GSE58827: Dynamics of the Mouse Liver
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Wrnip1
|
ENSMUSG00000021400.9 | Werner helicase interacting protein 1 |
Mta3
|
ENSMUSG00000055817.19 | metastasis associated 3 |
Rcor1
|
ENSMUSG00000037896.18 | REST corepressor 1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Rcor1 | mm39_v1_chr12_+_111005768_111005834 | -0.59 | 1.5e-04 | Click! |
Wrnip1 | mm39_v1_chr13_+_32985990_32986135 | -0.36 | 3.3e-02 | Click! |
Mta3 | mm39_v1_chr17_+_84013575_84013634 | -0.00 | 9.9e-01 | Click! |
Promoter | Log-likelihood | Transcript | Gene | Gene Info |
---|---|---|---|---|
chr7_-_44983080 | 7.09 |
ENSMUST00000211743.2
ENSMUST00000042194.10 |
Trpm4
|
transient receptor potential cation channel, subfamily M, member 4 |
chr4_-_137157824 | 6.75 |
ENSMUST00000102522.5
|
Cela3b
|
chymotrypsin-like elastase family, member 3B |
chr1_-_119349969 | 6.53 |
ENSMUST00000038765.6
|
Inhbb
|
inhibin beta-B |
chr13_-_63036096 | 6.50 |
ENSMUST00000092888.11
|
Fbp1
|
fructose bisphosphatase 1 |
chr11_+_69945157 | 6.21 |
ENSMUST00000108585.9
ENSMUST00000018699.13 |
Asgr1
|
asialoglycoprotein receptor 1 |
chr7_+_140343652 | 6.17 |
ENSMUST00000026552.9
ENSMUST00000209253.2 ENSMUST00000210235.2 |
Cyp2e1
|
cytochrome P450, family 2, subfamily e, polypeptide 1 |
chr17_-_84990360 | 5.96 |
ENSMUST00000066175.10
|
Abcg5
|
ATP binding cassette subfamily G member 5 |
chr1_-_171023798 | 5.91 |
ENSMUST00000111332.2
|
Pcp4l1
|
Purkinje cell protein 4-like 1 |
chr8_-_112417633 | 5.73 |
ENSMUST00000034435.7
|
Ctrb1
|
chymotrypsinogen B1 |
chr1_+_171246593 | 5.63 |
ENSMUST00000171362.2
|
Tstd1
|
thiosulfate sulfurtransferase (rhodanese)-like domain containing 1 |
chr1_+_72863641 | 5.49 |
ENSMUST00000047328.11
|
Igfbp2
|
insulin-like growth factor binding protein 2 |
chr15_+_89218601 | 5.46 |
ENSMUST00000023282.9
|
Miox
|
myo-inositol oxygenase |
chr8_-_4155758 | 4.95 |
ENSMUST00000138439.2
ENSMUST00000145007.8 |
Cd209f
|
CD209f antigen |
chr14_-_30645503 | 4.78 |
ENSMUST00000227995.2
|
Itih3
|
inter-alpha trypsin inhibitor, heavy chain 3 |
chr14_-_30645711 | 4.55 |
ENSMUST00000006697.17
|
Itih3
|
inter-alpha trypsin inhibitor, heavy chain 3 |
chr3_+_10077608 | 4.44 |
ENSMUST00000029046.9
|
Fabp5
|
fatty acid binding protein 5, epidermal |
chr6_+_41498716 | 4.41 |
ENSMUST00000070380.5
|
Prss2
|
protease, serine 2 |
chr5_-_122187884 | 4.39 |
ENSMUST00000111752.10
|
Cux2
|
cut-like homeobox 2 |
chr6_-_48549594 | 4.30 |
ENSMUST00000009425.7
ENSMUST00000204267.3 ENSMUST00000204930.3 ENSMUST00000204182.2 |
Rarres2
|
retinoic acid receptor responder (tazarotene induced) 2 |
chr11_+_7147779 | 4.25 |
ENSMUST00000020704.8
|
Igfbp1
|
insulin-like growth factor binding protein 1 |
chr6_+_41279199 | 4.25 |
ENSMUST00000031913.5
|
Try4
|
trypsin 4 |
chr7_-_142211203 | 4.21 |
ENSMUST00000097936.9
ENSMUST00000000033.12 |
Igf2
|
insulin-like growth factor 2 |
chr4_+_41569775 | 4.21 |
ENSMUST00000102963.10
|
Dnai1
|
dynein axonemal intermediate chain 1 |
chr7_-_26638802 | 4.18 |
ENSMUST00000170227.3
|
Cyp2a22
|
cytochrome P450, family 2, subfamily a, polypeptide 22 |
chr4_+_138181616 | 4.15 |
ENSMUST00000050918.4
|
Camk2n1
|
calcium/calmodulin-dependent protein kinase II inhibitor 1 |
chr7_+_25872836 | 4.04 |
ENSMUST00000082214.5
|
Cyp2b9
|
cytochrome P450, family 2, subfamily b, polypeptide 9 |
chr11_-_101998648 | 4.00 |
ENSMUST00000177304.8
ENSMUST00000017455.15 |
Pyy
|
peptide YY |
chr1_-_71692320 | 3.94 |
ENSMUST00000186940.7
ENSMUST00000188894.7 ENSMUST00000188674.7 ENSMUST00000189821.7 ENSMUST00000187938.7 ENSMUST00000190780.7 ENSMUST00000186736.2 ENSMUST00000055226.13 ENSMUST00000186129.7 |
Fn1
|
fibronectin 1 |
chr2_-_28453374 | 3.91 |
ENSMUST00000028161.6
|
Cel
|
carboxyl ester lipase |
chr1_-_172722589 | 3.86 |
ENSMUST00000027824.7
|
Apcs
|
serum amyloid P-component |
chr9_+_46151994 | 3.83 |
ENSMUST00000034585.7
|
Apoa4
|
apolipoprotein A-IV |
chr16_+_93404719 | 3.83 |
ENSMUST00000039659.9
ENSMUST00000231762.2 |
Cbr1
|
carbonyl reductase 1 |
chr9_+_46179899 | 3.80 |
ENSMUST00000121598.8
|
Apoa5
|
apolipoprotein A-V |
chr19_+_58717319 | 3.80 |
ENSMUST00000048644.6
ENSMUST00000236445.2 |
Pnliprp1
|
pancreatic lipase related protein 1 |
chr1_+_153616090 | 3.74 |
ENSMUST00000027748.8
|
Rgs16
|
regulator of G-protein signaling 16 |
chr11_-_83421333 | 3.72 |
ENSMUST00000035938.3
|
Ccl5
|
chemokine (C-C motif) ligand 5 |
chr10_-_127190280 | 3.62 |
ENSMUST00000059718.6
|
Inhbe
|
inhibin beta-E |
chr7_-_142233270 | 3.57 |
ENSMUST00000162317.2
ENSMUST00000125933.2 ENSMUST00000105931.8 ENSMUST00000105930.8 ENSMUST00000105933.8 ENSMUST00000105932.2 ENSMUST00000000220.3 |
Ins2
|
insulin II |
chr17_+_84990541 | 3.55 |
ENSMUST00000045714.15
ENSMUST00000171915.2 |
Abcg8
|
ATP binding cassette subfamily G member 8 |
chr6_+_41369290 | 3.53 |
ENSMUST00000049079.9
|
Gm5771
|
predicted gene 5771 |
chr15_-_74635423 | 3.51 |
ENSMUST00000040404.8
|
Ly6d
|
lymphocyte antigen 6 complex, locus D |
chr19_+_10819896 | 3.50 |
ENSMUST00000025646.3
|
Slc15a3
|
solute carrier family 15, member 3 |
chr1_-_134163102 | 3.47 |
ENSMUST00000187631.2
ENSMUST00000038191.8 ENSMUST00000086465.6 |
Adora1
|
adenosine A1 receptor |
chr6_+_41435846 | 3.47 |
ENSMUST00000031910.8
|
Prss1
|
protease, serine 1 (trypsin 1) |
chr8_-_46664321 | 3.47 |
ENSMUST00000034049.5
|
Slc25a4
|
solute carrier family 25 (mitochondrial carrier, adenine nucleotide translocator), member 4 |
chr10_+_128744689 | 3.42 |
ENSMUST00000105229.9
|
Cd63
|
CD63 antigen |
chr9_+_46180362 | 3.42 |
ENSMUST00000214202.2
ENSMUST00000215458.2 ENSMUST00000215187.2 ENSMUST00000213878.2 ENSMUST00000034584.4 |
Apoa5
|
apolipoprotein A-V |
chr3_-_107145968 | 3.41 |
ENSMUST00000197758.5
|
Prok1
|
prokineticin 1 |
chr9_+_110848339 | 3.41 |
ENSMUST00000198884.5
ENSMUST00000196777.5 ENSMUST00000196209.5 ENSMUST00000035077.8 ENSMUST00000196122.3 |
Ltf
|
lactotransferrin |
chr6_-_55152002 | 3.35 |
ENSMUST00000003569.6
|
Inmt
|
indolethylamine N-methyltransferase |
chr6_+_34389269 | 3.35 |
ENSMUST00000007449.9
|
Akr1b7
|
aldo-keto reductase family 1, member B7 |
chr11_+_101137231 | 3.33 |
ENSMUST00000122006.8
ENSMUST00000151830.2 |
Ramp2
|
receptor (calcitonin) activity modifying protein 2 |
chr13_-_4200627 | 3.33 |
ENSMUST00000110704.9
ENSMUST00000021635.9 |
Akr1c18
|
aldo-keto reductase family 1, member C18 |
chr7_-_142223662 | 3.33 |
ENSMUST00000228850.2
|
Gm49394
|
predicted gene, 49394 |
chr7_-_24459736 | 3.32 |
ENSMUST00000063956.7
|
Cd177
|
CD177 antigen |
chr7_+_13467422 | 3.31 |
ENSMUST00000086148.8
|
Sult2a2
|
sulfotransferase family 2A, dehydroepiandrosterone (DHEA)-preferring, member 2 |
chr6_+_30639217 | 3.30 |
ENSMUST00000031806.10
|
Cpa1
|
carboxypeptidase A1, pancreatic |
chr2_+_164404499 | 3.29 |
ENSMUST00000017867.10
ENSMUST00000109344.9 ENSMUST00000109345.9 |
Wfdc2
|
WAP four-disulfide core domain 2 |
chr10_-_95251327 | 3.26 |
ENSMUST00000172070.8
ENSMUST00000150432.8 |
Socs2
|
suppressor of cytokine signaling 2 |
chr3_-_90603013 | 3.26 |
ENSMUST00000069960.12
ENSMUST00000117167.2 |
S100a9
|
S100 calcium binding protein A9 (calgranulin B) |
chr14_-_30637344 | 3.24 |
ENSMUST00000226547.2
|
Itih3
|
inter-alpha trypsin inhibitor, heavy chain 3 |
chr14_+_51328534 | 3.23 |
ENSMUST00000022428.13
ENSMUST00000171688.9 |
Rnase4
Ang
|
ribonuclease, RNase A family 4 angiogenin, ribonuclease, RNase A family, 5 |
chr16_+_22710134 | 3.21 |
ENSMUST00000231328.2
|
Ahsg
|
alpha-2-HS-glycoprotein |
chr9_-_103107495 | 3.20 |
ENSMUST00000035158.16
|
Trf
|
transferrin |
chr11_+_78237492 | 3.18 |
ENSMUST00000100755.4
|
Unc119
|
unc-119 lipid binding chaperone |
chr7_-_19426529 | 3.17 |
ENSMUST00000207978.2
ENSMUST00000108451.4 ENSMUST00000045035.12 |
Apoc1
|
apolipoprotein C-I |
chr2_+_129434738 | 3.16 |
ENSMUST00000153491.8
ENSMUST00000161620.8 ENSMUST00000179001.8 |
Sirpa
|
signal-regulatory protein alpha |
chr7_+_45354512 | 3.10 |
ENSMUST00000080885.12
ENSMUST00000211513.2 ENSMUST00000211357.2 |
Dbp
|
D site albumin promoter binding protein |
chr11_+_115353290 | 3.09 |
ENSMUST00000106532.4
ENSMUST00000092445.12 ENSMUST00000153466.2 |
Slc16a5
|
solute carrier family 16 (monocarboxylic acid transporters), member 5 |
chr17_+_32755525 | 3.04 |
ENSMUST00000169591.8
ENSMUST00000003416.15 |
Cyp4f16
|
cytochrome P450, family 4, subfamily f, polypeptide 16 |
chr19_+_4560500 | 3.04 |
ENSMUST00000068004.13
ENSMUST00000224726.3 |
Pcx
|
pyruvate carboxylase |
chr16_+_22710785 | 3.03 |
ENSMUST00000023583.7
ENSMUST00000232098.2 |
Ahsg
|
alpha-2-HS-glycoprotein |
chr14_+_40826970 | 3.03 |
ENSMUST00000225720.2
|
Mat1a
|
methionine adenosyltransferase I, alpha |
chr4_-_57916283 | 3.00 |
ENSMUST00000063816.6
|
D630039A03Rik
|
RIKEN cDNA D630039A03 gene |
chr7_+_46700349 | 2.99 |
ENSMUST00000010451.8
|
Tmem86a
|
transmembrane protein 86A |
chr6_+_70703409 | 2.99 |
ENSMUST00000103410.3
|
Igkc
|
immunoglobulin kappa constant |
chr2_-_165242307 | 2.97 |
ENSMUST00000029213.5
|
Ocstamp
|
osteoclast stimulatory transmembrane protein |
chr10_-_128755127 | 2.96 |
ENSMUST00000149961.2
ENSMUST00000026406.14 |
Rdh5
|
retinol dehydrogenase 5 |
chr11_+_78079243 | 2.95 |
ENSMUST00000002128.14
ENSMUST00000150941.8 |
Rab34
|
RAB34, member RAS oncogene family |
chr1_-_155688551 | 2.95 |
ENSMUST00000194632.2
ENSMUST00000111764.8 |
Qsox1
|
quiescin Q6 sulfhydryl oxidase 1 |
chr11_+_94827050 | 2.94 |
ENSMUST00000001547.8
|
Col1a1
|
collagen, type I, alpha 1 |
chr18_+_9212154 | 2.94 |
ENSMUST00000041080.7
|
Fzd8
|
frizzled class receptor 8 |
chr8_+_110717062 | 2.93 |
ENSMUST00000001720.14
ENSMUST00000143741.2 |
Tat
|
tyrosine aminotransferase |
chr11_+_100306523 | 2.92 |
ENSMUST00000001595.10
ENSMUST00000107400.3 |
Fkbp10
|
FK506 binding protein 10 |
chr6_-_41291634 | 2.92 |
ENSMUST00000064324.12
|
Try5
|
trypsin 5 |
chr11_+_78234300 | 2.92 |
ENSMUST00000002127.14
ENSMUST00000108295.8 |
Unc119
|
unc-119 lipid binding chaperone |
chr1_+_85822250 | 2.90 |
ENSMUST00000185569.2
|
Itm2c
|
integral membrane protein 2C |
chr1_+_171041583 | 2.89 |
ENSMUST00000111328.8
|
Nr1i3
|
nuclear receptor subfamily 1, group I, member 3 |
chr19_-_10582773 | 2.89 |
ENSMUST00000237788.2
|
Tkfc
|
triokinase, FMN cyclase |
chr1_+_88139678 | 2.87 |
ENSMUST00000073049.7
|
Ugt1a1
|
UDP glucuronosyltransferase 1 family, polypeptide A1 |
chr7_-_140590605 | 2.84 |
ENSMUST00000026565.7
|
Ifitm3
|
interferon induced transmembrane protein 3 |
chr19_-_10582672 | 2.82 |
ENSMUST00000236478.2
ENSMUST00000236950.2 |
Tkfc
|
triokinase, FMN cyclase |
chr9_+_62765362 | 2.81 |
ENSMUST00000213643.2
ENSMUST00000034777.14 ENSMUST00000163820.3 ENSMUST00000215870.2 ENSMUST00000214633.2 ENSMUST00000215968.2 |
Calml4
|
calmodulin-like 4 |
chr17_+_8502594 | 2.81 |
ENSMUST00000155364.8
ENSMUST00000046754.15 |
Mpc1
|
mitochondrial pyruvate carrier 1 |
chr13_+_13612136 | 2.81 |
ENSMUST00000005532.9
|
Nid1
|
nidogen 1 |
chr10_-_95252712 | 2.80 |
ENSMUST00000020215.16
|
Socs2
|
suppressor of cytokine signaling 2 |
chr3_-_121325887 | 2.80 |
ENSMUST00000039197.9
|
Slc44a3
|
solute carrier family 44, member 3 |
chr3_-_132655804 | 2.78 |
ENSMUST00000117164.8
ENSMUST00000093971.5 ENSMUST00000042729.16 |
Npnt
|
nephronectin |
chr8_-_106198112 | 2.77 |
ENSMUST00000014990.13
|
Tppp3
|
tubulin polymerization-promoting protein family member 3 |
chr14_+_40827108 | 2.76 |
ENSMUST00000224514.2
|
Mat1a
|
methionine adenosyltransferase I, alpha |
chr9_-_71070506 | 2.76 |
ENSMUST00000074465.9
|
Aqp9
|
aquaporin 9 |
chr8_-_106670014 | 2.76 |
ENSMUST00000038896.8
|
Lcat
|
lecithin cholesterol acyltransferase |
chrX_-_8011952 | 2.75 |
ENSMUST00000115615.9
ENSMUST00000115616.8 ENSMUST00000115621.9 |
Rbm3
|
RNA binding motif (RNP1, RRM) protein 3 |
chr17_+_36177498 | 2.75 |
ENSMUST00000187690.7
ENSMUST00000113814.11 |
Ppp1r18
|
protein phosphatase 1, regulatory subunit 18 |
chr9_+_110248815 | 2.75 |
ENSMUST00000035061.9
|
Ngp
|
neutrophilic granule protein |
chr14_-_52150804 | 2.74 |
ENSMUST00000004673.15
ENSMUST00000111632.5 |
Ndrg2
|
N-myc downstream regulated gene 2 |
chr1_+_171041539 | 2.71 |
ENSMUST00000005820.11
ENSMUST00000075469.12 ENSMUST00000155126.8 |
Nr1i3
|
nuclear receptor subfamily 1, group I, member 3 |
chr11_-_70350783 | 2.71 |
ENSMUST00000019064.9
|
Cxcl16
|
chemokine (C-X-C motif) ligand 16 |
chr11_-_102360664 | 2.71 |
ENSMUST00000103086.4
|
Itga2b
|
integrin alpha 2b |
chr4_+_140737955 | 2.69 |
ENSMUST00000071977.9
|
Mfap2
|
microfibrillar-associated protein 2 |
chr6_+_121320008 | 2.68 |
ENSMUST00000166457.8
|
Slc6a12
|
solute carrier family 6 (neurotransmitter transporter, betaine/GABA), member 12 |
chr2_-_25511936 | 2.66 |
ENSMUST00000028308.11
ENSMUST00000142087.2 |
Tmem141
|
transmembrane protein 141 |
chr9_-_58220469 | 2.65 |
ENSMUST00000061799.10
|
Loxl1
|
lysyl oxidase-like 1 |
chr9_-_103105638 | 2.64 |
ENSMUST00000126359.2
|
Trf
|
transferrin |
chr16_+_44913974 | 2.63 |
ENSMUST00000099498.10
|
Ccdc80
|
coiled-coil domain containing 80 |
chr9_-_103107460 | 2.62 |
ENSMUST00000165296.8
ENSMUST00000112645.8 |
Trf
|
transferrin |
chr6_+_41331039 | 2.61 |
ENSMUST00000072103.7
|
Try10
|
trypsin 10 |
chr4_+_49059255 | 2.61 |
ENSMUST00000076670.3
|
Plppr1
|
phospholipid phosphatase related 1 |
chr14_-_31362835 | 2.59 |
ENSMUST00000167066.8
ENSMUST00000127204.9 |
Hacl1
|
2-hydroxyacyl-CoA lyase 1 |
chr3_+_90511068 | 2.58 |
ENSMUST00000001046.7
|
S100a4
|
S100 calcium binding protein A4 |
chr11_-_107607343 | 2.56 |
ENSMUST00000021065.6
|
Cacng1
|
calcium channel, voltage-dependent, gamma subunit 1 |
chr4_+_115375461 | 2.56 |
ENSMUST00000058785.10
ENSMUST00000094886.4 |
Cyp4a10
|
cytochrome P450, family 4, subfamily a, polypeptide 10 |
chr1_+_171265103 | 2.56 |
ENSMUST00000043839.5
|
F11r
|
F11 receptor |
chr7_-_44465998 | 2.56 |
ENSMUST00000209072.2
ENSMUST00000047356.11 |
Atf5
|
activating transcription factor 5 |
chr1_+_133291302 | 2.55 |
ENSMUST00000135222.9
|
Etnk2
|
ethanolamine kinase 2 |
chr15_-_91075933 | 2.55 |
ENSMUST00000069511.8
|
Abcd2
|
ATP-binding cassette, sub-family D (ALD), member 2 |
chr4_-_133695204 | 2.55 |
ENSMUST00000100472.10
ENSMUST00000136327.2 |
Hmgn2
|
high mobility group nucleosomal binding domain 2 |
chr10_+_122284404 | 2.54 |
ENSMUST00000020323.7
|
Avpr1a
|
arginine vasopressin receptor 1A |
chr5_+_30360246 | 2.53 |
ENSMUST00000026841.15
ENSMUST00000123980.8 ENSMUST00000114783.6 ENSMUST00000114786.8 |
Hadhb
|
hydroxyacyl-CoA dehydrogenase trifunctional multienzyme complex subunit beta |
chrX_-_8011918 | 2.53 |
ENSMUST00000115619.8
ENSMUST00000115617.10 ENSMUST00000040010.10 |
Rbm3
|
RNA binding motif (RNP1, RRM) protein 3 |
chr14_+_40827317 | 2.52 |
ENSMUST00000047286.7
|
Mat1a
|
methionine adenosyltransferase I, alpha |
chr6_+_4505493 | 2.52 |
ENSMUST00000031668.10
|
Col1a2
|
collagen, type I, alpha 2 |
chr5_+_90638580 | 2.52 |
ENSMUST00000042755.7
ENSMUST00000200693.2 |
Afp
|
alpha fetoprotein |
chr2_+_129435115 | 2.51 |
ENSMUST00000099113.10
ENSMUST00000103202.10 |
Sirpa
|
signal-regulatory protein alpha |
chr3_-_132655954 | 2.49 |
ENSMUST00000042744.16
ENSMUST00000117811.8 |
Npnt
|
nephronectin |
chr8_+_4184652 | 2.49 |
ENSMUST00000130372.3
|
Cd209g
|
CD209g antigen |
chr14_-_70757601 | 2.49 |
ENSMUST00000022693.9
|
Bmp1
|
bone morphogenetic protein 1 |
chr14_-_51384236 | 2.48 |
ENSMUST00000080126.4
|
Rnase1
|
ribonuclease, RNase A family, 1 (pancreatic) |
chr10_+_128104525 | 2.48 |
ENSMUST00000050901.5
|
Apof
|
apolipoprotein F |
chr9_-_118986123 | 2.48 |
ENSMUST00000010795.5
|
Acaa1b
|
acetyl-Coenzyme A acyltransferase 1B |
chr11_-_115903504 | 2.47 |
ENSMUST00000021114.5
|
Galk1
|
galactokinase 1 |
chr4_-_133695264 | 2.47 |
ENSMUST00000102553.11
|
Hmgn2
|
high mobility group nucleosomal binding domain 2 |
chr10_+_120869865 | 2.47 |
ENSMUST00000020439.11
ENSMUST00000175867.2 |
Wif1
|
Wnt inhibitory factor 1 |
chr11_+_78079562 | 2.46 |
ENSMUST00000108322.9
|
Rab34
|
RAB34, member RAS oncogene family |
chr19_-_10581622 | 2.46 |
ENSMUST00000037678.7
|
Tkfc
|
triokinase, FMN cyclase |
chr13_+_97377604 | 2.45 |
ENSMUST00000041623.9
|
Enc1
|
ectodermal-neural cortex 1 |
chr2_+_155223728 | 2.45 |
ENSMUST00000043237.14
ENSMUST00000174685.8 |
Trp53inp2
|
transformation related protein 53 inducible nuclear protein 2 |
chr7_+_25760922 | 2.45 |
ENSMUST00000005669.9
|
Cyp2b13
|
cytochrome P450, family 2, subfamily b, polypeptide 13 |
chr3_+_90576285 | 2.44 |
ENSMUST00000069927.10
|
S100a8
|
S100 calcium binding protein A8 (calgranulin A) |
chr9_-_110572721 | 2.44 |
ENSMUST00000166716.8
|
Pth1r
|
parathyroid hormone 1 receptor |
chr7_-_126303351 | 2.44 |
ENSMUST00000106364.8
|
Coro1a
|
coronin, actin binding protein 1A |
chr18_-_75830595 | 2.43 |
ENSMUST00000165559.3
|
Ctif
|
CBP80/20-dependent translation initiation factor |
chr10_-_95251145 | 2.43 |
ENSMUST00000119917.2
|
Socs2
|
suppressor of cytokine signaling 2 |
chr17_-_23896394 | 2.42 |
ENSMUST00000233428.2
ENSMUST00000233814.2 ENSMUST00000167059.9 ENSMUST00000024698.10 |
Tnfrsf12a
|
tumor necrosis factor receptor superfamily, member 12a |
chr4_-_118294521 | 2.42 |
ENSMUST00000006565.13
|
Cdc20
|
cell division cycle 20 |
chr7_+_127311881 | 2.42 |
ENSMUST00000047393.7
|
Ctf1
|
cardiotrophin 1 |
chrX_+_138701544 | 2.42 |
ENSMUST00000054889.4
|
Cldn2
|
claudin 2 |
chr14_-_31362909 | 2.41 |
ENSMUST00000022437.16
|
Hacl1
|
2-hydroxyacyl-CoA lyase 1 |
chr10_-_80492315 | 2.40 |
ENSMUST00000126980.8
|
Btbd2
|
BTB (POZ) domain containing 2 |
chr12_+_112073113 | 2.40 |
ENSMUST00000079400.6
|
Aspg
|
asparaginase |
chr3_+_94280101 | 2.39 |
ENSMUST00000029795.10
|
Rorc
|
RAR-related orphan receptor gamma |
chr11_+_78403019 | 2.39 |
ENSMUST00000001127.11
|
Poldip2
|
polymerase (DNA-directed), delta interacting protein 2 |
chr7_+_44865177 | 2.38 |
ENSMUST00000033060.14
ENSMUST00000210447.2 ENSMUST00000211744.2 ENSMUST00000107801.10 |
Tead2
|
TEA domain family member 2 |
chr4_+_141095415 | 2.38 |
ENSMUST00000006380.5
|
Fam131c
|
family with sequence similarity 131, member C |
chr10_+_127612243 | 2.38 |
ENSMUST00000136223.2
ENSMUST00000052652.7 |
Rdh9
|
retinol dehydrogenase 9 |
chr5_-_134776101 | 2.37 |
ENSMUST00000015138.13
|
Eln
|
elastin |
chr9_+_43954681 | 2.37 |
ENSMUST00000114840.2
|
Thy1
|
thymus cell antigen 1, theta |
chr11_+_119833589 | 2.37 |
ENSMUST00000106231.8
ENSMUST00000075180.12 ENSMUST00000103021.10 ENSMUST00000026436.10 ENSMUST00000106233.2 |
Baiap2
|
brain-specific angiogenesis inhibitor 1-associated protein 2 |
chr9_-_65330231 | 2.36 |
ENSMUST00000065894.7
|
Slc51b
|
solute carrier family 51, beta subunit |
chr5_-_30360113 | 2.36 |
ENSMUST00000156859.3
|
Hadha
|
hydroxyacyl-CoA dehydrogenase trifunctional multienzyme complex subunit alpha |
chr3_+_90520408 | 2.36 |
ENSMUST00000198128.2
|
S100a6
|
S100 calcium binding protein A6 (calcyclin) |
chr5_+_135698881 | 2.36 |
ENSMUST00000153500.8
|
Por
|
P450 (cytochrome) oxidoreductase |
chr11_+_50116145 | 2.36 |
ENSMUST00000041725.14
|
Mgat4b
|
mannoside acetylglucosaminyltransferase 4, isoenzyme B |
chr11_-_20282684 | 2.35 |
ENSMUST00000004634.7
ENSMUST00000109594.8 |
Slc1a4
|
solute carrier family 1 (glutamate/neutral amino acid transporter), member 4 |
chr12_+_104372962 | 2.35 |
ENSMUST00000021506.6
|
Serpina3n
|
serine (or cysteine) peptidase inhibitor, clade A, member 3N |
chr12_-_81014755 | 2.33 |
ENSMUST00000218342.2
|
Slc10a1
|
solute carrier family 10 (sodium/bile acid cotransporter family), member 1 |
chr5_+_118165808 | 2.33 |
ENSMUST00000031304.14
|
Tesc
|
tescalcin |
chr15_-_78413780 | 2.31 |
ENSMUST00000229185.2
|
C1qtnf6
|
C1q and tumor necrosis factor related protein 6 |
chr2_-_25255650 | 2.30 |
ENSMUST00000102925.4
|
Uap1l1
|
UDP-N-acteylglucosamine pyrophosphorylase 1-like 1 |
chr3_-_90373165 | 2.30 |
ENSMUST00000029540.13
|
Npr1
|
natriuretic peptide receptor 1 |
chr16_+_22769822 | 2.30 |
ENSMUST00000023590.9
|
Hrg
|
histidine-rich glycoprotein |
chr5_+_52521133 | 2.30 |
ENSMUST00000101208.6
|
Sod3
|
superoxide dismutase 3, extracellular |
chr11_+_101137786 | 2.29 |
ENSMUST00000107282.4
|
Ramp2
|
receptor (calcitonin) activity modifying protein 2 |
chr8_-_125296435 | 2.28 |
ENSMUST00000238882.2
ENSMUST00000063278.7 |
Agt
|
angiotensinogen (serpin peptidase inhibitor, clade A, member 8) |
chr5_-_125418107 | 2.27 |
ENSMUST00000111390.8
ENSMUST00000086075.13 |
Scarb1
|
scavenger receptor class B, member 1 |
chr14_+_70815250 | 2.27 |
ENSMUST00000228554.2
|
Nudt18
|
nudix (nucleoside diphosphate linked moiety X)-type motif 18 |
chr7_-_119801327 | 2.27 |
ENSMUST00000033198.6
|
Crym
|
crystallin, mu |
chr11_+_87685032 | 2.27 |
ENSMUST00000121303.8
|
Mpo
|
myeloperoxidase |
chr11_-_89893707 | 2.27 |
ENSMUST00000020864.9
|
Pctp
|
phosphatidylcholine transfer protein |
chr4_-_15945359 | 2.27 |
ENSMUST00000029877.9
|
Decr1
|
2,4-dienoyl CoA reductase 1, mitochondrial |
chr17_+_32904601 | 2.27 |
ENSMUST00000168171.8
|
Cyp4f15
|
cytochrome P450, family 4, subfamily f, polypeptide 15 |
chr4_+_126042250 | 2.26 |
ENSMUST00000106150.3
|
Eva1b
|
eva-1 homolog B (C. elegans) |
chr7_+_142025575 | 2.26 |
ENSMUST00000038946.9
|
Lsp1
|
lymphocyte specific 1 |
chr19_+_38121214 | 2.26 |
ENSMUST00000112329.3
|
Pde6c
|
phosphodiesterase 6C, cGMP specific, cone, alpha prime |
chr15_-_78413816 | 2.25 |
ENSMUST00000023075.9
|
C1qtnf6
|
C1q and tumor necrosis factor related protein 6 |
chr15_+_81695615 | 2.25 |
ENSMUST00000023024.8
|
Tef
|
thyrotroph embryonic factor |
chr2_+_25285878 | 2.25 |
ENSMUST00000028328.3
|
Entpd2
|
ectonucleoside triphosphate diphosphohydrolase 2 |
chr7_-_68398917 | 2.25 |
ENSMUST00000118110.3
|
Arrdc4
|
arrestin domain containing 4 |
chr15_+_32920869 | 2.25 |
ENSMUST00000022871.7
|
Sdc2
|
syndecan 2 |
chr4_+_115420876 | 2.25 |
ENSMUST00000126645.8
ENSMUST00000030480.4 |
Cyp4a31
|
cytochrome P450, family 4, subfamily a, polypeptide 31 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.8 | 8.3 | GO:0009087 | methionine catabolic process(GO:0009087) |
2.5 | 9.9 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
2.4 | 7.2 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
2.1 | 6.4 | GO:0006850 | mitochondrial pyruvate transport(GO:0006850) mitochondrial pyruvate transmembrane transport(GO:1902361) |
2.1 | 12.5 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
2.0 | 6.0 | GO:0002149 | hypochlorous acid metabolic process(GO:0002148) hypochlorous acid biosynthetic process(GO:0002149) |
1.8 | 5.5 | GO:0071395 | response to jasmonic acid(GO:0009753) cellular response to jasmonic acid stimulus(GO:0071395) |
1.7 | 6.7 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
1.6 | 3.3 | GO:0090420 | naphthalene metabolic process(GO:0018931) naphthalene-containing compound metabolic process(GO:0090420) |
1.6 | 4.8 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
1.5 | 4.6 | GO:0015920 | lipopolysaccharide transport(GO:0015920) |
1.5 | 4.6 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
1.5 | 6.0 | GO:0051673 | membrane disruption in other organism(GO:0051673) |
1.5 | 4.5 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) |
1.5 | 5.9 | GO:0046351 | disaccharide biosynthetic process(GO:0046351) |
1.4 | 4.3 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
1.4 | 4.3 | GO:0060265 | positive regulation of respiratory burst involved in inflammatory response(GO:0060265) |
1.4 | 4.3 | GO:0097037 | heme export(GO:0097037) |
1.4 | 4.2 | GO:0046967 | cytosol to ER transport(GO:0046967) |
1.4 | 5.5 | GO:2001287 | negative regulation of caveolin-mediated endocytosis(GO:2001287) |
1.4 | 4.1 | GO:0072138 | mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
1.4 | 5.5 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
1.4 | 5.5 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
1.3 | 3.9 | GO:0090320 | regulation of chylomicron remnant clearance(GO:0090320) |
1.3 | 3.9 | GO:0030573 | bile acid catabolic process(GO:0030573) |
1.3 | 3.9 | GO:0001869 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
1.3 | 6.4 | GO:1905169 | protein localization to phagocytic vesicle(GO:1905161) regulation of protein localization to phagocytic vesicle(GO:1905169) positive regulation of protein localization to phagocytic vesicle(GO:1905171) |
1.3 | 7.7 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
1.3 | 3.8 | GO:0071874 | cellular response to norepinephrine stimulus(GO:0071874) |
1.2 | 9.9 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
1.2 | 4.9 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
1.2 | 2.5 | GO:0002476 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) |
1.2 | 2.4 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
1.2 | 3.6 | GO:0052422 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
1.2 | 3.6 | GO:0006059 | hexitol metabolic process(GO:0006059) |
1.2 | 3.6 | GO:0002215 | defense response to nematode(GO:0002215) |
1.2 | 3.6 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
1.2 | 1.2 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
1.2 | 6.0 | GO:0097195 | pilomotor reflex(GO:0097195) |
1.2 | 3.6 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
1.2 | 10.6 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
1.2 | 4.7 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
1.2 | 9.4 | GO:0097647 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
1.2 | 3.5 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
1.2 | 6.9 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
1.1 | 3.4 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
1.1 | 4.6 | GO:0061402 | positive regulation of transcription from RNA polymerase II promoter in response to acidic pH(GO:0061402) |
1.1 | 5.7 | GO:0009992 | cellular water homeostasis(GO:0009992) |
1.1 | 1.1 | GO:1902460 | regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
1.1 | 4.5 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
1.1 | 3.3 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
1.1 | 1.1 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
1.1 | 3.3 | GO:0090285 | negative regulation of protein glycosylation in Golgi(GO:0090285) |
1.1 | 1.1 | GO:1901074 | regulation of engulfment of apoptotic cell(GO:1901074) |
1.1 | 3.2 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
1.1 | 1.1 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) negative regulation of serotonin uptake(GO:0051612) |
1.1 | 3.2 | GO:0002343 | peripheral B cell selection(GO:0002343) B cell affinity maturation(GO:0002344) |
1.1 | 3.2 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
1.0 | 8.4 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
1.0 | 6.2 | GO:1902847 | regulation of neuronal signal transduction(GO:1902847) positive regulation of neurofibrillary tangle assembly(GO:1902998) |
1.0 | 5.1 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
1.0 | 3.1 | GO:1903538 | meiotic cell cycle process involved in oocyte maturation(GO:1903537) regulation of meiotic cell cycle process involved in oocyte maturation(GO:1903538) |
1.0 | 3.1 | GO:0030070 | insulin processing(GO:0030070) |
1.0 | 5.1 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
1.0 | 5.1 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
1.0 | 4.0 | GO:0072277 | metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
1.0 | 5.0 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
1.0 | 10.9 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
1.0 | 8.0 | GO:0032796 | uropod organization(GO:0032796) |
1.0 | 4.9 | GO:0019072 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
1.0 | 5.8 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.9 | 3.8 | GO:0086017 | Purkinje myocyte action potential(GO:0086017) |
0.9 | 5.6 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.9 | 3.7 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.9 | 3.7 | GO:0045659 | negative regulation of neutrophil differentiation(GO:0045659) |
0.9 | 6.5 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.9 | 0.9 | GO:2000412 | positive regulation of thymocyte migration(GO:2000412) |
0.9 | 0.9 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) |
0.9 | 10.7 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.9 | 3.6 | GO:0090341 | negative regulation of secretion of lysosomal enzymes(GO:0090341) |
0.9 | 4.4 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
0.9 | 1.7 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.9 | 0.9 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.9 | 3.5 | GO:0090345 | nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) cellular organohalogen metabolic process(GO:0090345) cellular organofluorine metabolic process(GO:0090346) |
0.9 | 15.5 | GO:0042730 | fibrinolysis(GO:0042730) |
0.9 | 9.5 | GO:0052696 | flavonoid glucuronidation(GO:0052696) xenobiotic glucuronidation(GO:0052697) |
0.9 | 2.6 | GO:0034240 | negative regulation of macrophage fusion(GO:0034240) |
0.9 | 4.3 | GO:0072363 | regulation of glycolytic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072363) |
0.9 | 3.4 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) |
0.9 | 3.4 | GO:0021812 | neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
0.8 | 2.5 | GO:0006530 | asparagine catabolic process(GO:0006530) |
0.8 | 5.9 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.8 | 5.0 | GO:1903294 | regulation of glutamate secretion, neurotransmission(GO:1903294) positive regulation of glutamate secretion, neurotransmission(GO:1903296) |
0.8 | 3.3 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
0.8 | 2.5 | GO:0045014 | carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
0.8 | 4.9 | GO:0061760 | antifungal innate immune response(GO:0061760) |
0.8 | 2.4 | GO:0097494 | regulation of vesicle size(GO:0097494) |
0.8 | 2.4 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
0.8 | 4.8 | GO:0002538 | arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
0.8 | 4.0 | GO:2001280 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
0.8 | 2.4 | GO:0046710 | GDP metabolic process(GO:0046710) |
0.8 | 4.0 | GO:0052042 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
0.8 | 5.6 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.8 | 0.8 | GO:1904729 | regulation of intestinal lipid absorption(GO:1904729) |
0.8 | 2.3 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.8 | 3.1 | GO:0045575 | basophil activation(GO:0045575) |
0.8 | 2.3 | GO:0046021 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
0.8 | 0.8 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.8 | 1.5 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.8 | 2.3 | GO:2000295 | regulation of hydrogen peroxide catabolic process(GO:2000295) |
0.8 | 2.3 | GO:0071846 | actin filament debranching(GO:0071846) |
0.8 | 4.6 | GO:0032827 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) negative regulation of natural killer cell differentiation(GO:0032824) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.8 | 3.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.8 | 3.0 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
0.8 | 1.5 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.7 | 3.7 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
0.7 | 3.7 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
0.7 | 0.7 | GO:2000547 | regulation of dendritic cell dendrite assembly(GO:2000547) |
0.7 | 2.2 | GO:2000863 | positive regulation of estrogen secretion(GO:2000863) |
0.7 | 1.5 | GO:0015675 | nickel cation transport(GO:0015675) |
0.7 | 2.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.7 | 4.3 | GO:0009093 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine catabolic process to taurine(GO:0019452) L-cysteine metabolic process(GO:0046439) |
0.7 | 2.8 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
0.7 | 3.6 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.7 | 4.3 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
0.7 | 3.5 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.7 | 4.2 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.7 | 0.7 | GO:1905072 | cardiac jelly development(GO:1905072) |
0.7 | 2.8 | GO:0097460 | ferrous iron import into cell(GO:0097460) ferrous iron import across plasma membrane(GO:0098707) |
0.7 | 5.6 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.7 | 2.8 | GO:0015851 | nucleobase transport(GO:0015851) pyrimidine nucleobase transport(GO:0015855) |
0.7 | 5.6 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
0.7 | 1.4 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.7 | 2.8 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.7 | 0.7 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.7 | 1.4 | GO:1903173 | phytol metabolic process(GO:0033306) fatty alcohol metabolic process(GO:1903173) |
0.7 | 1.4 | GO:1901003 | negative regulation of fermentation(GO:1901003) |
0.7 | 2.1 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.7 | 2.7 | GO:0032329 | serine transport(GO:0032329) |
0.7 | 4.8 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.7 | 3.4 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.7 | 2.0 | GO:1904093 | regulation of autophagic cell death(GO:1904092) negative regulation of autophagic cell death(GO:1904093) |
0.7 | 4.7 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.7 | 0.7 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
0.7 | 1.3 | GO:0002484 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
0.6 | 2.6 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.6 | 9.0 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.6 | 1.3 | GO:1904954 | canonical Wnt signaling pathway involved in midbrain dopaminergic neuron differentiation(GO:1904954) |
0.6 | 3.8 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.6 | 2.5 | GO:2000983 | regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
0.6 | 1.3 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.6 | 0.6 | GO:0014805 | smooth muscle adaptation(GO:0014805) |
0.6 | 0.6 | GO:0039019 | pronephric nephron development(GO:0039019) |
0.6 | 1.9 | GO:0061357 | positive regulation of Wnt protein secretion(GO:0061357) |
0.6 | 15.4 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.6 | 1.8 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.6 | 1.8 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.6 | 11.5 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.6 | 0.6 | GO:0042986 | positive regulation of amyloid precursor protein biosynthetic process(GO:0042986) |
0.6 | 0.6 | GO:0072104 | glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
0.6 | 0.6 | GO:0033189 | response to vitamin A(GO:0033189) |
0.6 | 0.6 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.6 | 0.6 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
0.6 | 4.1 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.6 | 3.0 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.6 | 2.4 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.6 | 4.7 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.6 | 2.3 | GO:0035565 | regulation of pronephros size(GO:0035565) mesonephros morphogenesis(GO:0061206) mesonephric nephron development(GO:0061215) mesonephric nephron morphogenesis(GO:0061228) mesenchymal stem cell maintenance involved in mesonephric nephron morphogenesis(GO:0061235) regulation of mesenchymal cell apoptotic process involved in mesonephric nephron morphogenesis(GO:0061295) negative regulation of mesenchymal cell apoptotic process involved in mesonephric nephron morphogenesis(GO:0061296) mesenchymal cell apoptotic process involved in mesonephric nephron morphogenesis(GO:1901146) |
0.6 | 1.8 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.6 | 1.7 | GO:0061300 | cerebellum vasculature development(GO:0061300) |
0.6 | 1.7 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.6 | 1.7 | GO:0045004 | DNA replication proofreading(GO:0045004) |
0.6 | 2.3 | GO:1902164 | positive regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902164) |
0.6 | 16.5 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.6 | 1.1 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.6 | 1.1 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.6 | 2.3 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.6 | 6.7 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
0.6 | 2.2 | GO:2000656 | regulation of apolipoprotein binding(GO:2000656) negative regulation of apolipoprotein binding(GO:2000657) |
0.6 | 4.5 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.6 | 2.8 | GO:0034124 | regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
0.6 | 1.7 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.6 | 5.0 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.6 | 1.7 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
0.6 | 3.9 | GO:0006113 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.6 | 2.2 | GO:0010813 | neuropeptide catabolic process(GO:0010813) |
0.5 | 15.9 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.5 | 1.1 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.5 | 2.2 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
0.5 | 3.8 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.5 | 2.2 | GO:2000814 | positive regulation of barbed-end actin filament capping(GO:2000814) |
0.5 | 1.6 | GO:0072708 | response to sorbitol(GO:0072708) |
0.5 | 1.6 | GO:1990697 | protein depalmitoleylation(GO:1990697) |
0.5 | 0.5 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.5 | 1.6 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
0.5 | 1.6 | GO:0046087 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.5 | 1.1 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
0.5 | 4.3 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.5 | 3.8 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.5 | 13.5 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.5 | 2.2 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.5 | 1.6 | GO:1901052 | sarcosine metabolic process(GO:1901052) sarcosine catabolic process(GO:1901053) |
0.5 | 1.6 | GO:2000668 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
0.5 | 1.1 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.5 | 1.1 | GO:0036486 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.5 | 1.1 | GO:0070384 | Harderian gland development(GO:0070384) |
0.5 | 4.2 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.5 | 1.1 | GO:1903923 | renal protein absorption(GO:0097017) protein processing in phagocytic vesicle(GO:1900756) regulation of protein processing in phagocytic vesicle(GO:1903921) positive regulation of protein processing in phagocytic vesicle(GO:1903923) |
0.5 | 1.6 | GO:0019417 | sulfur oxidation(GO:0019417) |
0.5 | 5.3 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.5 | 1.1 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.5 | 0.5 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.5 | 5.8 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.5 | 5.8 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.5 | 2.1 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.5 | 2.1 | GO:0015744 | succinate transport(GO:0015744) |
0.5 | 2.6 | GO:2000768 | positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
0.5 | 1.5 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.5 | 3.1 | GO:0030421 | defecation(GO:0030421) |
0.5 | 1.5 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.5 | 2.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.5 | 1.5 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
0.5 | 4.6 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.5 | 0.5 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.5 | 2.0 | GO:0019064 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.5 | 5.6 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
0.5 | 2.0 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.5 | 2.0 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.5 | 1.0 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.5 | 0.5 | GO:0021644 | vagus nerve morphogenesis(GO:0021644) |
0.5 | 4.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.5 | 1.5 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.5 | 0.5 | GO:1904796 | regulation of core promoter binding(GO:1904796) positive regulation of core promoter binding(GO:1904798) |
0.5 | 0.5 | GO:0051542 | elastin biosynthetic process(GO:0051542) |
0.5 | 2.5 | GO:0034238 | macrophage fusion(GO:0034238) |
0.5 | 2.5 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
0.5 | 1.0 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.5 | 6.5 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.5 | 2.5 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.5 | 0.5 | GO:0006507 | GPI anchor release(GO:0006507) |
0.5 | 5.5 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.5 | 1.0 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) |
0.5 | 2.0 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.5 | 1.5 | GO:2000170 | positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
0.5 | 2.5 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.5 | 2.0 | GO:0071727 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.5 | 3.9 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.5 | 6.4 | GO:0097421 | liver regeneration(GO:0097421) |
0.5 | 1.5 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.5 | 4.4 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.5 | 1.0 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.5 | 2.4 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.5 | 2.0 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
0.5 | 1.0 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.5 | 1.5 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.5 | 1.9 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.5 | 1.5 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.5 | 1.5 | GO:0035934 | corticosterone secretion(GO:0035934) |
0.5 | 2.9 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.5 | 1.0 | GO:0061623 | glycolytic process from galactose(GO:0061623) |
0.5 | 1.9 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.5 | 1.0 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.5 | 4.8 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.5 | 2.9 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine salvage(GO:0071267) |
0.5 | 2.4 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
0.5 | 0.9 | GO:0034616 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
0.5 | 3.8 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.5 | 1.4 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.5 | 0.5 | GO:2000451 | positive regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000451) |
0.5 | 1.4 | GO:0015817 | histidine transport(GO:0015817) |
0.5 | 0.9 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.5 | 1.4 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.5 | 0.9 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.5 | 4.7 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.5 | 1.9 | GO:0009814 | defense response, incompatible interaction(GO:0009814) defense response to bacterium, incompatible interaction(GO:0009816) regulation of defense response to bacterium, incompatible interaction(GO:1902477) |
0.5 | 1.4 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.5 | 2.8 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.5 | 0.5 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.5 | 1.9 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
0.5 | 0.9 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.5 | 1.4 | GO:2000777 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process involved in cellular response to hypoxia(GO:2000777) |
0.5 | 1.8 | GO:0010286 | heat acclimation(GO:0010286) |
0.5 | 1.8 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.5 | 1.4 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.5 | 1.4 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.5 | 3.7 | GO:0031179 | peptide modification(GO:0031179) |
0.5 | 0.9 | GO:0031662 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
0.5 | 5.0 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.5 | 26.5 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
0.5 | 0.9 | GO:0016332 | establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
0.5 | 12.8 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.5 | 6.8 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
0.5 | 1.4 | GO:0015881 | creatine transport(GO:0015881) |
0.5 | 4.5 | GO:0090500 | endocardial cushion to mesenchymal transition(GO:0090500) |
0.5 | 0.5 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.5 | 0.9 | GO:0001946 | lymphangiogenesis(GO:0001946) |
0.5 | 1.8 | GO:0007412 | axon target recognition(GO:0007412) |
0.5 | 2.3 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.4 | 0.4 | GO:0031104 | dendrite regeneration(GO:0031104) |
0.4 | 4.5 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
0.4 | 2.2 | GO:0072223 | metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
0.4 | 0.4 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
0.4 | 0.4 | GO:0072300 | positive regulation of metanephric glomerulus development(GO:0072300) |
0.4 | 0.9 | GO:1990051 | activation of protein kinase C activity(GO:1990051) |
0.4 | 2.2 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.4 | 0.4 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.4 | 6.7 | GO:0046549 | retinal cone cell development(GO:0046549) |
0.4 | 2.2 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.4 | 2.2 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.4 | 1.3 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
0.4 | 1.3 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.4 | 3.5 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.4 | 1.8 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
0.4 | 1.3 | GO:0019043 | establishment of viral latency(GO:0019043) |
0.4 | 3.1 | GO:0031100 | organ regeneration(GO:0031100) |
0.4 | 1.8 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
0.4 | 0.4 | GO:0035791 | platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
0.4 | 3.1 | GO:0060309 | elastin catabolic process(GO:0060309) |
0.4 | 1.3 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.4 | 1.7 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.4 | 2.6 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.4 | 21.3 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
0.4 | 0.9 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.4 | 6.5 | GO:0051451 | myoblast migration(GO:0051451) |
0.4 | 0.9 | GO:1903874 | ferrous iron transmembrane transport(GO:1903874) |
0.4 | 0.4 | GO:0072098 | intermediate mesoderm development(GO:0048389) pattern specification involved in mesonephros development(GO:0061227) anterior/posterior pattern specification involved in kidney development(GO:0072098) |
0.4 | 1.7 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
0.4 | 1.7 | GO:0031944 | negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
0.4 | 0.9 | GO:0001803 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
0.4 | 2.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.4 | 2.1 | GO:0006548 | histidine catabolic process(GO:0006548) |
0.4 | 1.7 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
0.4 | 0.4 | GO:0061218 | negative regulation of mesonephros development(GO:0061218) |
0.4 | 1.3 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
0.4 | 0.8 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.4 | 1.3 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
0.4 | 1.7 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.4 | 0.4 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.4 | 1.7 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.4 | 2.5 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.4 | 3.7 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.4 | 0.8 | GO:1903367 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
0.4 | 1.2 | GO:0035425 | autocrine signaling(GO:0035425) |
0.4 | 2.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.4 | 1.2 | GO:0042262 | DNA protection(GO:0042262) |
0.4 | 1.6 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.4 | 2.5 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
0.4 | 2.0 | GO:0072014 | proximal tubule development(GO:0072014) |
0.4 | 2.4 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
0.4 | 0.8 | GO:0044598 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.4 | 4.8 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.4 | 4.0 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.4 | 0.4 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.4 | 1.2 | GO:0036302 | atrioventricular canal development(GO:0036302) |
0.4 | 1.6 | GO:0043376 | regulation of CD8-positive, alpha-beta T cell differentiation(GO:0043376) |
0.4 | 1.6 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
0.4 | 1.2 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
0.4 | 1.6 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
0.4 | 1.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.4 | 4.4 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.4 | 2.0 | GO:0032917 | polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
0.4 | 1.6 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.4 | 1.2 | GO:0006740 | NADPH regeneration(GO:0006740) |
0.4 | 0.4 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
0.4 | 2.7 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.4 | 2.4 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.4 | 0.8 | GO:0045716 | positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
0.4 | 0.4 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.4 | 2.7 | GO:0001766 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
0.4 | 2.3 | GO:0035981 | tongue muscle cell differentiation(GO:0035981) positive regulation of skeletal muscle fiber differentiation(GO:1902811) regulation of tongue muscle cell differentiation(GO:2001035) positive regulation of tongue muscle cell differentiation(GO:2001037) |
0.4 | 0.8 | GO:0006788 | heme oxidation(GO:0006788) |
0.4 | 1.6 | GO:0050428 | purine ribonucleoside bisphosphate biosynthetic process(GO:0034036) 3'-phosphoadenosine 5'-phosphosulfate biosynthetic process(GO:0050428) |
0.4 | 1.6 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.4 | 5.4 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.4 | 2.7 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.4 | 0.4 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
0.4 | 2.7 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.4 | 4.2 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.4 | 0.4 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.4 | 6.9 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.4 | 1.9 | GO:0048617 | foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
0.4 | 1.9 | GO:1902732 | positive regulation of chondrocyte proliferation(GO:1902732) |
0.4 | 0.4 | GO:1903378 | positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
0.4 | 1.1 | GO:0016999 | antibiotic metabolic process(GO:0016999) |
0.4 | 0.4 | GO:0044240 | multicellular organism lipid catabolic process(GO:0044240) |
0.4 | 1.5 | GO:0014916 | regulation of lung blood pressure(GO:0014916) |
0.4 | 1.1 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.4 | 1.5 | GO:0030091 | protein repair(GO:0030091) |
0.4 | 2.2 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.4 | 1.1 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.4 | 0.7 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.4 | 1.5 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.4 | 1.8 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.4 | 0.7 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.4 | 8.1 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.4 | 0.7 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
0.4 | 1.5 | GO:0050823 | antigen processing and presentation of exogenous peptide antigen via MHC class I, TAP-dependent(GO:0002479) peptide stabilization(GO:0050822) peptide antigen stabilization(GO:0050823) |
0.4 | 1.5 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.4 | 0.4 | GO:0072180 | mesonephric duct morphogenesis(GO:0072180) |
0.4 | 2.9 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.4 | 0.7 | GO:1902566 | regulation of eosinophil activation(GO:1902566) |
0.4 | 1.1 | GO:1904582 | positive regulation of intracellular mRNA localization(GO:1904582) |
0.4 | 2.9 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.4 | 1.4 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.4 | 1.1 | GO:1905165 | regulation of lysosomal protein catabolic process(GO:1905165) |
0.4 | 1.4 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.4 | 1.4 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.4 | 0.4 | GO:2000156 | regulation of retrograde vesicle-mediated transport, Golgi to ER(GO:2000156) |
0.4 | 2.5 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.4 | 1.4 | GO:0021571 | rhombomere 5 development(GO:0021571) |
0.4 | 1.1 | GO:0046491 | L-methylmalonyl-CoA metabolic process(GO:0046491) |
0.4 | 1.1 | GO:0009107 | lipoate biosynthetic process(GO:0009107) |
0.4 | 1.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.4 | 1.1 | GO:0002543 | activation of blood coagulation via clotting cascade(GO:0002543) phosphatidylserine exposure on blood platelet(GO:0097045) |
0.4 | 1.1 | GO:0008272 | sulfate transport(GO:0008272) |
0.4 | 0.4 | GO:0060066 | oviduct development(GO:0060066) |
0.4 | 4.2 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.4 | 1.1 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.3 | 0.3 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
0.3 | 2.4 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.3 | 1.0 | GO:0060540 | lung lobe formation(GO:0060464) diaphragm morphogenesis(GO:0060540) |
0.3 | 0.3 | GO:0035502 | metanephric part of ureteric bud development(GO:0035502) |
0.3 | 1.0 | GO:0051182 | coenzyme transport(GO:0051182) |
0.3 | 0.7 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.3 | 1.7 | GO:1903181 | regulation of dopamine biosynthetic process(GO:1903179) positive regulation of dopamine biosynthetic process(GO:1903181) |
0.3 | 0.3 | GO:0072194 | kidney smooth muscle tissue development(GO:0072194) |
0.3 | 3.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.3 | 1.0 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.3 | 7.6 | GO:0007614 | short-term memory(GO:0007614) |
0.3 | 3.1 | GO:0072615 | interleukin-17 secretion(GO:0072615) |
0.3 | 1.0 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.3 | 1.7 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.3 | 0.3 | GO:0034552 | respiratory chain complex II assembly(GO:0034552) mitochondrial respiratory chain complex II assembly(GO:0034553) mitochondrial respiratory chain complex II biogenesis(GO:0097032) |
0.3 | 1.4 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.3 | 1.7 | GO:1904171 | negative regulation of bleb assembly(GO:1904171) |
0.3 | 13.6 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.3 | 0.3 | GO:1905204 | negative regulation of connective tissue replacement(GO:1905204) |
0.3 | 0.3 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.3 | 1.7 | GO:1990743 | protein sialylation(GO:1990743) |
0.3 | 2.4 | GO:0051012 | microtubule sliding(GO:0051012) |
0.3 | 2.4 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
0.3 | 2.0 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.3 | 0.7 | GO:0046038 | GMP catabolic process(GO:0046038) |
0.3 | 5.7 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.3 | 2.3 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.3 | 6.0 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.3 | 1.3 | GO:0006116 | NADH oxidation(GO:0006116) |
0.3 | 2.3 | GO:0060192 | negative regulation of lipase activity(GO:0060192) |
0.3 | 0.7 | GO:0010726 | positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
0.3 | 0.7 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
0.3 | 0.7 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.3 | 1.3 | GO:0045077 | negative regulation of interferon-gamma biosynthetic process(GO:0045077) |
0.3 | 0.3 | GO:0035697 | CD8-positive, alpha-beta T cell extravasation(GO:0035697) |
0.3 | 3.2 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.3 | 1.3 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.3 | 4.5 | GO:0015695 | organic cation transport(GO:0015695) |
0.3 | 0.3 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.3 | 2.9 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.3 | 3.5 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
0.3 | 0.3 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.3 | 1.3 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.3 | 0.6 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
0.3 | 0.6 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
0.3 | 13.6 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
0.3 | 0.6 | GO:1904380 | trimming of terminal mannose on B branch(GO:0036509) endoplasmic reticulum mannose trimming(GO:1904380) |
0.3 | 0.3 | GO:0060854 | patterning of lymph vessels(GO:0060854) |
0.3 | 1.3 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
0.3 | 1.6 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.3 | 1.3 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.3 | 2.5 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.3 | 0.9 | GO:0070194 | synaptonemal complex disassembly(GO:0070194) |
0.3 | 0.9 | GO:1902219 | negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.3 | 3.7 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
0.3 | 0.3 | GO:0035799 | ureter maturation(GO:0035799) |
0.3 | 1.5 | GO:0019249 | lactate biosynthetic process(GO:0019249) |
0.3 | 0.9 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.3 | 0.6 | GO:0051659 | maintenance of mitochondrion location(GO:0051659) |
0.3 | 0.3 | GO:0098877 | neurotransmitter receptor transport to plasma membrane(GO:0098877) |
0.3 | 1.2 | GO:2000229 | pancreatic stellate cell proliferation(GO:0072343) regulation of pancreatic stellate cell proliferation(GO:2000229) negative regulation of pancreatic stellate cell proliferation(GO:2000230) |
0.3 | 1.8 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.3 | 1.8 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.3 | 0.9 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.3 | 0.6 | GO:0009437 | carnitine metabolic process(GO:0009437) |
0.3 | 0.9 | GO:0097501 | stress response to metal ion(GO:0097501) |
0.3 | 0.9 | GO:1904715 | negative regulation of chaperone-mediated autophagy(GO:1904715) |
0.3 | 3.6 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.3 | 1.5 | GO:0030576 | Cajal body organization(GO:0030576) |
0.3 | 1.5 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.3 | 1.8 | GO:0048104 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
0.3 | 0.9 | GO:0010705 | meiotic DNA double-strand break processing involved in reciprocal meiotic recombination(GO:0010705) |
0.3 | 0.6 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.3 | 1.5 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.3 | 1.2 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
0.3 | 1.5 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
0.3 | 0.3 | GO:0042245 | RNA repair(GO:0042245) |
0.3 | 0.6 | GO:0060152 | peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
0.3 | 3.3 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.3 | 0.9 | GO:0090673 | endothelial cell-matrix adhesion(GO:0090673) |
0.3 | 0.9 | GO:0060029 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) convergent extension involved in organogenesis(GO:0060029) |
0.3 | 2.1 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.3 | 1.2 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
0.3 | 1.5 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.3 | 0.3 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.3 | 0.9 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
0.3 | 0.3 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.3 | 0.6 | GO:0006710 | androgen catabolic process(GO:0006710) |
0.3 | 2.7 | GO:0051873 | disruption by host of symbiont cells(GO:0051852) killing by host of symbiont cells(GO:0051873) |
0.3 | 0.9 | GO:1904976 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
0.3 | 0.9 | GO:0021682 | nerve maturation(GO:0021682) |
0.3 | 1.5 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
0.3 | 2.6 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.3 | 0.9 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.3 | 1.8 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.3 | 0.6 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.3 | 1.5 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.3 | 0.6 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.3 | 1.4 | GO:0060857 | establishment of glial blood-brain barrier(GO:0060857) |
0.3 | 0.3 | GO:1904100 | regulation of protein O-linked glycosylation(GO:1904098) positive regulation of protein O-linked glycosylation(GO:1904100) |
0.3 | 1.4 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
0.3 | 0.9 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.3 | 0.9 | GO:0032930 | positive regulation of superoxide anion generation(GO:0032930) |
0.3 | 0.9 | GO:1903413 | response to bile acid(GO:1903412) cellular response to bile acid(GO:1903413) |
0.3 | 0.9 | GO:1903033 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
0.3 | 1.7 | GO:0032439 | endosome localization(GO:0032439) |
0.3 | 2.3 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
0.3 | 1.4 | GO:0044313 | protein K6-linked deubiquitination(GO:0044313) |
0.3 | 2.0 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
0.3 | 0.6 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.3 | 0.9 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.3 | 1.4 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.3 | 2.0 | GO:0034104 | negative regulation of tissue remodeling(GO:0034104) |
0.3 | 2.3 | GO:0048597 | post-embryonic eye morphogenesis(GO:0048050) post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.3 | 0.8 | GO:0007494 | midgut development(GO:0007494) |
0.3 | 1.4 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.3 | 1.7 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.3 | 0.6 | GO:0021561 | facial nerve development(GO:0021561) facial nerve morphogenesis(GO:0021610) |
0.3 | 0.6 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.3 | 1.1 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
0.3 | 0.3 | GO:0003290 | atrial septum secundum morphogenesis(GO:0003290) |
0.3 | 1.1 | GO:0010934 | macrophage cytokine production(GO:0010934) |
0.3 | 4.5 | GO:0021924 | cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
0.3 | 2.8 | GO:0032462 | regulation of protein homooligomerization(GO:0032462) |
0.3 | 0.3 | GO:0055093 | response to hyperoxia(GO:0055093) cellular response to hyperoxia(GO:0071455) |
0.3 | 0.3 | GO:0002325 | natural killer cell differentiation involved in immune response(GO:0002325) regulation of natural killer cell differentiation involved in immune response(GO:0032826) |
0.3 | 0.8 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.3 | 0.8 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
0.3 | 3.0 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.3 | 4.9 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.3 | 1.1 | GO:0097298 | regulation of nucleus size(GO:0097298) |
0.3 | 0.3 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.3 | 0.8 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.3 | 0.5 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.3 | 0.8 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.3 | 3.2 | GO:0070166 | enamel mineralization(GO:0070166) |
0.3 | 0.5 | GO:1901420 | negative regulation of vitamin D receptor signaling pathway(GO:0070563) negative regulation of response to alcohol(GO:1901420) |
0.3 | 0.5 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.3 | 0.5 | GO:0045329 | carnitine biosynthetic process(GO:0045329) |
0.3 | 0.8 | GO:0002030 | inhibitory G-protein coupled receptor phosphorylation(GO:0002030) |
0.3 | 0.5 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.3 | 1.9 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.3 | 1.9 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.3 | 1.6 | GO:0015889 | cobalamin transport(GO:0015889) |
0.3 | 1.3 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
0.3 | 3.7 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.3 | 2.4 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.3 | 2.1 | GO:1902713 | regulation of interferon-gamma secretion(GO:1902713) |
0.3 | 0.3 | GO:0006203 | dGTP catabolic process(GO:0006203) |
0.3 | 6.0 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.3 | 3.9 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.3 | 0.5 | GO:0048822 | enucleate erythrocyte development(GO:0048822) |
0.3 | 0.5 | GO:1904526 | regulation of microtubule binding(GO:1904526) |
0.3 | 0.5 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.3 | 2.3 | GO:0019375 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
0.3 | 0.8 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.3 | 1.0 | GO:1904569 | regulation of selenocysteine incorporation(GO:1904569) |
0.3 | 0.5 | GO:2000589 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) regulation of metanephric mesenchymal cell migration(GO:2000589) |
0.3 | 0.3 | GO:0010692 | regulation of alkaline phosphatase activity(GO:0010692) |
0.3 | 1.0 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.3 | 0.3 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
0.3 | 0.8 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
0.3 | 3.3 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
0.3 | 4.3 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.3 | 1.0 | GO:0015755 | fructose transport(GO:0015755) |
0.3 | 1.8 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.3 | 1.0 | GO:1902669 | positive regulation of axon guidance(GO:1902669) |
0.3 | 0.3 | GO:0046070 | dGTP metabolic process(GO:0046070) |
0.3 | 1.5 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.3 | 2.3 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.2 | 0.7 | GO:0070459 | prolactin secretion(GO:0070459) |
0.2 | 0.7 | GO:0070488 | neutrophil aggregation(GO:0070488) |
0.2 | 8.0 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.2 | 0.2 | GO:0072008 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
0.2 | 1.7 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.2 | 1.5 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.2 | 5.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.2 | 0.5 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.2 | 0.7 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.2 | 0.5 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.2 | 2.0 | GO:0015879 | carnitine transport(GO:0015879) |
0.2 | 1.2 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.2 | 1.0 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.2 | 0.5 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.2 | 1.2 | GO:0002468 | dendritic cell antigen processing and presentation(GO:0002468) |
0.2 | 1.5 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.2 | 0.5 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.2 | 0.2 | GO:2000320 | negative regulation of T-helper 17 type immune response(GO:2000317) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
0.2 | 0.5 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
0.2 | 0.7 | GO:0043181 | vacuolar sequestering(GO:0043181) |
0.2 | 2.4 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.2 | 0.7 | GO:0014738 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
0.2 | 0.7 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.2 | 1.2 | GO:0060956 | endocardial cell differentiation(GO:0060956) |
0.2 | 3.6 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.2 | 0.7 | GO:0006571 | tyrosine biosynthetic process(GO:0006571) aromatic amino acid family biosynthetic process(GO:0009073) aromatic amino acid family biosynthetic process, prephenate pathway(GO:0009095) |
0.2 | 0.7 | GO:0051933 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
0.2 | 0.9 | GO:0032901 | positive regulation of neurotrophin production(GO:0032901) |
0.2 | 0.2 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.2 | 0.5 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
0.2 | 0.9 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.2 | 1.4 | GO:1904321 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.2 | 0.7 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
0.2 | 0.2 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.2 | 2.8 | GO:0032096 | negative regulation of response to food(GO:0032096) |
0.2 | 0.5 | GO:0033005 | positive regulation of mast cell activation(GO:0033005) |
0.2 | 0.5 | GO:0003032 | detection of oxygen(GO:0003032) |
0.2 | 0.2 | GO:0055096 | lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
0.2 | 0.5 | GO:2000328 | regulation of T-helper 17 cell lineage commitment(GO:2000328) |
0.2 | 1.6 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.2 | 2.5 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.2 | 0.9 | GO:0072738 | response to diamide(GO:0072737) cellular response to diamide(GO:0072738) cellular response to sodium arsenite(GO:1903936) |
0.2 | 0.7 | GO:0030043 | actin filament fragmentation(GO:0030043) |
0.2 | 2.1 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
0.2 | 1.6 | GO:0060033 | anatomical structure regression(GO:0060033) |
0.2 | 0.2 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
0.2 | 0.2 | GO:0090182 | regulation of secretion of lysosomal enzymes(GO:0090182) |
0.2 | 0.5 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.2 | 2.0 | GO:0035376 | sterol import(GO:0035376) cholesterol import(GO:0070508) |
0.2 | 2.5 | GO:0002888 | positive regulation of myeloid leukocyte mediated immunity(GO:0002888) |
0.2 | 3.2 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.2 | 1.1 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.2 | 1.8 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.2 | 2.7 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.2 | 0.2 | GO:0010644 | cell communication by electrical coupling(GO:0010644) |
0.2 | 0.7 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.2 | 0.7 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.2 | 1.3 | GO:0090383 | phagosome acidification(GO:0090383) |
0.2 | 0.9 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.2 | 1.3 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.2 | 1.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.2 | 0.9 | GO:0046084 | adenine salvage(GO:0006168) adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.2 | 2.0 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.2 | 0.2 | GO:0032472 | Golgi calcium ion transport(GO:0032472) |
0.2 | 3.1 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.2 | 3.8 | GO:0051601 | exocyst localization(GO:0051601) |
0.2 | 1.5 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.2 | 0.4 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.2 | 0.2 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.2 | 4.2 | GO:0034389 | lipid particle organization(GO:0034389) |
0.2 | 2.2 | GO:0002681 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
0.2 | 0.2 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.2 | 0.2 | GO:0071317 | cellular response to isoquinoline alkaloid(GO:0071317) |
0.2 | 2.9 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.2 | 1.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.2 | 0.7 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
0.2 | 1.8 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
0.2 | 0.2 | GO:0060157 | urinary bladder development(GO:0060157) |
0.2 | 3.7 | GO:0031268 | pseudopodium organization(GO:0031268) |
0.2 | 0.2 | GO:0021534 | cell proliferation in hindbrain(GO:0021534) |
0.2 | 0.9 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
0.2 | 2.0 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.2 | 1.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.2 | 3.7 | GO:0046688 | response to copper ion(GO:0046688) |
0.2 | 0.6 | GO:0070625 | zymogen granule exocytosis(GO:0070625) |
0.2 | 1.3 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.2 | 1.9 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.2 | 1.3 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.2 | 0.4 | GO:0021886 | hypothalamus gonadotrophin-releasing hormone neuron differentiation(GO:0021886) hypothalamus gonadotrophin-releasing hormone neuron development(GO:0021888) |
0.2 | 4.7 | GO:0032060 | bleb assembly(GO:0032060) |
0.2 | 2.1 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
0.2 | 0.4 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.2 | 0.8 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.2 | 4.2 | GO:0048339 | paraxial mesoderm development(GO:0048339) |
0.2 | 0.2 | GO:0097350 | neutrophil clearance(GO:0097350) |
0.2 | 0.2 | GO:0090135 | actin filament branching(GO:0090135) |
0.2 | 0.4 | GO:0051892 | negative regulation of cardioblast differentiation(GO:0051892) |
0.2 | 0.4 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.2 | 0.8 | GO:0043397 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.2 | 0.2 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
0.2 | 5.0 | GO:0097435 | fibril organization(GO:0097435) |
0.2 | 1.5 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) endosome to plasma membrane protein transport(GO:0099638) neurotransmitter receptor transport, endosome to plasma membrane(GO:0099639) |
0.2 | 0.6 | GO:0032757 | positive regulation of interleukin-8 production(GO:0032757) |
0.2 | 0.8 | GO:0002266 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
0.2 | 1.9 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.2 | 1.4 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
0.2 | 0.2 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.2 | 3.3 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
0.2 | 3.5 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.2 | 0.6 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
0.2 | 1.0 | GO:0060312 | regulation of blood vessel remodeling(GO:0060312) |
0.2 | 7.1 | GO:0050766 | positive regulation of phagocytosis(GO:0050766) |
0.2 | 0.8 | GO:0036115 | fatty-acyl-CoA catabolic process(GO:0036115) |
0.2 | 1.6 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.2 | 1.8 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
0.2 | 2.2 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.2 | 3.0 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.2 | 0.6 | GO:0098974 | postsynaptic actin cytoskeleton organization(GO:0098974) |
0.2 | 1.6 | GO:0032202 | telomere assembly(GO:0032202) |
0.2 | 0.6 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
0.2 | 1.0 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
0.2 | 2.2 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.2 | 0.8 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.2 | 2.0 | GO:0010829 | negative regulation of glucose transport(GO:0010829) |
0.2 | 0.4 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.2 | 1.2 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.2 | 0.6 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
0.2 | 0.6 | GO:0032218 | riboflavin transport(GO:0032218) |
0.2 | 0.6 | GO:0006535 | cysteine biosynthetic process from serine(GO:0006535) |
0.2 | 0.6 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.2 | 0.4 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
0.2 | 0.4 | GO:0034505 | tooth mineralization(GO:0034505) |
0.2 | 1.4 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.2 | 0.6 | GO:0000451 | rRNA 2'-O-methylation(GO:0000451) |
0.2 | 1.9 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.2 | 2.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.2 | 0.6 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
0.2 | 1.0 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.2 | 1.0 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
0.2 | 0.2 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.2 | 0.6 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.2 | 0.6 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.2 | 0.6 | GO:0048627 | myoblast development(GO:0048627) |
0.2 | 1.3 | GO:0046320 | regulation of fatty acid oxidation(GO:0046320) |
0.2 | 2.5 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.2 | 0.6 | GO:0006713 | glucocorticoid catabolic process(GO:0006713) |
0.2 | 0.9 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
0.2 | 2.4 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.2 | 2.8 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.2 | 0.4 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.2 | 2.8 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.2 | 0.2 | GO:0036324 | vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
0.2 | 0.4 | GO:0039532 | negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
0.2 | 0.4 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.2 | 0.9 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.2 | 0.7 | GO:0043931 | ossification involved in bone maturation(GO:0043931) organ maturation(GO:0048799) bone maturation(GO:0070977) |
0.2 | 0.9 | GO:0002159 | desmosome assembly(GO:0002159) |
0.2 | 0.6 | GO:1902221 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
0.2 | 0.7 | GO:0032298 | positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
0.2 | 4.6 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
0.2 | 1.5 | GO:0031639 | plasminogen activation(GO:0031639) |
0.2 | 1.6 | GO:0038203 | TORC2 signaling(GO:0038203) |
0.2 | 2.2 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
0.2 | 0.2 | GO:0042737 | drug catabolic process(GO:0042737) |
0.2 | 0.7 | GO:0042482 | positive regulation of odontogenesis(GO:0042482) |
0.2 | 0.4 | GO:0030961 | peptidyl-arginine hydroxylation(GO:0030961) |
0.2 | 2.0 | GO:0006968 | cellular defense response(GO:0006968) |
0.2 | 1.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.2 | 1.1 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
0.2 | 0.5 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.2 | 0.7 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.2 | 1.4 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
0.2 | 1.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.2 | 1.1 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
0.2 | 1.1 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.2 | 1.6 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.2 | 1.8 | GO:0022010 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
0.2 | 5.7 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.2 | 0.4 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.2 | 0.2 | GO:1902563 | regulation of neutrophil degranulation(GO:0043313) regulation of neutrophil activation(GO:1902563) |
0.2 | 0.4 | GO:1904328 | regulation of myofibroblast contraction(GO:1904328) myofibroblast contraction(GO:1990764) |
0.2 | 0.4 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.2 | 0.2 | GO:0046689 | response to mercury ion(GO:0046689) |
0.2 | 1.4 | GO:0021978 | telencephalon regionalization(GO:0021978) |
0.2 | 1.6 | GO:0061756 | leukocyte tethering or rolling(GO:0050901) leukocyte adhesion to vascular endothelial cell(GO:0061756) |
0.2 | 1.4 | GO:0090045 | positive regulation of deacetylase activity(GO:0090045) positive regulation of histone deacetylase activity(GO:1901727) |
0.2 | 0.2 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.2 | 1.1 | GO:0045601 | regulation of endothelial cell differentiation(GO:0045601) |
0.2 | 0.9 | GO:0033762 | response to glucagon(GO:0033762) |
0.2 | 0.3 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
0.2 | 0.5 | GO:0060440 | trachea formation(GO:0060440) |
0.2 | 4.5 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.2 | 0.3 | GO:0097503 | sialylation(GO:0097503) |
0.2 | 0.2 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
0.2 | 1.2 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.2 | 25.3 | GO:0030198 | extracellular matrix organization(GO:0030198) |
0.2 | 2.2 | GO:0045923 | positive regulation of fatty acid metabolic process(GO:0045923) |
0.2 | 1.4 | GO:0043482 | cellular pigment accumulation(GO:0043482) |
0.2 | 1.2 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.2 | 0.2 | GO:0000706 | meiotic DNA double-strand break processing(GO:0000706) |
0.2 | 0.7 | GO:0098886 | modification of dendritic spine(GO:0098886) |
0.2 | 1.2 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.2 | 0.7 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.2 | 3.3 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
0.2 | 3.2 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
0.2 | 0.2 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
0.2 | 0.2 | GO:0040038 | polar body extrusion after meiotic divisions(GO:0040038) |
0.2 | 1.0 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.2 | 2.8 | GO:0019835 | cytolysis(GO:0019835) |
0.2 | 0.5 | GO:0051940 | regulation of dopamine uptake involved in synaptic transmission(GO:0051584) regulation of catecholamine uptake involved in synaptic transmission(GO:0051940) |
0.2 | 1.5 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
0.2 | 4.0 | GO:0010470 | regulation of gastrulation(GO:0010470) |
0.2 | 5.9 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.2 | 4.6 | GO:0018208 | peptidyl-proline modification(GO:0018208) |
0.2 | 0.2 | GO:0006555 | methionine metabolic process(GO:0006555) |
0.2 | 0.5 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.2 | 0.3 | GO:0002191 | cap-dependent translational initiation(GO:0002191) |
0.2 | 0.7 | GO:0090335 | regulation of brown fat cell differentiation(GO:0090335) |
0.2 | 2.6 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.2 | 0.8 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.2 | 1.3 | GO:0002283 | neutrophil activation involved in immune response(GO:0002283) |
0.2 | 2.9 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
0.2 | 0.5 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.2 | 0.5 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
0.2 | 0.5 | GO:1901623 | regulation of lymphocyte chemotaxis(GO:1901623) |
0.2 | 0.2 | GO:0002461 | tolerance induction dependent upon immune response(GO:0002461) |
0.2 | 0.5 | GO:0070476 | rRNA (guanine-N7)-methylation(GO:0070476) |
0.2 | 0.8 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
0.2 | 2.1 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.2 | 0.6 | GO:0042891 | antibiotic transport(GO:0042891) |
0.2 | 1.8 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.2 | 0.2 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.2 | 0.5 | GO:0071402 | cellular response to lipoprotein particle stimulus(GO:0071402) cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
0.2 | 1.9 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.2 | 2.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.2 | 0.6 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
0.2 | 0.5 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
0.2 | 0.5 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
0.2 | 0.6 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.2 | 0.6 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.2 | 1.4 | GO:0015961 | diadenosine polyphosphate catabolic process(GO:0015961) |
0.2 | 0.3 | GO:0007356 | thorax and anterior abdomen determination(GO:0007356) |
0.2 | 2.0 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.2 | 2.5 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.2 | 0.3 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.2 | 0.9 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.2 | 4.5 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
0.2 | 0.6 | GO:0003383 | apical constriction(GO:0003383) |
0.2 | 0.5 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
0.2 | 1.9 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.2 | 0.5 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.2 | 0.2 | GO:0000349 | generation of catalytic spliceosome for first transesterification step(GO:0000349) |
0.2 | 0.6 | GO:0043091 | L-arginine import(GO:0043091) arginine import(GO:0090467) |
0.2 | 1.1 | GO:0051532 | regulation of NFAT protein import into nucleus(GO:0051532) |
0.2 | 0.3 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.2 | 0.5 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
0.2 | 0.3 | GO:0014866 | skeletal myofibril assembly(GO:0014866) skeletal muscle thin filament assembly(GO:0030240) |
0.2 | 2.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.2 | 0.2 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.2 | 2.7 | GO:0045061 | thymic T cell selection(GO:0045061) |
0.2 | 0.2 | GO:0061074 | regulation of neural retina development(GO:0061074) |
0.2 | 1.2 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.2 | 0.3 | GO:0061734 | parkin-mediated mitophagy in response to mitochondrial depolarization(GO:0061734) |
0.1 | 1.5 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.1 | 0.6 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.1 | 0.4 | GO:0043686 | co-translational protein modification(GO:0043686) |
0.1 | 0.6 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.1 | 0.4 | GO:1902037 | negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
0.1 | 0.9 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.1 | 0.6 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
0.1 | 0.7 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 1.3 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
0.1 | 0.6 | GO:0017126 | nucleologenesis(GO:0017126) |
0.1 | 1.0 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 0.4 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.1 | 0.7 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.1 | 20.5 | GO:0006956 | complement activation(GO:0006956) |
0.1 | 1.7 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.1 | 0.1 | GO:0060676 | ureteric bud formation(GO:0060676) |
0.1 | 0.1 | GO:0007418 | ventral midline development(GO:0007418) |
0.1 | 0.1 | GO:0043373 | CD4-positive, alpha-beta T cell lineage commitment(GO:0043373) |
0.1 | 0.7 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
0.1 | 0.4 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
0.1 | 1.6 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.1 | 0.7 | GO:0060068 | vagina development(GO:0060068) |
0.1 | 0.6 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.1 | 0.6 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.1 | 2.2 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.1 | 1.5 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
0.1 | 0.4 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.1 | 0.4 | GO:0046386 | pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) deoxyribose phosphate catabolic process(GO:0046386) |
0.1 | 0.6 | GO:0061009 | common bile duct development(GO:0061009) |
0.1 | 0.3 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 2.1 | GO:0046415 | urate metabolic process(GO:0046415) |
0.1 | 2.1 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.1 | 1.8 | GO:0001958 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
0.1 | 0.8 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.1 | 0.3 | GO:1902527 | positive regulation of protein monoubiquitination(GO:1902527) |
0.1 | 0.3 | GO:1901374 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
0.1 | 2.4 | GO:0050913 | sensory perception of bitter taste(GO:0050913) |
0.1 | 0.5 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
0.1 | 0.8 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.1 | 0.7 | GO:0071371 | cellular response to gonadotropin stimulus(GO:0071371) |
0.1 | 1.2 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.1 | 0.4 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.1 | 2.8 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.1 | 0.4 | GO:0007183 | SMAD protein complex assembly(GO:0007183) |
0.1 | 1.9 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.1 | 0.5 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 0.3 | GO:0071674 | mononuclear cell migration(GO:0071674) |
0.1 | 0.4 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.1 | 0.3 | GO:0036079 | GDP-fucose transport(GO:0015783) purine nucleotide-sugar transport(GO:0036079) |
0.1 | 0.5 | GO:0042362 | fat-soluble vitamin biosynthetic process(GO:0042362) |
0.1 | 0.3 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.1 | 4.8 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
0.1 | 0.3 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.1 | 0.4 | GO:0010288 | response to lead ion(GO:0010288) |
0.1 | 4.7 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
0.1 | 0.1 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
0.1 | 0.5 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.1 | 1.3 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
0.1 | 0.6 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.1 | 1.4 | GO:0048662 | negative regulation of smooth muscle cell proliferation(GO:0048662) |
0.1 | 0.5 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.1 | 1.3 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.1 | 0.6 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
0.1 | 0.9 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
0.1 | 2.0 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.1 | 0.6 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.1 | 0.1 | GO:0032070 | regulation of deoxyribonuclease activity(GO:0032070) |
0.1 | 0.5 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
0.1 | 0.1 | GO:0036500 | ATF6-mediated unfolded protein response(GO:0036500) |
0.1 | 0.2 | GO:1903319 | positive regulation of protein maturation(GO:1903319) |
0.1 | 0.6 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.4 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.1 | 1.1 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.1 | 0.6 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
0.1 | 4.3 | GO:0001938 | positive regulation of endothelial cell proliferation(GO:0001938) |
0.1 | 1.5 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.1 | 1.3 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.1 | 1.2 | GO:0032570 | response to progesterone(GO:0032570) |
0.1 | 0.5 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 0.2 | GO:0046226 | coumarin catabolic process(GO:0046226) phenylpropanoid catabolic process(GO:0046271) |
0.1 | 1.2 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.1 | 2.1 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.1 | 1.2 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.1 | 0.5 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.1 | 0.5 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.1 | 0.2 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.1 | 3.2 | GO:0042775 | mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
0.1 | 0.4 | GO:0044107 | cellular alcohol metabolic process(GO:0044107) cellular alcohol biosynthetic process(GO:0044108) |
0.1 | 0.1 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.1 | 1.4 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.1 | 1.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.7 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
0.1 | 6.6 | GO:2000649 | regulation of sodium ion transmembrane transporter activity(GO:2000649) |
0.1 | 0.2 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.1 | 0.2 | GO:1900135 | positive regulation of renin secretion into blood stream(GO:1900135) |
0.1 | 0.2 | GO:2001176 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
0.1 | 0.1 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.1 | 1.2 | GO:0051043 | regulation of membrane protein ectodomain proteolysis(GO:0051043) |
0.1 | 0.3 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.1 | 6.1 | GO:0035456 | response to interferon-beta(GO:0035456) |
0.1 | 0.3 | GO:0072347 | response to anesthetic(GO:0072347) |
0.1 | 0.2 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
0.1 | 3.7 | GO:0045669 | positive regulation of osteoblast differentiation(GO:0045669) |
0.1 | 0.3 | GO:0033089 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
0.1 | 0.9 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.1 | 0.4 | GO:0060509 | negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) Type I pneumocyte differentiation(GO:0060509) |
0.1 | 1.0 | GO:0070255 | regulation of mucus secretion(GO:0070255) |
0.1 | 0.6 | GO:0008355 | olfactory learning(GO:0008355) |
0.1 | 0.1 | GO:0045976 | negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
0.1 | 0.8 | GO:0009405 | pathogenesis(GO:0009405) |
0.1 | 0.4 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.1 | 0.4 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
0.1 | 0.3 | GO:0072356 | chromosome passenger complex localization to kinetochore(GO:0072356) |
0.1 | 0.1 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.1 | 0.4 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.5 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.1 | 0.9 | GO:0019884 | antigen processing and presentation of exogenous antigen(GO:0019884) |
0.1 | 0.2 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
0.1 | 8.3 | GO:0007586 | digestion(GO:0007586) |
0.1 | 1.1 | GO:0035587 | purinergic receptor signaling pathway(GO:0035587) |
0.1 | 1.2 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.1 | 0.2 | GO:0060434 | bronchus morphogenesis(GO:0060434) |
0.1 | 0.1 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) |
0.1 | 0.1 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.1 | 1.1 | GO:0033619 | membrane protein proteolysis(GO:0033619) |
0.1 | 0.2 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.1 | 0.7 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.1 | 0.6 | GO:0001783 | B cell apoptotic process(GO:0001783) |
0.1 | 0.1 | GO:0001916 | positive regulation of T cell mediated cytotoxicity(GO:0001916) |
0.1 | 0.2 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
0.1 | 0.2 | GO:0000097 | sulfur amino acid biosynthetic process(GO:0000097) |
0.1 | 0.2 | GO:0032056 | positive regulation of translation in response to stress(GO:0032056) |
0.1 | 1.8 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.1 | 0.3 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.1 | 0.3 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
0.1 | 0.2 | GO:2000257 | regulation of protein activation cascade(GO:2000257) |
0.1 | 0.1 | GO:1902019 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
0.1 | 0.2 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.1 | 0.2 | GO:0000066 | mitochondrial ornithine transport(GO:0000066) |
0.1 | 0.1 | GO:0015801 | aromatic amino acid transport(GO:0015801) tryptophan transport(GO:0015827) |
0.1 | 0.7 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.1 | 0.3 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) positive regulation of microtubule nucleation(GO:0090063) |
0.1 | 0.2 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
0.1 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.1 | 0.3 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.1 | 0.2 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
0.1 | 0.6 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.1 | 0.4 | GO:0071586 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
0.1 | 0.1 | GO:0002911 | lymphocyte anergy(GO:0002249) regulation of T cell tolerance induction(GO:0002664) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
0.1 | 0.2 | GO:1903895 | negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
0.1 | 0.4 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
0.1 | 0.1 | GO:0060372 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
0.1 | 0.4 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.1 | 0.8 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
0.1 | 0.6 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.1 | 1.6 | GO:0000338 | protein deneddylation(GO:0000338) |
0.1 | 0.9 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.1 | 2.0 | GO:0010842 | retina layer formation(GO:0010842) |
0.1 | 0.2 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
0.1 | 0.8 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.1 | 0.2 | GO:0006577 | amino-acid betaine metabolic process(GO:0006577) |
0.1 | 0.2 | GO:1904395 | positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.1 | 0.6 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.1 | 1.0 | GO:0043277 | apoptotic cell clearance(GO:0043277) |
0.1 | 0.1 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.1 | 0.3 | GO:0097283 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
0.1 | 0.2 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.1 | 0.3 | GO:0046901 | tetrahydrofolylpolyglutamate biosynthetic process(GO:0046901) |
0.1 | 0.8 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.1 | 0.1 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
0.1 | 3.1 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.1 | 0.3 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
0.1 | 0.5 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
0.1 | 0.3 | GO:0006669 | sphinganine-1-phosphate biosynthetic process(GO:0006669) |
0.1 | 0.9 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.1 | 0.3 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
0.1 | 1.4 | GO:0042832 | defense response to protozoan(GO:0042832) |
0.1 | 0.5 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.1 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.1 | 1.3 | GO:1903405 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
0.1 | 1.6 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
0.1 | 0.6 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.1 | 2.5 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.5 | GO:0099538 | synaptic signaling via neuropeptide(GO:0099538) trans-synaptic signaling by neuropeptide(GO:0099540) trans-synaptic signaling by neuropeptide, modulating synaptic transmission(GO:0099551) |
0.1 | 0.9 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.1 | 0.2 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.1 | 0.2 | GO:0032278 | positive regulation of gonadotropin secretion(GO:0032278) |
0.1 | 0.1 | GO:0072720 | response to dithiothreitol(GO:0072720) |
0.1 | 0.2 | GO:0043307 | eosinophil activation(GO:0043307) |
0.1 | 0.2 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
0.1 | 0.3 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.1 | 0.2 | GO:0055014 | atrial cardiac muscle cell differentiation(GO:0055011) atrial cardiac muscle cell development(GO:0055014) |
0.1 | 5.4 | GO:0007229 | integrin-mediated signaling pathway(GO:0007229) |
0.1 | 1.0 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
0.1 | 1.0 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.1 | 0.8 | GO:0050832 | defense response to fungus(GO:0050832) |
0.1 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.1 | 0.2 | GO:0070904 | L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
0.1 | 0.2 | GO:0071938 | vitamin A transport(GO:0071938) vitamin A import(GO:0071939) |
0.1 | 1.1 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.1 | 0.5 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.4 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.1 | 0.3 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.2 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.1 | 0.5 | GO:0051014 | actin filament severing(GO:0051014) |
0.1 | 1.2 | GO:0030195 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
0.1 | 0.2 | GO:1904645 | response to beta-amyloid(GO:1904645) |
0.1 | 0.2 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
0.1 | 0.3 | GO:0016264 | gap junction assembly(GO:0016264) |
0.1 | 3.2 | GO:0009409 | response to cold(GO:0009409) |
0.1 | 1.9 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
0.1 | 0.2 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
0.1 | 1.6 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.1 | 0.1 | GO:0021933 | radial glia guided migration of cerebellar granule cell(GO:0021933) |
0.1 | 0.7 | GO:0006108 | malate metabolic process(GO:0006108) |
0.1 | 0.6 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.1 | 0.4 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.1 | GO:0014908 | myotube differentiation involved in skeletal muscle regeneration(GO:0014908) |
0.1 | 0.4 | GO:0035994 | response to muscle stretch(GO:0035994) |
0.1 | 0.1 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.1 | 3.8 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
0.1 | 4.3 | GO:1903844 | regulation of cellular response to transforming growth factor beta stimulus(GO:1903844) |
0.1 | 0.5 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.1 | 0.3 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.1 | 0.4 | GO:0033216 | ferric iron import(GO:0033216) |
0.1 | 0.3 | GO:0048753 | pigment granule organization(GO:0048753) |
0.1 | 0.1 | GO:0002016 | regulation of blood volume by renin-angiotensin(GO:0002016) |
0.1 | 0.2 | GO:0002380 | immunoglobulin secretion involved in immune response(GO:0002380) |
0.1 | 0.2 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.1 | 0.5 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.1 | 0.1 | GO:0032902 | nerve growth factor production(GO:0032902) |
0.1 | 0.9 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.1 | 0.3 | GO:0061187 | regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
0.1 | 0.3 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.1 | 1.6 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
0.1 | 3.5 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.1 | 0.1 | GO:0051611 | serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) |
0.1 | 0.9 | GO:0002548 | monocyte chemotaxis(GO:0002548) |
0.1 | 0.3 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.1 | 0.4 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 1.5 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.1 | 0.1 | GO:0002677 | negative regulation of chronic inflammatory response(GO:0002677) |
0.1 | 0.3 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
0.1 | 0.4 | GO:0051353 | positive regulation of oxidoreductase activity(GO:0051353) |
0.1 | 0.3 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.1 | 0.1 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.1 | 0.2 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.1 | 0.4 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.5 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.1 | 0.3 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.1 | 1.6 | GO:0045026 | plasma membrane fusion(GO:0045026) |
0.1 | 0.1 | GO:2001016 | positive regulation of skeletal muscle cell differentiation(GO:2001016) |
0.1 | 0.1 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.1 | 0.4 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 0.6 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.1 | 0.7 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.1 | 0.2 | GO:0014819 | regulation of skeletal muscle contraction(GO:0014819) |
0.1 | 2.1 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.1 | 0.2 | GO:0072268 | pattern specification involved in metanephros development(GO:0072268) |
0.1 | 2.2 | GO:0042990 | regulation of transcription factor import into nucleus(GO:0042990) |
0.1 | 0.2 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.2 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.1 | 0.2 | GO:0009071 | serine family amino acid catabolic process(GO:0009071) |
0.1 | 0.2 | GO:0097201 | negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
0.1 | 0.2 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.1 | 0.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 0.6 | GO:2000580 | regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
0.1 | 0.3 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.1 | 0.2 | GO:0036245 | cellular response to menadione(GO:0036245) |
0.1 | 0.2 | GO:0035878 | nail development(GO:0035878) |
0.1 | 0.2 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.1 | 0.9 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.1 | 0.1 | GO:0021546 | rhombomere development(GO:0021546) |
0.1 | 0.6 | GO:0032069 | regulation of nuclease activity(GO:0032069) |
0.1 | 0.3 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.1 | 0.6 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.1 | 0.4 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 0.2 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.1 | 0.2 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.1 | 0.1 | GO:0007439 | ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
0.1 | 0.2 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.1 | 0.2 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.1 | 0.2 | GO:0071630 | nucleus-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071630) |
0.1 | 0.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.1 | 0.4 | GO:0090382 | phagosome maturation(GO:0090382) |
0.1 | 1.3 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.1 | 0.3 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 0.3 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
0.1 | 0.1 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) |
0.1 | 0.4 | GO:0006907 | pinocytosis(GO:0006907) |
0.1 | 0.6 | GO:0019731 | antibacterial humoral response(GO:0019731) |
0.0 | 0.3 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.0 | 0.0 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.0 | 0.3 | GO:0071569 | protein ufmylation(GO:0071569) |
0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.0 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.0 | 0.2 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.2 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
0.0 | 0.1 | GO:0035702 | monocyte homeostasis(GO:0035702) |
0.0 | 0.0 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.0 | 0.3 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.4 | GO:0033622 | integrin activation(GO:0033622) |
0.0 | 0.5 | GO:0050687 | negative regulation of defense response to virus(GO:0050687) |
0.0 | 0.3 | GO:1901842 | negative regulation of high voltage-gated calcium channel activity(GO:1901842) |
0.0 | 0.3 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.0 | 0.4 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.2 | GO:0048664 | neuron fate determination(GO:0048664) |
0.0 | 0.6 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.1 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.0 | 3.6 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
0.0 | 0.3 | GO:0098828 | modulation of inhibitory postsynaptic potential(GO:0098828) |
0.0 | 0.7 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.1 | GO:0021815 | modulation of microtubule cytoskeleton involved in cerebral cortex radial glia guided migration(GO:0021815) |
0.0 | 0.7 | GO:0070296 | sarcoplasmic reticulum calcium ion transport(GO:0070296) |
0.0 | 0.4 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
0.0 | 0.8 | GO:0060393 | regulation of pathway-restricted SMAD protein phosphorylation(GO:0060393) |
0.0 | 0.4 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.0 | 0.2 | GO:0002084 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.7 | GO:0051573 | negative regulation of histone H3-K9 methylation(GO:0051573) |
0.0 | 0.4 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.0 | 0.2 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 0.3 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
0.0 | 0.4 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.4 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.0 | 0.2 | GO:0000423 | macromitophagy(GO:0000423) |
0.0 | 0.2 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.1 | GO:0032753 | positive regulation of interleukin-4 production(GO:0032753) |
0.0 | 0.3 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.0 | 1.3 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
0.0 | 0.1 | GO:1901377 | mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) |
0.0 | 0.1 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 1.4 | GO:0030834 | regulation of actin filament depolymerization(GO:0030834) |
0.0 | 0.1 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.0 | 0.6 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.2 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
0.0 | 0.1 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
0.0 | 0.0 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.0 | 0.1 | GO:0030472 | mitotic spindle organization in nucleus(GO:0030472) |
0.0 | 0.1 | GO:0097104 | postsynaptic membrane assembly(GO:0097104) |
0.0 | 0.1 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
0.0 | 0.4 | GO:0008210 | estrogen metabolic process(GO:0008210) |
0.0 | 0.6 | GO:0009251 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.0 | 0.3 | GO:0086036 | regulation of cardiac muscle cell membrane potential(GO:0086036) |
0.0 | 0.4 | GO:0001706 | endoderm formation(GO:0001706) |
0.0 | 0.1 | GO:0030887 | positive regulation of myeloid dendritic cell activation(GO:0030887) |
0.0 | 0.1 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
0.0 | 0.9 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
0.0 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.0 | 0.1 | GO:0018377 | protein myristoylation(GO:0018377) |
0.0 | 0.6 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.0 | 0.1 | GO:0072235 | distal convoluted tubule development(GO:0072025) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) |
0.0 | 0.1 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
0.0 | 0.5 | GO:0002021 | response to dietary excess(GO:0002021) |
0.0 | 0.1 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
0.0 | 0.1 | GO:0060795 | cell fate commitment involved in formation of primary germ layer(GO:0060795) |
0.0 | 0.1 | GO:0000448 | cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
0.0 | 0.0 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
0.0 | 0.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.0 | 0.1 | GO:2000178 | negative regulation of neural precursor cell proliferation(GO:2000178) |
0.0 | 0.1 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.0 | 0.1 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.0 | 0.2 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
0.0 | 0.5 | GO:0060285 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
0.0 | 0.1 | GO:0009838 | abscission(GO:0009838) |
0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.0 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.0 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
0.0 | 0.1 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.0 | 0.1 | GO:0006233 | dTDP biosynthetic process(GO:0006233) dTDP metabolic process(GO:0046072) |
0.0 | 0.1 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.1 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
0.0 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.0 | 0.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.1 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.5 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.0 | 0.1 | GO:0051309 | female meiosis chromosome separation(GO:0051309) |
0.0 | 0.0 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
0.0 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.1 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.4 | GO:0071625 | vocalization behavior(GO:0071625) |
0.0 | 0.1 | GO:0097475 | motor neuron migration(GO:0097475) |
0.0 | 0.0 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.3 | GO:0090280 | positive regulation of calcium ion import(GO:0090280) |
0.0 | 0.7 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.0 | 0.1 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.0 | 0.0 | GO:0060463 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
0.0 | 0.0 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.0 | 0.1 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
0.0 | 0.0 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.1 | GO:0098868 | bone growth(GO:0098868) |
0.0 | 0.0 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.0 | 0.1 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
0.0 | 0.1 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
0.0 | 0.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.0 | 0.0 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.0 | 0.0 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
0.0 | 0.3 | GO:1902547 | regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
0.0 | 0.0 | GO:0002358 | B cell homeostatic proliferation(GO:0002358) |
0.0 | 0.0 | GO:1903348 | positive regulation of bicellular tight junction assembly(GO:1903348) |
0.0 | 0.2 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.0 | 0.1 | GO:0016246 | RNA interference(GO:0016246) |
0.0 | 0.0 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.0 | 0.0 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.1 | GO:0036451 | cap mRNA methylation(GO:0036451) |
0.0 | 0.2 | GO:0042308 | negative regulation of protein import into nucleus(GO:0042308) negative regulation of protein import(GO:1904590) |
0.0 | 0.0 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
0.0 | 0.0 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.2 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
0.0 | 0.0 | GO:0061055 | myotome development(GO:0061055) |
0.0 | 0.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.0 | 0.1 | GO:0006817 | phosphate ion transport(GO:0006817) |
0.0 | 0.1 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.0 | 0.0 | GO:0060452 | positive regulation of cardiac muscle contraction(GO:0060452) |
0.0 | 0.3 | GO:0030168 | platelet activation(GO:0030168) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.3 | 6.8 | GO:0005584 | collagen type I trimer(GO:0005584) |
2.1 | 6.2 | GO:0031904 | endosome lumen(GO:0031904) |
1.4 | 5.7 | GO:0071953 | elastic fiber(GO:0071953) |
1.4 | 5.7 | GO:0043511 | inhibin complex(GO:0043511) |
1.4 | 8.6 | GO:1903439 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
1.4 | 4.1 | GO:0061474 | phagolysosome membrane(GO:0061474) |
1.3 | 12.0 | GO:0005577 | fibrinogen complex(GO:0005577) |
1.3 | 5.3 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
1.3 | 3.9 | GO:0044302 | dentate gyrus mossy fiber(GO:0044302) |
1.3 | 2.6 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
1.3 | 5.1 | GO:0043259 | laminin-10 complex(GO:0043259) |
1.3 | 5.0 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
1.2 | 8.1 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
1.1 | 3.4 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
1.1 | 15.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
1.0 | 5.1 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
1.0 | 5.0 | GO:0045160 | myosin I complex(GO:0045160) |
1.0 | 4.9 | GO:0044279 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
1.0 | 11.8 | GO:0042613 | MHC class II protein complex(GO:0042613) |
1.0 | 5.9 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.9 | 2.8 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
0.9 | 22.9 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.9 | 0.9 | GO:0032010 | phagolysosome(GO:0032010) |
0.9 | 8.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.8 | 3.3 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.8 | 12.0 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.8 | 3.9 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.8 | 2.3 | GO:0043540 | 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase complex(GO:0043540) |
0.8 | 6.2 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.8 | 2.3 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
0.8 | 7.6 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.7 | 3.6 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.7 | 4.2 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.7 | 2.0 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.6 | 5.2 | GO:0042825 | TAP complex(GO:0042825) |
0.6 | 3.8 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.6 | 1.9 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
0.6 | 1.8 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
0.6 | 0.6 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.6 | 1.7 | GO:0060187 | cell pole(GO:0060187) |
0.6 | 1.7 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.6 | 2.8 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.5 | 3.2 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.5 | 12.8 | GO:0005614 | interstitial matrix(GO:0005614) |
0.5 | 1.0 | GO:0032437 | cuticular plate(GO:0032437) |
0.5 | 5.7 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
0.5 | 2.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.5 | 3.5 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.5 | 1.0 | GO:0031166 | integral component of vacuolar membrane(GO:0031166) intrinsic component of vacuolar membrane(GO:0031310) |
0.5 | 1.9 | GO:0030312 | external encapsulating structure(GO:0030312) |
0.5 | 1.9 | GO:0044194 | cytolytic granule(GO:0044194) |
0.5 | 5.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.5 | 2.3 | GO:0017177 | glucosidase II complex(GO:0017177) |
0.5 | 2.3 | GO:0035976 | AP1 complex(GO:0035976) |
0.5 | 1.4 | GO:1990879 | CST complex(GO:1990879) |
0.5 | 0.9 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.4 | 1.8 | GO:1990429 | Pex17p-Pex14p docking complex(GO:1990415) peroxisomal importomer complex(GO:1990429) |
0.4 | 1.7 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.4 | 6.5 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.4 | 6.8 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.4 | 5.5 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.4 | 3.8 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.4 | 3.8 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.4 | 1.7 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.4 | 1.7 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.4 | 3.7 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.4 | 6.5 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.4 | 1.2 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.4 | 3.2 | GO:0000322 | storage vacuole(GO:0000322) |
0.4 | 2.4 | GO:0031523 | Myb complex(GO:0031523) |
0.4 | 4.3 | GO:0031931 | TORC1 complex(GO:0031931) |
0.4 | 1.9 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.4 | 1.1 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.4 | 4.5 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.4 | 6.1 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
0.4 | 5.6 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.4 | 1.1 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
0.4 | 1.9 | GO:0005605 | basal lamina(GO:0005605) |
0.4 | 1.1 | GO:1990031 | pinceau fiber(GO:1990031) |
0.4 | 0.7 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.4 | 0.7 | GO:0034684 | integrin alphav-beta5 complex(GO:0034684) |
0.3 | 5.2 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
0.3 | 1.0 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
0.3 | 1.7 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
0.3 | 8.5 | GO:0032426 | stereocilium tip(GO:0032426) |
0.3 | 1.7 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
0.3 | 1.0 | GO:0032997 | Fc receptor complex(GO:0032997) Fc-epsilon receptor I complex(GO:0032998) |
0.3 | 5.3 | GO:0042555 | MCM complex(GO:0042555) |
0.3 | 4.6 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.3 | 1.0 | GO:0044393 | microspike(GO:0044393) |
0.3 | 1.3 | GO:0045281 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
0.3 | 0.9 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
0.3 | 8.5 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.3 | 3.4 | GO:0098845 | postsynaptic endosome(GO:0098845) |
0.3 | 0.6 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.3 | 1.5 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.3 | 2.2 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.3 | 0.9 | GO:0048179 | activin receptor complex(GO:0048179) |
0.3 | 2.4 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.3 | 2.8 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.3 | 1.2 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.3 | 0.6 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.3 | 3.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.3 | 1.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.3 | 2.0 | GO:0071914 | prominosome(GO:0071914) |
0.3 | 1.7 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.3 | 0.3 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.3 | 14.5 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.3 | 12.1 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.3 | 67.8 | GO:0072562 | blood microparticle(GO:0072562) |
0.3 | 1.4 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.3 | 0.6 | GO:0014704 | intercalated disc(GO:0014704) |
0.3 | 1.4 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.3 | 2.8 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.3 | 1.6 | GO:0097433 | dense body(GO:0097433) |
0.3 | 7.6 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.3 | 0.8 | GO:0036398 | TCR signalosome(GO:0036398) |
0.3 | 1.8 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.3 | 2.9 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.3 | 2.9 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.3 | 4.7 | GO:0036038 | MKS complex(GO:0036038) |
0.3 | 4.2 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.3 | 1.0 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.3 | 4.4 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.3 | 1.8 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.3 | 1.8 | GO:1990357 | terminal web(GO:1990357) |
0.3 | 1.0 | GO:0097447 | dendritic tree(GO:0097447) |
0.3 | 1.0 | GO:1990032 | parallel fiber(GO:1990032) |
0.3 | 0.8 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.2 | 4.7 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.2 | 3.7 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
0.2 | 22.7 | GO:0005581 | collagen trimer(GO:0005581) |
0.2 | 1.5 | GO:0045180 | basal cortex(GO:0045180) |
0.2 | 1.2 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.2 | 6.4 | GO:0031528 | microvillus membrane(GO:0031528) |
0.2 | 1.9 | GO:0097427 | microtubule bundle(GO:0097427) |
0.2 | 1.8 | GO:0008091 | spectrin(GO:0008091) |
0.2 | 1.1 | GO:0005687 | U4 snRNP(GO:0005687) |
0.2 | 0.9 | GO:1990795 | lateral part of cell(GO:0097574) basolateral part of cell(GO:1990794) rod bipolar cell terminal bouton(GO:1990795) photoreceptor cell terminal bouton(GO:1990796) |
0.2 | 0.5 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.2 | 1.1 | GO:0032994 | protein-lipid complex(GO:0032994) |
0.2 | 2.9 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.2 | 2.9 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.2 | 1.1 | GO:0034687 | integrin alphaL-beta2 complex(GO:0034687) |
0.2 | 2.0 | GO:0031983 | vesicle lumen(GO:0031983) |
0.2 | 1.1 | GO:0097443 | sorting endosome(GO:0097443) |
0.2 | 1.3 | GO:0031082 | BLOC complex(GO:0031082) |
0.2 | 5.7 | GO:0043218 | compact myelin(GO:0043218) |
0.2 | 3.0 | GO:0043203 | axon hillock(GO:0043203) |
0.2 | 2.6 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.2 | 5.2 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
0.2 | 0.4 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.2 | 1.3 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.2 | 2.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.2 | 1.3 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.2 | 1.7 | GO:0033269 | internode region of axon(GO:0033269) |
0.2 | 0.8 | GO:0036284 | tubulobulbar complex(GO:0036284) |
0.2 | 0.6 | GO:0005760 | gamma DNA polymerase complex(GO:0005760) |
0.2 | 0.8 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.2 | 2.8 | GO:0046930 | pore complex(GO:0046930) |
0.2 | 1.6 | GO:0033270 | paranode region of axon(GO:0033270) |
0.2 | 1.2 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.2 | 0.6 | GO:0044317 | rod spherule(GO:0044317) |
0.2 | 0.2 | GO:0016460 | myosin II complex(GO:0016460) |
0.2 | 0.2 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
0.2 | 0.6 | GO:0005900 | oncostatin-M receptor complex(GO:0005900) |
0.2 | 0.8 | GO:0005757 | mitochondrial permeability transition pore complex(GO:0005757) |
0.2 | 0.6 | GO:0036387 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
0.2 | 2.9 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.2 | 0.8 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
0.2 | 7.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.2 | 0.7 | GO:0002111 | BRCA2-BRAF35 complex(GO:0002111) |
0.2 | 0.7 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.2 | 0.6 | GO:0070992 | translation initiation complex(GO:0070992) |
0.2 | 1.6 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.2 | 0.7 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.2 | 1.6 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.2 | 1.9 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) |
0.2 | 0.9 | GO:0071797 | LUBAC complex(GO:0071797) |
0.2 | 41.4 | GO:0044391 | ribosomal subunit(GO:0044391) |
0.2 | 0.5 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
0.2 | 0.5 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
0.2 | 0.2 | GO:0043083 | synaptic cleft(GO:0043083) |
0.2 | 2.2 | GO:0034709 | methylosome(GO:0034709) |
0.2 | 0.9 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.2 | 1.2 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.2 | 0.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.2 | 1.5 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.2 | 3.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.2 | 2.1 | GO:0042611 | MHC protein complex(GO:0042611) |
0.2 | 0.2 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
0.2 | 0.3 | GO:0002945 | cyclin K-CDK13 complex(GO:0002945) |
0.2 | 4.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.2 | 2.9 | GO:0031143 | pseudopodium(GO:0031143) |
0.2 | 1.4 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.2 | 2.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.2 | 1.9 | GO:0016011 | dystroglycan complex(GO:0016011) |
0.2 | 264.3 | GO:0005615 | extracellular space(GO:0005615) |
0.2 | 9.1 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.2 | 1.1 | GO:1990635 | proximal dendrite(GO:1990635) |
0.2 | 0.5 | GO:0036501 | UFD1-NPL4 complex(GO:0036501) |
0.2 | 0.3 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.1 | 0.3 | GO:0044753 | amphisome(GO:0044753) |
0.1 | 62.3 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.1 | 3.9 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.1 | 3.6 | GO:0005922 | connexon complex(GO:0005922) |
0.1 | 0.3 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
0.1 | 0.7 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 0.6 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 1.7 | GO:0038201 | TORC2 complex(GO:0031932) TOR complex(GO:0038201) |
0.1 | 3.3 | GO:0070069 | cytochrome complex(GO:0070069) |
0.1 | 1.7 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.1 | 1.6 | GO:0032584 | growth cone membrane(GO:0032584) |
0.1 | 1.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.1 | 1.5 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 0.3 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.1 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.1 | 2.9 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.1 | 1.2 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.1 | 0.9 | GO:0070938 | contractile ring(GO:0070938) |
0.1 | 0.4 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 1.1 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 0.8 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 0.7 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.1 | 1.1 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 5.3 | GO:0032420 | stereocilium(GO:0032420) |
0.1 | 4.0 | GO:0034706 | sodium channel complex(GO:0034706) |
0.1 | 0.8 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 15.0 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.1 | 1.5 | GO:0000801 | central element(GO:0000801) |
0.1 | 0.9 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) |
0.1 | 0.7 | GO:0031902 | late endosome membrane(GO:0031902) |
0.1 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.1 | 0.5 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 0.8 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 6.6 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.1 | 1.1 | GO:0030904 | retromer complex(GO:0030904) |
0.1 | 1.8 | GO:0044438 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
0.1 | 0.7 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.1 | 4.0 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.1 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.5 | GO:0031527 | filopodium membrane(GO:0031527) |
0.1 | 1.4 | GO:0032432 | actin filament bundle(GO:0032432) |
0.1 | 1.0 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 4.8 | GO:0051233 | spindle midzone(GO:0051233) |
0.1 | 0.3 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 0.3 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 1.5 | GO:0005869 | dynactin complex(GO:0005869) |
0.1 | 2.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.1 | 2.3 | GO:0001891 | phagocytic cup(GO:0001891) |
0.1 | 0.3 | GO:0098855 | HCN channel complex(GO:0098855) |
0.1 | 1.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.1 | 1.5 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 0.3 | GO:0034456 | CURI complex(GO:0032545) UTP-C complex(GO:0034456) |
0.1 | 2.3 | GO:0001772 | immunological synapse(GO:0001772) |
0.1 | 0.4 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
0.1 | 5.2 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.1 | 0.4 | GO:1990745 | EARP complex(GO:1990745) |
0.1 | 0.6 | GO:0008537 | proteasome activator complex(GO:0008537) |
0.1 | 0.5 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.1 | 0.8 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.8 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 1.7 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 0.3 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.1 | 0.5 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
0.1 | 0.5 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 1.5 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 1.0 | GO:0042382 | paraspeckles(GO:0042382) |
0.1 | 0.4 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.7 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.2 | GO:0000235 | astral microtubule(GO:0000235) |
0.1 | 0.3 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 1.9 | GO:0044453 | nuclear membrane part(GO:0044453) |
0.1 | 0.5 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 2.9 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.1 | 0.9 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 3.1 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 1.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.1 | 0.6 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
0.1 | 1.0 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 1.7 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 0.6 | GO:0036396 | MIS complex(GO:0036396) |
0.1 | 0.3 | GO:0071817 | MMXD complex(GO:0071817) |
0.1 | 4.1 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.1 | 0.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 4.2 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.1 | 0.8 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.1 | 0.8 | GO:0043194 | axon initial segment(GO:0043194) |
0.1 | 1.0 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.6 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 1.1 | GO:0030990 | intraciliary transport particle(GO:0030990) |
0.1 | 0.5 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 0.1 | GO:0097632 | extrinsic component of pre-autophagosomal structure membrane(GO:0097632) |
0.1 | 0.1 | GO:0035859 | Seh1-associated complex(GO:0035859) |
0.1 | 1.0 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.1 | 0.3 | GO:0071821 | FANCM-MHF complex(GO:0071821) |
0.1 | 0.2 | GO:0042599 | lamellar body(GO:0042599) |
0.1 | 8.8 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.1 | 0.1 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
0.1 | 7.5 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.1 | 0.2 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
0.1 | 0.3 | GO:0031251 | PAN complex(GO:0031251) |
0.1 | 0.4 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.1 | 0.8 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.1 | 3.0 | GO:0031901 | early endosome membrane(GO:0031901) |
0.1 | 2.8 | GO:0005902 | microvillus(GO:0005902) |
0.1 | 1.1 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 0.8 | GO:0005921 | gap junction(GO:0005921) |
0.1 | 0.1 | GO:0070161 | anchoring junction(GO:0070161) |
0.1 | 0.3 | GO:0098890 | extrinsic component of postsynaptic membrane(GO:0098890) |
0.1 | 1.2 | GO:0005652 | nuclear lamina(GO:0005652) |
0.1 | 3.0 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.1 | 1.5 | GO:0031526 | brush border membrane(GO:0031526) |
0.1 | 0.2 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.1 | 1.4 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.1 | 0.2 | GO:0031417 | NatC complex(GO:0031417) |
0.1 | 0.6 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.4 | GO:0042629 | mast cell granule(GO:0042629) |
0.1 | 0.5 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.1 | 0.1 | GO:0070877 | microprocessor complex(GO:0070877) ribonuclease III complex(GO:1903095) |
0.1 | 0.2 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.1 | 0.9 | GO:0000974 | Prp19 complex(GO:0000974) |
0.1 | 20.4 | GO:0005912 | adherens junction(GO:0005912) |
0.1 | 0.4 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.1 | 0.6 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.5 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 0.4 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 4.7 | GO:0005923 | bicellular tight junction(GO:0005923) |
0.1 | 2.5 | GO:0016459 | myosin complex(GO:0016459) |
0.1 | 0.4 | GO:0097470 | ribbon synapse(GO:0097470) |
0.1 | 0.3 | GO:0099524 | region of cytosol(GO:0099522) postsynaptic cytosol(GO:0099524) |
0.1 | 1.0 | GO:0005682 | U5 snRNP(GO:0005682) |
0.1 | 0.5 | GO:0097225 | sperm midpiece(GO:0097225) |
0.1 | 0.6 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 1.5 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 18.7 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.0 | 1.1 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.2 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.1 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 13.2 | GO:0045121 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
0.0 | 0.3 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 2.0 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 3.4 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 1.2 | GO:0045178 | basal part of cell(GO:0045178) |
0.0 | 0.7 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 1.1 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.8 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.4 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 0.1 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
0.0 | 0.1 | GO:0000308 | cytoplasmic cyclin-dependent protein kinase holoenzyme complex(GO:0000308) |
0.0 | 1.8 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.9 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.4 | GO:0090568 | nuclear transcriptional repressor complex(GO:0090568) |
0.0 | 0.2 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.3 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.0 | 0.2 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
0.0 | 2.6 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.2 | GO:0042588 | zymogen granule(GO:0042588) |
0.0 | 2.6 | GO:0005882 | intermediate filament(GO:0005882) |
0.0 | 0.0 | GO:0032797 | SMN complex(GO:0032797) |
0.0 | 0.0 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 0.5 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.6 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.0 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 11.6 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
0.0 | 7.0 | GO:0043235 | receptor complex(GO:0043235) |
0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 1.1 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 5.0 | GO:0009897 | external side of plasma membrane(GO:0009897) |
0.0 | 4.4 | GO:0031966 | mitochondrial membrane(GO:0031966) |
0.0 | 0.5 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
0.0 | 0.4 | GO:0061702 | inflammasome complex(GO:0061702) |
0.0 | 2.2 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.0 | 1.0 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 39.9 | GO:1903561 | extracellular vesicle(GO:1903561) |
0.0 | 17.3 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
0.0 | 0.4 | GO:0005903 | brush border(GO:0005903) |
0.0 | 0.0 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 57.7 | GO:0016021 | integral component of membrane(GO:0016021) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.7 | 8.2 | GO:0034012 | glycerone kinase activity(GO:0004371) FAD-AMP lyase (cyclizing) activity(GO:0034012) triokinase activity(GO:0050354) |
2.2 | 8.8 | GO:0004478 | methionine adenosyltransferase activity(GO:0004478) |
2.1 | 16.4 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
1.9 | 5.6 | GO:0008775 | acetate CoA-transferase activity(GO:0008775) |
1.8 | 5.5 | GO:0047006 | 17-alpha,20-alpha-dihydroxypregn-4-en-3-one dehydrogenase activity(GO:0047006) |
1.8 | 5.4 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
1.8 | 5.4 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
1.8 | 5.4 | GO:0004771 | sterol esterase activity(GO:0004771) |
1.8 | 5.3 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
1.7 | 10.5 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
1.7 | 10.4 | GO:0030294 | receptor signaling protein tyrosine kinase inhibitor activity(GO:0030294) |
1.7 | 1.7 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
1.6 | 4.7 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
1.6 | 15.5 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
1.5 | 6.2 | GO:0004736 | pyruvate carboxylase activity(GO:0004736) |
1.5 | 4.5 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
1.5 | 3.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
1.4 | 7.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
1.4 | 8.6 | GO:0097643 | amylin receptor activity(GO:0097643) |
1.4 | 4.2 | GO:0046980 | peptide antigen-transporting ATPase activity(GO:0015433) tapasin binding(GO:0046980) |
1.4 | 9.6 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
1.4 | 6.8 | GO:0070051 | fibrinogen binding(GO:0070051) |
1.3 | 5.3 | GO:0004103 | choline kinase activity(GO:0004103) |
1.3 | 5.1 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
1.3 | 1.3 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
1.3 | 8.8 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
1.2 | 3.7 | GO:1990698 | palmitoleoyltransferase activity(GO:1990698) |
1.2 | 4.7 | GO:0047016 | cholest-5-ene-3-beta,7-alpha-diol 3-beta-dehydrogenase activity(GO:0047016) |
1.2 | 3.5 | GO:0004370 | glycerol kinase activity(GO:0004370) |
1.1 | 1.1 | GO:0002061 | uracil binding(GO:0002058) pyrimidine nucleobase binding(GO:0002061) |
1.1 | 8.0 | GO:0015091 | ferric iron transmembrane transporter activity(GO:0015091) trivalent inorganic cation transmembrane transporter activity(GO:0072510) |
1.1 | 3.4 | GO:0033971 | hydroxyisourate hydrolase activity(GO:0033971) |
1.1 | 3.3 | GO:0004998 | transferrin receptor activity(GO:0004998) |
1.1 | 3.2 | GO:0016901 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
1.0 | 4.1 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
1.0 | 3.1 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
1.0 | 3.0 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
1.0 | 7.0 | GO:0004991 | parathyroid hormone receptor activity(GO:0004991) |
1.0 | 3.0 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
1.0 | 2.9 | GO:0016034 | maleylacetoacetate isomerase activity(GO:0016034) |
1.0 | 3.9 | GO:0030023 | extracellular matrix constituent conferring elasticity(GO:0030023) |
1.0 | 1.0 | GO:0031433 | telethonin binding(GO:0031433) |
1.0 | 1.0 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
1.0 | 5.7 | GO:0008453 | alanine-glyoxylate transaminase activity(GO:0008453) |
0.9 | 2.8 | GO:0015152 | glucose-6-phosphate transmembrane transporter activity(GO:0015152) |
0.9 | 6.6 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.9 | 2.8 | GO:0004613 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
0.9 | 3.7 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) |
0.9 | 7.3 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.9 | 3.6 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.9 | 3.5 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.9 | 3.5 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.9 | 2.6 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
0.9 | 3.5 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.9 | 3.5 | GO:0047726 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) iron-cytochrome-c reductase activity(GO:0047726) |
0.9 | 3.4 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
0.9 | 8.6 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.9 | 2.6 | GO:0005017 | platelet-derived growth factor-activated receptor activity(GO:0005017) |
0.8 | 5.1 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.8 | 2.5 | GO:0004067 | asparaginase activity(GO:0004067) |
0.8 | 2.5 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.8 | 1.6 | GO:1902271 | D3 vitamins binding(GO:1902271) |
0.8 | 6.6 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.8 | 5.7 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.8 | 3.3 | GO:0003883 | CTP synthase activity(GO:0003883) |
0.8 | 11.4 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.8 | 3.2 | GO:0042806 | fucose binding(GO:0042806) |
0.8 | 3.2 | GO:0005118 | sevenless binding(GO:0005118) |
0.8 | 4.9 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.8 | 2.4 | GO:0008127 | quercetin 2,3-dioxygenase activity(GO:0008127) |
0.8 | 3.2 | GO:0030984 | kininogen binding(GO:0030984) |
0.8 | 2.4 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.8 | 3.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.8 | 1.6 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
0.8 | 3.9 | GO:0035478 | chylomicron binding(GO:0035478) |
0.8 | 3.9 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.8 | 2.3 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
0.8 | 4.6 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.8 | 3.0 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
0.8 | 2.3 | GO:0034632 | retinol transporter activity(GO:0034632) |
0.8 | 8.3 | GO:0015217 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
0.7 | 1.5 | GO:0034189 | very-low-density lipoprotein particle binding(GO:0034189) |
0.7 | 3.7 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.7 | 4.3 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.7 | 2.1 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
0.7 | 14.7 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.7 | 2.1 | GO:0001729 | ceramide kinase activity(GO:0001729) |
0.7 | 6.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.7 | 0.7 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
0.7 | 2.7 | GO:0004335 | galactokinase activity(GO:0004335) |
0.7 | 10.8 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
0.7 | 4.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.7 | 5.4 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.7 | 3.4 | GO:0015254 | glycerol channel activity(GO:0015254) |
0.7 | 5.4 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.7 | 2.7 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.7 | 3.3 | GO:0004051 | arachidonate 5-lipoxygenase activity(GO:0004051) |
0.7 | 1.3 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.7 | 2.6 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
0.6 | 2.6 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.6 | 4.5 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.6 | 4.5 | GO:0051425 | PTB domain binding(GO:0051425) |
0.6 | 5.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.6 | 2.6 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.6 | 1.9 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.6 | 2.6 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.6 | 2.5 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.6 | 6.3 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.6 | 20.1 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.6 | 2.5 | GO:0005499 | vitamin D binding(GO:0005499) |
0.6 | 3.7 | GO:0015232 | heme transporter activity(GO:0015232) |
0.6 | 3.1 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.6 | 1.8 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
0.6 | 3.7 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.6 | 3.0 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.6 | 5.5 | GO:0034711 | inhibin binding(GO:0034711) |
0.6 | 3.6 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.6 | 9.0 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.6 | 7.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.6 | 4.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.6 | 4.1 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.6 | 1.8 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
0.6 | 1.8 | GO:0003858 | 3-hydroxybutyrate dehydrogenase activity(GO:0003858) |
0.6 | 3.5 | GO:0008142 | oxysterol binding(GO:0008142) |
0.6 | 3.5 | GO:0032810 | sterol response element binding(GO:0032810) |
0.6 | 1.2 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.6 | 2.3 | GO:0005534 | galactose binding(GO:0005534) |
0.6 | 4.0 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.6 | 2.2 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.6 | 1.7 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
0.6 | 3.3 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.6 | 1.7 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.6 | 2.2 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.6 | 3.3 | GO:0017002 | activin receptor activity, type I(GO:0016361) activin-activated receptor activity(GO:0017002) |
0.6 | 1.7 | GO:0005011 | macrophage colony-stimulating factor receptor activity(GO:0005011) |
0.6 | 1.7 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.5 | 1.6 | GO:1990699 | palmitoleyl hydrolase activity(GO:1990699) |
0.5 | 1.6 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.5 | 2.7 | GO:0048495 | Roundabout binding(GO:0048495) |
0.5 | 2.2 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.5 | 1.6 | GO:0008480 | sarcosine dehydrogenase activity(GO:0008480) |
0.5 | 7.5 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.5 | 4.3 | GO:0032052 | bile acid binding(GO:0032052) |
0.5 | 2.7 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.5 | 0.5 | GO:0046997 | oxidoreductase activity, acting on the CH-NH group of donors, flavin as acceptor(GO:0046997) |
0.5 | 2.1 | GO:0001733 | galactosylceramide sulfotransferase activity(GO:0001733) |
0.5 | 23.7 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.5 | 1.6 | GO:0003977 | UDP-N-acetylglucosamine diphosphorylase activity(GO:0003977) |
0.5 | 5.2 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.5 | 1.6 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.5 | 6.3 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.5 | 4.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.5 | 4.1 | GO:0008199 | ferric iron binding(GO:0008199) |
0.5 | 2.5 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.5 | 5.5 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.5 | 1.5 | GO:0015292 | uniporter activity(GO:0015292) |
0.5 | 2.0 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.5 | 1.5 | GO:0035939 | microsatellite binding(GO:0035939) |
0.5 | 6.4 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.5 | 3.9 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.5 | 2.0 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.5 | 5.3 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.5 | 1.9 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.5 | 2.9 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.5 | 2.4 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
0.5 | 1.9 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.5 | 2.4 | GO:0005124 | scavenger receptor binding(GO:0005124) |
0.5 | 10.9 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.5 | 1.4 | GO:0016213 | linoleoyl-CoA desaturase activity(GO:0016213) |
0.5 | 5.6 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.5 | 1.9 | GO:0051435 | BH4 domain binding(GO:0051435) |
0.5 | 1.4 | GO:0016803 | ether hydrolase activity(GO:0016803) |
0.5 | 4.1 | GO:0001968 | fibronectin binding(GO:0001968) |
0.5 | 2.3 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.5 | 1.4 | GO:0008456 | alpha-N-acetylgalactosaminidase activity(GO:0008456) |
0.5 | 1.8 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.5 | 5.4 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.5 | 1.4 | GO:0001851 | complement component C3b binding(GO:0001851) |
0.5 | 1.4 | GO:0005308 | creatine transmembrane transporter activity(GO:0005308) |
0.5 | 4.5 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.5 | 1.4 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.4 | 1.3 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
0.4 | 0.9 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.4 | 1.3 | GO:0003999 | adenine binding(GO:0002055) adenine phosphoribosyltransferase activity(GO:0003999) |
0.4 | 2.7 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.4 | 2.2 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.4 | 3.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.4 | 5.3 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.4 | 7.5 | GO:0044548 | S100 protein binding(GO:0044548) |
0.4 | 4.4 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.4 | 0.4 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.4 | 1.7 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.4 | 1.7 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
0.4 | 1.3 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.4 | 2.9 | GO:0035473 | lipase binding(GO:0035473) |
0.4 | 0.8 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.4 | 4.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.4 | 1.2 | GO:0004962 | endothelin receptor activity(GO:0004962) |
0.4 | 1.6 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.4 | 6.5 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
0.4 | 2.0 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
0.4 | 1.6 | GO:0004464 | leukotriene-C4 synthase activity(GO:0004464) |
0.4 | 1.6 | GO:0086077 | gap junction channel activity involved in AV node cell-bundle of His cell electrical coupling(GO:0086077) |
0.4 | 2.4 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.4 | 2.0 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
0.4 | 2.8 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
0.4 | 2.0 | GO:0004925 | prolactin receptor activity(GO:0004925) |
0.4 | 0.8 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.4 | 1.6 | GO:0004020 | adenylylsulfate kinase activity(GO:0004020) sulfate adenylyltransferase activity(GO:0004779) sulfate adenylyltransferase (ATP) activity(GO:0004781) |
0.4 | 5.1 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.4 | 2.7 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.4 | 1.6 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
0.4 | 9.3 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.4 | 5.8 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
0.4 | 3.5 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.4 | 3.4 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.4 | 0.8 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.4 | 0.8 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.4 | 2.3 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.4 | 4.1 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.4 | 1.1 | GO:0019948 | SUMO activating enzyme activity(GO:0019948) |
0.4 | 1.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.4 | 1.5 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.4 | 1.1 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
0.4 | 1.5 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.4 | 3.7 | GO:0045340 | mercury ion binding(GO:0045340) |
0.4 | 1.1 | GO:0031751 | D4 dopamine receptor binding(GO:0031751) |
0.4 | 1.5 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.4 | 4.8 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.4 | 1.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.4 | 1.1 | GO:0080023 | 3R-hydroxyacyl-CoA dehydratase activity(GO:0080023) |
0.4 | 1.1 | GO:0036004 | GAF domain binding(GO:0036004) |
0.4 | 4.7 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.4 | 78.5 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.4 | 0.7 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.4 | 2.5 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.4 | 4.3 | GO:0008061 | chitin binding(GO:0008061) |
0.4 | 0.7 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.4 | 1.4 | GO:0070905 | serine binding(GO:0070905) |
0.4 | 1.1 | GO:0004493 | methylmalonyl-CoA epimerase activity(GO:0004493) |
0.4 | 2.5 | GO:0030172 | troponin C binding(GO:0030172) |
0.4 | 6.0 | GO:0005522 | profilin binding(GO:0005522) |
0.3 | 2.8 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.3 | 1.7 | GO:0042903 | tubulin deacetylase activity(GO:0042903) |
0.3 | 3.5 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.3 | 1.0 | GO:0051538 | 3 iron, 4 sulfur cluster binding(GO:0051538) |
0.3 | 4.1 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.3 | 1.4 | GO:0047874 | dolichyldiphosphatase activity(GO:0047874) |
0.3 | 2.4 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.3 | 1.4 | GO:0047710 | bis(5'-adenosyl)-triphosphatase activity(GO:0047710) |
0.3 | 6.5 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.3 | 1.7 | GO:0001225 | RNA polymerase II transcription coactivator binding(GO:0001225) |
0.3 | 5.4 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.3 | 1.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.3 | 2.0 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.3 | 6.9 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.3 | 0.7 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.3 | 1.0 | GO:0070540 | stearic acid binding(GO:0070540) |
0.3 | 4.3 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.3 | 6.9 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.3 | 3.9 | GO:0001848 | complement binding(GO:0001848) |
0.3 | 8.7 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.3 | 0.6 | GO:0043532 | angiostatin binding(GO:0043532) |
0.3 | 1.6 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.3 | 1.3 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.3 | 3.8 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.3 | 3.5 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.3 | 1.9 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.3 | 1.6 | GO:0043758 | acetate-CoA ligase (ADP-forming) activity(GO:0043758) |
0.3 | 12.8 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.3 | 2.8 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.3 | 0.3 | GO:0016918 | retinal binding(GO:0016918) |
0.3 | 3.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.3 | 5.6 | GO:0015643 | toxic substance binding(GO:0015643) |
0.3 | 1.2 | GO:0045159 | myosin II binding(GO:0045159) |
0.3 | 2.2 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.3 | 0.9 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.3 | 0.6 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.3 | 3.4 | GO:0050543 | icosatetraenoic acid binding(GO:0050543) |
0.3 | 3.7 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
0.3 | 2.7 | GO:0039706 | co-receptor binding(GO:0039706) |
0.3 | 1.8 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.3 | 1.2 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.3 | 0.9 | GO:0070279 | vitamin B6 binding(GO:0070279) |
0.3 | 11.1 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.3 | 2.7 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.3 | 2.7 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.3 | 2.7 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.3 | 1.2 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.3 | 0.9 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
0.3 | 2.7 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.3 | 0.9 | GO:0004560 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
0.3 | 5.9 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.3 | 3.5 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.3 | 0.3 | GO:0050436 | microfibril binding(GO:0050436) |
0.3 | 1.5 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.3 | 0.9 | GO:0070122 | isopeptidase activity(GO:0070122) ubiquitin-like protein-specific isopeptidase activity(GO:0070138) SUMO-specific isopeptidase activity(GO:0070140) |
0.3 | 5.5 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.3 | 0.9 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.3 | 1.7 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.3 | 1.7 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
0.3 | 12.5 | GO:0003785 | actin monomer binding(GO:0003785) |
0.3 | 18.7 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.3 | 0.3 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.3 | 2.0 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
0.3 | 1.7 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
0.3 | 1.4 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
0.3 | 1.4 | GO:0008761 | UDP-N-acetylglucosamine 2-epimerase activity(GO:0008761) |
0.3 | 5.0 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.3 | 1.7 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.3 | 2.5 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.3 | 1.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.3 | 1.1 | GO:0046403 | polynucleotide 3'-phosphatase activity(GO:0046403) |
0.3 | 1.4 | GO:0052795 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.3 | 1.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.3 | 3.6 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.3 | 1.6 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.3 | 17.0 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.3 | 1.1 | GO:0000992 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
0.3 | 1.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.3 | 0.8 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.3 | 1.3 | GO:0016454 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
0.3 | 1.1 | GO:0004441 | inositol-1,4-bisphosphate 1-phosphatase activity(GO:0004441) |
0.3 | 1.6 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.3 | 1.3 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.3 | 37.7 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.3 | 0.8 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
0.3 | 1.6 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.3 | 1.6 | GO:0033691 | sialic acid binding(GO:0033691) |
0.3 | 6.1 | GO:0031402 | sodium ion binding(GO:0031402) |
0.3 | 0.8 | GO:0019981 | interleukin-6 receptor activity(GO:0004915) interleukin-6 binding(GO:0019981) |
0.3 | 1.0 | GO:0030519 | snoRNP binding(GO:0030519) |
0.3 | 2.3 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.3 | 0.8 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
0.3 | 0.3 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.3 | 0.8 | GO:0004658 | propionyl-CoA carboxylase activity(GO:0004658) |
0.2 | 1.0 | GO:0008386 | cholesterol monooxygenase (side-chain-cleaving) activity(GO:0008386) |
0.2 | 1.5 | GO:0003835 | beta-galactoside alpha-2,6-sialyltransferase activity(GO:0003835) |
0.2 | 0.7 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.2 | 1.5 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.2 | 0.7 | GO:0005333 | norepinephrine transmembrane transporter activity(GO:0005333) |
0.2 | 0.2 | GO:0048185 | activin binding(GO:0048185) |
0.2 | 5.1 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.2 | 0.7 | GO:0003845 | 11-beta-hydroxysteroid dehydrogenase [NAD(P)] activity(GO:0003845) |
0.2 | 6.0 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.2 | 4.8 | GO:0005537 | mannose binding(GO:0005537) |
0.2 | 1.4 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.2 | 0.2 | GO:0097001 | ceramide binding(GO:0097001) |
0.2 | 0.9 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.2 | 0.7 | GO:0004794 | L-threonine ammonia-lyase activity(GO:0004794) |
0.2 | 3.5 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.2 | 4.4 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.2 | 1.6 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.2 | 4.9 | GO:0016638 | oxidoreductase activity, acting on the CH-NH2 group of donors(GO:0016638) |
0.2 | 1.6 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.2 | 1.6 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.2 | 5.9 | GO:0031489 | myosin V binding(GO:0031489) |
0.2 | 1.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.2 | 2.3 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.2 | 1.1 | GO:0048039 | ubiquinone binding(GO:0048039) |
0.2 | 2.5 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.2 | 1.1 | GO:0001032 | RNA polymerase III type 3 promoter DNA binding(GO:0001032) |
0.2 | 1.1 | GO:0030060 | L-malate dehydrogenase activity(GO:0030060) |
0.2 | 2.2 | GO:0015288 | porin activity(GO:0015288) |
0.2 | 0.7 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.2 | 0.7 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
0.2 | 1.5 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.2 | 0.2 | GO:0071820 | N-box binding(GO:0071820) |
0.2 | 1.9 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
0.2 | 0.6 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.2 | 1.5 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.2 | 5.3 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.2 | 1.1 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.2 | 3.8 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.2 | 0.8 | GO:0046625 | sphingolipid binding(GO:0046625) |
0.2 | 25.7 | GO:0008201 | heparin binding(GO:0008201) |
0.2 | 0.6 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.2 | 1.9 | GO:0048038 | quinone binding(GO:0048038) |
0.2 | 1.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.2 | 2.3 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
0.2 | 1.9 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.2 | 10.3 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.2 | 1.6 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.2 | 4.3 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.2 | 1.0 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.2 | 1.4 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.2 | 0.4 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.2 | 0.6 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
0.2 | 0.4 | GO:0102345 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.2 | 1.8 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.2 | 0.6 | GO:0098918 | structural constituent of synapse(GO:0098918) structural constituent of postsynaptic actin cytoskeleton(GO:0098973) |
0.2 | 1.8 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.2 | 9.8 | GO:0038024 | cargo receptor activity(GO:0038024) |
0.2 | 0.2 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.2 | 1.6 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.2 | 0.6 | GO:0032217 | riboflavin transporter activity(GO:0032217) |
0.2 | 0.6 | GO:0070026 | cystathionine beta-synthase activity(GO:0004122) oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) nitrite reductase (NO-forming) activity(GO:0050421) carbon monoxide binding(GO:0070025) nitric oxide binding(GO:0070026) |
0.2 | 0.6 | GO:0070039 | rRNA (guanosine-2'-O-)-methyltransferase activity(GO:0070039) |
0.2 | 2.1 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.2 | 0.8 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.2 | 0.6 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
0.2 | 1.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.2 | 0.6 | GO:0086057 | voltage-gated calcium channel activity involved in bundle of His cell action potential(GO:0086057) |
0.2 | 1.3 | GO:0071253 | connexin binding(GO:0071253) |
0.2 | 2.6 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.2 | 1.7 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.2 | 1.3 | GO:0051861 | glycolipid binding(GO:0051861) |
0.2 | 4.5 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
0.2 | 0.6 | GO:0052894 | norspermine:oxygen oxidoreductase activity(GO:0052894) N1-acetylspermine:oxygen oxidoreductase (N1-acetylspermidine-forming) activity(GO:0052895) |
0.2 | 1.5 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
0.2 | 0.2 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
0.2 | 0.6 | GO:0047291 | lactosylceramide alpha-2,3-sialyltransferase activity(GO:0047291) |
0.2 | 0.6 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.2 | 0.4 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.2 | 0.7 | GO:0072541 | peroxynitrite reductase activity(GO:0072541) |
0.2 | 0.2 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
0.2 | 0.7 | GO:0008109 | N-acetyllactosaminide beta-1,6-N-acetylglucosaminyltransferase activity(GO:0008109) |
0.2 | 2.7 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.2 | 0.7 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
0.2 | 0.9 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.2 | 0.9 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.2 | 1.6 | GO:0030267 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
0.2 | 2.5 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.2 | 0.2 | GO:0009383 | rRNA (cytosine-C5-)-methyltransferase activity(GO:0009383) |
0.2 | 1.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.2 | 0.4 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.2 | 0.5 | GO:0047223 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase activity(GO:0047223) |
0.2 | 0.5 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.2 | 9.4 | GO:0005518 | collagen binding(GO:0005518) |
0.2 | 0.5 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
0.2 | 4.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.2 | 31.5 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.2 | 0.7 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.2 | 2.0 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.2 | 1.9 | GO:0043426 | MRF binding(GO:0043426) |
0.2 | 0.5 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.2 | 0.3 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.2 | 1.5 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.2 | 0.7 | GO:0004096 | catalase activity(GO:0004096) |
0.2 | 3.0 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.2 | 3.5 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.2 | 0.5 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.2 | 5.1 | GO:0005112 | Notch binding(GO:0005112) |
0.2 | 0.5 | GO:0004512 | inositol-3-phosphate synthase activity(GO:0004512) intramolecular lyase activity(GO:0016872) |
0.2 | 0.3 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.2 | 2.6 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.2 | 3.2 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.2 | 0.6 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.2 | 17.7 | GO:0005178 | integrin binding(GO:0005178) |
0.2 | 1.1 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
0.2 | 0.6 | GO:0070976 | TIR domain binding(GO:0070976) |
0.2 | 1.7 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.2 | 0.6 | GO:0045183 | translation factor activity, non-nucleic acid binding(GO:0045183) |
0.2 | 1.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.2 | 0.9 | GO:0035877 | death effector domain binding(GO:0035877) |
0.2 | 1.6 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.2 | 0.9 | GO:0004850 | uridine phosphorylase activity(GO:0004850) |
0.2 | 0.8 | GO:2001069 | glycogen binding(GO:2001069) |
0.2 | 0.5 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.2 | 0.6 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.2 | 11.5 | GO:0045309 | protein phosphorylated amino acid binding(GO:0045309) |
0.2 | 0.6 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.2 | 0.5 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.2 | 2.9 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.2 | 1.2 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.2 | 0.6 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.2 | 0.3 | GO:0043394 | proteoglycan binding(GO:0043394) |
0.1 | 2.7 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
0.1 | 0.9 | GO:0015266 | protein channel activity(GO:0015266) |
0.1 | 1.2 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.1 | 0.6 | GO:1902379 | chemoattractant activity involved in axon guidance(GO:1902379) |
0.1 | 1.3 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 0.4 | GO:0004373 | glycogen (starch) synthase activity(GO:0004373) |
0.1 | 0.1 | GO:0016840 | carbon-nitrogen lyase activity(GO:0016840) |
0.1 | 1.6 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.1 | 0.4 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.1 | 1.9 | GO:0031996 | thioesterase binding(GO:0031996) |
0.1 | 1.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 3.8 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.1 | 0.6 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.1 | 0.6 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 1.1 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 1.7 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.1 | GO:0016408 | C-acyltransferase activity(GO:0016408) |
0.1 | 2.9 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.1 | 0.6 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
0.1 | 1.5 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 0.6 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
0.1 | 0.1 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.1 | 0.4 | GO:0016781 | selenide, water dikinase activity(GO:0004756) phosphotransferase activity, paired acceptors(GO:0016781) |
0.1 | 0.3 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.1 | 0.4 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
0.1 | 0.7 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.1 | 5.3 | GO:0030332 | cyclin binding(GO:0030332) |
0.1 | 16.9 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.1 | 0.4 | GO:0004903 | growth hormone receptor activity(GO:0004903) |
0.1 | 0.8 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 1.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 2.3 | GO:0035591 | signaling adaptor activity(GO:0035591) |
0.1 | 0.9 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.1 | 0.7 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 0.5 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.1 | 0.4 | GO:0004609 | phosphatidylserine decarboxylase activity(GO:0004609) |
0.1 | 0.1 | GO:0019534 | toxin transporter activity(GO:0019534) |
0.1 | 0.5 | GO:0086038 | calcium:sodium antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086038) |
0.1 | 0.4 | GO:0018169 | ribosomal S6-glutamic acid ligase activity(GO:0018169) |
0.1 | 5.0 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 3.2 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.1 | 0.9 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 0.8 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.1 | 0.9 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.1 | 0.6 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.1 | 2.4 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.1 | 2.0 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.9 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 0.6 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.1 | 1.1 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.1 | 3.4 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.1 | 6.7 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.1 | 4.3 | GO:0005507 | copper ion binding(GO:0005507) |
0.1 | 1.8 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.1 | 2.9 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.1 | 1.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.1 | 0.5 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.1 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.1 | 2.1 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.1 | 1.7 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.4 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
0.1 | 2.4 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.1 | 1.8 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 1.3 | GO:0005539 | glycosaminoglycan binding(GO:0005539) |
0.1 | 0.3 | GO:0004557 | alpha-galactosidase activity(GO:0004557) |
0.1 | 0.3 | GO:0035539 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) 8-oxo-7,8-dihydrodeoxyguanosine triphosphate pyrophosphatase activity(GO:0035539) |
0.1 | 1.0 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
0.1 | 0.2 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.1 | 0.3 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.1 | 0.2 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.1 | 0.5 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
0.1 | 0.4 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.1 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
0.1 | 0.2 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.1 | 0.7 | GO:0043734 | DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
0.1 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 0.5 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 1.1 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
0.1 | 0.4 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.1 | 0.3 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 0.3 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.1 | 4.7 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 1.0 | GO:0004579 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 0.3 | GO:0036080 | GDP-fucose transmembrane transporter activity(GO:0005457) purine nucleotide-sugar transmembrane transporter activity(GO:0036080) |
0.1 | 0.3 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.1 | 0.8 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.1 | 1.4 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 1.4 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.1 | 0.4 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
0.1 | 0.1 | GO:0005119 | smoothened binding(GO:0005119) |
0.1 | 0.4 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.6 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.1 | 0.3 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.1 | 0.3 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.1 | 0.2 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.1 | 1.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 1.0 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 0.8 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 1.0 | GO:0051870 | methotrexate binding(GO:0051870) |
0.1 | 0.4 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.1 | 1.5 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 2.6 | GO:0005504 | fatty acid binding(GO:0005504) |
0.1 | 0.2 | GO:0046969 | histone deacetylase activity (H3-K9 specific)(GO:0032129) NAD-dependent histone deacetylase activity (H3-K9 specific)(GO:0046969) |
0.1 | 0.8 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
0.1 | 0.3 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
0.1 | 0.6 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.1 | 1.1 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.1 | 0.3 | GO:0030337 | DNA polymerase processivity factor activity(GO:0030337) |
0.1 | 0.9 | GO:0031404 | chloride ion binding(GO:0031404) |
0.1 | 0.4 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.1 | 1.8 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.1 | 0.4 | GO:0005459 | UDP-galactose transmembrane transporter activity(GO:0005459) |
0.1 | 0.4 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
0.1 | 0.4 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
0.1 | 2.4 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 0.3 | GO:0019150 | D-ribulokinase activity(GO:0019150) |
0.1 | 0.3 | GO:0004326 | tetrahydrofolylpolyglutamate synthase activity(GO:0004326) |
0.1 | 1.4 | GO:0055103 | ligase regulator activity(GO:0055103) |
0.1 | 3.5 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.1 | 1.0 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.1 | 0.5 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.1 | 0.5 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 0.8 | GO:0015605 | organophosphate ester transmembrane transporter activity(GO:0015605) |
0.1 | 0.3 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
0.1 | 0.6 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.1 | 8.7 | GO:0008083 | growth factor activity(GO:0008083) |
0.1 | 0.3 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.1 | 0.5 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.1 | 0.6 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
0.1 | 0.2 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.1 | 0.7 | GO:0015099 | nickel cation transmembrane transporter activity(GO:0015099) |
0.1 | 1.1 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 0.5 | GO:0047844 | deoxycytidine deaminase activity(GO:0047844) |
0.1 | 0.8 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.1 | 0.7 | GO:0010181 | FMN binding(GO:0010181) |
0.1 | 0.6 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.1 | 0.2 | GO:0015229 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
0.1 | 0.3 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.5 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.1 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.1 | 2.3 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.1 | 0.7 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.8 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.1 | 0.8 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 1.1 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.1 | 1.0 | GO:0015929 | hexosaminidase activity(GO:0015929) |
0.1 | 0.4 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.1 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 0.7 | GO:0019841 | retinol binding(GO:0019841) |
0.1 | 0.5 | GO:1990459 | transferrin receptor binding(GO:1990459) |
0.1 | 1.8 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.1 | 1.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.3 | GO:0005093 | Rab GDP-dissociation inhibitor activity(GO:0005093) |
0.1 | 0.4 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 1.4 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 0.3 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
0.1 | 0.7 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.1 | 0.2 | GO:0050479 | glyceryl-ether monooxygenase activity(GO:0050479) |
0.1 | 3.0 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.1 | 0.3 | GO:0008296 | 3'-5'-exodeoxyribonuclease activity(GO:0008296) |
0.1 | 0.1 | GO:0022829 | wide pore channel activity(GO:0022829) |
0.1 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.1 | 0.3 | GO:1990188 | euchromatin binding(GO:1990188) |
0.1 | 0.2 | GO:0004454 | ketohexokinase activity(GO:0004454) |
0.1 | 0.6 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.1 | 1.4 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.1 | 1.1 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
0.1 | 0.2 | GO:0004063 | aryldialkylphosphatase activity(GO:0004063) |
0.1 | 1.7 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.1 | 2.3 | GO:0009055 | electron carrier activity(GO:0009055) |
0.1 | 0.6 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.1 | 0.5 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.1 | 1.3 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
0.1 | 0.2 | GO:0001096 | TFIIF-class transcription factor binding(GO:0001096) |
0.1 | 0.2 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 0.1 | GO:0001847 | opsonin receptor activity(GO:0001847) |
0.1 | 0.2 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 2.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 0.4 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.1 | GO:0097677 | STAT family protein binding(GO:0097677) |
0.1 | 1.7 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.1 | 0.3 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.1 | 0.4 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.1 | 0.2 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
0.1 | 0.2 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.1 | 0.7 | GO:0031386 | protein tag(GO:0031386) |
0.1 | 1.5 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.1 | 0.2 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
0.1 | 0.5 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
0.1 | 0.7 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.1 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.1 | 1.0 | GO:0071949 | FAD binding(GO:0071949) |
0.1 | 0.5 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.1 | 0.7 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.3 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.0 | 5.2 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.0 | 1.0 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.0 | GO:1990955 | G-rich single-stranded DNA binding(GO:1990955) |
0.0 | 0.1 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.0 | 0.1 | GO:0005260 | channel-conductance-controlling ATPase activity(GO:0005260) |
0.0 | 0.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.4 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.0 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.3 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.0 | 0.2 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 1.2 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.3 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.0 | 0.6 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.2 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
0.0 | 0.3 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.1 | GO:0004921 | interleukin-11 receptor activity(GO:0004921) interleukin-11 binding(GO:0019970) |
0.0 | 0.0 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.0 | 0.6 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.6 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
0.0 | 0.1 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.0 | 0.2 | GO:0070728 | leucine binding(GO:0070728) |
0.0 | 0.6 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) |
0.0 | 0.5 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.1 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
0.0 | 0.4 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 1.8 | GO:0008146 | sulfotransferase activity(GO:0008146) |
0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.3 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.3 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 5.8 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.2 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) |
0.0 | 1.0 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 0.2 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.0 | 0.1 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.0 | 0.0 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) |
0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.1 | GO:0004909 | interleukin-1, Type I, activating receptor activity(GO:0004909) |
0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.3 | GO:0015250 | water channel activity(GO:0015250) |
0.0 | 3.3 | GO:0008013 | beta-catenin binding(GO:0008013) |
0.0 | 0.4 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.0 | 0.0 | GO:0051766 | inositol trisphosphate kinase activity(GO:0051766) |
0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 1.3 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.4 | GO:0046030 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) inositol trisphosphate phosphatase activity(GO:0046030) |
0.0 | 0.3 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.6 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.2 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.1 | GO:0002046 | opsin binding(GO:0002046) |
0.0 | 0.3 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.3 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.3 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.3 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.0 | 0.1 | GO:0004798 | thymidylate kinase activity(GO:0004798) |
0.0 | 0.2 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.0 | GO:0005026 | transforming growth factor beta receptor activity, type II(GO:0005026) |
0.0 | 0.1 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.0 | 0.6 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
0.0 | 1.0 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.0 | GO:0048019 | receptor antagonist activity(GO:0048019) |
0.0 | 0.6 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
0.0 | 0.5 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.1 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.0 | 1.5 | GO:0005179 | hormone activity(GO:0005179) |
0.0 | 0.1 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.6 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.4 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 0.0 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.0 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 5.6 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.0 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.2 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.0 | 0.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.1 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
0.0 | 0.1 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.0 | 0.1 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 0.2 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.0 | 0.1 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.0 | 0.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.0 | GO:0003696 | satellite DNA binding(GO:0003696) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 21.6 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.6 | 45.8 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.5 | 1.6 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.5 | 19.6 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.5 | 4.6 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.5 | 5.0 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.4 | 114.8 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.4 | 4.2 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.4 | 10.8 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.4 | 6.4 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.4 | 0.8 | PID INSULIN PATHWAY | Insulin Pathway |
0.3 | 3.8 | ST STAT3 PATHWAY | STAT3 Pathway |
0.3 | 10.3 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.3 | 18.9 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.3 | 0.3 | PID IFNG PATHWAY | IFN-gamma pathway |
0.3 | 7.7 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.3 | 2.5 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.3 | 2.5 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.3 | 1.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.3 | 2.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.3 | 2.0 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.3 | 22.8 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.3 | 3.9 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.3 | 6.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.3 | 51.0 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.3 | 0.5 | ST GAQ PATHWAY | G alpha q Pathway |
0.3 | 5.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.3 | 15.0 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.2 | 5.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.2 | 4.9 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.2 | 6.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.2 | 2.4 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.2 | 9.3 | PID ALK1 PATHWAY | ALK1 signaling events |
0.2 | 1.6 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.2 | 4.7 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.2 | 3.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.2 | 12.6 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.2 | 0.9 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.2 | 5.5 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.2 | 1.4 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.2 | 8.3 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.2 | 1.8 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.2 | 0.8 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.2 | 1.9 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.2 | 14.8 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.2 | 9.0 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.2 | 2.2 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.2 | 1.8 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.2 | 34.9 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.2 | 3.0 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.2 | 0.5 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.2 | 4.6 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.2 | 5.5 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.2 | 1.3 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.2 | 3.5 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.2 | 3.2 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.2 | 5.2 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.2 | 0.9 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.2 | 12.0 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 9.6 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.1 | 6.2 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.1 | 1.7 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.1 | 0.4 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.1 | 6.8 | PID BMP PATHWAY | BMP receptor signaling |
0.1 | 2.6 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 1.5 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 0.9 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 3.1 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.1 | 0.5 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.1 | 2.7 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 1.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 1.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.1 | 3.4 | PID BCR 5PATHWAY | BCR signaling pathway |
0.1 | 1.6 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.1 | 3.3 | PID AURORA A PATHWAY | Aurora A signaling |
0.1 | 4.6 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.1 | 7.3 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.1 | 0.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.1 | 1.0 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 1.6 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.1 | 2.2 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.1 | 3.8 | PID ATR PATHWAY | ATR signaling pathway |
0.1 | 1.2 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 3.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 1.5 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 0.6 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.1 | 1.9 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.1 | 1.6 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.1 | 2.7 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 1.4 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 4.4 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.1 | 18.8 | NABA MATRISOME ASSOCIATED | Ensemble of genes encoding ECM-associated proteins including ECM-affilaited proteins, ECM regulators and secreted factors |
0.1 | 2.9 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.1 | 0.6 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 1.3 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.1 | 0.8 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.1 | 1.7 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 1.7 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 1.2 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.1 | 2.5 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.4 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 2.0 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.0 | 1.6 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.2 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.7 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.4 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.3 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.8 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 1.8 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 0.3 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.5 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.0 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.3 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.5 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.3 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 1.4 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.3 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.5 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.5 | 7.6 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
1.5 | 34.0 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
1.0 | 1.0 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
0.9 | 18.4 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.9 | 10.1 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.9 | 12.8 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.8 | 22.8 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.8 | 13.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.8 | 12.0 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.7 | 2.9 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.7 | 0.7 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
0.6 | 5.2 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.6 | 17.6 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.6 | 12.7 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.6 | 12.1 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.6 | 4.8 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.6 | 2.4 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.6 | 8.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.5 | 10.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.5 | 6.4 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.5 | 16.0 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.5 | 3.7 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.5 | 15.0 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.4 | 0.8 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
0.4 | 17.9 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.4 | 3.9 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.4 | 1.9 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.4 | 14.6 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.4 | 5.9 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.4 | 17.9 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.4 | 18.9 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.4 | 9.1 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.4 | 6.3 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.3 | 1.7 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.3 | 8.5 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.3 | 3.7 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.3 | 4.7 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.3 | 6.4 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.3 | 5.1 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.3 | 4.9 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.3 | 4.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.3 | 0.9 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.3 | 8.5 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.3 | 12.8 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.3 | 7.3 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.3 | 5.9 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.3 | 29.4 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.3 | 11.5 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.3 | 0.3 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.3 | 5.4 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.3 | 2.9 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.3 | 2.4 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.3 | 6.8 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.3 | 17.0 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
0.3 | 2.6 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.3 | 11.9 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.3 | 2.3 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.2 | 0.2 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.2 | 15.3 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.2 | 5.3 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.2 | 5.9 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.2 | 3.3 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.2 | 0.7 | REACTOME KINESINS | Genes involved in Kinesins |
0.2 | 3.9 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.2 | 3.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.2 | 4.6 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF CYCLIN B | Genes involved in APC/C:Cdc20 mediated degradation of Cyclin B |
0.2 | 4.3 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.2 | 0.5 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.2 | 1.3 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.2 | 1.1 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.2 | 3.1 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.2 | 2.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.2 | 2.9 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.2 | 5.1 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.2 | 24.8 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.2 | 0.8 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.2 | 0.6 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.2 | 3.0 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.2 | 4.0 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.2 | 7.1 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.2 | 17.9 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.2 | 0.6 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.2 | 0.6 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.2 | 3.8 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.2 | 0.2 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.2 | 2.5 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.2 | 0.5 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.2 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.2 | 1.2 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.2 | 14.1 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.2 | 2.6 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.2 | 8.3 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.2 | 6.6 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.2 | 2.8 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.2 | 2.8 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.2 | 2.4 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.2 | 11.3 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.2 | 2.5 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.2 | 3.0 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.2 | 1.1 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.2 | 0.3 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.2 | 6.0 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.1 | 1.0 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.1 | 7.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.9 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.1 | 0.9 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.1 | 1.9 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.1 | 3.4 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.1 | 2.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 2.5 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
0.1 | 2.7 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 2.2 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.1 | 1.8 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.1 | 4.4 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.1 | 1.0 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.1 | 12.3 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 2.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 0.4 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.1 | 1.6 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.1 | 2.0 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 1.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 0.8 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.1 | 2.3 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 0.7 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 3.3 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.1 | 1.3 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.1 | 2.2 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.1 | 1.3 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 0.5 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.1 | 9.4 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.1 | 2.5 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.1 | 1.4 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.1 | 1.9 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 2.0 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 1.7 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.1 | 2.9 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.1 | 0.3 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.1 | 1.3 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.1 | 1.5 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.1 | 0.7 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.1 | 1.0 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 3.1 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.1 | 1.2 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.1 | 0.4 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.1 | 4.7 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
0.1 | 1.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 3.7 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 0.7 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.1 | 1.0 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.1 | 14.2 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.1 | 2.2 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
0.1 | 2.7 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.1 | 1.6 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.1 | 1.6 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.1 | 0.7 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.1 | 0.8 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.1 | 0.1 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 0.5 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 0.5 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.1 | 1.2 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.1 | 1.0 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 1.1 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.3 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.9 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 1.6 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.0 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.0 | 0.2 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.2 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.0 | 8.4 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 2.0 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.0 | 0.9 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 1.7 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
0.0 | 0.3 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.0 | 0.2 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.0 | 0.4 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 4.1 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 1.6 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
0.0 | 0.4 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.5 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.6 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.0 | 0.4 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.9 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 4.1 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 0.2 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.0 | 0.4 | REACTOME SHC MEDIATED CASCADE | Genes involved in SHC-mediated cascade |
0.0 | 0.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.1 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.0 | 0.2 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.2 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.3 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.2 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.0 | 0.2 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |