avrg: 12D miR HR13_24
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Zfx
|
ENSMUSG00000079509.4 | zinc finger protein X-linked |
|
Zfp711
|
ENSMUSG00000025529.8 | zinc finger protein 711 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Zfp711 | mm10_v2_chrX_+_112615301_112615301 | 0.41 | 2.2e-01 | Click! |
| Zfx | mm10_v2_chrX_-_94123359_94123412 | 0.35 | 3.0e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr2_+_31245801 | 0.96 |
ENSMUST00000000199.7
|
Ncs1
|
neuronal calcium sensor 1 |
| chr13_-_112652295 | 0.95 |
ENSMUST00000099166.2
ENSMUST00000075748.5 |
Ddx4
|
DEAD (Asp-Glu-Ala-Asp) box polypeptide 4 |
| chr7_-_4752972 | 0.71 |
ENSMUST00000183971.1
ENSMUST00000182173.1 ENSMUST00000182738.1 ENSMUST00000184143.1 ENSMUST00000182111.1 ENSMUST00000182048.1 ENSMUST00000063324.7 |
Cox6b2
|
cytochrome c oxidase subunit VIb polypeptide 2 |
| chr2_+_25242929 | 0.70 |
ENSMUST00000114355.1
ENSMUST00000060818.1 |
Rnf208
|
ring finger protein 208 |
| chr2_-_33130565 | 0.68 |
ENSMUST00000124000.1
|
Garnl3
|
GTPase activating RANGAP domain-like 3 |
| chr12_-_111485808 | 0.63 |
ENSMUST00000010673.5
|
Gm266
|
predicted gene 266 |
| chr2_-_181135103 | 0.62 |
ENSMUST00000149964.2
ENSMUST00000103050.3 ENSMUST00000081528.6 ENSMUST00000049792.8 ENSMUST00000103048.3 ENSMUST00000103047.3 ENSMUST00000129073.1 ENSMUST00000144592.1 ENSMUST00000139458.1 ENSMUST00000154164.1 ENSMUST00000123336.1 ENSMUST00000129361.1 ENSMUST00000103051.2 |
Kcnq2
|
potassium voltage-gated channel, subfamily Q, member 2 |
| chr18_+_60963517 | 0.60 |
ENSMUST00000115295.2
ENSMUST00000039904.6 |
Camk2a
|
calcium/calmodulin-dependent protein kinase II alpha |
| chr2_+_164960809 | 0.56 |
ENSMUST00000124372.1
|
Slc12a5
|
solute carrier family 12, member 5 |
| chr15_-_79834261 | 0.56 |
ENSMUST00000148358.1
|
Cbx6
|
chromobox 6 |
| chr7_+_46396439 | 0.55 |
ENSMUST00000025202.6
|
Kcnc1
|
potassium voltage gated channel, Shaw-related subfamily, member 1 |
| chr5_-_72587544 | 0.51 |
ENSMUST00000031124.4
|
Gm5868
|
predicted gene 5868 |
| chr7_-_4778141 | 0.50 |
ENSMUST00000094892.5
|
Il11
|
interleukin 11 |
| chr11_-_119547744 | 0.48 |
ENSMUST00000026670.4
|
Nptx1
|
neuronal pentraxin 1 |
| chr7_-_44670820 | 0.48 |
ENSMUST00000048102.7
|
Myh14
|
myosin, heavy polypeptide 14 |
| chr7_-_141276729 | 0.47 |
ENSMUST00000167263.1
ENSMUST00000080654.5 |
Cdhr5
|
cadherin-related family member 5 |
| chr12_-_108275409 | 0.47 |
ENSMUST00000136175.1
|
Ccdc85c
|
coiled-coil domain containing 85C |
| chr12_-_112929415 | 0.47 |
ENSMUST00000075827.3
|
Jag2
|
jagged 2 |
| chr7_-_62420139 | 0.46 |
ENSMUST00000094340.3
|
Mkrn3
|
makorin, ring finger protein, 3 |
| chr7_+_5056856 | 0.46 |
ENSMUST00000131368.1
ENSMUST00000123956.1 |
Ccdc106
|
coiled-coil domain containing 106 |
| chrX_+_74329058 | 0.46 |
ENSMUST00000004326.3
|
Plxna3
|
plexin A3 |
| chr7_-_80401707 | 0.44 |
ENSMUST00000120753.1
|
Furin
|
furin (paired basic amino acid cleaving enzyme) |
| chr7_-_19458494 | 0.44 |
ENSMUST00000085715.5
|
Mark4
|
MAP/microtubule affinity-regulating kinase 4 |
| chr1_+_87124946 | 0.43 |
ENSMUST00000044878.3
|
Akp3
|
alkaline phosphatase 3, intestine, not Mn requiring |
| chr5_-_33433976 | 0.42 |
ENSMUST00000173348.1
|
Nkx1-1
|
NK1 transcription factor related, locus 1 (Drosophila) |
| chr8_+_84723003 | 0.41 |
ENSMUST00000098571.4
|
G430095P16Rik
|
RIKEN cDNA G430095P16 gene |
| chr15_+_82275197 | 0.41 |
ENSMUST00000116423.1
|
Sept3
|
septin 3 |
| chr11_-_120824098 | 0.41 |
ENSMUST00000055655.7
|
Fasn
|
fatty acid synthase |
| chr17_-_45686120 | 0.40 |
ENSMUST00000143907.1
ENSMUST00000127065.1 |
Tmem63b
|
transmembrane protein 63b |
| chr7_+_143052739 | 0.40 |
ENSMUST00000037941.9
|
Cd81
|
CD81 antigen |
| chr5_-_31048014 | 0.40 |
ENSMUST00000137223.1
|
Slc5a6
|
solute carrier family 5 (sodium-dependent vitamin transporter), member 6 |
| chr9_-_21037775 | 0.39 |
ENSMUST00000180870.1
|
Gm26592
|
predicted gene, 26592 |
| chr1_+_74713551 | 0.39 |
ENSMUST00000027356.5
|
Cyp27a1
|
cytochrome P450, family 27, subfamily a, polypeptide 1 |
| chr12_+_111271089 | 0.39 |
ENSMUST00000021707.6
|
Amn
|
amnionless |
| chr2_-_157079212 | 0.39 |
ENSMUST00000069098.6
|
Soga1
|
suppressor of glucose, autophagy associated 1 |
| chr19_+_44989073 | 0.39 |
ENSMUST00000026225.8
|
Sema4g
|
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4G |
| chr10_+_79793553 | 0.38 |
ENSMUST00000046945.6
ENSMUST00000105379.2 |
Palm
|
paralemmin |
| chrY_+_90784738 | 0.38 |
ENSMUST00000179483.1
|
Erdr1
|
erythroid differentiation regulator 1 |
| chr7_+_109010825 | 0.37 |
ENSMUST00000033341.5
|
Tub
|
tubby candidate gene |
| chr11_+_60104971 | 0.37 |
ENSMUST00000064190.6
|
Rai1
|
retinoic acid induced 1 |
| chr2_+_181680284 | 0.37 |
ENSMUST00000103042.3
|
Tcea2
|
transcription elongation factor A (SII), 2 |
| chr2_-_73386396 | 0.37 |
ENSMUST00000112044.1
ENSMUST00000112043.1 ENSMUST00000076463.5 |
Gpr155
|
G protein-coupled receptor 155 |
| chr14_-_51988829 | 0.36 |
ENSMUST00000181008.1
|
Gm16617
|
predicted gene, 16617 |
| chr2_+_31759993 | 0.36 |
ENSMUST00000124089.1
|
Abl1
|
c-abl oncogene 1, non-receptor tyrosine kinase |
| chr5_-_110810080 | 0.36 |
ENSMUST00000031490.6
|
Ulk1
|
unc-51 like kinase 1 |
| chr13_-_43304153 | 0.36 |
ENSMUST00000055341.5
|
Gfod1
|
glucose-fructose oxidoreductase domain containing 1 |
| chr4_+_11156411 | 0.36 |
ENSMUST00000029865.3
|
Trp53inp1
|
transformation related protein 53 inducible nuclear protein 1 |
| chr1_+_135766085 | 0.36 |
ENSMUST00000038945.5
|
Phlda3
|
pleckstrin homology-like domain, family A, member 3 |
| chr4_-_128962420 | 0.36 |
ENSMUST00000119354.1
ENSMUST00000106068.1 ENSMUST00000030581.3 |
Adc
|
arginine decarboxylase |
| chr5_+_52190650 | 0.36 |
ENSMUST00000180601.1
|
9230114K14Rik
|
RIKEN cDNA 9230114K14 gene |
| chr11_+_115834314 | 0.36 |
ENSMUST00000173289.1
ENSMUST00000137900.1 |
Llgl2
|
lethal giant larvae homolog 2 (Drosophila) |
| chr2_+_139678178 | 0.36 |
ENSMUST00000184404.1
ENSMUST00000099307.3 |
Ism1
|
isthmin 1 homolog (zebrafish) |
| chr17_-_34628005 | 0.36 |
ENSMUST00000166040.2
|
Ppt2
|
palmitoyl-protein thioesterase 2 |
| chr9_+_44084944 | 0.35 |
ENSMUST00000176416.1
ENSMUST00000065461.7 |
Usp2
|
ubiquitin specific peptidase 2 |
| chr11_-_97775876 | 0.35 |
ENSMUST00000107576.1
|
1700001P01Rik
|
RIKEN cDNA 1700001P01 gene |
| chr1_+_93215899 | 0.35 |
ENSMUST00000138595.1
|
E030010N08Rik
|
RIKEN cDNA E030010N08 gene |
| chr18_+_67343564 | 0.35 |
ENSMUST00000025404.8
|
Cidea
|
cell death-inducing DNA fragmentation factor, alpha subunit-like effector A |
| chr5_-_134688568 | 0.35 |
ENSMUST00000015137.3
|
Limk1
|
LIM-domain containing, protein kinase |
| chr2_-_32353283 | 0.35 |
ENSMUST00000091089.5
ENSMUST00000113350.1 |
Dnm1
|
dynamin 1 |
| chr2_-_152332353 | 0.35 |
ENSMUST00000109847.2
|
Rbck1
|
RanBP-type and C3HC4-type zinc finger containing 1 |
| chr11_-_120784183 | 0.35 |
ENSMUST00000026156.7
|
Rfng
|
RFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
| chr13_+_46418266 | 0.35 |
ENSMUST00000037923.3
|
Rbm24
|
RNA binding motif protein 24 |
| chrX_+_48108912 | 0.34 |
ENSMUST00000114998.1
ENSMUST00000115000.3 |
Xpnpep2
|
X-prolyl aminopeptidase (aminopeptidase P) 2, membrane-bound |
| chr10_+_40883469 | 0.34 |
ENSMUST00000019975.7
|
Wasf1
|
WAS protein family, member 1 |
| chr17_-_45686214 | 0.34 |
ENSMUST00000113523.2
|
Tmem63b
|
transmembrane protein 63b |
| chr17_-_46487641 | 0.34 |
ENSMUST00000047034.8
|
Ttbk1
|
tau tubulin kinase 1 |
| chr7_+_141061274 | 0.34 |
ENSMUST00000048002.5
|
B4galnt4
|
beta-1,4-N-acetyl-galactosaminyl transferase 4 |
| chr6_-_24956106 | 0.34 |
ENSMUST00000127247.2
|
Tmem229a
|
transmembrane protein 229A |
| chr10_+_128377086 | 0.34 |
ENSMUST00000014642.3
|
Ankrd52
|
ankyrin repeat domain 52 |
| chr4_+_127169131 | 0.33 |
ENSMUST00000046659.7
|
Dlgap3
|
discs, large (Drosophila) homolog-associated protein 3 |
| chr11_+_120458093 | 0.33 |
ENSMUST00000058370.7
ENSMUST00000175970.1 ENSMUST00000176120.1 |
Ccdc137
|
coiled-coil domain containing 137 |
| chr6_-_87981482 | 0.33 |
ENSMUST00000056403.5
|
H1fx
|
H1 histone family, member X |
| chr1_-_57406443 | 0.33 |
ENSMUST00000160837.1
ENSMUST00000161780.1 |
Tyw5
|
tRNA-yW synthesizing protein 5 |
| chr17_-_45685973 | 0.33 |
ENSMUST00000145873.1
|
Tmem63b
|
transmembrane protein 63b |
| chr18_+_67464849 | 0.32 |
ENSMUST00000025411.7
|
Slmo1
|
slowmo homolog 1 (Drosophila) |
| chr2_+_32587057 | 0.32 |
ENSMUST00000102818.4
|
St6galnac4
|
ST6 (alpha-N-acetyl-neuraminyl-2,3-beta-galactosyl-1,3)-N-acetylgalactosaminide alpha-2,6-sialyltransferase 4 |
| chr13_-_49147931 | 0.32 |
ENSMUST00000162581.1
ENSMUST00000110097.2 ENSMUST00000049265.8 ENSMUST00000035538.6 ENSMUST00000110096.1 ENSMUST00000091623.3 |
Wnk2
|
WNK lysine deficient protein kinase 2 |
| chr17_+_46297917 | 0.32 |
ENSMUST00000166617.1
ENSMUST00000170271.1 |
Dlk2
|
delta-like 2 homolog (Drosophila) |
| chr2_-_33131645 | 0.32 |
ENSMUST00000133135.1
|
Garnl3
|
GTPase activating RANGAP domain-like 3 |
| chr7_+_141228766 | 0.31 |
ENSMUST00000106027.2
|
Phrf1
|
PHD and ring finger domains 1 |
| chr9_-_31913462 | 0.31 |
ENSMUST00000116615.3
|
Barx2
|
BarH-like homeobox 2 |
| chr9_+_111311674 | 0.31 |
ENSMUST00000078626.3
|
Trank1
|
tetratricopeptide repeat and ankyrin repeat containing 1 |
| chr7_+_29289300 | 0.31 |
ENSMUST00000048187.4
|
Ppp1r14a
|
protein phosphatase 1, regulatory (inhibitor) subunit 14A |
| chr1_-_153900198 | 0.31 |
ENSMUST00000123490.1
|
5830403L16Rik
|
RIKEN cDNA 5830403L16 gene |
| chr3_-_86920830 | 0.31 |
ENSMUST00000029719.8
|
Dclk2
|
doublecortin-like kinase 2 |
| chr8_-_92355764 | 0.31 |
ENSMUST00000180102.1
ENSMUST00000179421.1 ENSMUST00000179222.1 ENSMUST00000179029.1 |
4933436C20Rik
|
RIKEN cDNA 4933436C20 gene |
| chr5_-_77310049 | 0.30 |
ENSMUST00000047860.8
|
Noa1
|
nitric oxide associated 1 |
| chr19_-_10101501 | 0.30 |
ENSMUST00000025567.7
|
Fads2
|
fatty acid desaturase 2 |
| chr5_+_65764073 | 0.30 |
ENSMUST00000138239.1
ENSMUST00000087264.3 |
N4bp2
|
NEDD4 binding protein 2 |
| chr6_+_65778988 | 0.30 |
ENSMUST00000031976.7
ENSMUST00000081219.7 ENSMUST00000031973.6 ENSMUST00000172638.1 |
Prdm5
|
PR domain containing 5 |
| chr5_-_124249758 | 0.30 |
ENSMUST00000162812.1
|
Pitpnm2
|
phosphatidylinositol transfer protein, membrane-associated 2 |
| chrX_+_73639414 | 0.30 |
ENSMUST00000019701.8
|
Dusp9
|
dual specificity phosphatase 9 |
| chr2_-_154603658 | 0.30 |
ENSMUST00000109703.2
|
Pxmp4
|
peroxisomal membrane protein 4 |
| chr1_-_87101590 | 0.30 |
ENSMUST00000113270.2
|
Alpi
|
alkaline phosphatase, intestinal |
| chr4_-_117125618 | 0.30 |
ENSMUST00000183310.1
|
Btbd19
|
BTB (POZ) domain containing 19 |
| chr4_-_141060536 | 0.30 |
ENSMUST00000144196.1
ENSMUST00000097816.2 |
Crocc
|
ciliary rootlet coiled-coil, rootletin |
| chr9_+_60712989 | 0.30 |
ENSMUST00000038407.5
|
Larp6
|
La ribonucleoprotein domain family, member 6 |
| chr4_-_82885148 | 0.30 |
ENSMUST00000048430.3
|
Cer1
|
cerberus 1 homolog (Xenopus laevis) |
| chr2_-_152332639 | 0.29 |
ENSMUST00000028964.7
|
Rbck1
|
RanBP-type and C3HC4-type zinc finger containing 1 |
| chr11_-_98983016 | 0.29 |
ENSMUST00000062931.1
|
Gjd3
|
gap junction protein, delta 3 |
| chr9_-_22052021 | 0.29 |
ENSMUST00000003501.7
|
Elavl3
|
ELAV (embryonic lethal, abnormal vision, Drosophila)-like 3 (Hu antigen C) |
| chr17_-_34627365 | 0.29 |
ENSMUST00000064953.8
ENSMUST00000170345.1 ENSMUST00000171121.2 ENSMUST00000168391.2 ENSMUST00000169067.2 |
Ppt2
|
palmitoyl-protein thioesterase 2 |
| chr2_-_166155272 | 0.29 |
ENSMUST00000088086.3
|
Sulf2
|
sulfatase 2 |
| chr6_-_38254009 | 0.29 |
ENSMUST00000169256.1
|
D630045J12Rik
|
RIKEN cDNA D630045J12 gene |
| chr11_-_120086790 | 0.29 |
ENSMUST00000106227.1
ENSMUST00000106229.1 ENSMUST00000180242.1 |
Azi1
|
5-azacytidine induced gene 1 |
| chr12_+_109459843 | 0.29 |
ENSMUST00000173812.1
|
Dlk1
|
delta-like 1 homolog (Drosophila) |
| chr9_+_21032038 | 0.29 |
ENSMUST00000019616.4
|
Icam5
|
intercellular adhesion molecule 5, telencephalin |
| chr8_-_70476911 | 0.29 |
ENSMUST00000066597.5
ENSMUST00000166976.1 |
Klhl26
|
kelch-like 26 |
| chr15_+_89532816 | 0.29 |
ENSMUST00000167173.1
|
Shank3
|
SH3/ankyrin domain gene 3 |
| chr2_+_24949747 | 0.29 |
ENSMUST00000028350.3
|
Zmynd19
|
zinc finger, MYND domain containing 19 |
| chr11_-_120457936 | 0.29 |
ENSMUST00000137632.1
ENSMUST00000044007.2 |
Oxld1
|
oxidoreductase like domain containing 1 |
| chrX_+_9846945 | 0.28 |
ENSMUST00000044987.1
|
1700054O13Rik
|
RIKEN cDNA 1700054O13 gene |
| chr11_-_103101609 | 0.28 |
ENSMUST00000103077.1
|
Plcd3
|
phospholipase C, delta 3 |
| chr5_-_125179053 | 0.28 |
ENSMUST00000086083.4
|
Ncor2
|
nuclear receptor co-repressor 2 |
| chr6_-_85502980 | 0.28 |
ENSMUST00000159062.1
|
Fbxo41
|
F-box protein 41 |
| chr15_-_98807910 | 0.28 |
ENSMUST00000075444.6
|
Ddn
|
dendrin |
| chr19_-_42431778 | 0.28 |
ENSMUST00000048630.6
|
Crtac1
|
cartilage acidic protein 1 |
| chr4_-_89282152 | 0.28 |
ENSMUST00000060501.4
|
Cdkn2a
|
cyclin-dependent kinase inhibitor 2A |
| chr9_-_123260776 | 0.28 |
ENSMUST00000068140.4
|
Tmem158
|
transmembrane protein 158 |
| chr7_-_132813715 | 0.28 |
ENSMUST00000134946.1
|
Fam53b
|
family with sequence similarity 53, member B |
| chr18_-_70530313 | 0.28 |
ENSMUST00000043286.8
|
Poli
|
polymerase (DNA directed), iota |
| chr12_-_72917872 | 0.28 |
ENSMUST00000044000.5
|
4930447C04Rik
|
RIKEN cDNA 4930447C04 gene |
| chr15_+_93398344 | 0.28 |
ENSMUST00000109256.3
ENSMUST00000068457.7 ENSMUST00000049122.8 ENSMUST00000165935.1 |
Pphln1
|
periphilin 1 |
| chr7_-_34812677 | 0.27 |
ENSMUST00000078686.6
|
Chst8
|
carbohydrate (N-acetylgalactosamine 4-0) sulfotransferase 8 |
| chr7_-_80402743 | 0.27 |
ENSMUST00000122232.1
|
Furin
|
furin (paired basic amino acid cleaving enzyme) |
| chr2_-_32353247 | 0.27 |
ENSMUST00000078352.5
ENSMUST00000113352.2 ENSMUST00000113365.1 |
Dnm1
|
dynamin 1 |
| chr4_+_137862270 | 0.27 |
ENSMUST00000130407.1
|
Ece1
|
endothelin converting enzyme 1 |
| chr2_+_130274437 | 0.27 |
ENSMUST00000141872.1
|
Nop56
|
NOP56 ribonucleoprotein |
| chr10_-_79983970 | 0.27 |
ENSMUST00000124536.1
|
Tmem259
|
transmembrane protein 259 |
| chr15_-_100599864 | 0.27 |
ENSMUST00000177247.2
ENSMUST00000177505.2 |
Pou6f1
|
POU domain, class 6, transcription factor 1 |
| chr8_-_73353477 | 0.27 |
ENSMUST00000119826.1
|
Large
|
like-glycosyltransferase |
| chr10_-_78352212 | 0.27 |
ENSMUST00000146899.1
|
Agpat3
|
1-acylglycerol-3-phosphate O-acyltransferase 3 |
| chr12_+_109452833 | 0.27 |
ENSMUST00000056110.8
|
Dlk1
|
delta-like 1 homolog (Drosophila) |
| chr3_-_108402589 | 0.27 |
ENSMUST00000147565.1
|
Celsr2
|
cadherin, EGF LAG seven-pass G-type receptor 2 (flamingo homolog, Drosophila) |
| chr6_-_39557830 | 0.27 |
ENSMUST00000036877.3
ENSMUST00000154149.1 |
Dennd2a
|
DENN/MADD domain containing 2A |
| chr9_-_44799179 | 0.26 |
ENSMUST00000114705.1
ENSMUST00000002100.7 |
Tmem25
|
transmembrane protein 25 |
| chr3_-_108415552 | 0.26 |
ENSMUST00000090558.3
|
Celsr2
|
cadherin, EGF LAG seven-pass G-type receptor 2 (flamingo homolog, Drosophila) |
| chr7_+_29309429 | 0.26 |
ENSMUST00000137848.1
|
Dpf1
|
D4, zinc and double PHD fingers family 1 |
| chr15_-_89410230 | 0.26 |
ENSMUST00000109314.2
|
Syce3
|
synaptonemal complex central element protein 3 |
| chr8_-_68121527 | 0.26 |
ENSMUST00000178529.1
|
Gm21807
|
predicted gene, 21807 |
| chr11_-_61378052 | 0.26 |
ENSMUST00000010267.3
|
Slc47a1
|
solute carrier family 47, member 1 |
| chr2_-_178407583 | 0.26 |
ENSMUST00000081134.3
|
Sycp2
|
synaptonemal complex protein 2 |
| chr16_-_17144415 | 0.26 |
ENSMUST00000115709.1
|
Ccdc116
|
coiled-coil domain containing 116 |
| chr1_-_172219715 | 0.26 |
ENSMUST00000170700.1
ENSMUST00000003554.4 |
Casq1
|
calsequestrin 1 |
| chr1_-_71103146 | 0.26 |
ENSMUST00000027393.7
|
Bard1
|
BRCA1 associated RING domain 1 |
| chr2_-_181135220 | 0.26 |
ENSMUST00000016491.7
|
Kcnq2
|
potassium voltage-gated channel, subfamily Q, member 2 |
| chr18_+_65581704 | 0.26 |
ENSMUST00000182979.1
|
Zfp532
|
zinc finger protein 532 |
| chr4_+_124657646 | 0.25 |
ENSMUST00000053491.7
|
Pou3f1
|
POU domain, class 3, transcription factor 1 |
| chr2_-_104028287 | 0.25 |
ENSMUST00000056170.3
|
4931422A03Rik
|
RIKEN cDNA 4931422A03 gene |
| chr7_+_47050628 | 0.25 |
ENSMUST00000010451.5
|
Tmem86a
|
transmembrane protein 86A |
| chr17_-_80373541 | 0.25 |
ENSMUST00000086549.1
|
Gm10190
|
predicted gene 10190 |
| chr13_-_47043116 | 0.25 |
ENSMUST00000110118.1
ENSMUST00000124948.1 ENSMUST00000021806.3 ENSMUST00000136864.1 |
Tpmt
|
thiopurine methyltransferase |
| chr12_+_87026286 | 0.25 |
ENSMUST00000146292.1
|
Tmem63c
|
transmembrane protein 63c |
| chr7_-_97417730 | 0.25 |
ENSMUST00000043077.7
|
Thrsp
|
thyroid hormone responsive |
| chr7_+_5057161 | 0.24 |
ENSMUST00000045543.5
|
Ccdc106
|
coiled-coil domain containing 106 |
| chr11_+_32300069 | 0.24 |
ENSMUST00000020535.1
|
Hbq1a
|
hemoglobin, theta 1A |
| chr2_+_29619692 | 0.24 |
ENSMUST00000095087.4
ENSMUST00000091146.5 ENSMUST00000102872.4 |
Rapgef1
|
Rap guanine nucleotide exchange factor (GEF) 1 |
| chr5_-_125179155 | 0.24 |
ENSMUST00000111393.1
ENSMUST00000111394.1 ENSMUST00000111402.2 ENSMUST00000111398.1 |
Ncor2
|
nuclear receptor co-repressor 2 |
| chr17_-_34628380 | 0.24 |
ENSMUST00000167097.2
|
Ppt2
|
palmitoyl-protein thioesterase 2 |
| chr7_+_29307924 | 0.24 |
ENSMUST00000108230.1
ENSMUST00000065181.5 |
Dpf1
|
D4, zinc and double PHD fingers family 1 |
| chr11_-_75439489 | 0.24 |
ENSMUST00000043696.2
|
Serpinf2
|
serine (or cysteine) peptidase inhibitor, clade F, member 2 |
| chr8_+_105605220 | 0.24 |
ENSMUST00000043531.8
|
Fam65a
|
family with sequence similarity 65, member A |
| chr4_-_148159838 | 0.24 |
ENSMUST00000151127.1
ENSMUST00000105705.2 |
Fbxo44
|
F-box protein 44 |
| chr9_+_55326913 | 0.24 |
ENSMUST00000085754.3
ENSMUST00000034862.4 |
AI118078
|
expressed sequence AI118078 |
| chr7_-_126200413 | 0.24 |
ENSMUST00000163959.1
|
Xpo6
|
exportin 6 |
| chr1_+_91179822 | 0.24 |
ENSMUST00000097648.4
ENSMUST00000165855.1 |
Ramp1
|
receptor (calcitonin) activity modifying protein 1 |
| chr2_+_130274424 | 0.24 |
ENSMUST00000103198.4
|
Nop56
|
NOP56 ribonucleoprotein |
| chr11_+_77930800 | 0.24 |
ENSMUST00000093995.3
ENSMUST00000000646.7 |
Sez6
|
seizure related gene 6 |
| chr19_+_44992127 | 0.24 |
ENSMUST00000179305.1
|
Sema4g
|
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4G |
| chr4_+_149485260 | 0.23 |
ENSMUST00000030842.7
|
Lzic
|
leucine zipper and CTNNBIP1 domain containing |
| chr7_+_139085984 | 0.23 |
ENSMUST00000026551.8
|
Dpysl4
|
dihydropyrimidinase-like 4 |
| chr15_-_78773452 | 0.23 |
ENSMUST00000018313.5
|
Mfng
|
MFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
| chr10_+_4611971 | 0.23 |
ENSMUST00000105590.1
ENSMUST00000067086.7 |
Esr1
|
estrogen receptor 1 (alpha) |
| chr4_+_123116246 | 0.23 |
ENSMUST00000102648.4
|
Oxct2b
|
3-oxoacid CoA transferase 2B |
| chr16_-_55895279 | 0.23 |
ENSMUST00000099705.3
|
Nxpe3
|
neurexophilin and PC-esterase domain family, member 3 |
| chr5_-_125434048 | 0.23 |
ENSMUST00000169485.1
|
Dhx37
|
DEAH (Asp-Glu-Ala-His) box polypeptide 37 |
| chrX_+_99821021 | 0.23 |
ENSMUST00000096363.2
|
Tmem28
|
transmembrane protein 28 |
| chr6_-_88841935 | 0.23 |
ENSMUST00000032169.5
|
Abtb1
|
ankyrin repeat and BTB (POZ) domain containing 1 |
| chr19_+_60755947 | 0.23 |
ENSMUST00000088237.4
|
Nanos1
|
nanos homolog 1 (Drosophila) |
| chr19_+_6399857 | 0.23 |
ENSMUST00000146601.1
ENSMUST00000150713.1 |
Rasgrp2
|
RAS, guanyl releasing protein 2 |
| chr15_+_82274935 | 0.23 |
ENSMUST00000023095.6
|
Sept3
|
septin 3 |
| chr16_+_17646464 | 0.23 |
ENSMUST00000056962.4
|
Ccdc74a
|
coiled-coil domain containing 74A |
| chr2_-_102400863 | 0.23 |
ENSMUST00000102573.1
|
Trim44
|
tripartite motif-containing 44 |
| chr19_+_6241668 | 0.23 |
ENSMUST00000045351.6
|
Atg2a
|
autophagy related 2A |
| chr4_-_119658781 | 0.23 |
ENSMUST00000106309.2
ENSMUST00000044426.7 |
Guca2b
|
guanylate cyclase activator 2b (retina) |
| chr15_-_81960851 | 0.23 |
ENSMUST00000071462.6
ENSMUST00000023112.5 |
Pmm1
|
phosphomannomutase 1 |
| chr2_+_112239468 | 0.23 |
ENSMUST00000028554.3
|
Lpcat4
|
lysophosphatidylcholine acyltransferase 4 |
| chr8_+_4325205 | 0.23 |
ENSMUST00000069762.9
ENSMUST00000098949.4 ENSMUST00000127460.1 ENSMUST00000136191.1 |
Ccl25
Ccl25
|
chemokine (C-C motif) ligand 25 chemokine (C-C motif) ligand 25 |
| chr15_-_76477269 | 0.23 |
ENSMUST00000023217.9
|
Bop1
|
block of proliferation 1 |
| chr12_-_72085393 | 0.23 |
ENSMUST00000019862.2
|
L3hypdh
|
L-3-hydroxyproline dehydratase (trans-) |
| chr1_+_172312367 | 0.22 |
ENSMUST00000039506.9
|
Igsf8
|
immunoglobulin superfamily, member 8 |
| chr5_+_35041539 | 0.22 |
ENSMUST00000030985.6
|
Hgfac
|
hepatocyte growth factor activator |
| chr6_+_146796041 | 0.22 |
ENSMUST00000111639.1
|
Arntl2
|
aryl hydrocarbon receptor nuclear translocator-like 2 |
| chr2_+_163602331 | 0.22 |
ENSMUST00000152135.1
|
Ttpal
|
tocopherol (alpha) transfer protein-like |
| chr7_-_132776855 | 0.22 |
ENSMUST00000106168.1
|
Fam53b
|
family with sequence similarity 53, member B |
| chr11_-_100712429 | 0.22 |
ENSMUST00000006973.5
ENSMUST00000103118.3 |
Kat2a
|
K(lysine) acetyltransferase 2A |
| chr1_-_133424377 | 0.22 |
ENSMUST00000153799.1
|
Sox13
|
SRY-box containing gene 13 |
| chr7_+_28180272 | 0.22 |
ENSMUST00000173223.1
|
Dyrk1b
|
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1b |
| chr2_-_26208281 | 0.22 |
ENSMUST00000054099.9
|
Lhx3
|
LIM homeobox protein 3 |
| chr19_-_47050823 | 0.22 |
ENSMUST00000026032.5
|
Pcgf6
|
polycomb group ring finger 6 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.9 | GO:0090472 | dibasic protein processing(GO:0090472) |
| 0.2 | 0.2 | GO:0032902 | nerve growth factor production(GO:0032902) |
| 0.2 | 0.6 | GO:1904760 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 0.2 | 0.5 | GO:0000448 | cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
| 0.2 | 0.5 | GO:0070845 | misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.2 | 0.5 | GO:0010705 | meiotic DNA double-strand break processing involved in reciprocal meiotic recombination(GO:0010705) |
| 0.2 | 0.6 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.2 | 0.5 | GO:0021933 | radial glia guided migration of cerebellar granule cell(GO:0021933) |
| 0.1 | 0.4 | GO:0021636 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.1 | 0.6 | GO:1904616 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.1 | 0.4 | GO:0031591 | wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
| 0.1 | 0.4 | GO:2000616 | negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.1 | 0.8 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.1 | 0.5 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.1 | 0.5 | GO:0032053 | ciliary basal body organization(GO:0032053) |
| 0.1 | 0.8 | GO:1990416 | cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 0.1 | 0.3 | GO:1902277 | negative regulation of pancreatic amylase secretion(GO:1902277) |
| 0.1 | 0.6 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.1 | 0.5 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.1 | 0.3 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 0.1 | 0.3 | GO:0034959 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.1 | 0.5 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.1 | 0.8 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
| 0.1 | 0.5 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.1 | 0.5 | GO:0032298 | positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.1 | 0.6 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.1 | 0.7 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.1 | 0.4 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 | 0.5 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.1 | 1.0 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
| 0.1 | 0.3 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.1 | 0.3 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.1 | 0.3 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.1 | 0.3 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.1 | 0.3 | GO:0098971 | anterograde dendritic transport of neurotransmitter receptor complex(GO:0098971) |
| 0.1 | 1.0 | GO:0099628 | receptor diffusion trapping(GO:0098953) postsynaptic neurotransmitter receptor diffusion trapping(GO:0098970) neurotransmitter receptor diffusion trapping(GO:0099628) |
| 0.1 | 0.3 | GO:0003360 | brainstem development(GO:0003360) |
| 0.1 | 0.2 | GO:0000973 | posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.1 | 0.3 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.1 | 0.2 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.1 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) |
| 0.1 | 0.2 | GO:0071929 | alpha-tubulin acetylation(GO:0071929) |
| 0.1 | 0.3 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
| 0.1 | 0.3 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) gastric motility(GO:0035482) |
| 0.1 | 0.2 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.1 | 0.3 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.1 | 0.3 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.1 | 0.3 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.1 | 0.2 | GO:0035938 | estradiol secretion(GO:0035938) regulation of estradiol secretion(GO:2000864) |
| 0.1 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.1 | 0.3 | GO:1904717 | regulation of AMPA glutamate receptor clustering(GO:1904717) |
| 0.1 | 0.2 | GO:0042823 | pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.1 | 0.6 | GO:2000232 | regulation of rRNA processing(GO:2000232) |
| 0.1 | 0.1 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.1 | 0.4 | GO:0001757 | somite specification(GO:0001757) |
| 0.1 | 0.9 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.1 | 0.1 | GO:0042822 | pyridoxal phosphate metabolic process(GO:0042822) |
| 0.1 | 0.1 | GO:0034971 | histone H3-R17 methylation(GO:0034971) |
| 0.1 | 0.1 | GO:0031335 | regulation of sulfur amino acid metabolic process(GO:0031335) |
| 0.1 | 0.2 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.1 | 0.3 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.1 | 0.2 | GO:1904049 | negative regulation of spontaneous neurotransmitter secretion(GO:1904049) |
| 0.1 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.1 | 0.3 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.1 | 0.5 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
| 0.1 | 0.3 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
| 0.1 | 0.3 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.1 | 0.1 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.1 | 0.2 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 | 0.3 | GO:1904352 | positive regulation of protein catabolic process in the vacuole(GO:1904352) |
| 0.1 | 0.3 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.1 | 0.2 | GO:0001180 | transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
| 0.1 | 0.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 0.2 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.1 | 0.4 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.1 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.1 | 0.2 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.1 | 0.2 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.1 | 0.4 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.2 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.1 | 0.1 | GO:1901608 | regulation of vesicle transport along microtubule(GO:1901608) |
| 0.1 | 0.2 | GO:0060466 | activation of meiosis involved in egg activation(GO:0060466) |
| 0.1 | 0.5 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.2 | GO:0016332 | establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.1 | 0.2 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.1 | 0.2 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.1 | 0.3 | GO:1902412 | regulation of mitotic cytokinesis(GO:1902412) |
| 0.1 | 0.2 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.1 | 0.2 | GO:1900369 | negative regulation of RNA interference(GO:1900369) |
| 0.1 | 0.2 | GO:0021623 | oculomotor nerve morphogenesis(GO:0021622) oculomotor nerve formation(GO:0021623) |
| 0.1 | 0.3 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.1 | 0.3 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.1 | 0.2 | GO:0019740 | regulation of nitrogen utilization(GO:0006808) nitrogen utilization(GO:0019740) |
| 0.1 | 0.3 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.1 | 0.4 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
| 0.1 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.1 | 0.4 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 | 0.2 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.1 | 0.2 | GO:1901355 | response to rapamycin(GO:1901355) |
| 0.1 | 0.4 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.1 | 0.2 | GO:2000744 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.1 | 0.1 | GO:0033684 | regulation of luteinizing hormone secretion(GO:0033684) |
| 0.1 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.1 | 0.3 | GO:0090487 | toxin catabolic process(GO:0009407) secondary metabolite catabolic process(GO:0090487) |
| 0.1 | 0.2 | GO:0051325 | interphase(GO:0051325) mitotic interphase(GO:0051329) |
| 0.1 | 0.5 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 | 0.2 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 | 0.2 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.1 | 0.3 | GO:0046967 | cytosol to ER transport(GO:0046967) |
| 0.1 | 0.1 | GO:1904884 | telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 0.1 | 0.5 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 0.1 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.1 | 0.3 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.1 | GO:0019401 | glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
| 0.1 | 0.2 | GO:0010133 | proline catabolic process to glutamate(GO:0010133) |
| 0.0 | 0.6 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.1 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.0 | 0.2 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
| 0.0 | 0.1 | GO:1990773 | regulation of matrix metallopeptidase secretion(GO:1904464) matrix metallopeptidase secretion(GO:1990773) |
| 0.0 | 0.0 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.0 | 0.2 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
| 0.0 | 0.1 | GO:1901254 | regulation of translation at synapse, modulating synaptic transmission(GO:0099547) regulation of translation at postsynapse, modulating synaptic transmission(GO:0099578) positive regulation of intracellular transport of viral material(GO:1901254) |
| 0.0 | 0.5 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.0 | 1.1 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.0 | 0.0 | GO:1904412 | regulation of cardiac ventricle development(GO:1904412) |
| 0.0 | 0.2 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.2 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.0 | 0.2 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
| 0.0 | 0.4 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.0 | 0.1 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.0 | 0.3 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.0 | 0.3 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.0 | 0.1 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 | 0.6 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.0 | 0.4 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.0 | 0.5 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.0 | 0.1 | GO:0031554 | regulation of DNA-templated transcription, termination(GO:0031554) |
| 0.0 | 0.1 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.0 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.0 | 0.2 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
| 0.0 | 0.3 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.1 | GO:0072711 | cellular response to hydroxyurea(GO:0072711) |
| 0.0 | 0.3 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.0 | 0.2 | GO:0044805 | late nucleophagy(GO:0044805) |
| 0.0 | 0.2 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.0 | 0.2 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.5 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 | 0.3 | GO:0033239 | negative regulation of cellular amine metabolic process(GO:0033239) |
| 0.0 | 0.1 | GO:1904209 | regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
| 0.0 | 0.1 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.0 | 0.2 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.0 | 0.2 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.0 | 0.2 | GO:0050975 | sensory perception of touch(GO:0050975) |
| 0.0 | 0.1 | GO:0098968 | neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.0 | 0.1 | GO:0042264 | peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.0 | 0.3 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.0 | 0.1 | GO:0014735 | regulation of muscle atrophy(GO:0014735) |
| 0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.8 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.0 | 0.0 | GO:0072244 | metanephric glomerular epithelium development(GO:0072244) |
| 0.0 | 0.1 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.0 | 0.1 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.0 | 0.0 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
| 0.0 | 0.1 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.0 | 0.1 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 | 0.1 | GO:0015881 | creatine transport(GO:0015881) |
| 0.0 | 0.2 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.0 | 0.2 | GO:1903935 | response to sodium arsenite(GO:1903935) |
| 0.0 | 0.4 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.2 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.2 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.0 | 0.1 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
| 0.0 | 0.2 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.0 | 0.1 | GO:0098928 | presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
| 0.0 | 0.3 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
| 0.0 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.1 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
| 0.0 | 0.1 | GO:2000371 | regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.0 | 0.1 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.0 | 0.1 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.0 | 0.1 | GO:0002740 | negative regulation of cytokine secretion involved in immune response(GO:0002740) |
| 0.0 | 0.1 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.0 | 0.5 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 | 0.2 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.0 | 0.2 | GO:0099527 | postsynapse to nucleus signaling pathway(GO:0099527) |
| 0.0 | 0.1 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.0 | 0.2 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 0.1 | GO:0046021 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 0.0 | 0.1 | GO:0036363 | transforming growth factor beta activation(GO:0036363) |
| 0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 | 0.2 | GO:0015867 | ATP transport(GO:0015867) |
| 0.0 | 0.0 | GO:0003137 | Notch signaling pathway involved in heart induction(GO:0003137) regulation of Notch signaling pathway involved in heart induction(GO:0035480) positive regulation of Notch signaling pathway involved in heart induction(GO:0035481) |
| 0.0 | 0.3 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.3 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.0 | 0.0 | GO:0032240 | negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.0 | 0.1 | GO:0061228 | regulation of pronephros size(GO:0035565) mesonephros morphogenesis(GO:0061206) mesonephric nephron development(GO:0061215) mesonephric nephron morphogenesis(GO:0061228) mesenchymal stem cell maintenance involved in mesonephric nephron morphogenesis(GO:0061235) regulation of mesenchymal cell apoptotic process involved in mesonephric nephron morphogenesis(GO:0061295) negative regulation of mesenchymal cell apoptotic process involved in mesonephric nephron morphogenesis(GO:0061296) mesenchymal cell apoptotic process involved in mesonephric nephron morphogenesis(GO:1901146) |
| 0.0 | 0.0 | GO:0080144 | amino acid homeostasis(GO:0080144) |
| 0.0 | 0.2 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.0 | 0.1 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
| 0.0 | 0.2 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.0 | 0.1 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.1 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.0 | 0.0 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) |
| 0.0 | 0.3 | GO:0072615 | interleukin-17 secretion(GO:0072615) |
| 0.0 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.0 | 0.2 | GO:0015705 | iodide transport(GO:0015705) |
| 0.0 | 0.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.0 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.0 | 0.3 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.0 | 0.5 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.0 | 0.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.0 | 0.6 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 0.3 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
| 0.0 | 0.4 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.0 | 0.1 | GO:0006272 | leading strand elongation(GO:0006272) DNA replication proofreading(GO:0045004) |
| 0.0 | 0.3 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.2 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 | 0.1 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.0 | 0.2 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.0 | 0.2 | GO:0031120 | snRNA pseudouridine synthesis(GO:0031120) |
| 0.0 | 0.1 | GO:0090235 | regulation of metaphase plate congression(GO:0090235) |
| 0.0 | 0.1 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.0 | 0.1 | GO:0031161 | phosphatidylinositol catabolic process(GO:0031161) |
| 0.0 | 0.2 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.0 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.0 | 0.1 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.0 | 0.1 | GO:1904569 | regulation of selenocysteine incorporation(GO:1904569) |
| 0.0 | 0.1 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.0 | 0.5 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
| 0.0 | 0.4 | GO:0031571 | mitotic G1 DNA damage checkpoint(GO:0031571) |
| 0.0 | 0.1 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.0 | 0.1 | GO:0060220 | camera-type eye photoreceptor cell fate commitment(GO:0060220) |
| 0.0 | 0.1 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
| 0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.0 | 0.2 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
| 0.0 | 0.1 | GO:1902571 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
| 0.0 | 0.1 | GO:1904253 | positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
| 0.0 | 0.1 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.0 | 0.2 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.0 | 0.1 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.0 | 0.2 | GO:0002692 | negative regulation of cellular extravasation(GO:0002692) |
| 0.0 | 0.1 | GO:0060709 | glycogen cell differentiation involved in embryonic placenta development(GO:0060709) |
| 0.0 | 0.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.3 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.1 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.0 | 0.2 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.0 | 0.1 | GO:0009405 | pathogenesis(GO:0009405) |
| 0.0 | 0.1 | GO:0071042 | nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.0 | 0.0 | GO:1901950 | dense core granule localization(GO:0032253) dense core granule transport(GO:1901950) regulation of dense core granule transport(GO:1904809) positive regulation of dense core granule transport(GO:1904811) |
| 0.0 | 0.1 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.0 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.0 | 0.1 | GO:1900223 | positive regulation of beta-amyloid clearance(GO:1900223) |
| 0.0 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.0 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.0 | 0.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.0 | 0.0 | GO:1903943 | regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 0.0 | 0.3 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.3 | GO:1901250 | regulation of lung goblet cell differentiation(GO:1901249) negative regulation of lung goblet cell differentiation(GO:1901250) |
| 0.0 | 0.1 | GO:0045994 | regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.0 | 0.1 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
| 0.0 | 0.3 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.0 | 0.3 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.1 | GO:0015786 | UDP-glucose transport(GO:0015786) |
| 0.0 | 0.3 | GO:0032776 | DNA methylation on cytosine(GO:0032776) |
| 0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.0 | 0.1 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
| 0.0 | 0.5 | GO:0031498 | chromatin disassembly(GO:0031498) |
| 0.0 | 0.1 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 0.0 | 0.0 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
| 0.0 | 0.4 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.0 | 0.1 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.0 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.0 | 0.1 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.0 | 0.2 | GO:0048254 | snoRNA localization(GO:0048254) |
| 0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.0 | 0.3 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 | 0.7 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.0 | 0.1 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.0 | 0.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.3 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.0 | 0.2 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.0 | 0.1 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
| 0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.3 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
| 0.0 | 0.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.0 | 0.5 | GO:0007413 | axonal fasciculation(GO:0007413) |
| 0.0 | 0.1 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.0 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) selenocysteine metabolic process(GO:0016259) |
| 0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.0 | 0.1 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.0 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.0 | 0.1 | GO:0021691 | cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.0 | 0.2 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.0 | 0.2 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.0 | 0.1 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
| 0.0 | 0.1 | GO:1902044 | regulation of Fas signaling pathway(GO:1902044) negative regulation of Fas signaling pathway(GO:1902045) |
| 0.0 | 0.2 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.0 | 0.1 | GO:0097401 | synaptic vesicle lumen acidification(GO:0097401) |
| 0.0 | 0.2 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.0 | 0.3 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 | 0.2 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.0 | 0.0 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
| 0.0 | 0.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 | 0.9 | GO:0000305 | response to oxygen radical(GO:0000305) |
| 0.0 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.0 | 0.2 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.4 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.2 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.0 | 0.2 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 0.0 | 0.1 | GO:0042488 | positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) |
| 0.0 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.0 | 0.3 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.1 | GO:0002528 | regulation of vascular permeability involved in acute inflammatory response(GO:0002528) |
| 0.0 | 0.1 | GO:0021747 | cochlear nucleus development(GO:0021747) |
| 0.0 | 0.1 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.0 | 0.3 | GO:2001223 | negative regulation of neuron migration(GO:2001223) |
| 0.0 | 0.2 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.0 | 0.1 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.0 | 0.0 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
| 0.0 | 0.2 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.0 | 0.0 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.0 | 0.4 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.0 | 0.0 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.0 | 0.1 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 0.0 | 0.6 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.2 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.0 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.0 | 0.1 | GO:2000547 | regulation of dendritic cell dendrite assembly(GO:2000547) |
| 0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 0.1 | GO:2001189 | negative regulation of immunological synapse formation(GO:2000521) regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001188) negative regulation of T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:2001189) |
| 0.0 | 0.3 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.0 | 0.8 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
| 0.0 | 0.0 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
| 0.0 | 0.0 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.0 | 0.3 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.2 | GO:1904953 | Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904953) |
| 0.0 | 0.2 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.0 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 | 0.0 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.0 | 0.0 | GO:1904245 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 0.0 | 0.1 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 0.0 | 0.0 | GO:0017085 | response to insecticide(GO:0017085) |
| 0.0 | 0.2 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.0 | 0.1 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.0 | 0.2 | GO:0010744 | positive regulation of macrophage derived foam cell differentiation(GO:0010744) |
| 0.0 | 0.1 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.0 | 0.1 | GO:0009223 | pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.0 | 0.4 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
| 0.0 | 0.3 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.0 | 0.1 | GO:0044861 | protein transport into plasma membrane raft(GO:0044861) |
| 0.0 | 0.1 | GO:1904800 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) |
| 0.0 | 0.1 | GO:0046049 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.0 | 0.2 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.0 | 0.2 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
| 0.0 | 0.0 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
| 0.0 | 0.1 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
| 0.0 | 0.1 | GO:0042275 | error-free postreplication DNA repair(GO:0042275) |
| 0.0 | 0.1 | GO:0014874 | response to stimulus involved in regulation of muscle adaptation(GO:0014874) |
| 0.0 | 0.2 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.0 | 0.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 | 0.1 | GO:0007521 | muscle cell fate determination(GO:0007521) |
| 0.0 | 0.1 | GO:0060854 | patterning of lymph vessels(GO:0060854) |
| 0.0 | 0.1 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.0 | 0.1 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.0 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.0 | 0.2 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.0 | 0.5 | GO:0046852 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.0 | 0.2 | GO:0010766 | negative regulation of sodium ion transport(GO:0010766) |
| 0.0 | 0.6 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.1 | GO:0000915 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.0 | 0.1 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
| 0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.1 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
| 0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.1 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.0 | 0.1 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.0 | 0.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.0 | 0.1 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.1 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
| 0.0 | 0.1 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.0 | 0.0 | GO:0060382 | regulation of DNA strand elongation(GO:0060382) |
| 0.0 | 0.0 | GO:0003275 | apoptotic process involved in outflow tract morphogenesis(GO:0003275) regulation of apoptotic process involved in outflow tract morphogenesis(GO:1902256) |
| 0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.0 | 0.0 | GO:2000328 | regulation of T-helper 17 cell lineage commitment(GO:2000328) |
| 0.0 | 0.3 | GO:0051444 | negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.0 | 0.1 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.0 | 0.3 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.0 | 0.1 | GO:1900039 | positive regulation of cellular response to hypoxia(GO:1900039) |
| 0.0 | 0.1 | GO:0061056 | sclerotome development(GO:0061056) |
| 0.0 | 0.1 | GO:0035376 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.0 | 0.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.0 | 0.1 | GO:0042748 | circadian sleep/wake cycle, non-REM sleep(GO:0042748) |
| 0.0 | 0.2 | GO:0042637 | catagen(GO:0042637) |
| 0.0 | 0.1 | GO:0032026 | response to magnesium ion(GO:0032026) |
| 0.0 | 0.3 | GO:0015695 | organic cation transport(GO:0015695) |
| 0.0 | 0.0 | GO:0052572 | response to immune response of other organism involved in symbiotic interaction(GO:0052564) response to host immune response(GO:0052572) |
| 0.0 | 0.1 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
| 0.0 | 0.1 | GO:1904779 | regulation of protein localization to centrosome(GO:1904779) positive regulation of protein localization to centrosome(GO:1904781) |
| 0.0 | 0.1 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 0.0 | 0.2 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.0 | 0.0 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) neutrophil mediated killing of fungus(GO:0070947) |
| 0.0 | 0.1 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.0 | 0.0 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.0 | 0.1 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.0 | 0.1 | GO:0009644 | response to high light intensity(GO:0009644) |
| 0.0 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 | 0.1 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.0 | 0.1 | GO:0019323 | pentose catabolic process(GO:0019323) |
| 0.0 | 0.1 | GO:0002276 | basophil activation involved in immune response(GO:0002276) basophil activation(GO:0045575) |
| 0.0 | 0.1 | GO:0002842 | positive regulation of T cell mediated immune response to tumor cell(GO:0002842) |
| 0.0 | 0.5 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.1 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 | 0.1 | GO:0003373 | dynamin polymerization involved in membrane fission(GO:0003373) dynamin polymerization involved in mitochondrial fission(GO:0003374) |
| 0.0 | 0.1 | GO:0016340 | calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.0 | 0.4 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.0 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.0 | 0.1 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.0 | 0.2 | GO:1904259 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.0 | 0.1 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.0 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.0 | 0.0 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
| 0.0 | 0.3 | GO:0042255 | ribosome assembly(GO:0042255) |
| 0.0 | 0.1 | GO:0097534 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
| 0.0 | 0.1 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.0 | 0.1 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.0 | 0.1 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.0 | 0.1 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.0 | 0.2 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
| 0.0 | 0.1 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.0 | 0.1 | GO:0060715 | syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.0 | 0.1 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
| 0.0 | 0.2 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
| 0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.7 | GO:1902808 | positive regulation of cell cycle G1/S phase transition(GO:1902808) |
| 0.0 | 0.0 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
| 0.0 | 0.2 | GO:0071025 | RNA surveillance(GO:0071025) |
| 0.0 | 0.1 | GO:1903027 | regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
| 0.0 | 0.1 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.0 | 0.0 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.1 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.0 | 0.2 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.0 | 0.0 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
| 0.0 | 0.0 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.0 | 0.3 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.0 | 0.1 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.0 | 0.1 | GO:0021603 | cranial nerve formation(GO:0021603) |
| 0.0 | 0.6 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 | 0.1 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.0 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.0 | 0.1 | GO:0019389 | glucuronoside metabolic process(GO:0019389) |
| 0.0 | 0.0 | GO:0031662 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
| 0.0 | 0.1 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
| 0.0 | 0.1 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.1 | GO:1905053 | regulation of base-excision repair(GO:1905051) positive regulation of base-excision repair(GO:1905053) |
| 0.0 | 0.1 | GO:0015862 | uridine transport(GO:0015862) |
| 0.0 | 0.1 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.0 | 0.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.0 | 0.2 | GO:0046958 | nonassociative learning(GO:0046958) |
| 0.0 | 0.0 | GO:1904305 | negative regulation of gastro-intestinal system smooth muscle contraction(GO:1904305) negative regulation of small intestine smooth muscle contraction(GO:1904348) |
| 0.0 | 0.0 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 | 0.8 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.1 | GO:0090345 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) cellular organohalogen metabolic process(GO:0090345) cellular organofluorine metabolic process(GO:0090346) |
| 0.0 | 0.0 | GO:0030450 | regulation of complement activation, classical pathway(GO:0030450) |
| 0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.0 | 0.0 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.0 | 0.0 | GO:0002946 | tRNA C5-cytosine methylation(GO:0002946) |
| 0.0 | 0.2 | GO:1904292 | regulation of ERAD pathway(GO:1904292) |
| 0.0 | 0.1 | GO:0070162 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.0 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.0 | 0.1 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.0 | 0.0 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) |
| 0.0 | 0.0 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.3 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
| 0.0 | 0.0 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.0 | 0.0 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.0 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.0 | 0.1 | GO:0061072 | iris morphogenesis(GO:0061072) |
| 0.0 | 0.0 | GO:0071317 | cellular response to isoquinoline alkaloid(GO:0071317) |
| 0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.0 | 0.2 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.0 | 0.1 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.0 | 0.0 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.0 | 0.0 | GO:0002681 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
| 0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 | 0.3 | GO:1904353 | regulation of telomere capping(GO:1904353) |
| 0.0 | 0.1 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.0 | 0.1 | GO:0034627 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.0 | 0.0 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.0 | 0.0 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.0 | 0.2 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.0 | 0.1 | GO:0018201 | peptidyl-glycine modification(GO:0018201) |
| 0.0 | 0.0 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.0 | 0.1 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 0.0 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.0 | 0.0 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.0 | 0.1 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
| 0.0 | 0.0 | GO:0090034 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.0 | 0.0 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 0.0 | 0.0 | GO:0035709 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.0 | 0.7 | GO:0051646 | mitochondrion localization(GO:0051646) |
| 0.0 | 0.0 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.0 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
| 0.0 | 0.1 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.0 | 0.2 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 | 0.0 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
| 0.0 | 0.0 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.2 | GO:0080111 | DNA demethylation(GO:0080111) |
| 0.0 | 0.2 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.0 | 0.0 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.0 | 0.2 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.0 | 0.0 | GO:0060821 | inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.0 | 0.0 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.0 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 0.0 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
| 0.0 | 0.1 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.0 | GO:0017055 | negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) |
| 0.0 | 0.0 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.0 | 0.0 | GO:1901663 | quinone biosynthetic process(GO:1901663) |
| 0.0 | 0.0 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.0 | 0.1 | GO:0007207 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.0 | 0.0 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.0 | 0.0 | GO:0043181 | vacuolar sequestering(GO:0043181) |
| 0.0 | 0.1 | GO:0032901 | positive regulation of neurotrophin production(GO:0032901) |
| 0.0 | 0.5 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.0 | 0.0 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.7 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.0 | 0.3 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 | 0.1 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.0 | GO:2000584 | regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
| 0.0 | 0.1 | GO:0010642 | negative regulation of platelet-derived growth factor receptor signaling pathway(GO:0010642) |
| 0.0 | 0.1 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
| 0.0 | 0.0 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
| 0.0 | 0.0 | GO:0060857 | establishment of glial blood-brain barrier(GO:0060857) |
| 0.0 | 0.0 | GO:0032242 | regulation of nucleoside transport(GO:0032242) |
| 0.0 | 0.0 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.0 | 0.1 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.0 | 0.0 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.0 | 0.1 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.0 | GO:1904179 | positive regulation of adipose tissue development(GO:1904179) |
| 0.0 | 0.0 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
| 0.0 | 0.1 | GO:1901409 | positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.0 | 0.1 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.0 | 0.1 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
| 0.0 | 0.1 | GO:0032811 | negative regulation of epinephrine secretion(GO:0032811) |
| 0.0 | 0.3 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.0 | 0.0 | GO:0006154 | adenosine catabolic process(GO:0006154) |
| 0.0 | 0.1 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 | 0.2 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.1 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
| 0.0 | 0.1 | GO:0008215 | spermine metabolic process(GO:0008215) |
| 0.0 | 0.0 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.3 | GO:0031577 | spindle checkpoint(GO:0031577) |
| 0.0 | 0.1 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.0 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.0 | 0.0 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.0 | 0.0 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
| 0.0 | 0.1 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.0 | 0.3 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.0 | 0.1 | GO:0099612 | protein localization to axon(GO:0099612) |
| 0.0 | 0.1 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.0 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) sensory perception of umami taste(GO:0050917) |
| 0.0 | 0.1 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.0 | 0.0 | GO:0051542 | elastin biosynthetic process(GO:0051542) |
| 0.0 | 0.0 | GO:0030202 | heparin metabolic process(GO:0030202) |
| 0.0 | 0.0 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
| 0.0 | 0.0 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
| 0.0 | 0.0 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 0.0 | 0.3 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.0 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 | 0.8 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.1 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
| 0.0 | 0.0 | GO:0051177 | meiotic sister chromatid cohesion(GO:0051177) |
| 0.0 | 0.0 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
| 0.0 | 0.5 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 0.1 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.0 | 0.0 | GO:1903756 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.0 | 0.1 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
| 0.0 | 0.1 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.5 | GO:0007520 | myoblast fusion(GO:0007520) |
| 0.0 | 0.2 | GO:0051567 | histone H3-K9 methylation(GO:0051567) |
| 0.0 | 0.0 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
| 0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.1 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 | 0.3 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.0 | 0.2 | GO:0006884 | cell volume homeostasis(GO:0006884) |
| 0.0 | 0.0 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
| 0.0 | 0.1 | GO:0061718 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
| 0.0 | 0.0 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.0 | 0.1 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.2 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.0 | 0.1 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.0 | 0.0 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.0 | 0.0 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.0 | 0.0 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.0 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.0 | 0.0 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.0 | 0.0 | GO:0060010 | Sertoli cell fate commitment(GO:0060010) |
| 0.0 | 0.1 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
| 0.0 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.0 | 0.0 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
| 0.0 | 0.0 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.0 | 0.2 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.2 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.3 | GO:0098534 | centriole assembly(GO:0098534) |
| 0.0 | 0.0 | GO:0051138 | positive regulation of NK T cell differentiation(GO:0051138) |
| 0.0 | 0.1 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.0 | 0.1 | GO:1901898 | negative regulation of relaxation of muscle(GO:1901078) negative regulation of relaxation of cardiac muscle(GO:1901898) |
| 0.0 | 0.0 | GO:0098501 | polynucleotide dephosphorylation(GO:0098501) |
| 0.0 | 0.1 | GO:2000726 | negative regulation of cardiac muscle cell differentiation(GO:2000726) |
| 0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.0 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.0 | 0.0 | GO:0031627 | telomeric loop formation(GO:0031627) |
| 0.0 | 0.1 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.1 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.0 | 0.0 | GO:0010988 | regulation of low-density lipoprotein particle clearance(GO:0010988) |
| 0.0 | 0.2 | GO:0034508 | centromere complex assembly(GO:0034508) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.8 | GO:0099569 | presynaptic cytoskeleton(GO:0099569) |
| 0.2 | 0.9 | GO:0071547 | piP-body(GO:0071547) |
| 0.2 | 0.7 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 0.1 | GO:1902737 | dendritic filopodium(GO:1902737) |
| 0.1 | 0.4 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.1 | 0.6 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.1 | 0.5 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 0.3 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.1 | 0.3 | GO:0000811 | GINS complex(GO:0000811) |
| 0.1 | 0.4 | GO:0099524 | region of cytosol(GO:0099522) postsynaptic cytosol(GO:0099524) |
| 0.1 | 0.6 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.1 | 0.7 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.1 | 0.3 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 0.1 | 0.5 | GO:0044094 | host cell nucleus(GO:0042025) host cell nuclear part(GO:0044094) |
| 0.1 | 0.5 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.1 | 0.3 | GO:1990032 | parallel fiber(GO:1990032) |
| 0.1 | 0.2 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.1 | 0.1 | GO:0044317 | rod spherule(GO:0044317) |
| 0.1 | 0.2 | GO:0098831 | presynaptic active zone cytoplasmic component(GO:0098831) |
| 0.1 | 0.6 | GO:0000801 | central element(GO:0000801) |
| 0.1 | 0.3 | GO:0044307 | dendritic branch(GO:0044307) |
| 0.1 | 0.4 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.1 | 1.3 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 0.3 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.1 | 0.2 | GO:0031251 | PAN complex(GO:0031251) |
| 0.1 | 0.9 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.1 | 0.3 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 0.1 | GO:0097226 | sperm mitochondrial sheath(GO:0097226) |
| 0.1 | 0.3 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
| 0.1 | 0.2 | GO:0071920 | cleavage body(GO:0071920) |
| 0.1 | 0.1 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.1 | 0.1 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
| 0.1 | 1.0 | GO:0031045 | dense core granule(GO:0031045) |
| 0.1 | 0.2 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 0.4 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.7 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.1 | 0.2 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.0 | 0.2 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 0.1 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
| 0.0 | 0.2 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.0 | 0.2 | GO:0005606 | laminin-1 complex(GO:0005606) |
| 0.0 | 0.2 | GO:0000235 | astral microtubule(GO:0000235) |
| 0.0 | 0.2 | GO:0090537 | CERF complex(GO:0090537) |
| 0.0 | 0.3 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.0 | 0.4 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.3 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.0 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.3 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.0 | 0.9 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.3 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.0 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 1.7 | GO:0044298 | cell body membrane(GO:0044298) |
| 0.0 | 0.7 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 0.3 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 0.2 | GO:1990429 | Pex17p-Pex14p docking complex(GO:1990415) peroxisomal importomer complex(GO:1990429) |
| 0.0 | 0.7 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
| 0.0 | 0.2 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.1 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.0 | 0.3 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.0 | 0.8 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 0.4 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.0 | 0.2 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.4 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 0.4 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.0 | 0.1 | GO:0000802 | transverse filament(GO:0000802) |
| 0.0 | 0.1 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 0.3 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 0.9 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.0 | 0.2 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.0 | 0.5 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 1.2 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.0 | 0.4 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.0 | 0.3 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.2 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.2 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
| 0.0 | 0.3 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.0 | 0.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.0 | 0.1 | GO:0098835 | presynaptic endocytic zone(GO:0098833) presynaptic endocytic zone membrane(GO:0098835) |
| 0.0 | 0.7 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.2 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.0 | 0.2 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.0 | 0.1 | GO:0035101 | FACT complex(GO:0035101) |
| 0.0 | 0.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.0 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
| 0.0 | 0.5 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.0 | 0.1 | GO:0098842 | postsynaptic early endosome(GO:0098842) |
| 0.0 | 0.3 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.3 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.1 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 0.0 | 0.2 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.2 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.0 | 0.3 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.0 | 0.1 | GO:0042642 | actomyosin, myosin complex part(GO:0042642) |
| 0.0 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
| 0.0 | 0.4 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.0 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.6 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.0 | 0.3 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
| 0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.2 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.3 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.0 | 0.1 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.0 | 0.1 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.0 | 0.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.0 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.0 | 0.8 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.0 | 0.3 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 1.1 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.3 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.3 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.0 | 0.2 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.1 | GO:0097450 | astrocyte end-foot(GO:0097450) |
| 0.0 | 0.6 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.0 | 2.9 | GO:0022626 | cytosolic ribosome(GO:0022626) |
| 0.0 | 0.2 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.0 | 0.5 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.1 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.2 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.0 | 0.1 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.0 | 0.3 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 0.0 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.0 | 0.1 | GO:0036019 | endolysosome(GO:0036019) |
| 0.0 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.3 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.4 | GO:0032590 | dendrite membrane(GO:0032590) |
| 0.0 | 0.2 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 0.1 | GO:1990037 | Lewy body core(GO:1990037) |
| 0.0 | 0.0 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.0 | 0.4 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.3 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 0.2 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 1.8 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.1 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
| 0.0 | 0.2 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.1 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.0 | 0.4 | GO:0001741 | XY body(GO:0001741) |
| 0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.1 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.1 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.0 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.0 | 0.7 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.2 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.0 | 0.2 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.0 | GO:0070442 | integrin alphaIIb-beta3 complex(GO:0070442) |
| 0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.1 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.0 | 0.7 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 0.1 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.0 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 0.4 | GO:1990752 | microtubule end(GO:1990752) |
| 0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.2 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.2 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.0 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
| 0.0 | 0.2 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.1 | GO:0042827 | platelet dense granule(GO:0042827) |
| 0.0 | 0.1 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.0 | GO:0031310 | integral component of vacuolar membrane(GO:0031166) intrinsic component of vacuolar membrane(GO:0031310) |
| 0.0 | 0.0 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.0 | 0.2 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.1 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.0 | GO:0070985 | TFIIK complex(GO:0070985) |
| 0.0 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.0 | 0.1 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 0.1 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.0 | 0.1 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.0 | 0.0 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.1 | GO:0042825 | TAP complex(GO:0042825) |
| 0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.0 | 0.0 | GO:0032021 | NELF complex(GO:0032021) |
| 0.0 | 0.0 | GO:0005818 | aster(GO:0005818) |
| 0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.1 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 0.0 | 0.1 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.3 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.0 | GO:0098888 | extrinsic component of presynaptic membrane(GO:0098888) |
| 0.0 | 0.3 | GO:0000800 | lateral element(GO:0000800) |
| 0.0 | 0.1 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 0.1 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.0 | 0.3 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.0 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.0 | 0.3 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.1 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.0 | 0.3 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.0 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.0 | 0.0 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.0 | 0.2 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 0.0 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.0 | 0.2 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.5 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.1 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.0 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.9 | GO:0005811 | lipid particle(GO:0005811) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.6 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 0.5 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.1 | 0.4 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.1 | 1.1 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.1 | 0.3 | GO:0050610 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 0.1 | 0.4 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.4 | GO:0055105 | ubiquitin-protein transferase inhibitor activity(GO:0055105) |
| 0.1 | 0.4 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
| 0.1 | 0.8 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.1 | 0.3 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.1 | 0.3 | GO:0043404 | corticotrophin-releasing factor receptor activity(GO:0015056) corticotropin-releasing hormone receptor activity(GO:0043404) |
| 0.1 | 0.7 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.1 | 0.3 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.1 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.1 | 0.3 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.1 | 0.3 | GO:0033680 | ATP-dependent DNA/RNA helicase activity(GO:0033680) |
| 0.1 | 0.3 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.1 | 0.3 | GO:0038052 | RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
| 0.1 | 0.5 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 0.3 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
| 0.1 | 0.1 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.1 | 0.3 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.1 | 0.4 | GO:0008761 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) |
| 0.1 | 0.2 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.1 | 0.2 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.1 | 0.6 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.2 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.1 | 0.4 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
| 0.1 | 0.2 | GO:0001147 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 0.1 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 0.2 | GO:0070546 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.1 | 0.2 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.1 | 1.1 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.1 | 0.2 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.1 | 0.4 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.1 | 0.3 | GO:0050347 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
| 0.1 | 0.2 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.1 | 0.2 | GO:0031403 | lithium ion binding(GO:0031403) |
| 0.1 | 0.3 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.1 | 0.3 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.1 | 0.1 | GO:0030977 | taurine binding(GO:0030977) |
| 0.1 | 0.5 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
| 0.1 | 0.3 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.1 | 0.3 | GO:0086077 | gap junction channel activity involved in AV node cell-bundle of His cell electrical coupling(GO:0086077) |
| 0.1 | 0.6 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 0.2 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.1 | 0.2 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.1 | 0.4 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 0.3 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
| 0.1 | 0.4 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.3 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.1 | 0.2 | GO:0001003 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
| 0.1 | 0.5 | GO:0031812 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
| 0.1 | 0.5 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.1 | 0.5 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 0.3 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.5 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.1 | 0.2 | GO:1990955 | G-rich single-stranded DNA binding(GO:1990955) |
| 0.1 | 0.3 | GO:0061656 | SUMO conjugating enzyme activity(GO:0061656) |
| 0.1 | 0.4 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.1 | 0.4 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.1 | 0.3 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.1 | 0.3 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 0.2 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
| 0.1 | 0.3 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.1 | 0.4 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
| 0.1 | 0.3 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 0.1 | 0.1 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.1 | 1.2 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.3 | GO:0046980 | peptide antigen-transporting ATPase activity(GO:0015433) tapasin binding(GO:0046980) |
| 0.1 | 0.4 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 0.2 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
| 0.1 | 0.2 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
| 0.1 | 0.6 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.1 | 0.3 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.1 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.1 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.1 | 0.3 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 0.3 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 0.1 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.0 | 1.0 | GO:0016411 | acylglycerol O-acyltransferase activity(GO:0016411) |
| 0.0 | 0.2 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.0 | 0.0 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.0 | 0.6 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.2 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.0 | 0.2 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.0 | 0.4 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.0 | 0.3 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.0 | 0.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.1 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.0 | 0.3 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.0 | 0.4 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.0 | 0.3 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.0 | 0.4 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
| 0.0 | 0.1 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 0.0 | 0.2 | GO:1990269 | RNA polymerase II C-terminal domain phosphoserine binding(GO:1990269) |
| 0.0 | 0.1 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
| 0.0 | 0.0 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.0 | 0.8 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.2 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.0 | 0.2 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.0 | 1.1 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.3 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.0 | 0.2 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.0 | 0.3 | GO:1904315 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
| 0.0 | 0.1 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
| 0.0 | 0.2 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.0 | 0.1 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.0 | 0.2 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.1 | GO:0035605 | peptidyl-cysteine S-nitrosylase activity(GO:0035605) |
| 0.0 | 0.1 | GO:0005308 | creatine transmembrane transporter activity(GO:0005308) |
| 0.0 | 0.5 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.0 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.0 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.0 | 0.0 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.7 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.0 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 0.4 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 0.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 0.0 | GO:0001034 | RNA polymerase III transcription factor activity, sequence-specific DNA binding(GO:0001034) |
| 0.0 | 0.1 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.0 | 0.4 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.0 | 0.3 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.0 | 0.3 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.0 | 0.2 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.0 | 0.2 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.0 | 0.6 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.2 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.0 | 0.2 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.1 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
| 0.0 | 0.1 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.0 | 0.1 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.0 | 1.1 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 0.3 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.0 | 0.1 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.0 | 0.1 | GO:0001156 | TFIIIC-class transcription factor binding(GO:0001156) |
| 0.0 | 0.8 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 1.1 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 0.4 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.2 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 0.0 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
| 0.0 | 0.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.1 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.0 | 0.1 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.0 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.0 | 0.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.0 | 0.2 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.0 | 0.1 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.0 | 0.1 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) |
| 0.0 | 0.1 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.0 | 0.7 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.1 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 0.0 | 1.0 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.3 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.3 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
| 0.0 | 0.4 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.1 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
| 0.0 | 0.2 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.2 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.0 | 0.1 | GO:0042328 | heparan sulfate N-acetylglucosaminyltransferase activity(GO:0042328) |
| 0.0 | 0.6 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.0 | 0.1 | GO:0005333 | norepinephrine transmembrane transporter activity(GO:0005333) |
| 0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 0.1 | GO:0036478 | tyrosine 3-monooxygenase activator activity(GO:0036470) L-dopa decarboxylase activator activity(GO:0036478) |
| 0.0 | 0.1 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) apolipoprotein A-I receptor activity(GO:0034188) phosphatidylserine-translocating ATPase activity(GO:0090556) |
| 0.0 | 0.1 | GO:0032142 | single guanine insertion binding(GO:0032142) |
| 0.0 | 0.1 | GO:0070736 | protein-glycine ligase activity, initiating(GO:0070736) |
| 0.0 | 0.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
| 0.0 | 0.3 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.4 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.4 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.0 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.0 | 0.1 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.0 | 1.2 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 0.2 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.0 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
| 0.0 | 0.2 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.0 | 0.1 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.0 | 0.0 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.0 | 0.2 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.0 | 0.1 | GO:0005302 | hydrogen:amino acid symporter activity(GO:0005280) L-tyrosine transmembrane transporter activity(GO:0005302) |
| 0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 0.3 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.0 | 0.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.5 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.1 | GO:0016880 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.0 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.0 | 1.0 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.0 | 0.4 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.0 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.0 | 0.1 | GO:0001042 | RNA polymerase I core binding(GO:0001042) |
| 0.0 | 0.1 | GO:0008802 | betaine-aldehyde dehydrogenase activity(GO:0008802) |
| 0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.0 | 0.1 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.2 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
| 0.0 | 0.2 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.8 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) L-threonine ammonia-lyase activity(GO:0004794) |
| 0.0 | 0.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.3 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.1 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
| 0.0 | 0.5 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.1 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.0 | 1.1 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.0 | 0.1 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
| 0.0 | 0.1 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
| 0.0 | 0.2 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.2 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.9 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.0 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.0 | 0.0 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
| 0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.1 | GO:0019150 | D-ribulokinase activity(GO:0019150) |
| 0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 0.3 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
| 0.0 | 0.2 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.0 | 0.3 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.4 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.3 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.2 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.0 | 0.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.1 | GO:0070540 | stearic acid binding(GO:0070540) |
| 0.0 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 0.2 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.0 | GO:0016434 | rRNA (cytosine) methyltransferase activity(GO:0016434) |
| 0.0 | 0.2 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.0 | 0.1 | GO:0070404 | NADH binding(GO:0070404) |
| 0.0 | 0.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.2 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.1 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.2 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
| 0.0 | 0.1 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 0.1 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.0 | 0.1 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.0 | 0.0 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
| 0.0 | 0.1 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.0 | 0.3 | GO:0015605 | organophosphate ester transmembrane transporter activity(GO:0015605) |
| 0.0 | 0.1 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
| 0.0 | 0.1 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.0 | 0.2 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.0 | 0.1 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.0 | 0.2 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.2 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.0 | 0.9 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.3 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) |
| 0.0 | 0.1 | GO:0046997 | sarcosine dehydrogenase activity(GO:0008480) oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
| 0.0 | 0.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.0 | 0.1 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
| 0.0 | 0.6 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 0.1 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
| 0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.1 | GO:0004952 | dopamine neurotransmitter receptor activity(GO:0004952) |
| 0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.0 | 1.2 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.0 | 0.1 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.0 | 0.1 | GO:0022851 | GABA-gated chloride ion channel activity(GO:0022851) |
| 0.0 | 0.1 | GO:0032450 | maltose alpha-glucosidase activity(GO:0032450) |
| 0.0 | 0.6 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.0 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.0 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.0 | 0.1 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.0 | 0.1 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.1 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 0.9 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.0 | 0.1 | GO:0097617 | annealing helicase activity(GO:0036310) annealing activity(GO:0097617) |
| 0.0 | 0.2 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 0.8 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.0 | 0.0 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.1 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.1 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.0 | 0.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.3 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.1 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
| 0.0 | 0.1 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) inositol trisphosphate phosphatase activity(GO:0046030) |
| 0.0 | 0.2 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.3 | GO:0031005 | filamin binding(GO:0031005) |
| 0.0 | 0.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.0 | 0.0 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.0 | 1.2 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.3 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.0 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.0 | 0.1 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.4 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.3 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.0 | 0.1 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.0 | 0.0 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
| 0.0 | 0.0 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.0 | 0.0 | GO:0002153 | steroid receptor RNA activator RNA binding(GO:0002153) |
| 0.0 | 0.7 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
| 0.0 | 0.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.0 | GO:0052594 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
| 0.0 | 0.0 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.0 | 2.3 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.0 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.0 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.0 | 0.0 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
| 0.0 | 0.1 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) G-protein coupled neurotransmitter receptor activity(GO:0099528) |
| 0.0 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.0 | 0.2 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.0 | 0.0 | GO:0051747 | cytosine C-5 DNA demethylase activity(GO:0051747) |
| 0.0 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.0 | 0.1 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.1 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
| 0.0 | 0.0 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
| 0.0 | 0.1 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
| 0.0 | 0.1 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.0 | 0.1 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 1.5 | GO:0004386 | helicase activity(GO:0004386) |
| 0.0 | 0.2 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.1 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.0 | 0.0 | GO:0086038 | calcium:sodium antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086038) |
| 0.0 | 0.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.1 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.0 | 0.3 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.0 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.0 | 0.3 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.1 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
| 0.0 | 0.2 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.3 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.0 | 0.5 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.4 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.0 | GO:0052901 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
| 0.0 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.0 | 0.1 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.0 | 0.3 | GO:0071949 | FAD binding(GO:0071949) |
| 0.0 | 0.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.0 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
| 0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.0 | GO:0043734 | DNA demethylase activity(GO:0035514) DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
| 0.0 | 0.0 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.0 | 0.0 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 0.1 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.0 | 0.0 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.0 | 0.1 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.1 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.0 | GO:0034437 | glycoprotein transporter activity(GO:0034437) |
| 0.0 | 0.2 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.0 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.0 | 0.0 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.0 | 0.1 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 0.3 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.0 | 0.1 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 0.0 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
| 0.0 | 0.2 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.2 | GO:0015932 | nucleobase-containing compound transmembrane transporter activity(GO:0015932) |
| 0.0 | 0.0 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.0 | 0.0 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 0.4 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 3.5 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.0 | 0.0 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 1.0 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.4 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.0 | 0.4 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.4 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 0.3 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 1.7 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 1.0 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.6 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.4 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.6 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 1.3 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.2 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.0 | 0.0 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.8 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.9 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.5 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 0.5 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.1 | PID EPO PATHWAY | EPO signaling pathway |
| 0.0 | 0.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.7 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.6 | PID AURORA B PATHWAY | Aurora B signaling |
| 0.0 | 0.3 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.9 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.0 | 0.9 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 0.7 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 0.4 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.2 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.0 | 0.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.0 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.3 | PID ATR PATHWAY | ATR signaling pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.6 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.1 | 0.1 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.1 | 0.1 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
| 0.1 | 0.4 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.1 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 0.6 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.1 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.1 | 1.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 1.2 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 0.9 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 1.1 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 1.1 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.0 | 0.4 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 1.8 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.1 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
| 0.0 | 1.2 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.0 | 0.8 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.0 | 0.5 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.4 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.0 | 0.5 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.6 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.0 | 0.4 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.1 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.0 | 0.4 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.6 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 1.1 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.0 | 0.5 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 0.4 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.5 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.3 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 0.5 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.5 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.0 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.0 | 0.5 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.0 | 0.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 0.1 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.0 | 0.6 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.5 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.1 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 0.3 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 0.5 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 0.2 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.0 | 2.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.3 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.5 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.0 | 0.1 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
| 0.0 | 0.3 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 0.0 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 0.3 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.0 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.7 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.5 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.0 | 0.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.4 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.4 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.6 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.1 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.1 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.0 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.0 | 0.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 1.3 | REACTOME SIGNALING BY NOTCH | Genes involved in Signaling by NOTCH |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 0.3 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.0 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.0 | 0.2 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.0 | 0.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.0 | 0.2 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.0 | 0.3 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.7 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.1 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.0 | 0.3 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
| 0.0 | 0.0 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.0 | 0.3 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.3 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.3 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.3 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.5 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.6 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.2 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.0 | 0.1 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.0 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 0.2 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |