avrg: GSE58827: Dynamics of the Mouse Liver
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Smad1
|
ENSMUSG00000031681.17 | Smad1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Smad1 | mm39_v1_chr8_-_80126120_80126168 | -0.26 | 1.2e-01 | Click! |
Promoter | Score | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr6_-_55152002 | 7.51 |
ENSMUST00000003569.6
|
Inmt
|
indolethylamine N-methyltransferase |
chr4_+_115156243 | 5.72 |
ENSMUST00000084343.4
|
Cyp4a12a
|
cytochrome P450, family 4, subfamily a, polypeptide 12a |
chr8_-_112417633 | 5.39 |
ENSMUST00000034435.7
|
Ctrb1
|
chymotrypsinogen B1 |
chr4_+_115375461 | 5.15 |
ENSMUST00000058785.10
ENSMUST00000094886.4 |
Cyp4a10
|
cytochrome P450, family 4, subfamily a, polypeptide 10 |
chr12_-_103925197 | 5.11 |
ENSMUST00000122229.8
|
Serpina1e
|
serine (or cysteine) peptidase inhibitor, clade A, member 1E |
chr10_+_127702326 | 4.44 |
ENSMUST00000092058.4
|
Rdh16f2
|
RDH16 family member 2 |
chr12_+_104304631 | 4.42 |
ENSMUST00000043058.5
ENSMUST00000101078.12 |
Serpina3k
Serpina3m
|
serine (or cysteine) peptidase inhibitor, clade A, member 3K serine (or cysteine) peptidase inhibitor, clade A, member 3M |
chr8_+_110717062 | 3.84 |
ENSMUST00000001720.14
ENSMUST00000143741.2 |
Tat
|
tyrosine aminotransferase |
chr9_-_57590926 | 3.73 |
ENSMUST00000034860.5
|
Cyp1a2
|
cytochrome P450, family 1, subfamily a, polypeptide 2 |
chr10_-_127724557 | 2.83 |
ENSMUST00000047199.5
|
Rdh7
|
retinol dehydrogenase 7 |
chr7_-_30643444 | 2.82 |
ENSMUST00000062620.9
|
Hamp
|
hepcidin antimicrobial peptide |
chr6_-_41291634 | 2.75 |
ENSMUST00000064324.12
|
Try5
|
trypsin 5 |
chr17_-_31348576 | 2.55 |
ENSMUST00000024827.5
|
Tff3
|
trefoil factor 3, intestinal |
chr7_-_97066937 | 2.53 |
ENSMUST00000043077.8
|
Thrsp
|
thyroid hormone responsive |
chr19_+_20579322 | 2.42 |
ENSMUST00000087638.4
|
Aldh1a1
|
aldehyde dehydrogenase family 1, subfamily A1 |
chr8_+_105460627 | 2.41 |
ENSMUST00000034346.15
ENSMUST00000164182.3 |
Ces2a
|
carboxylesterase 2A |
chr3_-_98670369 | 2.41 |
ENSMUST00000107019.8
ENSMUST00000107018.8 |
Hsd3b3
|
hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 3 |
chr4_+_115458172 | 2.38 |
ENSMUST00000084342.6
|
Cyp4a32
|
cytochrome P450, family 4, subfamily a, polypeptide 32 |
chr19_+_46120327 | 2.37 |
ENSMUST00000043739.6
ENSMUST00000237098.2 |
Elovl3
|
elongation of very long chain fatty acids (FEN1/Elo2, SUR4/Elo3, yeast)-like 3 |
chr4_+_115268821 | 2.36 |
ENSMUST00000094887.4
|
Cyp4a12b
|
cytochrome P450, family 4, subfamily a, polypeptide 12B |
chr7_+_119217004 | 2.35 |
ENSMUST00000047929.13
ENSMUST00000135683.3 |
Acsm1
|
acyl-CoA synthetase medium-chain family member 1 |
chr7_+_26819334 | 2.30 |
ENSMUST00000003100.10
|
Cyp2f2
|
cytochrome P450, family 2, subfamily f, polypeptide 2 |
chr15_+_82336535 | 2.29 |
ENSMUST00000089129.7
ENSMUST00000229313.2 ENSMUST00000231136.2 |
Cyp2d9
|
cytochrome P450, family 2, subfamily d, polypeptide 9 |
chr14_-_51384236 | 2.28 |
ENSMUST00000080126.4
|
Rnase1
|
ribonuclease, RNase A family, 1 (pancreatic) |
chr16_+_22739191 | 2.23 |
ENSMUST00000116625.10
|
Fetub
|
fetuin beta |
chr6_+_41279199 | 2.17 |
ENSMUST00000031913.5
|
Try4
|
trypsin 4 |
chr1_+_88139678 | 2.17 |
ENSMUST00000073049.7
|
Ugt1a1
|
UDP glucuronosyltransferase 1 family, polypeptide A1 |
chr7_+_140415431 | 2.12 |
ENSMUST00000209978.2
ENSMUST00000210916.2 |
Urah
|
urate (5-hydroxyiso-) hydrolase |
chr11_+_16702203 | 2.09 |
ENSMUST00000102884.10
ENSMUST00000020329.13 |
Egfr
|
epidermal growth factor receptor |
chr17_-_84990360 | 2.08 |
ENSMUST00000066175.10
|
Abcg5
|
ATP binding cassette subfamily G member 5 |
chr11_+_3981769 | 2.03 |
ENSMUST00000019512.8
|
Sec14l4
|
SEC14-like lipid binding 4 |
chr4_+_63262775 | 1.96 |
ENSMUST00000030044.3
|
Orm1
|
orosomucoid 1 |
chr17_+_84990541 | 1.96 |
ENSMUST00000045714.15
ENSMUST00000171915.2 |
Abcg8
|
ATP binding cassette subfamily G member 8 |
chr8_+_105775224 | 1.95 |
ENSMUST00000093222.13
ENSMUST00000093223.5 |
Ces3a
|
carboxylesterase 3A |
chr11_+_72192455 | 1.95 |
ENSMUST00000151440.8
ENSMUST00000146233.8 ENSMUST00000140842.9 |
Xaf1
|
XIAP associated factor 1 |
chr16_+_93404719 | 1.91 |
ENSMUST00000039659.9
ENSMUST00000231762.2 |
Cbr1
|
carbonyl reductase 1 |
chr6_-_41423004 | 1.89 |
ENSMUST00000095999.7
|
Gm10334
|
predicted gene 10334 |
chr3_-_88332401 | 1.89 |
ENSMUST00000168755.7
ENSMUST00000193433.6 ENSMUST00000195657.6 ENSMUST00000057935.9 |
Slc25a44
|
solute carrier family 25, member 44 |
chr12_-_103956176 | 1.85 |
ENSMUST00000151709.3
ENSMUST00000176246.3 ENSMUST00000074693.13 ENSMUST00000120251.9 |
Serpina11
|
serine (or cysteine) peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 11 |
chr7_+_140343652 | 1.82 |
ENSMUST00000026552.9
ENSMUST00000209253.2 ENSMUST00000210235.2 |
Cyp2e1
|
cytochrome P450, family 2, subfamily e, polypeptide 1 |
chr19_+_58717319 | 1.81 |
ENSMUST00000048644.6
ENSMUST00000236445.2 |
Pnliprp1
|
pancreatic lipase related protein 1 |
chr7_-_46392403 | 1.78 |
ENSMUST00000128088.4
|
Saa1
|
serum amyloid A 1 |
chr7_+_140415170 | 1.77 |
ENSMUST00000211372.2
ENSMUST00000026554.11 ENSMUST00000185612.3 |
Urah
|
urate (5-hydroxyiso-) hydrolase |
chr10_-_127843377 | 1.76 |
ENSMUST00000219447.2
ENSMUST00000219780.2 ENSMUST00000219707.2 ENSMUST00000219953.2 ENSMUST00000219183.2 |
Hsd17b6
|
hydroxysteroid (17-beta) dehydrogenase 6 |
chr19_-_4889284 | 1.76 |
ENSMUST00000236451.2
ENSMUST00000236178.2 |
Ccs
|
copper chaperone for superoxide dismutase |
chr11_+_101339233 | 1.76 |
ENSMUST00000010502.13
|
Ifi35
|
interferon-induced protein 35 |
chr11_+_69945157 | 1.75 |
ENSMUST00000108585.9
ENSMUST00000018699.13 |
Asgr1
|
asialoglycoprotein receptor 1 |
chr12_+_104372962 | 1.70 |
ENSMUST00000021506.6
|
Serpina3n
|
serine (or cysteine) peptidase inhibitor, clade A, member 3N |
chr19_-_10582672 | 1.67 |
ENSMUST00000236478.2
ENSMUST00000236950.2 |
Tkfc
|
triokinase, FMN cyclase |
chr19_+_20470056 | 1.65 |
ENSMUST00000225337.3
|
Aldh1a1
|
aldehyde dehydrogenase family 1, subfamily A1 |
chr7_-_30623592 | 1.64 |
ENSMUST00000217812.2
ENSMUST00000074671.9 |
Hamp2
|
hepcidin antimicrobial peptide 2 |
chr9_+_46139878 | 1.64 |
ENSMUST00000034588.9
ENSMUST00000132155.2 |
Apoa1
|
apolipoprotein A-I |
chr6_+_121815473 | 1.62 |
ENSMUST00000032228.9
|
Mug1
|
murinoglobulin 1 |
chr1_+_133292898 | 1.61 |
ENSMUST00000129213.2
|
Etnk2
|
ethanolamine kinase 2 |
chr19_+_30210320 | 1.60 |
ENSMUST00000025797.7
|
Mbl2
|
mannose-binding lectin (protein C) 2 |
chr8_-_94006345 | 1.60 |
ENSMUST00000034178.9
|
Ces1f
|
carboxylesterase 1F |
chr12_-_103796632 | 1.59 |
ENSMUST00000164454.3
|
Serpina1b
|
serine (or cysteine) preptidase inhibitor, clade A, member 1B |
chr9_-_103097022 | 1.57 |
ENSMUST00000168142.8
|
Trf
|
transferrin |
chrX_+_72830607 | 1.52 |
ENSMUST00000166518.8
|
Ssr4
|
signal sequence receptor, delta |
chr19_-_40175709 | 1.52 |
ENSMUST00000051846.13
|
Cyp2c70
|
cytochrome P450, family 2, subfamily c, polypeptide 70 |
chrX_+_100420873 | 1.52 |
ENSMUST00000052130.14
|
Gjb1
|
gap junction protein, beta 1 |
chr17_-_34962823 | 1.49 |
ENSMUST00000069507.9
|
C4b
|
complement component 4B (Chido blood group) |
chr19_-_4889314 | 1.48 |
ENSMUST00000235245.2
ENSMUST00000037246.7 |
Ccs
|
copper chaperone for superoxide dismutase |
chr6_+_121983720 | 1.47 |
ENSMUST00000081777.8
|
Mug2
|
murinoglobulin 2 |
chr14_-_52150804 | 1.47 |
ENSMUST00000004673.15
ENSMUST00000111632.5 |
Ndrg2
|
N-myc downstream regulated gene 2 |
chr4_-_63072367 | 1.46 |
ENSMUST00000030041.5
|
Ambp
|
alpha 1 microglobulin/bikunin precursor |
chrX_+_72830668 | 1.44 |
ENSMUST00000002090.3
|
Ssr4
|
signal sequence receptor, delta |
chr7_+_46401214 | 1.43 |
ENSMUST00000210769.2
ENSMUST00000210272.2 ENSMUST00000075982.4 |
Saa2
|
serum amyloid A 2 |
chr9_-_121745354 | 1.42 |
ENSMUST00000062474.5
|
Cyp8b1
|
cytochrome P450, family 8, subfamily b, polypeptide 1 |
chr16_-_18904240 | 1.42 |
ENSMUST00000103746.3
|
Iglv1
|
immunoglobulin lambda variable 1 |
chr19_+_34560922 | 1.41 |
ENSMUST00000102825.4
|
Ifit3
|
interferon-induced protein with tetratricopeptide repeats 3 |
chr3_+_94600863 | 1.39 |
ENSMUST00000090848.10
ENSMUST00000173981.8 ENSMUST00000173849.8 ENSMUST00000174223.2 |
Selenbp2
|
selenium binding protein 2 |
chr7_-_12731594 | 1.38 |
ENSMUST00000133977.3
|
Slc27a5
|
solute carrier family 27 (fatty acid transporter), member 5 |
chr14_-_30665232 | 1.37 |
ENSMUST00000006704.17
ENSMUST00000163118.2 |
Itih1
|
inter-alpha trypsin inhibitor, heavy chain 1 |
chr7_-_48497771 | 1.35 |
ENSMUST00000032658.14
|
Csrp3
|
cysteine and glycine-rich protein 3 |
chr16_+_22769822 | 1.34 |
ENSMUST00000023590.9
|
Hrg
|
histidine-rich glycoprotein |
chr11_-_75313350 | 1.30 |
ENSMUST00000125982.2
ENSMUST00000137103.8 |
Serpinf1
|
serine (or cysteine) peptidase inhibitor, clade F, member 1 |
chr9_+_46151994 | 1.30 |
ENSMUST00000034585.7
|
Apoa4
|
apolipoprotein A-IV |
chr4_-_60777462 | 1.29 |
ENSMUST00000211875.2
|
Mup22
|
major urinary protein 22 |
chr16_+_22710027 | 1.28 |
ENSMUST00000231848.2
|
Ahsg
|
alpha-2-HS-glycoprotein |
chr1_+_87998487 | 1.28 |
ENSMUST00000073772.5
|
Ugt1a9
|
UDP glucuronosyltransferase 1 family, polypeptide A9 |
chr11_-_5900019 | 1.28 |
ENSMUST00000102920.4
|
Gck
|
glucokinase |
chr7_+_119206233 | 1.27 |
ENSMUST00000126367.8
|
Acsm1
|
acyl-CoA synthetase medium-chain family member 1 |
chr1_+_88015524 | 1.26 |
ENSMUST00000113139.2
|
Ugt1a8
|
UDP glucuronosyltransferase 1 family, polypeptide A8 |
chr17_-_46956920 | 1.26 |
ENSMUST00000233974.2
|
Klc4
|
kinesin light chain 4 |
chr16_+_22710134 | 1.26 |
ENSMUST00000231328.2
|
Ahsg
|
alpha-2-HS-glycoprotein |
chr2_-_91466739 | 1.25 |
ENSMUST00000111335.2
ENSMUST00000028681.15 |
F2
|
coagulation factor II |
chr14_+_66208253 | 1.25 |
ENSMUST00000138191.8
|
Clu
|
clusterin |
chr7_+_44114815 | 1.25 |
ENSMUST00000035929.11
ENSMUST00000146128.8 |
Aspdh
|
aspartate dehydrogenase domain containing |
chr7_+_37882642 | 1.24 |
ENSMUST00000178207.10
ENSMUST00000179525.10 |
1600014C10Rik
|
RIKEN cDNA 1600014C10 gene |
chr9_+_106324952 | 1.24 |
ENSMUST00000215475.2
ENSMUST00000187106.7 ENSMUST00000190167.7 |
Abhd14b
|
abhydrolase domain containing 14b |
chr6_-_70051586 | 1.23 |
ENSMUST00000103377.3
|
Igkv6-32
|
immunoglobulin kappa variable 6-32 |
chr2_-_76478336 | 1.23 |
ENSMUST00000002808.7
|
Prkra
|
protein kinase, interferon inducible double stranded RNA dependent activator |
chr3_+_93462387 | 1.22 |
ENSMUST00000045756.14
|
S100a10
|
S100 calcium binding protein A10 (calpactin) |
chr1_+_182591425 | 1.22 |
ENSMUST00000155229.7
ENSMUST00000153348.8 |
Susd4
|
sushi domain containing 4 |
chr12_+_108817043 | 1.21 |
ENSMUST00000057026.10
ENSMUST00000221080.2 |
Slc25a47
|
solute carrier family 25, member 47 |
chr3_-_107850707 | 1.20 |
ENSMUST00000106681.3
|
Gstm6
|
glutathione S-transferase, mu 6 |
chr7_+_44114857 | 1.19 |
ENSMUST00000135624.2
|
Aspdh
|
aspartate dehydrogenase domain containing |
chr2_-_168576155 | 1.18 |
ENSMUST00000109175.9
|
Atp9a
|
ATPase, class II, type 9A |
chr15_-_74869684 | 1.18 |
ENSMUST00000190188.2
ENSMUST00000189068.7 ENSMUST00000186526.7 ENSMUST00000187171.2 ENSMUST00000187994.7 |
Ly6a
|
lymphocyte antigen 6 complex, locus A |
chr7_-_19426529 | 1.17 |
ENSMUST00000207978.2
ENSMUST00000108451.4 ENSMUST00000045035.12 |
Apoc1
|
apolipoprotein C-I |
chr7_-_140590605 | 1.17 |
ENSMUST00000026565.7
|
Ifitm3
|
interferon induced transmembrane protein 3 |
chr15_-_74869483 | 1.17 |
ENSMUST00000023248.13
|
Ly6a
|
lymphocyte antigen 6 complex, locus A |
chr8_-_71990085 | 1.15 |
ENSMUST00000051672.9
|
Bst2
|
bone marrow stromal cell antigen 2 |
chr1_-_121255753 | 1.15 |
ENSMUST00000003818.14
|
Insig2
|
insulin induced gene 2 |
chr5_+_127709302 | 1.14 |
ENSMUST00000118139.3
|
Glt1d1
|
glycosyltransferase 1 domain containing 1 |
chr8_-_3770642 | 1.13 |
ENSMUST00000062037.7
|
Clec4g
|
C-type lectin domain family 4, member g |
chr6_+_70703409 | 1.13 |
ENSMUST00000103410.3
|
Igkc
|
immunoglobulin kappa constant |
chr4_-_49383576 | 1.12 |
ENSMUST00000107698.8
|
Acnat2
|
acyl-coenzyme A amino acid N-acyltransferase 2 |
chr19_+_20470114 | 1.12 |
ENSMUST00000225313.2
|
Aldh1a1
|
aldehyde dehydrogenase family 1, subfamily A1 |
chr18_+_56565188 | 1.12 |
ENSMUST00000070166.6
|
Gramd3
|
GRAM domain containing 3 |
chr11_+_96920751 | 1.11 |
ENSMUST00000021249.11
|
Scrn2
|
secernin 2 |
chr12_+_28725218 | 1.11 |
ENSMUST00000020957.13
|
Adi1
|
acireductone dioxygenase 1 |
chr19_-_20704896 | 1.10 |
ENSMUST00000025656.4
|
Aldh1a7
|
aldehyde dehydrogenase family 1, subfamily A7 |
chr12_-_54250646 | 1.09 |
ENSMUST00000039516.4
|
Egln3
|
egl-9 family hypoxia-inducible factor 3 |
chr15_-_76501041 | 1.09 |
ENSMUST00000073428.7
|
Slc39a4
|
solute carrier family 39 (zinc transporter), member 4 |
chr4_+_156077834 | 1.08 |
ENSMUST00000105578.2
|
Sdf4
|
stromal cell derived factor 4 |
chr15_-_78352801 | 1.08 |
ENSMUST00000229124.2
ENSMUST00000230226.2 ENSMUST00000017086.5 |
Tmprss6
|
transmembrane serine protease 6 |
chr16_-_18880821 | 1.07 |
ENSMUST00000200568.2
|
Iglc1
|
immunoglobulin lambda constant 1 |
chr13_-_55574596 | 1.07 |
ENSMUST00000021948.15
|
F12
|
coagulation factor XII (Hageman factor) |
chr4_-_150093435 | 1.07 |
ENSMUST00000030830.4
|
H6pd
|
hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) |
chr14_-_30645711 | 1.07 |
ENSMUST00000006697.17
|
Itih3
|
inter-alpha trypsin inhibitor, heavy chain 3 |
chr14_+_40827317 | 1.06 |
ENSMUST00000047286.7
|
Mat1a
|
methionine adenosyltransferase I, alpha |
chr14_+_66207163 | 1.06 |
ENSMUST00000153460.8
|
Clu
|
clusterin |
chr11_+_75400889 | 1.06 |
ENSMUST00000042972.7
|
Rilp
|
Rab interacting lysosomal protein |
chr6_+_125298372 | 1.06 |
ENSMUST00000176442.8
ENSMUST00000177329.2 |
Scnn1a
|
sodium channel, nonvoltage-gated 1 alpha |
chr16_-_18884431 | 1.05 |
ENSMUST00000200235.2
|
Iglc3
|
immunoglobulin lambda constant 3 |
chr7_-_44465043 | 1.05 |
ENSMUST00000107893.9
|
Atf5
|
activating transcription factor 5 |
chr19_-_6117815 | 1.05 |
ENSMUST00000162575.8
ENSMUST00000159084.8 ENSMUST00000161718.8 ENSMUST00000162810.8 ENSMUST00000025713.12 ENSMUST00000113543.9 ENSMUST00000160417.8 ENSMUST00000161528.2 |
Tm7sf2
|
transmembrane 7 superfamily member 2 |
chr1_+_93062962 | 1.05 |
ENSMUST00000027491.7
|
Agxt
|
alanine-glyoxylate aminotransferase |
chr7_-_44465998 | 1.04 |
ENSMUST00000209072.2
ENSMUST00000047356.11 |
Atf5
|
activating transcription factor 5 |
chr4_+_135673758 | 1.03 |
ENSMUST00000030432.8
|
Hmgcl
|
3-hydroxy-3-methylglutaryl-Coenzyme A lyase |
chr6_-_136899167 | 1.03 |
ENSMUST00000032343.7
|
Erp27
|
endoplasmic reticulum protein 27 |
chr10_+_77458197 | 1.02 |
ENSMUST00000172772.2
|
Ube2g2
|
ubiquitin-conjugating enzyme E2G 2 |
chr11_+_83637766 | 1.01 |
ENSMUST00000070832.3
|
Wfdc21
|
WAP four-disulfide core domain 21 |
chr1_+_88034556 | 1.01 |
ENSMUST00000113137.2
|
Ugt1a6b
|
UDP glucuronosyltransferase 1 family, polypeptide A6B |
chr17_+_32725420 | 1.01 |
ENSMUST00000235238.2
ENSMUST00000165999.2 |
Cyp4f17
|
cytochrome P450, family 4, subfamily f, polypeptide 17 |
chr17_+_34524841 | 1.00 |
ENSMUST00000235530.2
|
H2-Eb1
|
histocompatibility 2, class II antigen E beta |
chr15_-_102097387 | 1.00 |
ENSMUST00000230288.2
|
Csad
|
cysteine sulfinic acid decarboxylase |
chr3_+_94280101 | 1.00 |
ENSMUST00000029795.10
|
Rorc
|
RAR-related orphan receptor gamma |
chr11_-_69696428 | 1.00 |
ENSMUST00000051025.5
|
Tmem102
|
transmembrane protein 102 |
chr15_+_77613239 | 1.00 |
ENSMUST00000230979.2
ENSMUST00000109775.4 |
Apol9b
|
apolipoprotein L 9b |
chr7_-_25358406 | 0.99 |
ENSMUST00000071329.8
|
Bckdha
|
branched chain ketoacid dehydrogenase E1, alpha polypeptide |
chr15_+_31565508 | 0.98 |
ENSMUST00000226951.2
|
Cmbl
|
carboxymethylenebutenolidase-like (Pseudomonas) |
chr1_-_172722589 | 0.98 |
ENSMUST00000027824.7
|
Apcs
|
serum amyloid P-component |
chr6_+_121277186 | 0.98 |
ENSMUST00000064580.14
|
Slc6a13
|
solute carrier family 6 (neurotransmitter transporter, GABA), member 13 |
chr14_+_40826970 | 0.97 |
ENSMUST00000225720.2
|
Mat1a
|
methionine adenosyltransferase I, alpha |
chr7_+_29883569 | 0.97 |
ENSMUST00000098594.4
|
Cox7a1
|
cytochrome c oxidase subunit 7A1 |
chr4_-_156285247 | 0.97 |
ENSMUST00000085425.6
|
Isg15
|
ISG15 ubiquitin-like modifier |
chr15_-_96947963 | 0.96 |
ENSMUST00000230907.2
|
Slc38a4
|
solute carrier family 38, member 4 |
chr7_-_142233270 | 0.96 |
ENSMUST00000162317.2
ENSMUST00000125933.2 ENSMUST00000105931.8 ENSMUST00000105930.8 ENSMUST00000105933.8 ENSMUST00000105932.2 ENSMUST00000000220.3 |
Ins2
|
insulin II |
chr4_-_116991150 | 0.96 |
ENSMUST00000076859.12
|
Plk3
|
polo like kinase 3 |
chr2_-_173060647 | 0.96 |
ENSMUST00000109116.3
ENSMUST00000029018.14 |
Zbp1
|
Z-DNA binding protein 1 |
chr17_+_34524884 | 0.95 |
ENSMUST00000074557.11
|
H2-Eb1
|
histocompatibility 2, class II antigen E beta |
chr11_-_70590923 | 0.95 |
ENSMUST00000108543.4
ENSMUST00000108542.8 ENSMUST00000108541.9 ENSMUST00000126114.9 ENSMUST00000073625.8 |
Inca1
|
inhibitor of CDK, cyclin A1 interacting protein 1 |
chr5_-_4154681 | 0.94 |
ENSMUST00000001507.5
|
Cyp51
|
cytochrome P450, family 51 |
chr5_-_145816774 | 0.94 |
ENSMUST00000035918.8
|
Cyp3a11
|
cytochrome P450, family 3, subfamily a, polypeptide 11 |
chr2_-_84605732 | 0.94 |
ENSMUST00000023994.10
|
Serping1
|
serine (or cysteine) peptidase inhibitor, clade G, member 1 |
chr18_+_20798337 | 0.94 |
ENSMUST00000075312.5
|
Ttr
|
transthyretin |
chr3_-_107850666 | 0.94 |
ENSMUST00000106683.8
|
Gstm6
|
glutathione S-transferase, mu 6 |
chr2_-_84605764 | 0.94 |
ENSMUST00000111641.2
|
Serping1
|
serine (or cysteine) peptidase inhibitor, clade G, member 1 |
chrX_+_100419965 | 0.94 |
ENSMUST00000119080.8
|
Gjb1
|
gap junction protein, beta 1 |
chr6_+_138117295 | 0.93 |
ENSMUST00000008684.11
|
Mgst1
|
microsomal glutathione S-transferase 1 |
chr19_+_12610668 | 0.93 |
ENSMUST00000044976.12
|
Glyat
|
glycine-N-acyltransferase |
chr5_-_45607554 | 0.93 |
ENSMUST00000015950.12
|
Qdpr
|
quinoid dihydropteridine reductase |
chr7_+_140414837 | 0.93 |
ENSMUST00000106050.8
|
Urah
|
urate (5-hydroxyiso-) hydrolase |
chr6_-_85846110 | 0.92 |
ENSMUST00000045008.8
|
Nat8f2
|
N-acetyltransferase 8 (GCN5-related) family member 2 |
chr4_-_129132963 | 0.92 |
ENSMUST00000097873.10
|
C77080
|
expressed sequence C77080 |
chr17_-_33166346 | 0.91 |
ENSMUST00000139353.8
|
Cyp4f13
|
cytochrome P450, family 4, subfamily f, polypeptide 13 |
chr3_+_82915031 | 0.91 |
ENSMUST00000048486.13
ENSMUST00000194175.2 |
Fgg
|
fibrinogen gamma chain |
chr6_-_85809064 | 0.91 |
ENSMUST00000032073.7
|
Nat8
|
N-acetyltransferase 8 (GCN5-related) |
chr13_-_42001075 | 0.91 |
ENSMUST00000179758.8
|
Adtrp
|
androgen dependent TFPI regulating protein |
chr9_-_110571645 | 0.91 |
ENSMUST00000006005.12
|
Pth1r
|
parathyroid hormone 1 receptor |
chr3_+_89366425 | 0.90 |
ENSMUST00000029564.12
|
Pmvk
|
phosphomevalonate kinase |
chr15_-_82278223 | 0.90 |
ENSMUST00000170255.2
|
Cyp2d11
|
cytochrome P450, family 2, subfamily d, polypeptide 11 |
chr18_+_32087883 | 0.90 |
ENSMUST00000223753.2
|
Lims2
|
LIM and senescent cell antigen like domains 2 |
chr17_-_31363245 | 0.90 |
ENSMUST00000024826.8
|
Tff2
|
trefoil factor 2 (spasmolytic protein 1) |
chr4_+_108022645 | 0.90 |
ENSMUST00000116309.10
ENSMUST00000116307.8 |
Echdc2
|
enoyl Coenzyme A hydratase domain containing 2 |
chr3_+_142406787 | 0.90 |
ENSMUST00000106218.8
|
Kyat3
|
kynurenine aminotransferase 3 |
chr3_+_142406827 | 0.90 |
ENSMUST00000044392.11
ENSMUST00000199519.5 |
Kyat3
|
kynurenine aminotransferase 3 |
chr6_-_71121347 | 0.90 |
ENSMUST00000160918.8
|
Thnsl2
|
threonine synthase-like 2 (bacterial) |
chr11_+_78356523 | 0.90 |
ENSMUST00000001126.4
|
Slc46a1
|
solute carrier family 46, member 1 |
chr12_-_103871146 | 0.89 |
ENSMUST00000074051.6
|
Serpina1c
|
serine (or cysteine) peptidase inhibitor, clade A, member 1C |
chr19_-_4092218 | 0.89 |
ENSMUST00000237999.2
ENSMUST00000042700.12 |
Gstp2
|
glutathione S-transferase, pi 2 |
chr4_-_155445818 | 0.89 |
ENSMUST00000030922.15
|
Prkcz
|
protein kinase C, zeta |
chr8_-_3517617 | 0.88 |
ENSMUST00000111081.10
ENSMUST00000004686.13 |
Pex11g
|
peroxisomal biogenesis factor 11 gamma |
chr14_-_25928096 | 0.88 |
ENSMUST00000185006.9
|
Tmem254a
|
transmembrane protein 254a |
chr4_+_141473983 | 0.88 |
ENSMUST00000038161.5
|
Agmat
|
agmatine ureohydrolase (agmatinase) |
chr7_-_127494750 | 0.88 |
ENSMUST00000033074.8
|
Vkorc1
|
vitamin K epoxide reductase complex, subunit 1 |
chr5_+_90708962 | 0.87 |
ENSMUST00000094615.8
ENSMUST00000200765.2 |
Albfm1
|
albumin superfamily member 1 |
chr7_+_16186704 | 0.87 |
ENSMUST00000019302.10
|
Tmem160
|
transmembrane protein 160 |
chr7_+_123061535 | 0.86 |
ENSMUST00000098056.6
|
Aqp8
|
aquaporin 8 |
chr1_+_130793406 | 0.86 |
ENSMUST00000038829.7
|
Fcmr
|
Fc fragment of IgM receptor |
chr7_-_3298243 | 0.86 |
ENSMUST00000108653.4
|
Nlrp12
|
NLR family, pyrin domain containing 12 |
chr14_+_66208498 | 0.85 |
ENSMUST00000128539.8
|
Clu
|
clusterin |
chr17_-_33166362 | 0.85 |
ENSMUST00000234083.2
ENSMUST00000075253.13 |
Cyp4f13
|
cytochrome P450, family 4, subfamily f, polypeptide 13 |
chr7_+_100966289 | 0.85 |
ENSMUST00000163799.9
ENSMUST00000164479.9 |
Stard10
|
START domain containing 10 |
chr15_-_76191301 | 0.84 |
ENSMUST00000171340.9
ENSMUST00000023222.13 ENSMUST00000164189.2 |
Oplah
|
5-oxoprolinase (ATP-hydrolysing) |
chr11_+_117716759 | 0.84 |
ENSMUST00000149668.2
|
Afmid
|
arylformamidase |
chr13_-_55574582 | 0.84 |
ENSMUST00000170921.2
|
F12
|
coagulation factor XII (Hageman factor) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 4.5 | GO:0034757 | negative regulation of iron ion transport(GO:0034757) negative regulation of iron ion transmembrane transport(GO:0034760) |
1.0 | 2.9 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.9 | 2.8 | GO:0009087 | methionine catabolic process(GO:0009087) |
0.9 | 3.7 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.8 | 7.7 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
0.7 | 2.2 | GO:0090420 | naphthalene metabolic process(GO:0018931) naphthalene-containing compound metabolic process(GO:0090420) |
0.7 | 5.9 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.7 | 4.2 | GO:1902847 | regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
0.6 | 1.9 | GO:0002541 | activation of plasma proteins involved in acute inflammatory response(GO:0002541) |
0.6 | 1.9 | GO:0001868 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
0.6 | 0.6 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
0.6 | 2.4 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.5 | 1.6 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.5 | 3.5 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.5 | 1.5 | GO:1903699 | tarsal gland development(GO:1903699) |
0.5 | 4.4 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.5 | 1.4 | GO:1903920 | positive regulation of actin filament severing(GO:1903920) |
0.4 | 3.6 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.4 | 1.3 | GO:0097037 | heme export(GO:0097037) |
0.4 | 4.8 | GO:0052697 | flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
0.4 | 2.6 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.4 | 1.8 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.4 | 1.7 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.4 | 1.6 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.4 | 2.8 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.4 | 2.4 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.4 | 1.6 | GO:0061646 | positive regulation of glutamate neurotransmitter secretion in response to membrane depolarization(GO:0061646) |
0.4 | 1.5 | GO:0015886 | heme transport(GO:0015886) |
0.4 | 2.3 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.4 | 1.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.4 | 1.1 | GO:0070676 | intralumenal vesicle formation(GO:0070676) |
0.3 | 2.0 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.3 | 1.3 | GO:0070625 | zymogen granule exocytosis(GO:0070625) |
0.3 | 1.0 | GO:0052422 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.3 | 1.6 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.3 | 0.6 | GO:0046967 | cytosol to ER transport(GO:0046967) |
0.3 | 1.0 | GO:1990535 | negative regulation of NAD(P)H oxidase activity(GO:0033861) neuron projection maintenance(GO:1990535) |
0.3 | 1.0 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
0.3 | 0.3 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.3 | 0.9 | GO:0071938 | vitamin A transport(GO:0071938) vitamin A import(GO:0071939) |
0.3 | 1.5 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.3 | 0.9 | GO:0018003 | peptidyl-lysine N6-acetylation(GO:0018003) |
0.3 | 1.4 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.3 | 1.1 | GO:0006710 | androgen catabolic process(GO:0006710) |
0.3 | 3.1 | GO:1903278 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.3 | 0.8 | GO:0061623 | glycolytic process from galactose(GO:0061623) |
0.3 | 0.5 | GO:0002481 | antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) |
0.3 | 0.8 | GO:0042196 | dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
0.3 | 1.0 | GO:0030450 | regulation of complement activation, classical pathway(GO:0030450) |
0.3 | 1.3 | GO:0009732 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.3 | 1.0 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.3 | 0.8 | GO:0002343 | peripheral B cell selection(GO:0002343) B cell affinity maturation(GO:0002344) |
0.3 | 1.5 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
0.2 | 1.2 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.2 | 1.2 | GO:0002484 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
0.2 | 0.7 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.2 | 0.7 | GO:0000448 | cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
0.2 | 1.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.2 | 0.7 | GO:0090320 | chylomicron assembly(GO:0034378) regulation of chylomicron remnant clearance(GO:0090320) |
0.2 | 0.2 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
0.2 | 2.1 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.2 | 1.1 | GO:0019072 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
0.2 | 3.7 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.2 | 0.5 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.2 | 0.7 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
0.2 | 6.8 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.2 | 0.7 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.2 | 0.4 | GO:0046724 | oxalic acid secretion(GO:0046724) |
0.2 | 2.7 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.2 | 0.2 | GO:0061227 | intermediate mesoderm development(GO:0048389) pattern specification involved in mesonephros development(GO:0061227) anterior/posterior pattern specification involved in kidney development(GO:0072098) |
0.2 | 0.9 | GO:0051795 | positive regulation of catagen(GO:0051795) |
0.2 | 1.7 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.2 | 1.1 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
0.2 | 1.1 | GO:0006880 | intracellular sequestering of iron ion(GO:0006880) sequestering of iron ion(GO:0097577) |
0.2 | 0.9 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
0.2 | 3.6 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
0.2 | 0.6 | GO:0060559 | positive regulation of vitamin metabolic process(GO:0046136) positive regulation of vitamin D biosynthetic process(GO:0060557) positive regulation of calcidiol 1-monooxygenase activity(GO:0060559) |
0.2 | 1.0 | GO:0071718 | sodium-independent icosanoid transport(GO:0071718) |
0.2 | 1.5 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.2 | 0.4 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.2 | 1.4 | GO:0060309 | elastin catabolic process(GO:0060309) |
0.2 | 0.2 | GO:2000412 | positive regulation of thymocyte migration(GO:2000412) |
0.2 | 0.8 | GO:0086047 | membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
0.2 | 1.2 | GO:1904781 | positive regulation of protein localization to centrosome(GO:1904781) |
0.2 | 2.4 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.2 | 0.6 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.2 | 2.9 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.2 | 0.6 | GO:0009258 | 10-formyltetrahydrofolate catabolic process(GO:0009258) folic acid-containing compound catabolic process(GO:0009397) pteridine-containing compound catabolic process(GO:0042560) |
0.2 | 1.1 | GO:0015889 | cobalamin transport(GO:0015889) |
0.2 | 0.8 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.2 | 0.6 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.2 | 1.5 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.2 | 0.7 | GO:0090472 | dibasic protein processing(GO:0090472) |
0.2 | 0.4 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.2 | 0.5 | GO:0051659 | maintenance of mitochondrion location(GO:0051659) |
0.2 | 10.4 | GO:0006953 | acute-phase response(GO:0006953) |
0.2 | 0.4 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.2 | 2.0 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.2 | 1.8 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.2 | 0.9 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
0.2 | 0.2 | GO:0090182 | regulation of secretion of lysosomal enzymes(GO:0090182) |
0.2 | 0.5 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.2 | 0.2 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.2 | 0.8 | GO:0006548 | histidine catabolic process(GO:0006548) |
0.2 | 1.0 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
0.2 | 1.6 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.2 | 0.8 | GO:1904721 | regulation of mRNA cleavage(GO:0031437) negative regulation of mRNA cleavage(GO:0031438) regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904720) negative regulation of mRNA endonucleolytic cleavage involved in unfolded protein response(GO:1904721) |
0.2 | 0.3 | GO:0072720 | response to dithiothreitol(GO:0072720) |
0.2 | 1.0 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
0.2 | 4.3 | GO:0035455 | response to interferon-alpha(GO:0035455) |
0.2 | 0.6 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
0.2 | 0.8 | GO:0031335 | regulation of sulfur amino acid metabolic process(GO:0031335) |
0.2 | 0.5 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
0.2 | 0.2 | GO:0072181 | mesonephric duct formation(GO:0072181) |
0.2 | 0.5 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.2 | 1.2 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
0.2 | 0.5 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
0.2 | 0.2 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
0.2 | 0.5 | GO:0034371 | chylomicron remodeling(GO:0034371) |
0.2 | 0.2 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.2 | 0.6 | GO:0034031 | coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) acetyl-CoA catabolic process(GO:0046356) |
0.2 | 0.6 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
0.2 | 0.3 | GO:1903367 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
0.2 | 0.3 | GO:0071724 | response to diacyl bacterial lipopeptide(GO:0071724) cellular response to diacyl bacterial lipopeptide(GO:0071726) |
0.2 | 2.0 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.2 | 0.6 | GO:0010182 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.1 | 0.6 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.1 | 0.4 | GO:1903588 | negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
0.1 | 0.4 | GO:0036343 | psychomotor behavior(GO:0036343) |
0.1 | 0.7 | GO:0009992 | cellular water homeostasis(GO:0009992) |
0.1 | 0.9 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.1 | 0.4 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.1 | 0.6 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.1 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.1 | 1.1 | GO:1901748 | leukotriene D4 metabolic process(GO:1901748) leukotriene D4 biosynthetic process(GO:1901750) |
0.1 | 0.3 | GO:0019405 | alditol catabolic process(GO:0019405) |
0.1 | 0.4 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 0.4 | GO:0002414 | immune response in mucosal-associated lymphoid tissue(GO:0002386) immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.1 | 3.0 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
0.1 | 1.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 1.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.4 | GO:0046491 | L-methylmalonyl-CoA metabolic process(GO:0046491) |
0.1 | 0.8 | GO:0061760 | antifungal innate immune response(GO:0061760) |
0.1 | 0.1 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
0.1 | 0.7 | GO:0034372 | triglyceride-rich lipoprotein particle remodeling(GO:0034370) very-low-density lipoprotein particle remodeling(GO:0034372) |
0.1 | 0.4 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.1 | 0.4 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.1 | 0.7 | GO:0042446 | hormone biosynthetic process(GO:0042446) |
0.1 | 0.7 | GO:0097460 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
0.1 | 0.8 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
0.1 | 1.0 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
0.1 | 0.1 | GO:0060157 | urinary bladder development(GO:0060157) |
0.1 | 0.4 | GO:0043181 | vacuolar sequestering(GO:0043181) |
0.1 | 0.4 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
0.1 | 0.4 | GO:0048611 | ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
0.1 | 1.4 | GO:0042730 | fibrinolysis(GO:0042730) |
0.1 | 0.4 | GO:0031104 | dendrite regeneration(GO:0031104) |
0.1 | 0.9 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.4 | GO:0015817 | histidine transport(GO:0015817) |
0.1 | 0.7 | GO:0009253 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) negative regulation of natural killer cell differentiation(GO:0032824) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.1 | 0.6 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.1 | 0.4 | GO:0044268 | multicellular organismal protein metabolic process(GO:0044268) |
0.1 | 1.2 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.1 | 0.2 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.1 | 0.1 | GO:0070237 | positive regulation of activation-induced cell death of T cells(GO:0070237) |
0.1 | 0.7 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.1 | 1.2 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.1 | 0.6 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.1 | 0.8 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.1 | 0.8 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 0.3 | GO:1903173 | phytol metabolic process(GO:0033306) fatty alcohol metabolic process(GO:1903173) |
0.1 | 0.5 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
0.1 | 1.3 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.1 | 0.7 | GO:0043366 | beta selection(GO:0043366) |
0.1 | 0.4 | GO:0000239 | pachytene(GO:0000239) |
0.1 | 0.5 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.1 | 1.7 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 3.6 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.1 | 0.1 | GO:2000547 | regulation of dendritic cell dendrite assembly(GO:2000547) |
0.1 | 0.4 | GO:1990091 | sodium-dependent self proteolysis(GO:1990091) |
0.1 | 0.6 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.1 | 0.6 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.1 | 0.3 | GO:0071469 | cellular response to alkaline pH(GO:0071469) |
0.1 | 1.0 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.1 | 0.4 | GO:0032901 | positive regulation of neurotrophin production(GO:0032901) |
0.1 | 0.9 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.1 | 1.0 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.1 | 0.6 | GO:0035026 | leading edge cell differentiation(GO:0035026) cellular response to potassium ion starvation(GO:0051365) |
0.1 | 0.4 | GO:0051944 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.1 | 0.4 | GO:0036376 | sodium ion export from cell(GO:0036376) |
0.1 | 1.4 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.1 | 0.6 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.1 | 0.3 | GO:0032218 | riboflavin transport(GO:0032218) |
0.1 | 0.3 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
0.1 | 0.3 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
0.1 | 0.3 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
0.1 | 0.3 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.1 | 1.0 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.1 | 0.3 | GO:1904457 | positive regulation of neuronal action potential(GO:1904457) |
0.1 | 0.5 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
0.1 | 0.2 | GO:0014908 | myotube differentiation involved in skeletal muscle regeneration(GO:0014908) |
0.1 | 0.3 | GO:0019532 | oxalate transport(GO:0019532) |
0.1 | 2.7 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
0.1 | 0.2 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.1 | 0.6 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.1 | 1.8 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.1 | 0.6 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
0.1 | 0.7 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 4.8 | GO:0035456 | response to interferon-beta(GO:0035456) |
0.1 | 0.2 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
0.1 | 1.5 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
0.1 | 0.8 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.1 | 0.5 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 12.8 | GO:0007586 | digestion(GO:0007586) |
0.1 | 0.1 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
0.1 | 1.0 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.1 | 0.4 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.1 | 1.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.3 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.1 | 0.2 | GO:1904328 | regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
0.1 | 0.6 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.1 | 0.1 | GO:0010593 | negative regulation of lamellipodium assembly(GO:0010593) |
0.1 | 1.2 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.5 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.1 | 0.3 | GO:0035702 | monocyte homeostasis(GO:0035702) |
0.1 | 0.6 | GO:0021539 | subthalamus development(GO:0021539) |
0.1 | 0.5 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.1 | 0.3 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.1 | 0.3 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 1.5 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
0.1 | 0.4 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.1 | 0.4 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
0.1 | 0.3 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.1 | 0.2 | GO:0009750 | response to fructose(GO:0009750) |
0.1 | 0.7 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
0.1 | 0.4 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.3 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.1 | 0.2 | GO:0050976 | detection of mechanical stimulus involved in sensory perception of touch(GO:0050976) |
0.1 | 1.0 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.6 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.1 | 0.2 | GO:0060697 | positive regulation of phospholipid catabolic process(GO:0060697) |
0.1 | 2.8 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
0.1 | 1.8 | GO:0097435 | fibril organization(GO:0097435) |
0.1 | 1.4 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
0.1 | 0.5 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 1.1 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.1 | 0.3 | GO:1904453 | regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
0.1 | 0.1 | GO:0045112 | integrin biosynthetic process(GO:0045112) regulation of integrin biosynthetic process(GO:0045113) |
0.1 | 0.2 | GO:0099526 | presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
0.1 | 0.6 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.1 | 0.4 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.1 | 0.5 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
0.1 | 0.2 | GO:1904954 | Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904953) canonical Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904954) |
0.1 | 0.2 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.1 | 1.1 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.1 | 1.2 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.1 | 1.1 | GO:0071493 | cellular response to UV-B(GO:0071493) |
0.1 | 0.2 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.1 | 0.8 | GO:0019884 | antigen processing and presentation of exogenous antigen(GO:0019884) |
0.1 | 0.2 | GO:1904733 | negative regulation of electron carrier activity(GO:1904733) regulation of fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:1904735) negative regulation of fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:1904736) |
0.1 | 0.8 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.1 | 0.4 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
0.1 | 0.5 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.1 | 0.8 | GO:0090500 | endocardial cushion to mesenchymal transition(GO:0090500) |
0.1 | 0.6 | GO:0033089 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
0.1 | 0.9 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 0.2 | GO:0035874 | amiloride transport(GO:0015898) cellular response to copper ion starvation(GO:0035874) response to azide(GO:0097184) cellular response to azide(GO:0097185) |
0.1 | 1.1 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.1 | 0.2 | GO:0038156 | interleukin-3-mediated signaling pathway(GO:0038156) |
0.1 | 0.3 | GO:2000822 | regulation of fear response(GO:1903365) regulation of behavioral fear response(GO:2000822) |
0.1 | 0.8 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.1 | 1.6 | GO:0080184 | response to phenylpropanoid(GO:0080184) |
0.1 | 1.0 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
0.1 | 0.2 | GO:0002014 | vasoconstriction of artery involved in ischemic response to lowering of systemic arterial blood pressure(GO:0002014) |
0.1 | 0.5 | GO:0019433 | triglyceride catabolic process(GO:0019433) |
0.1 | 0.3 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.1 | 0.5 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
0.1 | 0.3 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.1 | 0.5 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
0.1 | 0.2 | GO:0090673 | endothelial cell-matrix adhesion(GO:0090673) |
0.1 | 0.5 | GO:0018377 | protein myristoylation(GO:0018377) |
0.1 | 0.1 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.1 | 0.5 | GO:0048242 | epinephrine secretion(GO:0048242) |
0.1 | 0.5 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.1 | 0.1 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.1 | 0.8 | GO:2000576 | positive regulation of microtubule motor activity(GO:2000576) |
0.1 | 0.3 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.1 | 0.3 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.1 | 0.4 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.1 | 0.3 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.1 | 0.5 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
0.1 | 8.8 | GO:0006956 | complement activation(GO:0006956) |
0.1 | 0.2 | GO:0060809 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
0.1 | 0.1 | GO:0002578 | negative regulation of antigen processing and presentation(GO:0002578) negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
0.1 | 0.4 | GO:0071321 | cellular response to cGMP(GO:0071321) |
0.1 | 0.4 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 0.5 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
0.1 | 0.1 | GO:0097017 | renal protein absorption(GO:0097017) |
0.1 | 0.5 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.8 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.1 | 0.2 | GO:0010808 | positive regulation of synaptic vesicle priming(GO:0010808) |
0.1 | 0.4 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.1 | 0.8 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.1 | 0.2 | GO:1902938 | regulation of intracellular calcium activated chloride channel activity(GO:1902938) |
0.1 | 0.3 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.1 | 0.5 | GO:0031054 | pre-miRNA processing(GO:0031054) |
0.1 | 0.2 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.1 | 0.1 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.1 | 0.4 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.1 | 0.1 | GO:0002461 | tolerance induction dependent upon immune response(GO:0002461) |
0.1 | 0.5 | GO:1903003 | positive regulation of protein deubiquitination(GO:1903003) |
0.1 | 0.1 | GO:0072069 | DCT cell differentiation(GO:0072069) metanephric DCT cell differentiation(GO:0072240) |
0.1 | 0.3 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.1 | 0.5 | GO:0051775 | response to redox state(GO:0051775) |
0.1 | 0.6 | GO:0060179 | male mating behavior(GO:0060179) |
0.1 | 0.8 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.1 | 2.4 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.1 | 1.5 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.1 | 0.2 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.1 | 0.4 | GO:0042427 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.1 | 0.2 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
0.1 | 0.5 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.1 | 0.4 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
0.1 | 4.8 | GO:0009062 | fatty acid catabolic process(GO:0009062) |
0.1 | 0.3 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.1 | 0.3 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.1 | 0.9 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 0.6 | GO:0060180 | female mating behavior(GO:0060180) |
0.1 | 0.2 | GO:0021526 | medial motor column neuron differentiation(GO:0021526) |
0.1 | 0.1 | GO:0099525 | presynaptic dense core granule exocytosis(GO:0099525) |
0.1 | 0.9 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
0.1 | 0.1 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.1 | 0.2 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.1 | 0.3 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.1 | 0.3 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.1 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.1 | 1.1 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.1 | 0.2 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
0.1 | 0.2 | GO:0061090 | positive regulation of sequestering of zinc ion(GO:0061090) |
0.1 | 1.4 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
0.1 | 0.6 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
0.1 | 2.9 | GO:0006801 | superoxide metabolic process(GO:0006801) |
0.1 | 6.9 | GO:0009636 | response to toxic substance(GO:0009636) |
0.1 | 0.3 | GO:1902949 | positive regulation of tau-protein kinase activity(GO:1902949) |
0.0 | 0.5 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.0 | 0.3 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.0 | 0.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.3 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.6 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.1 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.0 | 0.0 | GO:1902159 | regulation of cyclic nucleotide-gated ion channel activity(GO:1902159) |
0.0 | 0.6 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
0.0 | 1.0 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.0 | 0.2 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.0 | 0.3 | GO:0039019 | pronephric nephron development(GO:0039019) |
0.0 | 0.2 | GO:0060598 | dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
0.0 | 0.2 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.4 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.0 | 1.1 | GO:0060396 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
0.0 | 0.2 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
0.0 | 0.3 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 1.9 | GO:0050891 | multicellular organismal water homeostasis(GO:0050891) |
0.0 | 0.2 | GO:0002879 | positive regulation of acute inflammatory response to non-antigenic stimulus(GO:0002879) |
0.0 | 0.1 | GO:0003218 | cardiac left ventricle formation(GO:0003218) |
0.0 | 0.5 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
0.0 | 2.5 | GO:0006695 | cholesterol biosynthetic process(GO:0006695) |
0.0 | 0.1 | GO:0072278 | metanephric comma-shaped body morphogenesis(GO:0072278) |
0.0 | 0.1 | GO:0030070 | insulin processing(GO:0030070) |
0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
0.0 | 0.1 | GO:0002604 | regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.0 | 1.8 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.2 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.4 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 1.5 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.0 | 0.1 | GO:0060594 | mammary gland specification(GO:0060594) |
0.0 | 0.9 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.0 | 0.2 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.0 | 0.2 | GO:0051004 | regulation of lipoprotein lipase activity(GO:0051004) |
0.0 | 1.0 | GO:0002021 | response to dietary excess(GO:0002021) |
0.0 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.0 | 0.2 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
0.0 | 0.8 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.0 | 0.5 | GO:0031268 | pseudopodium organization(GO:0031268) |
0.0 | 0.4 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.0 | 0.1 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.0 | 0.2 | GO:0070142 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) synaptic vesicle budding(GO:0070142) |
0.0 | 0.5 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.5 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.1 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.0 | 0.4 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
0.0 | 0.2 | GO:0045059 | positive thymic T cell selection(GO:0045059) |
0.0 | 0.4 | GO:0046415 | urate metabolic process(GO:0046415) |
0.0 | 0.7 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
0.0 | 0.3 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.0 | 0.2 | GO:1904616 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
0.0 | 0.1 | GO:2001023 | regulation of response to drug(GO:2001023) |
0.0 | 0.5 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.3 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.0 | 0.8 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.0 | 0.3 | GO:0043383 | negative T cell selection(GO:0043383) |
0.0 | 0.2 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.0 | 0.8 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.0 | 0.1 | GO:1904796 | regulation of core promoter binding(GO:1904796) positive regulation of core promoter binding(GO:1904798) |
0.0 | 0.2 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.0 | 0.2 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
0.0 | 0.5 | GO:0006536 | glutamate metabolic process(GO:0006536) |
0.0 | 0.3 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.0 | 0.2 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
0.0 | 0.8 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.3 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.0 | 0.2 | GO:0097309 | cap1 mRNA methylation(GO:0097309) |
0.0 | 0.3 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.3 | GO:0035878 | nail development(GO:0035878) |
0.0 | 0.2 | GO:0009449 | gamma-aminobutyric acid metabolic process(GO:0009448) gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.0 | 0.2 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.5 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.0 | 0.9 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.0 | 0.1 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.0 | 2.9 | GO:0006694 | steroid biosynthetic process(GO:0006694) |
0.0 | 0.4 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.0 | 0.1 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.0 | 0.7 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
0.0 | 0.2 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.0 | 0.2 | GO:0070508 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
0.0 | 0.3 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.0 | 0.0 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.0 | 0.1 | GO:0002191 | formation of cytoplasmic translation initiation complex(GO:0001732) cap-dependent translational initiation(GO:0002191) |
0.0 | 0.2 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 0.8 | GO:0001765 | membrane raft assembly(GO:0001765) |
0.0 | 0.2 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
0.0 | 0.4 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.1 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.0 | 0.1 | GO:0060720 | spongiotrophoblast cell proliferation(GO:0060720) cell proliferation involved in embryonic placenta development(GO:0060722) |
0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 1.0 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
0.0 | 0.5 | GO:0086036 | regulation of cardiac muscle cell membrane potential(GO:0086036) |
0.0 | 0.1 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.1 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.0 | 0.2 | GO:0006991 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.0 | 0.1 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.0 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.0 | 0.0 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
0.0 | 0.2 | GO:0019321 | pentose metabolic process(GO:0019321) |
0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.1 | GO:0003350 | pulmonary myocardium development(GO:0003350) |
0.0 | 0.4 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.0 | 0.1 | GO:0060686 | regulation of prostatic bud formation(GO:0060685) negative regulation of prostatic bud formation(GO:0060686) |
0.0 | 0.2 | GO:0060474 | positive regulation of sperm motility involved in capacitation(GO:0060474) |
0.0 | 0.1 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.0 | 0.3 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.0 | 0.7 | GO:0070229 | negative regulation of lymphocyte apoptotic process(GO:0070229) |
0.0 | 0.3 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.0 | 0.3 | GO:0072501 | cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 0.2 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.0 | 0.2 | GO:0072554 | blood vessel lumenization(GO:0072554) regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901295) positive regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901297) regulation of canonical Wnt signaling pathway involved in heart development(GO:1905066) positive regulation of canonical Wnt signaling pathway involved in heart development(GO:1905068) |
0.0 | 0.9 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.3 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.0 | 0.3 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.0 | 1.5 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.0 | 0.4 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.0 | 0.1 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.0 | 0.9 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
0.0 | 0.1 | GO:0032972 | regulation of muscle filament sliding speed(GO:0032972) |
0.0 | 5.3 | GO:0006631 | fatty acid metabolic process(GO:0006631) |
0.0 | 0.1 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.0 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 1.4 | GO:0008203 | cholesterol metabolic process(GO:0008203) |
0.0 | 0.2 | GO:0015888 | thiamine transport(GO:0015888) |
0.0 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.5 | GO:0009134 | nucleoside diphosphate catabolic process(GO:0009134) |
0.0 | 0.1 | GO:0021852 | axon midline choice point recognition(GO:0016199) pyramidal neuron migration(GO:0021852) |
0.0 | 0.1 | GO:0061590 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
0.0 | 0.3 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.0 | 0.3 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.0 | 0.1 | GO:0034971 | histone H3-R17 methylation(GO:0034971) |
0.0 | 0.3 | GO:0009071 | serine family amino acid catabolic process(GO:0009071) |
0.0 | 1.3 | GO:0006749 | glutathione metabolic process(GO:0006749) |
0.0 | 0.1 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
0.0 | 0.2 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.1 | GO:0006561 | proline metabolic process(GO:0006560) proline biosynthetic process(GO:0006561) |
0.0 | 0.1 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.0 | 0.4 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.0 | 0.2 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.1 | GO:0035799 | ureter maturation(GO:0035799) |
0.0 | 0.2 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.0 | 0.1 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
0.0 | 0.3 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.0 | 0.3 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
0.0 | 0.2 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.0 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.0 | 0.2 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.0 | 0.1 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.1 | GO:0061033 | secretion by lung epithelial cell involved in lung growth(GO:0061033) |
0.0 | 0.3 | GO:0033108 | mitochondrial respiratory chain complex assembly(GO:0033108) |
0.0 | 0.1 | GO:0006589 | octopamine biosynthetic process(GO:0006589) octopamine metabolic process(GO:0046333) |
0.0 | 0.1 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.0 | 0.1 | GO:0048819 | regulation of hair follicle maturation(GO:0048819) |
0.0 | 0.2 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.0 | 0.3 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.2 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.1 | GO:1903225 | regulation of endodermal cell fate specification(GO:0042663) negative regulation of endodermal cell differentiation(GO:1903225) |
0.0 | 6.2 | GO:0043434 | response to peptide hormone(GO:0043434) |
0.0 | 1.6 | GO:0051289 | protein homotetramerization(GO:0051289) |
0.0 | 0.6 | GO:1902307 | positive regulation of sodium ion transmembrane transport(GO:1902307) |
0.0 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.4 | GO:0021854 | hypothalamus development(GO:0021854) |
0.0 | 0.3 | GO:0072319 | synaptic vesicle uncoating(GO:0016191) vesicle uncoating(GO:0072319) |
0.0 | 0.4 | GO:0031498 | chromatin disassembly(GO:0031498) |
0.0 | 0.2 | GO:0002003 | angiotensin maturation(GO:0002003) |
0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.1 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.0 | 0.1 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.0 | 0.3 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.3 | GO:0070633 | transepithelial transport(GO:0070633) |
0.0 | 0.5 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.5 | GO:1901028 | regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901028) |
0.0 | 0.9 | GO:0001702 | gastrulation with mouth forming second(GO:0001702) |
0.0 | 0.3 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.0 | 0.2 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.8 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
0.0 | 0.1 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.0 | 0.1 | GO:0003409 | optic cup structural organization(GO:0003409) |
0.0 | 0.1 | GO:1902490 | regulation of sperm capacitation(GO:1902490) |
0.0 | 0.1 | GO:0032225 | regulation of synaptic transmission, dopaminergic(GO:0032225) |
0.0 | 0.3 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.4 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.0 | 0.3 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.1 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.1 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.0 | 0.1 | GO:0098909 | regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
0.0 | 0.2 | GO:0032202 | telomere assembly(GO:0032202) |
0.0 | 0.2 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.0 | 0.1 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
0.0 | 0.2 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
0.0 | 0.3 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.0 | 0.5 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.5 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.5 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.0 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.0 | 0.2 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.0 | 0.0 | GO:0060192 | negative regulation of lipase activity(GO:0060192) |
0.0 | 0.6 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
0.0 | 0.1 | GO:0002159 | desmosome assembly(GO:0002159) |
0.0 | 0.2 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.1 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.0 | 0.1 | GO:0008216 | spermidine metabolic process(GO:0008216) polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.1 | GO:0015862 | uridine transport(GO:0015862) |
0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 0.2 | GO:0090335 | regulation of brown fat cell differentiation(GO:0090335) |
0.0 | 0.1 | GO:1904566 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
0.0 | 0.1 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.0 | 0.1 | GO:0099612 | protein localization to axon(GO:0099612) |
0.0 | 0.3 | GO:0001675 | acrosome assembly(GO:0001675) |
0.0 | 0.4 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.0 | 0.2 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
0.0 | 0.2 | GO:0061709 | reticulophagy(GO:0061709) |
0.0 | 0.1 | GO:0003308 | inner cell mass cellular morphogenesis(GO:0001828) cardiogenic plate morphogenesis(GO:0003142) negative regulation of Wnt signaling pathway involved in heart development(GO:0003308) regulation of transcription from RNA polymerase II promoter involved in definitive endodermal cell fate specification(GO:0060807) regulation of cardiac cell fate specification(GO:2000043) |
0.0 | 0.0 | GO:0033091 | positive regulation of immature T cell proliferation(GO:0033091) |
0.0 | 0.1 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.0 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.0 | 0.1 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.0 | 0.1 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
0.0 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.0 | 0.3 | GO:0006089 | lactate metabolic process(GO:0006089) |
0.0 | 0.0 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.0 | 0.2 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.0 | 0.2 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.0 | 0.3 | GO:0006817 | phosphate ion transport(GO:0006817) |
0.0 | 0.3 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.2 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.0 | 0.3 | GO:0007614 | short-term memory(GO:0007614) |
0.0 | 0.2 | GO:0070166 | enamel mineralization(GO:0070166) |
0.0 | 0.1 | GO:0007617 | mating behavior(GO:0007617) multi-organism reproductive behavior(GO:0044705) |
0.0 | 0.2 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.0 | 0.3 | GO:0071625 | vocalization behavior(GO:0071625) |
0.0 | 0.2 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.2 | GO:0071548 | response to dexamethasone(GO:0071548) |
0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.0 | 0.8 | GO:0007566 | embryo implantation(GO:0007566) |
0.0 | 0.1 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
0.0 | 0.7 | GO:0099601 | regulation of neurotransmitter receptor activity(GO:0099601) |
0.0 | 0.1 | GO:0086043 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.0 | 0.1 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.0 | 0.1 | GO:1903961 | positive regulation of anion transmembrane transport(GO:1903961) |
0.0 | 0.0 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
0.0 | 0.3 | GO:0090218 | positive regulation of lipid kinase activity(GO:0090218) |
0.0 | 0.2 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.0 | 0.1 | GO:0018158 | protein oxidation(GO:0018158) |
0.0 | 0.1 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
0.0 | 0.0 | GO:0042335 | cuticle development(GO:0042335) |
0.0 | 0.2 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.0 | 0.8 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
0.0 | 0.1 | GO:0098964 | dendritic transport of ribonucleoprotein complex(GO:0098961) dendritic transport of messenger ribonucleoprotein complex(GO:0098963) anterograde dendritic transport of messenger ribonucleoprotein complex(GO:0098964) |
0.0 | 0.4 | GO:0030262 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.0 | 0.2 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.0 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.1 | GO:0060372 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
0.0 | 0.3 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.1 | GO:0009072 | aromatic amino acid family metabolic process(GO:0009072) |
0.0 | 0.1 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.1 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:0022010 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
0.0 | 0.3 | GO:0099514 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.0 | 0.2 | GO:0090042 | tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.0 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.0 | 0.5 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
0.0 | 0.0 | GO:0061009 | common bile duct development(GO:0061009) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.2 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.0 | GO:0021941 | negative regulation of cerebellar granule cell precursor proliferation(GO:0021941) |
0.0 | 0.1 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.2 | GO:0042311 | vasodilation(GO:0042311) |
0.0 | 0.5 | GO:2000649 | regulation of sodium ion transmembrane transporter activity(GO:2000649) |
0.0 | 0.3 | GO:0006582 | melanin metabolic process(GO:0006582) |
0.0 | 0.4 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 0.1 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
0.0 | 0.0 | GO:0031639 | plasminogen activation(GO:0031639) |
0.0 | 0.7 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.1 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.0 | 0.2 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.0 | 0.1 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.0 | 0.2 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.0 | 0.1 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.4 | GO:1901264 | carbohydrate derivative transport(GO:1901264) |
0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.1 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.0 | 0.1 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.0 | 0.3 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.0 | GO:1904350 | regulation of protein catabolic process in the vacuole(GO:1904350) regulation of lysosomal protein catabolic process(GO:1905165) |
0.0 | 0.1 | GO:0006311 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
0.0 | 0.1 | GO:0048617 | embryonic foregut morphogenesis(GO:0048617) |
0.0 | 0.0 | GO:0097283 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
0.0 | 0.0 | GO:0072144 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
0.0 | 0.0 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
0.0 | 0.1 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.0 | 0.0 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.0 | 0.1 | GO:0032485 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.0 | GO:1903899 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) positive regulation of IRE1-mediated unfolded protein response(GO:1903896) positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
0.0 | 0.0 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.0 | 0.2 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.0 | 0.1 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.0 | 0.1 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.0 | 0.0 | GO:0061056 | sclerotome development(GO:0061056) |
0.0 | 0.1 | GO:0030578 | PML body organization(GO:0030578) |
0.0 | 0.1 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
0.0 | 0.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.2 | GO:0001553 | luteinization(GO:0001553) |
0.0 | 0.3 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
0.0 | 0.1 | GO:0014850 | response to muscle activity(GO:0014850) |
0.0 | 0.2 | GO:0001706 | endoderm formation(GO:0001706) |
0.0 | 0.4 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
0.0 | 0.2 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 0.1 | GO:0042148 | strand invasion(GO:0042148) |
0.0 | 0.2 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.0 | 0.1 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
0.0 | 0.0 | GO:0001980 | regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
0.0 | 0.1 | GO:0032098 | regulation of appetite(GO:0032098) |
0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.3 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
0.0 | 0.1 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.2 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.0 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.0 | 0.2 | GO:0032355 | response to estradiol(GO:0032355) |
0.0 | 0.1 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.0 | 0.1 | GO:0090190 | positive regulation of mesonephros development(GO:0061213) positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
0.0 | 0.4 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) regulation of microtubule depolymerization(GO:0031114) |
0.0 | 0.2 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.3 | GO:0061474 | phagolysosome membrane(GO:0061474) |
0.4 | 3.4 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.4 | 3.0 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.4 | 6.1 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.4 | 0.4 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.3 | 4.5 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.3 | 1.7 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.3 | 4.5 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.3 | 3.5 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.3 | 0.9 | GO:0032997 | Fc receptor complex(GO:0032997) Fc-epsilon receptor I complex(GO:0032998) |
0.3 | 1.6 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.2 | 2.3 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.2 | 0.7 | GO:0098855 | HCN channel complex(GO:0098855) |
0.2 | 5.6 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.2 | 0.9 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.2 | 0.6 | GO:0098830 | presynaptic endosome(GO:0098830) |
0.2 | 0.6 | GO:0005715 | late recombination nodule(GO:0005715) |
0.2 | 0.6 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
0.2 | 0.2 | GO:0032010 | phagolysosome(GO:0032010) |
0.2 | 0.8 | GO:0045281 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
0.2 | 1.4 | GO:1903349 | omegasome membrane(GO:1903349) |
0.2 | 3.1 | GO:0043203 | axon hillock(GO:0043203) |
0.2 | 0.9 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.2 | 0.9 | GO:0035976 | AP1 complex(GO:0035976) |
0.2 | 0.5 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
0.2 | 2.3 | GO:0042611 | MHC protein complex(GO:0042611) |
0.2 | 0.8 | GO:0042827 | platelet dense granule(GO:0042827) |
0.1 | 1.3 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 0.4 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.1 | 0.8 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.1 | 1.4 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 1.1 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.1 | 0.5 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.1 | 0.6 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 1.3 | GO:0005796 | Golgi lumen(GO:0005796) |
0.1 | 3.0 | GO:0005922 | connexon complex(GO:0005922) |
0.1 | 0.6 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 0.9 | GO:0042825 | TAP complex(GO:0042825) |
0.1 | 0.9 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 0.6 | GO:0000938 | GARP complex(GO:0000938) EARP complex(GO:1990745) |
0.1 | 1.2 | GO:0031931 | TORC1 complex(GO:0031931) |
0.1 | 2.0 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 25.4 | GO:0072562 | blood microparticle(GO:0072562) |
0.1 | 3.1 | GO:0034706 | sodium channel complex(GO:0034706) |
0.1 | 1.6 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
0.1 | 0.3 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.1 | 0.6 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 3.1 | GO:0070069 | cytochrome complex(GO:0070069) |
0.1 | 0.5 | GO:0008537 | proteasome activator complex(GO:0008537) |
0.1 | 0.7 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 1.2 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.1 | 1.1 | GO:0044754 | autolysosome(GO:0044754) |
0.1 | 0.4 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.2 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
0.1 | 0.5 | GO:0097452 | GAIT complex(GO:0097452) |
0.1 | 0.3 | GO:1990794 | lateral part of cell(GO:0097574) basolateral part of cell(GO:1990794) rod bipolar cell terminal bouton(GO:1990795) |
0.1 | 0.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.9 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.7 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 0.9 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 2.0 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.1 | 0.3 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
0.1 | 0.5 | GO:0005605 | basal lamina(GO:0005605) |
0.1 | 0.5 | GO:0034709 | methylosome(GO:0034709) |
0.1 | 2.3 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.1 | 0.3 | GO:0035339 | SPOTS complex(GO:0035339) |
0.1 | 0.3 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 1.2 | GO:0045180 | basal cortex(GO:0045180) |
0.1 | 0.6 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.4 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 0.5 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.1 | 13.5 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.1 | 0.5 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 0.8 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 0.5 | GO:0071546 | pi-body(GO:0071546) |
0.1 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.4 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 1.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.1 | 0.7 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.1 | 0.2 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.1 | 0.3 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
0.1 | 0.3 | GO:0000802 | transverse filament(GO:0000802) |
0.1 | 0.9 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.1 | 0.3 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
0.1 | 0.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 8.7 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 2.8 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
0.0 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.5 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.5 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.1 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.0 | 0.1 | GO:0099573 | glutamatergic postsynaptic density(GO:0099573) |
0.0 | 0.1 | GO:0032783 | ELL-EAF complex(GO:0032783) |
0.0 | 0.8 | GO:0042599 | lamellar body(GO:0042599) |
0.0 | 0.1 | GO:0044302 | dentate gyrus mossy fiber(GO:0044302) |
0.0 | 0.8 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.4 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.0 | 1.0 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.5 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 0.3 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.0 | 0.1 | GO:0034774 | secretory granule lumen(GO:0034774) cytoplasmic membrane-bounded vesicle lumen(GO:0060205) |
0.0 | 0.6 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 0.9 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.7 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.4 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.0 | 1.1 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.4 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.5 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.2 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.0 | 0.2 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.0 | 0.5 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.1 | GO:0044305 | calyx of Held(GO:0044305) |
0.0 | 0.5 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.4 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 2.9 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 1.5 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 15.7 | GO:0016324 | apical plasma membrane(GO:0016324) |
0.0 | 0.4 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.1 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.3 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.1 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.0 | 1.5 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.4 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 3.0 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.6 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 0.4 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.1 | GO:0098831 | presynaptic active zone cytoplasmic component(GO:0098831) |
0.0 | 1.0 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.2 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.0 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 0.1 | GO:0014802 | terminal cisterna(GO:0014802) |
0.0 | 0.0 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.3 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.2 | GO:0001652 | granular component(GO:0001652) |
0.0 | 52.7 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.4 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 0.7 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.0 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.2 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.8 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.1 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
0.0 | 0.2 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.2 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 1.9 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.0 | 0.1 | GO:0016014 | dystrobrevin complex(GO:0016014) |
0.0 | 0.1 | GO:1990031 | pinceau fiber(GO:1990031) |
0.0 | 1.1 | GO:0005902 | microvillus(GO:0005902) |
0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.3 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.1 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
0.0 | 0.1 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.1 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.2 | GO:1990584 | cardiac Troponin complex(GO:1990584) |
0.0 | 0.1 | GO:0035859 | Seh1-associated complex(GO:0035859) |
0.0 | 0.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.3 | GO:0043083 | synaptic cleft(GO:0043083) |
0.0 | 0.2 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 7.1 | GO:0000323 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.6 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 32.4 | GO:0005615 | extracellular space(GO:0005615) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.1 | GO:0098839 | postsynaptic density membrane(GO:0098839) |
0.0 | 0.2 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.3 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.3 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.0 | 0.1 | GO:1990696 | USH2 complex(GO:1990696) |
0.0 | 0.1 | GO:0005713 | recombination nodule(GO:0005713) |
0.0 | 0.2 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.2 | GO:0016011 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.0 | 2.6 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.1 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.2 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.6 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
0.0 | 0.1 | GO:0033268 | node of Ranvier(GO:0033268) |
0.0 | 0.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.5 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.0 | 0.9 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.2 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.1 | GO:1990769 | proximal neuron projection(GO:1990769) |
0.0 | 0.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.0 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.1 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
0.0 | 0.1 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.2 | GO:0036156 | axonemal dynein complex(GO:0005858) inner dynein arm(GO:0036156) |
0.0 | 0.1 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.0 | 0.1 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.2 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.3 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.3 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.4 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 1.3 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.2 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.1 | 15.0 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
1.6 | 4.8 | GO:0033971 | hydroxyisourate hydrolase activity(GO:0033971) |
1.3 | 3.8 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
1.2 | 6.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
1.0 | 7.8 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.9 | 5.2 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.7 | 2.7 | GO:0004478 | methionine adenosyltransferase activity(GO:0004478) |
0.7 | 2.0 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
0.6 | 4.4 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.6 | 1.8 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.6 | 1.7 | GO:0004371 | glycerone kinase activity(GO:0004371) FAD-AMP lyase (cyclizing) activity(GO:0034012) triokinase activity(GO:0050354) |
0.5 | 2.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.5 | 3.6 | GO:0015091 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
0.5 | 1.5 | GO:0004658 | propionyl-CoA carboxylase activity(GO:0004658) |
0.5 | 3.0 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.5 | 1.5 | GO:0047936 | glucose 1-dehydrogenase [NAD(P)] activity(GO:0047936) |
0.5 | 3.9 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
0.5 | 1.9 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
0.5 | 2.7 | GO:0030294 | receptor signaling protein tyrosine kinase inhibitor activity(GO:0030294) |
0.5 | 0.5 | GO:0004087 | carbamoyl-phosphate synthase (ammonia) activity(GO:0004087) carbamoyl-phosphate synthase (glutamine-hydrolyzing) activity(GO:0004088) |
0.4 | 1.6 | GO:0004103 | choline kinase activity(GO:0004103) |
0.4 | 1.6 | GO:0070905 | serine binding(GO:0070905) |
0.4 | 1.5 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.4 | 1.5 | GO:0019862 | IgA binding(GO:0019862) |
0.4 | 11.9 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
0.4 | 1.8 | GO:0047804 | cysteine-S-conjugate beta-lyase activity(GO:0047804) |
0.4 | 2.5 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
0.3 | 0.7 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.3 | 1.0 | GO:0045030 | UTP-activated nucleotide receptor activity(GO:0045030) |
0.3 | 1.0 | GO:0003692 | left-handed Z-DNA binding(GO:0003692) |
0.3 | 1.3 | GO:0047016 | cholest-5-ene-3-beta,7-alpha-diol 3-beta-dehydrogenase activity(GO:0047016) |
0.3 | 0.9 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
0.3 | 2.5 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.3 | 2.1 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.3 | 0.9 | GO:0035731 | S-nitrosoglutathione binding(GO:0035730) dinitrosyl-iron complex binding(GO:0035731) |
0.3 | 0.9 | GO:0016900 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
0.3 | 2.0 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.3 | 1.1 | GO:0004736 | pyruvate carboxylase activity(GO:0004736) |
0.3 | 2.5 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.3 | 0.8 | GO:0070404 | NADH binding(GO:0070404) |
0.3 | 0.8 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
0.3 | 0.8 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
0.3 | 1.0 | GO:0046997 | oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
0.3 | 0.8 | GO:0016824 | hydrolase activity, acting on acid halide bonds(GO:0016824) hydrolase activity, acting on acid halide bonds, in C-halide compounds(GO:0019120) alkylhalidase activity(GO:0047651) |
0.3 | 1.0 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.3 | 1.5 | GO:0015232 | heme transporter activity(GO:0015232) |
0.3 | 1.3 | GO:0047635 | L-alanine:2-oxoglutarate aminotransferase activity(GO:0004021) alanine-oxo-acid transaminase activity(GO:0047635) |
0.2 | 1.5 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
0.2 | 0.7 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
0.2 | 1.8 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.2 | 2.7 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.2 | 1.5 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.2 | 0.7 | GO:0004998 | transferrin receptor activity(GO:0004998) |
0.2 | 0.6 | GO:0015433 | peptide antigen-transporting ATPase activity(GO:0015433) tapasin binding(GO:0046980) |
0.2 | 0.6 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.2 | 0.6 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.2 | 0.8 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.2 | 0.6 | GO:0016155 | formyltetrahydrofolate dehydrogenase activity(GO:0016155) |
0.2 | 0.6 | GO:0016034 | maleylacetoacetate isomerase activity(GO:0016034) |
0.2 | 28.8 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.2 | 3.6 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.2 | 3.7 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.2 | 2.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.2 | 0.5 | GO:0031751 | D4 dopamine receptor binding(GO:0031751) |
0.2 | 7.4 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.2 | 1.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.2 | 1.0 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
0.2 | 1.0 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.2 | 0.7 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.2 | 0.5 | GO:0036004 | GAF domain binding(GO:0036004) |
0.2 | 0.9 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.2 | 0.9 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
0.2 | 0.5 | GO:0004421 | hydroxymethylglutaryl-CoA synthase activity(GO:0004421) |
0.2 | 1.4 | GO:0005534 | galactose binding(GO:0005534) |
0.2 | 1.8 | GO:0031433 | telethonin binding(GO:0031433) |
0.2 | 1.0 | GO:0008142 | oxysterol binding(GO:0008142) |
0.2 | 0.8 | GO:2001069 | glycogen binding(GO:2001069) |
0.2 | 0.6 | GO:1902271 | D3 vitamins binding(GO:1902271) |
0.2 | 3.5 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.2 | 1.0 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.2 | 0.6 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.2 | 0.2 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.2 | 0.9 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
0.2 | 2.3 | GO:0046977 | TAP binding(GO:0046977) |
0.2 | 3.6 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.2 | 0.6 | GO:0042806 | fucose binding(GO:0042806) |
0.1 | 0.4 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
0.1 | 0.7 | GO:0042610 | CD8 receptor binding(GO:0042610) |
0.1 | 3.9 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.1 | 0.9 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.1 | 2.3 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.1 | 0.7 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.1 | 0.9 | GO:0032810 | sterol response element binding(GO:0032810) |
0.1 | 0.8 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.8 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.1 | 0.4 | GO:0004493 | methylmalonyl-CoA epimerase activity(GO:0004493) |
0.1 | 0.8 | GO:0060698 | endoribonuclease inhibitor activity(GO:0060698) |
0.1 | 0.4 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
0.1 | 1.3 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.1 | 0.9 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
0.1 | 1.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 0.4 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
0.1 | 1.9 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.1 | 1.1 | GO:0032052 | bile acid binding(GO:0032052) |
0.1 | 1.5 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.5 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
0.1 | 0.7 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 2.0 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
0.1 | 0.6 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.1 | 0.5 | GO:0019970 | interleukin-11 receptor activity(GO:0004921) interleukin-11 binding(GO:0019970) |
0.1 | 0.7 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.1 | 0.5 | GO:0005118 | sevenless binding(GO:0005118) |
0.1 | 1.3 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.1 | 1.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 0.3 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.1 | 0.5 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.1 | 0.5 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.1 | 0.6 | GO:0070012 | oligopeptidase activity(GO:0070012) |
0.1 | 0.8 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.1 | 1.8 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 0.3 | GO:0031753 | endothelial differentiation G-protein coupled receptor binding(GO:0031753) Edg-2 lysophosphatidic acid receptor binding(GO:0031755) |
0.1 | 0.3 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
0.1 | 0.2 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
0.1 | 0.4 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 0.4 | GO:0086038 | calcium:sodium antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086038) |
0.1 | 1.3 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
0.1 | 0.3 | GO:0070279 | vitamin B6 binding(GO:0070279) |
0.1 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.1 | 1.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 1.0 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
0.1 | 0.4 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.1 | 0.7 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.1 | 0.5 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.1 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.1 | 0.6 | GO:0048039 | ubiquinone binding(GO:0048039) |
0.1 | 0.5 | GO:0034584 | piRNA binding(GO:0034584) |
0.1 | 0.4 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.1 | 1.0 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
0.1 | 0.6 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.1 | 2.5 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
0.1 | 0.7 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.6 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.4 | GO:0004058 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
0.1 | 0.3 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
0.1 | 0.3 | GO:0005353 | fructose transmembrane transporter activity(GO:0005353) |
0.1 | 0.3 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
0.1 | 0.6 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.1 | 20.3 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.1 | 0.5 | GO:0008761 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) |
0.1 | 0.4 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
0.1 | 0.3 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
0.1 | 0.5 | GO:0005345 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.1 | 0.6 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.1 | 0.8 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.1 | 0.5 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 1.1 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.1 | 0.6 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.7 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.1 | 0.3 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 1.0 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 1.8 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.1 | 1.3 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.1 | 0.2 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.1 | 3.1 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.1 | 0.2 | GO:0005277 | acetylcholine transmembrane transporter activity(GO:0005277) norepinephrine transmembrane transporter activity(GO:0005333) acetate ester transmembrane transporter activity(GO:1901375) |
0.1 | 0.2 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.1 | 0.2 | GO:0015248 | sterol transporter activity(GO:0015248) |
0.1 | 0.7 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.1 | 1.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.9 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.1 | 1.3 | GO:0031386 | protein tag(GO:0031386) |
0.1 | 0.5 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.1 | 0.3 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.1 | 1.2 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.1 | 0.2 | GO:0019150 | D-ribulokinase activity(GO:0019150) |
0.1 | 0.3 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.4 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 0.3 | GO:0051435 | BH4 domain binding(GO:0051435) |
0.1 | 9.0 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.1 | 0.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.2 | GO:0004912 | interleukin-3 receptor activity(GO:0004912) interleukin-3 binding(GO:0019978) |
0.1 | 0.5 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.1 | 1.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.1 | 0.4 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
0.1 | 0.3 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.1 | 0.4 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.7 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.2 | GO:0003999 | adenine binding(GO:0002055) adenine phosphoribosyltransferase activity(GO:0003999) |
0.1 | 2.6 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.1 | 0.3 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
0.1 | 1.0 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 0.3 | GO:0034597 | phosphatidylinositol-3,4-bisphosphate 4-phosphatase activity(GO:0016316) phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
0.1 | 0.2 | GO:0009384 | N-acylmannosamine kinase activity(GO:0009384) |
0.1 | 0.3 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.1 | 1.1 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.1 | 0.8 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 0.5 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 0.9 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.1 | 1.8 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
0.1 | 0.4 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.1 | 0.5 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.1 | 0.3 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
0.1 | 1.5 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.1 | 0.2 | GO:0008124 | 4-alpha-hydroxytetrahydrobiopterin dehydratase activity(GO:0008124) |
0.1 | 0.5 | GO:0008481 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
0.1 | 0.1 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.1 | 0.4 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.1 | 0.3 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 1.2 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.1 | 0.4 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.1 | 0.6 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 0.7 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.1 | 0.6 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.1 | 0.9 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 1.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.5 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 0.3 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.3 | GO:0052796 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 0.2 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.1 | 0.3 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 0.2 | GO:0005499 | vitamin D binding(GO:0005499) |
0.1 | 1.7 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.1 | 0.4 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.1 | 1.2 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.1 | 1.2 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.1 | 0.6 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 0.2 | GO:0003881 | CDP-diacylglycerol-inositol 3-phosphatidyltransferase activity(GO:0003881) |
0.0 | 1.2 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 0.3 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.0 | 0.5 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.2 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
0.0 | 0.7 | GO:0015250 | water channel activity(GO:0015250) |
0.0 | 0.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.1 | GO:0098808 | mRNA cap binding(GO:0098808) |
0.0 | 0.3 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.5 | GO:0004064 | arylesterase activity(GO:0004064) |
0.0 | 0.9 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.0 | 0.5 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
0.0 | 1.1 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.0 | 0.1 | GO:0008431 | vitamin E binding(GO:0008431) |
0.0 | 0.7 | GO:0001848 | complement binding(GO:0001848) |
0.0 | 0.3 | GO:0042328 | heparan sulfate N-acetylglucosaminyltransferase activity(GO:0042328) |
0.0 | 1.5 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.2 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.0 | 1.3 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.5 | GO:0008556 | potassium-transporting ATPase activity(GO:0008556) |
0.0 | 1.4 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) |
0.0 | 0.4 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
0.0 | 0.6 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.5 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.3 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.9 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.1 | GO:0016784 | 3-mercaptopyruvate sulfurtransferase activity(GO:0016784) |
0.0 | 0.1 | GO:0052692 | raffinose alpha-galactosidase activity(GO:0052692) |
0.0 | 1.3 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 2.8 | GO:0004497 | monooxygenase activity(GO:0004497) |
0.0 | 0.2 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.0 | 0.2 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 4.1 | GO:0005179 | hormone activity(GO:0005179) |
0.0 | 0.5 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.4 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) |
0.0 | 0.1 | GO:0001565 | phorbol ester receptor activity(GO:0001565) non-kinase phorbol ester receptor activity(GO:0001566) |
0.0 | 0.1 | GO:0001002 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
0.0 | 0.0 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
0.0 | 0.3 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.0 | 1.8 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.4 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.0 | 3.4 | GO:0017022 | myosin binding(GO:0017022) |
0.0 | 0.2 | GO:1990599 | 3' overhang single-stranded DNA endodeoxyribonuclease activity(GO:1990599) |
0.0 | 0.1 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) |
0.0 | 1.4 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
0.0 | 0.4 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.2 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.4 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.7 | GO:0055103 | ligase regulator activity(GO:0055103) |
0.0 | 0.7 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.1 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.0 | 0.4 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.0 | 0.2 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
0.0 | 2.5 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
0.0 | 0.2 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
0.0 | 0.6 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.1 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.0 | 0.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 4.0 | GO:0052689 | carboxylic ester hydrolase activity(GO:0052689) |
0.0 | 0.2 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
0.0 | 0.1 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
0.0 | 0.2 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.0 | 0.9 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.0 | 0.3 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.0 | 0.1 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
0.0 | 0.1 | GO:0004925 | prolactin receptor activity(GO:0004925) |
0.0 | 0.4 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.4 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.3 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.0 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.6 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.4 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.1 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
0.0 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.1 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 0.2 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.1 | GO:0001032 | RNA polymerase III type 3 promoter DNA binding(GO:0001032) |
0.0 | 0.1 | GO:0019809 | spermidine binding(GO:0019809) |
0.0 | 0.1 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.4 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.0 | 0.2 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.0 | 0.1 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.0 | 0.4 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.1 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
0.0 | 0.9 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.4 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.0 | 0.1 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
0.0 | 0.4 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.4 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.3 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 0.1 | GO:0097643 | amylin receptor activity(GO:0097643) |
0.0 | 0.2 | GO:0030172 | troponin C binding(GO:0030172) |
0.0 | 0.1 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.0 | 0.1 | GO:0004572 | mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase activity(GO:0004572) |
0.0 | 0.1 | GO:0099583 | PLC activating G-protein coupled glutamate receptor activity(GO:0001639) G-protein coupled receptor activity involved in regulation of postsynaptic membrane potential(GO:0099530) neurotransmitter receptor activity involved in regulation of postsynaptic cytosolic calcium ion concentration(GO:0099583) |
0.0 | 0.5 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.3 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.0 | 0.6 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 0.0 | GO:0033906 | hyaluronoglucuronidase activity(GO:0033906) |
0.0 | 0.4 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.5 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.2 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.0 | 0.5 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 0.1 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.0 | 0.2 | GO:0005124 | scavenger receptor binding(GO:0005124) |
0.0 | 0.2 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.0 | 0.1 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
0.0 | 0.1 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.1 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
0.0 | 0.8 | GO:0016836 | hydro-lyase activity(GO:0016836) |
0.0 | 0.4 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
0.0 | 0.3 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.0 | 0.1 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.6 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.1 | GO:0044729 | double-stranded methylated DNA binding(GO:0010385) hemi-methylated DNA-binding(GO:0044729) |
0.0 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.0 | 0.2 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.0 | 0.1 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.0 | 0.2 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.0 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.4 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.3 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
0.0 | 0.0 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
0.0 | 0.1 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.3 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.0 | 0.1 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 1.6 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
0.0 | 0.1 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.0 | 0.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.4 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.1 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
0.0 | 0.2 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.0 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.0 | 0.1 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
0.0 | 0.1 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.4 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 0.0 | GO:0016492 | G-protein coupled neurotensin receptor activity(GO:0016492) |
0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.2 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.0 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.1 | GO:0004905 | interferon receptor activity(GO:0004904) type I interferon receptor activity(GO:0004905) type I interferon binding(GO:0019962) |
0.0 | 0.2 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.1 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.0 | 0.3 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.0 | 0.1 | GO:0016499 | orexin receptor activity(GO:0016499) |
0.0 | 0.1 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.0 | 0.4 | GO:0003823 | antigen binding(GO:0003823) |
0.0 | 0.2 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
0.0 | 0.3 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.1 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
0.0 | 0.6 | GO:0016776 | phosphotransferase activity, phosphate group as acceptor(GO:0016776) |
0.0 | 0.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.1 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.1 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.1 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.2 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
0.0 | 0.1 | GO:0099529 | neurotransmitter receptor activity involved in regulation of postsynaptic membrane potential(GO:0099529) |
0.0 | 0.1 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.0 | 0.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.4 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.0 | 0.3 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 2.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 6.8 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 0.5 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 1.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.1 | 19.4 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.1 | 6.6 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.1 | 0.2 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 1.9 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.1 | 1.9 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.3 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.7 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 2.3 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.3 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.0 | 0.4 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.8 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.2 | PID IFNG PATHWAY | IFN-gamma pathway |
0.0 | 0.5 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 1.8 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.9 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.8 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.5 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.2 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.8 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.4 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 1.3 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.4 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 1.9 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.1 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 1.4 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.4 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.6 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.2 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.3 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.3 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.4 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.5 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 1.5 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.7 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.9 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.0 | 0.3 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.6 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.2 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.2 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.6 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.9 | 5.6 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.5 | 5.5 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.4 | 4.7 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.3 | 4.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.3 | 3.7 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.2 | 1.6 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.2 | 6.7 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.2 | 3.5 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.2 | 5.2 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.2 | 2.6 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.2 | 2.8 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.2 | 1.8 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.2 | 3.0 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.2 | 0.6 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 10.1 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.1 | 3.0 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 2.8 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 4.5 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.1 | 2.7 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.1 | 3.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 1.5 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.1 | 2.4 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.1 | 2.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 1.3 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.1 | 2.2 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 2.1 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.1 | 0.2 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.1 | 0.9 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.1 | 0.9 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.1 | 0.8 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 4.4 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.1 | 0.5 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.1 | 0.7 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 1.1 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.1 | 1.7 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.1 | 0.4 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.1 | 1.1 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.1 | 0.9 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.1 | 1.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.1 | 0.2 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.1 | 1.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 8.9 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.1 | 0.7 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 1.7 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 3.5 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 0.7 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.0 | 1.6 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.6 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.0 | 0.8 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.6 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.0 | 1.1 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
0.0 | 1.0 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.2 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 1.2 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.0 | 0.6 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 2.5 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.7 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.1 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 0.1 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.0 | 0.1 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.0 | 0.7 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.2 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.3 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.0 | 1.1 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.2 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
0.0 | 0.5 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 1.4 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.3 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.3 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
0.0 | 0.4 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 1.0 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.6 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 1.1 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.4 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.3 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.9 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.4 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 2.6 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.4 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 0.7 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.7 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.3 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.5 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.0 | 0.5 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.0 | 0.5 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 3.0 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.2 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.3 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 1.3 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 0.4 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.0 | 0.3 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.1 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.1 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
0.0 | 0.2 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.0 | 0.4 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.3 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.0 | 0.2 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.0 | 0.1 | REACTOME DEFENSINS | Genes involved in Defensins |
0.0 | 0.2 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.6 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
0.0 | 0.1 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.0 | 0.2 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 0.4 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.4 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |