avrg: 12D miR HR13_24
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Klf16
|
ENSMUSG00000035397.8 | Kruppel-like factor 16 |
Sp8
|
ENSMUSG00000048562.6 | trans-acting transcription factor 8 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Klf16 | mm10_v2_chr10_-_80577285_80577327 | -0.78 | 4.6e-03 | Click! |
Sp8 | mm10_v2_chr12_+_118846329_118846329 | -0.68 | 2.1e-02 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr7_+_121865070 | 2.39 |
ENSMUST00000033161.5
|
Scnn1b
|
sodium channel, nonvoltage-gated 1 beta |
chr7_+_35334175 | 2.15 |
ENSMUST00000032705.6
ENSMUST00000085556.3 |
Rhpn2
|
rhophilin, Rho GTPase binding protein 2 |
chr2_-_92024502 | 2.14 |
ENSMUST00000028663.4
|
Creb3l1
|
cAMP responsive element binding protein 3-like 1 |
chr4_+_148160613 | 2.01 |
ENSMUST00000047951.8
|
Fbxo2
|
F-box protein 2 |
chr4_+_120854786 | 1.95 |
ENSMUST00000071093.2
|
Rims3
|
regulating synaptic membrane exocytosis 3 |
chr7_+_49974864 | 1.95 |
ENSMUST00000081872.5
ENSMUST00000151721.1 |
Nell1
|
NEL-like 1 |
chr7_-_44816586 | 1.92 |
ENSMUST00000047356.8
|
Atf5
|
activating transcription factor 5 |
chr8_-_54529951 | 1.84 |
ENSMUST00000067476.8
|
Spcs3
|
signal peptidase complex subunit 3 homolog (S. cerevisiae) |
chr1_+_125561010 | 1.74 |
ENSMUST00000027580.4
|
Slc35f5
|
solute carrier family 35, member F5 |
chr7_+_49975228 | 1.74 |
ENSMUST00000107603.1
|
Nell1
|
NEL-like 1 |
chr17_-_8148097 | 1.66 |
ENSMUST00000097420.5
|
Rnaset2a
|
ribonuclease T2A |
chr11_-_102296618 | 1.64 |
ENSMUST00000107132.2
ENSMUST00000073234.2 |
Atxn7l3
|
ataxin 7-like 3 |
chr13_+_56522497 | 1.62 |
ENSMUST00000045428.6
|
Fbxl21
|
F-box and leucine-rich repeat protein 21 |
chr15_-_75566811 | 1.56 |
ENSMUST00000065417.8
|
Ly6h
|
lymphocyte antigen 6 complex, locus H |
chr12_+_17690793 | 1.54 |
ENSMUST00000071858.3
|
Hpcal1
|
hippocalcin-like 1 |
chr13_-_17694729 | 1.52 |
ENSMUST00000068545.4
|
5033411D12Rik
|
RIKEN cDNA 5033411D12 gene |
chr17_-_25256274 | 1.51 |
ENSMUST00000182435.1
ENSMUST00000169109.2 ENSMUST00000182056.1 |
Baiap3
|
BAI1-associated protein 3 |
chr9_+_59578192 | 1.51 |
ENSMUST00000118549.1
ENSMUST00000034840.3 |
Celf6
|
CUGBP, Elav-like family member 6 |
chr7_-_128237984 | 1.50 |
ENSMUST00000078816.3
|
9130023H24Rik
|
RIKEN cDNA 9130023H24 gene |
chr15_-_75566608 | 1.49 |
ENSMUST00000163116.1
ENSMUST00000023241.5 |
Ly6h
|
lymphocyte antigen 6 complex, locus H |
chr15_+_25622525 | 1.49 |
ENSMUST00000110457.1
ENSMUST00000137601.1 |
Myo10
|
myosin X |
chr4_+_120666562 | 1.36 |
ENSMUST00000094814.4
|
Cited4
|
Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 |
chr11_-_31824463 | 1.33 |
ENSMUST00000129425.1
ENSMUST00000126265.1 |
D630024D03Rik
|
RIKEN cDNA D630024D03 gene |
chr10_+_80167778 | 1.31 |
ENSMUST00000105365.2
ENSMUST00000054666.6 |
Cirbp
|
cold inducible RNA binding protein |
chr8_+_105305572 | 1.29 |
ENSMUST00000109375.2
|
Elmo3
|
engulfment and cell motility 3 |
chr11_+_61684419 | 1.26 |
ENSMUST00000093019.5
|
Fam83g
|
family with sequence similarity 83, member G |
chr15_-_32244632 | 1.26 |
ENSMUST00000181536.1
|
0610007N19Rik
|
RIKEN cDNA 0610007N19 |
chr7_-_100658394 | 1.26 |
ENSMUST00000138830.1
ENSMUST00000107044.3 ENSMUST00000116287.2 |
Plekhb1
|
pleckstrin homology domain containing, family B (evectins) member 1 |
chr5_-_37717122 | 1.24 |
ENSMUST00000094836.4
|
Stk32b
|
serine/threonine kinase 32B |
chr4_-_11386757 | 1.19 |
ENSMUST00000108313.1
ENSMUST00000108311.2 |
Esrp1
|
epithelial splicing regulatory protein 1 |
chrX_+_107816477 | 1.18 |
ENSMUST00000143975.1
ENSMUST00000144695.1 ENSMUST00000167154.1 |
Fam46d
|
family with sequence similarity 46, member D |
chr2_-_3419019 | 1.17 |
ENSMUST00000115084.1
ENSMUST00000115083.1 |
Meig1
|
meiosis expressed gene 1 |
chr16_-_24393588 | 1.16 |
ENSMUST00000181640.1
|
1110054M08Rik
|
RIKEN cDNA 1110054M08 gene |
chr13_+_56522449 | 1.16 |
ENSMUST00000121095.1
ENSMUST00000121871.1 |
Fbxl21
|
F-box and leucine-rich repeat protein 21 |
chr1_-_134235420 | 1.15 |
ENSMUST00000038191.6
ENSMUST00000086465.4 |
Adora1
|
adenosine A1 receptor |
chr17_-_35046726 | 1.15 |
ENSMUST00000097338.4
|
Msh5
|
mutS homolog 5 (E. coli) |
chr6_-_118197732 | 1.14 |
ENSMUST00000032201.5
ENSMUST00000088790.3 |
Ret
|
ret proto-oncogene |
chr4_+_115088708 | 1.13 |
ENSMUST00000171877.1
ENSMUST00000177647.1 ENSMUST00000106548.2 ENSMUST00000030488.2 |
Pdzk1ip1
|
PDZK1 interacting protein 1 |
chr11_-_119086221 | 1.12 |
ENSMUST00000026665.7
|
Cbx4
|
chromobox 4 |
chr1_-_172632931 | 1.12 |
ENSMUST00000027826.5
|
Dusp23
|
dual specificity phosphatase 23 |
chr19_-_47464406 | 1.11 |
ENSMUST00000111800.2
ENSMUST00000081619.2 |
Sh3pxd2a
|
SH3 and PX domains 2A |
chr17_-_35046539 | 1.10 |
ENSMUST00000007250.7
|
Msh5
|
mutS homolog 5 (E. coli) |
chr17_-_34959232 | 1.10 |
ENSMUST00000165202.1
ENSMUST00000172753.1 |
Hspa1b
|
heat shock protein 1B |
chr4_-_43046196 | 1.10 |
ENSMUST00000036462.5
|
Fam214b
|
family with sequence similarity 214, member B |
chr1_-_184033998 | 1.10 |
ENSMUST00000050306.5
|
1700056E22Rik
|
RIKEN cDNA 1700056E22 gene |
chr7_-_45370559 | 1.09 |
ENSMUST00000003971.7
|
Lin7b
|
lin-7 homolog B (C. elegans) |
chr2_-_30903255 | 1.09 |
ENSMUST00000102852.3
|
Ptges
|
prostaglandin E synthase |
chr4_+_138454305 | 1.09 |
ENSMUST00000050918.3
|
Camk2n1
|
calcium/calmodulin-dependent protein kinase II inhibitor 1 |
chr9_-_53706211 | 1.06 |
ENSMUST00000068449.3
|
Rab39
|
RAB39, member RAS oncogene family |
chr12_+_11456052 | 1.06 |
ENSMUST00000124065.1
|
Rad51ap2
|
RAD51 associated protein 2 |
chr17_+_87635974 | 1.03 |
ENSMUST00000053577.8
|
Epcam
|
epithelial cell adhesion molecule |
chr3_+_28263205 | 1.03 |
ENSMUST00000159236.2
|
Tnik
|
TRAF2 and NCK interacting kinase |
chr5_-_109558957 | 1.02 |
ENSMUST00000044579.7
|
Crlf2
|
cytokine receptor-like factor 2 |
chr5_+_140505550 | 1.02 |
ENSMUST00000043050.8
ENSMUST00000124142.1 |
Chst12
|
carbohydrate sulfotransferase 12 |
chr4_-_11386679 | 1.02 |
ENSMUST00000043781.7
ENSMUST00000108310.1 |
Esrp1
|
epithelial splicing regulatory protein 1 |
chr2_-_144011202 | 1.01 |
ENSMUST00000016072.5
ENSMUST00000037875.5 |
Rrbp1
|
ribosome binding protein 1 |
chr4_-_8239034 | 1.01 |
ENSMUST00000066674.7
|
Car8
|
carbonic anhydrase 8 |
chr5_-_138996087 | 1.00 |
ENSMUST00000110897.1
|
Pdgfa
|
platelet derived growth factor, alpha |
chr7_-_100658364 | 1.00 |
ENSMUST00000107043.1
|
Plekhb1
|
pleckstrin homology domain containing, family B (evectins) member 1 |
chr2_-_3419066 | 0.99 |
ENSMUST00000115082.3
|
Meig1
|
meiosis expressed gene 1 |
chr4_-_129239165 | 0.99 |
ENSMUST00000097873.3
|
C77080
|
expressed sequence C77080 |
chr5_+_138995038 | 0.98 |
ENSMUST00000100518.2
|
6330403L08Rik
|
RIKEN cDNA 6330403L08 gene |
chr11_+_3983704 | 0.98 |
ENSMUST00000063004.7
|
Gal3st1
|
galactose-3-O-sulfotransferase 1 |
chr4_-_117133953 | 0.97 |
ENSMUST00000076859.5
|
Plk3
|
polo-like kinase 3 |
chr4_+_134864536 | 0.97 |
ENSMUST00000030627.7
|
Rhd
|
Rh blood group, D antigen |
chr11_+_61022560 | 0.97 |
ENSMUST00000089184.4
|
Kcnj12
|
potassium inwardly-rectifying channel, subfamily J, member 12 |
chr12_+_24651346 | 0.96 |
ENSMUST00000020982.5
|
Klf11
|
Kruppel-like factor 11 |
chr6_+_29396665 | 0.96 |
ENSMUST00000096084.5
|
Ccdc136
|
coiled-coil domain containing 136 |
chr4_+_43058939 | 0.96 |
ENSMUST00000079978.6
|
Unc13b
|
unc-13 homolog B (C. elegans) |
chr9_+_114978507 | 0.96 |
ENSMUST00000183104.1
|
Osbpl10
|
oxysterol binding protein-like 10 |
chr4_-_117872520 | 0.96 |
ENSMUST00000171052.1
ENSMUST00000166325.1 ENSMUST00000106422.2 |
Ccdc24
|
coiled-coil domain containing 24 |
chr17_+_6978860 | 0.96 |
ENSMUST00000089119.5
ENSMUST00000179728.1 |
Rnaset2b
|
ribonuclease T2B |
chr11_+_69964758 | 0.95 |
ENSMUST00000108597.1
ENSMUST00000060651.5 ENSMUST00000108596.1 |
Cldn7
|
claudin 7 |
chr11_+_3983636 | 0.95 |
ENSMUST00000078757.1
|
Gal3st1
|
galactose-3-O-sulfotransferase 1 |
chr16_+_5007306 | 0.95 |
ENSMUST00000178155.2
ENSMUST00000184256.1 ENSMUST00000185147.1 |
Smim22
|
small integral membrane protein 22 |
chr11_-_109611417 | 0.95 |
ENSMUST00000103060.3
ENSMUST00000047186.3 ENSMUST00000106689.1 |
Wipi1
|
WD repeat domain, phosphoinositide interacting 1 |
chr3_+_89418443 | 0.94 |
ENSMUST00000039110.5
ENSMUST00000125036.1 ENSMUST00000154791.1 ENSMUST00000128238.1 ENSMUST00000107417.2 |
Shc1
|
src homology 2 domain-containing transforming protein C1 |
chr5_+_125003440 | 0.94 |
ENSMUST00000036109.3
|
Fam101a
|
family with sequence similarity 101, member A |
chr13_+_51171025 | 0.94 |
ENSMUST00000021828.4
|
Nxnl2
|
nucleoredoxin-like 2 |
chr8_+_47675362 | 0.94 |
ENSMUST00000098781.2
|
AA386476
|
expressed sequence AA386476 |
chr15_+_31224371 | 0.93 |
ENSMUST00000044524.9
|
Dap
|
death-associated protein |
chr6_-_47813512 | 0.92 |
ENSMUST00000077290.7
|
Pdia4
|
protein disulfide isomerase associated 4 |
chr12_-_4841583 | 0.92 |
ENSMUST00000020964.5
|
Fkbp1b
|
FK506 binding protein 1b |
chr9_+_25481547 | 0.92 |
ENSMUST00000040677.5
|
Eepd1
|
endonuclease/exonuclease/phosphatase family domain containing 1 |
chr17_+_72918298 | 0.92 |
ENSMUST00000024857.6
|
Lbh
|
limb-bud and heart |
chr8_+_106603351 | 0.91 |
ENSMUST00000000312.5
ENSMUST00000167688.1 |
Cdh1
|
cadherin 1 |
chr4_-_134704235 | 0.91 |
ENSMUST00000054096.6
ENSMUST00000038628.3 |
Man1c1
|
mannosidase, alpha, class 1C, member 1 |
chr13_-_95525239 | 0.90 |
ENSMUST00000022185.8
|
F2rl1
|
coagulation factor II (thrombin) receptor-like 1 |
chr8_+_76902277 | 0.90 |
ENSMUST00000109912.1
ENSMUST00000128862.1 ENSMUST00000109911.1 |
Nr3c2
|
nuclear receptor subfamily 3, group C, member 2 |
chr2_-_66634653 | 0.90 |
ENSMUST00000164384.2
ENSMUST00000169900.1 |
Scn9a
|
sodium channel, voltage-gated, type IX, alpha |
chr7_+_29170345 | 0.89 |
ENSMUST00000033886.7
|
Ggn
|
gametogenetin |
chr1_+_74409376 | 0.89 |
ENSMUST00000027366.6
|
Vil1
|
villin 1 |
chr7_-_19749464 | 0.88 |
ENSMUST00000075447.7
ENSMUST00000108450.3 |
Pvrl2
|
poliovirus receptor-related 2 |
chr11_+_29692937 | 0.88 |
ENSMUST00000102843.3
ENSMUST00000102842.3 ENSMUST00000078830.4 ENSMUST00000170731.1 |
Rtn4
|
reticulon 4 |
chr16_+_5007283 | 0.88 |
ENSMUST00000184439.1
|
Smim22
|
small integral membrane protein 22 |
chr1_+_191906743 | 0.88 |
ENSMUST00000044954.6
|
Slc30a1
|
solute carrier family 30 (zinc transporter), member 1 |
chr4_-_114908892 | 0.88 |
ENSMUST00000068654.3
|
Foxd2
|
forkhead box D2 |
chr5_+_134986191 | 0.87 |
ENSMUST00000094245.2
|
Cldn3
|
claudin 3 |
chr10_+_69213084 | 0.87 |
ENSMUST00000163497.1
ENSMUST00000164212.1 ENSMUST00000067908.7 |
Rhobtb1
|
Rho-related BTB domain containing 1 |
chr12_-_73546383 | 0.86 |
ENSMUST00000042975.5
|
Tmem30b
|
transmembrane protein 30B |
chr16_-_20621255 | 0.85 |
ENSMUST00000052939.2
|
Camk2n2
|
calcium/calmodulin-dependent protein kinase II inhibitor 2 |
chr11_+_120721543 | 0.85 |
ENSMUST00000142229.1
|
Rac3
|
RAS-related C3 botulinum substrate 3 |
chr10_-_127041513 | 0.85 |
ENSMUST00000116231.2
|
Mettl21b
|
methyltransferase like 21B |
chr4_-_62519885 | 0.85 |
ENSMUST00000107444.1
ENSMUST00000030090.3 |
Alad
|
aminolevulinate, delta-, dehydratase |
chr11_-_69858723 | 0.85 |
ENSMUST00000001626.3
ENSMUST00000108626.1 |
Tnk1
|
tyrosine kinase, non-receptor, 1 |
chr11_-_69122589 | 0.84 |
ENSMUST00000180487.1
|
9130213A22Rik
|
RIKEN cDNA 9130213A22 gene |
chr5_-_139813237 | 0.84 |
ENSMUST00000110832.1
|
Tmem184a
|
transmembrane protein 184a |
chr4_-_154026037 | 0.84 |
ENSMUST00000131325.2
ENSMUST00000146054.1 ENSMUST00000126119.1 ENSMUST00000125533.2 |
Smim1
|
small integral membrane protein 1 |
chr5_+_35757875 | 0.83 |
ENSMUST00000101280.3
ENSMUST00000054598.5 ENSMUST00000114205.1 ENSMUST00000114206.2 |
Ablim2
|
actin-binding LIM protein 2 |
chr4_-_134238372 | 0.83 |
ENSMUST00000030645.8
|
Cnksr1
|
connector enhancer of kinase suppressor of Ras 1 |
chr17_+_46681038 | 0.83 |
ENSMUST00000002845.6
|
Mea1
|
male enhanced antigen 1 |
chr1_+_58713241 | 0.83 |
ENSMUST00000114309.1
ENSMUST00000069333.7 |
Cflar
|
CASP8 and FADD-like apoptosis regulator |
chr14_+_118937925 | 0.83 |
ENSMUST00000022734.7
|
Dnajc3
|
DnaJ (Hsp40) homolog, subfamily C, member 3 |
chr7_+_44816364 | 0.83 |
ENSMUST00000118125.1
|
Il4i1
|
interleukin 4 induced 1 |
chr2_-_170131156 | 0.82 |
ENSMUST00000063710.6
|
Zfp217
|
zinc finger protein 217 |
chr8_+_84415348 | 0.82 |
ENSMUST00000121390.1
ENSMUST00000122053.1 |
Cacna1a
|
calcium channel, voltage-dependent, P/Q type, alpha 1A subunit |
chr2_-_93462386 | 0.82 |
ENSMUST00000123565.1
ENSMUST00000099696.1 |
Cd82
|
CD82 antigen |
chr9_+_54698859 | 0.82 |
ENSMUST00000120452.1
|
Dnaja4
|
DnaJ (Hsp40) homolog, subfamily A, member 4 |
chr18_+_65800543 | 0.81 |
ENSMUST00000025394.6
ENSMUST00000153193.1 |
Sec11c
|
SEC11 homolog C (S. cerevisiae) |
chr18_+_49979427 | 0.81 |
ENSMUST00000148989.2
|
Tnfaip8
|
tumor necrosis factor, alpha-induced protein 8 |
chr5_+_129941949 | 0.80 |
ENSMUST00000051758.7
ENSMUST00000073945.4 |
Vkorc1l1
|
vitamin K epoxide reductase complex, subunit 1-like 1 |
chr12_+_24831583 | 0.80 |
ENSMUST00000110942.3
ENSMUST00000078902.6 |
Mboat2
|
membrane bound O-acyltransferase domain containing 2 |
chr2_-_128967725 | 0.80 |
ENSMUST00000099385.2
|
Gm10762
|
predicted gene 10762 |
chr7_-_134938264 | 0.80 |
ENSMUST00000171394.1
|
Fam196a
|
family with sequence similarity 196, member A |
chr5_-_139814231 | 0.79 |
ENSMUST00000044002.4
|
Tmem184a
|
transmembrane protein 184a |
chr11_+_120530688 | 0.79 |
ENSMUST00000026119.7
|
Gcgr
|
glucagon receptor |
chr8_-_84067283 | 0.79 |
ENSMUST00000071067.3
|
C330011M18Rik
|
RIKEN cDNA C330011M18 gene |
chr5_+_73491026 | 0.79 |
ENSMUST00000063882.5
ENSMUST00000113558.1 |
Dcun1d4
|
DCN1, defective in cullin neddylation 1, domain containing 4 (S. cerevisiae) |
chr2_-_93462457 | 0.79 |
ENSMUST00000028644.4
|
Cd82
|
CD82 antigen |
chr5_-_115158169 | 0.79 |
ENSMUST00000053271.5
ENSMUST00000112121.1 |
Mlec
|
malectin |
chrX_-_51205773 | 0.79 |
ENSMUST00000114875.1
|
Mbnl3
|
muscleblind-like 3 (Drosophila) |
chr17_+_24752980 | 0.79 |
ENSMUST00000044922.6
|
Hs3st6
|
heparan sulfate (glucosamine) 3-O-sulfotransferase 6 |
chr11_+_114851507 | 0.79 |
ENSMUST00000177952.1
|
Gprc5c
|
G protein-coupled receptor, family C, group 5, member C |
chr3_-_89393629 | 0.78 |
ENSMUST00000124783.1
ENSMUST00000126027.1 |
Zbtb7b
|
zinc finger and BTB domain containing 7B |
chr17_+_72836678 | 0.78 |
ENSMUST00000045174.5
|
Ypel5
|
yippee-like 5 (Drosophila) |
chr10_+_69212676 | 0.78 |
ENSMUST00000167384.1
|
Rhobtb1
|
Rho-related BTB domain containing 1 |
chr4_-_43040279 | 0.78 |
ENSMUST00000107958.1
ENSMUST00000107959.1 ENSMUST00000152846.1 |
Fam214b
|
family with sequence similarity 214, member B |
chr13_-_71963713 | 0.78 |
ENSMUST00000077337.8
|
Irx1
|
Iroquois related homeobox 1 (Drosophila) |
chr1_+_193153107 | 0.78 |
ENSMUST00000076521.5
|
Irf6
|
interferon regulatory factor 6 |
chr18_-_66002612 | 0.78 |
ENSMUST00000120461.1
ENSMUST00000048260.7 |
Lman1
|
lectin, mannose-binding, 1 |
chr11_+_96464587 | 0.77 |
ENSMUST00000103154.4
ENSMUST00000100521.3 ENSMUST00000100519.4 ENSMUST00000071510.7 ENSMUST00000107662.2 |
Skap1
|
src family associated phosphoprotein 1 |
chr7_-_29281977 | 0.77 |
ENSMUST00000098604.4
ENSMUST00000108236.3 |
Spint2
|
serine protease inhibitor, Kunitz type 2 |
chr4_+_49059256 | 0.77 |
ENSMUST00000076670.2
|
E130309F12Rik
|
RIKEN cDNA E130309F12 gene |
chr9_+_80165079 | 0.77 |
ENSMUST00000184480.1
|
Myo6
|
myosin VI |
chr4_+_43059028 | 0.77 |
ENSMUST00000163653.1
ENSMUST00000107952.2 ENSMUST00000107953.2 |
Unc13b
|
unc-13 homolog B (C. elegans) |
chr19_-_6992478 | 0.77 |
ENSMUST00000025915.5
|
Dnajc4
|
DnaJ (Hsp40) homolog, subfamily C, member 4 |
chr5_+_137288273 | 0.77 |
ENSMUST00000024099.4
ENSMUST00000085934.3 |
Ache
|
acetylcholinesterase |
chr14_-_61556881 | 0.77 |
ENSMUST00000022497.8
|
Spryd7
|
SPRY domain containing 7 |
chr7_+_80246375 | 0.76 |
ENSMUST00000058266.6
|
Ttll13
|
tubulin tyrosine ligase-like family, member 13 |
chr19_-_7607103 | 0.76 |
ENSMUST00000079902.5
ENSMUST00000099729.3 ENSMUST00000159983.1 |
Lgals12
|
lectin, galactose binding, soluble 12 |
chr1_+_16688405 | 0.76 |
ENSMUST00000026881.4
|
Ly96
|
lymphocyte antigen 96 |
chr8_+_4678446 | 0.76 |
ENSMUST00000181337.1
|
Gm6410
|
predicted gene 6410 |
chr3_-_89393294 | 0.76 |
ENSMUST00000142119.1
ENSMUST00000029677.8 ENSMUST00000148361.1 |
Zbtb7b
|
zinc finger and BTB domain containing 7B |
chr17_+_25188380 | 0.76 |
ENSMUST00000039734.5
|
Unkl
|
unkempt-like (Drosophila) |
chr11_+_114851142 | 0.76 |
ENSMUST00000133245.1
ENSMUST00000122967.2 |
Gprc5c
|
G protein-coupled receptor, family C, group 5, member C |
chr7_+_121734477 | 0.76 |
ENSMUST00000000221.5
|
Scnn1g
|
sodium channel, nonvoltage-gated 1 gamma |
chr4_-_142015056 | 0.75 |
ENSMUST00000105780.1
|
Fhad1
|
forkhead-associated (FHA) phosphopeptide binding domain 1 |
chr8_-_94012558 | 0.75 |
ENSMUST00000053766.6
|
Amfr
|
autocrine motility factor receptor |
chr4_-_154025657 | 0.75 |
ENSMUST00000146426.1
|
Smim1
|
small integral membrane protein 1 |
chr10_+_59221945 | 0.75 |
ENSMUST00000182161.1
|
Sowahc
|
sosondowah ankyrin repeat domain family member C |
chr11_+_3514861 | 0.75 |
ENSMUST00000094469.4
|
Selm
|
selenoprotein M |
chr11_+_69965396 | 0.75 |
ENSMUST00000018713.6
|
Cldn7
|
claudin 7 |
chr9_+_104002546 | 0.75 |
ENSMUST00000035167.8
ENSMUST00000117054.1 |
Nphp3
|
nephronophthisis 3 (adolescent) |
chr12_+_108792946 | 0.74 |
ENSMUST00000021692.7
|
Yy1
|
YY1 transcription factor |
chr14_+_58075115 | 0.74 |
ENSMUST00000074654.5
|
Fgf9
|
fibroblast growth factor 9 |
chrX_+_7842056 | 0.73 |
ENSMUST00000115667.3
ENSMUST00000115668.3 ENSMUST00000115665.1 |
Otud5
|
OTU domain containing 5 |
chr8_-_47675130 | 0.73 |
ENSMUST00000080353.2
|
Ing2
|
inhibitor of growth family, member 2 |
chr8_+_105269788 | 0.73 |
ENSMUST00000036127.2
ENSMUST00000163734.2 |
Hsf4
|
heat shock transcription factor 4 |
chr9_+_100643755 | 0.73 |
ENSMUST00000133388.1
|
Stag1
|
stromal antigen 1 |
chr3_+_106482427 | 0.72 |
ENSMUST00000029508.4
|
Dennd2d
|
DENN/MADD domain containing 2D |
chr15_-_75747922 | 0.72 |
ENSMUST00000062002.4
|
Mafa
|
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein A (avian) |
chr7_+_29170204 | 0.72 |
ENSMUST00000098609.2
|
Ggn
|
gametogenetin |
chr17_+_29490812 | 0.72 |
ENSMUST00000024811.6
|
Pim1
|
proviral integration site 1 |
chr15_-_83350151 | 0.72 |
ENSMUST00000067215.7
|
Arfgap3
|
ADP-ribosylation factor GTPase activating protein 3 |
chr4_+_136247932 | 0.72 |
ENSMUST00000102533.4
ENSMUST00000143942.1 |
Tcea3
|
transcription elongation factor A (SII), 3 |
chr11_+_114765363 | 0.72 |
ENSMUST00000138804.1
ENSMUST00000084368.5 |
Kif19a
|
kinesin family member 19A |
chr11_+_62879449 | 0.72 |
ENSMUST00000014321.4
|
Tvp23b
|
trans-golgi network vesicle protein 23B |
chr3_-_90465858 | 0.71 |
ENSMUST00000029540.6
|
Npr1
|
natriuretic peptide receptor 1 |
chr6_+_29396576 | 0.71 |
ENSMUST00000115275.1
|
Ccdc136
|
coiled-coil domain containing 136 |
chr5_-_24351604 | 0.71 |
ENSMUST00000036092.7
|
Kcnh2
|
potassium voltage-gated channel, subfamily H (eag-related), member 2 |
chr4_-_137118135 | 0.71 |
ENSMUST00000154285.1
|
Gm13001
|
predicted gene 13001 |
chr1_-_51478390 | 0.70 |
ENSMUST00000027279.5
|
Nabp1
|
nucleic acid binding protein 1 |
chr2_+_122765377 | 0.70 |
ENSMUST00000124460.1
ENSMUST00000147475.1 |
Sqrdl
|
sulfide quinone reductase-like (yeast) |
chr4_-_151996113 | 0.70 |
ENSMUST00000055688.9
|
Phf13
|
PHD finger protein 13 |
chr12_+_32378692 | 0.70 |
ENSMUST00000172332.2
|
Ccdc71l
|
coiled-coil domain containing 71 like |
chr15_+_57694651 | 0.70 |
ENSMUST00000096430.4
|
Zhx2
|
zinc fingers and homeoboxes 2 |
chr7_+_66079643 | 0.70 |
ENSMUST00000101801.5
|
Vimp
|
VCP-interacting membrane protein |
chr2_+_172345565 | 0.70 |
ENSMUST00000028995.4
|
Fam210b
|
family with sequence similarity 210, member B |
chr4_-_129696579 | 0.70 |
ENSMUST00000137640.1
|
Tmem39b
|
transmembrane protein 39b |
chr7_-_27396542 | 0.70 |
ENSMUST00000108363.1
|
Sptbn4
|
spectrin beta, non-erythrocytic 4 |
chr4_-_46650102 | 0.70 |
ENSMUST00000084621.5
ENSMUST00000107750.1 |
Tbc1d2
|
TBC1 domain family, member 2 |
chr3_-_88548249 | 0.70 |
ENSMUST00000131775.1
ENSMUST00000008745.6 |
Rab25
|
RAB25, member RAS oncogene family |
chr1_-_144004142 | 0.69 |
ENSMUST00000127206.1
|
Rgs2
|
regulator of G-protein signaling 2 |
chr4_+_141242850 | 0.69 |
ENSMUST00000138096.1
ENSMUST00000006618.2 ENSMUST00000125392.1 |
Arhgef19
|
Rho guanine nucleotide exchange factor (GEF) 19 |
chr2_+_129593195 | 0.69 |
ENSMUST00000099113.3
ENSMUST00000103202.3 |
Sirpa
|
signal-regulatory protein alpha |
chr2_-_32775584 | 0.69 |
ENSMUST00000161430.1
|
Ttc16
|
tetratricopeptide repeat domain 16 |
chr7_+_141079759 | 0.68 |
ENSMUST00000066873.4
ENSMUST00000163041.1 |
Pkp3
|
plakophilin 3 |
chr19_+_55741810 | 0.68 |
ENSMUST00000111657.3
ENSMUST00000061496.9 ENSMUST00000041717.7 ENSMUST00000111662.4 |
Tcf7l2
|
transcription factor 7 like 2, T cell specific, HMG box |
chr18_-_44662251 | 0.68 |
ENSMUST00000164666.1
|
Mcc
|
mutated in colorectal cancers |
chr7_-_66427469 | 0.68 |
ENSMUST00000015278.7
|
Aldh1a3
|
aldehyde dehydrogenase family 1, subfamily A3 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.7 | GO:0031959 | mineralocorticoid receptor signaling pathway(GO:0031959) |
0.5 | 1.6 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
0.5 | 1.4 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.4 | 1.8 | GO:0010808 | positive regulation of synaptic vesicle priming(GO:0010808) |
0.4 | 1.3 | GO:1902568 | positive regulation of eosinophil degranulation(GO:0043311) positive regulation of eosinophil activation(GO:1902568) |
0.4 | 1.7 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
0.4 | 1.2 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
0.4 | 1.2 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) |
0.4 | 1.2 | GO:0018900 | dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
0.4 | 1.5 | GO:0097494 | regulation of vesicle size(GO:0097494) |
0.4 | 1.1 | GO:0035799 | ureter maturation(GO:0035799) |
0.4 | 2.2 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.4 | 2.2 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.4 | 1.1 | GO:0071579 | regulation of zinc ion transport(GO:0071579) |
0.4 | 1.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.3 | 1.0 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.3 | 1.0 | GO:1901079 | positive regulation of relaxation of muscle(GO:1901079) |
0.3 | 4.0 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.3 | 1.3 | GO:1902896 | terminal web assembly(GO:1902896) |
0.3 | 1.0 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.3 | 1.3 | GO:0072272 | proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
0.3 | 0.9 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.3 | 1.2 | GO:0014056 | acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) |
0.3 | 0.9 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
0.3 | 2.6 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
0.3 | 0.3 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
0.3 | 2.0 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.3 | 0.8 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
0.3 | 1.6 | GO:0090383 | phagosome acidification(GO:0090383) |
0.3 | 0.3 | GO:0061526 | acetylcholine secretion(GO:0061526) |
0.3 | 0.8 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.3 | 0.5 | GO:0072034 | renal vesicle induction(GO:0072034) |
0.3 | 1.3 | GO:0060066 | oviduct development(GO:0060066) |
0.3 | 1.3 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
0.3 | 0.8 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
0.2 | 2.9 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.2 | 1.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.2 | 0.7 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.2 | 1.0 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
0.2 | 1.2 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.2 | 0.7 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.2 | 0.7 | GO:0019072 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
0.2 | 1.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.2 | 1.4 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.2 | 1.6 | GO:0051775 | response to redox state(GO:0051775) |
0.2 | 0.9 | GO:2000256 | positive regulation of male germ cell proliferation(GO:2000256) |
0.2 | 1.2 | GO:1990839 | response to endothelin(GO:1990839) |
0.2 | 1.2 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.2 | 1.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.2 | 1.1 | GO:0070384 | Harderian gland development(GO:0070384) |
0.2 | 0.9 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
0.2 | 1.3 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.2 | 0.9 | GO:1905077 | negative regulation of interleukin-17 secretion(GO:1905077) |
0.2 | 0.9 | GO:0033869 | coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
0.2 | 0.7 | GO:0045660 | positive regulation of neutrophil differentiation(GO:0045660) |
0.2 | 0.9 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.2 | 0.9 | GO:1903943 | regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
0.2 | 0.6 | GO:0071707 | immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
0.2 | 2.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.2 | 0.9 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
0.2 | 1.9 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.2 | 0.6 | GO:2000016 | negative regulation of determination of dorsal identity(GO:2000016) |
0.2 | 0.2 | GO:0006011 | UDP-glucose metabolic process(GO:0006011) |
0.2 | 0.6 | GO:0098976 | excitatory chemical synaptic transmission(GO:0098976) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
0.2 | 0.2 | GO:1904933 | regulation of cell proliferation in midbrain(GO:1904933) |
0.2 | 0.6 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.2 | 0.8 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
0.2 | 0.6 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.2 | 0.8 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.2 | 0.6 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
0.2 | 3.8 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.2 | 0.6 | GO:0001193 | maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
0.2 | 0.6 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
0.2 | 0.2 | GO:0080144 | amino acid homeostasis(GO:0080144) |
0.2 | 0.6 | GO:0051794 | regulation of catagen(GO:0051794) |
0.2 | 1.3 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) |
0.2 | 0.6 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.2 | 1.3 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.2 | 0.8 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
0.2 | 1.1 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.2 | 0.2 | GO:0071211 | protein targeting to vacuole involved in autophagy(GO:0071211) |
0.2 | 0.7 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.2 | 0.2 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.2 | 0.2 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.2 | 0.7 | GO:1903294 | regulation of glutamate secretion, neurotransmission(GO:1903294) positive regulation of glutamate secretion, neurotransmission(GO:1903296) |
0.2 | 0.2 | GO:0031161 | phosphatidylinositol catabolic process(GO:0031161) |
0.2 | 0.5 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.2 | 0.5 | GO:1902605 | heterotrimeric G-protein complex assembly(GO:1902605) |
0.2 | 0.4 | GO:1902022 | L-lysine transport(GO:1902022) |
0.2 | 0.7 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.2 | 0.9 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.2 | 0.5 | GO:0009726 | detection of nodal flow(GO:0003127) detection of endogenous stimulus(GO:0009726) |
0.2 | 0.4 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.2 | 0.3 | GO:0061357 | positive regulation of Wnt protein secretion(GO:0061357) |
0.2 | 1.2 | GO:0019695 | choline metabolic process(GO:0019695) |
0.2 | 0.7 | GO:0010958 | regulation of amino acid import(GO:0010958) |
0.2 | 0.5 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.2 | 1.9 | GO:0051026 | chiasma assembly(GO:0051026) |
0.2 | 0.5 | GO:1901074 | regulation of engulfment of apoptotic cell(GO:1901074) |
0.2 | 0.7 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.2 | 2.9 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.2 | 0.7 | GO:1904451 | regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
0.2 | 0.7 | GO:0098884 | postsynaptic neurotransmitter receptor internalization(GO:0098884) |
0.2 | 0.3 | GO:0034757 | negative regulation of iron ion transport(GO:0034757) negative regulation of iron ion transmembrane transport(GO:0034760) |
0.2 | 0.8 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
0.2 | 0.3 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
0.2 | 0.8 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.2 | 0.5 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
0.2 | 0.3 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.2 | 0.7 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.2 | 0.8 | GO:0033762 | response to glucagon(GO:0033762) |
0.2 | 1.2 | GO:0015675 | nickel cation transport(GO:0015675) |
0.2 | 2.2 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
0.2 | 0.8 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.2 | 0.8 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.2 | 0.5 | GO:0009189 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate metabolic process(GO:0009138) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
0.2 | 0.7 | GO:0061762 | CAMKK-AMPK signaling cascade(GO:0061762) |
0.2 | 0.8 | GO:0002159 | desmosome assembly(GO:0002159) |
0.2 | 0.8 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
0.2 | 0.2 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.2 | 0.5 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.2 | 0.2 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.2 | 0.5 | GO:0042117 | monocyte activation(GO:0042117) |
0.2 | 1.0 | GO:0036257 | multivesicular body organization(GO:0036257) multivesicular body assembly(GO:0036258) |
0.2 | 1.6 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.2 | 0.6 | GO:0010286 | heat acclimation(GO:0010286) |
0.2 | 0.2 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.2 | 0.2 | GO:0044857 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
0.2 | 0.3 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
0.2 | 0.6 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.2 | 0.5 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.2 | 0.6 | GO:0030070 | insulin processing(GO:0030070) |
0.2 | 2.4 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.2 | 0.5 | GO:1990869 | response to chemokine(GO:1990868) cellular response to chemokine(GO:1990869) |
0.1 | 0.3 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 0.6 | GO:0003165 | Purkinje myocyte development(GO:0003165) |
0.1 | 0.6 | GO:0090182 | regulation of secretion of lysosomal enzymes(GO:0090182) |
0.1 | 0.1 | GO:0015827 | aromatic amino acid transport(GO:0015801) tryptophan transport(GO:0015827) |
0.1 | 0.7 | GO:0051012 | microtubule sliding(GO:0051012) |
0.1 | 1.2 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.1 | 0.7 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.1 | 0.4 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.1 | 0.4 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
0.1 | 0.9 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.1 | 0.3 | GO:0032907 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
0.1 | 0.4 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
0.1 | 0.4 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.4 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.1 | 1.0 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.1 | 1.7 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.1 | 0.3 | GO:0002934 | desmosome organization(GO:0002934) |
0.1 | 0.6 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.1 | GO:0009186 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) deoxyribonucleoside diphosphate metabolic process(GO:0009186) dGDP metabolic process(GO:0046066) GDP metabolic process(GO:0046710) |
0.1 | 0.5 | GO:0060376 | positive regulation of mast cell differentiation(GO:0060376) |
0.1 | 0.5 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.1 | 0.4 | GO:0060854 | patterning of lymph vessels(GO:0060854) |
0.1 | 0.4 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.1 | 0.8 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.1 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.1 | 0.7 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
0.1 | 0.7 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
0.1 | 0.5 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.1 | 0.9 | GO:1904672 | regulation of somatic stem cell population maintenance(GO:1904672) |
0.1 | 1.6 | GO:0051593 | response to folic acid(GO:0051593) |
0.1 | 0.8 | GO:0002835 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
0.1 | 0.5 | GO:2000049 | regulation of cell-cell adhesion mediated by cadherin(GO:2000047) positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.1 | 0.8 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.1 | 0.7 | GO:0009597 | detection of virus(GO:0009597) |
0.1 | 1.6 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.1 | 0.4 | GO:0001928 | regulation of exocyst assembly(GO:0001928) |
0.1 | 0.6 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
0.1 | 0.6 | GO:0021564 | vagus nerve development(GO:0021564) |
0.1 | 2.2 | GO:0006465 | signal peptide processing(GO:0006465) |
0.1 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 0.6 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.1 | 0.3 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.1 | 0.3 | GO:1904717 | regulation of AMPA glutamate receptor clustering(GO:1904717) |
0.1 | 0.9 | GO:1904220 | regulation of serine C-palmitoyltransferase activity(GO:1904220) |
0.1 | 0.1 | GO:1904057 | negative regulation of sensory perception of pain(GO:1904057) |
0.1 | 0.9 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
0.1 | 0.5 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.1 | 0.5 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
0.1 | 0.5 | GO:1904566 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
0.1 | 0.4 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
0.1 | 1.0 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.4 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.1 | 1.4 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.1 | 0.4 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.1 | 0.4 | GO:1905034 | regulation of antifungal innate immune response(GO:1905034) negative regulation of antifungal innate immune response(GO:1905035) |
0.1 | 0.5 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.4 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
0.1 | 0.5 | GO:1990743 | protein sialylation(GO:1990743) |
0.1 | 0.6 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
0.1 | 0.1 | GO:1902861 | copper ion import across plasma membrane(GO:0098705) copper ion import into cell(GO:1902861) |
0.1 | 0.9 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.1 | 0.2 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.1 | 0.6 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.1 | 0.6 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 0.2 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.1 | 0.7 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.1 | 0.6 | GO:0032915 | positive regulation of transforming growth factor beta2 production(GO:0032915) |
0.1 | 3.3 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
0.1 | 0.5 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.1 | 0.5 | GO:1901373 | positive regulation of intracellular lipid transport(GO:0032379) positive regulation of intracellular sterol transport(GO:0032382) positive regulation of intracellular cholesterol transport(GO:0032385) lipid hydroperoxide transport(GO:1901373) |
0.1 | 0.5 | GO:0002489 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway(GO:0002488) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway, TAP-dependent(GO:0002489) |
0.1 | 0.4 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.1 | 0.5 | GO:0060003 | copper ion export(GO:0060003) |
0.1 | 0.5 | GO:0046898 | response to cycloheximide(GO:0046898) |
0.1 | 0.1 | GO:0019377 | glycolipid catabolic process(GO:0019377) |
0.1 | 3.1 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
0.1 | 0.1 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.1 | 0.6 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.1 | 0.5 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 1.6 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.1 | 0.9 | GO:0015677 | copper ion import(GO:0015677) |
0.1 | 2.0 | GO:0001675 | acrosome assembly(GO:0001675) |
0.1 | 0.8 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.1 | 0.5 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.1 | 0.3 | GO:0097195 | pilomotor reflex(GO:0097195) |
0.1 | 0.3 | GO:0048698 | negative regulation of collateral sprouting in absence of injury(GO:0048698) |
0.1 | 0.3 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.1 | 0.3 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.1 | 0.2 | GO:0060168 | positive regulation of adenosine receptor signaling pathway(GO:0060168) |
0.1 | 0.1 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.1 | 0.5 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
0.1 | 0.5 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.1 | 0.3 | GO:0046168 | glycerol-3-phosphate catabolic process(GO:0046168) |
0.1 | 0.1 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.1 | 0.3 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.1 | 0.1 | GO:0070671 | response to interleukin-12(GO:0070671) |
0.1 | 0.1 | GO:0002476 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) |
0.1 | 0.4 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.1 | 0.3 | GO:0070459 | prolactin secretion(GO:0070459) |
0.1 | 0.7 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
0.1 | 0.4 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.1 | 0.6 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.1 | 0.1 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
0.1 | 0.4 | GO:1903288 | positive regulation of potassium ion import(GO:1903288) |
0.1 | 0.3 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.1 | 0.9 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.1 | 1.4 | GO:0006491 | N-glycan processing(GO:0006491) |
0.1 | 0.3 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.1 | 0.3 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.1 | 0.3 | GO:0003360 | brainstem development(GO:0003360) |
0.1 | 0.7 | GO:0071569 | protein ufmylation(GO:0071569) |
0.1 | 0.3 | GO:1904684 | negative regulation of metalloendopeptidase activity(GO:1904684) |
0.1 | 0.6 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.1 | 0.4 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.1 | 1.0 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.2 | GO:0051462 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) positive regulation of cortisol secretion(GO:0051464) positive regulation of glucocorticoid secretion(GO:2000851) |
0.1 | 0.3 | GO:1901675 | negative regulation of histone H3-K27 acetylation(GO:1901675) |
0.1 | 0.4 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.1 | 0.3 | GO:0031296 | B cell costimulation(GO:0031296) |
0.1 | 0.8 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.1 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.1 | 0.4 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.1 | 0.3 | GO:0032962 | positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
0.1 | 1.2 | GO:0003214 | cardiac left ventricle morphogenesis(GO:0003214) |
0.1 | 0.3 | GO:0051036 | regulation of endosome size(GO:0051036) |
0.1 | 0.2 | GO:0034334 | adherens junction maintenance(GO:0034334) |
0.1 | 0.6 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.1 | 0.5 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.1 | 0.4 | GO:0060437 | lung growth(GO:0060437) |
0.1 | 0.3 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.1 | 0.3 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
0.1 | 0.3 | GO:0048209 | regulation of vesicle targeting, to, from or within Golgi(GO:0048209) |
0.1 | 0.3 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) positive regulation of acute inflammatory response to non-antigenic stimulus(GO:0002879) |
0.1 | 1.3 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.1 | 0.7 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
0.1 | 0.8 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.1 | 0.3 | GO:0007308 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) P granule organization(GO:0030719) |
0.1 | 0.3 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.1 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.1 | 0.3 | GO:0002268 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
0.1 | 2.7 | GO:1905144 | acetylcholine receptor signaling pathway(GO:0095500) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
0.1 | 0.3 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 0.3 | GO:1900149 | positive regulation of Schwann cell migration(GO:1900149) |
0.1 | 0.5 | GO:0070417 | cellular response to cold(GO:0070417) |
0.1 | 0.6 | GO:0098909 | regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
0.1 | 0.2 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.1 | 0.3 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.3 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
0.1 | 0.4 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) nucleotide-sugar catabolic process(GO:0009227) |
0.1 | 0.3 | GO:0072038 | mesenchymal stem cell maintenance involved in nephron morphogenesis(GO:0072038) |
0.1 | 0.3 | GO:2000158 | positive regulation of ubiquitin-specific protease activity(GO:2000158) |
0.1 | 0.1 | GO:0002606 | positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.1 | 0.3 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.3 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 0.4 | GO:2001274 | positive regulation of fat cell proliferation(GO:0070346) negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.1 | 1.1 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.1 | 0.5 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.1 | 0.6 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.1 | 0.9 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
0.1 | 0.6 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.1 | 0.5 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.1 | 0.2 | GO:1904685 | positive regulation of metalloendopeptidase activity(GO:1904685) |
0.1 | 0.3 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.1 | 0.6 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.1 | 0.5 | GO:0046135 | pyrimidine nucleoside catabolic process(GO:0046135) |
0.1 | 0.6 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.1 | 0.3 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 1.4 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.1 | 0.1 | GO:0021898 | commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.1 | 0.2 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) |
0.1 | 0.6 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.1 | 0.6 | GO:0001969 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.1 | 0.4 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.1 | 0.3 | GO:0036233 | glycine import(GO:0036233) |
0.1 | 0.8 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.1 | 0.2 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.1 | 0.4 | GO:0021888 | hypothalamus gonadotrophin-releasing hormone neuron differentiation(GO:0021886) hypothalamus gonadotrophin-releasing hormone neuron development(GO:0021888) |
0.1 | 0.2 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.1 | 0.4 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.1 | 0.4 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.1 | 0.5 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 1.4 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.1 | 0.5 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
0.1 | 0.5 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.1 | 0.2 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.1 | 0.2 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.1 | 0.3 | GO:0010730 | negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
0.1 | 0.1 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.1 | 1.3 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.1 | 0.3 | GO:0090004 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
0.1 | 0.4 | GO:0035608 | protein deglutamylation(GO:0035608) |
0.1 | 0.2 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.1 | 0.3 | GO:0097117 | protein complex assembly involved in synapse maturation(GO:0090126) guanylate kinase-associated protein clustering(GO:0097117) |
0.1 | 0.3 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.1 | 0.4 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 0.3 | GO:0046144 | D-serine catabolic process(GO:0036088) D-alanine family amino acid metabolic process(GO:0046144) D-alanine metabolic process(GO:0046436) D-alanine catabolic process(GO:0055130) |
0.1 | 0.6 | GO:0030242 | pexophagy(GO:0030242) |
0.1 | 0.2 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
0.1 | 0.1 | GO:0009202 | purine deoxyribonucleotide biosynthetic process(GO:0009153) deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
0.1 | 0.6 | GO:0090205 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.1 | 0.5 | GO:0002003 | angiotensin maturation(GO:0002003) |
0.1 | 0.4 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.1 | 0.2 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
0.1 | 0.3 | GO:0002278 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.1 | 0.3 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
0.1 | 0.3 | GO:0019085 | early viral transcription(GO:0019085) |
0.1 | 0.9 | GO:0060396 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
0.1 | 0.5 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.1 | 0.7 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.1 | 0.5 | GO:0098964 | dendritic transport of ribonucleoprotein complex(GO:0098961) dendritic transport of messenger ribonucleoprotein complex(GO:0098963) anterograde dendritic transport of messenger ribonucleoprotein complex(GO:0098964) |
0.1 | 0.3 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.1 | 0.3 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
0.1 | 0.5 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.1 | 0.5 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.1 | 0.7 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.1 | 0.2 | GO:0021589 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) |
0.1 | 0.3 | GO:0070269 | pyroptosis(GO:0070269) |
0.1 | 0.1 | GO:0033278 | cell proliferation in midbrain(GO:0033278) |
0.1 | 0.2 | GO:0014916 | regulation of lung blood pressure(GO:0014916) |
0.1 | 0.1 | GO:0045976 | negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
0.1 | 1.4 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.1 | 0.2 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.1 | 0.4 | GO:1901731 | positive regulation of platelet aggregation(GO:1901731) |
0.1 | 0.3 | GO:0060598 | dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
0.1 | 0.4 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.1 | 0.2 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
0.1 | 0.4 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.2 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
0.1 | 0.4 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
0.1 | 0.2 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 2.1 | GO:0009648 | photoperiodism(GO:0009648) |
0.1 | 0.2 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.1 | 0.4 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.1 | 0.5 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 0.6 | GO:0046541 | saliva secretion(GO:0046541) |
0.1 | 0.2 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.1 | 0.2 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.2 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.1 | 0.5 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.1 | 0.2 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) positive regulation of cellular pH reduction(GO:0032849) |
0.1 | 0.2 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
0.1 | 0.3 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.1 | 0.3 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.1 | 0.1 | GO:0003274 | endocardial cushion fusion(GO:0003274) |
0.1 | 0.2 | GO:0016598 | protein arginylation(GO:0016598) |
0.1 | 1.0 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.1 | 1.3 | GO:0033008 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
0.1 | 1.0 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.1 | GO:0060527 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.1 | 0.2 | GO:0021586 | pons maturation(GO:0021586) |
0.1 | 0.2 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.1 | 1.1 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
0.1 | 0.7 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.1 | 0.5 | GO:0016266 | O-glycan processing(GO:0016266) |
0.1 | 0.1 | GO:0071929 | alpha-tubulin acetylation(GO:0071929) |
0.1 | 0.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.1 | 0.6 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.1 | 0.2 | GO:2000620 | positive regulation of histone H4-K16 acetylation(GO:2000620) |
0.1 | 0.3 | GO:0097298 | regulation of nucleus size(GO:0097298) |
0.1 | 0.1 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.1 | 0.6 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.2 | GO:0071608 | macrophage inflammatory protein-1 alpha production(GO:0071608) |
0.1 | 0.7 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.1 | 0.3 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.1 | 0.3 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.1 | 0.3 | GO:0051697 | protein delipidation(GO:0051697) |
0.1 | 1.0 | GO:0009048 | dosage compensation by inactivation of X chromosome(GO:0009048) |
0.1 | 0.3 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.1 | 0.2 | GO:0061090 | positive regulation of sequestering of zinc ion(GO:0061090) |
0.1 | 0.2 | GO:0015866 | ADP transport(GO:0015866) |
0.1 | 0.5 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.1 | 0.1 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.1 | 0.1 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
0.1 | 0.5 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
0.1 | 0.4 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
0.1 | 1.6 | GO:0010043 | response to zinc ion(GO:0010043) |
0.1 | 0.5 | GO:0051665 | membrane raft localization(GO:0051665) |
0.1 | 0.4 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.3 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.1 | 0.3 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.1 | 0.3 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
0.1 | 0.4 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
0.1 | 0.2 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.6 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.1 | 2.4 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.1 | 0.2 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.1 | 0.6 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.1 | 0.2 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.1 | 0.3 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.1 | 0.3 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.1 | 0.1 | GO:0019323 | pentose catabolic process(GO:0019323) |
0.1 | 0.1 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.1 | 0.3 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.1 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) |
0.1 | 0.2 | GO:0002343 | peripheral B cell selection(GO:0002343) B cell affinity maturation(GO:0002344) |
0.1 | 0.2 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
0.1 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.1 | 0.3 | GO:0070829 | heterochromatin maintenance(GO:0070829) |
0.1 | 0.3 | GO:0015840 | urea transport(GO:0015840) |
0.1 | 0.2 | GO:0010814 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
0.1 | 0.1 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
0.1 | 1.5 | GO:0071625 | vocalization behavior(GO:0071625) |
0.1 | 0.4 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
0.1 | 0.3 | GO:0045006 | DNA deamination(GO:0045006) |
0.1 | 0.1 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
0.1 | 0.3 | GO:0072189 | ureter development(GO:0072189) |
0.1 | 0.1 | GO:0048818 | positive regulation of hair follicle maturation(GO:0048818) |
0.1 | 0.2 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.1 | 0.4 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
0.1 | 0.7 | GO:0006903 | vesicle targeting(GO:0006903) |
0.1 | 0.5 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.1 | 0.8 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
0.1 | 0.1 | GO:1904798 | regulation of core promoter binding(GO:1904796) positive regulation of core promoter binding(GO:1904798) |
0.1 | 0.3 | GO:0033058 | directional locomotion(GO:0033058) |
0.1 | 0.1 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.1 | 0.3 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.1 | 0.6 | GO:0035878 | nail development(GO:0035878) |
0.1 | 0.2 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.1 | 0.2 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.1 | 0.3 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.3 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) negative regulation of SMAD protein complex assembly(GO:0010991) |
0.1 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.1 | 0.2 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.1 | 0.2 | GO:0071455 | cellular response to hyperoxia(GO:0071455) |
0.1 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 0.3 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
0.1 | 0.3 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.5 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.1 | 0.3 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.1 | 0.2 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
0.1 | 0.1 | GO:0039019 | pronephric nephron development(GO:0039019) |
0.1 | 0.1 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.1 | 0.2 | GO:0002349 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
0.1 | 0.2 | GO:1900477 | negative regulation of G1/S transition of mitotic cell cycle by negative regulation of transcription from RNA polymerase II promoter(GO:1900477) |
0.1 | 0.1 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.1 | 0.1 | GO:0045404 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.1 | 0.2 | GO:1902856 | negative regulation of nonmotile primary cilium assembly(GO:1902856) |
0.1 | 0.2 | GO:0006434 | seryl-tRNA aminoacylation(GO:0006434) |
0.1 | 0.2 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.1 | 0.1 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
0.1 | 0.1 | GO:0003195 | tricuspid valve formation(GO:0003195) |
0.1 | 0.1 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
0.1 | 1.5 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.1 | 0.2 | GO:0006780 | uroporphyrinogen III biosynthetic process(GO:0006780) |
0.1 | 0.2 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
0.1 | 0.1 | GO:0032098 | regulation of appetite(GO:0032098) |
0.1 | 0.1 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.1 | 0.2 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.1 | 0.1 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.1 | 0.2 | GO:1905204 | negative regulation of connective tissue replacement(GO:1905204) |
0.1 | 0.5 | GO:0046514 | ceramide catabolic process(GO:0046514) |
0.1 | 0.2 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
0.1 | 0.1 | GO:0052564 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to immune response of other organism involved in symbiotic interaction(GO:0052564) response to host immune response(GO:0052572) response to host(GO:0075136) |
0.1 | 0.7 | GO:0090197 | chemokine secretion(GO:0090195) regulation of chemokine secretion(GO:0090196) positive regulation of chemokine secretion(GO:0090197) |
0.1 | 0.5 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.1 | 0.2 | GO:0009992 | cellular water homeostasis(GO:0009992) |
0.1 | 0.2 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.1 | 0.2 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.1 | 0.2 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 0.2 | GO:0006657 | CDP-choline pathway(GO:0006657) |
0.1 | 0.1 | GO:0002484 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
0.1 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.1 | 0.1 | GO:0030825 | positive regulation of cGMP metabolic process(GO:0030825) |
0.1 | 0.2 | GO:0052805 | imidazole-containing compound catabolic process(GO:0052805) |
0.1 | 0.2 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.1 | 0.2 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.1 | 0.3 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.1 | 0.4 | GO:0002432 | granuloma formation(GO:0002432) |
0.1 | 0.1 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.1 | 0.1 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.1 | 0.1 | GO:0002588 | positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
0.1 | 0.3 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.1 | 0.3 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 0.2 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 0.2 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.1 | 0.7 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.1 | 2.5 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.1 | 0.3 | GO:0060558 | regulation of calcidiol 1-monooxygenase activity(GO:0060558) |
0.1 | 0.7 | GO:0010225 | response to UV-C(GO:0010225) |
0.1 | 0.3 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.1 | 0.3 | GO:0009405 | pathogenesis(GO:0009405) |
0.1 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.1 | 0.2 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.1 | 0.2 | GO:0002415 | immunoglobulin transcytosis in epithelial cells mediated by polymeric immunoglobulin receptor(GO:0002415) |
0.1 | 0.1 | GO:0036215 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.1 | 0.2 | GO:0043302 | positive regulation of leukocyte degranulation(GO:0043302) |
0.1 | 0.7 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.1 | 1.1 | GO:0046457 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
0.1 | 0.3 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.1 | 0.2 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
0.1 | 0.2 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.1 | 0.2 | GO:0003163 | sinoatrial node development(GO:0003163) |
0.1 | 0.3 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.1 | 0.6 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.1 | 0.3 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.1 | 0.2 | GO:1904579 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
0.1 | 0.3 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.1 | 0.1 | GO:0036486 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.1 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.1 | 0.3 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.1 | 0.1 | GO:2001034 | positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
0.1 | 0.6 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.1 | 0.9 | GO:0031268 | pseudopodium organization(GO:0031268) |
0.1 | 0.4 | GO:0018377 | protein myristoylation(GO:0018377) |
0.1 | 0.4 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.1 | 0.6 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.1 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.1 | 0.1 | GO:0035502 | metanephric part of ureteric bud development(GO:0035502) |
0.1 | 0.2 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
0.1 | 0.3 | GO:0070922 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) small RNA loading onto RISC(GO:0070922) |
0.1 | 0.2 | GO:0097501 | stress response to metal ion(GO:0097501) |
0.1 | 1.0 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
0.1 | 0.4 | GO:2000252 | negative regulation of feeding behavior(GO:2000252) |
0.1 | 0.1 | GO:0090005 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.1 | 1.0 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.1 | 0.2 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.1 | 0.2 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
0.1 | 0.3 | GO:0015791 | polyol transport(GO:0015791) |
0.1 | 0.1 | GO:0097026 | dendritic cell dendrite assembly(GO:0097026) |
0.1 | 0.3 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.4 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.1 | 0.2 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
0.0 | 0.2 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.0 | 0.1 | GO:0099566 | regulation of postsynaptic cytosolic calcium ion concentration(GO:0099566) |
0.0 | 0.3 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.0 | 0.1 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.0 | 0.2 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
0.0 | 0.2 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
0.0 | 0.6 | GO:0006751 | glutathione catabolic process(GO:0006751) |
0.0 | 0.2 | GO:1903207 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.0 | 0.9 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.0 | 0.1 | GO:2000742 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
0.0 | 0.0 | GO:0003180 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
0.0 | 0.1 | GO:0072139 | glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
0.0 | 0.1 | GO:0043686 | co-translational protein modification(GO:0043686) |
0.0 | 0.0 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
0.0 | 0.1 | GO:0043181 | vacuolar sequestering(GO:0043181) |
0.0 | 0.0 | GO:0036492 | regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) |
0.0 | 0.1 | GO:0016332 | establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
0.0 | 0.4 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.0 | 0.1 | GO:0046886 | positive regulation of hormone metabolic process(GO:0032352) positive regulation of hormone biosynthetic process(GO:0046886) |
0.0 | 0.1 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.0 | 0.4 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
0.0 | 0.2 | GO:0072513 | regulation of secondary heart field cardioblast proliferation(GO:0003266) positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.0 | 0.5 | GO:0030238 | male sex determination(GO:0030238) |
0.0 | 0.1 | GO:1903416 | response to glycoside(GO:1903416) |
0.0 | 0.1 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
0.0 | 0.4 | GO:0007343 | egg activation(GO:0007343) |
0.0 | 0.2 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.0 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.0 | 0.7 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.2 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
0.0 | 0.0 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.0 | 0.8 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.0 | 0.2 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.6 | GO:0070633 | transepithelial transport(GO:0070633) |
0.0 | 0.3 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 1.0 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.2 | GO:0009816 | defense response, incompatible interaction(GO:0009814) defense response to bacterium, incompatible interaction(GO:0009816) regulation of defense response to bacterium, incompatible interaction(GO:1902477) |
0.0 | 0.2 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.0 | 0.2 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.0 | 0.0 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.0 | 0.3 | GO:0032274 | gonadotropin secretion(GO:0032274) |
0.0 | 0.2 | GO:0002407 | dendritic cell chemotaxis(GO:0002407) |
0.0 | 0.2 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.0 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.0 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.4 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.0 | 0.1 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.6 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.0 | 0.2 | GO:1905150 | regulation of voltage-gated sodium channel activity(GO:1905150) |
0.0 | 0.6 | GO:0009437 | carnitine metabolic process(GO:0009437) |
0.0 | 0.4 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.0 | 0.4 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.3 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.1 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.0 | 0.5 | GO:0060736 | prostate gland growth(GO:0060736) |
0.0 | 0.1 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
0.0 | 0.1 | GO:1902528 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
0.0 | 0.1 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
0.0 | 0.3 | GO:0015961 | diadenosine polyphosphate catabolic process(GO:0015961) |
0.0 | 0.2 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.2 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
0.0 | 1.8 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.0 | 0.9 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.2 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
0.0 | 0.3 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.0 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.0 | 0.2 | GO:0015788 | UDP-N-acetylglucosamine transport(GO:0015788) |
0.0 | 0.3 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 0.4 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.1 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.0 | 0.0 | GO:0010725 | regulation of primitive erythrocyte differentiation(GO:0010725) |
0.0 | 0.0 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.0 | 0.3 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.0 | 0.1 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.0 | 0.1 | GO:0001788 | antibody-dependent cellular cytotoxicity(GO:0001788) positive regulation of type I hypersensitivity(GO:0001812) |
0.0 | 0.5 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.0 | 0.0 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.0 | 0.1 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.0 | 0.2 | GO:0075071 | autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
0.0 | 0.4 | GO:0046697 | decidualization(GO:0046697) |
0.0 | 0.2 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.0 | 0.2 | GO:0014824 | artery smooth muscle contraction(GO:0014824) |
0.0 | 0.2 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.4 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.0 | 0.3 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.6 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.0 | 0.3 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.0 | 0.5 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.2 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
0.0 | 0.8 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) |
0.0 | 0.3 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
0.0 | 0.2 | GO:0006983 | ER overload response(GO:0006983) |
0.0 | 0.2 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
0.0 | 0.1 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.0 | 0.2 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.3 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.1 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.0 | 0.1 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
0.0 | 0.1 | GO:0009258 | 10-formyltetrahydrofolate catabolic process(GO:0009258) folic acid-containing compound catabolic process(GO:0009397) pteridine-containing compound catabolic process(GO:0042560) |
0.0 | 0.6 | GO:1903077 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.0 | 0.2 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.0 | 0.6 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.0 | 0.1 | GO:0097186 | amelogenesis(GO:0097186) |
0.0 | 0.1 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.0 | 0.7 | GO:0032332 | positive regulation of chondrocyte differentiation(GO:0032332) |
0.0 | 0.2 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.1 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.0 | 0.1 | GO:0098928 | presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
0.0 | 0.0 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.0 | 0.8 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.6 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
0.0 | 0.1 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
0.0 | 0.1 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.0 | 0.5 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.2 | GO:0045416 | regulation of interleukin-8 biosynthetic process(GO:0045414) positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
0.0 | 0.7 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.0 | 0.1 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.0 | 0.1 | GO:0030450 | regulation of complement activation, classical pathway(GO:0030450) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.4 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.0 | 0.3 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
0.0 | 0.2 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
0.0 | 0.1 | GO:0071314 | cellular response to cocaine(GO:0071314) |
0.0 | 0.1 | GO:2001183 | negative regulation of interleukin-12 secretion(GO:2001183) |
0.0 | 0.0 | GO:0002371 | dendritic cell cytokine production(GO:0002371) |
0.0 | 0.1 | GO:0070942 | neutrophil mediated cytotoxicity(GO:0070942) neutrophil mediated killing of symbiont cell(GO:0070943) |
0.0 | 0.0 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
0.0 | 1.7 | GO:0009250 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
0.0 | 0.0 | GO:2000843 | testosterone secretion(GO:0035936) regulation of testosterone secretion(GO:2000843) |
0.0 | 0.8 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.0 | 0.3 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.3 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
0.0 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.0 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.3 | GO:0006884 | cell volume homeostasis(GO:0006884) |
0.0 | 0.1 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.2 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.0 | 0.1 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
0.0 | 0.3 | GO:0051014 | actin filament severing(GO:0051014) |
0.0 | 0.5 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.1 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
0.0 | 0.2 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.0 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.0 | 0.2 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.0 | 0.2 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.0 | 0.5 | GO:0031294 | lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
0.0 | 0.1 | GO:2000987 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
0.0 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.4 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.0 | 0.0 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
0.0 | 0.1 | GO:0021815 | modulation of microtubule cytoskeleton involved in cerebral cortex radial glia guided migration(GO:0021815) nucleokinesis involved in cell motility in cerebral cortex radial glia guided migration(GO:0021817) nuclear migration along microtubule(GO:0030473) nuclear migration along microfilament(GO:0031022) |
0.0 | 0.1 | GO:2000425 | regulation of apoptotic cell clearance(GO:2000425) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.0 | 0.1 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
0.0 | 0.2 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
0.0 | 0.2 | GO:1902267 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.0 | 0.2 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.0 | 0.2 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.0 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.5 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
0.0 | 0.8 | GO:0019731 | antibacterial humoral response(GO:0019731) |
0.0 | 0.4 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.0 | 0.1 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.0 | 0.1 | GO:0006559 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.0 | 0.1 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
0.0 | 0.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.0 | 0.2 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.0 | 0.1 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
0.0 | 0.1 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.0 | 0.1 | GO:0061312 | BMP signaling pathway involved in heart development(GO:0061312) |
0.0 | 0.1 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
0.0 | 0.1 | GO:0060431 | primary lung bud formation(GO:0060431) |
0.0 | 0.3 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.6 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
0.0 | 0.1 | GO:0006788 | heme oxidation(GO:0006788) |
0.0 | 1.4 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.0 | GO:0021648 | vestibulocochlear nerve morphogenesis(GO:0021648) vestibulocochlear nerve formation(GO:0021650) |
0.0 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.0 | 0.2 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.0 | 0.0 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
0.0 | 0.4 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.0 | 0.5 | GO:0044253 | positive regulation of collagen metabolic process(GO:0010714) positive regulation of multicellular organismal metabolic process(GO:0044253) |
0.0 | 0.2 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.0 | 0.1 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.0 | 0.2 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.4 | GO:0010543 | regulation of platelet activation(GO:0010543) |
0.0 | 0.1 | GO:0042161 | plasma lipoprotein particle oxidation(GO:0034441) lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
0.0 | 0.2 | GO:0030149 | sphingolipid catabolic process(GO:0030149) |
0.0 | 0.2 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.0 | 0.3 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.0 | 0.1 | GO:0046021 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
0.0 | 0.1 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
0.0 | 0.2 | GO:0006907 | pinocytosis(GO:0006907) |
0.0 | 0.0 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
0.0 | 0.1 | GO:0021934 | branchiomotor neuron axon guidance(GO:0021785) hindbrain tangential cell migration(GO:0021934) |
0.0 | 0.1 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
0.0 | 0.2 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.3 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.2 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.2 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.0 | 0.3 | GO:0002070 | epithelial cell maturation(GO:0002070) |
0.0 | 0.1 | GO:0070472 | uterine smooth muscle contraction(GO:0070471) regulation of uterine smooth muscle contraction(GO:0070472) positive regulation of uterine smooth muscle contraction(GO:0070474) |
0.0 | 0.1 | GO:0097113 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.0 | 0.1 | GO:0036446 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
0.0 | 0.1 | GO:0048611 | ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
0.0 | 0.9 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
0.0 | 0.1 | GO:0019532 | oxalate transport(GO:0019532) |
0.0 | 0.2 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.0 | 0.2 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
0.0 | 0.1 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
0.0 | 0.1 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.0 | GO:2001188 | negative regulation of immunological synapse formation(GO:2000521) regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001188) negative regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001189) |
0.0 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.0 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.0 | 0.2 | GO:0002385 | organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
0.0 | 0.1 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
0.0 | 0.8 | GO:1903078 | positive regulation of protein localization to plasma membrane(GO:1903078) |
0.0 | 0.1 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.0 | 0.1 | GO:0010747 | positive regulation of plasma membrane long-chain fatty acid transport(GO:0010747) |
0.0 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.0 | 0.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.0 | 0.0 | GO:0030860 | regulation of polarized epithelial cell differentiation(GO:0030860) |
0.0 | 0.8 | GO:0005977 | glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
0.0 | 0.4 | GO:0033866 | nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
0.0 | 0.2 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.1 | GO:0097421 | liver regeneration(GO:0097421) |
0.0 | 0.1 | GO:0015671 | oxygen transport(GO:0015671) |
0.0 | 0.4 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.0 | 0.1 | GO:1902564 | negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) negative regulation of neutrophil activation(GO:1902564) |
0.0 | 0.0 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
0.0 | 0.1 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.0 | 0.2 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.1 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
0.0 | 0.4 | GO:0031424 | keratinization(GO:0031424) |
0.0 | 0.1 | GO:0045919 | positive regulation of cytolysis(GO:0045919) |
0.0 | 0.0 | GO:0030432 | peristalsis(GO:0030432) |
0.0 | 0.1 | GO:1904953 | Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904953) |
0.0 | 0.2 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.7 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.1 | GO:0072362 | regulation of glycolytic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072362) |
0.0 | 0.1 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.1 | GO:0006713 | glucocorticoid catabolic process(GO:0006713) |
0.0 | 0.0 | GO:0034204 | lipid translocation(GO:0034204) |
0.0 | 0.0 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
0.0 | 0.1 | GO:0021995 | anterior neuropore closure(GO:0021506) neuropore closure(GO:0021995) |
0.0 | 0.1 | GO:0035268 | protein mannosylation(GO:0035268) mannosylation(GO:0097502) |
0.0 | 0.0 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.0 | 0.2 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.3 | GO:0006953 | acute-phase response(GO:0006953) |
0.0 | 0.2 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
0.0 | 0.4 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.0 | 0.3 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.5 | GO:0009072 | aromatic amino acid family metabolic process(GO:0009072) |
0.0 | 0.0 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.0 | 0.2 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.3 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.2 | GO:0002446 | neutrophil mediated immunity(GO:0002446) |
0.0 | 0.2 | GO:0097012 | response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
0.0 | 0.0 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.2 | GO:0006497 | protein lipidation(GO:0006497) |
0.0 | 0.1 | GO:0090190 | positive regulation of mesonephros development(GO:0061213) positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
0.0 | 0.1 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.0 | 0.1 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.0 | 0.3 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.3 | GO:0006828 | manganese ion transport(GO:0006828) |
0.0 | 0.1 | GO:0042938 | dipeptide transport(GO:0042938) |
0.0 | 0.3 | GO:0009208 | pyrimidine ribonucleoside triphosphate metabolic process(GO:0009208) |
0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.0 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
0.0 | 0.2 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.0 | 0.0 | GO:0016093 | polyprenol metabolic process(GO:0016093) |
0.0 | 0.0 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.1 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.0 | 0.0 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 0.1 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.4 | GO:0006198 | cAMP catabolic process(GO:0006198) |
0.0 | 0.2 | GO:1900193 | regulation of oocyte maturation(GO:1900193) |
0.0 | 0.1 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.0 | 0.2 | GO:0032264 | IMP salvage(GO:0032264) |
0.0 | 0.6 | GO:0015914 | phospholipid transport(GO:0015914) |
0.0 | 0.1 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.0 | 0.4 | GO:0048240 | sperm capacitation(GO:0048240) |
0.0 | 0.0 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.4 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.2 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.0 | 0.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.0 | 0.2 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
0.0 | 0.2 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
0.0 | 0.1 | GO:1901594 | detection of temperature stimulus involved in thermoception(GO:0050960) smooth muscle contraction involved in micturition(GO:0060083) regulation of establishment of blood-brain barrier(GO:0090210) negative regulation of establishment of blood-brain barrier(GO:0090212) response to capsazepine(GO:1901594) |
0.0 | 0.2 | GO:0032456 | endocytic recycling(GO:0032456) |
0.0 | 0.3 | GO:1900077 | negative regulation of cellular response to insulin stimulus(GO:1900077) |
0.0 | 0.6 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
0.0 | 0.1 | GO:0051325 | interphase(GO:0051325) mitotic interphase(GO:0051329) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.1 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.2 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.3 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.0 | 0.1 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.2 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.0 | 0.3 | GO:0019236 | response to pheromone(GO:0019236) |
0.0 | 0.0 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.0 | 0.2 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.0 | 0.3 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 0.3 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.0 | 0.1 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
0.0 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.0 | 0.2 | GO:0050913 | sensory perception of bitter taste(GO:0050913) |
0.0 | 0.5 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.1 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
0.0 | 0.1 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
0.0 | 2.1 | GO:0007601 | visual perception(GO:0007601) |
0.0 | 0.0 | GO:0042640 | anagen(GO:0042640) |
0.0 | 0.1 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.0 | 0.2 | GO:0032094 | response to food(GO:0032094) |
0.0 | 0.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 0.1 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.1 | GO:0046381 | CMP-N-acetylneuraminate metabolic process(GO:0046381) |
0.0 | 0.1 | GO:0045851 | pH reduction(GO:0045851) |
0.0 | 0.1 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.0 | 0.2 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.0 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.0 | 0.0 | GO:0097476 | spinal cord motor neuron migration(GO:0097476) lateral motor column neuron migration(GO:0097477) |
0.0 | 0.1 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) |
0.0 | 0.0 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.0 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.0 | 0.9 | GO:0009062 | fatty acid catabolic process(GO:0009062) |
0.0 | 0.1 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
0.0 | 0.1 | GO:0035376 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
0.0 | 0.1 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.0 | 0.0 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.1 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.2 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.2 | GO:0060444 | branching involved in mammary gland duct morphogenesis(GO:0060444) |
0.0 | 0.0 | GO:0061245 | establishment or maintenance of apical/basal cell polarity(GO:0035088) establishment or maintenance of bipolar cell polarity(GO:0061245) |
0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.0 | 0.1 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.3 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.0 | 0.8 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
0.0 | 0.1 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.1 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.0 | 0.2 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.0 | 0.3 | GO:0060065 | uterus development(GO:0060065) |
0.0 | 0.0 | GO:2000561 | CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.0 | 0.0 | GO:0021800 | cerebral cortex tangential migration(GO:0021800) |
0.0 | 0.5 | GO:0006911 | phagocytosis, engulfment(GO:0006911) |
0.0 | 0.2 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.1 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.5 | GO:0001881 | receptor recycling(GO:0001881) |
0.0 | 0.0 | GO:0045019 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
0.0 | 0.1 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
0.0 | 0.8 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.0 | 0.0 | GO:0072666 | establishment of protein localization to vacuole(GO:0072666) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.0 | GO:0060279 | regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
0.0 | 0.0 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
0.0 | 0.2 | GO:0007616 | long-term memory(GO:0007616) |
0.0 | 0.4 | GO:0051453 | regulation of intracellular pH(GO:0051453) |
0.0 | 0.2 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.0 | 0.0 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
0.0 | 0.0 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.0 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.0 | 0.1 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.0 | 0.0 | GO:0070178 | D-serine metabolic process(GO:0070178) |
0.0 | 0.1 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.0 | 0.0 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.0 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
0.0 | 0.0 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) |
0.0 | 0.1 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.0 | 0.0 | GO:1903758 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
0.0 | 0.0 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.0 | 0.0 | GO:1990167 | protein K27-linked deubiquitination(GO:1990167) |
0.0 | 0.0 | GO:1903895 | negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
0.0 | 0.0 | GO:0009698 | phenylpropanoid metabolic process(GO:0009698) coumarin metabolic process(GO:0009804) |
0.0 | 0.0 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.0 | 0.0 | GO:0014029 | neural crest formation(GO:0014029) |
0.0 | 0.1 | GO:0034142 | toll-like receptor 4 signaling pathway(GO:0034142) |
0.0 | 0.1 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.0 | 0.0 | GO:0014005 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
0.0 | 0.1 | GO:0002638 | negative regulation of immunoglobulin production(GO:0002638) |
0.0 | 0.0 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.0 | 0.1 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
0.0 | 0.0 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 0.0 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.0 | 0.1 | GO:0002931 | response to ischemia(GO:0002931) |
0.0 | 0.0 | GO:0015860 | purine nucleoside transmembrane transport(GO:0015860) nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.0 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.0 | 0.1 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.2 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.1 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
0.0 | 0.0 | GO:0070343 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.0 | 0.0 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
0.0 | 0.0 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.0 | 0.3 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
0.0 | 0.1 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.0 | 0.1 | GO:0035063 | nuclear speck organization(GO:0035063) |
0.0 | 0.0 | GO:0044878 | mitotic cytokinesis checkpoint(GO:0044878) |
0.0 | 0.1 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.0 | 0.1 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.0 | 0.1 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.0 | 0.0 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
0.0 | 0.0 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.0 | 0.2 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
0.0 | 0.0 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.0 | 0.1 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.0 | 0.0 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.0 | 0.1 | GO:0032292 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
0.0 | 0.1 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
0.0 | 0.1 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 2.7 | GO:0005787 | signal peptidase complex(GO:0005787) |
0.3 | 1.6 | GO:0044305 | calyx of Held(GO:0044305) |
0.3 | 1.6 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.3 | 2.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.3 | 0.8 | GO:0034667 | integrin alpha3-beta1 complex(GO:0034667) |
0.2 | 1.5 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.2 | 3.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.2 | 1.4 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.2 | 0.9 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
0.2 | 0.9 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
0.2 | 1.1 | GO:0005914 | spot adherens junction(GO:0005914) |
0.2 | 0.8 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.2 | 0.6 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.2 | 1.0 | GO:0070820 | tertiary granule(GO:0070820) |
0.2 | 1.4 | GO:0008091 | spectrin(GO:0008091) |
0.2 | 2.5 | GO:0043219 | lateral loop(GO:0043219) |
0.2 | 0.7 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
0.2 | 1.7 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
0.2 | 0.5 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
0.2 | 0.7 | GO:1990795 | lateral part of cell(GO:0097574) basolateral part of cell(GO:1990794) rod bipolar cell terminal bouton(GO:1990795) |
0.2 | 0.3 | GO:0033263 | CORVET complex(GO:0033263) |
0.2 | 1.7 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.2 | 0.8 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
0.2 | 0.2 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.2 | 4.0 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.2 | 0.5 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.1 | 0.6 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
0.1 | 0.6 | GO:0099524 | region of cytosol(GO:0099522) postsynaptic cytosol(GO:0099524) |
0.1 | 3.5 | GO:0034706 | sodium channel complex(GO:0034706) |
0.1 | 0.6 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 1.3 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 0.3 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.1 | 0.9 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.4 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 1.0 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 0.3 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 4.5 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.1 | 1.9 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 0.5 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 1.1 | GO:0031983 | vesicle lumen(GO:0031983) |
0.1 | 1.0 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.1 | 0.3 | GO:0098855 | HCN channel complex(GO:0098855) |
0.1 | 0.3 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 0.8 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.5 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
0.1 | 0.4 | GO:1902636 | kinociliary basal body(GO:1902636) |
0.1 | 0.3 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.7 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.1 | 4.6 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.1 | 0.8 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 0.8 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 0.5 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 0.9 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.3 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.1 | 1.5 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.1 | 0.8 | GO:0098837 | postsynaptic recycling endosome(GO:0098837) |
0.1 | 0.3 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
0.1 | 0.3 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
0.1 | 0.3 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.1 | 1.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.1 | 2.0 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.1 | 0.6 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.6 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 1.6 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 0.8 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 0.4 | GO:0098576 | lumenal side of membrane(GO:0098576) |
0.1 | 5.3 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.1 | 0.4 | GO:0070826 | paraferritin complex(GO:0070826) |
0.1 | 0.5 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.1 | 1.7 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.1 | 1.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.7 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 0.2 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.1 | 1.2 | GO:0045179 | apical cortex(GO:0045179) |
0.1 | 1.8 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.9 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 1.7 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 0.8 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.1 | 0.9 | GO:0042588 | zymogen granule(GO:0042588) |
0.1 | 1.1 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 0.4 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.1 | 2.3 | GO:0031231 | intrinsic component of peroxisomal membrane(GO:0031231) |
0.1 | 0.3 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 1.3 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.7 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 0.5 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.1 | 0.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 0.3 | GO:1990462 | omegasome(GO:1990462) |
0.1 | 0.2 | GO:0070195 | growth hormone receptor complex(GO:0070195) |
0.1 | 0.4 | GO:0042581 | specific granule(GO:0042581) |
0.1 | 2.6 | GO:0034358 | plasma lipoprotein particle(GO:0034358) lipoprotein particle(GO:1990777) |
0.1 | 0.3 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.1 | 0.3 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.1 | 0.5 | GO:0042599 | lamellar body(GO:0042599) |
0.1 | 1.2 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 0.6 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.1 | 0.3 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 0.3 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.1 | 0.6 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 2.8 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 0.4 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 0.8 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.1 | 0.5 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.1 | 0.9 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 7.5 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.1 | 0.2 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.1 | 1.0 | GO:0043186 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.1 | 0.8 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 0.2 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.1 | 0.9 | GO:0001533 | cornified envelope(GO:0001533) |
0.1 | 0.1 | GO:0098888 | extrinsic component of presynaptic membrane(GO:0098888) |
0.1 | 0.6 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 2.0 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 0.2 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
0.1 | 0.2 | GO:0045160 | myosin I complex(GO:0045160) |
0.1 | 0.2 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 0.2 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.1 | 4.0 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.1 | 3.9 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.1 | 0.1 | GO:0030312 | external encapsulating structure(GO:0030312) |
0.1 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.3 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.1 | 0.2 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 1.6 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.1 | 0.9 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.1 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.5 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 0.8 | GO:0042611 | MHC protein complex(GO:0042611) |
0.0 | 0.3 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
0.0 | 0.1 | GO:0044218 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
0.0 | 0.2 | GO:0071914 | prominosome(GO:0071914) |
0.0 | 0.1 | GO:0036019 | endolysosome(GO:0036019) |
0.0 | 0.2 | GO:0000802 | transverse filament(GO:0000802) |
0.0 | 0.3 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.3 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.0 | 1.0 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) nuclear transcriptional repressor complex(GO:0090568) |
0.0 | 0.3 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.5 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.3 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.0 | 0.1 | GO:0044753 | amphisome(GO:0044753) |
0.0 | 0.2 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 1.0 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.3 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.2 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 1.4 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.1 | GO:0042272 | nuclear RNA export factor complex(GO:0042272) |
0.0 | 3.6 | GO:0005902 | microvillus(GO:0005902) |
0.0 | 0.1 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.5 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.6 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.3 | GO:0044754 | autolysosome(GO:0044754) |
0.0 | 0.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.0 | 0.0 | GO:0036452 | ESCRT complex(GO:0036452) |
0.0 | 0.5 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.8 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.0 | GO:0005713 | recombination nodule(GO:0005713) |
0.0 | 0.4 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 0.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.3 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.2 | GO:0097449 | astrocyte projection(GO:0097449) |
0.0 | 0.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.2 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.1 | GO:0034657 | GID complex(GO:0034657) |
0.0 | 1.6 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.5 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.1 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
0.0 | 0.2 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.2 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.4 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 3.7 | GO:0005770 | late endosome(GO:0005770) |
0.0 | 0.3 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.2 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.2 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
0.0 | 2.2 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 0.4 | GO:0044453 | nuclear membrane part(GO:0044453) |
0.0 | 0.6 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.6 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.5 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.0 | 1.5 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 0.2 | GO:0060091 | kinocilium(GO:0060091) |
0.0 | 0.7 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.5 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 0.1 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.1 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
0.0 | 0.1 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.0 | 0.7 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.2 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.2 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.0 | 0.7 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.0 | 3.7 | GO:0005769 | early endosome(GO:0005769) |
0.0 | 1.7 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.2 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.1 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.4 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.6 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 3.5 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.2 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.1 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.0 | 0.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.1 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.1 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.6 | GO:0008305 | integrin complex(GO:0008305) |
0.0 | 0.1 | GO:0036128 | CatSper complex(GO:0036128) |
0.0 | 0.2 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.0 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.1 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.1 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
0.0 | 0.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.2 | GO:0043083 | synaptic cleft(GO:0043083) |
0.0 | 0.2 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
0.0 | 0.6 | GO:0044291 | cell-cell contact zone(GO:0044291) |
0.0 | 0.6 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.3 | GO:0032156 | septin cytoskeleton(GO:0032156) |
0.0 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
0.0 | 0.1 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 0.2 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.1 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.1 | GO:0005579 | membrane attack complex(GO:0005579) |
0.0 | 2.1 | GO:0030141 | secretory granule(GO:0030141) |
0.0 | 0.3 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.0 | 0.1 | GO:0043218 | compact myelin(GO:0043218) |
0.0 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.0 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.0 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
0.0 | 0.5 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.0 | GO:0071439 | clathrin complex(GO:0071439) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.9 | GO:0005118 | sevenless binding(GO:0005118) |
0.6 | 2.9 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.5 | 2.1 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) |
0.5 | 1.4 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.4 | 1.3 | GO:0017082 | mineralocorticoid receptor activity(GO:0017082) |
0.4 | 0.4 | GO:0004923 | leukemia inhibitory factor receptor activity(GO:0004923) |
0.4 | 3.5 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.4 | 1.6 | GO:0003844 | 1,4-alpha-glucan branching enzyme activity(GO:0003844) |
0.4 | 1.2 | GO:0019120 | hydrolase activity, acting on acid halide bonds(GO:0016824) hydrolase activity, acting on acid halide bonds, in C-halide compounds(GO:0019120) alkylhalidase activity(GO:0047651) |
0.3 | 1.0 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.3 | 1.2 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.3 | 1.2 | GO:0019970 | interleukin-11 receptor activity(GO:0004921) interleukin-11 binding(GO:0019970) |
0.3 | 1.2 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.3 | 3.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.3 | 0.9 | GO:0035500 | MH2 domain binding(GO:0035500) |
0.3 | 0.8 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
0.3 | 0.8 | GO:0048030 | disaccharide binding(GO:0048030) |
0.3 | 0.8 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
0.2 | 2.0 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.2 | 0.7 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.2 | 0.2 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.2 | 0.9 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.2 | 0.2 | GO:0032029 | myosin tail binding(GO:0032029) |
0.2 | 0.7 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.2 | 1.3 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.2 | 0.2 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
0.2 | 1.0 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.2 | 0.6 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.2 | 1.4 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.2 | 1.8 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.2 | 0.2 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.2 | 2.0 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.2 | 1.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.2 | 1.0 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.2 | 0.8 | GO:0070976 | TIR domain binding(GO:0070976) |
0.2 | 0.9 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.2 | 1.1 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.2 | 0.6 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) |
0.2 | 0.7 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.2 | 0.7 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.2 | 1.4 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
0.2 | 0.4 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
0.2 | 3.6 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.2 | 0.2 | GO:0005308 | creatine transmembrane transporter activity(GO:0005308) |
0.2 | 0.7 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.2 | 0.5 | GO:0019002 | GMP binding(GO:0019002) |
0.2 | 0.7 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.2 | 0.5 | GO:0034437 | glycoprotein transporter activity(GO:0034437) |
0.2 | 1.5 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.2 | 1.0 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.2 | 0.5 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
0.2 | 1.2 | GO:0015099 | nickel cation transmembrane transporter activity(GO:0015099) |
0.2 | 0.8 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
0.2 | 1.3 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.2 | 1.3 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.2 | 0.8 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
0.2 | 0.5 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.2 | 0.5 | GO:0015056 | corticotrophin-releasing factor receptor activity(GO:0015056) corticotropin-releasing hormone receptor activity(GO:0043404) |
0.2 | 4.2 | GO:0031489 | myosin V binding(GO:0031489) |
0.2 | 1.0 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.2 | 0.5 | GO:0098809 | nitrite reductase activity(GO:0098809) |
0.2 | 0.8 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.2 | 0.5 | GO:0071568 | UFM1 transferase activity(GO:0071568) |
0.2 | 2.2 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.2 | 0.5 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.2 | 0.6 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.2 | 1.5 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.3 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.1 | 0.6 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.1 | 0.6 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
0.1 | 0.7 | GO:0032810 | sterol response element binding(GO:0032810) |
0.1 | 0.7 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.1 | 2.3 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 0.6 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.1 | 1.8 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 0.3 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.1 | 0.7 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.1 | 0.4 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.1 | 1.1 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
0.1 | 0.6 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
0.1 | 0.1 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.1 | 0.4 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.1 | 0.7 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 0.4 | GO:0045159 | myosin II binding(GO:0045159) |
0.1 | 0.4 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.9 | GO:0015923 | mannosidase activity(GO:0015923) |
0.1 | 2.1 | GO:0044548 | S100 protein binding(GO:0044548) |
0.1 | 0.9 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.1 | 0.8 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.5 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.4 | GO:0071633 | dihydroceramidase activity(GO:0071633) |
0.1 | 1.2 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 2.9 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.1 | 0.5 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.1 | 0.8 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.1 | 0.5 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.1 | 0.4 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.1 | 2.5 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.5 | GO:0031996 | thioesterase binding(GO:0031996) |
0.1 | 0.7 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.1 | 0.9 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.4 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 0.5 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 0.8 | GO:0005499 | vitamin D binding(GO:0005499) |
0.1 | 0.8 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.5 | GO:0033814 | propanoyl-CoA C-acyltransferase activity(GO:0033814) propionyl-CoA C2-trimethyltridecanoyltransferase activity(GO:0050632) phosphatidylethanolamine transporter activity(GO:1904121) |
0.1 | 0.4 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.1 | 0.7 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.1 | 0.5 | GO:0004008 | copper-exporting ATPase activity(GO:0004008) copper-transporting ATPase activity(GO:0043682) |
0.1 | 0.4 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 0.5 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.1 | 0.3 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.1 | 0.3 | GO:0090556 | apolipoprotein receptor activity(GO:0030226) apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
0.1 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 0.5 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
0.1 | 0.3 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 1.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.3 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 0.5 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
0.1 | 1.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.1 | 0.9 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.1 | 0.3 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.8 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.7 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.1 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.1 | 1.6 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 0.4 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 0.4 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.1 | 0.6 | GO:0004064 | arylesterase activity(GO:0004064) |
0.1 | 0.3 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
0.1 | 0.1 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.1 | 0.3 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.1 | 0.3 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.1 | 1.1 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.4 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
0.1 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.5 | GO:0070012 | oligopeptidase activity(GO:0070012) |
0.1 | 0.2 | GO:0043559 | insulin binding(GO:0043559) |
0.1 | 0.5 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
0.1 | 0.3 | GO:0002113 | interleukin-33 binding(GO:0002113) |
0.1 | 0.4 | GO:0019808 | polyamine binding(GO:0019808) |
0.1 | 0.5 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
0.1 | 0.5 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.1 | 0.3 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.5 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
0.1 | 0.6 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.4 | GO:0016316 | phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity(GO:0016316) |
0.1 | 0.3 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
0.1 | 0.3 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.1 | 0.3 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.1 | 0.4 | GO:0061628 | H3K27me3 modified histone binding(GO:0061628) |
0.1 | 0.3 | GO:0003977 | UDP-N-acetylglucosamine diphosphorylase activity(GO:0003977) |
0.1 | 0.5 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.1 | 0.4 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.1 | 0.3 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
0.1 | 0.4 | GO:0042806 | fucose binding(GO:0042806) |
0.1 | 0.4 | GO:0047710 | bis(5'-adenosyl)-triphosphatase activity(GO:0047710) |
0.1 | 0.5 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 0.6 | GO:0038132 | neuregulin binding(GO:0038132) |
0.1 | 0.6 | GO:0016803 | ether hydrolase activity(GO:0016803) |
0.1 | 0.5 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.1 | 0.5 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 0.6 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.1 | 1.7 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
0.1 | 0.3 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
0.1 | 0.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.1 | 0.7 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 0.3 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
0.1 | 0.3 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
0.1 | 1.5 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.1 | 0.6 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 1.1 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
0.1 | 0.5 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) extracellular matrix protein binding(GO:1990430) |
0.1 | 0.3 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.1 | 0.5 | GO:0048039 | ubiquinone binding(GO:0048039) |
0.1 | 0.4 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
0.1 | 0.8 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.6 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 1.4 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.3 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
0.1 | 0.6 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
0.1 | 0.2 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
0.1 | 0.3 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.1 | 0.3 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
0.1 | 0.7 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.1 | 0.2 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
0.1 | 0.5 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.1 | 0.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 0.2 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.1 | 0.5 | GO:0099609 | microtubule lateral binding(GO:0099609) |
0.1 | 0.2 | GO:0071077 | coenzyme A transmembrane transporter activity(GO:0015228) adenosine 3',5'-bisphosphate transmembrane transporter activity(GO:0071077) AMP transmembrane transporter activity(GO:0080122) |
0.1 | 0.2 | GO:0030977 | taurine binding(GO:0030977) |
0.1 | 0.3 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.2 | GO:0052740 | phosphatidylserine 1-acylhydrolase activity(GO:0052739) 1-acyl-2-lysophosphatidylserine acylhydrolase activity(GO:0052740) |
0.1 | 0.2 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.1 | 0.2 | GO:0004903 | growth hormone receptor activity(GO:0004903) |
0.1 | 0.3 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.1 | 1.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.1 | 0.4 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.1 | 0.4 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.1 | 0.6 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) potassium-transporting ATPase activity(GO:0008556) |
0.1 | 0.2 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 0.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.1 | 1.0 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.1 | 0.8 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.3 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
0.1 | 0.3 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.1 | 0.3 | GO:0008967 | phosphoglycolate phosphatase activity(GO:0008967) |
0.1 | 0.6 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.1 | 0.3 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.2 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
0.1 | 0.3 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.3 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 0.4 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.1 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.1 | 0.4 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 0.6 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.1 | 0.3 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.1 | 0.3 | GO:0003883 | CTP synthase activity(GO:0003883) |
0.1 | 0.6 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 3.6 | GO:0019003 | GDP binding(GO:0019003) |
0.1 | 0.2 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
0.1 | 0.6 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 0.4 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.1 | 0.5 | GO:0008329 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.1 | 0.3 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.1 | 2.7 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 1.7 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 0.6 | GO:0004331 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.1 | 0.3 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 0.2 | GO:0030617 | transforming growth factor beta receptor, inhibitory cytoplasmic mediator activity(GO:0030617) |
0.1 | 0.4 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.1 | 0.2 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.1 | 0.2 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.1 | 0.4 | GO:0002046 | opsin binding(GO:0002046) |
0.1 | 0.4 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 0.6 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.2 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.1 | 0.3 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.1 | 0.3 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
0.1 | 0.4 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 0.4 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 0.2 | GO:0004637 | phosphoribosylamine-glycine ligase activity(GO:0004637) |
0.1 | 0.8 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.1 | 0.7 | GO:0051870 | methotrexate binding(GO:0051870) |
0.1 | 0.2 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
0.1 | 0.8 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.1 | 0.2 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.1 | 0.4 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.1 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.1 | 0.7 | GO:0048038 | quinone binding(GO:0048038) |
0.1 | 0.2 | GO:0047726 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) iron-cytochrome-c reductase activity(GO:0047726) |
0.1 | 0.3 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.1 | 0.4 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.1 | 0.8 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.1 | 0.2 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
0.1 | 1.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 1.0 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.1 | 0.2 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
0.1 | 2.7 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.1 | 1.0 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 0.6 | GO:0034595 | phosphatidylinositol phosphate 5-phosphatase activity(GO:0034595) |
0.1 | 1.2 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
0.1 | 0.2 | GO:0005008 | hepatocyte growth factor-activated receptor activity(GO:0005008) |
0.1 | 0.2 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
0.1 | 0.3 | GO:0042834 | peptidoglycan binding(GO:0042834) |
0.1 | 0.7 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 0.7 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.9 | GO:0005537 | mannose binding(GO:0005537) |
0.1 | 0.2 | GO:0001847 | opsonin receptor activity(GO:0001847) |
0.1 | 0.5 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 1.2 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 3.0 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.1 | 0.3 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 0.5 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.1 | 0.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.1 | 0.7 | GO:0031386 | protein tag(GO:0031386) |
0.1 | 0.2 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.1 | 0.8 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
0.1 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.1 | 0.6 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.3 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.2 | GO:0052794 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.1 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.0 | 0.2 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.0 | 1.0 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 1.0 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.6 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.3 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 1.4 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 1.8 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.1 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 1.2 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.3 | GO:0016801 | adenosylhomocysteinase activity(GO:0004013) hydrolase activity, acting on ether bonds(GO:0016801) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.2 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.3 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.2 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.0 | 0.2 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.1 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
0.0 | 1.2 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.4 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.0 | 0.4 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.0 | 0.3 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
0.0 | 1.0 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.1 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.1 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
0.0 | 0.4 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.1 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
0.0 | 0.2 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.1 | GO:0031692 | alpha-1A adrenergic receptor binding(GO:0031691) alpha-1B adrenergic receptor binding(GO:0031692) follicle-stimulating hormone receptor binding(GO:0031762) vasopressin receptor binding(GO:0031893) V2 vasopressin receptor binding(GO:0031896) |
0.0 | 0.3 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.1 | GO:0015925 | galactosidase activity(GO:0015925) |
0.0 | 0.2 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.4 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.2 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.0 | 0.1 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.0 | 0.4 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.0 | 0.1 | GO:0047936 | glucose 1-dehydrogenase [NAD(P)] activity(GO:0047936) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.3 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.2 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.8 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.0 | 0.3 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.2 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.3 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.3 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.8 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.3 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 1.6 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.5 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 1.2 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.5 | GO:0015250 | water channel activity(GO:0015250) |
0.0 | 0.2 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.5 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 2.1 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.2 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
0.0 | 0.1 | GO:0031208 | POZ domain binding(GO:0031208) |
0.0 | 0.5 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.3 | GO:0004118 | cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) |
0.0 | 0.2 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.0 | 0.7 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.2 | GO:1902379 | chemoattractant activity involved in axon guidance(GO:1902379) |
0.0 | 0.9 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.2 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 1.0 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.3 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.1 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.0 | 0.5 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.0 | 0.2 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 0.0 | GO:0005110 | frizzled-2 binding(GO:0005110) |
0.0 | 0.1 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
0.0 | 0.4 | GO:0070403 | NAD+ binding(GO:0070403) |
0.0 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.4 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.0 | 0.2 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.0 | 1.0 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.0 | 0.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.0 | 0.2 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.2 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.0 | 0.5 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.1 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
0.0 | 0.2 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.1 | GO:0042936 | dipeptide transporter activity(GO:0042936) |
0.0 | 1.0 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.0 | 0.6 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.1 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
0.0 | 0.5 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.5 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 0.2 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.0 | 0.3 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.1 | GO:0004454 | ketohexokinase activity(GO:0004454) |
0.0 | 0.1 | GO:0047237 | glucuronylgalactosylproteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047237) |
0.0 | 0.2 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.6 | GO:0001848 | complement binding(GO:0001848) |
0.0 | 0.4 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.0 | 0.1 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.0 | 0.6 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.0 | 0.1 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.0 | 0.4 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.1 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.5 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.1 | GO:0008940 | nitrate reductase activity(GO:0008940) |
0.0 | 0.1 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.0 | 0.5 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
0.0 | 2.1 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.2 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.2 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.4 | GO:0031402 | sodium ion binding(GO:0031402) |
0.0 | 0.0 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.0 | 0.2 | GO:0046977 | TAP binding(GO:0046977) |
0.0 | 4.6 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.0 | 0.2 | GO:0005550 | pheromone binding(GO:0005550) |
0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.3 | GO:0030553 | cGMP binding(GO:0030553) |
0.0 | 0.1 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.0 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.1 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
0.0 | 0.4 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.4 | GO:0070330 | aromatase activity(GO:0070330) |
0.0 | 0.7 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
0.0 | 0.3 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) |
0.0 | 0.1 | GO:0004373 | glycogen (starch) synthase activity(GO:0004373) |
0.0 | 0.1 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 1.4 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 0.8 | GO:0045309 | protein phosphorylated amino acid binding(GO:0045309) |
0.0 | 0.3 | GO:0004579 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) hedgehog receptor activity(GO:0008158) |
0.0 | 0.1 | GO:0072541 | peroxynitrite reductase activity(GO:0072541) |
0.0 | 0.6 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.0 | 0.4 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.5 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.0 | 0.2 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.0 | 0.1 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 1.1 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.1 | GO:0031699 | beta-3 adrenergic receptor binding(GO:0031699) |
0.0 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 2.0 | GO:0002020 | protease binding(GO:0002020) |
0.0 | 2.1 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.2 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.6 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 0.5 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 0.1 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.0 | 0.0 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.0 | 0.1 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
0.0 | 0.2 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.0 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.0 | 0.5 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.5 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.5 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.0 | 0.1 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
0.0 | 0.3 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) |
0.0 | 0.3 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.1 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.7 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.1 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.0 | 0.0 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) transcription factor activity, RNA polymerase III transcription factor binding(GO:0001007) |
0.0 | 0.5 | GO:0016409 | palmitoyltransferase activity(GO:0016409) |
0.0 | 0.1 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 0.2 | GO:0016307 | phosphatidylinositol phosphate kinase activity(GO:0016307) |
0.0 | 0.1 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.0 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.1 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.1 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
0.0 | 0.2 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
0.0 | 0.2 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.0 | 0.3 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.3 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.1 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.0 | 0.1 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
0.0 | 0.0 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.0 | 0.1 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) inositol trisphosphate phosphatase activity(GO:0046030) |
0.0 | 0.0 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.0 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.0 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.1 | GO:0005093 | Rab GDP-dissociation inhibitor activity(GO:0005093) |
0.0 | 0.1 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.0 | 0.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.6 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 0.1 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 0.1 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
0.0 | 0.3 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.0 | 0.0 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0043121 | neurotrophin binding(GO:0043121) brain-derived neurotrophic factor binding(GO:0048403) |
0.0 | 0.5 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.2 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.1 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.0 | 0.3 | GO:0008236 | serine-type peptidase activity(GO:0008236) |
0.0 | 0.2 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.1 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.2 | GO:0015662 | ATPase activity, coupled to transmembrane movement of ions, phosphorylative mechanism(GO:0015662) |
0.0 | 0.4 | GO:0030145 | manganese ion binding(GO:0030145) |
0.0 | 0.0 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.0 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
0.0 | 0.2 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.0 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 0.0 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
0.0 | 0.0 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.2 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.4 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.0 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) pyrimidine- and adenine-specific:sodium symporter activity(GO:0015389) |
0.0 | 0.1 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.0 | GO:0008534 | oxidized purine nucleobase lesion DNA N-glycosylase activity(GO:0008534) |
0.0 | 0.7 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.0 | GO:0080130 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.0 | 0.3 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
0.0 | 0.1 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.0 | 0.3 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 0.1 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.0 | 0.3 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.3 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.1 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.1 | 4.9 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.1 | 4.7 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.1 | 1.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 0.4 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 0.3 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 0.3 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 0.7 | ST STAT3 PATHWAY | STAT3 Pathway |
0.1 | 1.3 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.1 | 0.8 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.1 | 3.7 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.1 | 0.3 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.1 | 1.5 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.1 | 1.8 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 1.9 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 1.5 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 1.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.1 | 1.5 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.1 | 0.4 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.1 | 1.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.1 | 1.5 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.0 | 1.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 1.5 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.8 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 1.8 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.2 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.2 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 0.3 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 0.8 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 1.0 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 1.1 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.8 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 1.9 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.7 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.1 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 2.4 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.6 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 1.0 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.2 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 1.6 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.8 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.1 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.9 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 0.6 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.3 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 1.0 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.7 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.5 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 2.6 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.4 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.6 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.4 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.9 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.3 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 0.7 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 0.2 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.3 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.9 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 0.9 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.7 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.6 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.1 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.3 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.0 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.2 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.0 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.4 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.1 | ST GAQ PATHWAY | G alpha q Pathway |
0.0 | 0.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.1 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.7 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 1.7 | REACTOME NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Neurotransmitter Release Cycle |
0.2 | 0.2 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.2 | 0.2 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.2 | 0.5 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.2 | 1.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.2 | 1.3 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.2 | 3.5 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.2 | 2.9 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.1 | 1.8 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.1 | 5.4 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.1 | 1.1 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.1 | 1.9 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.1 | 1.0 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 1.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 0.2 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.1 | 0.1 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
0.1 | 2.2 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 1.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 1.9 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.1 | 0.2 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 4.6 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.1 | 1.0 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 4.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 1.2 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
0.1 | 2.9 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.1 | 1.7 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 2.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.1 | 0.9 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.1 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 2.9 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.1 | 1.2 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 0.6 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.1 | 0.5 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.1 | 0.9 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 1.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.1 | 1.6 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 0.6 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.1 | 1.0 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.1 | 0.8 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 0.7 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 0.2 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.1 | 0.3 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 0.4 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 0.8 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 1.0 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 2.4 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
0.1 | 0.5 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 0.4 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
0.1 | 0.7 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.1 | 1.4 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.1 | 0.1 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.1 | 0.5 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.5 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.4 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 2.7 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.3 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 1.4 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.1 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.0 | 0.5 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.2 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.9 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.0 | 0.3 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.4 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 1.2 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.6 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.6 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 1.7 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.1 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
0.0 | 0.9 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.5 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.3 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.0 | 0.6 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 1.3 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.2 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
0.0 | 1.1 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 0.4 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 3.3 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
0.0 | 0.6 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.0 | 0.4 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 1.4 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 1.2 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 1.2 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.0 | 0.9 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
0.0 | 0.3 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.0 | 1.0 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
0.0 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.4 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 0.3 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.6 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 2.4 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.8 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.4 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.0 | 0.1 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
0.0 | 0.6 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.8 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.2 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.3 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 1.8 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.0 | 0.3 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.0 | 0.8 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.5 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 1.6 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
0.0 | 0.1 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.0 | 0.6 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.3 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.0 | 0.1 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.0 | 0.5 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.3 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.4 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.6 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.8 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 0.5 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
0.0 | 0.6 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.0 | 1.0 | REACTOME MEIOSIS | Genes involved in Meiosis |
0.0 | 1.7 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.3 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.4 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.4 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 0.9 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 1.1 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.3 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 2.8 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.8 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 0.3 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.0 | 0.1 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.0 | 0.2 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.0 | 0.2 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.6 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.2 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.3 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
0.0 | 0.1 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
0.0 | 0.1 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
0.0 | 0.3 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
0.0 | 0.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.4 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.1 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.0 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.0 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.7 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.0 | 0.2 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
0.0 | 0.2 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.1 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |