |
ENSMUST00000112247.2
|
Mospd2
|
motile sperm domain containing 2 |
chr1_-_124045247 | 0.29 |
ENSMUST00000112603.2
|
Dpp10
|
dipeptidylpeptidase 10 |
chr12_-_75177325 | 0.29 |
ENSMUST00000042299.2
|
Kcnh5
|
potassium voltage-gated channel, subfamily H (eag-related), member 5 |
chr10_-_54075702 | 0.29 |
ENSMUST00000105470.1
|
Man1a
|
mannosidase 1, alpha |
chr15_+_98708187 | 0.29 |
ENSMUST00000003444.4
|
Ccdc65
|
coiled-coil domain containing 65 |
chrX_-_153037549 | 0.29 |
ENSMUST00000051484.3
|
Mageh1
|
melanoma antigen, family H, 1 |
chr2_+_69135799 | 0.29 |
ENSMUST00000041865.7
|
Nostrin
|
nitric oxide synthase trafficker |
chr7_+_51878967 | 0.28 |
ENSMUST00000051912.6
|
Gas2
|
growth arrest specific 2 |
chr9_+_108049254 | 0.28 |
ENSMUST00000112295.2
ENSMUST00000047947.7 |
Gmppb
|
GDP-mannose pyrophosphorylase B |
chr7_+_19083842 | 0.28 |
ENSMUST00000032568.7
ENSMUST00000122999.1 ENSMUST00000108473.3 ENSMUST00000108474.1 |
Dmpk
|
dystrophia myotonica-protein kinase |
chr8_+_105413614 | 0.28 |
ENSMUST00000109355.2
|
Lrrc36
|
leucine rich repeat containing 36 |
chr3_-_69859875 | 0.28 |
ENSMUST00000051239.7
ENSMUST00000171529.1 |
Sptssb
|
serine palmitoyltransferase, small subunit B |
chr5_-_8997324 | 0.28 |
ENSMUST00000003720.4
|
Crot
|
carnitine O-octanoyltransferase |
chr2_+_52038005 | 0.28 |
ENSMUST00000065927.5
|
Tnfaip6
|
tumor necrosis factor alpha induced protein 6 |
chr17_-_31636631 | 0.28 |
ENSMUST00000135425.1
ENSMUST00000151718.1 ENSMUST00000155814.1 |
Cbs
|
cystathionine beta-synthase |
chr17_+_35821675 | 0.28 |
ENSMUST00000003635.6
|
Ier3
|
immediate early response 3 |
chr13_-_21753851 | 0.28 |
ENSMUST00000074752.2
|
Hist1h2ak
|
histone cluster 1, H2ak |
chr11_-_96747405 | 0.28 |
ENSMUST00000180492.1
|
2010300F17Rik
|
RIKEN cDNA 2010300F17 gene |
chr3_+_89418443 | 0.28 |
ENSMUST00000039110.5
ENSMUST00000125036.1 ENSMUST00000154791.1 ENSMUST00000128238.1 ENSMUST00000107417.2 |
Shc1
|
src homology 2 domain-containing transforming protein C1 |
chr14_+_65970610 | 0.28 |
ENSMUST00000127387.1
|
Clu
|
clusterin |
chr6_+_39573894 | 0.28 |
ENSMUST00000051249.6
|
Adck2
|
aarF domain containing kinase 2 |
chr11_-_120572822 | 0.28 |
ENSMUST00000168360.1
|
P4hb
|
prolyl 4-hydroxylase, beta polypeptide |
chr9_-_87731248 | 0.28 |
ENSMUST00000034991.7
|
Tbx18
|
T-box18 |
chr6_-_125313844 | 0.27 |
ENSMUST00000032489.7
|
Ltbr
|
lymphotoxin B receptor |
chr6_-_83121385 | 0.27 |
ENSMUST00000146328.1
ENSMUST00000113936.3 ENSMUST00000032111.4 |
Wbp1
|
WW domain binding protein 1 |
chr15_+_99591028 | 0.27 |
ENSMUST00000169082.1
|
Aqp5
|
aquaporin 5 |
chr11_+_69095217 | 0.27 |
ENSMUST00000101004.2
|
Per1
|
period circadian clock 1 |
chr4_-_4138432 | 0.27 |
ENSMUST00000070375.7
|
Penk
|
preproenkephalin |
chr3_+_59006978 | 0.27 |
ENSMUST00000040325.7
ENSMUST00000164225.1 ENSMUST00000040846.8 ENSMUST00000029393.8 |
Med12l
|
mediator of RNA polymerase II transcription, subunit 12 homolog (yeast)-like |
chr3_+_97628804 | 0.27 |
ENSMUST00000107050.1
ENSMUST00000029729.8 ENSMUST00000107049.1 |
Fmo5
|
flavin containing monooxygenase 5 |
chr16_+_23429133 | 0.27 |
ENSMUST00000038730.6
|
Rtp1
|
receptor transporter protein 1 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.3 | GO:0046898 | response to cycloheximide(GO:0046898) |
0.3 | 0.9 | GO:1901079 | positive regulation of relaxation of muscle(GO:1901079) |
0.3 | 1.0 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.2 | 0.7 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) regulation of nucleoside transport(GO:0032242) negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
0.2 | 0.6 | GO:0019343 | cysteine biosynthetic process via cystathionine(GO:0019343) |
0.2 | 0.6 | GO:2000845 | negative regulation of glucagon secretion(GO:0070093) positive regulation of testosterone secretion(GO:2000845) |
0.2 | 0.8 | GO:0060376 | positive regulation of mast cell differentiation(GO:0060376) |
0.2 | 0.8 | GO:0006069 | ethanol oxidation(GO:0006069) |
0.2 | 0.8 | GO:0072272 | proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
0.2 | 0.6 | GO:2001076 | negative regulation of metanephric glomerulus development(GO:0072299) negative regulation of metanephric glomerular mesangial cell proliferation(GO:0072302) regulation of metanephric ureteric bud development(GO:2001074) positive regulation of metanephric ureteric bud development(GO:2001076) |
0.2 | 0.6 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.2 | 1.1 | GO:0002003 | angiotensin maturation(GO:0002003) |
0.2 | 1.0 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.2 | 0.5 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.2 | 0.5 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.2 | 0.2 | GO:0035801 | adrenal cortex development(GO:0035801) adrenal cortex formation(GO:0035802) |
0.1 | 1.9 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.1 | 0.7 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
0.1 | 0.4 | GO:0006583 | melanin biosynthetic process from tyrosine(GO:0006583) |
0.1 | 0.6 | GO:0021550 | medulla oblongata development(GO:0021550) |
0.1 | 1.7 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.1 | 0.4 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
0.1 | 0.8 | GO:0002159 | desmosome assembly(GO:0002159) |
0.1 | 0.4 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
0.1 | 0.7 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.1 | 0.4 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.1 | 0.4 | GO:0048209 | regulation of vesicle targeting, to, from or within Golgi(GO:0048209) |
0.1 | 0.7 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.1 | 1.1 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
0.1 | 0.6 | GO:0003195 | tricuspid valve formation(GO:0003195) |
0.1 | 0.3 | GO:0032962 | positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
0.1 | 0.7 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.1 | 0.3 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 0.3 | GO:0034971 | histone H3-R17 methylation(GO:0034971) |
0.1 | 0.5 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.1 | 0.4 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.1 | 0.6 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.1 | 0.6 | GO:0002835 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
0.1 | 0.8 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.6 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.3 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.1 | 0.4 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.1 | 0.4 | GO:1990743 | protein sialylation(GO:1990743) |
0.1 | 0.3 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
0.1 | 0.5 | GO:1902847 | regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
0.1 | 0.3 | GO:0033375 | protein localization to secretory granule(GO:0033366) protein localization to mast cell secretory granule(GO:0033367) protease localization to mast cell secretory granule(GO:0033368) maintenance of protein location in mast cell secretory granule(GO:0033370) T cell secretory granule organization(GO:0033371) maintenance of protease location in mast cell secretory granule(GO:0033373) protein localization to T cell secretory granule(GO:0033374) protease localization to T cell secretory granule(GO:0033375) maintenance of protein location in T cell secretory granule(GO:0033377) maintenance of protease location in T cell secretory granule(GO:0033379) granzyme B localization to T cell secretory granule(GO:0033380) maintenance of granzyme B location in T cell secretory granule(GO:0033382) |
0.1 | 0.1 | GO:1905072 | cardiac jelly development(GO:1905072) |
0.1 | 0.3 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 0.1 | GO:0033189 | response to vitamin A(GO:0033189) |
0.1 | 0.4 | GO:1903598 | negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) positive regulation of gap junction assembly(GO:1903598) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
0.1 | 0.3 | GO:0044771 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) negative regulation of meiotic cell cycle phase transition(GO:1901994) |
0.1 | 0.5 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.3 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) negative regulation of lymphocyte migration(GO:2000402) |
0.1 | 0.6 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.1 | 0.2 | GO:2000016 | negative regulation of determination of dorsal identity(GO:2000016) |
0.1 | 0.2 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.1 | 0.5 | GO:0032346 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
0.1 | 0.2 | GO:0071332 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) cellular response to fructose stimulus(GO:0071332) |
0.1 | 0.8 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.1 | 0.4 | GO:1904720 | regulation of mRNA cleavage(GO:0031437) negative regulation of mRNA cleavage(GO:0031438) regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904720) negative regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904721) |
0.1 | 0.2 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) bud outgrowth involved in lung branching(GO:0060447) |
0.1 | 0.7 | GO:0003147 | neural crest cell migration involved in heart formation(GO:0003147) anterior neural tube closure(GO:0061713) cellular response to folic acid(GO:0071231) |
0.1 | 0.4 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.1 | 0.4 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.1 | 0.5 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.1 | 0.4 | GO:1990839 | response to endothelin(GO:1990839) |
0.1 | 0.8 | GO:0052697 | flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
0.1 | 0.3 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.1 | 0.3 | GO:0072198 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) |
0.1 | 0.3 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.1 | 0.3 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.1 | 0.2 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
0.1 | 0.3 | GO:0060005 | vestibular reflex(GO:0060005) |
0.1 | 0.2 | GO:1904382 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) glycoprotein ERAD pathway(GO:0097466) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
0.1 | 0.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 0.4 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.1 | 0.2 | GO:0003430 | growth plate cartilage chondrocyte growth(GO:0003430) |
0.1 | 0.3 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
0.1 | 0.5 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.1 | 0.2 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.1 | 0.2 | GO:2000338 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
0.1 | 0.1 | GO:0048880 | sensory system development(GO:0048880) |
0.1 | 0.2 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
0.1 | 0.2 | GO:0090264 | immune complex clearance by monocytes and macrophages(GO:0002436) monocyte homeostasis(GO:0035702) regulation of immune complex clearance by monocytes and macrophages(GO:0090264) positive regulation of immune complex clearance by monocytes and macrophages(GO:0090265) |
0.1 | 0.2 | GO:0006311 | meiotic gene conversion(GO:0006311) male meiosis chromosome segregation(GO:0007060) gene conversion(GO:0035822) |
0.1 | 0.6 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.1 | 0.8 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.1 | 0.6 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.1 | 0.2 | GO:0097021 | lymphocyte migration into lymphoid organs(GO:0097021) |
0.1 | 0.1 | GO:0048298 | positive regulation of isotype switching to IgA isotypes(GO:0048298) |
0.1 | 0.2 | GO:0010808 | positive regulation of synaptic vesicle priming(GO:0010808) |
0.1 | 0.2 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.3 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.1 | 0.3 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 0.4 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.1 | 0.2 | GO:1900477 | negative regulation of G1/S transition of mitotic cell cycle by negative regulation of transcription from RNA polymerase II promoter(GO:1900477) |
0.1 | 0.5 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.1 | 0.2 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.1 | 0.2 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.1 | 0.2 | GO:0021586 | pons maturation(GO:0021586) |
0.1 | 0.2 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.1 | 0.3 | GO:0051684 | maintenance of centrosome location(GO:0051661) maintenance of Golgi location(GO:0051684) |
0.1 | 0.1 | GO:0002481 | antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) |
0.0 | 0.2 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 0.4 | GO:0060290 | transdifferentiation(GO:0060290) |
0.0 | 0.1 | GO:1903406 | regulation of sodium:potassium-exchanging ATPase activity(GO:1903406) |
0.0 | 0.1 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
0.0 | 0.2 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.0 | 0.3 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.0 | 0.2 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
0.0 | 0.1 | GO:0002485 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
0.0 | 0.2 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.0 | 1.6 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
0.0 | 0.4 | GO:1900034 | regulation of cellular response to heat(GO:1900034) |
0.0 | 0.2 | GO:0019532 | oxalate transport(GO:0019532) |
0.0 | 0.3 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.0 | 0.2 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.4 | GO:1904220 | regulation of serine C-palmitoyltransferase activity(GO:1904220) |
0.0 | 0.4 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
0.0 | 0.2 | GO:0030070 | insulin processing(GO:0030070) |
0.0 | 0.1 | GO:1902728 | positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
0.0 | 0.1 | GO:2000320 | negative regulation of T-helper 17 type immune response(GO:2000317) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
0.0 | 0.1 | GO:1903596 | regulation of gap junction assembly(GO:1903596) |
0.0 | 0.2 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.0 | 0.2 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.2 | GO:0046368 | GDP-L-fucose metabolic process(GO:0046368) |
0.0 | 0.2 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.2 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.0 | 0.1 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
0.0 | 0.3 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.2 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.0 | 0.8 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.2 | GO:2000987 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
0.0 | 0.0 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
0.0 | 0.2 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.0 | 0.3 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.0 | 0.2 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.0 | 0.1 | GO:0097402 | neuroblast migration(GO:0097402) |
0.0 | 0.2 | GO:0001970 | positive regulation of activation of membrane attack complex(GO:0001970) |
0.0 | 0.1 | GO:0046707 | IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
0.0 | 0.3 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.4 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.0 | 0.1 | GO:0036215 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.0 | 0.2 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) |
0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.0 | 0.1 | GO:1903179 | regulation of dopamine biosynthetic process(GO:1903179) positive regulation of dopamine biosynthetic process(GO:1903181) |
0.0 | 0.1 | GO:1903575 | cornified envelope assembly(GO:1903575) |
0.0 | 0.5 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.1 | GO:0001869 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
0.0 | 0.2 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.0 | 0.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.2 | GO:0036476 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.0 | 0.2 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.5 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.0 | 0.2 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.1 | GO:1902524 | positive regulation of protein K48-linked ubiquitination(GO:1902524) |
0.0 | 0.6 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.0 | 0.1 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.0 | 0.1 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.0 | 0.4 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.1 | GO:0051124 | synaptic growth at neuromuscular junction(GO:0051124) |
0.0 | 0.8 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.4 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.0 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.0 | 0.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.1 | GO:2000501 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 0.1 | GO:0042938 | dipeptide transport(GO:0042938) |
0.0 | 0.2 | GO:0003057 | regulation of the force of heart contraction by chemical signal(GO:0003057) |
0.0 | 0.1 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
0.0 | 0.2 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.0 | 0.2 | GO:0035617 | stress granule disassembly(GO:0035617) plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) regulation of voltage-gated sodium channel activity(GO:1905150) |
0.0 | 0.3 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.0 | 0.1 | GO:1903896 | positive regulation of IRE1-mediated unfolded protein response(GO:1903896) |
0.0 | 0.2 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.0 | 0.5 | GO:0046415 | urate metabolic process(GO:0046415) |
0.0 | 0.1 | GO:0070433 | regulation of granuloma formation(GO:0002631) negative regulation of granuloma formation(GO:0002632) regulation of toll-like receptor 5 signaling pathway(GO:0034147) negative regulation of toll-like receptor 5 signaling pathway(GO:0034148) negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070429) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) tolerance induction to lipopolysaccharide(GO:0072573) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.6 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.0 | 0.1 | GO:0070417 | cellular response to cold(GO:0070417) |
0.0 | 0.7 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.0 | 0.7 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
0.0 | 0.1 | GO:0002182 | cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) positive regulation of mRNA polyadenylation(GO:1900365) |
0.0 | 0.3 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
0.0 | 0.6 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
0.0 | 0.1 | GO:0072236 | distal convoluted tubule development(GO:0072025) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric loop of Henle development(GO:0072236) |
0.0 | 0.1 | GO:0060578 | pulmonary myocardium development(GO:0003350) subthalamic nucleus development(GO:0021763) superior vena cava morphogenesis(GO:0060578) |
0.0 | 0.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.0 | 0.2 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.0 | 0.1 | GO:0021886 | hypothalamus gonadotrophin-releasing hormone neuron differentiation(GO:0021886) hypothalamus gonadotrophin-releasing hormone neuron development(GO:0021888) |
0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.1 | GO:0046436 | D-serine catabolic process(GO:0036088) D-alanine family amino acid metabolic process(GO:0046144) D-alanine metabolic process(GO:0046436) D-alanine catabolic process(GO:0055130) |
0.0 | 0.1 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.0 | 0.3 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.0 | 0.2 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
0.0 | 0.1 | GO:0035106 | operant conditioning(GO:0035106) |
0.0 | 0.0 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
0.0 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 0.3 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.0 | GO:0002759 | regulation of antimicrobial humoral response(GO:0002759) |
0.0 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
0.0 | 0.4 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.0 | 0.0 | GO:0071211 | protein targeting to vacuole involved in autophagy(GO:0071211) lysosomal membrane organization(GO:0097212) |
0.0 | 0.1 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.0 | 0.3 | GO:0006751 | glutathione catabolic process(GO:0006751) |
0.0 | 0.1 | GO:0014854 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.0 | 0.1 | GO:1990035 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
0.0 | 0.1 | GO:1902952 | positive regulation of dendritic spine maintenance(GO:1902952) regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
0.0 | 0.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.0 | 0.1 | GO:0002432 | granuloma formation(GO:0002432) |
0.0 | 0.2 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
0.0 | 0.3 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.1 | GO:2001205 | negative regulation of osteoclast development(GO:2001205) |
0.0 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.1 | GO:0060598 | dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
0.0 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.0 | 0.3 | GO:0015812 | gamma-aminobutyric acid secretion(GO:0014051) gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.3 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.1 | GO:0019442 | tryptophan catabolic process to acetyl-CoA(GO:0019442) |
0.0 | 0.1 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
0.0 | 0.1 | GO:0052203 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.0 | 0.1 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
0.0 | 0.2 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.2 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.1 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
0.0 | 0.1 | GO:0009153 | purine deoxyribonucleotide biosynthetic process(GO:0009153) |
0.0 | 0.2 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.0 | 0.2 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.0 | 0.0 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
0.0 | 0.1 | GO:0035635 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.0 | 0.0 | GO:0014718 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) positive regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014718) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
0.0 | 0.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.3 | GO:0080184 | response to stilbenoid(GO:0035634) response to phenylpropanoid(GO:0080184) |
0.0 | 0.3 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.0 | 0.1 | GO:0043686 | co-translational protein modification(GO:0043686) |
0.0 | 0.1 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.2 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.1 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.0 | 0.2 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.3 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.0 | 0.1 | GO:0043129 | surfactant homeostasis(GO:0043129) |
0.0 | 0.0 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) pancreatic stellate cell proliferation(GO:0072343) regulation of pancreatic stellate cell proliferation(GO:2000229) |
0.0 | 0.0 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
0.0 | 0.3 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.1 | GO:0016129 | phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
0.0 | 0.1 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.0 | 0.1 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.0 | 0.1 | GO:0019336 | phenol-containing compound catabolic process(GO:0019336) |
0.0 | 1.0 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.1 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
0.0 | 0.3 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
0.0 | 0.1 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.0 | 0.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.1 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.1 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.0 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.0 | 0.3 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.0 | 0.2 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.0 | 0.0 | GO:0060748 | paracrine signaling(GO:0038001) tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.0 | 0.3 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.0 | 0.2 | GO:0097421 | liver regeneration(GO:0097421) |
0.0 | 0.4 | GO:1904376 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.0 | 0.2 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
0.0 | 0.0 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.5 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.0 | 0.2 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.1 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) chloride ion homeostasis(GO:0055064) |
0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.2 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.0 | 0.1 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.0 | 0.0 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.0 | 0.2 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.0 | 0.1 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
0.0 | 0.1 | GO:0045341 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.0 | 0.0 | GO:1903918 | regulation of actin filament severing(GO:1903918) negative regulation of actin filament severing(GO:1903919) |
0.0 | 0.1 | GO:0044376 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
0.0 | 0.1 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.0 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.0 | 0.1 | GO:0060396 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
0.0 | 0.0 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
0.0 | 0.9 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.0 | 0.1 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.0 | 0.2 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
0.0 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.0 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
0.0 | 0.1 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) |
0.0 | 0.3 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
0.0 | 0.0 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.0 | 0.4 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.2 | GO:0042095 | interferon-gamma biosynthetic process(GO:0042095) |
0.0 | 0.4 | GO:0009409 | response to cold(GO:0009409) |
0.0 | 0.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.2 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.0 | 0.1 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.0 | 0.1 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.0 | 0.0 | GO:0046168 | glycerol-3-phosphate catabolic process(GO:0046168) |
0.0 | 0.1 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
0.0 | 0.1 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.0 | 0.2 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.1 | GO:0046060 | dATP metabolic process(GO:0046060) |
0.0 | 0.3 | GO:2000279 | negative regulation of DNA biosynthetic process(GO:2000279) |
0.0 | 0.1 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.9 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.2 | 1.4 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 0.4 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 1.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 1.4 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.1 | 1.7 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.1 | 0.3 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 0.3 | GO:0044218 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
0.1 | 0.2 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
0.1 | 0.6 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 1.7 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.2 | GO:0036019 | endolysosome(GO:0036019) |
0.1 | 1.1 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.2 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 0.3 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.3 | GO:0097450 | astrocyte end-foot(GO:0097450) |
0.1 | 0.9 | GO:0042588 | zymogen granule(GO:0042588) |
0.1 | 0.4 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.1 | 0.6 | GO:0031983 | vesicle lumen(GO:0031983) |
0.1 | 0.2 | GO:0044299 | C-fiber(GO:0044299) |
0.1 | 0.3 | GO:0044305 | calyx of Held(GO:0044305) |
0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.1 | 0.9 | GO:0033391 | chromatoid body(GO:0033391) |
0.1 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.2 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
0.0 | 0.5 | GO:0016600 | flotillin complex(GO:0016600) lateral loop(GO:0043219) |
0.0 | 0.5 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.0 | 1.0 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 1.4 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.7 | GO:0032279 | asymmetric synapse(GO:0032279) neuron to neuron synapse(GO:0098984) |
0.0 | 0.1 | GO:1990696 | USH2 complex(GO:1990696) |
0.0 | 0.6 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.0 | 0.4 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.3 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 1.2 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.7 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.0 | 0.4 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.8 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.2 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 0.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.1 | GO:0034685 | integrin alphav-beta6 complex(GO:0034685) |
0.0 | 0.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.1 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.5 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.5 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.4 | GO:0044217 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
0.0 | 0.3 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.5 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.0 | 0.8 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 0.2 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.1 | GO:0014802 | terminal cisterna(GO:0014802) |
0.0 | 0.0 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.0 | 0.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.6 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.3 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 0.0 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.1 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.3 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.1 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 0.3 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.4 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.0 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.0 | 0.4 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.1 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.1 | GO:0098651 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.2 | GO:0090544 | BAF-type complex(GO:0090544) |
0.0 | 0.1 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.4 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
0.3 | 1.1 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) |
0.3 | 0.8 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.2 | 0.6 | GO:0098809 | nitrite reductase activity(GO:0098809) |
0.2 | 0.6 | GO:0048030 | disaccharide binding(GO:0048030) |
0.2 | 0.6 | GO:0070737 | protein-glycine ligase activity, elongating(GO:0070737) |
0.2 | 1.3 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.2 | 1.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.2 | 0.6 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 1.2 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.1 | 0.5 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.1 | 0.7 | GO:0004925 | prolactin receptor activity(GO:0004925) |
0.1 | 0.5 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.3 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.1 | 1.3 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 1.1 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.1 | 0.5 | GO:0070976 | TIR domain binding(GO:0070976) |
0.1 | 0.4 | GO:0071820 | N-box binding(GO:0071820) |
0.1 | 0.3 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.1 | 0.4 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
0.1 | 0.3 | GO:0045353 | interleukin-1, Type II receptor binding(GO:0005151) interleukin-1 receptor antagonist activity(GO:0005152) interleukin-1 Type I receptor antagonist activity(GO:0045352) interleukin-1 Type II receptor antagonist activity(GO:0045353) |
0.1 | 0.4 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
0.1 | 0.4 | GO:0052796 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 1.0 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.3 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.1 | 0.7 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.1 | 0.4 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
0.1 | 0.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.4 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 0.3 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.1 | 1.3 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 1.1 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 0.2 | GO:0004903 | growth hormone receptor activity(GO:0004903) |
0.1 | 1.0 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 0.6 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
0.1 | 0.4 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.1 | 0.7 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.3 | GO:2001069 | glycogen binding(GO:2001069) |
0.1 | 0.2 | GO:0004947 | bradykinin receptor activity(GO:0004947) |
0.1 | 0.2 | GO:0019002 | GMP binding(GO:0019002) |
0.1 | 0.4 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
0.1 | 0.7 | GO:0032564 | dATP binding(GO:0032564) |
0.1 | 0.6 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.1 | 0.4 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
0.1 | 0.5 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.3 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.1 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.1 | 0.2 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
0.1 | 0.3 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 0.2 | GO:0045159 | myosin II binding(GO:0045159) |
0.1 | 1.7 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.4 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
0.1 | 0.2 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.1 | 0.7 | GO:0051870 | methotrexate binding(GO:0051870) |
0.1 | 0.4 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
0.1 | 0.5 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.1 | 0.9 | GO:0044548 | S100 protein binding(GO:0044548) |
0.1 | 0.3 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
0.1 | 0.2 | GO:0030116 | glial cell-derived neurotrophic factor receptor binding(GO:0030116) |
0.1 | 0.2 | GO:0008967 | phosphoglycolate phosphatase activity(GO:0008967) |
0.1 | 0.3 | GO:0019798 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
0.1 | 0.2 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 0.3 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
0.1 | 0.2 | GO:0070401 | NADP+ binding(GO:0070401) |
0.1 | 0.4 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.2 | GO:0004560 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
0.0 | 0.2 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.2 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
0.0 | 0.4 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.0 | 0.1 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
0.0 | 0.3 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.0 | 0.2 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 1.0 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.4 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.1 | GO:0030617 | transforming growth factor beta receptor, inhibitory cytoplasmic mediator activity(GO:0030617) |
0.0 | 0.5 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.2 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.0 | 0.2 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
0.0 | 0.2 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.0 | 0.1 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.2 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.1 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.2 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.0 | 0.3 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.0 | 0.4 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.2 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.0 | 0.2 | GO:0032810 | sterol response element binding(GO:0032810) |
0.0 | 0.4 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.0 | 0.4 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.5 | GO:0015250 | water channel activity(GO:0015250) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.3 | GO:0009374 | biotin binding(GO:0009374) |
0.0 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.0 | 0.8 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.2 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.1 | GO:0042936 | dipeptide transporter activity(GO:0042936) |
0.0 | 0.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.8 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.3 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.3 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.3 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.0 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 1.1 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.6 | GO:0005549 | odorant binding(GO:0005549) |
0.0 | 0.8 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.1 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
0.0 | 0.3 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.4 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.0 | 0.1 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.1 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.3 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.0 | 0.1 | GO:0035939 | microsatellite binding(GO:0035939) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.2 | GO:0099609 | microtubule lateral binding(GO:0099609) |
0.0 | 0.1 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 0.3 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.1 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) tetrahydrobiopterin binding(GO:0034617) |
0.0 | 0.5 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.1 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) |
0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.2 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.0 | 0.5 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.6 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.2 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.0 | 0.2 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.1 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.0 | 0.1 | GO:0004473 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
0.0 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.2 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.0 | 0.1 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
0.0 | 0.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.2 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.2 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.3 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 1.7 | GO:0019905 | syntaxin binding(GO:0019905) |
0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.1 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
0.0 | 0.4 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.9 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.4 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) |
0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.1 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.1 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.0 | 0.1 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
0.0 | 0.1 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.1 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
0.0 | 0.1 | GO:0005093 | Rab GDP-dissociation inhibitor activity(GO:0005093) |
0.0 | 0.3 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.2 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.5 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.7 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.1 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.0 | 0.1 | GO:0019864 | IgG binding(GO:0019864) |
0.0 | 0.1 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
0.0 | 0.3 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.0 | 0.5 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.2 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.0 | 0.4 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.5 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.0 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
0.0 | 0.1 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.1 | GO:0061578 | Lys63-specific deubiquitinase activity(GO:0061578) |
0.0 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.3 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.0 | 0.1 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.8 | GO:0005179 | hormone activity(GO:0005179) |
0.0 | 0.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 1.3 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.3 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 2.9 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.5 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 0.9 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.2 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.9 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.5 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 1.4 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.3 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.8 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.4 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.3 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.2 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 0.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.3 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.2 | PID EPO PATHWAY | EPO signaling pathway |
0.0 | 0.6 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.5 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.6 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.3 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.5 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.4 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.0 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.3 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.1 | 0.3 | REACTOME SIGNALING BY ERBB4 | Genes involved in Signaling by ERBB4 |
0.1 | 1.7 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 1.3 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.1 | 0.8 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.1 | 1.0 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.1 | 1.0 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.0 | 1.6 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.5 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.5 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 2.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 1.0 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.5 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 1.0 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.0 | 0.9 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.0 | 1.1 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 1.3 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.2 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.5 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.4 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.0 | 0.7 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.3 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.6 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 0.3 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.7 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.8 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.3 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 0.8 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.4 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.0 | 0.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.4 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.3 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.4 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 0.2 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.0 | 0.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.2 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.5 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 0.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.2 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.1 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.0 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.3 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.2 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |