GSE53960: rat RNA-Seq transcriptomic Bodymap
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Zfx
|
ENSRNOG00000005624 | zinc finger protein X-linked |
|
Zfp711
|
ENSRNOG00000022391 | zinc finger protein 711 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Zfx | rn6_v1_chrX_-_63165759_63165759 | 0.27 | 7.1e-07 | Click! |
| Zfp711 | rn6_v1_chrX_+_84064427_84064427 | -0.21 | 1.5e-04 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr3_-_23020441 | 98.26 |
ENSRNOT00000017651
|
Nr5a1
|
nuclear receptor subfamily 5, group A, member 1 |
| chr6_+_136536736 | 47.35 |
ENSRNOT00000086594
|
Tdrd9
|
tudor domain containing 9 |
| chr3_+_172195844 | 41.27 |
ENSRNOT00000034915
|
Npepl1
|
aminopeptidase-like 1 |
| chr1_-_142500367 | 40.29 |
ENSRNOT00000015948
ENSRNOT00000089591 |
Crtc3
|
CREB regulated transcription coactivator 3 |
| chr11_+_66878658 | 36.32 |
ENSRNOT00000003208
|
Eaf2
|
ELL associated factor 2 |
| chr1_+_221099998 | 33.51 |
ENSRNOT00000028262
|
Ltbp3
|
latent transforming growth factor beta binding protein 3 |
| chr3_+_172420591 | 30.06 |
ENSRNOT00000071215
|
Gnas
|
GNAS complex locus |
| chr19_-_26084679 | 28.88 |
ENSRNOT00000046181
|
Rnaseh2a
|
ribonuclease H2, subunit A |
| chr5_+_155812105 | 28.41 |
ENSRNOT00000039341
|
AABR07073181.1
|
|
| chr12_+_36871999 | 28.31 |
ENSRNOT00000001334
ENSRNOT00000084236 |
Ncor2
|
nuclear receptor co-repressor 2 |
| chr2_-_250743960 | 27.24 |
ENSRNOT00000084337
|
Sh3glb1
|
SH3 domain -containing GRB2-like endophilin B1 |
| chr11_-_66878551 | 27.24 |
ENSRNOT00000066616
|
Iqcb1
|
IQ motif containing B1 |
| chr7_+_117326279 | 26.01 |
ENSRNOT00000050522
|
Spatc1
|
spermatogenesis and centriole associated 1 |
| chr3_-_51297852 | 25.48 |
ENSRNOT00000001607
|
Cobll1
|
cordon-bleu WH2 repeat protein-like 1 |
| chr1_-_166912524 | 25.47 |
ENSRNOT00000092952
|
Inppl1
|
inositol polyphosphate phosphatase-like 1 |
| chr10_+_56546710 | 25.25 |
ENSRNOT00000023003
|
Ybx2
|
Y box binding protein 2 |
| chr10_-_39405311 | 25.21 |
ENSRNOT00000074616
|
Pdlim4
|
PDZ and LIM domain 4 |
| chr13_-_100414226 | 24.60 |
ENSRNOT00000085188
|
Enah
|
enabled homolog (Drosophila) |
| chr9_+_10963723 | 24.48 |
ENSRNOT00000075424
|
Plin4
|
perilipin 4 |
| chr7_-_62972084 | 23.61 |
ENSRNOT00000064251
|
Msrb3
|
methionine sulfoxide reductase B3 |
| chr7_-_14402010 | 23.32 |
ENSRNOT00000008303
|
Wiz
|
widely-interspaced zinc finger motifs |
| chr5_+_147692391 | 23.27 |
ENSRNOT00000064855
|
Fam229a
|
family with sequence similarity 229, member A |
| chr1_+_166893734 | 23.26 |
ENSRNOT00000026702
|
Phox2a
|
paired-like homeobox 2a |
| chr5_+_48224994 | 22.97 |
ENSRNOT00000068028
|
Rragd
|
Ras-related GTP binding D |
| chr2_-_149325913 | 22.92 |
ENSRNOT00000036690
|
Gpr171
|
G protein-coupled receptor 171 |
| chr3_-_156905892 | 21.87 |
ENSRNOT00000022424
|
Emilin3
|
elastin microfibril interfacer 3 |
| chr19_-_25801526 | 21.36 |
ENSRNOT00000003884
|
Nacc1
|
nucleus accumbens associated 1 |
| chr6_+_10533151 | 21.30 |
ENSRNOT00000020822
|
Rhoq
|
ras homolog family member Q |
| chr1_+_72580424 | 21.24 |
ENSRNOT00000022977
|
Ube2s
|
ubiquitin-conjugating enzyme E2S |
| chr7_+_116632506 | 21.22 |
ENSRNOT00000009811
|
Gpihbp1
|
glycosylphosphatidylinositol anchored high density lipoprotein binding protein 1 |
| chr5_-_27180819 | 21.19 |
ENSRNOT00000045483
|
AABR07047293.1
|
|
| chr1_-_198460126 | 21.00 |
ENSRNOT00000082940
ENSRNOT00000086019 |
Maz
|
MYC associated zinc finger protein |
| chr12_-_38638536 | 20.72 |
ENSRNOT00000001690
|
Mlxip
|
MLX interacting protein |
| chr10_+_13836128 | 20.71 |
ENSRNOT00000012720
|
Pgp
|
phosphoglycolate phosphatase |
| chr9_+_71398710 | 20.52 |
ENSRNOT00000049411
|
Ccnyl1
|
cyclin Y-like 1 |
| chr1_+_142883040 | 20.47 |
ENSRNOT00000015898
|
Alpk3
|
alpha-kinase 3 |
| chr6_-_135412312 | 20.46 |
ENSRNOT00000010610
|
Ankrd9
|
ankyrin repeat domain 9 |
| chr1_+_225195802 | 20.38 |
ENSRNOT00000088387
|
Ahnak
|
AHNAK nucleoprotein |
| chr8_-_56393233 | 20.25 |
ENSRNOT00000016263
|
Fdx1
|
ferredoxin 1 |
| chr1_+_189870622 | 20.17 |
ENSRNOT00000075003
|
Tmem159
|
transmembrane protein 159 |
| chr3_+_61627383 | 20.10 |
ENSRNOT00000067861
|
Hoxd8
|
homeobox D8 |
| chr19_+_25123724 | 20.03 |
ENSRNOT00000007407
|
LOC686013
|
hypothetical protein LOC686013 |
| chr10_-_105668593 | 19.37 |
ENSRNOT00000016622
|
St6galnac2
|
ST6 N-acetylgalactosaminide alpha-2,6-sialyltransferase 2 |
| chrX_+_138046494 | 19.35 |
ENSRNOT00000010596
|
Stk26
|
serine/threonine kinase 26 |
| chr11_+_87549059 | 19.33 |
ENSRNOT00000002567
|
Ccdc74a
|
coiled-coil domain containing 74A |
| chr1_+_85324079 | 19.31 |
ENSRNOT00000093693
|
Samd4b
|
sterile alpha motif domain containing 4B |
| chr10_-_56511583 | 19.15 |
ENSRNOT00000021402
|
LOC497940
|
similar to RIKEN cDNA 2810408A11 |
| chr11_-_25456836 | 18.77 |
ENSRNOT00000085444
|
Adamts5
|
ADAM metallopeptidase with thrombospondin type 1 motif, 5 |
| chr13_+_60568146 | 18.75 |
ENSRNOT00000004881
|
Uchl5
|
ubiquitin C-terminal hydrolase L5 |
| chr19_+_26084903 | 18.67 |
ENSRNOT00000004799
|
Prdx2
|
peroxiredoxin 2 |
| chr1_-_80367313 | 18.65 |
ENSRNOT00000023392
ENSRNOT00000084882 |
Mark4
|
microtubule affinity regulating kinase 4 |
| chr9_-_64573660 | 18.62 |
ENSRNOT00000021299
|
LOC108348134
|
protein boule-like |
| chr9_-_82699551 | 18.52 |
ENSRNOT00000020673
|
Obsl1
|
obscurin-like 1 |
| chr2_-_44504354 | 18.42 |
ENSRNOT00000013035
|
Ddx4
|
DEAD-box helicase 4 |
| chr3_-_153188915 | 18.34 |
ENSRNOT00000079893
|
Soga1
|
suppressor of glucose, autophagy associated 1 |
| chr1_-_80783898 | 18.28 |
ENSRNOT00000045306
|
Ceacam16
|
carcinoembryonic antigen-related cell adhesion molecule 16 |
| chr1_+_82253005 | 18.21 |
ENSRNOT00000027854
|
AC121639.1
|
|
| chr4_-_155116154 | 18.17 |
ENSRNOT00000020529
|
Phc1
|
polyhomeotic homolog 1 |
| chr15_-_33193537 | 18.02 |
ENSRNOT00000016401
|
Haus4
|
HAUS augmin-like complex, subunit 4 |
| chr7_-_117326551 | 17.92 |
ENSRNOT00000086087
|
AC107096.1
|
|
| chr4_+_7377563 | 17.73 |
ENSRNOT00000084826
|
Kcnh2
|
potassium voltage-gated channel subfamily H member 2 |
| chr1_-_216663720 | 17.66 |
ENSRNOT00000078944
ENSRNOT00000077409 |
Cdkn1c
|
cyclin-dependent kinase inhibitor 1C |
| chr20_+_13670066 | 17.58 |
ENSRNOT00000031400
|
LOC103694874
|
stromelysin-3 |
| chr10_+_31074251 | 17.45 |
ENSRNOT00000007978
|
Sox30
|
SRY box 30 |
| chr19_-_41798383 | 17.41 |
ENSRNOT00000021744
|
Phlpp2
|
PH domain and leucine rich repeat protein phosphatase 2 |
| chr14_-_37871051 | 17.40 |
ENSRNOT00000003087
|
Slain2
|
SLAIN motif family, member 2 |
| chr20_+_8696436 | 17.34 |
ENSRNOT00000085131
|
Zfand3
|
zinc finger AN1-type containing 3 |
| chr6_+_93281408 | 17.32 |
ENSRNOT00000009610
|
Frmd6
|
FERM domain containing 6 |
| chr14_+_83412968 | 17.22 |
ENSRNOT00000024993
|
Eif4enif1
|
eukaryotic translation initiation factor 4E nuclear import factor 1 |
| chr10_+_88620655 | 17.22 |
ENSRNOT00000055248
|
Hspb9
|
heat shock protein family B (small) member 9 |
| chr3_+_61620192 | 17.21 |
ENSRNOT00000065426
|
Hoxd9
|
homeo box D9 |
| chr7_-_139318455 | 16.93 |
ENSRNOT00000092029
|
Hdac7
|
histone deacetylase 7 |
| chr5_-_59165160 | 16.92 |
ENSRNOT00000029035
|
Fam221b
|
family with sequence similarity 221, member B |
| chr16_+_83522162 | 16.88 |
ENSRNOT00000057386
|
Col4a1
|
collagen type IV alpha 1 chain |
| chr1_+_214434626 | 16.85 |
ENSRNOT00000025319
|
Pnpla2
|
patatin-like phospholipase domain containing 2 |
| chr8_-_118893702 | 16.77 |
ENSRNOT00000028416
|
Nradd
|
neurotrophin receptor associated death domain |
| chr4_+_79055280 | 16.64 |
ENSRNOT00000086307
|
Stk31
|
serine threonine kinase 31 |
| chr9_-_43251400 | 16.54 |
ENSRNOT00000037570
|
Fam178b
|
family with sequence similarity 178, member B |
| chr12_+_39699181 | 16.43 |
ENSRNOT00000048454
|
Rad9b
|
RAD9 checkpoint clamp component B |
| chr20_-_7930929 | 16.43 |
ENSRNOT00000000607
|
Tead3
|
TEA domain transcription factor 3 |
| chr18_+_16650806 | 16.39 |
ENSRNOT00000093679
ENSRNOT00000041961 ENSRNOT00000093140 |
Fhod3
|
formin homology 2 domain containing 3 |
| chr3_-_4055806 | 16.36 |
ENSRNOT00000026408
|
Agpat2
|
1-acylglycerol-3-phosphate O-acyltransferase 2 |
| chrX_+_79546624 | 16.33 |
ENSRNOT00000050807
|
RGD1562871
|
similar to BMI1-like protein |
| chr1_+_103172987 | 16.31 |
ENSRNOT00000018688
|
Tmem86a
|
transmembrane protein 86A |
| chr3_-_94767239 | 16.30 |
ENSRNOT00000056808
|
Qser1
|
glutamine and serine rich 1 |
| chr10_+_46972038 | 16.24 |
ENSRNOT00000023838
|
Mief2
|
mitochondrial elongation factor 2 |
| chr7_+_138707426 | 16.22 |
ENSRNOT00000037874
|
Pced1b
|
PC-esterase domain containing 1B |
| chr2_+_154556029 | 16.15 |
ENSRNOT00000084238
|
Gmps
|
guanine monophosphate synthase |
| chr4_+_123118468 | 16.12 |
ENSRNOT00000010895
|
Tmem43
|
transmembrane protein 43 |
| chr3_+_95133713 | 16.07 |
ENSRNOT00000067940
|
Wt1
|
Wilms tumor 1 |
| chr5_+_62718787 | 16.04 |
ENSRNOT00000011112
|
Galnt12
|
polypeptide N-acetylgalactosaminyltransferase 12 |
| chr4_-_176720012 | 16.04 |
ENSRNOT00000017965
|
Ldhb
|
lactate dehydrogenase B |
| chr10_-_14061703 | 16.00 |
ENSRNOT00000017917
|
Gfer
|
growth factor, augmenter of liver regeneration |
| chr5_-_138336475 | 15.95 |
ENSRNOT00000015875
|
Ybx1
|
Y box binding protein 1 |
| chr8_-_68525911 | 15.88 |
ENSRNOT00000080588
ENSRNOT00000011109 |
Iqch
|
IQ motif containing H |
| chr4_-_82295470 | 15.69 |
ENSRNOT00000091073
|
Hoxa10
|
homeobox A10 |
| chr8_-_128711221 | 15.58 |
ENSRNOT00000055888
|
Xirp1
|
xin actin-binding repeat containing 1 |
| chr9_+_50247692 | 15.56 |
ENSRNOT00000023029
|
Nck2
|
NCK adaptor protein 2 |
| chr10_-_94460732 | 15.55 |
ENSRNOT00000014508
|
Smarcd2
|
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily d, member 2 |
| chr10_+_67559385 | 15.49 |
ENSRNOT00000082685
ENSRNOT00000006218 ENSRNOT00000079696 |
Rhot1
|
ras homolog family member T1 |
| chr9_+_12633990 | 15.43 |
ENSRNOT00000066517
ENSRNOT00000077532 |
Dazl
|
deleted in azoospermia-like |
| chr9_-_110936631 | 15.36 |
ENSRNOT00000064431
|
Fbxl17
|
F-box and leucine-rich repeat protein 17 |
| chr1_+_218632764 | 15.34 |
ENSRNOT00000019861
|
Tesmin
|
testis expressed metallothionein like protein |
| chr16_-_20807070 | 15.34 |
ENSRNOT00000072536
|
Comp
|
cartilage oligomeric matrix protein |
| chr9_-_99299715 | 15.28 |
ENSRNOT00000027622
|
Hdac4
|
histone deacetylase 4 |
| chr2_+_154555871 | 15.26 |
ENSRNOT00000076292
|
Gmps
|
guanine monophosphate synthase |
| chr20_+_4993560 | 15.25 |
ENSRNOT00000081628
ENSRNOT00000087861 ENSRNOT00000001160 |
Vars
|
valyl-tRNA synthetase |
| chr10_-_15960673 | 15.25 |
ENSRNOT00000036447
|
RGD1311343
|
similar to RIKEN cDNA 4930524B15 |
| chr10_-_45726524 | 15.12 |
ENSRNOT00000050370
|
Prss38
|
protease, serine, 38 |
| chr5_-_173081839 | 15.09 |
ENSRNOT00000066880
|
Mmp23
|
matrix metallopeptidase 23 |
| chr1_+_254974789 | 14.92 |
ENSRNOT00000025020
|
Pcgf5
|
polycomb group ring finger 5 |
| chr7_-_116781766 | 14.90 |
ENSRNOT00000010084
|
Mafa
|
MAF bZIP transcription factor A |
| chr2_+_211930326 | 14.89 |
ENSRNOT00000027765
|
Slc25a24
|
solute carrier family 25 member 24 |
| chr7_+_120153184 | 14.88 |
ENSRNOT00000013538
|
Lgals1
|
galectin 1 |
| chr4_-_170620703 | 14.76 |
ENSRNOT00000011930
|
Plbd1
|
phospholipase B domain containing 1 |
| chr3_+_159421671 | 14.69 |
ENSRNOT00000010343
|
Mybl2
|
myeloblastosis oncogene-like 2 |
| chr8_-_6203515 | 14.65 |
ENSRNOT00000087278
ENSRNOT00000031189 ENSRNOT00000008074 ENSRNOT00000085285 ENSRNOT00000007866 |
Yap1
|
yes-associated protein 1 |
| chr3_+_61634005 | 14.60 |
ENSRNOT00000002145
|
Hoxd4
|
homeo box D4 |
| chr6_+_51662224 | 14.54 |
ENSRNOT00000060006
|
Ccdc71l
|
coiled-coil domain containing 71-like |
| chr19_+_34139997 | 14.50 |
ENSRNOT00000017867
|
Arhgap10
|
Rho GTPase activating protein 10 |
| chr1_+_213997709 | 14.48 |
ENSRNOT00000025826
|
LOC100911615
|
patatin-like phospholipase domain-containing protein 2-like |
| chr8_-_116045954 | 14.37 |
ENSRNOT00000020065
|
Mapkapk3
|
mitogen-activated protein kinase-activated protein kinase 3 |
| chr17_+_43050789 | 14.34 |
ENSRNOT00000080745
|
Carmil1
|
capping protein regulator and myosin 1 linker 1 |
| chr17_+_10065947 | 14.32 |
ENSRNOT00000022703
|
Uimc1
|
ubiquitin interaction motif containing 1 |
| chr3_-_117766120 | 14.31 |
ENSRNOT00000056022
|
Fbn1
|
fibrillin 1 |
| chr3_-_170378210 | 14.26 |
ENSRNOT00000055102
|
Aurka
|
aurora kinase A |
| chr12_-_40590361 | 14.26 |
ENSRNOT00000067503
|
Tmem116
|
transmembrane protein 116 |
| chr14_+_80248140 | 14.26 |
ENSRNOT00000010852
|
Htra3
|
HtrA serine peptidase 3 |
| chr1_-_282251257 | 14.25 |
ENSRNOT00000015186
|
Prdx3
|
peroxiredoxin 3 |
| chr15_+_83442144 | 14.20 |
ENSRNOT00000039344
|
Bora
|
bora, aurora kinase A activator |
| chr20_-_2701815 | 14.17 |
ENSRNOT00000061950
|
Hspa1a
|
heat shock protein family A (Hsp70) member 1A |
| chr3_-_8981362 | 14.15 |
ENSRNOT00000086717
|
Crat
|
carnitine O-acetyltransferase |
| chr1_+_89408935 | 14.11 |
ENSRNOT00000075068
|
LOC100909893
|
protein FAM187B-like |
| chr17_-_43675934 | 14.10 |
ENSRNOT00000081345
|
Hist1h1t
|
histone cluster 1 H1 family member t |
| chr10_-_48599208 | 14.07 |
ENSRNOT00000003974
|
Zswim7
|
zinc finger, SWIM-type containing 7 |
| chr10_+_11240138 | 14.01 |
ENSRNOT00000048687
|
Srl
|
sarcalumenin |
| chr3_-_164095878 | 14.01 |
ENSRNOT00000079414
|
B4galt5
|
beta-1,4-galactosyltransferase 5 |
| chr8_+_62779875 | 13.97 |
ENSRNOT00000010831
|
Cyp11a1
|
cytochrome P450, family 11, subfamily a, polypeptide 1 |
| chr1_-_213751405 | 13.96 |
ENSRNOT00000020216
|
Ifitm2
|
interferon induced transmembrane protein 2 |
| chr3_+_5481522 | 13.95 |
ENSRNOT00000031316
|
Stkld1
|
serine/threonine kinase-like domain containing 1 |
| chr13_-_84452181 | 13.94 |
ENSRNOT00000005060
|
Mael
|
maelstrom spermatogenic transposon silencer |
| chr3_-_12944494 | 13.94 |
ENSRNOT00000023172
|
Mvb12b
|
multivesicular body subunit 12B |
| chr4_-_6046477 | 13.92 |
ENSRNOT00000073925
|
Cct8l1
|
chaperonin containing TCP1, subunit 8 (theta)-like 1 |
| chr12_+_38490230 | 13.91 |
ENSRNOT00000047861
|
Diablo
|
diablo, IAP-binding mitochondrial protein |
| chr2_-_250744196 | 13.91 |
ENSRNOT00000017770
|
Sh3glb1
|
SH3 domain -containing GRB2-like endophilin B1 |
| chr9_-_64573076 | 13.89 |
ENSRNOT00000084658
|
LOC108348134
|
protein boule-like |
| chr1_-_220644636 | 13.84 |
ENSRNOT00000027632
|
Pacs1
|
phosphofurin acidic cluster sorting protein 1 |
| chr18_-_28444880 | 13.79 |
ENSRNOT00000060696
|
Prob1
|
proline rich basic protein 1 |
| chr1_+_141767940 | 13.78 |
ENSRNOT00000064034
|
Zfp710
|
zinc finger protein 710 |
| chr13_+_98924962 | 13.72 |
ENSRNOT00000074148
|
Lin9
|
lin-9 DREAM MuvB core complex component |
| chr4_+_7158970 | 13.71 |
ENSRNOT00000037446
|
Asb10
|
ankyrin repeat and SOCS box-containing 10 |
| chr9_-_61974898 | 13.70 |
ENSRNOT00000091519
|
Boll
|
boule homolog, RNA binding protein |
| chr8_-_62542622 | 13.65 |
ENSRNOT00000080071
|
Clk3
|
CDC-like kinase 3 |
| chr2_+_30664639 | 13.65 |
ENSRNOT00000076372
ENSRNOT00000076294 ENSRNOT00000076434 ENSRNOT00000076484 |
Taf9
|
TATA-box binding protein associated factor 9 |
| chr7_+_74047814 | 13.56 |
ENSRNOT00000014879
|
Osr2
|
odd-skipped related transciption factor 2 |
| chr6_+_137243185 | 13.50 |
ENSRNOT00000030879
|
Zbtb42
|
zinc finger and BTB domain containing 42 |
| chr10_-_48860902 | 13.44 |
ENSRNOT00000004127
|
Cenpv
|
centromere protein V |
| chr11_+_84396033 | 13.42 |
ENSRNOT00000002316
|
Abcc5
|
ATP binding cassette subfamily C member 5 |
| chr5_-_24631679 | 13.41 |
ENSRNOT00000010846
ENSRNOT00000067129 |
Esrp1
|
epithelial splicing regulatory protein 1 |
| chr4_+_155321553 | 13.40 |
ENSRNOT00000089614
|
Mfap5
|
microfibrillar associated protein 5 |
| chr4_-_157798868 | 13.39 |
ENSRNOT00000044425
|
Tuba3b
|
tubulin, alpha 3B |
| chr17_+_55008265 | 13.37 |
ENSRNOT00000033827
|
Zfp438
|
zinc finger protein 438 |
| chr8_-_13262729 | 13.34 |
ENSRNOT00000012176
|
Fut4
|
fucosyltransferase 4 |
| chr13_+_51384562 | 13.33 |
ENSRNOT00000077928
|
Kdm5b
|
lysine demethylase 5B |
| chr20_+_12429315 | 13.33 |
ENSRNOT00000001675
|
Pcbp3
|
poly(rC) binding protein 3 |
| chr2_-_183031214 | 13.32 |
ENSRNOT00000013260
|
LOC679811
|
similar to RIKEN cDNA D930015E06 |
| chr1_-_123100464 | 13.32 |
ENSRNOT00000031973
|
Peg12
|
paternally expressed 12 |
| chr12_-_14244316 | 13.32 |
ENSRNOT00000001466
|
Foxk1
|
forkhead box K1 |
| chr7_+_120345180 | 13.32 |
ENSRNOT00000036357
|
Micall1
|
MICAL-like 1 |
| chr1_+_261229347 | 13.31 |
ENSRNOT00000018485
|
Ubtd1
|
ubiquitin domain containing 1 |
| chr7_+_116090189 | 13.29 |
ENSRNOT00000081571
|
Psca
|
prostate stem cell antigen |
| chr13_-_74740458 | 13.27 |
ENSRNOT00000006548
|
Tex35
|
testis expressed 35 |
| chr8_-_78655856 | 13.23 |
ENSRNOT00000081185
|
Tcf12
|
transcription factor 12 |
| chr14_-_84662143 | 13.15 |
ENSRNOT00000057529
ENSRNOT00000080078 |
Hormad2
|
HORMA domain containing 2 |
| chr10_+_92245442 | 13.12 |
ENSRNOT00000006808
|
Sppl2c
|
signal peptide peptidase like 2C |
| chr17_+_15845931 | 13.04 |
ENSRNOT00000092083
|
Card19
|
caspase recruitment domain family, member 19 |
| chr17_+_15814132 | 13.01 |
ENSRNOT00000032997
|
Susd3
|
sushi domain containing 3 |
| chr17_+_6909728 | 12.92 |
ENSRNOT00000061231
|
LOC681410
|
hypothetical protein LOC681410 |
| chr1_+_82419947 | 12.92 |
ENSRNOT00000027964
|
B3gnt8
|
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 8 |
| chr3_+_149802621 | 12.91 |
ENSRNOT00000071772
|
LOC690507
|
similar to Vomeromodulin |
| chr15_+_67092304 | 12.90 |
ENSRNOT00000040244
|
AABR07018646.1
|
|
| chr4_+_56674832 | 12.88 |
ENSRNOT00000060309
|
Ccdc136
|
coiled-coil domain containing 136 |
| chr8_-_66893083 | 12.87 |
ENSRNOT00000037028
ENSRNOT00000091755 |
Kif23
|
kinesin family member 23 |
| chr1_-_165967069 | 12.86 |
ENSRNOT00000089359
|
Arhgef17
|
Rho guanine nucleotide exchange factor (GEF) 17 |
| chr19_-_31942180 | 12.83 |
ENSRNOT00000024924
|
Otud4
|
OTU deubiquitinase 4 |
| chr19_+_25262076 | 12.78 |
ENSRNOT00000030658
|
RGD1306072
|
hypothetical LOC304654 |
| chr5_+_59128315 | 12.74 |
ENSRNOT00000021802
|
Npr2
|
natriuretic peptide receptor 2 |
| chr7_-_98098268 | 12.73 |
ENSRNOT00000010361
|
Fbxo32
|
F-box protein 32 |
| chr12_-_9331195 | 12.73 |
ENSRNOT00000044134
|
Pan3
|
PAN3 poly(A) specific ribonuclease subunit |
| chr6_+_48866601 | 12.72 |
ENSRNOT00000077321
ENSRNOT00000079891 |
Pxdn
|
peroxidasin |
| chr7_+_24534615 | 12.68 |
ENSRNOT00000009124
|
Cry1
|
cryptochrome circadian clock 1 |
| chr15_-_43733182 | 12.66 |
ENSRNOT00000015318
|
Ppp2r2a
|
protein phosphatase 2, regulatory subunit B, alpha |
| chr17_-_78735324 | 12.66 |
ENSRNOT00000036299
|
Cdnf
|
cerebral dopamine neurotrophic factor |
| chr1_-_163071508 | 12.66 |
ENSRNOT00000019053
|
Myo7a
|
myosin VIIA |
| chr1_-_83993270 | 12.65 |
ENSRNOT00000002050
|
Mia
|
melanoma inhibitory activity |
| chr8_-_44327551 | 12.62 |
ENSRNOT00000083939
|
Gramd1b
|
GRAM domain containing 1B |
| chr1_-_197770669 | 12.62 |
ENSRNOT00000023563
|
Lat
|
linker for activation of T cells |
| chr15_+_32894938 | 12.60 |
ENSRNOT00000012837
|
Abhd4
|
abhydrolase domain containing 4 |
| chr10_-_105600913 | 12.58 |
ENSRNOT00000068026
|
Rhbdf2
|
rhomboid 5 homolog 2 |
| chr5_-_147691997 | 12.55 |
ENSRNOT00000011887
|
Tssk3
|
testis-specific serine kinase 3 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 29.2 | 116.7 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
| 13.7 | 41.1 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) protein localization to vacuolar membrane(GO:1903778) |
| 12.6 | 37.8 | GO:1904722 | positive regulation of mRNA cleavage(GO:0031439) positive regulation of endoribonuclease activity(GO:1902380) positive regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904722) |
| 11.2 | 33.5 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 10.5 | 31.4 | GO:1901367 | response to L-cysteine(GO:1901367) |
| 9.5 | 28.6 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
| 9.5 | 9.5 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
| 8.9 | 26.8 | GO:1902460 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 8.0 | 23.9 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
| 7.8 | 131.9 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 7.8 | 23.3 | GO:0021558 | trochlear nerve development(GO:0021558) |
| 7.6 | 22.9 | GO:0030091 | protein repair(GO:0030091) |
| 7.5 | 22.5 | GO:1902303 | negative regulation of potassium ion export(GO:1902303) |
| 7.1 | 21.3 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 6.8 | 27.3 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 6.6 | 6.6 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 6.6 | 26.3 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 6.5 | 6.5 | GO:0060857 | establishment of glial blood-brain barrier(GO:0060857) |
| 6.4 | 25.5 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 6.3 | 18.9 | GO:0051695 | actin filament uncapping(GO:0051695) |
| 6.3 | 6.3 | GO:1902689 | negative regulation of fermentation(GO:1901003) negative regulation of NAD metabolic process(GO:1902689) negative regulation of glucose catabolic process to lactate via pyruvate(GO:1904024) |
| 6.1 | 18.4 | GO:0002333 | transitional stage B cell differentiation(GO:0002332) transitional one stage B cell differentiation(GO:0002333) positive regulation of actin filament binding(GO:1904531) positive regulation of actin binding(GO:1904618) |
| 6.1 | 6.1 | GO:0072710 | response to hydroxyurea(GO:0072710) |
| 6.0 | 23.9 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 5.9 | 11.8 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 5.7 | 17.0 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 5.7 | 45.4 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 5.6 | 5.6 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 5.5 | 22.0 | GO:0010424 | DNA methylation on cytosine within a CG sequence(GO:0010424) |
| 5.5 | 16.4 | GO:2000230 | negative regulation of pancreatic stellate cell proliferation(GO:2000230) |
| 5.4 | 21.7 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 5.4 | 32.4 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 5.3 | 10.6 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 5.3 | 21.2 | GO:2000861 | estrogen secretion(GO:0035937) estradiol secretion(GO:0035938) regulation of estrogen secretion(GO:2000861) regulation of estradiol secretion(GO:2000864) |
| 5.3 | 15.8 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
| 5.2 | 15.7 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 5.2 | 25.9 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
| 5.1 | 5.1 | GO:2000277 | positive regulation of oxidative phosphorylation uncoupler activity(GO:2000277) |
| 5.1 | 30.5 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 5.1 | 15.2 | GO:0061441 | renal artery morphogenesis(GO:0061441) |
| 5.0 | 20.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 4.9 | 4.9 | GO:2000872 | positive regulation of progesterone secretion(GO:2000872) |
| 4.9 | 34.2 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 4.9 | 14.7 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
| 4.9 | 14.6 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 4.8 | 14.4 | GO:0000294 | nuclear-transcribed mRNA catabolic process, endonucleolytic cleavage-dependent decay(GO:0000294) |
| 4.7 | 28.5 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
| 4.7 | 18.7 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 4.6 | 23.1 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 4.6 | 32.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 4.6 | 13.7 | GO:0071349 | interleukin-12-mediated signaling pathway(GO:0035722) cellular response to interleukin-12(GO:0071349) |
| 4.6 | 4.6 | GO:0034971 | histone H3-R17 methylation(GO:0034971) |
| 4.5 | 31.7 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 4.5 | 13.6 | GO:0036023 | embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 4.5 | 13.5 | GO:0002462 | tolerance induction to nonself antigen(GO:0002462) |
| 4.4 | 22.2 | GO:0072717 | cellular response to actinomycin D(GO:0072717) |
| 4.4 | 39.8 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 4.4 | 13.3 | GO:0021817 | nucleokinesis involved in cell motility in cerebral cortex radial glia guided migration(GO:0021817) nuclear migration along microtubule(GO:0030473) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 4.4 | 17.6 | GO:0046351 | disaccharide biosynthetic process(GO:0046351) |
| 4.4 | 17.5 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 4.4 | 43.5 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 4.3 | 30.2 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
| 4.3 | 21.5 | GO:0021747 | cochlear nucleus development(GO:0021747) |
| 4.3 | 34.3 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 4.3 | 42.8 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 4.3 | 8.5 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 4.2 | 29.6 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 4.2 | 12.5 | GO:0000915 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 4.1 | 12.4 | GO:1903943 | regulation of hepatocyte apoptotic process(GO:1903943) negative regulation of hepatocyte apoptotic process(GO:1903944) |
| 4.1 | 12.4 | GO:0061188 | negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 4.1 | 20.6 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 4.0 | 24.2 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 4.0 | 28.1 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 4.0 | 12.0 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 4.0 | 11.9 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 4.0 | 15.8 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 4.0 | 11.9 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 3.9 | 27.4 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 3.9 | 7.8 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 3.9 | 3.9 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 3.9 | 15.5 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 3.9 | 27.0 | GO:0044351 | macropinocytosis(GO:0044351) |
| 3.8 | 26.9 | GO:1990253 | cellular response to leucine starvation(GO:1990253) |
| 3.8 | 11.5 | GO:0001545 | primary ovarian follicle growth(GO:0001545) |
| 3.8 | 11.5 | GO:1905243 | response to 3,3',5-triiodo-L-thyronine(GO:1905242) cellular response to 3,3',5-triiodo-L-thyronine(GO:1905243) |
| 3.8 | 19.0 | GO:0044691 | tooth eruption(GO:0044691) |
| 3.8 | 11.4 | GO:0060489 | orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 3.8 | 18.9 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
| 3.8 | 11.3 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 3.7 | 29.9 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 3.7 | 7.4 | GO:0007493 | endodermal cell fate determination(GO:0007493) |
| 3.7 | 44.4 | GO:0007135 | meiosis II(GO:0007135) |
| 3.7 | 18.5 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 3.7 | 11.1 | GO:2000338 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
| 3.7 | 3.7 | GO:0071350 | interleukin-15-mediated signaling pathway(GO:0035723) cellular response to interleukin-15(GO:0071350) |
| 3.7 | 29.2 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 3.6 | 10.9 | GO:2000687 | negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 3.6 | 10.9 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 3.6 | 10.8 | GO:1902304 | positive regulation of potassium ion export(GO:1902304) |
| 3.6 | 10.8 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 3.6 | 14.4 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 3.6 | 14.3 | GO:0044211 | CTP salvage(GO:0044211) |
| 3.6 | 17.8 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 3.5 | 14.1 | GO:0007525 | somatic muscle development(GO:0007525) |
| 3.5 | 38.7 | GO:0006337 | nucleosome disassembly(GO:0006337) |
| 3.5 | 7.0 | GO:1901143 | insulin catabolic process(GO:1901143) |
| 3.5 | 10.5 | GO:0045799 | positive regulation of chromatin assembly or disassembly(GO:0045799) |
| 3.5 | 3.5 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
| 3.5 | 17.5 | GO:0031296 | B cell costimulation(GO:0031296) |
| 3.5 | 10.5 | GO:1905075 | occluding junction disassembly(GO:1905071) regulation of occluding junction disassembly(GO:1905073) positive regulation of occluding junction disassembly(GO:1905075) |
| 3.4 | 13.6 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
| 3.4 | 16.9 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 3.4 | 10.2 | GO:1902856 | negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 3.3 | 16.6 | GO:1904179 | positive regulation of adipose tissue development(GO:1904179) |
| 3.3 | 26.6 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 3.3 | 6.6 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 3.3 | 16.4 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 3.3 | 6.5 | GO:0003192 | mitral valve formation(GO:0003192) |
| 3.2 | 6.5 | GO:0030719 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) P granule organization(GO:0030719) |
| 3.2 | 64.8 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 3.2 | 13.0 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 3.2 | 9.7 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 3.2 | 16.2 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 3.2 | 3.2 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 3.2 | 12.8 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 3.2 | 16.0 | GO:2000435 | regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 3.2 | 6.4 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 3.2 | 12.7 | GO:0071543 | diadenosine polyphosphate catabolic process(GO:0015961) diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 3.2 | 25.4 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
| 3.2 | 6.3 | GO:0007079 | mitotic chromosome movement towards spindle pole(GO:0007079) |
| 3.1 | 31.0 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 3.1 | 18.3 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 3.1 | 6.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 3.1 | 3.1 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 3.0 | 3.0 | GO:0045210 | FasL biosynthetic process(GO:0045210) |
| 3.0 | 9.1 | GO:1990167 | protein K27-linked deubiquitination(GO:1990167) |
| 3.0 | 9.1 | GO:0018201 | peptidyl-glycine modification(GO:0018201) |
| 3.0 | 12.1 | GO:0061056 | sclerotome development(GO:0061056) |
| 3.0 | 30.2 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 3.0 | 3.0 | GO:1904884 | telomerase catalytic core complex assembly(GO:1904868) regulation of telomerase catalytic core complex assembly(GO:1904882) positive regulation of telomerase catalytic core complex assembly(GO:1904884) |
| 3.0 | 18.1 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 3.0 | 9.0 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 3.0 | 12.0 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
| 3.0 | 14.9 | GO:0072244 | metanephric glomerular epithelium development(GO:0072244) |
| 3.0 | 5.9 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 2.9 | 11.8 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
| 2.9 | 8.8 | GO:0072237 | metanephric proximal tubule development(GO:0072237) |
| 2.9 | 23.4 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
| 2.9 | 26.2 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 2.9 | 11.6 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 2.9 | 8.6 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
| 2.9 | 20.1 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 2.9 | 11.5 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 2.9 | 11.4 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 2.9 | 14.3 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 2.8 | 2.8 | GO:0060974 | cell migration involved in heart formation(GO:0060974) |
| 2.8 | 8.4 | GO:0002326 | B cell lineage commitment(GO:0002326) |
| 2.8 | 19.6 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
| 2.8 | 8.4 | GO:0046333 | octopamine biosynthetic process(GO:0006589) octopamine metabolic process(GO:0046333) |
| 2.8 | 8.4 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 2.8 | 19.4 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
| 2.8 | 13.9 | GO:1904401 | cellular response to Thyroid stimulating hormone(GO:1904401) |
| 2.8 | 5.5 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 2.8 | 16.6 | GO:0003383 | apical constriction(GO:0003383) |
| 2.8 | 2.8 | GO:0033122 | negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 2.8 | 19.3 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 2.8 | 11.0 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 2.7 | 8.2 | GO:0072141 | renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) |
| 2.7 | 11.0 | GO:0048865 | stem cell fate commitment(GO:0048865) |
| 2.7 | 11.0 | GO:2000669 | negative regulation of dendritic cell apoptotic process(GO:2000669) |
| 2.7 | 8.2 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine to uridine editing(GO:0016554) cytidine metabolic process(GO:0046087) |
| 2.7 | 2.7 | GO:0071387 | cellular response to cortisol stimulus(GO:0071387) |
| 2.7 | 13.7 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 2.7 | 2.7 | GO:2000819 | regulation of nucleotide-excision repair(GO:2000819) |
| 2.7 | 21.7 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 2.7 | 5.4 | GO:0072185 | metanephric cap development(GO:0072185) metanephric cap morphogenesis(GO:0072186) metanephric cap mesenchymal cell proliferation involved in metanephros development(GO:0090094) response to putrescine(GO:1904585) cellular response to putrescine(GO:1904586) |
| 2.7 | 10.8 | GO:0045006 | DNA deamination(GO:0045006) |
| 2.7 | 16.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 2.7 | 13.4 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
| 2.7 | 13.3 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 2.6 | 2.6 | GO:0030221 | basophil differentiation(GO:0030221) |
| 2.6 | 5.3 | GO:0035470 | positive regulation of vascular wound healing(GO:0035470) |
| 2.6 | 18.5 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 2.6 | 2.6 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 2.6 | 18.4 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 2.6 | 15.7 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 2.6 | 15.6 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 2.6 | 67.5 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 2.6 | 5.2 | GO:0038183 | bile acid signaling pathway(GO:0038183) |
| 2.6 | 7.7 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 2.6 | 25.8 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 2.6 | 25.8 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 2.6 | 5.1 | GO:0019541 | propionate metabolic process(GO:0019541) |
| 2.6 | 10.3 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 2.6 | 7.7 | GO:0030239 | myofibril assembly(GO:0030239) |
| 2.5 | 10.2 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 2.5 | 7.6 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 2.5 | 10.1 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 2.5 | 5.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 2.5 | 15.2 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 2.5 | 22.7 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 2.5 | 7.6 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 2.5 | 7.5 | GO:1901420 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) negative regulation of response to alcohol(GO:1901420) |
| 2.5 | 5.0 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 2.5 | 29.9 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
| 2.5 | 12.4 | GO:0099550 | trans-synaptic signalling, modulating synaptic transmission(GO:0099550) |
| 2.5 | 14.9 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 2.5 | 14.8 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 2.5 | 12.3 | GO:0060215 | primitive hemopoiesis(GO:0060215) |
| 2.5 | 4.9 | GO:0048105 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 2.5 | 7.4 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 2.5 | 2.5 | GO:0071454 | cellular response to anoxia(GO:0071454) |
| 2.4 | 12.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 2.4 | 7.3 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 2.4 | 12.1 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 2.4 | 7.3 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 2.4 | 7.3 | GO:1902044 | regulation of Fas signaling pathway(GO:1902044) |
| 2.4 | 19.4 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 2.4 | 12.1 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 2.4 | 29.0 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 2.4 | 7.2 | GO:1990091 | sodium-dependent self proteolysis(GO:1990091) |
| 2.4 | 2.4 | GO:0006311 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
| 2.4 | 7.2 | GO:0032978 | protein insertion into membrane from inner side(GO:0032978) |
| 2.4 | 14.4 | GO:1901993 | meiotic cell cycle phase transition(GO:0044771) regulation of meiotic cell cycle phase transition(GO:1901993) |
| 2.4 | 9.5 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 2.4 | 9.5 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 2.4 | 9.5 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 2.4 | 9.5 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
| 2.4 | 23.7 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 2.4 | 7.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 2.4 | 23.7 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 2.4 | 9.4 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 2.3 | 11.7 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 2.3 | 7.0 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
| 2.3 | 18.7 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 2.3 | 4.7 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
| 2.3 | 9.3 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
| 2.3 | 9.3 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 2.3 | 18.5 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 2.3 | 2.3 | GO:0051037 | regulation of transcription involved in meiotic cell cycle(GO:0051037) |
| 2.3 | 6.8 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 2.3 | 4.5 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 2.3 | 20.3 | GO:0014877 | response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 2.3 | 27.0 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
| 2.3 | 18.0 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 2.2 | 13.5 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 2.2 | 6.7 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) |
| 2.2 | 11.1 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 2.2 | 8.9 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
| 2.2 | 6.7 | GO:1904100 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
| 2.2 | 17.7 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 2.2 | 11.1 | GO:0015801 | aromatic amino acid transport(GO:0015801) |
| 2.2 | 4.4 | GO:0061419 | positive regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061419) |
| 2.2 | 6.6 | GO:0032298 | positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 2.2 | 6.6 | GO:0046078 | dUMP metabolic process(GO:0046078) |
| 2.2 | 6.6 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 2.2 | 10.9 | GO:0072103 | renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 2.2 | 10.9 | GO:1903251 | multi-ciliated epithelial cell differentiation(GO:1903251) |
| 2.2 | 15.2 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 2.2 | 4.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 2.2 | 4.3 | GO:0072156 | distal tubule morphogenesis(GO:0072156) |
| 2.2 | 4.3 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 2.1 | 73.0 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 2.1 | 4.3 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
| 2.1 | 47.2 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
| 2.1 | 12.9 | GO:0033227 | dsRNA transport(GO:0033227) |
| 2.1 | 6.4 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 2.1 | 4.3 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 2.1 | 19.2 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 2.1 | 8.5 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 2.1 | 10.6 | GO:0007144 | female meiosis I(GO:0007144) |
| 2.1 | 2.1 | GO:0032962 | positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
| 2.1 | 12.7 | GO:0002467 | germinal center formation(GO:0002467) |
| 2.1 | 8.5 | GO:0031659 | positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
| 2.1 | 10.5 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 2.1 | 6.3 | GO:0021570 | rhombomere 4 development(GO:0021570) |
| 2.1 | 6.3 | GO:0002380 | immunoglobulin secretion involved in immune response(GO:0002380) |
| 2.1 | 12.5 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 2.1 | 6.3 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 2.1 | 16.6 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
| 2.1 | 6.2 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 2.1 | 10.3 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 2.1 | 16.4 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 2.0 | 8.2 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 2.0 | 6.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 2.0 | 16.4 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 2.0 | 6.1 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 2.0 | 12.2 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
| 2.0 | 16.3 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
| 2.0 | 40.5 | GO:0006298 | mismatch repair(GO:0006298) |
| 2.0 | 6.1 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
| 2.0 | 6.1 | GO:1903445 | protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 2.0 | 12.0 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 2.0 | 12.0 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 2.0 | 6.0 | GO:1902966 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 2.0 | 5.9 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 2.0 | 5.9 | GO:0016240 | autophagosome docking(GO:0016240) |
| 2.0 | 15.8 | GO:0015871 | choline transport(GO:0015871) |
| 2.0 | 37.3 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 2.0 | 7.8 | GO:0072709 | cellular response to sorbitol(GO:0072709) |
| 2.0 | 2.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 2.0 | 5.9 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 2.0 | 5.9 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 1.9 | 13.6 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 1.9 | 5.8 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 1.9 | 1.9 | GO:1901220 | regulation of cardiac chamber morphogenesis(GO:1901219) negative regulation of cardiac chamber morphogenesis(GO:1901220) |
| 1.9 | 9.7 | GO:0051255 | spindle midzone assembly(GO:0051255) |
| 1.9 | 7.7 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 1.9 | 1.9 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 1.9 | 19.2 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 1.9 | 7.7 | GO:0030220 | platelet formation(GO:0030220) platelet morphogenesis(GO:0036344) |
| 1.9 | 19.1 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 1.9 | 9.5 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 1.9 | 7.6 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) |
| 1.9 | 9.5 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 1.9 | 1.9 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
| 1.9 | 9.5 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
| 1.9 | 7.6 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 1.9 | 32.2 | GO:0006000 | fructose metabolic process(GO:0006000) |
| 1.9 | 3.8 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
| 1.9 | 5.7 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 1.9 | 3.8 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 1.9 | 3.8 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 1.9 | 18.8 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 1.9 | 5.6 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 1.9 | 5.6 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 1.9 | 5.6 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 1.9 | 3.7 | GO:0006574 | valine catabolic process(GO:0006574) |
| 1.9 | 3.7 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 1.9 | 9.3 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 1.9 | 7.5 | GO:0015889 | cobalamin transport(GO:0015889) |
| 1.9 | 5.6 | GO:0021615 | specification of organ position(GO:0010159) glossopharyngeal nerve morphogenesis(GO:0021615) |
| 1.9 | 40.8 | GO:0035329 | hippo signaling(GO:0035329) |
| 1.9 | 5.6 | GO:0042369 | vitamin D catabolic process(GO:0042369) |
| 1.9 | 20.4 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 1.8 | 9.2 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
| 1.8 | 5.5 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
| 1.8 | 1.8 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
| 1.8 | 11.0 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 1.8 | 18.4 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
| 1.8 | 1.8 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 1.8 | 7.3 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
| 1.8 | 5.4 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 1.8 | 43.4 | GO:0048255 | mRNA stabilization(GO:0048255) |
| 1.8 | 1.8 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
| 1.8 | 7.2 | GO:0030578 | PML body organization(GO:0030578) |
| 1.8 | 3.6 | GO:0033091 | positive regulation of immature T cell proliferation(GO:0033091) |
| 1.8 | 5.4 | GO:1904373 | response to kainic acid(GO:1904373) |
| 1.8 | 30.5 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 1.8 | 1.8 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 1.8 | 12.5 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 1.8 | 3.6 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 1.8 | 3.5 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 1.8 | 1.8 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 1.8 | 1.8 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 1.8 | 12.4 | GO:0006705 | mineralocorticoid biosynthetic process(GO:0006705) |
| 1.8 | 5.3 | GO:0032776 | DNA methylation on cytosine(GO:0032776) C-5 methylation of cytosine(GO:0090116) |
| 1.8 | 5.3 | GO:0042197 | chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
| 1.7 | 3.5 | GO:1904580 | regulation of intracellular mRNA localization(GO:1904580) |
| 1.7 | 7.0 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 1.7 | 5.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 1.7 | 1.7 | GO:0061197 | fungiform papilla morphogenesis(GO:0061197) |
| 1.7 | 7.0 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 1.7 | 5.2 | GO:0002149 | hypochlorous acid metabolic process(GO:0002148) hypochlorous acid biosynthetic process(GO:0002149) |
| 1.7 | 3.5 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
| 1.7 | 5.2 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
| 1.7 | 5.2 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 1.7 | 6.9 | GO:0044725 | chromatin reprogramming in the zygote(GO:0044725) |
| 1.7 | 6.8 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
| 1.7 | 10.3 | GO:0015074 | DNA integration(GO:0015074) |
| 1.7 | 10.2 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
| 1.7 | 17.0 | GO:1990001 | inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 1.7 | 5.1 | GO:0033575 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 1.7 | 5.1 | GO:0042350 | GDP-L-fucose biosynthetic process(GO:0042350) |
| 1.7 | 6.8 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 1.7 | 13.5 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 1.7 | 5.1 | GO:0070084 | protein initiator methionine removal(GO:0070084) |
| 1.7 | 8.4 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 1.7 | 1.7 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 1.7 | 1.7 | GO:0000019 | regulation of mitotic recombination(GO:0000019) negative regulation of mitotic recombination(GO:0045950) |
| 1.7 | 6.6 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
| 1.7 | 6.6 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 1.7 | 5.0 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 1.6 | 1.6 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 1.6 | 8.2 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 1.6 | 1.6 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
| 1.6 | 9.9 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 1.6 | 6.6 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
| 1.6 | 4.9 | GO:0060821 | inactivation of X chromosome by DNA methylation(GO:0060821) |
| 1.6 | 4.9 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 1.6 | 1.6 | GO:0036166 | phenotypic switching(GO:0036166) |
| 1.6 | 4.9 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 1.6 | 9.7 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 1.6 | 24.3 | GO:0030261 | chromosome condensation(GO:0030261) |
| 1.6 | 1.6 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
| 1.6 | 3.2 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 1.6 | 16.2 | GO:0000338 | protein deneddylation(GO:0000338) |
| 1.6 | 1.6 | GO:1902659 | regulation of glucose mediated signaling pathway(GO:1902659) |
| 1.6 | 4.8 | GO:0019249 | lactate biosynthetic process(GO:0019249) |
| 1.6 | 3.2 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 1.6 | 8.0 | GO:0044857 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
| 1.6 | 6.4 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 1.6 | 4.8 | GO:2000327 | positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 1.6 | 1.6 | GO:0071733 | transcriptional activation by promoter-enhancer looping(GO:0071733) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
| 1.6 | 6.4 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 1.6 | 1.6 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 1.6 | 4.8 | GO:1903207 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 1.6 | 12.7 | GO:0019985 | translesion synthesis(GO:0019985) |
| 1.6 | 1.6 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
| 1.6 | 4.8 | GO:0071105 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) response to interleukin-11(GO:0071105) |
| 1.6 | 3.2 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
| 1.6 | 1.6 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
| 1.6 | 25.2 | GO:0010390 | histone monoubiquitination(GO:0010390) |
| 1.6 | 9.4 | GO:1904117 | cellular response to vasopressin(GO:1904117) |
| 1.6 | 6.2 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 1.5 | 34.1 | GO:0030325 | adrenal gland development(GO:0030325) |
| 1.5 | 4.6 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
| 1.5 | 17.0 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 1.5 | 9.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 1.5 | 3.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 1.5 | 10.7 | GO:0045738 | negative regulation of DNA repair(GO:0045738) |
| 1.5 | 6.1 | GO:0001555 | oocyte growth(GO:0001555) |
| 1.5 | 3.1 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
| 1.5 | 4.6 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 1.5 | 3.0 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) regulation of thyroid-stimulating hormone secretion(GO:2000612) |
| 1.5 | 4.5 | GO:0048535 | lymph node development(GO:0048535) |
| 1.5 | 4.5 | GO:0035600 | tRNA methylthiolation(GO:0035600) |
| 1.5 | 12.0 | GO:0098734 | macromolecule depalmitoylation(GO:0098734) |
| 1.5 | 1.5 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
| 1.5 | 5.9 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
| 1.5 | 7.4 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
| 1.5 | 11.8 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 1.5 | 7.3 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 1.5 | 30.8 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 1.5 | 5.9 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
| 1.5 | 2.9 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 1.5 | 4.4 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
| 1.5 | 1.5 | GO:0072193 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) kidney smooth muscle tissue development(GO:0072194) |
| 1.5 | 4.4 | GO:0002731 | negative regulation of dendritic cell cytokine production(GO:0002731) |
| 1.5 | 2.9 | GO:0035425 | autocrine signaling(GO:0035425) |
| 1.4 | 4.3 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 1.4 | 11.6 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 1.4 | 18.7 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 1.4 | 4.3 | GO:2000584 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
| 1.4 | 58.9 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 1.4 | 2.9 | GO:0071313 | cellular response to caffeine(GO:0071313) |
| 1.4 | 7.2 | GO:0034088 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 1.4 | 2.9 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 1.4 | 2.9 | GO:0097325 | melanocyte proliferation(GO:0097325) |
| 1.4 | 1.4 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
| 1.4 | 5.6 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 1.4 | 2.8 | GO:1903691 | positive regulation of wound healing, spreading of epidermal cells(GO:1903691) |
| 1.4 | 2.8 | GO:0019230 | proprioception(GO:0019230) |
| 1.4 | 2.8 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 1.4 | 4.2 | GO:0014870 | response to muscle inactivity(GO:0014870) |
| 1.4 | 19.5 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 1.4 | 15.3 | GO:0021670 | lateral ventricle development(GO:0021670) |
| 1.4 | 11.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 1.4 | 5.5 | GO:0061042 | vascular wound healing(GO:0061042) |
| 1.4 | 9.7 | GO:0015705 | iodide transport(GO:0015705) |
| 1.4 | 12.4 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 1.4 | 9.6 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 1.4 | 8.2 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
| 1.4 | 9.6 | GO:2000095 | regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000095) |
| 1.4 | 2.7 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 1.4 | 1.4 | GO:0070370 | cellular heat acclimation(GO:0070370) |
| 1.4 | 2.7 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 1.4 | 5.4 | GO:1903758 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 1.4 | 12.2 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
| 1.4 | 2.7 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 1.3 | 8.1 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 1.3 | 8.0 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 1.3 | 12.1 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 1.3 | 2.7 | GO:0030240 | skeletal myofibril assembly(GO:0014866) skeletal muscle thin filament assembly(GO:0030240) |
| 1.3 | 6.7 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 1.3 | 4.0 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 1.3 | 8.0 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 1.3 | 9.3 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 1.3 | 18.5 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 1.3 | 7.9 | GO:0038096 | immune response-regulating cell surface receptor signaling pathway involved in phagocytosis(GO:0002433) Fc-gamma receptor signaling pathway involved in phagocytosis(GO:0038096) |
| 1.3 | 2.6 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 1.3 | 23.6 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 1.3 | 10.5 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
| 1.3 | 5.2 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
| 1.3 | 3.9 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 1.3 | 6.5 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 1.3 | 3.9 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 1.3 | 16.9 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 1.3 | 5.2 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 1.3 | 5.2 | GO:1903564 | regulation of protein localization to cilium(GO:1903564) |
| 1.3 | 3.9 | GO:0002159 | desmosome assembly(GO:0002159) |
| 1.3 | 1.3 | GO:1905206 | positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 1.3 | 1.3 | GO:0060459 | left lung development(GO:0060459) |
| 1.3 | 7.7 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 1.3 | 5.1 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 1.3 | 1.3 | GO:1904528 | positive regulation of microtubule binding(GO:1904528) |
| 1.3 | 17.9 | GO:0036065 | fucosylation(GO:0036065) |
| 1.3 | 28.1 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
| 1.3 | 14.0 | GO:0051567 | histone H3-K9 methylation(GO:0051567) |
| 1.3 | 5.1 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 1.3 | 10.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 1.3 | 2.5 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 1.3 | 5.1 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 1.3 | 3.8 | GO:0097010 | eukaryotic translation initiation factor 4F complex assembly(GO:0097010) |
| 1.3 | 5.1 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 1.3 | 2.5 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
| 1.3 | 6.3 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 1.3 | 6.3 | GO:0033260 | nuclear DNA replication(GO:0033260) |
| 1.3 | 6.3 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 1.3 | 2.5 | GO:0009838 | abscission(GO:0009838) |
| 1.3 | 3.8 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 1.2 | 1.2 | GO:0071224 | cellular response to peptidoglycan(GO:0071224) |
| 1.2 | 9.9 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 1.2 | 7.4 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 1.2 | 1.2 | GO:0032057 | negative regulation of translational initiation in response to stress(GO:0032057) |
| 1.2 | 2.5 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 1.2 | 4.9 | GO:1902617 | response to fluoride(GO:1902617) |
| 1.2 | 3.7 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 1.2 | 3.7 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 1.2 | 3.7 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
| 1.2 | 4.9 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 1.2 | 3.6 | GO:0097498 | endothelial tube lumen extension(GO:0097498) |
| 1.2 | 2.4 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 1.2 | 8.4 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 1.2 | 13.2 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 1.2 | 1.2 | GO:0002432 | granuloma formation(GO:0002432) |
| 1.2 | 25.1 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 1.2 | 2.4 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 1.2 | 11.9 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 1.2 | 9.5 | GO:0015866 | ADP transport(GO:0015866) |
| 1.2 | 14.3 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 1.2 | 4.7 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 1.2 | 5.9 | GO:0036233 | glycine import(GO:0036233) |
| 1.2 | 8.3 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 1.2 | 2.4 | GO:0021571 | rhombomere 5 development(GO:0021571) |
| 1.2 | 3.5 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
| 1.2 | 3.5 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 1.2 | 5.9 | GO:0075522 | viral translation(GO:0019081) IRES-dependent viral translational initiation(GO:0075522) |
| 1.2 | 7.0 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 1.2 | 9.3 | GO:0080009 | mRNA methylation(GO:0080009) |
| 1.2 | 2.3 | GO:0043316 | cytotoxic T cell degranulation(GO:0043316) |
| 1.2 | 4.6 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 1.2 | 1.2 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 1.2 | 1.2 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 1.2 | 6.9 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) inositol phosphate catabolic process(GO:0071545) |
| 1.2 | 9.2 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 1.2 | 3.5 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
| 1.2 | 10.4 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 1.1 | 2.3 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) |
| 1.1 | 2.3 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 1.1 | 28.4 | GO:0010664 | negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 1.1 | 4.5 | GO:0070294 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 1.1 | 2.3 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) |
| 1.1 | 2.3 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 1.1 | 9.0 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) |
| 1.1 | 5.7 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
| 1.1 | 6.8 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 1.1 | 2.2 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
| 1.1 | 12.3 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 1.1 | 4.5 | GO:0030581 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 1.1 | 2.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 1.1 | 2.2 | GO:0045869 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
| 1.1 | 7.7 | GO:0035879 | plasma membrane lactate transport(GO:0035879) |
| 1.1 | 1.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 1.1 | 8.8 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 1.1 | 4.4 | GO:0010225 | response to UV-C(GO:0010225) |
| 1.1 | 7.7 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 1.1 | 2.2 | GO:0090290 | regulation of osteoclast proliferation(GO:0090289) positive regulation of osteoclast proliferation(GO:0090290) |
| 1.1 | 25.1 | GO:0048536 | spleen development(GO:0048536) |
| 1.1 | 4.4 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 1.1 | 3.3 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 1.1 | 1.1 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
| 1.1 | 10.8 | GO:0006657 | CDP-choline pathway(GO:0006657) |
| 1.1 | 5.4 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 1.1 | 6.5 | GO:0006868 | glutamine transport(GO:0006868) |
| 1.1 | 2.1 | GO:1902299 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 1.1 | 16.1 | GO:0035455 | response to interferon-alpha(GO:0035455) |
| 1.1 | 4.3 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 1.1 | 5.3 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 1.1 | 4.2 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
| 1.1 | 35.8 | GO:0010972 | negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
| 1.1 | 3.2 | GO:0070828 | heterochromatin organization(GO:0070828) |
| 1.1 | 6.3 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 1.0 | 3.1 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 1.0 | 4.2 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 1.0 | 1.0 | GO:0060061 | Spemann organizer formation(GO:0060061) |
| 1.0 | 1.0 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
| 1.0 | 1.0 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
| 1.0 | 7.3 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 1.0 | 3.1 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 1.0 | 10.4 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 1.0 | 34.2 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 1.0 | 9.3 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
| 1.0 | 18.6 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 1.0 | 12.4 | GO:0048484 | enteric nervous system development(GO:0048484) |
| 1.0 | 4.1 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 1.0 | 6.2 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 1.0 | 3.1 | GO:0060838 | lymphatic endothelial cell fate commitment(GO:0060838) regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 1.0 | 14.3 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 1.0 | 2.0 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 1.0 | 2.0 | GO:0071640 | regulation of macrophage inflammatory protein 1 alpha production(GO:0071640) |
| 1.0 | 1.0 | GO:2000328 | regulation of T-helper 17 cell lineage commitment(GO:2000328) |
| 1.0 | 10.1 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 1.0 | 4.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 1.0 | 3.0 | GO:0060527 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
| 1.0 | 1.0 | GO:1903903 | regulation of establishment of T cell polarity(GO:1903903) |
| 1.0 | 4.0 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 1.0 | 1.0 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 1.0 | 7.9 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 1.0 | 3.9 | GO:0001302 | replicative cell aging(GO:0001302) |
| 1.0 | 9.8 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 1.0 | 8.8 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 1.0 | 6.8 | GO:0045141 | meiotic telomere clustering(GO:0045141) |
| 1.0 | 1.0 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 1.0 | 4.8 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 1.0 | 3.9 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 1.0 | 5.8 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 1.0 | 2.9 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 1.0 | 10.6 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 1.0 | 5.8 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
| 1.0 | 1.9 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
| 1.0 | 3.8 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 1.0 | 9.6 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 1.0 | 2.9 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
| 1.0 | 4.8 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 1.0 | 8.6 | GO:0010458 | exit from mitosis(GO:0010458) |
| 1.0 | 7.6 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.9 | 14.2 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.9 | 5.7 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.9 | 1.9 | GO:0072716 | response to actinomycin D(GO:0072716) |
| 0.9 | 4.7 | GO:0032918 | polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.9 | 4.7 | GO:0060631 | regulation of meiosis I(GO:0060631) |
| 0.9 | 1.9 | GO:1901563 | response to camptothecin(GO:1901563) |
| 0.9 | 2.8 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.9 | 1.9 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.9 | 1.9 | GO:0045082 | positive regulation of interleukin-10 biosynthetic process(GO:0045082) |
| 0.9 | 45.4 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.9 | 7.4 | GO:0031272 | regulation of pseudopodium assembly(GO:0031272) positive regulation of pseudopodium assembly(GO:0031274) |
| 0.9 | 7.3 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
| 0.9 | 10.0 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.9 | 23.7 | GO:0045214 | sarcomere organization(GO:0045214) |
| 0.9 | 6.4 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.9 | 2.7 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.9 | 3.6 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.9 | 18.9 | GO:0006378 | mRNA polyadenylation(GO:0006378) |
| 0.9 | 10.7 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.9 | 29.3 | GO:0071427 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
| 0.9 | 3.5 | GO:0022605 | oogenesis stage(GO:0022605) |
| 0.9 | 4.4 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.9 | 6.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.9 | 5.3 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.9 | 6.2 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.9 | 0.9 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
| 0.9 | 18.5 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
| 0.9 | 2.6 | GO:1904814 | regulation of protein localization to chromosome, telomeric region(GO:1904814) |
| 0.9 | 5.3 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.9 | 14.0 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
| 0.9 | 14.0 | GO:0043488 | regulation of mRNA stability(GO:0043488) |
| 0.9 | 3.5 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.9 | 3.5 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.9 | 3.5 | GO:0032714 | negative regulation of interleukin-5 production(GO:0032714) |
| 0.9 | 7.0 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.9 | 2.6 | GO:0038110 | interleukin-2-mediated signaling pathway(GO:0038110) |
| 0.9 | 4.3 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.9 | 2.6 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.9 | 3.5 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
| 0.9 | 13.0 | GO:0007051 | spindle organization(GO:0007051) |
| 0.9 | 1.7 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.9 | 3.5 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.9 | 0.9 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.9 | 4.3 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
| 0.9 | 0.9 | GO:0045814 | negative regulation of gene expression, epigenetic(GO:0045814) |
| 0.8 | 7.6 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.8 | 9.3 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.8 | 5.1 | GO:2000018 | regulation of male gonad development(GO:2000018) |
| 0.8 | 1.7 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.8 | 5.0 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.8 | 5.0 | GO:0034502 | protein localization to chromosome(GO:0034502) |
| 0.8 | 5.8 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.8 | 1.7 | GO:1901491 | regulation of lymphangiogenesis(GO:1901490) negative regulation of lymphangiogenesis(GO:1901491) |
| 0.8 | 22.4 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.8 | 4.1 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.8 | 2.5 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.8 | 2.5 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.8 | 4.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.8 | 5.7 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
| 0.8 | 3.3 | GO:1903527 | positive regulation of membrane tubulation(GO:1903527) |
| 0.8 | 4.9 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.8 | 1.6 | GO:0071284 | cellular response to lead ion(GO:0071284) |
| 0.8 | 3.2 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) |
| 0.8 | 5.6 | GO:0051444 | negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.8 | 5.6 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.8 | 6.4 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.8 | 2.4 | GO:0009299 | mRNA transcription(GO:0009299) |
| 0.8 | 3.2 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.8 | 8.8 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.8 | 1.6 | GO:0016246 | RNA interference(GO:0016246) |
| 0.8 | 0.8 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) |
| 0.8 | 5.6 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.8 | 10.3 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.8 | 11.8 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.8 | 9.4 | GO:0051354 | negative regulation of oxidoreductase activity(GO:0051354) |
| 0.8 | 4.7 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
| 0.8 | 46.9 | GO:0048704 | embryonic skeletal system morphogenesis(GO:0048704) |
| 0.8 | 3.9 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.8 | 4.7 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
| 0.8 | 1.6 | GO:0051138 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.8 | 8.6 | GO:0003417 | growth plate cartilage development(GO:0003417) |
| 0.8 | 7.8 | GO:0016574 | histone ubiquitination(GO:0016574) |
| 0.8 | 6.2 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.8 | 3.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.8 | 4.6 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
| 0.8 | 2.3 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.8 | 1.5 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.8 | 2.3 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.8 | 1.5 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
| 0.8 | 1.5 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
| 0.8 | 0.8 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
| 0.8 | 9.2 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
| 0.8 | 2.3 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.8 | 3.8 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.8 | 2.3 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.8 | 3.0 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.8 | 2.3 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
| 0.8 | 2.3 | GO:0030953 | astral microtubule organization(GO:0030953) |
| 0.7 | 2.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.7 | 12.0 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.7 | 6.7 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.7 | 6.0 | GO:0001977 | renal system process involved in regulation of blood volume(GO:0001977) |
| 0.7 | 3.0 | GO:0046725 | negative regulation by virus of viral protein levels in host cell(GO:0046725) |
| 0.7 | 11.1 | GO:0007140 | male meiosis(GO:0007140) |
| 0.7 | 1.5 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.7 | 2.9 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.7 | 7.3 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.7 | 3.7 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.7 | 2.9 | GO:0002339 | B cell selection(GO:0002339) |
| 0.7 | 1.5 | GO:1903003 | positive regulation of protein deubiquitination(GO:1903003) |
| 0.7 | 0.7 | GO:0060442 | branching involved in prostate gland morphogenesis(GO:0060442) |
| 0.7 | 11.6 | GO:0010831 | positive regulation of myotube differentiation(GO:0010831) |
| 0.7 | 2.9 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.7 | 2.2 | GO:0071168 | post-translational protein acetylation(GO:0034421) protein localization to chromatin(GO:0071168) |
| 0.7 | 1.4 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.7 | 5.0 | GO:0051532 | regulation of NFAT protein import into nucleus(GO:0051532) |
| 0.7 | 1.4 | GO:0044565 | dendritic cell proliferation(GO:0044565) |
| 0.7 | 7.2 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.7 | 2.9 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.7 | 6.4 | GO:0050684 | regulation of mRNA processing(GO:0050684) |
| 0.7 | 91.6 | GO:0048515 | spermatid differentiation(GO:0048515) |
| 0.7 | 7.1 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
| 0.7 | 2.1 | GO:0031062 | positive regulation of histone methylation(GO:0031062) |
| 0.7 | 2.1 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.7 | 1.4 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.7 | 7.1 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
| 0.7 | 7.0 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.7 | 6.3 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.7 | 11.1 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.7 | 3.5 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
| 0.7 | 6.9 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.7 | 1.4 | GO:0038158 | granulocyte colony-stimulating factor signaling pathway(GO:0038158) |
| 0.7 | 1.4 | GO:1990523 | bone regeneration(GO:1990523) |
| 0.7 | 7.6 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
| 0.7 | 4.9 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.7 | 5.5 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.7 | 21.4 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.7 | 0.7 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.7 | 2.8 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
| 0.7 | 15.2 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.7 | 1.4 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.7 | 9.6 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
| 0.7 | 8.2 | GO:0016925 | protein sumoylation(GO:0016925) |
| 0.7 | 26.6 | GO:0000724 | double-strand break repair via homologous recombination(GO:0000724) |
| 0.7 | 4.8 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.7 | 10.2 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.7 | 2.0 | GO:0098543 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.7 | 0.7 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
| 0.7 | 13.6 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.7 | 2.7 | GO:0014738 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 0.7 | 11.5 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.7 | 3.4 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.7 | 1.3 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.7 | 1.3 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.7 | 2.7 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.7 | 21.9 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
| 0.7 | 2.0 | GO:0060014 | granulosa cell differentiation(GO:0060014) |
| 0.7 | 123.1 | GO:0008380 | RNA splicing(GO:0008380) |
| 0.7 | 0.7 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.7 | 4.6 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.7 | 1.3 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.7 | 2.0 | GO:0002729 | positive regulation of natural killer cell cytokine production(GO:0002729) |
| 0.7 | 3.9 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.7 | 19.0 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.7 | 2.0 | GO:2001226 | negative regulation of chloride transport(GO:2001226) |
| 0.7 | 2.0 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.7 | 3.3 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.6 | 2.6 | GO:0060087 | relaxation of smooth muscle(GO:0044557) relaxation of vascular smooth muscle(GO:0060087) |
| 0.6 | 2.6 | GO:0045061 | thymic T cell selection(GO:0045061) |
| 0.6 | 4.5 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.6 | 8.3 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
| 0.6 | 3.8 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.6 | 3.2 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.6 | 1.3 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.6 | 1.9 | GO:0015675 | nickel cation transport(GO:0015675) vanadium ion transport(GO:0015676) lead ion transport(GO:0015692) nickel cation transmembrane transport(GO:0035444) |
| 0.6 | 3.2 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
| 0.6 | 5.7 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.6 | 1.3 | GO:0002876 | positive regulation of chronic inflammatory response to antigenic stimulus(GO:0002876) |
| 0.6 | 1.3 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.6 | 1.3 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.6 | 2.5 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.6 | 10.1 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.6 | 0.6 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.6 | 1.9 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.6 | 6.3 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.6 | 9.4 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.6 | 2.5 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.6 | 1.2 | GO:0043628 | ncRNA 3'-end processing(GO:0043628) |
| 0.6 | 1.2 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.6 | 2.5 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.6 | 1.2 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
| 0.6 | 7.8 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.6 | 3.0 | GO:0010575 | positive regulation of vascular endothelial growth factor production(GO:0010575) |
| 0.6 | 0.6 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
| 0.6 | 3.5 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.6 | 1.2 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
| 0.6 | 6.5 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.6 | 1.2 | GO:0009301 | snRNA transcription(GO:0009301) |
| 0.6 | 1.8 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
| 0.6 | 1.8 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.6 | 1.7 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
| 0.6 | 2.3 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) protein transport into plasma membrane raft(GO:0044861) |
| 0.6 | 1.7 | GO:1904181 | positive regulation of mitochondrial depolarization(GO:0051901) positive regulation of membrane depolarization(GO:1904181) |
| 0.6 | 2.9 | GO:0034968 | histone lysine methylation(GO:0034968) |
| 0.6 | 3.4 | GO:0007099 | centriole replication(GO:0007099) |
| 0.6 | 2.3 | GO:0098792 | xenophagy(GO:0098792) |
| 0.6 | 8.0 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.6 | 9.0 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.6 | 1.7 | GO:0035036 | sperm-egg recognition(GO:0035036) |
| 0.6 | 1.7 | GO:0061525 | hindgut development(GO:0061525) |
| 0.6 | 8.3 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.6 | 1.7 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.6 | 1.7 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
| 0.5 | 3.8 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.5 | 3.8 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.5 | 2.2 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.5 | 1.6 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.5 | 6.6 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
| 0.5 | 1.1 | GO:0002158 | osteoclast proliferation(GO:0002158) |
| 0.5 | 10.8 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.5 | 1.1 | GO:0014721 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
| 0.5 | 4.3 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.5 | 2.1 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
| 0.5 | 7.0 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
| 0.5 | 1.6 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.5 | 3.2 | GO:1905049 | negative regulation of metallopeptidase activity(GO:1905049) |
| 0.5 | 1.6 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
| 0.5 | 18.1 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.5 | 11.7 | GO:0006342 | chromatin silencing(GO:0006342) |
| 0.5 | 4.8 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.5 | 0.5 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.5 | 1.6 | GO:0048820 | hair follicle maturation(GO:0048820) |
| 0.5 | 3.7 | GO:0045581 | negative regulation of T cell differentiation(GO:0045581) |
| 0.5 | 1.1 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
| 0.5 | 7.8 | GO:0055013 | cardiac muscle cell development(GO:0055013) |
| 0.5 | 10.4 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.5 | 1.0 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.5 | 0.5 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.5 | 3.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.5 | 20.2 | GO:0035914 | skeletal muscle cell differentiation(GO:0035914) |
| 0.5 | 2.1 | GO:0035994 | response to muscle stretch(GO:0035994) |
| 0.5 | 1.0 | GO:1904672 | regulation of somatic stem cell population maintenance(GO:1904672) positive regulation of somatic stem cell population maintenance(GO:1904674) |
| 0.5 | 6.7 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.5 | 3.6 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
| 0.5 | 2.0 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.5 | 6.6 | GO:1900424 | regulation of defense response to bacterium(GO:1900424) |
| 0.5 | 16.2 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.5 | 10.1 | GO:0000819 | sister chromatid segregation(GO:0000819) |
| 0.5 | 0.5 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.5 | 2.5 | GO:1903147 | negative regulation of macromitophagy(GO:1901525) negative regulation of mitophagy(GO:1903147) |
| 0.5 | 5.5 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.5 | 4.5 | GO:0033008 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.5 | 1.0 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.5 | 0.5 | GO:0032075 | positive regulation of nuclease activity(GO:0032075) |
| 0.5 | 2.5 | GO:0032461 | positive regulation of protein oligomerization(GO:0032461) |
| 0.5 | 4.5 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.5 | 1.0 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.5 | 1.0 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.5 | 1.5 | GO:0045575 | basophil activation(GO:0045575) |
| 0.5 | 1.0 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.5 | 1.5 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.5 | 1.0 | GO:0019323 | pentose catabolic process(GO:0019323) |
| 0.5 | 2.0 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.5 | 1.5 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.5 | 1.0 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
| 0.5 | 5.4 | GO:0055012 | ventricular cardiac muscle cell differentiation(GO:0055012) |
| 0.5 | 1.0 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.5 | 2.0 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.5 | 3.9 | GO:0055095 | lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
| 0.5 | 6.7 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.5 | 1.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.5 | 5.2 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.5 | 10.0 | GO:0002260 | lymphocyte homeostasis(GO:0002260) |
| 0.5 | 2.8 | GO:0014037 | Schwann cell differentiation(GO:0014037) |
| 0.5 | 8.0 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.5 | 1.4 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.5 | 2.8 | GO:0048069 | eye pigmentation(GO:0048069) |
| 0.5 | 1.4 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.5 | 2.8 | GO:0051310 | metaphase plate congression(GO:0051310) |
| 0.5 | 0.5 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.5 | 2.8 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.5 | 0.9 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.5 | 3.2 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.5 | 3.2 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.5 | 43.3 | GO:0006364 | rRNA processing(GO:0006364) |
| 0.5 | 0.5 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.5 | 47.2 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.5 | 9.0 | GO:1903146 | regulation of mitophagy(GO:1903146) |
| 0.4 | 0.9 | GO:1903373 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) positive regulation of endoplasmic reticulum tubular network organization(GO:1903373) |
| 0.4 | 0.9 | GO:0038161 | prolactin signaling pathway(GO:0038161) regulation of glucocorticoid mediated signaling pathway(GO:1900169) negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) regulation of prolactin signaling pathway(GO:1902211) |
| 0.4 | 2.2 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.4 | 0.9 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.4 | 11.1 | GO:0048747 | muscle fiber development(GO:0048747) |
| 0.4 | 1.3 | GO:1904009 | cellular response to monosodium glutamate(GO:1904009) |
| 0.4 | 1.8 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.4 | 1.3 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.4 | 6.6 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.4 | 1.8 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
| 0.4 | 0.9 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.4 | 0.9 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.4 | 2.2 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.4 | 0.4 | GO:0060338 | regulation of type I interferon-mediated signaling pathway(GO:0060338) |
| 0.4 | 1.7 | GO:0006598 | polyamine catabolic process(GO:0006598) |
| 0.4 | 1.7 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.4 | 1.3 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.4 | 19.4 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
| 0.4 | 1.3 | GO:0032218 | riboflavin transport(GO:0032218) |
| 0.4 | 1.7 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.4 | 3.3 | GO:0038202 | TORC1 signaling(GO:0038202) |
| 0.4 | 5.7 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.4 | 2.8 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.4 | 2.8 | GO:0060412 | ventricular septum morphogenesis(GO:0060412) |
| 0.4 | 0.8 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.4 | 8.0 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.4 | 0.8 | GO:0060370 | susceptibility to T cell mediated cytotoxicity(GO:0060370) |
| 0.4 | 0.4 | GO:1904031 | positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.4 | 3.2 | GO:0032435 | negative regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032435) |
| 0.4 | 2.0 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.4 | 1.2 | GO:0008078 | mesodermal cell migration(GO:0008078) |
| 0.4 | 2.4 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.4 | 2.0 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.4 | 0.8 | GO:0090178 | regulation of establishment of planar polarity involved in neural tube closure(GO:0090178) planar cell polarity pathway involved in neural tube closure(GO:0090179) |
| 0.4 | 1.6 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.4 | 2.3 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
| 0.4 | 1.5 | GO:0071481 | cellular response to X-ray(GO:0071481) |
| 0.4 | 1.5 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.4 | 1.5 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
| 0.4 | 3.8 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.4 | 1.9 | GO:0033591 | response to L-ascorbic acid(GO:0033591) |
| 0.4 | 3.0 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.4 | 2.6 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.4 | 1.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.4 | 1.8 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.4 | 3.3 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
| 0.4 | 1.8 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.4 | 0.7 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.4 | 1.5 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
| 0.4 | 0.7 | GO:0071104 | response to interleukin-9(GO:0071104) |
| 0.4 | 0.7 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) |
| 0.4 | 1.1 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
| 0.4 | 4.0 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
| 0.4 | 2.2 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
| 0.4 | 1.4 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.4 | 1.4 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.4 | 3.9 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.4 | 1.1 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.4 | 2.1 | GO:0010818 | T cell chemotaxis(GO:0010818) |
| 0.4 | 0.4 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
| 0.4 | 6.3 | GO:0032528 | microvillus organization(GO:0032528) |
| 0.3 | 1.7 | GO:0036336 | dendritic cell migration(GO:0036336) |
| 0.3 | 3.4 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
| 0.3 | 0.3 | GO:1990009 | retinal cell apoptotic process(GO:1990009) |
| 0.3 | 8.2 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
| 0.3 | 1.7 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.3 | 2.0 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
| 0.3 | 0.7 | GO:2000544 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
| 0.3 | 4.4 | GO:0006302 | double-strand break repair(GO:0006302) |
| 0.3 | 0.3 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
| 0.3 | 7.3 | GO:0030512 | negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) |
| 0.3 | 1.7 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.3 | 1.3 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
| 0.3 | 3.2 | GO:0042407 | cristae formation(GO:0042407) |
| 0.3 | 2.3 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.3 | 1.3 | GO:0060005 | vestibular reflex(GO:0060005) |
| 0.3 | 2.9 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.3 | 4.8 | GO:0001658 | branching involved in ureteric bud morphogenesis(GO:0001658) |
| 0.3 | 1.6 | GO:0015855 | pyrimidine nucleobase transport(GO:0015855) |
| 0.3 | 2.5 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.3 | 0.9 | GO:0033385 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.3 | 0.9 | GO:0000105 | histidine biosynthetic process(GO:0000105) |
| 0.3 | 1.2 | GO:0006907 | pinocytosis(GO:0006907) |
| 0.3 | 3.7 | GO:0016441 | posttranscriptional gene silencing(GO:0016441) |
| 0.3 | 1.5 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.3 | 2.4 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.3 | 0.9 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.3 | 0.6 | GO:0071600 | otic vesicle morphogenesis(GO:0071600) |
| 0.3 | 1.8 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
| 0.3 | 0.9 | GO:2001106 | regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.3 | 8.9 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.3 | 0.9 | GO:0001556 | oocyte maturation(GO:0001556) |
| 0.3 | 0.9 | GO:0098939 | dendritic transport of mitochondrion(GO:0098939) anterograde dendritic transport of mitochondrion(GO:0098972) |
| 0.3 | 14.8 | GO:0006413 | translational initiation(GO:0006413) |
| 0.3 | 0.3 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.3 | 2.6 | GO:0032495 | response to muramyl dipeptide(GO:0032495) |
| 0.3 | 4.0 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.3 | 3.5 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.3 | 4.2 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 0.3 | 0.6 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.3 | 1.9 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.3 | 6.6 | GO:0033209 | tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.3 | 1.6 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.3 | 3.8 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.3 | 5.5 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.3 | 1.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.3 | 1.9 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
| 0.3 | 0.8 | GO:0090481 | pyrimidine nucleotide-sugar transmembrane transport(GO:0090481) |
| 0.3 | 5.3 | GO:0046326 | positive regulation of glucose import(GO:0046326) |
| 0.3 | 1.8 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.3 | 1.6 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.3 | 2.9 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.3 | 7.8 | GO:0006414 | translational elongation(GO:0006414) |
| 0.3 | 3.6 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.3 | 2.3 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.3 | 0.3 | GO:1900063 | regulation of peroxisome organization(GO:1900063) |
| 0.3 | 0.8 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 0.3 | 4.8 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.3 | 0.5 | GO:1903672 | positive regulation of sprouting angiogenesis(GO:1903672) |
| 0.3 | 1.5 | GO:0000726 | non-recombinational repair(GO:0000726) |
| 0.2 | 5.5 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.2 | 2.5 | GO:0002507 | tolerance induction(GO:0002507) |
| 0.2 | 1.2 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.2 | 0.2 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.2 | 5.1 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
| 0.2 | 1.4 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
| 0.2 | 1.2 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.2 | 1.9 | GO:0006405 | RNA export from nucleus(GO:0006405) |
| 0.2 | 2.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.2 | 2.3 | GO:1903321 | negative regulation of protein modification by small protein conjugation or removal(GO:1903321) |
| 0.2 | 0.7 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.2 | 0.2 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
| 0.2 | 2.0 | GO:0015747 | urate transport(GO:0015747) |
| 0.2 | 0.7 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.2 | 1.6 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.2 | 1.3 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.2 | 0.7 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.2 | 6.1 | GO:1901998 | toxin transport(GO:1901998) |
| 0.2 | 0.6 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
| 0.2 | 2.1 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.2 | 2.2 | GO:0006949 | syncytium formation(GO:0006949) |
| 0.2 | 0.2 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
| 0.2 | 1.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.2 | 0.6 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.2 | 2.1 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
| 0.2 | 1.2 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.2 | 0.4 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.2 | 1.3 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.2 | 1.2 | GO:0016571 | histone methylation(GO:0016571) |
| 0.2 | 0.2 | GO:0014908 | myotube differentiation involved in skeletal muscle regeneration(GO:0014908) |
| 0.2 | 0.4 | GO:0046813 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.2 | 0.7 | GO:0009111 | vitamin catabolic process(GO:0009111) |
| 0.2 | 0.6 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
| 0.2 | 0.4 | GO:0033505 | floor plate formation(GO:0021508) floor plate morphogenesis(GO:0033505) |
| 0.2 | 1.4 | GO:0033173 | calcineurin-NFAT signaling cascade(GO:0033173) regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.2 | 5.0 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.2 | 0.5 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.2 | 0.9 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.2 | 0.9 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
| 0.2 | 1.4 | GO:0035066 | positive regulation of histone acetylation(GO:0035066) |
| 0.2 | 5.1 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
| 0.2 | 1.2 | GO:0070253 | somatostatin secretion(GO:0070253) |
| 0.2 | 0.3 | GO:0021897 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.2 | 1.5 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
| 0.2 | 1.2 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.2 | 2.3 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
| 0.2 | 0.5 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
| 0.2 | 0.8 | GO:0003085 | negative regulation of systemic arterial blood pressure(GO:0003085) |
| 0.2 | 1.8 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.2 | 0.6 | GO:0070266 | necroptotic process(GO:0070266) |
| 0.2 | 1.0 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
| 0.2 | 1.3 | GO:0070193 | synaptonemal complex organization(GO:0070193) |
| 0.2 | 0.5 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.2 | 0.3 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.2 | 0.3 | GO:0032480 | negative regulation of type I interferon production(GO:0032480) |
| 0.2 | 0.6 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.2 | 0.5 | GO:0032205 | negative regulation of telomere maintenance(GO:0032205) |
| 0.2 | 3.5 | GO:0043124 | negative regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043124) |
| 0.1 | 0.3 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.1 | 0.6 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.1 | 1.0 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 | 6.4 | GO:0006323 | DNA packaging(GO:0006323) |
| 0.1 | 1.0 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
| 0.1 | 0.1 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
| 0.1 | 1.3 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
| 0.1 | 0.9 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.1 | 0.9 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.1 | 0.1 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.1 | 0.3 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
| 0.1 | 0.7 | GO:0032274 | gonadotropin secretion(GO:0032274) |
| 0.1 | 0.4 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.1 | 0.3 | GO:0006235 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) |
| 0.1 | 0.6 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
| 0.1 | 1.4 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 0.1 | 0.1 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.1 | 0.5 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 | 0.2 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.1 | 0.8 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 | 0.5 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 0.7 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.1 | 0.5 | GO:1904044 | response to aldosterone(GO:1904044) |
| 0.1 | 1.0 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.1 | 0.6 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
| 0.1 | 0.3 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
| 0.1 | 0.3 | GO:0038084 | vascular endothelial growth factor signaling pathway(GO:0038084) |
| 0.1 | 0.1 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.1 | 0.3 | GO:0071529 | cementum mineralization(GO:0071529) |
| 0.1 | 0.8 | GO:0044346 | fibroblast apoptotic process(GO:0044346) |
| 0.1 | 1.8 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
| 0.1 | 2.3 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
| 0.1 | 0.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 2.7 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.1 | 2.0 | GO:0018393 | internal peptidyl-lysine acetylation(GO:0018393) |
| 0.1 | 0.9 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.1 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 | 0.5 | GO:0061737 | leukotriene signaling pathway(GO:0061737) |
| 0.1 | 0.3 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.1 | 0.4 | GO:0044598 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 | 15.8 | GO:0007283 | spermatogenesis(GO:0007283) |
| 0.1 | 0.6 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.1 | 0.2 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.1 | 0.4 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.1 | 4.5 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.1 | 0.4 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.1 | 1.4 | GO:0051168 | nuclear export(GO:0051168) |
| 0.1 | 0.3 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
| 0.1 | 1.5 | GO:0097503 | sialylation(GO:0097503) |
| 0.1 | 0.1 | GO:0071409 | cellular response to cycloheximide(GO:0071409) |
| 0.1 | 0.1 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.2 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.1 | 0.6 | GO:0070265 | necrotic cell death(GO:0070265) |
| 0.1 | 0.6 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
| 0.1 | 0.2 | GO:0097032 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
| 0.1 | 0.3 | GO:0060972 | left/right pattern formation(GO:0060972) |
| 0.1 | 0.2 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.1 | 0.1 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.1 | 0.2 | GO:2000194 | regulation of female gonad development(GO:2000194) |
| 0.1 | 0.1 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
| 0.1 | 0.5 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.3 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
| 0.0 | 0.4 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
| 0.0 | 0.3 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.0 | 0.1 | GO:2001169 | regulation of ATP biosynthetic process(GO:2001169) positive regulation of ATP biosynthetic process(GO:2001171) |
| 0.0 | 0.4 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.0 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.0 | 0.3 | GO:0030318 | melanocyte differentiation(GO:0030318) |
| 0.0 | 0.3 | GO:0042073 | intraciliary transport(GO:0042073) |
| 0.0 | 0.3 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.0 | 0.2 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.0 | 0.1 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
| 0.0 | 0.0 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.0 | 0.4 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.1 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.0 | 0.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.1 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 | 0.1 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 14.1 | 84.6 | GO:0071547 | piP-body(GO:0071547) |
| 8.3 | 33.3 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 7.7 | 23.0 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 7.0 | 20.9 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 6.1 | 18.3 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
| 6.0 | 23.9 | GO:0031436 | BRCA1-BARD1 complex(GO:0031436) |
| 5.7 | 34.2 | GO:0071546 | pi-body(GO:0071546) |
| 5.5 | 11.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 4.9 | 4.9 | GO:0000803 | sex chromosome(GO:0000803) |
| 4.9 | 19.5 | GO:0042585 | germinal vesicle(GO:0042585) |
| 4.7 | 32.7 | GO:0001739 | sex chromatin(GO:0001739) |
| 4.7 | 27.9 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 4.4 | 13.2 | GO:0000802 | transverse filament(GO:0000802) |
| 4.3 | 21.6 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 4.3 | 12.8 | GO:0043511 | inhibin complex(GO:0043511) |
| 4.2 | 12.6 | GO:1990423 | RZZ complex(GO:1990423) |
| 4.2 | 16.6 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 4.1 | 41.3 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 4.1 | 16.3 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 4.0 | 12.0 | GO:1990796 | photoreceptor cell terminal bouton(GO:1990796) |
| 4.0 | 12.0 | GO:0033018 | sarcoplasmic reticulum lumen(GO:0033018) |
| 3.9 | 66.7 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 3.9 | 42.6 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
| 3.8 | 11.4 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 3.7 | 26.0 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 3.6 | 10.7 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 3.5 | 10.4 | GO:0005745 | m-AAA complex(GO:0005745) |
| 3.5 | 24.2 | GO:0000796 | condensin complex(GO:0000796) |
| 3.4 | 6.8 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 3.4 | 20.3 | GO:0001940 | male pronucleus(GO:0001940) |
| 3.4 | 20.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 3.4 | 6.7 | GO:0071148 | TEAD-1-YAP complex(GO:0071148) |
| 3.3 | 16.6 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 3.3 | 6.6 | GO:1990037 | Lewy body core(GO:1990037) |
| 3.3 | 32.5 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 3.2 | 9.6 | GO:0032173 | septin collar(GO:0032173) |
| 3.2 | 19.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 3.1 | 9.3 | GO:0097124 | cyclin A2-CDK2 complex(GO:0097124) |
| 3.1 | 12.4 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
| 3.0 | 30.3 | GO:0035102 | PRC1 complex(GO:0035102) |
| 3.0 | 21.1 | GO:0001652 | granular component(GO:0001652) |
| 3.0 | 21.1 | GO:0005827 | polar microtubule(GO:0005827) |
| 3.0 | 9.0 | GO:0097125 | cyclin B1-CDK1 complex(GO:0097125) |
| 3.0 | 29.9 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 3.0 | 29.7 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 2.9 | 11.8 | GO:0097196 | Shu complex(GO:0097196) |
| 2.9 | 11.5 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 2.9 | 14.4 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 2.8 | 8.4 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
| 2.8 | 25.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 2.8 | 16.7 | GO:1990393 | 3M complex(GO:1990393) |
| 2.8 | 8.3 | GO:0005713 | recombination nodule(GO:0005713) |
| 2.8 | 11.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 2.7 | 22.0 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 2.7 | 21.9 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 2.7 | 16.3 | GO:0000125 | PCAF complex(GO:0000125) |
| 2.7 | 8.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 2.7 | 13.3 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 2.7 | 37.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 2.6 | 13.2 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 2.6 | 10.4 | GO:0031417 | NatC complex(GO:0031417) |
| 2.6 | 18.0 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 2.6 | 25.6 | GO:0070652 | HAUS complex(GO:0070652) |
| 2.5 | 10.2 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 2.5 | 14.8 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 2.5 | 27.0 | GO:0071564 | npBAF complex(GO:0071564) |
| 2.4 | 48.7 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 2.4 | 12.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 2.4 | 21.7 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 2.4 | 7.1 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 2.4 | 9.4 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 2.3 | 16.4 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 2.3 | 7.0 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
| 2.3 | 28.0 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 2.3 | 16.3 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 2.3 | 4.7 | GO:1990923 | PET complex(GO:1990923) |
| 2.3 | 41.9 | GO:0001520 | outer dense fiber(GO:0001520) |
| 2.3 | 9.3 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 2.3 | 6.9 | GO:0000812 | Swr1 complex(GO:0000812) |
| 2.2 | 22.5 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 2.2 | 35.8 | GO:0001741 | XY body(GO:0001741) |
| 2.2 | 17.8 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) |
| 2.2 | 4.4 | GO:0044393 | microspike(GO:0044393) |
| 2.2 | 4.4 | GO:1990005 | granular vesicle(GO:1990005) |
| 2.2 | 6.5 | GO:0000811 | GINS complex(GO:0000811) |
| 2.2 | 17.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 2.1 | 10.7 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 2.1 | 10.7 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 2.1 | 6.4 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 2.1 | 4.3 | GO:0008091 | spectrin(GO:0008091) |
| 2.1 | 2.1 | GO:0005869 | dynactin complex(GO:0005869) |
| 2.1 | 8.4 | GO:0034774 | secretory granule lumen(GO:0034774) |
| 2.1 | 18.6 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 2.1 | 14.4 | GO:0071203 | WASH complex(GO:0071203) |
| 2.1 | 8.2 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 2.1 | 106.6 | GO:0005844 | polysome(GO:0005844) |
| 2.0 | 6.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 2.0 | 31.9 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 2.0 | 31.6 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 2.0 | 17.7 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 2.0 | 9.8 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 1.9 | 3.8 | GO:0032301 | MutSalpha complex(GO:0032301) |
| 1.9 | 5.7 | GO:0035692 | macrophage migration inhibitory factor receptor complex(GO:0035692) |
| 1.9 | 20.9 | GO:0072687 | meiotic spindle(GO:0072687) |
| 1.9 | 17.0 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 1.9 | 11.3 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 1.9 | 13.1 | GO:0045495 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 1.9 | 5.6 | GO:0033557 | Slx1-Slx4 complex(GO:0033557) |
| 1.9 | 13.0 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 1.8 | 18.4 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 1.8 | 152.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 1.8 | 3.6 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 1.8 | 32.1 | GO:0005916 | fascia adherens(GO:0005916) |
| 1.7 | 10.5 | GO:0030914 | STAGA complex(GO:0030914) |
| 1.7 | 3.5 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 1.7 | 19.1 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 1.7 | 8.6 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 1.7 | 6.8 | GO:0005683 | U7 snRNP(GO:0005683) |
| 1.7 | 17.0 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 1.7 | 32.0 | GO:0030056 | hemidesmosome(GO:0030056) |
| 1.7 | 5.0 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 1.7 | 15.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 1.7 | 6.7 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 1.7 | 11.7 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 1.7 | 23.3 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 1.6 | 26.3 | GO:0005685 | U1 snRNP(GO:0005685) |
| 1.6 | 13.0 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 1.6 | 16.1 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 1.6 | 6.4 | GO:0072487 | MSL complex(GO:0072487) |
| 1.6 | 184.5 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
| 1.6 | 23.8 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 1.6 | 25.3 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 1.6 | 1.6 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 1.6 | 6.2 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 1.6 | 4.7 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
| 1.6 | 9.3 | GO:0036396 | MIS complex(GO:0036396) |
| 1.6 | 9.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 1.5 | 20.1 | GO:0000793 | condensed chromosome(GO:0000793) |
| 1.5 | 30.9 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 1.5 | 3.1 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 1.5 | 13.9 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 1.5 | 36.9 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 1.5 | 13.8 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 1.5 | 7.6 | GO:1990130 | Iml1 complex(GO:1990130) |
| 1.5 | 21.3 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 1.5 | 32.9 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 1.5 | 7.4 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 1.5 | 24.9 | GO:1902562 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 1.5 | 8.7 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 1.5 | 1.5 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 1.4 | 4.3 | GO:0036117 | hyaluranon cable(GO:0036117) |
| 1.4 | 26.0 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 1.4 | 7.2 | GO:0030689 | Noc complex(GO:0030689) |
| 1.4 | 24.1 | GO:0031519 | PcG protein complex(GO:0031519) |
| 1.4 | 11.3 | GO:0036464 | cytoplasmic ribonucleoprotein granule(GO:0036464) |
| 1.4 | 2.8 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 1.4 | 4.2 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 1.4 | 20.8 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 1.4 | 11.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 1.4 | 2.8 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 1.4 | 8.2 | GO:0036128 | CatSper complex(GO:0036128) |
| 1.3 | 16.1 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 1.3 | 5.3 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 1.3 | 18.5 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 1.3 | 11.7 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 1.3 | 11.7 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
| 1.3 | 6.4 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 1.3 | 1.3 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
| 1.3 | 3.8 | GO:0044317 | rod spherule(GO:0044317) |
| 1.3 | 3.8 | GO:0055087 | Ski complex(GO:0055087) |
| 1.3 | 25.4 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 1.3 | 5.1 | GO:0018444 | translation release factor complex(GO:0018444) |
| 1.3 | 19.0 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
| 1.3 | 8.9 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 1.3 | 2.5 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
| 1.3 | 53.8 | GO:0016235 | aggresome(GO:0016235) |
| 1.3 | 17.5 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 1.2 | 9.9 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 1.2 | 6.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 1.2 | 3.7 | GO:0061673 | mitotic spindle astral microtubule(GO:0061673) |
| 1.2 | 60.6 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 1.2 | 4.9 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
| 1.2 | 3.6 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 1.2 | 6.0 | GO:0070695 | FHF complex(GO:0070695) |
| 1.2 | 5.9 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 1.2 | 1.2 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 1.2 | 4.7 | GO:0071797 | LUBAC complex(GO:0071797) |
| 1.2 | 38.3 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 1.2 | 4.6 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 1.2 | 11.5 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 1.2 | 50.7 | GO:0045171 | intercellular bridge(GO:0045171) |
| 1.1 | 26.4 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 1.1 | 5.6 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 1.1 | 100.2 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 1.1 | 93.4 | GO:0044815 | DNA packaging complex(GO:0044815) |
| 1.1 | 6.6 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 1.1 | 6.6 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 1.1 | 8.8 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 1.1 | 12.1 | GO:0010369 | chromocenter(GO:0010369) |
| 1.1 | 14.1 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 1.1 | 4.3 | GO:0042382 | paraspeckles(GO:0042382) |
| 1.1 | 14.0 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 1.1 | 4.3 | GO:0098536 | deuterosome(GO:0098536) |
| 1.1 | 86.7 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 1.1 | 16.0 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 1.1 | 46.4 | GO:0032420 | stereocilium(GO:0032420) |
| 1.0 | 18.5 | GO:0005614 | interstitial matrix(GO:0005614) |
| 1.0 | 11.2 | GO:0005686 | U2 snRNP(GO:0005686) |
| 1.0 | 5.0 | GO:0071953 | elastic fiber(GO:0071953) |
| 1.0 | 5.9 | GO:0090543 | Flemming body(GO:0090543) |
| 1.0 | 4.9 | GO:0034455 | t-UTP complex(GO:0034455) |
| 1.0 | 1.0 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 1.0 | 2.9 | GO:0044609 | DBIRD complex(GO:0044609) |
| 1.0 | 8.7 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 1.0 | 17.4 | GO:0035861 | site of double-strand break(GO:0035861) |
| 1.0 | 3.8 | GO:0014704 | intercalated disc(GO:0014704) |
| 1.0 | 53.8 | GO:0000776 | kinetochore(GO:0000776) |
| 1.0 | 74.8 | GO:0016605 | PML body(GO:0016605) |
| 1.0 | 7.6 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.9 | 0.9 | GO:0019013 | viral nucleocapsid(GO:0019013) |
| 0.9 | 3.8 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.9 | 104.8 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.9 | 6.5 | GO:0090544 | BAF-type complex(GO:0090544) |
| 0.9 | 4.6 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.9 | 43.9 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
| 0.9 | 10.9 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
| 0.9 | 2.7 | GO:0033503 | HULC complex(GO:0033503) |
| 0.9 | 25.3 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.9 | 1.8 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.9 | 8.9 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.9 | 1.8 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.9 | 2.7 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.9 | 12.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.9 | 13.2 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.9 | 32.2 | GO:0016592 | mediator complex(GO:0016592) |
| 0.9 | 4.3 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.9 | 9.5 | GO:0005605 | basal lamina(GO:0005605) |
| 0.9 | 3.5 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.9 | 2.6 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.9 | 2.6 | GO:0005760 | gamma DNA polymerase complex(GO:0005760) |
| 0.9 | 7.7 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.9 | 23.9 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.9 | 23.0 | GO:0043034 | costamere(GO:0043034) |
| 0.8 | 16.1 | GO:0030904 | retromer complex(GO:0030904) |
| 0.8 | 2.5 | GO:0045283 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) fumarate reductase complex(GO:0045283) |
| 0.8 | 18.6 | GO:0031430 | M band(GO:0031430) |
| 0.8 | 5.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.8 | 21.9 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.8 | 1.7 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
| 0.8 | 5.8 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.8 | 10.7 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.8 | 2.5 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.8 | 4.9 | GO:0034518 | RNA cap binding complex(GO:0034518) |
| 0.8 | 7.3 | GO:0042555 | MCM complex(GO:0042555) |
| 0.8 | 6.5 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.8 | 2.4 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.8 | 3.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) IRE1-RACK1-PP2A complex(GO:1990630) |
| 0.8 | 33.5 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.8 | 1.6 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.8 | 58.5 | GO:0032432 | actin filament bundle(GO:0032432) |
| 0.8 | 34.0 | GO:0030286 | dynein complex(GO:0030286) |
| 0.8 | 48.8 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
| 0.8 | 1.6 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.8 | 3.9 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.8 | 2.3 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.8 | 2.3 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.8 | 3.9 | GO:0043293 | apoptosome(GO:0043293) |
| 0.8 | 10.0 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.8 | 1.5 | GO:0060205 | cytoplasmic membrane-bounded vesicle lumen(GO:0060205) |
| 0.8 | 3.0 | GO:0030891 | VCB complex(GO:0030891) |
| 0.7 | 6.0 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.7 | 2.2 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.7 | 2.9 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
| 0.7 | 149.1 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.7 | 9.4 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.7 | 15.0 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.7 | 2.9 | GO:0043219 | lateral loop(GO:0043219) |
| 0.7 | 311.1 | GO:0016604 | nuclear body(GO:0016604) |
| 0.7 | 2.8 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.7 | 11.3 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.7 | 4.9 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.7 | 4.9 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.7 | 2.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.7 | 2.0 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.7 | 4.1 | GO:0016011 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
| 0.7 | 2.0 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.7 | 6.1 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.7 | 14.1 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
| 0.7 | 3.3 | GO:0097361 | CIA complex(GO:0097361) |
| 0.7 | 7.3 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.7 | 9.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.7 | 23.7 | GO:0002102 | podosome(GO:0002102) |
| 0.7 | 2.0 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.6 | 5.8 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.6 | 56.3 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.6 | 56.8 | GO:0031674 | I band(GO:0031674) |
| 0.6 | 29.5 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.6 | 19.9 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.6 | 2.5 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.6 | 4.3 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.6 | 4.2 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.6 | 1.8 | GO:0019814 | immunoglobulin complex(GO:0019814) |
| 0.6 | 4.1 | GO:0035770 | ribonucleoprotein granule(GO:0035770) |
| 0.6 | 3.5 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.6 | 4.0 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.6 | 5.0 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.6 | 5.0 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.6 | 3.9 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.5 | 1.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.5 | 2.7 | GO:0005638 | lamin filament(GO:0005638) |
| 0.5 | 2.7 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.5 | 1.6 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.5 | 1.5 | GO:0008537 | proteasome activator complex(GO:0008537) |
| 0.5 | 6.7 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.5 | 7.1 | GO:0032039 | integrator complex(GO:0032039) |
| 0.5 | 2.5 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.5 | 0.5 | GO:0045273 | respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) |
| 0.5 | 2.0 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.5 | 141.4 | GO:0005813 | centrosome(GO:0005813) |
| 0.5 | 29.8 | GO:0031514 | motile cilium(GO:0031514) |
| 0.5 | 3.0 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.5 | 29.4 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.5 | 2.9 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.5 | 1.4 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.5 | 10.7 | GO:0008305 | integrin complex(GO:0008305) |
| 0.5 | 11.5 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.5 | 0.9 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.4 | 2.7 | GO:0042825 | TAP complex(GO:0042825) |
| 0.4 | 29.1 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.4 | 3.5 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.4 | 4.8 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.4 | 1.7 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
| 0.4 | 78.7 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
| 0.4 | 239.2 | GO:0005730 | nucleolus(GO:0005730) |
| 0.4 | 1.2 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.4 | 4.9 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.4 | 2.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.4 | 6.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.4 | 16.3 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.4 | 1.2 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.4 | 37.3 | GO:0042383 | sarcolemma(GO:0042383) |
| 0.4 | 3.5 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.4 | 1.6 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.4 | 0.8 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.4 | 1.1 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.4 | 1.8 | GO:0036038 | MKS complex(GO:0036038) |
| 0.4 | 1.1 | GO:0036452 | ESCRT III complex(GO:0000815) ESCRT complex(GO:0036452) |
| 0.4 | 2.9 | GO:0042581 | specific granule(GO:0042581) |
| 0.4 | 5.8 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.4 | 5.0 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.4 | 0.4 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.3 | 0.7 | GO:0030990 | intraciliary transport particle(GO:0030990) |
| 0.3 | 5.5 | GO:0032993 | protein-DNA complex(GO:0032993) |
| 0.3 | 1.0 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
| 0.3 | 0.7 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.3 | 2.3 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.3 | 2.2 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.3 | 1.7 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.3 | 2.9 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.3 | 0.6 | GO:1903349 | omegasome membrane(GO:1903349) omegasome(GO:1990462) |
| 0.3 | 12.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.3 | 3.3 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
| 0.3 | 47.7 | GO:0005694 | chromosome(GO:0005694) |
| 0.3 | 1.3 | GO:0031085 | BLOC-3 complex(GO:0031085) |
| 0.3 | 1.6 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.3 | 1.8 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.3 | 252.8 | GO:0005654 | nucleoplasm(GO:0005654) |
| 0.2 | 1.7 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.2 | 14.4 | GO:0030175 | filopodium(GO:0030175) |
| 0.2 | 1.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.2 | 1.3 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.2 | 1.2 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.2 | 5.0 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.2 | 6.9 | GO:0030667 | secretory granule membrane(GO:0030667) |
| 0.2 | 1.8 | GO:0030057 | desmosome(GO:0030057) |
| 0.2 | 0.2 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.2 | 1.9 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.2 | 1.2 | GO:0061702 | inflammasome complex(GO:0061702) |
| 0.2 | 0.8 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.2 | 5.4 | GO:0005901 | caveola(GO:0005901) |
| 0.1 | 0.9 | GO:0044291 | cell-cell contact zone(GO:0044291) |
| 0.1 | 0.8 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.1 | 7.1 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 0.5 | GO:0097546 | ciliary base(GO:0097546) |
| 0.1 | 2.5 | GO:0045259 | proton-transporting ATP synthase complex(GO:0045259) |
| 0.1 | 0.5 | GO:0098636 | protein complex involved in cell adhesion(GO:0098636) |
| 0.1 | 0.5 | GO:0002947 | tumor necrosis factor receptor superfamily complex(GO:0002947) |
| 0.1 | 3.7 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.1 | 247.1 | GO:0005634 | nucleus(GO:0005634) |
| 0.1 | 0.3 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.1 | 5.7 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.1 | 0.2 | GO:0035838 | growing cell tip(GO:0035838) |
| 0.1 | 0.2 | GO:0032421 | stereocilium bundle(GO:0032421) |
| 0.1 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.7 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.2 | GO:0033643 | host cell part(GO:0033643) |
| 0.0 | 0.1 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 12.6 | 37.8 | GO:0031249 | denatured protein binding(GO:0031249) |
| 10.5 | 31.4 | GO:0003922 | GMP synthase activity(GO:0003921) GMP synthase (glutamine-hydrolyzing) activity(GO:0003922) |
| 7.4 | 22.3 | GO:0032427 | GBD domain binding(GO:0032427) |
| 6.8 | 33.8 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 6.5 | 19.4 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 6.3 | 19.0 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
| 6.0 | 18.0 | GO:0031208 | POZ domain binding(GO:0031208) |
| 5.9 | 23.5 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 5.8 | 23.2 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 5.7 | 17.0 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 5.5 | 49.7 | GO:0008494 | translation activator activity(GO:0008494) |
| 5.4 | 16.1 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 5.3 | 16.0 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 5.2 | 20.7 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 4.9 | 19.6 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
| 4.8 | 71.9 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 4.7 | 23.6 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 4.6 | 18.4 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
| 4.6 | 41.1 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
| 4.5 | 26.9 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 4.5 | 22.3 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 4.4 | 13.3 | GO:0042799 | histone methyltransferase activity (H4-K20 specific)(GO:0042799) |
| 4.4 | 57.0 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 4.3 | 13.0 | GO:0016015 | morphogen activity(GO:0016015) |
| 4.2 | 12.5 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 4.0 | 101.0 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 4.0 | 16.1 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 4.0 | 15.9 | GO:0034584 | piRNA binding(GO:0034584) |
| 3.9 | 3.9 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 3.9 | 11.7 | GO:2001070 | starch binding(GO:2001070) |
| 3.9 | 3.9 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
| 3.8 | 34.2 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 3.8 | 11.4 | GO:0016657 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 3.7 | 18.7 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 3.6 | 3.6 | GO:0070538 | oleic acid binding(GO:0070538) |
| 3.6 | 21.6 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 3.5 | 17.7 | GO:0004105 | choline-phosphate cytidylyltransferase activity(GO:0004105) |
| 3.5 | 17.6 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 3.5 | 35.0 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 3.5 | 10.4 | GO:0015203 | polyamine transmembrane transporter activity(GO:0015203) putrescine transmembrane transporter activity(GO:0015489) |
| 3.5 | 13.8 | GO:0042610 | CD8 receptor binding(GO:0042610) |
| 3.4 | 13.7 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 3.4 | 30.7 | GO:0043559 | insulin binding(GO:0043559) |
| 3.4 | 20.4 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 3.4 | 10.1 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
| 3.3 | 10.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 3.3 | 23.3 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 3.3 | 26.5 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 3.3 | 23.2 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 3.3 | 9.8 | GO:0008263 | pyrimidine-specific mismatch base pair DNA N-glycosylase activity(GO:0008263) |
| 3.2 | 9.7 | GO:0043398 | HLH domain binding(GO:0043398) |
| 3.2 | 13.0 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 3.2 | 6.4 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 3.2 | 16.0 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 3.2 | 12.7 | GO:0034431 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
| 3.2 | 9.5 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 3.1 | 12.4 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
| 3.1 | 12.3 | GO:0001159 | core promoter proximal region DNA binding(GO:0001159) |
| 3.0 | 9.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 3.0 | 12.1 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
| 3.0 | 12.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 3.0 | 15.1 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
| 3.0 | 9.0 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) procollagen glucosyltransferase activity(GO:0033823) |
| 3.0 | 11.9 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 2.9 | 32.0 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 2.9 | 14.4 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 2.9 | 25.7 | GO:0043495 | protein anchor(GO:0043495) |
| 2.8 | 19.9 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 2.8 | 8.5 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 2.8 | 11.3 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 2.8 | 19.6 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 2.8 | 8.4 | GO:0004500 | dopamine beta-monooxygenase activity(GO:0004500) |
| 2.8 | 8.4 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 2.7 | 8.2 | GO:0051870 | methotrexate binding(GO:0051870) |
| 2.7 | 46.5 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 2.7 | 220.6 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 2.7 | 13.6 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 2.7 | 8.1 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
| 2.7 | 13.4 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 2.6 | 10.5 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 2.6 | 80.2 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 2.6 | 2.6 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 2.6 | 18.0 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 2.6 | 30.6 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 2.5 | 17.7 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 2.5 | 32.7 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 2.5 | 29.9 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 2.5 | 12.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 2.5 | 14.9 | GO:0048030 | disaccharide binding(GO:0048030) |
| 2.5 | 9.8 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
| 2.4 | 7.3 | GO:0070506 | high-density lipoprotein particle receptor activity(GO:0070506) |
| 2.4 | 12.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 2.4 | 17.0 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 2.4 | 17.0 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 2.4 | 9.7 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 2.4 | 7.2 | GO:0070976 | TIR domain binding(GO:0070976) |
| 2.4 | 14.4 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 2.4 | 9.6 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 2.4 | 11.9 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 2.4 | 170.4 | GO:0008186 | RNA-dependent ATPase activity(GO:0008186) |
| 2.4 | 9.5 | GO:0000995 | transcription factor activity, core RNA polymerase III binding(GO:0000995) |
| 2.3 | 9.3 | GO:0051373 | FATZ binding(GO:0051373) |
| 2.3 | 20.8 | GO:0043515 | kinetochore binding(GO:0043515) |
| 2.3 | 6.9 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 2.3 | 9.2 | GO:0030614 | oxidoreductase activity, acting on a sulfur group of donors, quinone or similar compound as acceptor(GO:0016672) oxidoreductase activity, acting on phosphorus or arsenic in donors(GO:0030613) oxidoreductase activity, acting on phosphorus or arsenic in donors, disulfide as acceptor(GO:0030614) glutathione dehydrogenase (ascorbate) activity(GO:0045174) methylarsonate reductase activity(GO:0050610) |
| 2.3 | 13.7 | GO:0055104 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 2.3 | 6.9 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 2.3 | 22.8 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 2.2 | 6.7 | GO:0030977 | taurine binding(GO:0030977) |
| 2.2 | 60.6 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 2.2 | 42.3 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 2.2 | 15.6 | GO:0050700 | CARD domain binding(GO:0050700) |
| 2.2 | 15.5 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 2.2 | 8.9 | GO:0030622 | U4atac snRNA binding(GO:0030622) |
| 2.2 | 8.8 | GO:0001093 | TFIIB-class transcription factor binding(GO:0001093) |
| 2.2 | 19.8 | GO:0032404 | mismatch repair complex binding(GO:0032404) |
| 2.2 | 17.5 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 2.1 | 12.8 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 2.1 | 6.4 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 2.1 | 80.6 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 2.1 | 23.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 2.1 | 21.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 2.1 | 14.7 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 2.1 | 14.7 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) |
| 2.1 | 23.0 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 2.1 | 33.3 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 2.1 | 43.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 2.1 | 39.3 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 2.1 | 10.3 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 2.1 | 8.2 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 2.0 | 24.5 | GO:0010857 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
| 2.0 | 6.1 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 2.0 | 6.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 2.0 | 10.1 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
| 2.0 | 24.2 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 2.0 | 8.0 | GO:0005163 | nerve growth factor receptor binding(GO:0005163) |
| 2.0 | 8.0 | GO:0044378 | non-sequence-specific DNA binding, bending(GO:0044378) |
| 2.0 | 16.0 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 2.0 | 12.0 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 2.0 | 6.0 | GO:0004586 | ornithine decarboxylase activity(GO:0004586) |
| 2.0 | 6.0 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 2.0 | 9.9 | GO:0000150 | recombinase activity(GO:0000150) |
| 2.0 | 5.9 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
| 2.0 | 7.9 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 2.0 | 5.9 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) |
| 2.0 | 3.9 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 2.0 | 7.8 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 1.9 | 1.9 | GO:0016896 | exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
| 1.9 | 15.5 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 1.9 | 36.6 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 1.9 | 32.6 | GO:0005522 | profilin binding(GO:0005522) |
| 1.9 | 5.7 | GO:0008281 | sulfonylurea receptor activity(GO:0008281) |
| 1.9 | 9.3 | GO:0005123 | death receptor binding(GO:0005123) |
| 1.8 | 12.9 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
| 1.8 | 3.6 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 1.8 | 14.6 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
| 1.8 | 5.4 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 1.8 | 1.8 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 1.8 | 9.0 | GO:0038132 | neuregulin binding(GO:0038132) |
| 1.8 | 55.7 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 1.8 | 14.2 | GO:0031419 | cobalamin binding(GO:0031419) |
| 1.8 | 8.8 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
| 1.8 | 10.5 | GO:0046977 | TAP binding(GO:0046977) TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
| 1.7 | 5.2 | GO:0047757 | chondroitin-glucuronate 5-epimerase activity(GO:0047757) |
| 1.7 | 24.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 1.7 | 10.3 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 1.7 | 12.0 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 1.7 | 6.8 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 1.7 | 6.8 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 1.7 | 3.3 | GO:1990269 | RNA polymerase II C-terminal domain phosphoserine binding(GO:1990269) |
| 1.6 | 41.2 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 1.6 | 6.5 | GO:0048185 | activin binding(GO:0048185) |
| 1.6 | 4.9 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 1.6 | 4.9 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 1.6 | 6.5 | GO:0015186 | L-glutamine transmembrane transporter activity(GO:0015186) |
| 1.6 | 54.9 | GO:0031491 | nucleosome binding(GO:0031491) |
| 1.6 | 22.6 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 1.6 | 22.6 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 1.6 | 4.8 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 1.6 | 9.6 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 1.6 | 9.6 | GO:0030274 | LIM domain binding(GO:0030274) |
| 1.6 | 3.2 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 1.6 | 3.2 | GO:0004963 | follicle-stimulating hormone receptor activity(GO:0004963) |
| 1.6 | 14.3 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 1.6 | 1.6 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 1.6 | 12.6 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 1.6 | 41.0 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 1.6 | 20.5 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 1.6 | 26.7 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 1.6 | 4.7 | GO:0019809 | spermidine binding(GO:0019809) |
| 1.6 | 7.8 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 1.5 | 15.4 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 1.5 | 6.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 1.5 | 12.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 1.5 | 3.1 | GO:0055105 | ubiquitin-protein transferase inhibitor activity(GO:0055105) |
| 1.5 | 4.6 | GO:0004807 | triose-phosphate isomerase activity(GO:0004807) |
| 1.5 | 6.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 1.5 | 16.8 | GO:0008143 | poly(A) binding(GO:0008143) |
| 1.5 | 6.1 | GO:0003896 | DNA primase activity(GO:0003896) |
| 1.5 | 6.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 1.5 | 4.5 | GO:0035596 | methylthiotransferase activity(GO:0035596) transferase activity, transferring alkylthio groups(GO:0050497) |
| 1.5 | 51.0 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 1.5 | 4.4 | GO:0004775 | succinate-CoA ligase activity(GO:0004774) succinate-CoA ligase (ADP-forming) activity(GO:0004775) |
| 1.5 | 35.0 | GO:0035173 | histone kinase activity(GO:0035173) |
| 1.5 | 10.2 | GO:0031014 | troponin T binding(GO:0031014) |
| 1.4 | 56.0 | GO:0070888 | E-box binding(GO:0070888) |
| 1.4 | 1.4 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 1.4 | 5.7 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 1.4 | 7.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 1.4 | 1.4 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
| 1.4 | 4.2 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 1.4 | 2.8 | GO:0060002 | plus-end directed microfilament motor activity(GO:0060002) |
| 1.4 | 11.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 1.4 | 40.6 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
| 1.4 | 1.4 | GO:0016433 | rRNA (adenine) methyltransferase activity(GO:0016433) |
| 1.4 | 1.4 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 1.4 | 1.4 | GO:0035877 | death effector domain binding(GO:0035877) |
| 1.4 | 12.5 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 1.4 | 86.1 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 1.4 | 12.5 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 1.4 | 24.8 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 1.4 | 23.4 | GO:0005521 | lamin binding(GO:0005521) |
| 1.4 | 8.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 1.4 | 16.4 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 1.4 | 4.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 1.4 | 46.1 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 1.4 | 5.4 | GO:0001030 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) 5S rDNA binding(GO:0080084) |
| 1.3 | 17.3 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 1.3 | 4.0 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 1.3 | 9.2 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 1.3 | 53.7 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 1.3 | 57.0 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 1.3 | 3.9 | GO:0004956 | prostaglandin D receptor activity(GO:0004956) |
| 1.3 | 12.9 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 1.3 | 9.0 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 1.3 | 2.5 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 1.3 | 5.1 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 1.3 | 7.6 | GO:0034711 | inhibin binding(GO:0034711) |
| 1.3 | 7.5 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 1.2 | 22.4 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 1.2 | 7.4 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 1.2 | 6.2 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 1.2 | 4.9 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 1.2 | 1.2 | GO:0004827 | proline-tRNA ligase activity(GO:0004827) |
| 1.2 | 11.1 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 1.2 | 49.1 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 1.2 | 4.9 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 1.2 | 7.4 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 1.2 | 4.9 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 1.2 | 10.9 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 1.2 | 4.8 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
| 1.2 | 19.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 1.2 | 4.8 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 1.2 | 9.5 | GO:0031432 | titin binding(GO:0031432) |
| 1.2 | 2.4 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 1.2 | 7.0 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 1.2 | 3.5 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 1.2 | 37.3 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 1.2 | 29.0 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 1.2 | 17.4 | GO:0030371 | translation repressor activity(GO:0030371) |
| 1.2 | 2.3 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 1.1 | 9.2 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 1.1 | 26.1 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 1.1 | 2.3 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 1.1 | 20.4 | GO:0070628 | proteasome binding(GO:0070628) |
| 1.1 | 11.3 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 1.1 | 2.2 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 1.1 | 4.5 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 1.1 | 5.6 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 1.1 | 13.5 | GO:0004532 | exoribonuclease activity(GO:0004532) |
| 1.1 | 2.2 | GO:0034485 | phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase activity(GO:0034485) |
| 1.1 | 11.0 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 1.1 | 2.2 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 1.1 | 7.5 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 1.1 | 8.6 | GO:0048256 | flap endonuclease activity(GO:0048256) |
| 1.1 | 5.3 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 1.1 | 1.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 1.1 | 6.4 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 1.1 | 5.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 1.1 | 7.4 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 1.1 | 4.2 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
| 1.0 | 13.6 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 1.0 | 4.2 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 1.0 | 4.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 1.0 | 11.4 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 1.0 | 4.1 | GO:0017050 | D-erythro-sphingosine kinase activity(GO:0017050) |
| 1.0 | 4.1 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 1.0 | 5.1 | GO:0070401 | NADP+ binding(GO:0070401) |
| 1.0 | 15.2 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 1.0 | 5.1 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 1.0 | 19.1 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 1.0 | 3.0 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 1.0 | 5.0 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 1.0 | 4.0 | GO:0048495 | Roundabout binding(GO:0048495) |
| 1.0 | 21.8 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 1.0 | 3.0 | GO:0004925 | prolactin receptor activity(GO:0004925) |
| 1.0 | 5.9 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 1.0 | 5.9 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 1.0 | 2.9 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 1.0 | 4.9 | GO:0015168 | polyol transmembrane transporter activity(GO:0015166) glycerol transmembrane transporter activity(GO:0015168) |
| 1.0 | 9.7 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 1.0 | 5.8 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 1.0 | 6.8 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 1.0 | 7.7 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 1.0 | 26.0 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 1.0 | 9.6 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 1.0 | 5.8 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 1.0 | 7.6 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.9 | 5.7 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.9 | 6.5 | GO:0035375 | zymogen binding(GO:0035375) |
| 0.9 | 1.8 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.9 | 51.2 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.9 | 11.8 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.9 | 3.6 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.9 | 2.7 | GO:0016403 | dimethylargininase activity(GO:0016403) |
| 0.9 | 3.6 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.9 | 30.5 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.9 | 87.6 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.9 | 0.9 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.9 | 0.9 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.9 | 2.6 | GO:0004911 | interleukin-2 receptor activity(GO:0004911) |
| 0.9 | 7.9 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.9 | 4.3 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.9 | 3.5 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.9 | 103.3 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.9 | 6.0 | GO:0005113 | patched binding(GO:0005113) |
| 0.9 | 97.3 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.9 | 8.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.8 | 7.6 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.8 | 5.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.8 | 5.1 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
| 0.8 | 390.1 | GO:0001012 | RNA polymerase II regulatory region sequence-specific DNA binding(GO:0000977) RNA polymerase II regulatory region DNA binding(GO:0001012) |
| 0.8 | 15.8 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.8 | 1.6 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.8 | 2.5 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.8 | 0.8 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.8 | 8.2 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.8 | 3.3 | GO:0003989 | acetyl-CoA carboxylase activity(GO:0003989) |
| 0.8 | 4.0 | GO:0043682 | copper-exporting ATPase activity(GO:0004008) copper-transporting ATPase activity(GO:0043682) |
| 0.8 | 12.1 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.8 | 4.8 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.8 | 2.4 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.8 | 8.9 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.8 | 2.4 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 0.8 | 6.4 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.8 | 30.5 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.8 | 1.6 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.8 | 16.0 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.8 | 4.0 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.8 | 2.4 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.8 | 3.2 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.8 | 6.3 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.8 | 4.0 | GO:0043532 | angiostatin binding(GO:0043532) |
| 0.8 | 5.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.8 | 3.1 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.8 | 2.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.8 | 14.0 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.8 | 3.1 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
| 0.8 | 3.9 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.8 | 14.6 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
| 0.8 | 16.7 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.7 | 42.0 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.7 | 6.0 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.7 | 6.7 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.7 | 7.5 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.7 | 2.2 | GO:0004478 | methionine adenosyltransferase activity(GO:0004478) |
| 0.7 | 6.7 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.7 | 3.0 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.7 | 3.0 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.7 | 41.2 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.7 | 22.1 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.7 | 5.1 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.7 | 1.5 | GO:0035800 | deubiquitinase activator activity(GO:0035800) |
| 0.7 | 5.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.7 | 2.9 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.7 | 3.6 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.7 | 5.6 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.7 | 1.4 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.7 | 2.8 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.7 | 0.7 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.7 | 2.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.7 | 4.9 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.7 | 11.1 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.7 | 8.3 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.7 | 2.8 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.7 | 1.4 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.7 | 3.4 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.7 | 1.4 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.7 | 9.6 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.7 | 53.9 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.7 | 3.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.7 | 3.4 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.7 | 6.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.7 | 2.7 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.7 | 40.7 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.7 | 4.7 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) |
| 0.7 | 4.7 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
| 0.7 | 10.6 | GO:0004518 | nuclease activity(GO:0004518) |
| 0.7 | 3.3 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.7 | 7.3 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
| 0.7 | 9.9 | GO:0004402 | histone acetyltransferase activity(GO:0004402) peptide-lysine-N-acetyltransferase activity(GO:0061733) |
| 0.7 | 2.0 | GO:0047522 | 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.7 | 29.5 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.7 | 1.3 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.7 | 2.0 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.7 | 3.3 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.6 | 1.3 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.6 | 12.9 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.6 | 585.1 | GO:0003677 | DNA binding(GO:0003677) |
| 0.6 | 3.2 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 0.6 | 5.7 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.6 | 2.5 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.6 | 103.2 | GO:0003700 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
| 0.6 | 3.8 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.6 | 1.9 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.6 | 19.9 | GO:0001076 | transcription factor activity, RNA polymerase II transcription factor binding(GO:0001076) |
| 0.6 | 13.6 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.6 | 1.8 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.6 | 1.2 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
| 0.6 | 3.0 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.6 | 3.0 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.6 | 3.0 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.6 | 3.5 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.6 | 3.5 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.6 | 56.5 | GO:0003729 | mRNA binding(GO:0003729) poly(A) RNA binding(GO:0044822) |
| 0.6 | 39.4 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
| 0.6 | 1.7 | GO:0089720 | caspase binding(GO:0089720) |
| 0.6 | 28.2 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.6 | 2.9 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.6 | 6.3 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.6 | 2.3 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) malate dehydrogenase (decarboxylating) (NADP+) activity(GO:0004473) |
| 0.6 | 7.9 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.6 | 3.9 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.6 | 6.7 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
| 0.6 | 7.3 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.6 | 3.9 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.6 | 1.7 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) |
| 0.5 | 1.6 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.5 | 15.7 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.5 | 1.6 | GO:0031404 | chloride ion binding(GO:0031404) |
| 0.5 | 9.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.5 | 10.8 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.5 | 4.3 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.5 | 4.8 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.5 | 2.1 | GO:0086075 | gap junction channel activity involved in cardiac conduction electrical coupling(GO:0086075) gap junction channel activity involved in AV node cell-bundle of His cell electrical coupling(GO:0086077) |
| 0.5 | 6.3 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.5 | 4.2 | GO:0008430 | selenium binding(GO:0008430) |
| 0.5 | 1.5 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.5 | 1.5 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.5 | 1.5 | GO:0008169 | C-methyltransferase activity(GO:0008169) |
| 0.5 | 0.5 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.5 | 1.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.5 | 2.0 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.5 | 3.5 | GO:0016279 | lysine N-methyltransferase activity(GO:0016278) protein-lysine N-methyltransferase activity(GO:0016279) |
| 0.5 | 1.5 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.5 | 2.4 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.5 | 1.9 | GO:0042806 | fucose binding(GO:0042806) |
| 0.5 | 1.9 | GO:0045159 | myosin II binding(GO:0045159) |
| 0.5 | 1.4 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.5 | 2.8 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
| 0.5 | 1.4 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.5 | 1.4 | GO:0047025 | 3-oxoacyl-[acyl-carrier-protein] reductase (NADH) activity(GO:0047025) |
| 0.5 | 106.6 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.5 | 0.9 | GO:1904680 | peptide-transporting ATPase activity(GO:0015440) peptide transmembrane transporter activity(GO:1904680) |
| 0.5 | 14.1 | GO:0042805 | actinin binding(GO:0042805) |
| 0.5 | 1.8 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.4 | 2.7 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
| 0.4 | 5.3 | GO:0000828 | inositol hexakisphosphate kinase activity(GO:0000828) |
| 0.4 | 2.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.4 | 6.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.4 | 1.7 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.4 | 12.7 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.4 | 4.2 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.4 | 2.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
| 0.4 | 1.3 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
| 0.4 | 1.2 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.4 | 2.5 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.4 | 1.6 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.4 | 3.6 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.4 | 0.4 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.4 | 2.0 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.4 | 1.6 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.4 | 1.6 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.4 | 9.0 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.4 | 12.1 | GO:0042605 | peptide antigen binding(GO:0042605) |
| 0.4 | 1.5 | GO:0016608 | growth hormone-releasing hormone activity(GO:0016608) |
| 0.4 | 1.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.4 | 14.4 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.4 | 1.4 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.3 | 2.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.3 | 14.8 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.3 | 4.8 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.3 | 3.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.3 | 1.3 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.3 | 6.2 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.3 | 3.6 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.3 | 1.3 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.3 | 3.9 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.3 | 5.1 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.3 | 1.3 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.3 | 5.4 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.3 | 0.9 | GO:0004161 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.3 | 358.8 | GO:0003676 | nucleic acid binding(GO:0003676) |
| 0.3 | 0.9 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
| 0.3 | 1.5 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.3 | 1.5 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.3 | 7.3 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.3 | 1.5 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.3 | 2.9 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.3 | 3.4 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.3 | 7.5 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.3 | 1.1 | GO:0045125 | bioactive lipid receptor activity(GO:0045125) |
| 0.3 | 1.4 | GO:0004954 | prostanoid receptor activity(GO:0004954) |
| 0.3 | 0.8 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.3 | 1.6 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.2 | 6.6 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
| 0.2 | 1.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.2 | 2.1 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.2 | 0.7 | GO:0102344 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
| 0.2 | 31.0 | GO:0061659 | ubiquitin-like protein ligase activity(GO:0061659) |
| 0.2 | 0.7 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.2 | 0.4 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.2 | 1.3 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.2 | 0.6 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.2 | 0.8 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.2 | 2.2 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.2 | 0.4 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.2 | 2.7 | GO:0015288 | porin activity(GO:0015288) |
| 0.2 | 2.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.2 | 1.7 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.2 | 0.6 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
| 0.2 | 1.8 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.2 | 0.3 | GO:0000295 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) |
| 0.2 | 0.8 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
| 0.2 | 0.5 | GO:0004051 | arachidonate 5-lipoxygenase activity(GO:0004051) |
| 0.2 | 7.0 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.2 | 0.5 | GO:0017168 | 5-oxoprolinase (ATP-hydrolyzing) activity(GO:0017168) |
| 0.2 | 0.6 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.2 | 2.7 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.2 | 0.8 | GO:0046527 | glucosyltransferase activity(GO:0046527) |
| 0.1 | 0.4 | GO:0019961 | interferon binding(GO:0019961) |
| 0.1 | 0.7 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.1 | 0.5 | GO:0052796 | exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.1 | 0.8 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.1 | 0.6 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.1 | 0.9 | GO:0019808 | polyamine binding(GO:0019808) |
| 0.1 | 0.6 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.1 | 0.5 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 0.8 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.1 | 0.9 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.1 | 1.9 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 0.5 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.1 | 0.2 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.1 | 0.1 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
| 0.1 | 1.2 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.1 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.1 | 0.3 | GO:0072590 | N-acetyl-L-aspartate-L-glutamate ligase activity(GO:0072590) |
| 0.1 | 0.3 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.1 | 0.4 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.1 | 0.2 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.1 | 8.1 | GO:0016503 | pheromone receptor activity(GO:0016503) |
| 0.1 | 0.2 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.1 | 0.3 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.1 | 0.7 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.1 | 0.6 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.1 | 0.3 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.1 | 0.5 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
| 0.1 | 0.5 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 0.7 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 0.3 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.1 | 0.7 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
| 0.1 | 0.7 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.1 | 0.2 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
| 0.0 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.6 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.0 | 0.3 | GO:0015926 | glucosidase activity(GO:0015926) |
| 0.0 | 1.1 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.0 | 0.1 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.0 | 6.2 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
| 0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.8 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.3 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.0 | 0.0 | GO:0005017 | platelet-derived growth factor-activated receptor activity(GO:0005017) |
| 0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.0 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.8 | 3.8 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 3.4 | 6.8 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 3.3 | 3.3 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 2.5 | 31.9 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 2.3 | 6.8 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
| 2.2 | 4.4 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 2.2 | 37.4 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 2.1 | 100.9 | PID AURORA B PATHWAY | Aurora B signaling |
| 2.0 | 34.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 1.8 | 41.8 | PID MYC PATHWAY | C-MYC pathway |
| 1.8 | 36.0 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 1.8 | 15.9 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 1.8 | 79.0 | PID ATM PATHWAY | ATM pathway |
| 1.7 | 13.8 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 1.7 | 54.9 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 1.6 | 42.6 | PID BARD1 PATHWAY | BARD1 signaling events |
| 1.6 | 6.4 | PID EPO PATHWAY | EPO signaling pathway |
| 1.6 | 19.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 1.6 | 1.6 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 1.6 | 77.0 | PID P53 REGULATION PATHWAY | p53 pathway |
| 1.5 | 33.7 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 1.5 | 24.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 1.5 | 16.4 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 1.5 | 48.8 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 1.4 | 17.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 1.4 | 14.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 1.4 | 1.4 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 1.4 | 2.8 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 1.4 | 20.5 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 1.3 | 67.1 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 1.3 | 32.5 | PID FOXO PATHWAY | FoxO family signaling |
| 1.3 | 21.8 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 1.3 | 24.3 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 1.3 | 39.1 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 1.3 | 59.2 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 1.2 | 13.6 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 1.2 | 18.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 1.2 | 27.7 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 1.2 | 8.4 | PID IGF1 PATHWAY | IGF1 pathway |
| 1.2 | 39.7 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 1.1 | 36.7 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 1.1 | 36.7 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 1.1 | 37.8 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 1.1 | 7.7 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 1.1 | 7.6 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 1.1 | 47.3 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 1.0 | 60.8 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 1.0 | 5.2 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 1.0 | 12.1 | PID ALK2 PATHWAY | ALK2 signaling events |
| 1.0 | 8.1 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 1.0 | 2.9 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
| 0.9 | 14.0 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.9 | 6.0 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.8 | 20.0 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.8 | 6.4 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.8 | 42.1 | PID NOTCH PATHWAY | Notch signaling pathway |
| 0.8 | 1.5 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.7 | 11.2 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.7 | 23.7 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.7 | 21.7 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.7 | 2.0 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.7 | 16.5 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.7 | 6.0 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.7 | 7.9 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.6 | 16.1 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.6 | 4.4 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.6 | 30.0 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.6 | 10.6 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.6 | 12.2 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.6 | 9.7 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.6 | 21.8 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.6 | 4.8 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.6 | 7.8 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.6 | 11.9 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.6 | 103.1 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.6 | 24.7 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.5 | 17.5 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.5 | 8.6 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.5 | 5.3 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.5 | 4.7 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.5 | 15.6 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.5 | 3.0 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.5 | 3.5 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.5 | 20.1 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.5 | 15.6 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.5 | 19.8 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.4 | 16.8 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.4 | 1.8 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.4 | 13.9 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.4 | 13.0 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.4 | 8.0 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.4 | 13.6 | PID E2F PATHWAY | E2F transcription factor network |
| 0.4 | 10.8 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.4 | 0.4 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.4 | 5.7 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.4 | 2.5 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.3 | 5.4 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.3 | 23.6 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.3 | 8.2 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.3 | 3.3 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.3 | 8.8 | PID BMP PATHWAY | BMP receptor signaling |
| 0.3 | 1.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.3 | 0.9 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.3 | 5.9 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.3 | 1.0 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.2 | 1.8 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.2 | 1.4 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.2 | 1.6 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.2 | 1.9 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.2 | 1.0 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 0.5 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.1 | 1.2 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.1 | 0.4 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 0.2 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 1.2 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.4 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.9 | 4.9 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 4.5 | 9.1 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 3.3 | 26.2 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 3.1 | 12.4 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 3.1 | 36.9 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 3.0 | 83.3 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 2.9 | 14.3 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 2.8 | 14.1 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 2.8 | 2.8 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 2.6 | 62.8 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 2.5 | 27.7 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 2.5 | 47.3 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 2.4 | 2.4 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 2.3 | 23.1 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 2.3 | 4.5 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 2.2 | 11.2 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 2.2 | 26.5 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 2.2 | 6.6 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 2.1 | 45.5 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 2.0 | 31.9 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 2.0 | 11.9 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 2.0 | 29.8 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 1.9 | 1.9 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 1.9 | 9.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 1.9 | 63.0 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 1.8 | 31.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 1.8 | 131.4 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 1.8 | 39.0 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 1.7 | 17.0 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 1.7 | 69.0 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 1.7 | 1.7 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 1.6 | 11.5 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 1.6 | 8.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 1.6 | 26.0 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 1.6 | 11.3 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 1.6 | 11.2 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
| 1.6 | 42.5 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 1.6 | 32.9 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 1.6 | 1.6 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
| 1.5 | 20.0 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
| 1.5 | 18.5 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 1.5 | 29.0 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 1.5 | 25.4 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 1.5 | 25.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 1.5 | 46.1 | REACTOME KINESINS | Genes involved in Kinesins |
| 1.5 | 30.8 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 1.4 | 18.8 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 1.4 | 54.7 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 1.4 | 10.0 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 1.4 | 52.2 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 1.4 | 38.0 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 1.4 | 25.0 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 1.4 | 4.1 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 1.3 | 19.4 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
| 1.3 | 14.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 1.3 | 56.7 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 1.3 | 1.3 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 1.1 | 6.9 | REACTOME NUCLEOTIDE BINDING DOMAIN LEUCINE RICH REPEAT CONTAINING RECEPTOR NLR SIGNALING PATHWAYS | Genes involved in Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways |
| 1.1 | 140.9 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 1.1 | 24.6 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 1.1 | 39.8 | REACTOME RNA POL II PRE TRANSCRIPTION EVENTS | Genes involved in RNA Polymerase II Pre-transcription Events |
| 1.1 | 2.2 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 1.1 | 8.7 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 1.1 | 26.8 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 1.0 | 19.9 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 1.0 | 14.6 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 1.0 | 22.8 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 1.0 | 18.6 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 1.0 | 95.4 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 1.0 | 12.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 1.0 | 8.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 1.0 | 13.9 | REACTOME G2 M CHECKPOINTS | Genes involved in G2/M Checkpoints |
| 1.0 | 35.4 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 1.0 | 15.7 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 1.0 | 4.9 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.9 | 16.1 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.9 | 6.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.9 | 1.8 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.9 | 29.4 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.9 | 39.1 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.9 | 1.8 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
| 0.9 | 8.0 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.9 | 12.3 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.9 | 16.7 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.8 | 6.7 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.8 | 6.7 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.8 | 5.0 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.8 | 2.5 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.8 | 12.4 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.8 | 22.0 | REACTOME MEIOSIS | Genes involved in Meiosis |
| 0.8 | 7.3 | REACTOME GLOBAL GENOMIC NER GG NER | Genes involved in Global Genomic NER (GG-NER) |
| 0.8 | 8.8 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.8 | 28.0 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.8 | 14.0 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.8 | 62.2 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.8 | 9.8 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.7 | 25.1 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.7 | 10.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.7 | 0.7 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.7 | 1.5 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.7 | 38.9 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.7 | 5.0 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.7 | 0.7 | REACTOME GPCR LIGAND BINDING | Genes involved in GPCR ligand binding |
| 0.7 | 146.2 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.7 | 4.2 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
| 0.7 | 7.7 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.7 | 9.7 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.7 | 8.7 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
| 0.6 | 2.6 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.6 | 8.9 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.6 | 26.4 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
| 0.6 | 18.2 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.6 | 5.0 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.6 | 7.9 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.6 | 3.0 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.6 | 3.0 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
| 0.6 | 7.0 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.6 | 1.7 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.6 | 7.4 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.6 | 7.4 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.6 | 1.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.5 | 16.3 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.5 | 12.3 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.5 | 0.5 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.5 | 17.2 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.5 | 1.0 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.5 | 15.0 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.5 | 5.6 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.5 | 3.7 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.5 | 4.6 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.4 | 10.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.4 | 3.7 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.4 | 17.0 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.4 | 8.5 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.4 | 3.0 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.4 | 23.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.4 | 2.2 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.4 | 6.9 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.3 | 2.8 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.3 | 23.2 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.3 | 7.2 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.3 | 1.3 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.3 | 6.2 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.3 | 1.5 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.3 | 11.2 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.3 | 1.1 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.3 | 1.6 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.3 | 1.8 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.3 | 4.7 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.3 | 13.0 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.2 | 8.3 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.2 | 2.8 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.2 | 7.9 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.2 | 3.9 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.2 | 1.2 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.2 | 3.8 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
| 0.2 | 0.7 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.2 | 0.8 | REACTOME TCA CYCLE AND RESPIRATORY ELECTRON TRANSPORT | Genes involved in The citric acid (TCA) cycle and respiratory electron transport |
| 0.1 | 6.3 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.1 | 1.0 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
| 0.1 | 2.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 0.3 | REACTOME APOPTOTIC EXECUTION PHASE | Genes involved in Apoptotic execution phase |
| 0.1 | 3.2 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 3.7 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.1 | 2.1 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.1 | 0.5 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.1 | 0.6 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.1 | 0.2 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
| 0.1 | 1.4 | REACTOME SIGNALING BY NOTCH1 | Genes involved in Signaling by NOTCH1 |
| 0.1 | 0.8 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.1 | 0.1 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
| 0.0 | 0.5 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.3 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.0 | 0.3 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
| 0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.1 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.0 | 0.0 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |