GSE58827: Dynamics of the Mouse Liver
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Nhlh1
|
ENSMUSG00000051251.4 | nescient helix loop helix 1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Nhlh1 | mm39_v1_chr1_-_171885140_171885169 | -0.22 | 2.0e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr19_+_7034149 | 10.04 |
ENSMUST00000040261.7
|
Macrod1
|
mono-ADP ribosylhydrolase 1 |
chr11_+_99755302 | 8.79 |
ENSMUST00000092694.4
|
Gm11559
|
predicted gene 11559 |
chr7_-_97066937 | 8.08 |
ENSMUST00000043077.8
|
Thrsp
|
thyroid hormone responsive |
chr1_+_177269845 | 7.81 |
ENSMUST00000195002.2
|
Zbtb18
|
zinc finger and BTB domain containing 18 |
chr19_+_20579322 | 6.62 |
ENSMUST00000087638.4
|
Aldh1a1
|
aldehyde dehydrogenase family 1, subfamily A1 |
chr7_-_140590605 | 6.60 |
ENSMUST00000026565.7
|
Ifitm3
|
interferon induced transmembrane protein 3 |
chr15_+_77613239 | 6.34 |
ENSMUST00000230979.2
ENSMUST00000109775.4 |
Apol9b
|
apolipoprotein L 9b |
chr17_-_45997132 | 5.95 |
ENSMUST00000113523.9
|
Tmem63b
|
transmembrane protein 63b |
chr11_-_120551494 | 5.78 |
ENSMUST00000106178.9
|
Notum
|
notum palmitoleoyl-protein carboxylesterase |
chr11_-_120551426 | 5.65 |
ENSMUST00000106177.8
|
Notum
|
notum palmitoleoyl-protein carboxylesterase |
chr1_-_91340884 | 5.62 |
ENSMUST00000086851.2
|
Hes6
|
hairy and enhancer of split 6 |
chr1_+_177270032 | 5.51 |
ENSMUST00000195549.6
|
Zbtb18
|
zinc finger and BTB domain containing 18 |
chr4_-_107928567 | 5.46 |
ENSMUST00000106701.2
|
Scp2
|
sterol carrier protein 2, liver |
chr4_+_133280680 | 5.40 |
ENSMUST00000042706.3
|
Nr0b2
|
nuclear receptor subfamily 0, group B, member 2 |
chr12_-_103423472 | 5.22 |
ENSMUST00000044687.7
|
Ifi27l2b
|
interferon, alpha-inducible protein 27 like 2B |
chr11_+_72326391 | 5.06 |
ENSMUST00000100903.3
|
Ggt6
|
gamma-glutamyltransferase 6 |
chr15_+_77613348 | 4.87 |
ENSMUST00000230742.2
|
Apol9b
|
apolipoprotein L 9b |
chr11_+_75358866 | 4.85 |
ENSMUST00000043598.14
ENSMUST00000108435.2 |
Tlcd2
|
TLC domain containing 2 |
chr1_+_74752710 | 4.83 |
ENSMUST00000027356.7
|
Cyp27a1
|
cytochrome P450, family 27, subfamily a, polypeptide 1 |
chr10_-_88339773 | 4.75 |
ENSMUST00000117579.8
ENSMUST00000073783.6 |
Chpt1
|
choline phosphotransferase 1 |
chr19_-_29025233 | 4.71 |
ENSMUST00000025696.5
|
Ak3
|
adenylate kinase 3 |
chr17_+_35539505 | 4.62 |
ENSMUST00000105041.10
ENSMUST00000073208.6 |
H2-Q1
|
histocompatibility 2, Q region locus 1 |
chr10_-_88339814 | 4.58 |
ENSMUST00000020253.15
|
Chpt1
|
choline phosphotransferase 1 |
chr7_+_26821266 | 4.51 |
ENSMUST00000206552.2
|
Cyp2f2
|
cytochrome P450, family 2, subfamily f, polypeptide 2 |
chr10_-_88339935 | 4.47 |
ENSMUST00000117440.8
|
Chpt1
|
choline phosphotransferase 1 |
chr4_-_124744266 | 4.43 |
ENSMUST00000137769.3
|
1110065P20Rik
|
RIKEN cDNA 1110065P20 gene |
chr17_-_45997046 | 4.43 |
ENSMUST00000143907.3
ENSMUST00000127065.8 |
Tmem63b
|
transmembrane protein 63b |
chr1_+_177270101 | 4.43 |
ENSMUST00000194319.2
|
Zbtb18
|
zinc finger and BTB domain containing 18 |
chr6_-_72212547 | 4.27 |
ENSMUST00000042646.8
|
Atoh8
|
atonal bHLH transcription factor 8 |
chr15_-_60793115 | 4.23 |
ENSMUST00000096418.5
|
A1bg
|
alpha-1-B glycoprotein |
chr2_-_103315483 | 4.18 |
ENSMUST00000028610.10
|
Cat
|
catalase |
chr7_-_19530714 | 4.13 |
ENSMUST00000108449.9
ENSMUST00000043822.8 |
Cblc
|
Casitas B-lineage lymphoma c |
chr2_-_103315418 | 4.10 |
ENSMUST00000111168.4
|
Cat
|
catalase |
chr8_-_22888604 | 4.01 |
ENSMUST00000033871.8
|
Slc25a15
|
solute carrier family 25 (mitochondrial carrier ornithine transporter), member 15 |
chr17_-_34218301 | 3.92 |
ENSMUST00000235463.2
|
H2-K1
|
histocompatibility 2, K1, K region |
chr2_+_102488985 | 3.87 |
ENSMUST00000080210.10
|
Slc1a2
|
solute carrier family 1 (glial high affinity glutamate transporter), member 2 |
chr4_-_124744454 | 3.85 |
ENSMUST00000125776.8
ENSMUST00000163946.2 ENSMUST00000106190.10 |
1110065P20Rik
|
RIKEN cDNA 1110065P20 gene |
chr2_+_153334710 | 3.74 |
ENSMUST00000109783.2
|
4930404H24Rik
|
RIKEN cDNA 4930404H24 gene |
chr6_+_88701810 | 3.44 |
ENSMUST00000089449.5
|
Mgll
|
monoglyceride lipase |
chr8_+_86219191 | 3.41 |
ENSMUST00000034136.12
|
Gpt2
|
glutamic pyruvate transaminase (alanine aminotransferase) 2 |
chr10_-_81127057 | 3.37 |
ENSMUST00000045744.7
|
Tjp3
|
tight junction protein 3 |
chr17_-_45996899 | 3.25 |
ENSMUST00000145873.8
|
Tmem63b
|
transmembrane protein 63b |
chr10_-_81127334 | 3.18 |
ENSMUST00000219479.2
|
Tjp3
|
tight junction protein 3 |
chr6_-_23839136 | 3.18 |
ENSMUST00000166458.9
ENSMUST00000142913.9 ENSMUST00000069074.14 ENSMUST00000115361.9 ENSMUST00000018122.14 ENSMUST00000115356.3 |
Cadps2
|
Ca2+-dependent activator protein for secretion 2 |
chr8_+_46111703 | 3.16 |
ENSMUST00000134675.8
ENSMUST00000139869.8 ENSMUST00000126067.8 |
Sorbs2
|
sorbin and SH3 domain containing 2 |
chr11_+_99770013 | 3.12 |
ENSMUST00000078442.4
|
Gm11567
|
predicted gene 11567 |
chr6_-_84564623 | 3.10 |
ENSMUST00000205228.3
|
Cyp26b1
|
cytochrome P450, family 26, subfamily b, polypeptide 1 |
chr7_+_43856724 | 3.01 |
ENSMUST00000077354.5
|
Klk1b4
|
kallikrein 1-related pepidase b4 |
chr15_-_89258012 | 2.99 |
ENSMUST00000167643.4
|
Sco2
|
SCO2 cytochrome c oxidase assembly protein |
chr4_+_116734573 | 2.96 |
ENSMUST00000044823.4
|
Zswim5
|
zinc finger SWIM-type containing 5 |
chr7_-_30672747 | 2.95 |
ENSMUST00000205961.2
|
Lsr
|
lipolysis stimulated lipoprotein receptor |
chr1_-_180823709 | 2.92 |
ENSMUST00000154133.8
|
Ephx1
|
epoxide hydrolase 1, microsomal |
chr11_+_72326337 | 2.90 |
ENSMUST00000076443.10
|
Ggt6
|
gamma-glutamyltransferase 6 |
chr11_-_106378622 | 2.90 |
ENSMUST00000001059.9
ENSMUST00000106799.2 ENSMUST00000106800.2 |
Ern1
|
endoplasmic reticulum (ER) to nucleus signalling 1 |
chr16_+_91066602 | 2.88 |
ENSMUST00000056882.7
|
Olig1
|
oligodendrocyte transcription factor 1 |
chr10_-_78005560 | 2.88 |
ENSMUST00000219120.2
ENSMUST00000001242.9 |
Gatd3a
|
glutamine amidotransferase like class 1 domain containing 3A |
chr18_+_32055339 | 2.87 |
ENSMUST00000233994.2
|
Lims2
|
LIM and senescent cell antigen like domains 2 |
chr19_-_45548942 | 2.86 |
ENSMUST00000026239.7
|
Poll
|
polymerase (DNA directed), lambda |
chr15_-_89258034 | 2.86 |
ENSMUST00000228977.2
|
Sco2
|
SCO2 cytochrome c oxidase assembly protein |
chr11_-_120552001 | 2.86 |
ENSMUST00000150458.2
|
Notum
|
notum palmitoleoyl-protein carboxylesterase |
chr10_+_75729237 | 2.84 |
ENSMUST00000009236.6
ENSMUST00000217811.2 |
Derl3
|
Der1-like domain family, member 3 |
chrX_-_161426542 | 2.83 |
ENSMUST00000101102.2
|
Reps2
|
RALBP1 associated Eps domain containing protein 2 |
chr7_-_30672824 | 2.82 |
ENSMUST00000147431.2
ENSMUST00000098553.11 ENSMUST00000108116.10 |
Lsr
|
lipolysis stimulated lipoprotein receptor |
chr17_-_84154196 | 2.81 |
ENSMUST00000234214.2
|
Haao
|
3-hydroxyanthranilate 3,4-dioxygenase |
chr17_+_45997248 | 2.77 |
ENSMUST00000024734.8
|
Mrpl14
|
mitochondrial ribosomal protein L14 |
chr7_-_30672889 | 2.77 |
ENSMUST00000001279.15
|
Lsr
|
lipolysis stimulated lipoprotein receptor |
chr6_+_108805594 | 2.74 |
ENSMUST00000089162.5
|
Edem1
|
ER degradation enhancer, mannosidase alpha-like 1 |
chr6_-_119521243 | 2.73 |
ENSMUST00000119369.2
ENSMUST00000178696.8 |
Wnt5b
|
wingless-type MMTV integration site family, member 5B |
chr7_-_119122681 | 2.73 |
ENSMUST00000033267.4
|
Pdilt
|
protein disulfide isomerase-like, testis expressed |
chr3_-_107851021 | 2.72 |
ENSMUST00000106684.8
ENSMUST00000106685.9 |
Gstm6
|
glutathione S-transferase, mu 6 |
chr1_+_127657142 | 2.69 |
ENSMUST00000038006.8
|
Acmsd
|
amino carboxymuconate semialdehyde decarboxylase |
chr4_+_20008357 | 2.68 |
ENSMUST00000117632.8
ENSMUST00000098244.2 |
Ttpa
|
tocopherol (alpha) transfer protein |
chr14_+_30608478 | 2.65 |
ENSMUST00000168782.4
|
Itih4
|
inter alpha-trypsin inhibitor, heavy chain 4 |
chr18_+_32064358 | 2.65 |
ENSMUST00000025254.9
|
Lims2
|
LIM and senescent cell antigen like domains 2 |
chr14_+_30608433 | 2.64 |
ENSMUST00000120269.11
ENSMUST00000078490.14 ENSMUST00000006703.15 |
Itih4
|
inter alpha-trypsin inhibitor, heavy chain 4 |
chr5_+_21391282 | 2.64 |
ENSMUST00000036031.13
ENSMUST00000198937.2 |
Gsap
|
gamma-secretase activating protein |
chr11_-_43727071 | 2.63 |
ENSMUST00000167574.2
|
Adra1b
|
adrenergic receptor, alpha 1b |
chr6_-_127086480 | 2.61 |
ENSMUST00000039913.9
|
Tigar
|
Trp53 induced glycolysis regulatory phosphatase |
chr4_-_129142208 | 2.59 |
ENSMUST00000052602.6
|
C77080
|
expressed sequence C77080 |
chr18_+_45402018 | 2.58 |
ENSMUST00000183850.8
ENSMUST00000066890.14 |
Kcnn2
|
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 2 |
chr3_-_41037427 | 2.56 |
ENSMUST00000058578.8
|
Pgrmc2
|
progesterone receptor membrane component 2 |
chr5_-_121710768 | 2.54 |
ENSMUST00000200541.5
|
Aldh2
|
aldehyde dehydrogenase 2, mitochondrial |
chr6_-_39095144 | 2.54 |
ENSMUST00000038398.7
|
Parp12
|
poly (ADP-ribose) polymerase family, member 12 |
chr11_-_69696428 | 2.53 |
ENSMUST00000051025.5
|
Tmem102
|
transmembrane protein 102 |
chr13_-_10410857 | 2.49 |
ENSMUST00000187510.7
|
Chrm3
|
cholinergic receptor, muscarinic 3, cardiac |
chr4_-_46536088 | 2.48 |
ENSMUST00000102924.3
ENSMUST00000046897.13 |
Trim14
|
tripartite motif-containing 14 |
chr4_-_8239034 | 2.47 |
ENSMUST00000066674.8
|
Car8
|
carbonic anhydrase 8 |
chr19_+_32734884 | 2.44 |
ENSMUST00000013807.8
|
Pten
|
phosphatase and tensin homolog |
chr9_+_100525807 | 2.40 |
ENSMUST00000133388.2
|
Stag1
|
stromal antigen 1 |
chr4_+_137589548 | 2.40 |
ENSMUST00000102518.10
|
Ece1
|
endothelin converting enzyme 1 |
chr8_+_46111310 | 2.38 |
ENSMUST00000153798.8
|
Sorbs2
|
sorbin and SH3 domain containing 2 |
chr7_-_28947882 | 2.38 |
ENSMUST00000032808.6
|
2200002D01Rik
|
RIKEN cDNA 2200002D01 gene |
chr11_-_70910058 | 2.34 |
ENSMUST00000108523.10
ENSMUST00000143850.8 |
Derl2
|
Der1-like domain family, member 2 |
chr1_+_133292898 | 2.34 |
ENSMUST00000129213.2
|
Etnk2
|
ethanolamine kinase 2 |
chr8_-_111532495 | 2.32 |
ENSMUST00000150680.2
ENSMUST00000076846.11 |
Il34
|
interleukin 34 |
chr1_+_133291302 | 2.32 |
ENSMUST00000135222.9
|
Etnk2
|
ethanolamine kinase 2 |
chr7_-_28001624 | 2.30 |
ENSMUST00000108315.4
|
Dll3
|
delta like canonical Notch ligand 3 |
chr6_-_85310393 | 2.29 |
ENSMUST00000059034.13
ENSMUST00000045846.12 ENSMUST00000113788.2 |
Sfxn5
|
sideroflexin 5 |
chr9_+_44290787 | 2.29 |
ENSMUST00000066601.13
|
Hyou1
|
hypoxia up-regulated 1 |
chr13_+_4278681 | 2.29 |
ENSMUST00000118663.9
|
Akr1c19
|
aldo-keto reductase family 1, member C19 |
chr7_-_30754193 | 2.26 |
ENSMUST00000205778.2
|
Fxyd1
|
FXYD domain-containing ion transport regulator 1 |
chr17_+_31605184 | 2.26 |
ENSMUST00000047168.13
ENSMUST00000127929.8 ENSMUST00000134525.9 ENSMUST00000236454.2 ENSMUST00000238091.2 ENSMUST00000235719.2 |
Pde9a
|
phosphodiesterase 9A |
chr14_+_36776775 | 2.26 |
ENSMUST00000120052.2
|
Lrit1
|
leucine-rich repeat, immunoglobulin-like and transmembrane domains 1 |
chrX_-_161426624 | 2.24 |
ENSMUST00000112334.8
|
Reps2
|
RALBP1 associated Eps domain containing protein 2 |
chr7_-_30754223 | 2.23 |
ENSMUST00000206012.2
ENSMUST00000108110.5 |
Fxyd1
|
FXYD domain-containing ion transport regulator 1 |
chr2_-_5719302 | 2.22 |
ENSMUST00000044009.14
|
Camk1d
|
calcium/calmodulin-dependent protein kinase ID |
chr7_-_30754240 | 2.22 |
ENSMUST00000206860.2
ENSMUST00000071697.11 |
Fxyd1
|
FXYD domain-containing ion transport regulator 1 |
chr18_+_50261268 | 2.21 |
ENSMUST00000025385.7
|
Hsd17b4
|
hydroxysteroid (17-beta) dehydrogenase 4 |
chr4_-_141345549 | 2.21 |
ENSMUST00000053263.9
|
Tmem82
|
transmembrane protein 82 |
chr17_+_45817750 | 2.20 |
ENSMUST00000024733.9
|
Aars2
|
alanyl-tRNA synthetase 2, mitochondrial |
chr18_+_51250748 | 2.19 |
ENSMUST00000116639.4
|
Prr16
|
proline rich 16 |
chr11_+_87482971 | 2.17 |
ENSMUST00000103179.10
ENSMUST00000092802.12 ENSMUST00000146871.8 |
Mtmr4
|
myotubularin related protein 4 |
chr7_-_100307601 | 2.16 |
ENSMUST00000138830.2
ENSMUST00000107044.10 ENSMUST00000116287.9 |
Plekhb1
|
pleckstrin homology domain containing, family B (evectins) member 1 |
chr8_-_123885007 | 2.16 |
ENSMUST00000000755.15
|
Sult5a1
|
sulfotransferase family 5A, member 1 |
chr14_-_14466825 | 2.15 |
ENSMUST00000225234.2
ENSMUST00000166497.9 |
Abhd6
|
abhydrolase domain containing 6 |
chr8_+_120121612 | 2.12 |
ENSMUST00000098367.5
|
Mlycd
|
malonyl-CoA decarboxylase |
chr6_-_84564972 | 2.11 |
ENSMUST00000204109.2
|
Cyp26b1
|
cytochrome P450, family 26, subfamily b, polypeptide 1 |
chr4_+_53440516 | 2.10 |
ENSMUST00000107651.9
ENSMUST00000107647.8 |
Slc44a1
|
solute carrier family 44, member 1 |
chr7_-_114162125 | 2.09 |
ENSMUST00000211506.2
ENSMUST00000119712.8 ENSMUST00000032908.15 |
Cyp2r1
|
cytochrome P450, family 2, subfamily r, polypeptide 1 |
chr11_+_72326358 | 2.08 |
ENSMUST00000108499.2
|
Ggt6
|
gamma-glutamyltransferase 6 |
chr9_+_37524966 | 2.08 |
ENSMUST00000215474.2
|
Siae
|
sialic acid acetylesterase |
chr14_+_16728196 | 2.07 |
ENSMUST00000177556.8
|
Gm3373
|
predicted gene 3373 |
chr3_+_13536696 | 2.07 |
ENSMUST00000191806.3
ENSMUST00000193117.3 |
Ralyl
|
RALY RNA binding protein-like |
chr13_-_53135064 | 2.07 |
ENSMUST00000071065.8
|
Nfil3
|
nuclear factor, interleukin 3, regulated |
chr2_-_110144869 | 2.04 |
ENSMUST00000133608.2
|
Bbox1
|
butyrobetaine (gamma), 2-oxoglutarate dioxygenase 1 (gamma-butyrobetaine hydroxylase) |
chr2_-_180685338 | 2.04 |
ENSMUST00000124400.2
|
Chrna4
|
cholinergic receptor, nicotinic, alpha polypeptide 4 |
chr4_+_40722911 | 2.02 |
ENSMUST00000164233.8
ENSMUST00000137246.8 ENSMUST00000125442.8 |
Dnaja1
|
DnaJ heat shock protein family (Hsp40) member A1 |
chr9_+_44290832 | 2.01 |
ENSMUST00000161318.8
ENSMUST00000217019.2 ENSMUST00000160902.8 |
Hyou1
|
hypoxia up-regulated 1 |
chr17_+_25114090 | 2.00 |
ENSMUST00000043907.14
|
Mrps34
|
mitochondrial ribosomal protein S34 |
chr6_-_11907392 | 1.99 |
ENSMUST00000204084.3
ENSMUST00000031637.8 ENSMUST00000204978.3 ENSMUST00000204714.2 |
Ndufa4
|
Ndufa4, mitochondrial complex associated |
chr9_+_80072274 | 1.98 |
ENSMUST00000035889.15
ENSMUST00000113268.8 |
Myo6
|
myosin VI |
chr12_+_113103817 | 1.98 |
ENSMUST00000084882.9
|
Crip2
|
cysteine rich protein 2 |
chr13_-_47196633 | 1.98 |
ENSMUST00000021806.11
ENSMUST00000136864.8 |
Tpmt
|
thiopurine methyltransferase |
chr7_+_49624978 | 1.96 |
ENSMUST00000107603.2
|
Nell1
|
NEL-like 1 |
chr8_-_85500998 | 1.96 |
ENSMUST00000109762.8
|
Nfix
|
nuclear factor I/X |
chr4_+_137589581 | 1.96 |
ENSMUST00000130407.3
|
Ece1
|
endothelin converting enzyme 1 |
chr13_-_47196592 | 1.96 |
ENSMUST00000110118.8
|
Tpmt
|
thiopurine methyltransferase |
chr8_+_46111361 | 1.95 |
ENSMUST00000210946.2
|
Sorbs2
|
sorbin and SH3 domain containing 2 |
chr2_-_37593287 | 1.94 |
ENSMUST00000072186.12
|
Strbp
|
spermatid perinuclear RNA binding protein |
chr12_+_113104085 | 1.93 |
ENSMUST00000200380.5
|
Crip2
|
cysteine rich protein 2 |
chr2_-_23938869 | 1.90 |
ENSMUST00000114497.2
|
Hnmt
|
histamine N-methyltransferase |
chr4_+_148215339 | 1.90 |
ENSMUST00000084129.9
|
Mad2l2
|
MAD2 mitotic arrest deficient-like 2 |
chr8_-_107783282 | 1.90 |
ENSMUST00000034391.4
ENSMUST00000095517.12 |
Cog8
|
component of oligomeric golgi complex 8 |
chr14_-_78970160 | 1.88 |
ENSMUST00000226342.3
|
Dgkh
|
diacylglycerol kinase, eta |
chr9_-_53617508 | 1.88 |
ENSMUST00000068449.4
|
Rab39
|
RAB39, member RAS oncogene family |
chr8_-_84738761 | 1.86 |
ENSMUST00000191523.2
ENSMUST00000190457.2 ENSMUST00000185457.2 |
Misp3
|
MISP family member 3 |
chr11_-_88755360 | 1.85 |
ENSMUST00000018572.11
|
Akap1
|
A kinase (PRKA) anchor protein 1 |
chr6_+_54241830 | 1.85 |
ENSMUST00000146114.8
|
Chn2
|
chimerin 2 |
chr8_-_14024715 | 1.85 |
ENSMUST00000062613.12
|
Tdrp
|
testis development related protein |
chr11_-_120675009 | 1.83 |
ENSMUST00000026156.8
|
Rfng
|
RFNG O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase |
chr13_-_100152069 | 1.83 |
ENSMUST00000022148.7
|
Mccc2
|
methylcrotonoyl-Coenzyme A carboxylase 2 (beta) |
chrX_+_21581135 | 1.81 |
ENSMUST00000033414.8
|
Slc6a14
|
solute carrier family 6 (neurotransmitter transporter), member 14 |
chr8_+_41315419 | 1.81 |
ENSMUST00000098816.10
ENSMUST00000057784.15 |
Slc7a2
|
solute carrier family 7 (cationic amino acid transporter, y+ system), member 2 |
chr12_+_108300599 | 1.80 |
ENSMUST00000021684.6
|
Cyp46a1
|
cytochrome P450, family 46, subfamily a, polypeptide 1 |
chr4_-_155430153 | 1.80 |
ENSMUST00000103178.11
|
Prkcz
|
protein kinase C, zeta |
chr11_+_99764215 | 1.79 |
ENSMUST00000093936.5
|
Krtap9-1
|
keratin associated protein 9-1 |
chr9_-_71678814 | 1.78 |
ENSMUST00000122065.2
ENSMUST00000121322.8 ENSMUST00000072899.9 |
Cgnl1
|
cingulin-like 1 |
chr13_-_47196607 | 1.78 |
ENSMUST00000124948.2
|
Tpmt
|
thiopurine methyltransferase |
chr17_-_23964807 | 1.77 |
ENSMUST00000046525.10
|
Kremen2
|
kringle containing transmembrane protein 2 |
chr7_-_7301760 | 1.77 |
ENSMUST00000210061.2
|
Clcn4
|
chloride channel, voltage-sensitive 4 |
chr1_-_162687254 | 1.76 |
ENSMUST00000131058.8
|
Fmo1
|
flavin containing monooxygenase 1 |
chr2_-_27138347 | 1.74 |
ENSMUST00000139312.8
|
Sardh
|
sarcosine dehydrogenase |
chr1_-_162687369 | 1.74 |
ENSMUST00000193078.6
|
Fmo1
|
flavin containing monooxygenase 1 |
chr7_+_130537902 | 1.73 |
ENSMUST00000006367.8
|
Htra1
|
HtrA serine peptidase 1 |
chr14_+_16431564 | 1.72 |
ENSMUST00000164139.2
|
Gm8206
|
predicted gene 8206 |
chr4_+_45848664 | 1.71 |
ENSMUST00000107783.8
|
Stra6l
|
STRA6-like |
chr16_-_17745999 | 1.71 |
ENSMUST00000003622.16
|
Slc25a1
|
solute carrier family 25 (mitochondrial carrier, citrate transporter), member 1 |
chr4_+_148225139 | 1.70 |
ENSMUST00000140049.8
ENSMUST00000105707.2 |
Mad2l2
|
MAD2 mitotic arrest deficient-like 2 |
chr7_+_80863314 | 1.70 |
ENSMUST00000026672.8
|
Pde8a
|
phosphodiesterase 8A |
chr6_-_116084810 | 1.70 |
ENSMUST00000204353.3
|
Tmcc1
|
transmembrane and coiled coil domains 1 |
chr14_-_55881257 | 1.69 |
ENSMUST00000122358.8
|
Tm9sf1
|
transmembrane 9 superfamily member 1 |
chr9_+_43655230 | 1.69 |
ENSMUST00000034510.9
|
Nectin1
|
nectin cell adhesion molecule 1 |
chr9_+_80072361 | 1.69 |
ENSMUST00000184480.8
|
Myo6
|
myosin VI |
chr6_+_88701578 | 1.68 |
ENSMUST00000150180.4
ENSMUST00000163271.8 |
Mgll
|
monoglyceride lipase |
chr3_+_130411097 | 1.68 |
ENSMUST00000166187.8
ENSMUST00000072271.13 |
Etnppl
|
ethanolamine phosphate phospholyase |
chr17_+_80434874 | 1.68 |
ENSMUST00000039205.11
|
Galm
|
galactose mutarotase |
chr6_-_86374080 | 1.66 |
ENSMUST00000204116.2
ENSMUST00000153723.3 ENSMUST00000032065.15 |
Pcyox1
|
prenylcysteine oxidase 1 |
chr10_+_3316057 | 1.66 |
ENSMUST00000043374.7
|
Ppp1r14c
|
protein phosphatase 1, regulatory inhibitor subunit 14C |
chr17_-_57023788 | 1.65 |
ENSMUST00000067931.7
|
Vmac
|
vimentin-type intermediate filament associated coiled-coil protein |
chr10_+_107107477 | 1.65 |
ENSMUST00000020057.16
|
Lin7a
|
lin-7 homolog A (C. elegans) |
chr14_-_17614197 | 1.65 |
ENSMUST00000166776.8
|
Gm3264
|
predicted gene 3264 |
chr6_-_47790272 | 1.64 |
ENSMUST00000077290.9
|
Pdia4
|
protein disulfide isomerase associated 4 |
chr4_+_45848816 | 1.63 |
ENSMUST00000107782.8
|
Stra6l
|
STRA6-like |
chr10_+_107107558 | 1.63 |
ENSMUST00000105280.5
|
Lin7a
|
lin-7 homolog A (C. elegans) |
chr8_-_3767547 | 1.63 |
ENSMUST00000058040.7
|
Clec4g
|
C-type lectin domain family 4, member g |
chr14_-_55880708 | 1.62 |
ENSMUST00000120041.8
ENSMUST00000121937.8 ENSMUST00000133707.2 ENSMUST00000002391.15 ENSMUST00000121791.8 |
Tm9sf1
|
transmembrane 9 superfamily member 1 |
chr15_-_78687216 | 1.62 |
ENSMUST00000164826.8
|
Card10
|
caspase recruitment domain family, member 10 |
chr2_-_179915276 | 1.62 |
ENSMUST00000108891.2
|
Cables2
|
CDK5 and Abl enzyme substrate 2 |
chr4_+_45848918 | 1.61 |
ENSMUST00000030011.6
|
Stra6l
|
STRA6-like |
chr6_+_48570817 | 1.61 |
ENSMUST00000154010.8
ENSMUST00000009420.15 ENSMUST00000163452.7 ENSMUST00000118229.2 ENSMUST00000135151.3 |
Repin1
|
replication initiator 1 |
chr14_-_19420488 | 1.61 |
ENSMUST00000166494.2
|
Gm2897
|
predicted gene 2897 |
chr10_-_61946724 | 1.61 |
ENSMUST00000142821.8
ENSMUST00000124615.8 ENSMUST00000064050.5 ENSMUST00000125704.8 ENSMUST00000142796.8 |
Fam241b
|
family with sequence similarity 241, member B |
chr14_+_14901127 | 1.61 |
ENSMUST00000163790.2
|
Gm3558
|
predicted gene 3558 |
chr19_-_58442866 | 1.60 |
ENSMUST00000169850.8
|
Gfra1
|
glial cell line derived neurotrophic factor family receptor alpha 1 |
chr19_-_58443012 | 1.59 |
ENSMUST00000129100.8
ENSMUST00000123957.2 |
Gfra1
|
glial cell line derived neurotrophic factor family receptor alpha 1 |
chr14_+_15295240 | 1.58 |
ENSMUST00000172431.8
|
Gm3512
|
predicted gene 3512 |
chr2_+_25447859 | 1.58 |
ENSMUST00000015236.4
|
Edf1
|
endothelial differentiation-related factor 1 |
chr17_+_88748139 | 1.57 |
ENSMUST00000112238.9
ENSMUST00000155640.2 |
Foxn2
|
forkhead box N2 |
chr4_-_109013807 | 1.57 |
ENSMUST00000161363.2
|
Osbpl9
|
oxysterol binding protein-like 9 |
chr6_-_23839419 | 1.57 |
ENSMUST00000115358.9
ENSMUST00000163871.9 |
Cadps2
|
Ca2+-dependent activator protein for secretion 2 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
4.8 | 14.3 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
2.8 | 8.5 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
2.3 | 13.8 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
1.7 | 5.0 | GO:0071939 | vitamin A transport(GO:0071938) vitamin A import(GO:0071939) |
1.6 | 11.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
1.5 | 4.5 | GO:0018931 | naphthalene metabolic process(GO:0018931) naphthalene-containing compound metabolic process(GO:0090420) |
1.5 | 2.9 | GO:1903400 | L-ornithine transmembrane transport(GO:1903352) L-arginine transmembrane transport(GO:1903400) L-lysine transmembrane transport(GO:1903401) arginine transmembrane transport(GO:1903826) |
1.5 | 4.4 | GO:0034959 | substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
1.4 | 8.5 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
1.4 | 5.5 | GO:0032382 | positive regulation of intracellular lipid transport(GO:0032379) positive regulation of intracellular sterol transport(GO:0032382) positive regulation of intracellular cholesterol transport(GO:0032385) lipid hydroperoxide transport(GO:1901373) |
1.3 | 4.0 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
1.3 | 1.3 | GO:0015744 | succinate transport(GO:0015744) |
0.9 | 2.7 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.9 | 3.6 | GO:1903760 | regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) |
0.9 | 2.6 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.9 | 2.6 | GO:0001982 | baroreceptor response to decreased systemic arterial blood pressure(GO:0001982) |
0.9 | 2.6 | GO:0016131 | brassinosteroid metabolic process(GO:0016131) brassinosteroid biosynthetic process(GO:0016132) |
0.9 | 2.6 | GO:1904024 | negative regulation of NAD metabolic process(GO:1902689) negative regulation of glucose catabolic process to lactate via pyruvate(GO:1904024) |
0.9 | 5.2 | GO:0035981 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
0.9 | 2.6 | GO:0021682 | nerve maturation(GO:0021682) |
0.9 | 3.4 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.8 | 4.0 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.8 | 4.7 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.8 | 3.9 | GO:0002484 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
0.8 | 5.3 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.8 | 3.0 | GO:0030450 | regulation of complement activation, classical pathway(GO:0030450) |
0.7 | 6.6 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.7 | 2.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.7 | 2.9 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.7 | 10.0 | GO:0006751 | glutathione catabolic process(GO:0006751) |
0.7 | 2.1 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
0.7 | 2.1 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
0.7 | 2.0 | GO:1903048 | regulation of acetylcholine-gated cation channel activity(GO:1903048) |
0.6 | 3.1 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
0.6 | 5.5 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.6 | 6.7 | GO:1903797 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.6 | 6.7 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.6 | 4.8 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
0.6 | 3.5 | GO:0090212 | negative regulation of establishment of blood-brain barrier(GO:0090212) |
0.6 | 8.8 | GO:0009650 | UV protection(GO:0009650) |
0.6 | 1.7 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
0.6 | 2.3 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) suppression by virus of host autophagy(GO:0039521) amino acid homeostasis(GO:0080144) negative regulation of sphingolipid biosynthesis involved in cellular sphingolipid homeostasis(GO:0090157) |
0.6 | 1.1 | GO:2000974 | negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of pro-B cell differentiation(GO:2000974) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
0.6 | 3.9 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.5 | 3.3 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.5 | 1.6 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.5 | 2.0 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
0.5 | 2.5 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.5 | 3.5 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
0.5 | 5.5 | GO:1904152 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.5 | 2.4 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.5 | 5.3 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.5 | 2.9 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.5 | 1.4 | GO:0046203 | spermidine catabolic process(GO:0046203) |
0.5 | 1.0 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.5 | 2.4 | GO:0098957 | anterograde axonal transport of mitochondrion(GO:0098957) |
0.5 | 1.4 | GO:0070563 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) |
0.5 | 4.7 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.5 | 5.0 | GO:1903297 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
0.4 | 2.5 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.4 | 1.7 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
0.4 | 1.3 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.4 | 3.8 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.4 | 2.9 | GO:0015862 | uridine transport(GO:0015862) |
0.4 | 2.9 | GO:0090383 | phagosome acidification(GO:0090383) |
0.4 | 1.2 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.4 | 3.9 | GO:0019243 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.4 | 1.2 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
0.4 | 1.1 | GO:2000137 | negative regulation of cell proliferation involved in heart morphogenesis(GO:2000137) cell proliferation involved in heart valve development(GO:2000793) |
0.4 | 1.9 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.4 | 1.1 | GO:2000547 | regulation of dendritic cell dendrite assembly(GO:2000547) |
0.4 | 1.5 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
0.4 | 1.9 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.4 | 1.1 | GO:0099547 | modulation by host of viral RNA genome replication(GO:0044830) regulation of translation at synapse, modulating synaptic transmission(GO:0099547) regulation of translation at postsynapse, modulating synaptic transmission(GO:0099578) positive regulation of intracellular transport of viral material(GO:1901254) |
0.4 | 1.5 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.4 | 2.2 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.4 | 1.5 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.4 | 8.4 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.4 | 1.4 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
0.4 | 1.1 | GO:0060720 | spongiotrophoblast cell proliferation(GO:0060720) cell proliferation involved in embryonic placenta development(GO:0060722) |
0.4 | 1.4 | GO:0009804 | coumarin metabolic process(GO:0009804) coumarin catabolic process(GO:0046226) |
0.3 | 1.4 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
0.3 | 1.7 | GO:0072197 | ureter morphogenesis(GO:0072197) |
0.3 | 3.7 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.3 | 0.7 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.3 | 1.0 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.3 | 1.7 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.3 | 1.0 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.3 | 1.0 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
0.3 | 0.6 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.3 | 9.1 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.3 | 1.0 | GO:1905168 | positive regulation of double-strand break repair via homologous recombination(GO:1905168) |
0.3 | 3.8 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.3 | 3.5 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
0.3 | 2.2 | GO:0015871 | choline transport(GO:0015871) |
0.3 | 1.3 | GO:0070650 | actin filament bundle distribution(GO:0070650) |
0.3 | 0.6 | GO:0060424 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
0.3 | 2.7 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.3 | 1.5 | GO:1904457 | positive regulation of neuronal action potential(GO:1904457) |
0.3 | 0.6 | GO:0045168 | BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) cell-cell signaling involved in cell fate commitment(GO:0045168) |
0.3 | 1.5 | GO:0009992 | cellular water homeostasis(GO:0009992) |
0.3 | 1.5 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.3 | 1.2 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.3 | 0.3 | GO:0010996 | response to auditory stimulus(GO:0010996) |
0.3 | 1.7 | GO:0032439 | endosome localization(GO:0032439) |
0.3 | 0.9 | GO:0021594 | rhombomere formation(GO:0021594) rhombomere 3 formation(GO:0021660) rhombomere 5 morphogenesis(GO:0021664) rhombomere 5 formation(GO:0021666) |
0.3 | 1.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.3 | 1.1 | GO:0048880 | sensory system development(GO:0048880) |
0.3 | 0.8 | GO:1900477 | negative regulation of G1/S transition of mitotic cell cycle by negative regulation of transcription from RNA polymerase II promoter(GO:1900477) |
0.3 | 6.0 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.3 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
0.3 | 1.6 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.3 | 1.6 | GO:0006668 | sphinganine-1-phosphate metabolic process(GO:0006668) |
0.3 | 0.5 | GO:0010808 | positive regulation of synaptic vesicle priming(GO:0010808) |
0.3 | 0.8 | GO:0021629 | olfactory nerve morphogenesis(GO:0021627) olfactory nerve structural organization(GO:0021629) |
0.3 | 0.3 | GO:0021759 | globus pallidus development(GO:0021759) |
0.3 | 0.5 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
0.3 | 1.8 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.3 | 1.0 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.2 | 2.2 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.2 | 3.2 | GO:0034312 | diol biosynthetic process(GO:0034312) |
0.2 | 0.7 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.2 | 8.6 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
0.2 | 0.7 | GO:0072752 | cellular response to rapamycin(GO:0072752) |
0.2 | 2.0 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.2 | 2.2 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.2 | 1.0 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.2 | 1.2 | GO:0003349 | epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
0.2 | 1.7 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
0.2 | 1.0 | GO:2000795 | negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
0.2 | 1.7 | GO:0015886 | heme transport(GO:0015886) |
0.2 | 0.7 | GO:1903412 | response to bile acid(GO:1903412) cellular response to bile acid(GO:1903413) |
0.2 | 5.9 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.2 | 3.3 | GO:0002934 | desmosome organization(GO:0002934) |
0.2 | 0.5 | GO:0021586 | pons maturation(GO:0021586) |
0.2 | 1.9 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.2 | 2.5 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
0.2 | 0.9 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
0.2 | 0.2 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.2 | 1.8 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.2 | 0.6 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.2 | 1.3 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.2 | 0.9 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
0.2 | 1.3 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.2 | 3.6 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.2 | 1.1 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.2 | 2.7 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.2 | 2.3 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.2 | 1.3 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.2 | 0.6 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
0.2 | 0.6 | GO:2000847 | negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.2 | 1.0 | GO:0034334 | adherens junction maintenance(GO:0034334) |
0.2 | 1.0 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.2 | 0.4 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.2 | 3.9 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.2 | 0.8 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.2 | 1.2 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.2 | 0.6 | GO:0021571 | rhombomere 5 development(GO:0021571) |
0.2 | 2.2 | GO:0060174 | limb bud formation(GO:0060174) |
0.2 | 0.8 | GO:0019323 | pentose catabolic process(GO:0019323) |
0.2 | 1.4 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.2 | 1.0 | GO:0048069 | eye pigmentation(GO:0048069) |
0.2 | 1.0 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
0.2 | 1.0 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.2 | 1.7 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.2 | 2.9 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.2 | 19.4 | GO:0021766 | hippocampus development(GO:0021766) |
0.2 | 0.6 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
0.2 | 0.8 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.2 | 0.7 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.2 | 0.7 | GO:0010593 | negative regulation of lamellipodium assembly(GO:0010593) |
0.2 | 1.1 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.2 | 1.5 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.2 | 1.1 | GO:0045991 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) carbon catabolite activation of transcription(GO:0045991) |
0.2 | 0.9 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.2 | 1.8 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.2 | 2.3 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.2 | 0.5 | GO:0001978 | regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.2 | 0.5 | GO:0045645 | regulation of eosinophil differentiation(GO:0045643) positive regulation of eosinophil differentiation(GO:0045645) |
0.2 | 4.3 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.2 | 1.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.2 | 1.2 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.2 | 2.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.2 | 0.2 | GO:0097535 | lymphoid lineage cell migration(GO:0097534) lymphoid lineage cell migration into thymus(GO:0097535) |
0.2 | 0.7 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.2 | 1.3 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.2 | 0.7 | GO:0070459 | prolactin secretion(GO:0070459) |
0.2 | 0.5 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.2 | 1.5 | GO:0021840 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
0.2 | 1.5 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.2 | 0.6 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.2 | 0.6 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
0.2 | 0.6 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.2 | 0.8 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.2 | 1.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.2 | 0.6 | GO:1904253 | positive regulation of bile acid biosynthetic process(GO:0070859) positive regulation of bile acid metabolic process(GO:1904253) |
0.2 | 0.5 | GO:1904828 | regulation of hydrogen sulfide biosynthetic process(GO:1904826) positive regulation of hydrogen sulfide biosynthetic process(GO:1904828) |
0.2 | 0.8 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
0.2 | 0.5 | GO:1904393 | regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) |
0.2 | 2.6 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.2 | 0.8 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) |
0.2 | 0.5 | GO:1904456 | negative regulation of neuronal action potential(GO:1904456) |
0.2 | 2.0 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.2 | 0.6 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
0.2 | 1.2 | GO:0009249 | protein lipoylation(GO:0009249) |
0.2 | 0.5 | GO:0043686 | co-translational protein modification(GO:0043686) |
0.2 | 3.6 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.1 | 1.0 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.1 | 0.4 | GO:0032618 | interleukin-15 production(GO:0032618) |
0.1 | 0.9 | GO:0006477 | protein sulfation(GO:0006477) |
0.1 | 0.4 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.1 | 1.4 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.6 | GO:0034757 | negative regulation of iron ion transport(GO:0034757) negative regulation of iron ion transmembrane transport(GO:0034760) |
0.1 | 0.3 | GO:0072054 | renal outer medulla development(GO:0072054) |
0.1 | 0.9 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 2.3 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.1 | 0.6 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.1 | 0.3 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.3 | GO:0060003 | copper ion export(GO:0060003) |
0.1 | 1.1 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.1 | 1.9 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.1 | 0.5 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.8 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 1.0 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 1.6 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.1 | 0.5 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.1 | 1.7 | GO:0021554 | optic nerve development(GO:0021554) |
0.1 | 0.6 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 0.4 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.1 | 0.6 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.1 | 0.9 | GO:0015705 | iodide transport(GO:0015705) |
0.1 | 1.5 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
0.1 | 1.0 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.1 | 0.7 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.1 | 0.5 | GO:0000239 | pachytene(GO:0000239) |
0.1 | 0.2 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.4 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.1 | 0.7 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.6 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.1 | 0.5 | GO:1904453 | regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
0.1 | 1.0 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.1 | 0.8 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.8 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 0.6 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.1 | 0.5 | GO:0070268 | cornification(GO:0070268) |
0.1 | 3.9 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.1 | 1.4 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.1 | 1.6 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.1 | 0.3 | GO:2000097 | regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.1 | 2.2 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.1 | 0.3 | GO:0044861 | protein transport into plasma membrane raft(GO:0044861) |
0.1 | 0.8 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
0.1 | 0.2 | GO:0070376 | regulation of ERK5 cascade(GO:0070376) |
0.1 | 1.6 | GO:0034331 | cell junction maintenance(GO:0034331) cell-cell junction maintenance(GO:0045217) |
0.1 | 6.2 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.1 | 1.2 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.4 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.1 | 1.7 | GO:0060307 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) |
0.1 | 2.0 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.1 | 0.8 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
0.1 | 1.7 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
0.1 | 0.3 | GO:0038060 | nitric oxide-cGMP-mediated signaling pathway(GO:0038060) |
0.1 | 0.3 | GO:2001034 | positive regulation of double-strand break repair via nonhomologous end joining(GO:2001034) |
0.1 | 0.4 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.1 | 0.2 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 0.4 | GO:0098964 | dendritic transport of ribonucleoprotein complex(GO:0098961) dendritic transport of messenger ribonucleoprotein complex(GO:0098963) anterograde dendritic transport of messenger ribonucleoprotein complex(GO:0098964) |
0.1 | 0.7 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.1 | 0.9 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.5 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.1 | 0.6 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.1 | 0.3 | GO:0007309 | oocyte construction(GO:0007308) oocyte axis specification(GO:0007309) oocyte anterior/posterior axis specification(GO:0007314) pole plasm assembly(GO:0007315) maternal determination of anterior/posterior axis, embryo(GO:0008358) P granule organization(GO:0030719) |
0.1 | 1.8 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
0.1 | 0.1 | GO:0098712 | amino acid import across plasma membrane(GO:0089718) L-glutamate import across plasma membrane(GO:0098712) |
0.1 | 1.6 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.3 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.1 | 1.6 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.1 | 1.4 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.1 | 0.2 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.1 | 1.2 | GO:0060025 | regulation of synaptic activity(GO:0060025) |
0.1 | 1.0 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.1 | 0.7 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.1 | 0.4 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.1 | 2.7 | GO:1902175 | regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902175) |
0.1 | 0.4 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
0.1 | 0.8 | GO:0015671 | oxygen transport(GO:0015671) |
0.1 | 0.4 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.1 | 0.5 | GO:0002681 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
0.1 | 1.9 | GO:0008272 | sulfate transport(GO:0008272) |
0.1 | 0.6 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
0.1 | 1.2 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.1 | 0.7 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.1 | 0.5 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 0.5 | GO:0001980 | regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
0.1 | 0.3 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.1 | 1.4 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 0.3 | GO:1903566 | positive regulation of protein localization to cilium(GO:1903566) |
0.1 | 0.3 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
0.1 | 0.9 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.1 | 0.6 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.1 | 0.9 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.1 | 0.6 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.1 | 0.9 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.1 | 2.5 | GO:0048240 | sperm capacitation(GO:0048240) |
0.1 | 2.9 | GO:0045103 | intermediate filament-based process(GO:0045103) |
0.1 | 0.7 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
0.1 | 1.7 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.1 | 1.8 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.1 | 0.7 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.1 | 1.8 | GO:0006744 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) |
0.1 | 2.6 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.1 | 0.2 | GO:0014908 | myotube differentiation involved in skeletal muscle regeneration(GO:0014908) |
0.1 | 0.7 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 1.5 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.1 | 0.3 | GO:0044805 | late nucleophagy(GO:0044805) |
0.1 | 3.8 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.1 | 1.2 | GO:0060482 | lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
0.1 | 0.9 | GO:0000050 | urea cycle(GO:0000050) |
0.1 | 0.2 | GO:1903233 | regulation of calcium ion-dependent exocytosis of neurotransmitter(GO:1903233) |
0.1 | 0.2 | GO:0018008 | N-terminal peptidyl-glycine N-myristoylation(GO:0018008) |
0.1 | 1.2 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.1 | 0.5 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 2.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.1 | 2.9 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.1 | 1.3 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
0.1 | 0.7 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.1 | 0.9 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.1 | 0.2 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.1 | 1.3 | GO:0060736 | prostate gland growth(GO:0060736) |
0.1 | 1.6 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
0.1 | 1.0 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.1 | 0.3 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.1 | 0.5 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.1 | 0.6 | GO:0001766 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
0.1 | 0.2 | GO:0033128 | negative regulation of histone phosphorylation(GO:0033128) |
0.1 | 1.0 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.1 | 0.5 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.1 | 0.1 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.1 | 0.8 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.1 | 0.4 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.1 | 0.8 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
0.1 | 3.1 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.1 | 5.2 | GO:0032024 | positive regulation of insulin secretion(GO:0032024) |
0.1 | 0.6 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.1 | 1.0 | GO:0032119 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.1 | 0.9 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.1 | 0.7 | GO:0015791 | polyol transport(GO:0015791) |
0.1 | 1.2 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.1 | 0.5 | GO:0006616 | SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
0.1 | 0.4 | GO:0070894 | transposon integration(GO:0070893) regulation of transposon integration(GO:0070894) negative regulation of transposon integration(GO:0070895) |
0.1 | 1.2 | GO:0098780 | response to mitochondrial depolarisation(GO:0098780) |
0.1 | 0.6 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.1 | 1.0 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.1 | 1.1 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.1 | 1.2 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.1 | 1.0 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.1 | 0.8 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.1 | 3.7 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.1 | 0.8 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.1 | 1.5 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.1 | 1.5 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 3.3 | GO:0006953 | acute-phase response(GO:0006953) |
0.1 | 1.2 | GO:0021511 | spinal cord patterning(GO:0021511) |
0.1 | 1.4 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.1 | 0.6 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.1 | 1.4 | GO:0031424 | keratinization(GO:0031424) |
0.1 | 0.1 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.1 | 0.6 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.1 | 1.1 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.1 | 0.1 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
0.1 | 0.3 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 1.2 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.1 | 0.2 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.1 | 0.5 | GO:0051458 | protein import into peroxisome matrix, docking(GO:0016560) corticotropin secretion(GO:0051458) regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
0.1 | 1.0 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
0.1 | 0.9 | GO:0010623 | programmed cell death involved in cell development(GO:0010623) |
0.1 | 1.5 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
0.1 | 0.3 | GO:0015817 | histidine transport(GO:0015817) |
0.1 | 0.4 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.1 | 0.5 | GO:0048820 | hair follicle maturation(GO:0048820) |
0.1 | 0.7 | GO:0000730 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
0.1 | 0.7 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.1 | 0.2 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.1 | 0.4 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.1 | 1.0 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.1 | 1.2 | GO:0060487 | lung cell differentiation(GO:0060479) lung epithelial cell differentiation(GO:0060487) |
0.1 | 0.4 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.1 | 0.3 | GO:0001830 | trophectodermal cell fate commitment(GO:0001830) |
0.1 | 2.4 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.1 | 0.1 | GO:0021589 | hindbrain structural organization(GO:0021577) cerebellum structural organization(GO:0021589) |
0.1 | 0.2 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) |
0.1 | 0.9 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.1 | 0.3 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
0.1 | 0.2 | GO:0051885 | positive regulation of anagen(GO:0051885) |
0.1 | 0.5 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.1 | 0.4 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.1 | 1.5 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.1 | GO:2000275 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.1 | 0.3 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.1 | 0.3 | GO:0035660 | MyD88-dependent toll-like receptor 4 signaling pathway(GO:0035660) |
0.1 | 0.3 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.1 | 0.2 | GO:1903998 | regulation of eating behavior(GO:1903998) negative regulation of eating behavior(GO:1903999) |
0.1 | 0.4 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.1 | 0.9 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.1 | 0.4 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.1 | 2.9 | GO:0048663 | neuron fate commitment(GO:0048663) |
0.1 | 1.8 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.1 | 2.1 | GO:0051351 | positive regulation of ligase activity(GO:0051351) |
0.1 | 0.1 | GO:0035063 | nuclear speck organization(GO:0035063) |
0.1 | 0.8 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.0 | 0.8 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.0 | 1.3 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
0.0 | 1.7 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.0 | 0.4 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
0.0 | 0.3 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.0 | 0.7 | GO:0019985 | translesion synthesis(GO:0019985) |
0.0 | 0.8 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.7 | GO:0042711 | maternal behavior(GO:0042711) |
0.0 | 0.5 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.6 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.0 | 0.3 | GO:0070417 | cellular response to cold(GO:0070417) |
0.0 | 0.4 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.3 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.0 | 0.4 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
0.0 | 0.7 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 1.2 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
0.0 | 0.7 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
0.0 | 0.1 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.0 | 0.1 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.0 | 0.8 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.5 | GO:2001288 | positive regulation of caveolin-mediated endocytosis(GO:2001288) |
0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
0.0 | 0.9 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.0 | 0.7 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
0.0 | 0.8 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
0.0 | 0.4 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.0 | 0.4 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
0.0 | 0.5 | GO:0002024 | diet induced thermogenesis(GO:0002024) |
0.0 | 0.8 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.0 | 1.0 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
0.0 | 0.3 | GO:1990839 | response to endothelin(GO:1990839) |
0.0 | 1.4 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
0.0 | 0.5 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 1.3 | GO:0010842 | retina layer formation(GO:0010842) |
0.0 | 0.0 | GO:1990791 | cerebral cortex tangential migration using cell-axon interactions(GO:0021824) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) cranial ganglion development(GO:0061550) trigeminal ganglion development(GO:0061551) facioacoustic ganglion development(GO:1903375) dorsal root ganglion development(GO:1990791) |
0.0 | 0.5 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 2.3 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.6 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.0 | 0.1 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.0 | 0.5 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.9 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.0 | 1.2 | GO:0007628 | adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
0.0 | 0.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 1.8 | GO:1901998 | toxin transport(GO:1901998) |
0.0 | 0.3 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.0 | 0.2 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.3 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.0 | 0.4 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.4 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.0 | 0.1 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.2 | GO:0072092 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
0.0 | 0.2 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.0 | 0.9 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
0.0 | 1.2 | GO:0051220 | cytoplasmic sequestering of protein(GO:0051220) |
0.0 | 0.8 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.0 | 0.6 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.0 | 0.2 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.0 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.2 | GO:0045872 | regulation of rhodopsin gene expression(GO:0007468) positive regulation of rhodopsin gene expression(GO:0045872) |
0.0 | 1.0 | GO:0009303 | rRNA transcription(GO:0009303) |
0.0 | 0.3 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.7 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
0.0 | 0.3 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.0 | 0.7 | GO:0071501 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.0 | 0.6 | GO:0061157 | mRNA destabilization(GO:0061157) |
0.0 | 0.2 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.2 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.0 | 0.5 | GO:0070673 | response to interleukin-18(GO:0070673) |
0.0 | 0.3 | GO:0043369 | CD4-positive or CD8-positive, alpha-beta T cell lineage commitment(GO:0043369) |
0.0 | 1.5 | GO:0043525 | positive regulation of neuron apoptotic process(GO:0043525) |
0.0 | 0.1 | GO:1900145 | regulation of nodal signaling pathway involved in determination of left/right asymmetry(GO:1900145) regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900175) |
0.0 | 0.5 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
0.0 | 0.5 | GO:0002088 | lens development in camera-type eye(GO:0002088) |
0.0 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.0 | 0.1 | GO:0055075 | potassium ion homeostasis(GO:0055075) |
0.0 | 0.2 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.0 | 0.7 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.0 | 0.5 | GO:0048713 | regulation of oligodendrocyte differentiation(GO:0048713) |
0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 1.3 | GO:0055013 | cardiac muscle cell development(GO:0055013) |
0.0 | 0.5 | GO:0006465 | signal peptide processing(GO:0006465) |
0.0 | 0.6 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 3.1 | GO:0007338 | single fertilization(GO:0007338) |
0.0 | 0.3 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.0 | 0.7 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.0 | 0.9 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.0 | 1.3 | GO:0001881 | receptor recycling(GO:0001881) |
0.0 | 0.1 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.0 | 0.3 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.0 | 0.1 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.0 | 0.1 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
0.0 | 0.1 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.0 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.3 | GO:0021904 | dorsal/ventral neural tube patterning(GO:0021904) |
0.0 | 0.3 | GO:0022038 | corpus callosum development(GO:0022038) |
0.0 | 0.4 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.0 | 0.2 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.2 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.0 | 0.4 | GO:0019228 | neuronal action potential(GO:0019228) |
0.0 | 0.1 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.4 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
0.0 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.2 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.1 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.0 | 1.3 | GO:0008277 | regulation of G-protein coupled receptor protein signaling pathway(GO:0008277) |
0.0 | 0.2 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
0.0 | 0.3 | GO:0060074 | synapse maturation(GO:0060074) |
0.0 | 0.2 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.4 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
0.0 | 0.5 | GO:0097320 | membrane tubulation(GO:0097320) |
0.0 | 0.1 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
0.0 | 0.6 | GO:0014037 | Schwann cell differentiation(GO:0014037) |
0.0 | 0.6 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.1 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.0 | 0.3 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 1.1 | GO:0008306 | associative learning(GO:0008306) |
0.0 | 0.3 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.0 | 1.2 | GO:0019233 | sensory perception of pain(GO:0019233) |
0.0 | 0.6 | GO:0009880 | embryonic pattern specification(GO:0009880) |
0.0 | 0.4 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
0.0 | 0.5 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
0.0 | 0.1 | GO:0072017 | distal tubule development(GO:0072017) |
0.0 | 0.4 | GO:0010107 | potassium ion import(GO:0010107) |
0.0 | 1.0 | GO:0034341 | response to interferon-gamma(GO:0034341) |
0.0 | 0.5 | GO:0001953 | negative regulation of cell-matrix adhesion(GO:0001953) |
0.0 | 0.4 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
0.0 | 0.1 | GO:0007527 | adult somatic muscle development(GO:0007527) |
0.0 | 0.2 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.7 | GO:0007612 | learning(GO:0007612) |
0.0 | 0.2 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
0.0 | 0.6 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.0 | 0.0 | GO:1903027 | regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
0.0 | 1.0 | GO:0008203 | cholesterol metabolic process(GO:0008203) |
0.0 | 0.0 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) negative regulation of axon guidance(GO:1902668) |
0.0 | 0.0 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.0 | 0.5 | GO:0009566 | fertilization(GO:0009566) |
0.0 | 0.4 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.0 | 0.7 | GO:0036503 | ERAD pathway(GO:0036503) |
0.0 | 0.7 | GO:0035418 | protein localization to synapse(GO:0035418) |
0.0 | 0.4 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.0 | 0.6 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.2 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.2 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.0 | 0.3 | GO:0070232 | regulation of T cell apoptotic process(GO:0070232) |
0.0 | 0.1 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.2 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.0 | 0.2 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 3.6 | GO:1990630 | IRE1-RACK1-PP2A complex(GO:1990630) |
0.9 | 8.5 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.9 | 3.6 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
0.9 | 6.9 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.8 | 5.6 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.6 | 2.5 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.6 | 8.5 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.4 | 4.4 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.4 | 5.3 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.4 | 1.9 | GO:0044307 | dendritic branch(GO:0044307) |
0.3 | 3.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.3 | 1.3 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.3 | 3.5 | GO:0045179 | apical cortex(GO:0045179) |
0.3 | 1.6 | GO:0000802 | transverse filament(GO:0000802) |
0.3 | 0.9 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.3 | 1.1 | GO:0019034 | viral replication complex(GO:0019034) dendritic filopodium(GO:1902737) |
0.3 | 18.2 | GO:0045171 | intercellular bridge(GO:0045171) |
0.2 | 1.0 | GO:0045283 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
0.2 | 1.1 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
0.2 | 2.4 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.2 | 0.7 | GO:0060473 | cortical granule(GO:0060473) |
0.2 | 1.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.2 | 0.7 | GO:0044753 | amphisome(GO:0044753) |
0.2 | 2.6 | GO:0016011 | dystroglycan complex(GO:0016011) |
0.2 | 1.6 | GO:0033263 | CORVET complex(GO:0033263) |
0.2 | 1.0 | GO:0000938 | GARP complex(GO:0000938) |
0.2 | 0.6 | GO:0098830 | presynaptic endosome(GO:0098830) |
0.2 | 0.6 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) |
0.2 | 0.8 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.2 | 8.3 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.2 | 4.9 | GO:0043196 | varicosity(GO:0043196) |
0.2 | 0.5 | GO:0098831 | presynaptic active zone cytoplasmic component(GO:0098831) |
0.2 | 1.2 | GO:0070695 | FHF complex(GO:0070695) |
0.2 | 2.4 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.2 | 1.9 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.2 | 0.5 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.2 | 1.3 | GO:0005827 | polar microtubule(GO:0005827) |
0.2 | 0.9 | GO:0030870 | Mre11 complex(GO:0030870) |
0.2 | 0.3 | GO:0032783 | ELL-EAF complex(GO:0032783) |
0.2 | 3.0 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.1 | 3.9 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.1 | 3.3 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.1 | 2.8 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.1 | 3.6 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.1 | 11.0 | GO:0034707 | chloride channel complex(GO:0034707) |
0.1 | 2.3 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.8 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.1 | 1.6 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.7 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 1.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.1 | 2.0 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 1.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 1.7 | GO:0032584 | growth cone membrane(GO:0032584) |
0.1 | 0.7 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.1 | 0.6 | GO:0044194 | cytolytic granule(GO:0044194) |
0.1 | 2.4 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 2.2 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 1.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.1 | 2.6 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.1 | 1.4 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.1 | 11.2 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) microbody part(GO:0044438) peroxisomal part(GO:0044439) |
0.1 | 0.5 | GO:1990794 | lateral part of cell(GO:0097574) basolateral part of cell(GO:1990794) rod bipolar cell terminal bouton(GO:1990795) |
0.1 | 0.4 | GO:0034686 | integrin alphav-beta8 complex(GO:0034686) |
0.1 | 0.8 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 0.4 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 5.0 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 0.4 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.1 | 4.4 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.1 | 1.5 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.1 | 2.0 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 0.9 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 0.3 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) extrinsic component of autophagosome membrane(GO:0097635) |
0.1 | 3.2 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.1 | 9.0 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.1 | 0.9 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 0.9 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.4 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.4 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.1 | 0.3 | GO:0070435 | Shc-EGFR complex(GO:0070435) |
0.1 | 1.4 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 1.4 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.5 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 1.0 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 1.0 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 1.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.5 | GO:0032807 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) DNA ligase IV complex(GO:0032807) |
0.1 | 0.7 | GO:0032590 | dendrite membrane(GO:0032590) |
0.1 | 0.9 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 1.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 1.0 | GO:1990635 | proximal dendrite(GO:1990635) |
0.1 | 1.3 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.1 | 0.4 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 1.6 | GO:0033268 | node of Ranvier(GO:0033268) |
0.1 | 1.8 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.3 | GO:1902937 | inward rectifier potassium channel complex(GO:1902937) |
0.1 | 0.5 | GO:0061617 | MICOS complex(GO:0061617) |
0.1 | 3.5 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 0.9 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 0.6 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.1 | 5.9 | GO:0005882 | intermediate filament(GO:0005882) |
0.1 | 0.7 | GO:0036128 | CatSper complex(GO:0036128) |
0.1 | 0.8 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 12.1 | GO:0070160 | occluding junction(GO:0070160) |
0.1 | 0.8 | GO:0097470 | ribbon synapse(GO:0097470) |
0.1 | 0.4 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 0.8 | GO:0036156 | inner dynein arm(GO:0036156) |
0.1 | 1.5 | GO:0030057 | desmosome(GO:0030057) |
0.1 | 0.8 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 3.7 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.1 | 13.2 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.1 | 0.7 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 0.5 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.1 | 4.4 | GO:0043198 | dendritic shaft(GO:0043198) |
0.1 | 2.6 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
0.1 | 6.1 | GO:0032587 | ruffle membrane(GO:0032587) |
0.1 | 7.7 | GO:0043204 | perikaryon(GO:0043204) |
0.1 | 0.5 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 0.9 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.1 | 0.5 | GO:0005787 | signal peptidase complex(GO:0005787) |
0.0 | 1.9 | GO:0030173 | integral component of Golgi membrane(GO:0030173) intrinsic component of Golgi membrane(GO:0031228) |
0.0 | 1.1 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 2.7 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 1.1 | GO:0005605 | basal lamina(GO:0005605) |
0.0 | 0.5 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.3 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.4 | GO:0045240 | dihydrolipoyl dehydrogenase complex(GO:0045240) oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.9 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 1.7 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.0 | 1.3 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 2.2 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.0 | 6.1 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.0 | 0.3 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.0 | 0.2 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.0 | 0.7 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 12.6 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.0 | 0.5 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 1.1 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 0.5 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.6 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.0 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.6 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.0 | 1.7 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 1.4 | GO:0014704 | intercalated disc(GO:0014704) |
0.0 | 1.5 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.0 | 0.1 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
0.0 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.0 | 2.3 | GO:0001669 | acrosomal vesicle(GO:0001669) |
0.0 | 0.6 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.6 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.0 | 0.4 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.2 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.2 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 5.7 | GO:0014069 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
0.0 | 0.3 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 1.4 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.0 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.2 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 0.2 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.4 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.2 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.2 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.0 | 0.5 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 2.3 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.2 | GO:0001739 | sex chromatin(GO:0001739) |
0.0 | 0.5 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.3 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.0 | 0.3 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.0 | 1.2 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.4 | GO:0016235 | aggresome(GO:0016235) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
4.8 | 14.3 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
2.3 | 13.8 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
2.1 | 8.3 | GO:0004096 | catalase activity(GO:0004096) |
1.9 | 5.7 | GO:0008119 | thiopurine S-methyltransferase activity(GO:0008119) |
1.6 | 4.7 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
1.4 | 5.5 | GO:0050632 | propanoyl-CoA C-acyltransferase activity(GO:0033814) propionyl-CoA C2-trimethyltridecanoyltransferase activity(GO:0050632) phosphatidylethanolamine transporter activity(GO:1904121) |
1.3 | 6.6 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
1.3 | 1.3 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
1.2 | 4.7 | GO:0004103 | choline kinase activity(GO:0004103) |
1.2 | 7.0 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
1.0 | 6.9 | GO:0097016 | L27 domain binding(GO:0097016) |
0.9 | 2.8 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.9 | 3.6 | GO:0047016 | cholest-5-ene-3-beta,7-alpha-diol 3-beta-dehydrogenase activity(GO:0047016) |
0.9 | 2.7 | GO:0008431 | vitamin E binding(GO:0008431) |
0.9 | 2.6 | GO:0047598 | sterol delta7 reductase activity(GO:0009918) 7-dehydrocholesterol reductase activity(GO:0047598) |
0.9 | 5.2 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.8 | 10.0 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
0.8 | 2.4 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
0.8 | 4.0 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.7 | 2.2 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.7 | 2.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.7 | 3.4 | GO:0004021 | L-alanine:2-oxoglutarate aminotransferase activity(GO:0004021) alanine-oxo-acid transaminase activity(GO:0047635) |
0.7 | 2.6 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.6 | 3.9 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
0.6 | 1.9 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.6 | 2.5 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.6 | 1.9 | GO:0022865 | transmembrane electron transfer carrier(GO:0022865) |
0.6 | 2.9 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.6 | 1.7 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) |
0.6 | 2.3 | GO:0019778 | Atg12 activating enzyme activity(GO:0019778) Atg8 activating enzyme activity(GO:0019779) |
0.6 | 1.7 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.5 | 8.7 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.5 | 1.6 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.5 | 8.5 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.5 | 2.5 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.5 | 1.5 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.5 | 3.9 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.4 | 0.8 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.4 | 1.2 | GO:0016979 | lipoate-protein ligase activity(GO:0016979) |
0.4 | 1.2 | GO:0003990 | acetylcholinesterase activity(GO:0003990) cholinesterase activity(GO:0004104) |
0.4 | 1.6 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.4 | 1.2 | GO:0004372 | glycine hydroxymethyltransferase activity(GO:0004372) |
0.4 | 2.2 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.4 | 2.5 | GO:0070404 | NADH binding(GO:0070404) |
0.4 | 2.8 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.4 | 1.4 | GO:0004063 | aryldialkylphosphatase activity(GO:0004063) |
0.3 | 1.4 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.3 | 2.8 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.3 | 3.7 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.3 | 1.0 | GO:0070773 | protein-N-terminal glutamine amidohydrolase activity(GO:0070773) |
0.3 | 3.3 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.3 | 2.0 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.3 | 1.0 | GO:0034632 | retinol transporter activity(GO:0034632) |
0.3 | 1.0 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
0.3 | 2.9 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.3 | 0.9 | GO:0036361 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
0.3 | 1.8 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.3 | 7.3 | GO:0019825 | oxygen binding(GO:0019825) |
0.3 | 1.4 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
0.3 | 1.4 | GO:0052901 | polyamine oxidase activity(GO:0046592) spermine:oxygen oxidoreductase (spermidine-forming) activity(GO:0052901) |
0.3 | 1.4 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
0.3 | 0.9 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.3 | 0.8 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
0.3 | 1.7 | GO:0015232 | heme transporter activity(GO:0015232) |
0.3 | 6.4 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.3 | 1.9 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.3 | 0.8 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.3 | 2.4 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.3 | 1.3 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.3 | 1.0 | GO:0034647 | histone demethylase activity (H3-trimethyl-K4 specific)(GO:0034647) |
0.3 | 1.6 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.2 | 2.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.2 | 1.4 | GO:0032810 | sterol response element binding(GO:0032810) |
0.2 | 1.1 | GO:1990254 | keratin filament binding(GO:1990254) |
0.2 | 2.3 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.2 | 0.9 | GO:0047710 | bis(5'-adenosyl)-triphosphatase activity(GO:0047710) |
0.2 | 1.8 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.2 | 0.7 | GO:0070002 | glutamic-type peptidase activity(GO:0070002) |
0.2 | 0.6 | GO:0097604 | temperature-gated cation channel activity(GO:0097604) |
0.2 | 0.9 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.2 | 1.5 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.2 | 2.7 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.2 | 6.0 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.2 | 1.2 | GO:0048039 | ubiquinone binding(GO:0048039) |
0.2 | 0.8 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
0.2 | 0.6 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
0.2 | 13.4 | GO:0019213 | deacetylase activity(GO:0019213) |
0.2 | 1.2 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.2 | 0.6 | GO:0042165 | neurotransmitter binding(GO:0042165) |
0.2 | 1.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.2 | 1.8 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.2 | 4.5 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.2 | 0.5 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
0.2 | 4.3 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.2 | 0.5 | GO:0016501 | prostacyclin receptor activity(GO:0016501) |
0.2 | 0.7 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.2 | 5.2 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
0.2 | 0.7 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
0.2 | 2.5 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.2 | 0.8 | GO:2001069 | glycogen binding(GO:2001069) |
0.2 | 1.6 | GO:0004579 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.2 | 6.0 | GO:0005112 | Notch binding(GO:0005112) |
0.2 | 0.7 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.2 | 0.6 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.2 | 4.3 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.2 | 0.8 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.2 | 1.7 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.2 | 0.6 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.1 | 0.9 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 0.9 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.1 | 2.5 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.1 | 0.4 | GO:0033149 | FFAT motif binding(GO:0033149) |
0.1 | 0.6 | GO:0050347 | trans-hexaprenyltranstransferase activity(GO:0000010) trans-octaprenyltranstransferase activity(GO:0050347) |
0.1 | 4.2 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.4 | GO:0004510 | tryptophan 5-monooxygenase activity(GO:0004510) |
0.1 | 1.7 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.1 | 1.9 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 1.9 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.1 | 0.6 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.1 | 0.4 | GO:0016900 | oxidoreductase activity, acting on the CH-OH group of donors, disulfide as acceptor(GO:0016900) vitamin-K-epoxide reductase (warfarin-sensitive) activity(GO:0047057) |
0.1 | 4.4 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.1 | 0.4 | GO:0086059 | voltage-gated calcium channel activity involved SA node cell action potential(GO:0086059) |
0.1 | 0.5 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) starch binding(GO:2001070) |
0.1 | 1.5 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 2.4 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.1 | 0.4 | GO:0032190 | acrosin binding(GO:0032190) |
0.1 | 1.2 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 0.9 | GO:0086089 | voltage-gated potassium channel activity involved in atrial cardiac muscle cell action potential repolarization(GO:0086089) |
0.1 | 2.9 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
0.1 | 0.8 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.1 | 1.7 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 1.7 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 0.4 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.1 | 1.2 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.1 | 0.5 | GO:0033797 | selenate reductase activity(GO:0033797) |
0.1 | 0.5 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.7 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 6.1 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.1 | 15.9 | GO:0015108 | chloride transmembrane transporter activity(GO:0015108) |
0.1 | 0.5 | GO:1904315 | transmitter-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1904315) |
0.1 | 2.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 1.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 1.1 | GO:0005314 | high-affinity glutamate transmembrane transporter activity(GO:0005314) |
0.1 | 0.4 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.1 | 1.6 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.1 | 2.6 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 2.2 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.1 | 0.3 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.1 | 0.8 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 1.6 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.7 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.1 | 0.5 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.1 | 0.4 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.1 | 0.3 | GO:0070540 | stearic acid binding(GO:0070540) |
0.1 | 6.9 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.1 | 7.5 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.4 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) protein histidine kinase activity(GO:0004673) |
0.1 | 1.0 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 2.9 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.1 | 1.1 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.1 | 0.4 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
0.1 | 1.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.1 | 2.3 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.1 | 1.5 | GO:0015929 | hexosaminidase activity(GO:0015929) |
0.1 | 0.5 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 2.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 2.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.8 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.1 | 0.4 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 0.8 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 1.3 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.3 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.1 | 0.7 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.1 | 1.3 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.1 | 0.2 | GO:0004958 | prostaglandin F receptor activity(GO:0004958) |
0.1 | 0.5 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
0.1 | 0.3 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.9 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
0.1 | 0.3 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
0.1 | 1.5 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.1 | 0.6 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.5 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.1 | 0.2 | GO:0019107 | glycylpeptide N-tetradecanoyltransferase activity(GO:0004379) myristoyltransferase activity(GO:0019107) |
0.1 | 0.3 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.1 | 0.2 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
0.1 | 0.2 | GO:0047936 | glucose 1-dehydrogenase [NAD(P)] activity(GO:0047936) |
0.1 | 0.5 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 2.3 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 1.5 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.1 | 1.8 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.1 | 0.8 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.1 | 0.2 | GO:0030298 | receptor signaling protein tyrosine kinase activator activity(GO:0030298) |
0.1 | 1.5 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.1 | 1.0 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.1 | 0.6 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.1 | 0.4 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
0.1 | 4.4 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.1 | 0.3 | GO:0043682 | copper-exporting ATPase activity(GO:0004008) copper-transporting ATPase activity(GO:0043682) |
0.1 | 0.5 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
0.1 | 0.5 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.1 | 0.7 | GO:0008494 | translation activator activity(GO:0008494) |
0.1 | 0.3 | GO:0050436 | microfibril binding(GO:0050436) |
0.1 | 0.7 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 1.0 | GO:0019841 | retinol binding(GO:0019841) |
0.1 | 0.5 | GO:1903763 | gap junction channel activity involved in cell communication by electrical coupling(GO:1903763) |
0.1 | 1.7 | GO:0030552 | cAMP binding(GO:0030552) |
0.1 | 3.7 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.1 | 0.5 | GO:0008428 | ribonuclease inhibitor activity(GO:0008428) |
0.1 | 0.4 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.1 | 1.2 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
0.1 | 0.8 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.1 | 0.2 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.1 | 0.4 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.1 | 0.8 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.1 | 1.0 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 4.6 | GO:0005507 | copper ion binding(GO:0005507) |
0.1 | 5.1 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
0.1 | 3.5 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
0.1 | 0.2 | GO:0043532 | angiostatin binding(GO:0043532) |
0.1 | 0.3 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.6 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.1 | 1.4 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 0.5 | GO:0031014 | troponin T binding(GO:0031014) |
0.1 | 0.4 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.1 | 0.4 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.1 | 6.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.1 | 2.7 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.1 | 0.2 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
0.1 | 1.1 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 0.3 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.1 | 1.6 | GO:0008483 | transaminase activity(GO:0008483) |
0.1 | 0.1 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.1 | 0.6 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.7 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.8 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.0 | 0.3 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.0 | 0.9 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.0 | 1.5 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
0.0 | 0.5 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.4 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.0 | 3.6 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
0.0 | 1.9 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.3 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.0 | 0.8 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 0.3 | GO:0042285 | xylosyltransferase activity(GO:0042285) |
0.0 | 1.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.3 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.2 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
0.0 | 0.5 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.8 | GO:0005537 | mannose binding(GO:0005537) |
0.0 | 0.1 | GO:0042936 | dipeptide transporter activity(GO:0042936) |
0.0 | 1.5 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.8 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.7 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.6 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.2 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.0 | 0.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.7 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.0 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.8 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.9 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 1.0 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 0.7 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.9 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.7 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 1.2 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
0.0 | 2.7 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 1.3 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 1.2 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.6 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 1.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 2.3 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.0 | 0.2 | GO:0051734 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
0.0 | 2.7 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.0 | 1.0 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.5 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.8 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.0 | 0.8 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 1.0 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.2 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.0 | 0.2 | GO:0043855 | cyclic nucleotide-gated ion channel activity(GO:0043855) |
0.0 | 1.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.6 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 3.2 | GO:0005249 | voltage-gated potassium channel activity(GO:0005249) |
0.0 | 0.3 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.0 | 0.4 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.9 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.3 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.7 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 1.5 | GO:0016706 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, 2-oxoglutarate as one donor, and incorporation of one atom each of oxygen into both donors(GO:0016706) |
0.0 | 0.4 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.0 | 0.2 | GO:0030548 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
0.0 | 0.5 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.0 | 0.9 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.0 | 0.2 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 1.8 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.5 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.6 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.0 | 0.5 | GO:0022829 | wide pore channel activity(GO:0022829) |
0.0 | 0.3 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.6 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.9 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.3 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.2 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.0 | 1.1 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 0.4 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
0.0 | 0.3 | GO:0030546 | receptor activator activity(GO:0030546) |
0.0 | 0.6 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.0 | 0.1 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
0.0 | 1.5 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.0 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.4 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.3 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.2 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.2 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.2 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.3 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.4 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
0.0 | 0.9 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.9 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 4.8 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.0 | 0.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.2 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.5 | GO:0015149 | glucose transmembrane transporter activity(GO:0005355) hexose transmembrane transporter activity(GO:0015149) |
0.0 | 0.1 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.9 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 13.4 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
0.0 | 0.1 | GO:0004905 | interferon receptor activity(GO:0004904) type I interferon receptor activity(GO:0004905) type I interferon binding(GO:0019962) |
0.0 | 0.1 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.1 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.0 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.0 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.9 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.0 | 0.6 | GO:0016814 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amidines(GO:0016814) |
0.0 | 0.3 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.1 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.0 | 0.3 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.1 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 1.1 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
0.0 | 0.5 | GO:0016620 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, NAD or NADP as acceptor(GO:0016620) |
0.0 | 1.4 | GO:0047485 | protein N-terminus binding(GO:0047485) |
0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.2 | GO:0017160 | Ral GTPase binding(GO:0017160) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.6 | 1.6 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.3 | 5.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.2 | 1.4 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.2 | 2.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 1.4 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 3.0 | PID ARF 3PATHWAY | Arf1 pathway |
0.1 | 2.9 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 4.4 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.1 | 0.5 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 1.5 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 7.0 | PID NOTCH PATHWAY | Notch signaling pathway |
0.1 | 7.6 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.1 | 2.0 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.1 | 4.1 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.1 | 2.5 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.1 | 2.3 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.1 | 1.4 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 2.0 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.1 | 4.5 | PID FOXO PATHWAY | FoxO family signaling |
0.1 | 2.2 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 2.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 4.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 1.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 5.5 | PID P73PATHWAY | p73 transcription factor network |
0.1 | 0.1 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.1 | 0.4 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.1 | 1.9 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.1 | 0.7 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.1 | 0.7 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 3.3 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 1.1 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.8 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.2 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 2.4 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.7 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.0 | 10.4 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 1.0 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.4 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.4 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 2.1 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.6 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 2.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.7 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.3 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.0 | 0.5 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 0.4 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.5 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 0.4 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.4 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.7 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.2 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.3 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 1.1 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.3 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 1.0 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.6 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.7 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.0 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 4.7 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.8 | 9.2 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.7 | 16.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.6 | 1.8 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.4 | 13.9 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.4 | 5.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.3 | 6.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.3 | 5.8 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.3 | 1.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.3 | 3.8 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.3 | 12.5 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.3 | 3.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.2 | 3.8 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.2 | 1.3 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
0.2 | 4.2 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.2 | 4.0 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.2 | 4.9 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.2 | 5.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.2 | 5.8 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.2 | 0.7 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.2 | 2.4 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.2 | 1.7 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.1 | 1.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.1 | 3.3 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.1 | 0.3 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
0.1 | 13.9 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 2.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.1 | 2.8 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 2.5 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.1 | 2.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 2.7 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.1 | 1.8 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.1 | 5.5 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.1 | 2.2 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 2.9 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 1.5 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 2.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.1 | 1.4 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 1.4 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.1 | 1.7 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.1 | 2.6 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.1 | 2.8 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.1 | 4.6 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 6.4 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 6.2 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.1 | 2.7 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 0.8 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 0.8 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 4.9 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 0.9 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 4.5 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.1 | 2.8 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.1 | 1.8 | REACTOME UNFOLDED PROTEIN RESPONSE | Genes involved in Unfolded Protein Response |
0.1 | 2.1 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 1.5 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.1 | 8.5 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.1 | 1.1 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.1 | 0.7 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.1 | 1.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 0.4 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 3.4 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.1 | 8.2 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.9 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
0.0 | 0.5 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 2.5 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.8 | REACTOME SIGNALING BY FGFR MUTANTS | Genes involved in Signaling by FGFR mutants |
0.0 | 0.7 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 2.0 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.0 | 2.0 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.7 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 1.5 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 1.0 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.0 | 1.6 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 1.4 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.3 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.4 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.6 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 1.1 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 0.3 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.4 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.0 | 0.5 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.0 | 0.5 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.0 | 0.9 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.0 | 0.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.6 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.0 | 0.6 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.0 | 0.7 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.6 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 1.4 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 5.5 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.5 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.1 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 0.3 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 1.1 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 0.2 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.2 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.3 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.0 | 0.1 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
0.0 | 0.2 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.0 | 0.7 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.6 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.1 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |