GSE58827: Dynamics of the Mouse Liver
Gene Symbol | Gene ID | Gene Info |
---|---|---|
Yy1
|
ENSMUSG00000021264.13 | YY1 transcription factor |
Yy2
|
ENSMUSG00000091736.4 | Yy2 transcription factor |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Yy2 | mm39_v1_chrX_-_156351979_156351987 | 0.27 | 1.2e-01 | Click! |
Yy1 | mm39_v1_chr12_+_108758871_108758914 | -0.02 | 9.0e-01 | Click! |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
8.5 | 33.9 | GO:0070488 | neutrophil aggregation(GO:0070488) |
6.6 | 19.8 | GO:0030472 | mitotic spindle organization in nucleus(GO:0030472) |
5.8 | 40.4 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
4.8 | 14.4 | GO:0006780 | uroporphyrinogen III biosynthetic process(GO:0006780) |
3.7 | 11.2 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
3.7 | 18.6 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
3.4 | 13.6 | GO:1900191 | biofilm formation(GO:0042710) single-species biofilm formation(GO:0044010) single-species biofilm formation in or on host organism(GO:0044407) membrane disruption in other organism(GO:0051673) regulation of single-species biofilm formation(GO:1900190) negative regulation of single-species biofilm formation(GO:1900191) regulation of single-species biofilm formation in or on host organism(GO:1900228) negative regulation of single-species biofilm formation in or on host organism(GO:1900229) |
3.0 | 8.9 | GO:0034118 | erythrocyte aggregation(GO:0034117) regulation of erythrocyte aggregation(GO:0034118) |
2.8 | 8.4 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
2.8 | 16.8 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
2.7 | 13.3 | GO:0070829 | heterochromatin maintenance(GO:0070829) |
2.6 | 2.6 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
2.4 | 7.3 | GO:0006233 | dTDP biosynthetic process(GO:0006233) dTDP metabolic process(GO:0046072) |
2.4 | 7.3 | GO:0001807 | regulation of type IV hypersensitivity(GO:0001807) |
2.4 | 9.7 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
2.4 | 7.2 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
2.3 | 7.0 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
2.3 | 6.9 | GO:0035425 | autocrine signaling(GO:0035425) |
2.3 | 11.3 | GO:0034224 | cellular response to zinc ion starvation(GO:0034224) |
2.3 | 9.0 | GO:1904008 | response to monosodium glutamate(GO:1904008) cellular response to monosodium glutamate(GO:1904009) |
2.2 | 8.9 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
2.2 | 13.4 | GO:0035585 | calcium-mediated signaling using extracellular calcium source(GO:0035585) |
2.2 | 8.9 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
2.2 | 8.8 | GO:1904799 | regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) |
2.2 | 6.6 | GO:0002582 | positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) |
2.1 | 14.9 | GO:0090521 | glomerular visceral epithelial cell migration(GO:0090521) |
2.1 | 14.6 | GO:0051697 | protein delipidation(GO:0051697) |
2.0 | 6.1 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
2.0 | 18.2 | GO:0007144 | female meiosis I(GO:0007144) |
2.0 | 8.1 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
2.0 | 5.9 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
2.0 | 5.9 | GO:0019427 | acetate biosynthetic process(GO:0019413) acetyl-CoA biosynthetic process from acetate(GO:0019427) propionate biosynthetic process(GO:0019542) |
1.9 | 3.9 | GO:0072708 | response to sorbitol(GO:0072708) |
1.9 | 5.8 | GO:0006740 | NADPH regeneration(GO:0006740) |
1.9 | 1.9 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
1.9 | 5.7 | GO:0036388 | pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
1.9 | 5.7 | GO:1990535 | negative regulation of NAD(P)H oxidase activity(GO:0033861) neuron projection maintenance(GO:1990535) |
1.9 | 11.3 | GO:0003065 | positive regulation of heart rate by epinephrine(GO:0003065) |
1.9 | 5.6 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
1.9 | 9.3 | GO:0072138 | mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
1.8 | 9.1 | GO:0006566 | threonine metabolic process(GO:0006566) |
1.8 | 1.8 | GO:2000424 | regulation of eosinophil chemotaxis(GO:2000422) positive regulation of eosinophil chemotaxis(GO:2000424) |
1.7 | 5.2 | GO:0001869 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
1.7 | 5.1 | GO:2001178 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
1.7 | 1.7 | GO:1900110 | negative regulation of histone H3-K9 dimethylation(GO:1900110) |
1.7 | 3.3 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
1.7 | 20.0 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
1.6 | 9.9 | GO:0050812 | regulation of acyl-CoA biosynthetic process(GO:0050812) |
1.6 | 4.9 | GO:0046035 | CMP salvage(GO:0006238) CMP biosynthetic process(GO:0009224) pyrimidine ribonucleotide salvage(GO:0010138) pyrimidine nucleotide salvage(GO:0032262) UMP salvage(GO:0044206) CMP metabolic process(GO:0046035) |
1.6 | 4.9 | GO:0006021 | inositol biosynthetic process(GO:0006021) |
1.6 | 4.9 | GO:0019918 | peptidyl-arginine methylation, to symmetrical-dimethyl arginine(GO:0019918) |
1.6 | 8.1 | GO:1904171 | negative regulation of bleb assembly(GO:1904171) |
1.6 | 9.7 | GO:1904923 | regulation of mitophagy in response to mitochondrial depolarization(GO:1904923) |
1.6 | 1.6 | GO:0001966 | thigmotaxis(GO:0001966) |
1.6 | 8.0 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
1.6 | 4.8 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
1.6 | 4.8 | GO:1903632 | positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) |
1.6 | 6.2 | GO:0014718 | positive regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014718) sodium-dependent self proteolysis(GO:1990091) |
1.5 | 4.6 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
1.5 | 7.7 | GO:0071038 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) nuclear polyadenylation-dependent tRNA catabolic process(GO:0071038) |
1.5 | 6.2 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
1.5 | 18.4 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
1.5 | 27.2 | GO:0015816 | glycine transport(GO:0015816) |
1.5 | 11.9 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
1.5 | 5.9 | GO:0071544 | diphosphoinositol polyphosphate catabolic process(GO:0071544) |
1.5 | 22.0 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
1.5 | 4.4 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
1.5 | 7.3 | GO:0046952 | ketone body catabolic process(GO:0046952) |
1.5 | 7.3 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
1.4 | 5.8 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
1.4 | 8.6 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
1.4 | 7.1 | GO:2000660 | negative regulation of interleukin-1-mediated signaling pathway(GO:2000660) |
1.4 | 8.5 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
1.4 | 1.4 | GO:0006713 | glucocorticoid catabolic process(GO:0006713) |
1.4 | 4.2 | GO:0000451 | rRNA 2'-O-methylation(GO:0000451) |
1.4 | 4.2 | GO:0060720 | spongiotrophoblast cell proliferation(GO:0060720) cell proliferation involved in embryonic placenta development(GO:0060722) |
1.4 | 7.0 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
1.4 | 40.3 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
1.4 | 1.4 | GO:0036257 | multivesicular body organization(GO:0036257) |
1.4 | 8.3 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
1.4 | 5.5 | GO:0042245 | RNA repair(GO:0042245) |
1.4 | 9.5 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
1.3 | 8.0 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
1.3 | 4.0 | GO:0015891 | iron chelate transport(GO:0015688) siderophore transport(GO:0015891) |
1.3 | 14.5 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
1.3 | 14.4 | GO:0032056 | positive regulation of translation in response to stress(GO:0032056) |
1.3 | 41.1 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
1.3 | 6.4 | GO:1902340 | telomeric heterochromatin assembly(GO:0031509) negative regulation of chromosome condensation(GO:1902340) |
1.3 | 3.8 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
1.3 | 16.6 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
1.3 | 7.6 | GO:0097167 | circadian regulation of translation(GO:0097167) |
1.3 | 5.0 | GO:0034241 | regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) |
1.2 | 12.5 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
1.2 | 9.9 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
1.2 | 99.3 | GO:0002181 | cytoplasmic translation(GO:0002181) |
1.2 | 11.1 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
1.2 | 4.9 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
1.2 | 2.5 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
1.2 | 4.9 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
1.2 | 4.8 | GO:0071226 | cellular response to molecule of fungal origin(GO:0071226) |
1.2 | 6.0 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
1.2 | 6.0 | GO:0033121 | regulation of purine nucleotide catabolic process(GO:0033121) |
1.2 | 3.6 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
1.2 | 9.4 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
1.2 | 4.7 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
1.2 | 3.5 | GO:0002625 | regulation of T cell antigen processing and presentation(GO:0002625) |
1.2 | 4.7 | GO:0017126 | nucleologenesis(GO:0017126) |
1.2 | 3.5 | GO:0060217 | hemangioblast cell differentiation(GO:0060217) |
1.2 | 5.8 | GO:0002352 | B cell negative selection(GO:0002352) |
1.2 | 1.2 | GO:0000448 | cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
1.2 | 3.5 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
1.2 | 4.6 | GO:0019046 | release from viral latency(GO:0019046) |
1.1 | 9.2 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
1.1 | 2.3 | GO:0019043 | establishment of viral latency(GO:0019043) |
1.1 | 4.5 | GO:0046084 | adenine salvage(GO:0006168) adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
1.1 | 11.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
1.1 | 2.2 | GO:0006550 | isoleucine catabolic process(GO:0006550) |
1.1 | 5.6 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
1.1 | 4.5 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
1.1 | 4.4 | GO:0035574 | histone H4-K20 demethylation(GO:0035574) |
1.1 | 3.3 | GO:0071460 | cellular response to cell-matrix adhesion(GO:0071460) |
1.1 | 2.2 | GO:0048822 | enucleate erythrocyte development(GO:0048822) |
1.1 | 2.2 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
1.1 | 8.7 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
1.1 | 4.4 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
1.1 | 12.8 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
1.1 | 1.1 | GO:0033045 | regulation of sister chromatid segregation(GO:0033045) |
1.0 | 2.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
1.0 | 4.2 | GO:0002155 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
1.0 | 1.0 | GO:1904798 | positive regulation of core promoter binding(GO:1904798) |
1.0 | 7.2 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
1.0 | 8.2 | GO:0002432 | granuloma formation(GO:0002432) |
1.0 | 3.1 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
1.0 | 6.1 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
1.0 | 3.1 | GO:0045004 | DNA replication proofreading(GO:0045004) |
1.0 | 4.1 | GO:0042125 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
1.0 | 7.1 | GO:0014005 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
1.0 | 10.1 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
1.0 | 8.1 | GO:0031179 | peptide modification(GO:0031179) |
1.0 | 5.1 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
1.0 | 4.0 | GO:0046898 | response to cycloheximide(GO:0046898) |
1.0 | 6.0 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
1.0 | 2.0 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
1.0 | 1.0 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
1.0 | 2.9 | GO:0033189 | response to vitamin A(GO:0033189) |
1.0 | 1.0 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.9 | 2.8 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.9 | 4.7 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.9 | 8.3 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
0.9 | 7.4 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.9 | 3.6 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.9 | 4.5 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.9 | 8.1 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.9 | 5.3 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.9 | 7.1 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.9 | 1.8 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.9 | 2.6 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.9 | 2.6 | GO:0015827 | aromatic amino acid transport(GO:0015801) tryptophan transport(GO:0015827) |
0.9 | 5.2 | GO:0019660 | glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.9 | 1.7 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
0.9 | 6.0 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.9 | 6.8 | GO:0061621 | NADH regeneration(GO:0006735) canonical glycolysis(GO:0061621) glucose catabolic process to pyruvate(GO:0061718) |
0.9 | 1.7 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
0.9 | 2.6 | GO:0007225 | patched ligand maturation(GO:0007225) signal maturation(GO:0035638) |
0.8 | 1.7 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.8 | 9.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.8 | 10.1 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.8 | 3.3 | GO:2000657 | regulation of apolipoprotein binding(GO:2000656) negative regulation of apolipoprotein binding(GO:2000657) |
0.8 | 1.7 | GO:2000662 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
0.8 | 7.4 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.8 | 2.5 | GO:0018160 | peptidyl-pyrromethane cofactor linkage(GO:0018160) |
0.8 | 2.5 | GO:0043973 | histone H3-K4 acetylation(GO:0043973) |
0.8 | 2.4 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
0.8 | 3.2 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
0.8 | 5.7 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.8 | 1.6 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) |
0.8 | 2.4 | GO:0034378 | chylomicron assembly(GO:0034378) |
0.8 | 4.0 | GO:0072737 | response to diamide(GO:0072737) cellular response to diamide(GO:0072738) |
0.8 | 2.4 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.8 | 2.4 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
0.8 | 5.5 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.8 | 4.7 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.8 | 2.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.8 | 7.7 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.8 | 3.1 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.8 | 6.2 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.8 | 15.4 | GO:0031498 | chromatin disassembly(GO:0031498) |
0.8 | 3.8 | GO:0015966 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
0.8 | 2.3 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.8 | 6.9 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.8 | 0.8 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.7 | 3.0 | GO:1904247 | positive regulation of polynucleotide adenylyltransferase activity(GO:1904247) |
0.7 | 0.7 | GO:0044208 | 'de novo' AMP biosynthetic process(GO:0044208) |
0.7 | 5.2 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
0.7 | 2.2 | GO:1990428 | miRNA transport(GO:1990428) |
0.7 | 17.1 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.7 | 3.7 | GO:0051754 | meiotic sister chromatid cohesion, centromeric(GO:0051754) |
0.7 | 3.0 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.7 | 2.2 | GO:1900158 | negative regulation of bone mineralization involved in bone maturation(GO:1900158) |
0.7 | 2.2 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.7 | 2.9 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.7 | 1.5 | GO:0048611 | ectodermal digestive tract development(GO:0007439) embryonic ectodermal digestive tract development(GO:0048611) |
0.7 | 2.2 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.7 | 0.7 | GO:0071046 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
0.7 | 24.0 | GO:0015804 | neutral amino acid transport(GO:0015804) |
0.7 | 5.8 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.7 | 5.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.7 | 2.9 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.7 | 4.3 | GO:0007000 | nucleolus organization(GO:0007000) |
0.7 | 2.8 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.7 | 5.0 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.7 | 7.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.7 | 3.5 | GO:0018343 | protein farnesylation(GO:0018343) |
0.7 | 2.1 | GO:0035702 | monocyte homeostasis(GO:0035702) |
0.7 | 2.8 | GO:1902966 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
0.7 | 6.3 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.7 | 3.4 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
0.7 | 3.4 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.7 | 5.4 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.7 | 5.4 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.7 | 6.1 | GO:0015671 | oxygen transport(GO:0015671) |
0.7 | 2.7 | GO:0010286 | heat acclimation(GO:0010286) |
0.7 | 8.6 | GO:0016998 | cell wall macromolecule catabolic process(GO:0016998) cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.7 | 2.0 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.7 | 1.3 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
0.7 | 2.0 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
0.7 | 3.3 | GO:1904749 | regulation of protein localization to nucleolus(GO:1904749) |
0.7 | 2.6 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
0.6 | 1.9 | GO:0071846 | actin filament debranching(GO:0071846) |
0.6 | 1.9 | GO:0046601 | positive regulation of centriole replication(GO:0046601) |
0.6 | 5.1 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
0.6 | 2.5 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.6 | 3.8 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
0.6 | 3.8 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.6 | 1.9 | GO:1903406 | regulation of sodium:potassium-exchanging ATPase activity(GO:1903406) |
0.6 | 3.1 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.6 | 11.9 | GO:0000338 | protein deneddylation(GO:0000338) |
0.6 | 5.0 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.6 | 3.7 | GO:0006116 | NADH oxidation(GO:0006116) |
0.6 | 1.2 | GO:0032070 | regulation of deoxyribonuclease activity(GO:0032070) |
0.6 | 4.3 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.6 | 1.8 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.6 | 1.8 | GO:0061623 | glycolytic process through glucose-1-phosphate(GO:0061622) glycolytic process from galactose(GO:0061623) |
0.6 | 1.8 | GO:0030221 | basophil differentiation(GO:0030221) |
0.6 | 12.0 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.6 | 1.2 | GO:0044827 | modulation by host of viral genome replication(GO:0044827) negative regulation by host of viral genome replication(GO:0044828) |
0.6 | 0.6 | GO:2000847 | negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.6 | 2.4 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
0.6 | 24.2 | GO:0048821 | erythrocyte development(GO:0048821) |
0.6 | 12.4 | GO:0006999 | nuclear pore organization(GO:0006999) |
0.6 | 6.5 | GO:0016075 | rRNA catabolic process(GO:0016075) |
0.6 | 4.7 | GO:0097647 | calcitonin family receptor signaling pathway(GO:0097646) amylin receptor signaling pathway(GO:0097647) |
0.6 | 1.2 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.6 | 3.5 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.6 | 2.3 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.6 | 2.3 | GO:0017055 | negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) |
0.6 | 3.4 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.6 | 1.7 | GO:0060821 | inactivation of X chromosome by DNA methylation(GO:0060821) |
0.6 | 1.7 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.6 | 2.3 | GO:2000987 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
0.6 | 3.4 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.6 | 2.8 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.6 | 2.8 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.6 | 2.8 | GO:0042412 | taurine biosynthetic process(GO:0042412) |
0.6 | 1.7 | GO:1902946 | protein localization to early endosome(GO:1902946) |
0.6 | 8.3 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.6 | 1.1 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
0.6 | 1.1 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.5 | 8.2 | GO:0009209 | CTP biosynthetic process(GO:0006241) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) CTP metabolic process(GO:0046036) |
0.5 | 1.1 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.5 | 1.6 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
0.5 | 14.0 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.5 | 1.1 | GO:0002740 | negative regulation of cytokine secretion involved in immune response(GO:0002740) |
0.5 | 1.6 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.5 | 10.7 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
0.5 | 2.7 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.5 | 5.3 | GO:0032264 | IMP salvage(GO:0032264) |
0.5 | 4.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.5 | 4.2 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
0.5 | 13.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.5 | 12.1 | GO:0019731 | antibacterial humoral response(GO:0019731) |
0.5 | 1.6 | GO:0070476 | rRNA (guanine-N7)-methylation(GO:0070476) |
0.5 | 4.2 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.5 | 1.6 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.5 | 1.6 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
0.5 | 16.6 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.5 | 1.0 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.5 | 8.1 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.5 | 3.5 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.5 | 0.5 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.5 | 5.5 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.5 | 2.0 | GO:0051031 | tRNA transport(GO:0051031) |
0.5 | 4.5 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.5 | 3.0 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.5 | 4.0 | GO:0042167 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.5 | 3.5 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
0.5 | 1.0 | GO:0032487 | regulation of Rap protein signal transduction(GO:0032487) |
0.5 | 2.0 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
0.5 | 9.4 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.5 | 3.9 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
0.5 | 3.4 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.5 | 3.4 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
0.5 | 5.4 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.5 | 7.3 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.5 | 2.4 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.5 | 1.5 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.5 | 1.9 | GO:0032667 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
0.5 | 1.9 | GO:1904425 | negative regulation of GTP binding(GO:1904425) |
0.5 | 1.4 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
0.5 | 1.9 | GO:1904209 | chemokine (C-C motif) ligand 2 secretion(GO:0035926) regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
0.5 | 6.2 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.5 | 4.3 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.5 | 0.5 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.5 | 4.7 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
0.5 | 5.6 | GO:0002903 | negative regulation of B cell apoptotic process(GO:0002903) |
0.5 | 2.3 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
0.5 | 10.3 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.5 | 15.4 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
0.5 | 1.9 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
0.5 | 2.3 | GO:1902962 | regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902962) negative regulation of metalloendopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902963) |
0.5 | 1.4 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.5 | 1.9 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.5 | 2.3 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.5 | 1.9 | GO:0015904 | tetracycline transport(GO:0015904) |
0.5 | 4.6 | GO:0051014 | actin filament severing(GO:0051014) |
0.5 | 19.7 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.5 | 1.4 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.5 | 0.9 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.5 | 3.6 | GO:0033277 | abortive mitotic cell cycle(GO:0033277) |
0.5 | 9.1 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.4 | 0.4 | GO:0003256 | regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003256) |
0.4 | 0.9 | GO:0002436 | immune complex clearance by monocytes and macrophages(GO:0002436) regulation of immune complex clearance by monocytes and macrophages(GO:0090264) positive regulation of immune complex clearance by monocytes and macrophages(GO:0090265) regulation of hematopoietic stem cell migration(GO:2000471) positive regulation of hematopoietic stem cell migration(GO:2000473) |
0.4 | 2.2 | GO:0031296 | B cell costimulation(GO:0031296) |
0.4 | 1.8 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.4 | 3.1 | GO:0051256 | mitotic spindle midzone assembly(GO:0051256) |
0.4 | 0.9 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.4 | 1.3 | GO:0046032 | ADP catabolic process(GO:0046032) |
0.4 | 4.3 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.4 | 1.7 | GO:0015793 | glycerol transport(GO:0015793) renal water absorption(GO:0070295) |
0.4 | 9.7 | GO:0032060 | bleb assembly(GO:0032060) |
0.4 | 4.2 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.4 | 2.5 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.4 | 2.5 | GO:0000821 | regulation of arginine metabolic process(GO:0000821) |
0.4 | 6.7 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.4 | 0.8 | GO:2000612 | regulation of thyroid-stimulating hormone secretion(GO:2000612) |
0.4 | 17.5 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.4 | 0.8 | GO:0043144 | snoRNA processing(GO:0043144) |
0.4 | 1.7 | GO:0002030 | inhibitory G-protein coupled receptor phosphorylation(GO:0002030) |
0.4 | 1.7 | GO:2001201 | regulation of transforming growth factor-beta secretion(GO:2001201) |
0.4 | 1.7 | GO:0030576 | Cajal body organization(GO:0030576) |
0.4 | 1.2 | GO:0038156 | interleukin-3-mediated signaling pathway(GO:0038156) |
0.4 | 0.8 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.4 | 1.6 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.4 | 3.3 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.4 | 3.3 | GO:1903003 | positive regulation of protein deubiquitination(GO:1903003) |
0.4 | 57.3 | GO:0006364 | rRNA processing(GO:0006364) |
0.4 | 2.0 | GO:0035616 | histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
0.4 | 2.0 | GO:0048539 | bone marrow development(GO:0048539) |
0.4 | 0.8 | GO:0002580 | regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) |
0.4 | 3.2 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.4 | 1.2 | GO:0006427 | histidyl-tRNA aminoacylation(GO:0006427) |
0.4 | 0.8 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.4 | 33.8 | GO:0070527 | platelet aggregation(GO:0070527) |
0.4 | 3.2 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.4 | 0.8 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.4 | 5.2 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.4 | 1.2 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
0.4 | 0.4 | GO:0045297 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
0.4 | 2.0 | GO:0031657 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.4 | 1.6 | GO:1901970 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.4 | 1.2 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.4 | 0.8 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.4 | 2.4 | GO:0035625 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
0.4 | 2.7 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
0.4 | 1.6 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.4 | 0.4 | GO:2001200 | positive regulation of dendritic cell differentiation(GO:2001200) |
0.4 | 1.2 | GO:1902220 | positive regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902220) |
0.4 | 1.5 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.4 | 3.8 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.4 | 1.5 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.4 | 1.5 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
0.4 | 3.4 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.4 | 1.9 | GO:0098887 | neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
0.4 | 2.6 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.4 | 1.1 | GO:0000393 | generation of catalytic spliceosome for first transesterification step(GO:0000349) spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
0.4 | 1.9 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.4 | 1.5 | GO:1902167 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902167) |
0.4 | 0.8 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.4 | 2.2 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.4 | 3.7 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.4 | 0.7 | GO:0001180 | transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
0.4 | 2.6 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.4 | 2.2 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.4 | 1.8 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.4 | 9.9 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
0.4 | 1.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.4 | 0.7 | GO:0035799 | ureter maturation(GO:0035799) |
0.4 | 1.5 | GO:0080120 | CAAX-box protein processing(GO:0071586) CAAX-box protein maturation(GO:0080120) |
0.4 | 0.7 | GO:0034970 | histone H3-R2 methylation(GO:0034970) |
0.4 | 0.7 | GO:2000328 | regulation of T-helper 17 cell lineage commitment(GO:2000328) |
0.4 | 0.4 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.4 | 1.4 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.4 | 2.9 | GO:0071168 | protein localization to chromatin(GO:0071168) |
0.4 | 4.6 | GO:0031297 | replication fork processing(GO:0031297) |
0.4 | 1.1 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.4 | 1.1 | GO:2000156 | regulation of retrograde vesicle-mediated transport, Golgi to ER(GO:2000156) |
0.4 | 4.6 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.4 | 2.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.4 | 9.2 | GO:0045730 | respiratory burst(GO:0045730) |
0.3 | 3.1 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
0.3 | 1.4 | GO:2000984 | regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
0.3 | 2.8 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.3 | 2.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.3 | 4.9 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.3 | 2.1 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
0.3 | 3.8 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.3 | 0.7 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.3 | 2.4 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.3 | 1.4 | GO:0009816 | defense response, incompatible interaction(GO:0009814) defense response to bacterium, incompatible interaction(GO:0009816) regulation of defense response to bacterium, incompatible interaction(GO:1902477) |
0.3 | 0.7 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.3 | 1.0 | GO:1904783 | positive regulation of NMDA glutamate receptor activity(GO:1904783) |
0.3 | 5.1 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.3 | 1.7 | GO:0090035 | regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
0.3 | 1.4 | GO:0040030 | regulation of molecular function, epigenetic(GO:0040030) |
0.3 | 1.3 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.3 | 0.3 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
0.3 | 0.7 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.3 | 1.0 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.3 | 0.7 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.3 | 1.6 | GO:0002268 | follicular dendritic cell activation(GO:0002266) follicular dendritic cell differentiation(GO:0002268) |
0.3 | 2.0 | GO:0044803 | multi-organism membrane organization(GO:0044803) |
0.3 | 1.0 | GO:0038060 | nitric oxide-cGMP-mediated signaling pathway(GO:0038060) |
0.3 | 2.2 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.3 | 1.9 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
0.3 | 3.5 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.3 | 10.2 | GO:0006907 | pinocytosis(GO:0006907) |
0.3 | 3.5 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.3 | 0.6 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) positive regulation of Wnt protein secretion(GO:0061357) |
0.3 | 0.6 | GO:0035720 | intraciliary anterograde transport(GO:0035720) |
0.3 | 1.3 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.3 | 0.3 | GO:0035063 | nuclear speck organization(GO:0035063) |
0.3 | 0.3 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.3 | 1.6 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.3 | 2.8 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.3 | 5.3 | GO:1904776 | regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
0.3 | 1.9 | GO:1902951 | negative regulation of dendritic spine maintenance(GO:1902951) |
0.3 | 1.3 | GO:0050902 | leukocyte adhesive activation(GO:0050902) |
0.3 | 5.3 | GO:0051601 | exocyst localization(GO:0051601) |
0.3 | 9.1 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.3 | 0.6 | GO:0019230 | proprioception(GO:0019230) |
0.3 | 3.4 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.3 | 1.9 | GO:0060082 | response to carbon monoxide(GO:0034465) eye blink reflex(GO:0060082) |
0.3 | 1.2 | GO:0045186 | zonula adherens assembly(GO:0045186) |
0.3 | 12.1 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.3 | 7.4 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.3 | 2.8 | GO:0008228 | opsonization(GO:0008228) |
0.3 | 2.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.3 | 2.8 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) |
0.3 | 1.8 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
0.3 | 5.5 | GO:0002052 | positive regulation of neuroblast proliferation(GO:0002052) |
0.3 | 1.2 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.3 | 7.0 | GO:0071800 | podosome assembly(GO:0071800) |
0.3 | 11.8 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.3 | 1.5 | GO:0032740 | positive regulation of interleukin-17 production(GO:0032740) |
0.3 | 5.1 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.3 | 5.6 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.3 | 1.2 | GO:0035989 | tendon development(GO:0035989) |
0.3 | 5.3 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.3 | 5.3 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.3 | 1.2 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.3 | 10.6 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.3 | 2.9 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.3 | 4.9 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
0.3 | 1.4 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.3 | 1.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.3 | 2.3 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.3 | 1.4 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.3 | 0.9 | GO:0045212 | neurotransmitter receptor biosynthetic process(GO:0045212) |
0.3 | 1.1 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.3 | 2.6 | GO:0031269 | pseudopodium assembly(GO:0031269) regulation of pseudopodium assembly(GO:0031272) positive regulation of pseudopodium assembly(GO:0031274) |
0.3 | 0.3 | GO:0070315 | G1 to G0 transition involved in cell differentiation(GO:0070315) |
0.3 | 0.6 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.3 | 1.1 | GO:1905214 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
0.3 | 0.8 | GO:1905171 | protein localization to phagocytic vesicle(GO:1905161) regulation of protein localization to phagocytic vesicle(GO:1905169) positive regulation of protein localization to phagocytic vesicle(GO:1905171) |
0.3 | 3.3 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.3 | 4.2 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
0.3 | 1.1 | GO:0071348 | cellular response to interleukin-11(GO:0071348) |
0.3 | 1.4 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
0.3 | 3.5 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.3 | 1.1 | GO:0036166 | DNA methylation on cytosine within a CG sequence(GO:0010424) phenotypic switching(GO:0036166) cellular response to cocaine(GO:0071314) |
0.3 | 1.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.3 | 0.8 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.3 | 1.3 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.3 | 2.9 | GO:0030913 | paranodal junction assembly(GO:0030913) |
0.3 | 1.3 | GO:0046946 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
0.3 | 2.4 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.3 | 1.3 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.3 | 2.6 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.3 | 2.4 | GO:0009303 | rRNA transcription(GO:0009303) |
0.3 | 3.7 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.3 | 7.3 | GO:0031050 | dsRNA fragmentation(GO:0031050) production of miRNAs involved in gene silencing by miRNA(GO:0035196) production of small RNA involved in gene silencing by RNA(GO:0070918) |
0.3 | 0.3 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.3 | 1.3 | GO:0051643 | endoplasmic reticulum localization(GO:0051643) |
0.3 | 1.0 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.3 | 3.4 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.3 | 0.5 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.3 | 0.3 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
0.3 | 3.3 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.3 | 1.5 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.3 | 0.5 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.3 | 1.3 | GO:0051013 | microtubule severing(GO:0051013) |
0.2 | 1.2 | GO:0038032 | termination of G-protein coupled receptor signaling pathway(GO:0038032) |
0.2 | 0.7 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.2 | 0.5 | GO:0043418 | homocysteine catabolic process(GO:0043418) |
0.2 | 0.2 | GO:0016246 | RNA interference(GO:0016246) |
0.2 | 0.5 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.2 | 1.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.2 | 1.2 | GO:0032439 | endosome localization(GO:0032439) |
0.2 | 1.5 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.2 | 3.2 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.2 | 10.0 | GO:0006414 | translational elongation(GO:0006414) |
0.2 | 1.2 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.2 | 0.5 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
0.2 | 4.1 | GO:0046498 | S-adenosylhomocysteine metabolic process(GO:0046498) |
0.2 | 1.7 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.2 | 0.7 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.2 | 0.7 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.2 | 0.5 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
0.2 | 0.5 | GO:0051834 | evasion or tolerance of host defenses by virus(GO:0019049) avoidance of host defenses(GO:0044413) evasion or tolerance of host defenses(GO:0044415) avoidance of defenses of other organism involved in symbiotic interaction(GO:0051832) evasion or tolerance of defenses of other organism involved in symbiotic interaction(GO:0051834) |
0.2 | 2.1 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
0.2 | 1.9 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.2 | 0.2 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
0.2 | 2.6 | GO:0072672 | neutrophil extravasation(GO:0072672) |
0.2 | 0.7 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.2 | 0.9 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.2 | 3.0 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) |
0.2 | 2.8 | GO:0006026 | aminoglycan catabolic process(GO:0006026) |
0.2 | 7.8 | GO:0006284 | base-excision repair(GO:0006284) |
0.2 | 3.2 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.2 | 0.5 | GO:0072718 | response to cisplatin(GO:0072718) |
0.2 | 0.5 | GO:0070417 | cellular response to cold(GO:0070417) |
0.2 | 1.4 | GO:0070472 | regulation of uterine smooth muscle contraction(GO:0070472) positive regulation of uterine smooth muscle contraction(GO:0070474) |
0.2 | 2.3 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.2 | 4.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.2 | 0.4 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
0.2 | 1.8 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.2 | 0.9 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.2 | 0.2 | GO:0032252 | secretory granule localization(GO:0032252) |
0.2 | 1.1 | GO:0046015 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) carbon catabolite regulation of transcription(GO:0045990) carbon catabolite activation of transcription(GO:0045991) regulation of transcription by glucose(GO:0046015) positive regulation of transcription by glucose(GO:0046016) |
0.2 | 0.7 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.2 | 1.8 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.2 | 1.5 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.2 | 2.2 | GO:0060318 | definitive erythrocyte differentiation(GO:0060318) |
0.2 | 1.7 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.2 | 0.9 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
0.2 | 3.0 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.2 | 0.4 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
0.2 | 0.8 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.2 | 7.0 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.2 | 13.0 | GO:0051028 | mRNA transport(GO:0051028) |
0.2 | 7.9 | GO:0006378 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
0.2 | 0.2 | GO:0061187 | regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
0.2 | 3.3 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.2 | 2.5 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.2 | 0.8 | GO:0035672 | glutathione transport(GO:0034635) oligopeptide transmembrane transport(GO:0035672) tripeptide transport(GO:0042939) |
0.2 | 0.2 | GO:0061511 | centriole elongation(GO:0061511) |
0.2 | 2.0 | GO:0051461 | corticotropin secretion(GO:0051458) regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
0.2 | 0.6 | GO:0043686 | co-translational protein modification(GO:0043686) |
0.2 | 3.6 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.2 | 2.2 | GO:0045736 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
0.2 | 1.2 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.2 | 0.8 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
0.2 | 1.2 | GO:1904628 | response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
0.2 | 5.0 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.2 | 0.6 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.2 | 1.2 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
0.2 | 2.2 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
0.2 | 2.0 | GO:0046476 | glycosylceramide biosynthetic process(GO:0046476) |
0.2 | 1.0 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.2 | 1.4 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.2 | 1.4 | GO:0061085 | regulation of histone H3-K27 methylation(GO:0061085) |
0.2 | 1.2 | GO:1900086 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.2 | 1.9 | GO:0070269 | pyroptosis(GO:0070269) |
0.2 | 0.2 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
0.2 | 0.2 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.2 | 0.8 | GO:1901249 | regulation of lung goblet cell differentiation(GO:1901249) negative regulation of lung goblet cell differentiation(GO:1901250) |
0.2 | 3.4 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
0.2 | 1.9 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
0.2 | 0.2 | GO:2000095 | regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000095) |
0.2 | 0.8 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
0.2 | 0.4 | GO:0098928 | presynaptic signal transduction(GO:0098928) presynapse to nucleus signaling pathway(GO:0099526) |
0.2 | 1.1 | GO:0071955 | recycling endosome to Golgi transport(GO:0071955) |
0.2 | 5.8 | GO:0015991 | ATP hydrolysis coupled proton transport(GO:0015991) |
0.2 | 0.7 | GO:1990481 | mRNA pseudouridine synthesis(GO:1990481) |
0.2 | 0.7 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.2 | 2.4 | GO:2000671 | motor neuron apoptotic process(GO:0097049) regulation of motor neuron apoptotic process(GO:2000671) |
0.2 | 1.7 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.2 | 30.8 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
0.2 | 1.5 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
0.2 | 0.2 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.2 | 5.7 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.2 | 0.7 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.2 | 0.4 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.2 | 1.3 | GO:0071459 | protein localization to kinetochore(GO:0034501) protein localization to chromosome, centromeric region(GO:0071459) |
0.2 | 0.2 | GO:1903487 | regulation of lactation(GO:1903487) |
0.2 | 1.8 | GO:0042711 | maternal behavior(GO:0042711) |
0.2 | 2.9 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.2 | 0.2 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.2 | 0.5 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.2 | 0.7 | GO:1904672 | regulation of somatic stem cell population maintenance(GO:1904672) |
0.2 | 3.1 | GO:0045830 | positive regulation of isotype switching(GO:0045830) |
0.2 | 2.5 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.2 | 1.6 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
0.2 | 0.7 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
0.2 | 2.6 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
0.2 | 5.4 | GO:0043029 | T cell homeostasis(GO:0043029) |
0.2 | 2.1 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.2 | 3.5 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.2 | 0.5 | GO:0060746 | parental behavior(GO:0060746) |
0.2 | 14.0 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
0.2 | 1.0 | GO:0016266 | O-glycan processing(GO:0016266) |
0.2 | 0.5 | GO:0098917 | retrograde trans-synaptic signaling(GO:0098917) trans-synaptic signaling by lipid(GO:0099541) trans-synaptic signaling by endocannabinoid(GO:0099542) |
0.2 | 0.5 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.2 | 0.9 | GO:0001927 | exocyst assembly(GO:0001927) |
0.2 | 0.3 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.2 | 0.7 | GO:0016185 | synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
0.2 | 4.6 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.2 | 0.5 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.2 | 0.7 | GO:0043307 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
0.2 | 1.7 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.2 | 0.5 | GO:1904861 | excitatory synapse assembly(GO:1904861) |
0.2 | 0.5 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
0.2 | 0.3 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.2 | 1.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.2 | 1.0 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.2 | 3.4 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.2 | 1.0 | GO:0000012 | single strand break repair(GO:0000012) |
0.2 | 1.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.2 | 1.4 | GO:0042092 | type 2 immune response(GO:0042092) |
0.2 | 0.3 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.2 | 0.6 | GO:2000628 | cellular response to nicotine(GO:0071316) regulation of miRNA metabolic process(GO:2000628) |
0.2 | 0.8 | GO:0010836 | negative regulation of protein ADP-ribosylation(GO:0010836) |
0.2 | 4.8 | GO:0033598 | mammary gland epithelial cell proliferation(GO:0033598) |
0.2 | 1.6 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
0.2 | 0.6 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
0.2 | 0.9 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
0.2 | 1.9 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.2 | 0.5 | GO:0009750 | response to fructose(GO:0009750) |
0.2 | 1.9 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.2 | 2.3 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.2 | 0.3 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.2 | 0.5 | GO:0046436 | D-serine catabolic process(GO:0036088) D-alanine family amino acid metabolic process(GO:0046144) D-alanine metabolic process(GO:0046436) D-alanine catabolic process(GO:0055130) |
0.2 | 1.4 | GO:0060974 | neural crest cell migration involved in heart formation(GO:0003147) cell migration involved in heart formation(GO:0060974) anterior neural tube closure(GO:0061713) cellular response to folic acid(GO:0071231) |
0.2 | 0.9 | GO:0006265 | DNA topological change(GO:0006265) |
0.2 | 1.8 | GO:0033275 | actin-myosin filament sliding(GO:0033275) |
0.2 | 1.2 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
0.2 | 0.3 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.2 | 1.4 | GO:0070633 | transepithelial transport(GO:0070633) |
0.2 | 2.1 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.1 | 0.9 | GO:0016446 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.1 | 0.7 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
0.1 | 1.2 | GO:0036344 | platelet formation(GO:0030220) platelet morphogenesis(GO:0036344) |
0.1 | 2.5 | GO:0030225 | macrophage differentiation(GO:0030225) |
0.1 | 4.5 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
0.1 | 0.3 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.7 | GO:0045002 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) double-strand break repair via single-strand annealing(GO:0045002) |
0.1 | 0.3 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.1 | 0.7 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
0.1 | 0.3 | GO:0048880 | sensory system development(GO:0048880) |
0.1 | 2.0 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.1 | 2.6 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.1 | 0.4 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
0.1 | 5.1 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.1 | 1.5 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.1 | 0.7 | GO:0070543 | response to linoleic acid(GO:0070543) blood microparticle formation(GO:0072564) regulation of blood microparticle formation(GO:2000332) positive regulation of blood microparticle formation(GO:2000334) |
0.1 | 5.9 | GO:0007052 | mitotic spindle organization(GO:0007052) |
0.1 | 1.5 | GO:2001223 | negative regulation of neuron migration(GO:2001223) |
0.1 | 7.0 | GO:0016925 | protein sumoylation(GO:0016925) |
0.1 | 0.4 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.1 | 1.6 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
0.1 | 0.8 | GO:0090009 | primitive streak formation(GO:0090009) |
0.1 | 1.0 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.1 | 1.0 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
0.1 | 1.3 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.6 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.1 | 0.5 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.1 | 0.5 | GO:0031077 | post-embryonic camera-type eye development(GO:0031077) |
0.1 | 0.8 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.1 | 1.5 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 0.5 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
0.1 | 0.2 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 1.2 | GO:0086043 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.1 | 1.0 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
0.1 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 2.4 | GO:2000036 | regulation of stem cell population maintenance(GO:2000036) |
0.1 | 0.9 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.1 | 1.9 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.1 | 0.4 | GO:0048302 | regulation of isotype switching to IgG isotypes(GO:0048302) |
0.1 | 3.6 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.1 | 1.8 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.6 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.5 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 1.3 | GO:0071636 | positive regulation of transforming growth factor beta production(GO:0071636) |
0.1 | 0.2 | GO:0009189 | deoxyribonucleoside diphosphate biosynthetic process(GO:0009189) |
0.1 | 0.5 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.1 | 0.9 | GO:0001842 | neural fold formation(GO:0001842) |
0.1 | 0.7 | GO:0048069 | eye pigmentation(GO:0048069) |
0.1 | 15.4 | GO:1990823 | response to leukemia inhibitory factor(GO:1990823) cellular response to leukemia inhibitory factor(GO:1990830) |
0.1 | 2.6 | GO:0033363 | secretory granule organization(GO:0033363) |
0.1 | 0.9 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.1 | 1.7 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.1 | 1.6 | GO:0016180 | snRNA processing(GO:0016180) |
0.1 | 1.1 | GO:0050957 | equilibrioception(GO:0050957) |
0.1 | 1.8 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.1 | 0.6 | GO:0010824 | regulation of centrosome duplication(GO:0010824) |
0.1 | 1.7 | GO:0071549 | cellular response to dexamethasone stimulus(GO:0071549) |
0.1 | 1.9 | GO:0043488 | regulation of mRNA stability(GO:0043488) |
0.1 | 1.7 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.1 | 3.7 | GO:0030593 | neutrophil chemotaxis(GO:0030593) |
0.1 | 0.8 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 5.8 | GO:0042100 | B cell proliferation(GO:0042100) |
0.1 | 0.7 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
0.1 | 0.4 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.1 | 1.3 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.1 | 0.5 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.1 | 6.6 | GO:0045576 | mast cell activation(GO:0045576) |
0.1 | 0.3 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.1 | 0.9 | GO:0036371 | protein localization to M-band(GO:0036309) protein localization to T-tubule(GO:0036371) |
0.1 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 1.1 | GO:0019985 | translesion synthesis(GO:0019985) |
0.1 | 6.7 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.1 | 0.3 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.1 | 0.1 | GO:0030578 | PML body organization(GO:0030578) |
0.1 | 2.6 | GO:0017145 | stem cell division(GO:0017145) |
0.1 | 0.1 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.1 | 0.6 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.1 | 0.4 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.1 | 0.6 | GO:0050760 | thymidylate synthase biosynthetic process(GO:0050757) regulation of thymidylate synthase biosynthetic process(GO:0050758) negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
0.1 | 3.2 | GO:0042254 | ribosome biogenesis(GO:0042254) |
0.1 | 2.2 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.1 | 1.2 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.1 | 0.3 | GO:0016240 | autophagosome docking(GO:0016240) |
0.1 | 2.2 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.1 | 1.8 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.1 | 0.3 | GO:0002767 | immune response-inhibiting signal transduction(GO:0002765) immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.1 | 0.5 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.1 | 0.4 | GO:0031062 | positive regulation of histone methylation(GO:0031062) |
0.1 | 0.4 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 0.6 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.1 | 1.6 | GO:0035065 | regulation of histone acetylation(GO:0035065) |
0.1 | 0.3 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.1 | 2.2 | GO:0000281 | mitotic cytokinesis(GO:0000281) |
0.1 | 1.1 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
0.1 | 0.4 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
0.1 | 1.0 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 0.6 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 1.1 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.1 | 0.3 | GO:0044805 | late nucleophagy(GO:0044805) |
0.1 | 0.5 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.1 | 0.4 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.1 | 0.2 | GO:0003360 | brainstem development(GO:0003360) |
0.1 | 1.2 | GO:0007097 | nuclear migration(GO:0007097) establishment of nucleus localization(GO:0040023) |
0.1 | 0.6 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.1 | 0.7 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.1 | 0.5 | GO:0033574 | response to testosterone(GO:0033574) |
0.1 | 0.1 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.1 | 0.3 | GO:0003420 | regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
0.1 | 0.3 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.1 | 0.5 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.6 | GO:0035879 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.1 | 0.2 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) |
0.1 | 1.0 | GO:0080009 | mRNA methylation(GO:0080009) |
0.1 | 0.9 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.1 | 0.8 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.1 | 12.4 | GO:0009615 | response to virus(GO:0009615) |
0.1 | 0.3 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.1 | 5.6 | GO:0035914 | skeletal muscle cell differentiation(GO:0035914) |
0.1 | 0.2 | GO:0033153 | somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
0.1 | 0.4 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.4 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.1 | 0.5 | GO:1904851 | positive regulation of establishment of protein localization to telomere(GO:1904851) |
0.1 | 1.2 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
0.1 | 1.1 | GO:0051602 | response to electrical stimulus(GO:0051602) |
0.1 | 0.2 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
0.1 | 0.3 | GO:0072218 | ascending thin limb development(GO:0072021) thick ascending limb development(GO:0072023) metanephric ascending thin limb development(GO:0072218) metanephric thick ascending limb development(GO:0072233) |
0.1 | 0.6 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.1 | 0.5 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.1 | 0.3 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.1 | 0.7 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.1 | 0.4 | GO:0021800 | cerebral cortex tangential migration(GO:0021800) |
0.1 | 0.6 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
0.1 | 0.4 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.1 | 0.4 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
0.1 | 1.3 | GO:1901099 | negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
0.1 | 0.4 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.1 | 0.2 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.1 | 0.4 | GO:0002313 | mature B cell differentiation involved in immune response(GO:0002313) |
0.1 | 0.2 | GO:0046134 | pyrimidine nucleoside biosynthetic process(GO:0046134) |
0.1 | 0.2 | GO:0030575 | nuclear body organization(GO:0030575) |
0.1 | 0.5 | GO:0007183 | SMAD protein complex assembly(GO:0007183) |
0.1 | 0.2 | GO:0030450 | regulation of complement activation, classical pathway(GO:0030450) |
0.1 | 0.8 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
0.1 | 0.2 | GO:0050904 | diapedesis(GO:0050904) endothelial cell-matrix adhesion(GO:0090673) |
0.1 | 0.2 | GO:0006478 | peptidyl-tyrosine sulfation(GO:0006478) |
0.1 | 0.4 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.1 | 2.3 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.1 | 1.5 | GO:0006611 | protein export from nucleus(GO:0006611) |
0.1 | 0.6 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.2 | GO:0075044 | radial glia guided migration of cerebellar granule cell(GO:0021933) autophagy of host cells involved in interaction with symbiont(GO:0075044) autophagy involved in symbiotic interaction(GO:0075071) |
0.1 | 0.2 | GO:0061056 | sclerotome development(GO:0061056) |
0.1 | 2.8 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
0.1 | 0.1 | GO:0033505 | floor plate formation(GO:0021508) floor plate morphogenesis(GO:0033505) |
0.1 | 0.8 | GO:0006734 | NADH metabolic process(GO:0006734) |
0.1 | 0.4 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.1 | 0.4 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
0.1 | 0.2 | GO:0032962 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
0.0 | 0.1 | GO:0097401 | synaptic vesicle lumen acidification(GO:0097401) |
0.0 | 1.4 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.0 | 0.2 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.0 | 4.0 | GO:0045667 | regulation of osteoblast differentiation(GO:0045667) |
0.0 | 0.2 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.0 | 0.7 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.0 | 2.6 | GO:0042475 | odontogenesis of dentin-containing tooth(GO:0042475) |
0.0 | 0.2 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
0.0 | 0.3 | GO:1904406 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
0.0 | 0.3 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
0.0 | 0.6 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.5 | GO:0010972 | negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
0.0 | 0.3 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 0.7 | GO:0006817 | phosphate ion transport(GO:0006817) |
0.0 | 0.5 | GO:0098953 | receptor diffusion trapping(GO:0098953) postsynaptic neurotransmitter receptor diffusion trapping(GO:0098970) neurotransmitter receptor diffusion trapping(GO:0099628) protein localization to postsynaptic specialization membrane(GO:0099633) neurotransmitter receptor localization to postsynaptic specialization membrane(GO:0099645) |
0.0 | 0.0 | GO:2000769 | regulation of establishment or maintenance of cell polarity regulating cell shape(GO:2000769) positive regulation of establishment or maintenance of cell polarity regulating cell shape(GO:2000771) |
0.0 | 0.4 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.0 | 0.5 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
0.0 | 0.1 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.0 | 1.0 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.2 | GO:0038203 | TORC2 signaling(GO:0038203) |
0.0 | 0.0 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.0 | 0.2 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
0.0 | 0.1 | GO:0003365 | establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
0.0 | 0.1 | GO:0042635 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
0.0 | 0.3 | GO:0015879 | amino-acid betaine transport(GO:0015838) carnitine transport(GO:0015879) |
0.0 | 0.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 1.2 | GO:0061178 | regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061178) |
0.0 | 0.9 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
0.0 | 0.4 | GO:0046040 | IMP metabolic process(GO:0046040) |
0.0 | 0.2 | GO:1901660 | calcium ion export(GO:1901660) |
0.0 | 1.4 | GO:1903749 | positive regulation of establishment of protein localization to mitochondrion(GO:1903749) positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.0 | 0.3 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.0 | 8.7 | GO:0006412 | translation(GO:0006412) |
0.0 | 6.8 | GO:0006397 | mRNA processing(GO:0006397) |
0.0 | 0.5 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
0.0 | 0.6 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
0.0 | 0.1 | GO:1903756 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
0.0 | 0.1 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.0 | 0.0 | GO:1905244 | regulation of modification of synaptic structure(GO:1905244) |
0.0 | 0.3 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.0 | 0.1 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 1.1 | GO:0032272 | negative regulation of protein polymerization(GO:0032272) |
0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.0 | 0.3 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.6 | GO:0000070 | mitotic sister chromatid segregation(GO:0000070) |
0.0 | 0.1 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.0 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.0 | 0.4 | GO:0015858 | nucleoside transport(GO:0015858) |
0.0 | 0.0 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.0 | 0.2 | GO:0030279 | negative regulation of ossification(GO:0030279) |
0.0 | 0.2 | GO:0086026 | atrial cardiac muscle cell action potential(GO:0086014) atrial cardiac muscle cell to AV node cell signaling(GO:0086026) atrial cardiac muscle cell to AV node cell communication(GO:0086066) |
0.0 | 0.4 | GO:0071479 | cellular response to ionizing radiation(GO:0071479) |
0.0 | 0.1 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
0.0 | 0.1 | GO:0097503 | sialylation(GO:0097503) |
0.0 | 0.0 | GO:0060558 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) bile acid signaling pathway(GO:0038183) regulation of calcidiol 1-monooxygenase activity(GO:0060558) |
0.0 | 0.6 | GO:0007093 | mitotic cell cycle checkpoint(GO:0007093) |
0.0 | 0.2 | GO:0003416 | endochondral bone growth(GO:0003416) bone growth(GO:0098868) |
0.0 | 0.1 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.0 | 0.1 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
0.0 | 0.2 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.0 | 0.0 | GO:0019085 | early viral transcription(GO:0019085) late viral transcription(GO:0019086) |
0.0 | 0.2 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.0 | 0.1 | GO:0003017 | lymph circulation(GO:0003017) |
0.0 | 0.1 | GO:0050798 | activated T cell proliferation(GO:0050798) |
0.0 | 0.1 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.0 | 0.0 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.0 | 0.0 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.0 | 0.0 | GO:1902267 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.0 | 0.1 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
6.8 | 40.8 | GO:0032133 | chromosome passenger complex(GO:0032133) |
6.3 | 31.6 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
4.0 | 15.9 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
3.4 | 24.1 | GO:0005638 | lamin filament(GO:0005638) |
3.0 | 9.1 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
2.9 | 8.6 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
2.7 | 5.5 | GO:0005656 | nuclear pre-replicative complex(GO:0005656) pre-replicative complex(GO:0036387) |
2.6 | 7.9 | GO:1902912 | pyruvate kinase complex(GO:1902912) |
2.5 | 17.4 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
2.4 | 196.9 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
2.2 | 24.2 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
2.2 | 6.5 | GO:0031904 | endosome lumen(GO:0031904) |
2.1 | 6.4 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
2.1 | 6.2 | GO:0005588 | collagen type V trimer(GO:0005588) |
2.1 | 8.2 | GO:0032021 | NELF complex(GO:0032021) |
2.0 | 111.8 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
1.9 | 19.4 | GO:0042382 | paraspeckles(GO:0042382) |
1.9 | 13.4 | GO:0031095 | platelet dense tubular network membrane(GO:0031095) |
1.9 | 9.3 | GO:0005687 | U4 snRNP(GO:0005687) |
1.8 | 5.5 | GO:0005854 | nascent polypeptide-associated complex(GO:0005854) |
1.8 | 7.2 | GO:0005833 | hemoglobin complex(GO:0005833) |
1.8 | 8.9 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
1.8 | 10.7 | GO:0098553 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
1.7 | 25.6 | GO:0042555 | MCM complex(GO:0042555) |
1.7 | 6.6 | GO:0001740 | Barr body(GO:0001740) |
1.6 | 14.5 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
1.6 | 4.8 | GO:1990423 | RZZ complex(GO:1990423) |
1.6 | 23.8 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
1.6 | 9.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
1.6 | 20.2 | GO:0034709 | methylosome(GO:0034709) |
1.5 | 1.5 | GO:0031209 | SCAR complex(GO:0031209) |
1.5 | 1.5 | GO:0097526 | spliceosomal tri-snRNP complex(GO:0097526) |
1.5 | 4.5 | GO:0044302 | dentate gyrus mossy fiber(GO:0044302) |
1.4 | 9.5 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
1.3 | 9.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
1.3 | 11.4 | GO:0033093 | Weibel-Palade body(GO:0033093) |
1.3 | 13.8 | GO:0097451 | glial limiting end-foot(GO:0097451) |
1.2 | 5.0 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
1.2 | 8.6 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
1.2 | 7.1 | GO:0070449 | elongin complex(GO:0070449) |
1.2 | 16.4 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
1.2 | 3.5 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
1.1 | 16.1 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
1.1 | 13.3 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
1.1 | 3.2 | GO:0097144 | BAX complex(GO:0097144) |
1.0 | 12.5 | GO:0000796 | condensin complex(GO:0000796) |
1.0 | 6.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
1.0 | 3.0 | GO:0098592 | cytoplasmic side of apical plasma membrane(GO:0098592) |
1.0 | 7.9 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
1.0 | 7.9 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
1.0 | 3.0 | GO:0036398 | TCR signalosome(GO:0036398) |
1.0 | 2.9 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
1.0 | 2.9 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
1.0 | 5.8 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
1.0 | 18.4 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.9 | 3.8 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.9 | 2.8 | GO:0001652 | granular component(GO:0001652) |
0.9 | 26.7 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.9 | 6.4 | GO:0097165 | nuclear stress granule(GO:0097165) |
0.9 | 4.5 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.9 | 6.3 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.9 | 9.9 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.9 | 4.5 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.9 | 13.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.9 | 7.9 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.9 | 5.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.9 | 8.7 | GO:0061574 | ASAP complex(GO:0061574) |
0.9 | 2.6 | GO:1990630 | IRE1-RACK1-PP2A complex(GO:1990630) |
0.8 | 13.6 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.8 | 4.2 | GO:0071953 | elastic fiber(GO:0071953) |
0.8 | 1.7 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.8 | 4.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.8 | 4.9 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.8 | 4.0 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.8 | 4.7 | GO:0044279 | other organism cell membrane(GO:0044218) other organism membrane(GO:0044279) |
0.8 | 6.9 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.8 | 9.1 | GO:0000974 | Prp19 complex(GO:0000974) |
0.8 | 0.8 | GO:0019034 | viral replication complex(GO:0019034) |
0.7 | 8.1 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.7 | 13.8 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.7 | 10.2 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.7 | 2.9 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
0.7 | 7.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.7 | 10.6 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.7 | 3.5 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
0.7 | 3.4 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.7 | 10.3 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.7 | 5.4 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.7 | 2.0 | GO:0034455 | t-UTP complex(GO:0034455) |
0.7 | 2.0 | GO:0005584 | collagen type I trimer(GO:0005584) |
0.7 | 1.3 | GO:0000805 | X chromosome(GO:0000805) |
0.7 | 13.8 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.6 | 0.6 | GO:0016342 | catenin complex(GO:0016342) |
0.6 | 4.5 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
0.6 | 8.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.6 | 6.2 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.6 | 30.8 | GO:0015030 | Cajal body(GO:0015030) |
0.6 | 6.0 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.6 | 25.9 | GO:0016592 | mediator complex(GO:0016592) |
0.6 | 4.7 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.6 | 3.5 | GO:1903440 | calcitonin family receptor complex(GO:1903439) amylin receptor complex(GO:1903440) |
0.6 | 16.6 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.6 | 4.0 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.6 | 19.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.6 | 1.7 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.6 | 2.3 | GO:0032280 | symmetric synapse(GO:0032280) |
0.6 | 2.8 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.6 | 8.3 | GO:0005869 | dynactin complex(GO:0005869) |
0.6 | 11.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.5 | 3.8 | GO:1990246 | uniplex complex(GO:1990246) |
0.5 | 1.6 | GO:0005760 | gamma DNA polymerase complex(GO:0005760) |
0.5 | 17.1 | GO:0001891 | phagocytic cup(GO:0001891) |
0.5 | 1.6 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
0.5 | 7.9 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.5 | 4.1 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.5 | 3.5 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.5 | 3.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.5 | 2.5 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.5 | 3.0 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.5 | 2.4 | GO:0045160 | myosin I complex(GO:0045160) |
0.5 | 4.8 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.5 | 5.6 | GO:0071439 | clathrin complex(GO:0071439) |
0.5 | 2.8 | GO:0042583 | chromaffin granule(GO:0042583) |
0.5 | 5.0 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.4 | 2.2 | GO:0000125 | PCAF complex(GO:0000125) |
0.4 | 29.5 | GO:0015934 | large ribosomal subunit(GO:0015934) |
0.4 | 21.4 | GO:0008305 | integrin complex(GO:0008305) |
0.4 | 2.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.4 | 1.3 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
0.4 | 1.7 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.4 | 4.7 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.4 | 0.4 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
0.4 | 11.1 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.4 | 7.7 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.4 | 6.8 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.4 | 32.3 | GO:0005871 | kinesin complex(GO:0005871) |
0.4 | 1.2 | GO:0002945 | cyclin K-CDK12 complex(GO:0002944) cyclin K-CDK13 complex(GO:0002945) |
0.4 | 3.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.4 | 1.2 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.4 | 2.3 | GO:0008537 | proteasome activator complex(GO:0008537) |
0.4 | 1.9 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.4 | 2.3 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.4 | 27.2 | GO:0005643 | nuclear pore(GO:0005643) |
0.4 | 1.9 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.4 | 4.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.4 | 0.4 | GO:1990257 | piccolo-bassoon transport vesicle(GO:1990257) |
0.4 | 2.2 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.4 | 1.5 | GO:0014802 | terminal cisterna(GO:0014802) |
0.4 | 1.5 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.4 | 2.5 | GO:0000243 | commitment complex(GO:0000243) |
0.4 | 1.1 | GO:1990622 | CHOP-ATF3 complex(GO:1990622) |
0.3 | 8.7 | GO:0071564 | npBAF complex(GO:0071564) |
0.3 | 6.2 | GO:0036038 | MKS complex(GO:0036038) |
0.3 | 1.0 | GO:0042643 | actomyosin, actin portion(GO:0042643) |
0.3 | 1.0 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
0.3 | 4.4 | GO:0097427 | microtubule bundle(GO:0097427) |
0.3 | 2.3 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
0.3 | 1.6 | GO:0033257 | Bcl3/NF-kappaB2 complex(GO:0033257) |
0.3 | 1.0 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.3 | 1.6 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.3 | 1.3 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.3 | 1.6 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.3 | 1.9 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.3 | 1.6 | GO:0030690 | Noc complex(GO:0030689) Noc1p-Noc2p complex(GO:0030690) |
0.3 | 0.9 | GO:0038045 | large latent transforming growth factor-beta complex(GO:0038045) |
0.3 | 0.6 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.3 | 0.6 | GO:0031021 | interphase microtubule organizing center(GO:0031021) |
0.3 | 2.9 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.3 | 3.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.3 | 1.2 | GO:0070820 | tertiary granule(GO:0070820) |
0.3 | 2.6 | GO:0032584 | growth cone membrane(GO:0032584) |
0.3 | 1.2 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.3 | 1.7 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.3 | 4.0 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.3 | 0.3 | GO:0030891 | VCB complex(GO:0030891) |
0.3 | 14.9 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.3 | 11.2 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.3 | 1.4 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.3 | 1.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.3 | 1.6 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.3 | 2.4 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.3 | 4.8 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.3 | 4.3 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.3 | 1.1 | GO:1990037 | Lewy body core(GO:1990037) |
0.3 | 0.8 | GO:0034456 | CURI complex(GO:0032545) UTP-C complex(GO:0034456) |
0.3 | 2.4 | GO:0045298 | tubulin complex(GO:0045298) |
0.3 | 9.8 | GO:0002102 | podosome(GO:0002102) |
0.3 | 2.4 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.3 | 0.8 | GO:0033010 | paranodal junction(GO:0033010) |
0.3 | 1.3 | GO:0099524 | region of cytosol(GO:0099522) postsynaptic cytosol(GO:0099524) |
0.3 | 5.0 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.3 | 1.3 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.3 | 4.2 | GO:0001939 | female pronucleus(GO:0001939) |
0.3 | 3.8 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.3 | 1.5 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.3 | 2.8 | GO:0000812 | Swr1 complex(GO:0000812) |
0.3 | 0.8 | GO:0005682 | U5 snRNP(GO:0005682) |
0.2 | 3.2 | GO:0060170 | ciliary membrane(GO:0060170) |
0.2 | 3.7 | GO:0043596 | nuclear replication fork(GO:0043596) |
0.2 | 1.0 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.2 | 1.0 | GO:0071920 | cleavage body(GO:0071920) |
0.2 | 1.7 | GO:0030897 | HOPS complex(GO:0030897) |
0.2 | 0.7 | GO:0035354 | Toll-like receptor 1-Toll-like receptor 2 protein complex(GO:0035354) |
0.2 | 1.6 | GO:0098536 | deuterosome(GO:0098536) |
0.2 | 2.6 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.2 | 3.2 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.2 | 2.8 | GO:0044327 | dendritic spine head(GO:0044327) |
0.2 | 1.8 | GO:0005686 | U2 snRNP(GO:0005686) |
0.2 | 2.0 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.2 | 0.7 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.2 | 0.4 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.2 | 2.6 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.2 | 4.1 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.2 | 4.3 | GO:0031143 | pseudopodium(GO:0031143) |
0.2 | 1.5 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.2 | 0.6 | GO:0089701 | U2AF(GO:0089701) |
0.2 | 1.0 | GO:1990745 | GARP complex(GO:0000938) EARP complex(GO:1990745) |
0.2 | 0.2 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
0.2 | 1.4 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.2 | 0.6 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.2 | 19.1 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.2 | 3.8 | GO:0044453 | nuclear membrane part(GO:0044453) |
0.2 | 1.8 | GO:0042629 | mast cell granule(GO:0042629) |
0.2 | 2.8 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.2 | 23.4 | GO:0019814 | immunoglobulin complex(GO:0019814) |
0.2 | 0.6 | GO:0070985 | TFIIK complex(GO:0070985) |
0.2 | 1.4 | GO:0036396 | MIS complex(GO:0036396) |
0.2 | 1.4 | GO:0097443 | sorting endosome(GO:0097443) |
0.2 | 5.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.2 | 5.0 | GO:0005839 | proteasome core complex(GO:0005839) |
0.2 | 8.5 | GO:0043034 | costamere(GO:0043034) |
0.2 | 0.8 | GO:0042642 | actomyosin, myosin complex part(GO:0042642) |
0.2 | 0.9 | GO:0010370 | perinucleolar chromocenter(GO:0010370) |
0.2 | 31.7 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.2 | 7.2 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.2 | 0.6 | GO:1990879 | CST complex(GO:1990879) |
0.2 | 0.7 | GO:0019908 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
0.2 | 4.3 | GO:0000145 | exocyst(GO:0000145) |
0.2 | 8.6 | GO:0031519 | PcG protein complex(GO:0031519) |
0.2 | 1.4 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.2 | 2.5 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.2 | 0.9 | GO:0031251 | PAN complex(GO:0031251) |
0.2 | 0.9 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.2 | 0.5 | GO:0043540 | 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase complex(GO:0043540) |
0.2 | 0.7 | GO:0008623 | CHRAC(GO:0008623) |
0.2 | 4.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.2 | 2.0 | GO:0051286 | cell tip(GO:0051286) |
0.2 | 0.8 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.2 | 3.3 | GO:0046930 | pore complex(GO:0046930) |
0.2 | 5.0 | GO:0005876 | spindle microtubule(GO:0005876) |
0.2 | 0.6 | GO:0035061 | interchromatin granule(GO:0035061) |
0.2 | 11.7 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.2 | 1.2 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
0.2 | 0.9 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 1.6 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.1 | 6.3 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.1 | 2.7 | GO:0005605 | basal lamina(GO:0005605) |
0.1 | 1.8 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 0.7 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.1 | 0.7 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.7 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.1 | 2.3 | GO:0033202 | DNA helicase complex(GO:0033202) |
0.1 | 2.8 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.1 | 8.4 | GO:0030684 | preribosome(GO:0030684) |
0.1 | 2.2 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.1 | 0.7 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.1 | 0.4 | GO:1904602 | serotonin-activated cation-selective channel complex(GO:1904602) |
0.1 | 0.5 | GO:0032982 | myosin filament(GO:0032982) |
0.1 | 14.4 | GO:0032993 | protein-DNA complex(GO:0032993) |
0.1 | 1.6 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 1.4 | GO:0000792 | heterochromatin(GO:0000792) |
0.1 | 0.6 | GO:0098560 | cytoplasmic side of late endosome membrane(GO:0098560) |
0.1 | 2.4 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 1.7 | GO:0070938 | contractile ring(GO:0070938) |
0.1 | 0.4 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 1.3 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.1 | 0.7 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.1 | 15.2 | GO:0005681 | spliceosomal complex(GO:0005681) |
0.1 | 0.7 | GO:0010369 | chromocenter(GO:0010369) |
0.1 | 0.8 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.1 | 1.9 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 1.2 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.1 | 0.5 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 2.1 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.1 | 2.1 | GO:0031528 | microvillus membrane(GO:0031528) |
0.1 | 1.6 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 1.3 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.1 | 0.2 | GO:0032806 | holo TFIIH complex(GO:0005675) carboxy-terminal domain protein kinase complex(GO:0032806) |
0.1 | 4.6 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.1 | 1.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.1 | 3.7 | GO:0016460 | myosin II complex(GO:0016460) |
0.1 | 1.0 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.4 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.8 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.1 | 3.0 | GO:0016469 | proton-transporting two-sector ATPase complex(GO:0016469) |
0.1 | 3.0 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 0.3 | GO:0002095 | caveolar macromolecular signaling complex(GO:0002095) |
0.1 | 7.8 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.1 | 0.2 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.1 | 0.5 | GO:0071144 | SMAD2-SMAD3 protein complex(GO:0071144) |
0.1 | 1.2 | GO:0005861 | troponin complex(GO:0005861) |
0.1 | 3.7 | GO:0001772 | immunological synapse(GO:0001772) |
0.1 | 0.6 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 0.7 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 0.7 | GO:0061617 | MICOS complex(GO:0061617) |
0.1 | 0.9 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 1.9 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.1 | 1.4 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 12.0 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
0.1 | 7.2 | GO:0043198 | dendritic shaft(GO:0043198) |
0.1 | 13.0 | GO:0044452 | nucleolar part(GO:0044452) |
0.1 | 1.1 | GO:0022624 | proteasome regulatory particle(GO:0005838) proteasome accessory complex(GO:0022624) |
0.1 | 0.4 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 0.3 | GO:0036157 | outer dynein arm(GO:0036157) |
0.1 | 3.1 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
0.1 | 0.2 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.1 | 0.9 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 14.8 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
0.1 | 1.0 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 0.2 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.1 | 0.7 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.1 | 1.4 | GO:0031672 | A band(GO:0031672) |
0.1 | 2.6 | GO:0032809 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
0.1 | 0.6 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.1 | 0.2 | GO:0097632 | extrinsic component of pre-autophagosomal structure membrane(GO:0097632) |
0.1 | 2.2 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 4.7 | GO:0016605 | PML body(GO:0016605) |
0.1 | 2.9 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.1 | 0.8 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 5.4 | GO:0005814 | centriole(GO:0005814) |
0.1 | 4.8 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.1 | 0.3 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.1 | 1.1 | GO:0032039 | integrator complex(GO:0032039) |
0.1 | 0.6 | GO:0031931 | TORC1 complex(GO:0031931) |
0.1 | 1.7 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.1 | 5.5 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.1 | 0.3 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.1 | 0.4 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 37.2 | GO:0005730 | nucleolus(GO:0005730) |
0.1 | 0.2 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 3.1 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 0.1 | GO:0030677 | ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.1 | 16.4 | GO:0000790 | nuclear chromatin(GO:0000790) |
0.1 | 1.7 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.8 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 7.8 | GO:0030027 | lamellipodium(GO:0030027) |
0.0 | 3.4 | GO:0031970 | organelle envelope lumen(GO:0031970) |
0.0 | 0.5 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 1.3 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
0.0 | 1.2 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 0.5 | GO:0043205 | microfibril(GO:0001527) fibril(GO:0043205) |
0.0 | 3.4 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.0 | 0.9 | GO:0034708 | methyltransferase complex(GO:0034708) |
0.0 | 0.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 2.7 | GO:0030018 | Z disc(GO:0030018) |
0.0 | 0.3 | GO:0098687 | chromosomal region(GO:0098687) |
0.0 | 10.5 | GO:0005813 | centrosome(GO:0005813) |
0.0 | 0.6 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 0.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 10.8 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.4 | GO:0043218 | compact myelin(GO:0043218) |
0.0 | 1.5 | GO:0032587 | ruffle membrane(GO:0032587) |
0.0 | 0.3 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 0.2 | GO:0036379 | myofilament(GO:0036379) |
0.0 | 2.1 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 5.3 | GO:0005925 | focal adhesion(GO:0005925) |
0.0 | 0.2 | GO:0038201 | TOR complex(GO:0038201) |
0.0 | 1.2 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 1.5 | GO:0044798 | nuclear transcription factor complex(GO:0044798) |
0.0 | 2.0 | GO:0030426 | growth cone(GO:0030426) |
0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
0.0 | 0.1 | GO:0001741 | sex chromosome(GO:0000803) XY body(GO:0001741) |
0.0 | 0.4 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.1 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
8.1 | 32.6 | GO:0031720 | haptoglobin binding(GO:0031720) |
5.0 | 40.3 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
4.9 | 19.7 | GO:0008160 | protein tyrosine phosphatase activator activity(GO:0008160) |
4.3 | 21.6 | GO:0070051 | fibrinogen binding(GO:0070051) |
3.4 | 16.8 | GO:0008859 | exoribonuclease II activity(GO:0008859) |
3.2 | 9.6 | GO:0019948 | SUMO activating enzyme activity(GO:0019948) |
2.8 | 16.9 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
2.7 | 8.2 | GO:0031753 | endothelial differentiation G-protein coupled receptor binding(GO:0031753) Edg-2 lysophosphatidic acid receptor binding(GO:0031755) |
2.5 | 14.8 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
2.4 | 7.3 | GO:0004798 | thymidylate kinase activity(GO:0004798) |
2.4 | 7.1 | GO:0005152 | interleukin-1 receptor antagonist activity(GO:0005152) |
2.3 | 7.0 | GO:0019959 | interleukin-8 binding(GO:0019959) |
2.3 | 20.7 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
2.3 | 6.8 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
2.2 | 9.0 | GO:0043532 | angiostatin binding(GO:0043532) |
2.2 | 8.8 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
2.2 | 6.5 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
2.1 | 8.3 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
2.0 | 27.6 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
1.9 | 5.8 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
1.9 | 34.7 | GO:0003688 | DNA replication origin binding(GO:0003688) |
1.8 | 7.3 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
1.8 | 3.5 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
1.8 | 10.6 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
1.7 | 8.7 | GO:0030621 | U4 snRNA binding(GO:0030621) |
1.6 | 8.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
1.6 | 4.9 | GO:0004615 | phosphomannomutase activity(GO:0004615) |
1.6 | 4.9 | GO:0016872 | inositol-3-phosphate synthase activity(GO:0004512) intramolecular lyase activity(GO:0016872) |
1.6 | 4.9 | GO:0004087 | carbamoyl-phosphate synthase (ammonia) activity(GO:0004087) carbamoyl-phosphate synthase (glutamine-hydrolyzing) activity(GO:0004088) |
1.6 | 14.7 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
1.6 | 6.4 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
1.6 | 1.6 | GO:0016890 | site-specific endodeoxyribonuclease activity, specific for altered base(GO:0016890) |
1.6 | 7.9 | GO:0004743 | pyruvate kinase activity(GO:0004743) |
1.6 | 7.8 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
1.6 | 9.3 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
1.5 | 23.0 | GO:0008097 | 5S rRNA binding(GO:0008097) |
1.5 | 6.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
1.5 | 7.3 | GO:0055056 | dehydroascorbic acid transporter activity(GO:0033300) D-glucose transmembrane transporter activity(GO:0055056) |
1.4 | 267.8 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
1.4 | 4.2 | GO:0070039 | rRNA (guanosine-2'-O-)-methyltransferase activity(GO:0070039) |
1.4 | 4.2 | GO:0003999 | adenine binding(GO:0002055) adenine phosphoribosyltransferase activity(GO:0003999) |
1.4 | 21.0 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
1.3 | 6.7 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
1.3 | 8.0 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
1.3 | 4.0 | GO:0042602 | riboflavin reductase (NADPH) activity(GO:0042602) |
1.3 | 7.7 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
1.3 | 11.5 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
1.2 | 5.0 | GO:0030629 | U6 snRNA 3'-end binding(GO:0030629) |
1.2 | 3.7 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
1.2 | 6.2 | GO:0034041 | sterol-transporting ATPase activity(GO:0034041) |
1.2 | 7.4 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
1.2 | 6.1 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
1.2 | 5.9 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
1.2 | 4.7 | GO:0004329 | formate-tetrahydrofolate ligase activity(GO:0004329) |
1.2 | 1.2 | GO:0030348 | syntaxin-3 binding(GO:0030348) |
1.2 | 4.7 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
1.2 | 3.5 | GO:0052871 | tocopherol omega-hydroxylase activity(GO:0052870) alpha-tocopherol omega-hydroxylase activity(GO:0052871) |
1.2 | 3.5 | GO:0036004 | GAF domain binding(GO:0036004) |
1.1 | 8.0 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
1.1 | 3.4 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
1.1 | 4.4 | GO:0035575 | histone demethylase activity (H4-K20 specific)(GO:0035575) |
1.1 | 5.4 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
1.1 | 5.4 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
1.1 | 9.8 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
1.1 | 13.8 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
1.0 | 7.3 | GO:0070883 | pre-miRNA binding(GO:0070883) |
1.0 | 5.2 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
1.0 | 7.2 | GO:0001851 | complement component C3b binding(GO:0001851) |
1.0 | 5.1 | GO:0004051 | arachidonate 5-lipoxygenase activity(GO:0004051) |
1.0 | 9.9 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
1.0 | 2.9 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
1.0 | 6.8 | GO:0032027 | myosin light chain binding(GO:0032027) |
1.0 | 2.9 | GO:0004819 | glutamine-tRNA ligase activity(GO:0004819) |
0.9 | 2.8 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.9 | 13.2 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.9 | 12.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.9 | 5.6 | GO:0016936 | galactoside binding(GO:0016936) |
0.9 | 6.2 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
0.9 | 3.6 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.9 | 0.9 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.9 | 2.7 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.9 | 3.5 | GO:0004092 | carnitine O-acetyltransferase activity(GO:0004092) |
0.9 | 8.7 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.9 | 44.3 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.9 | 4.3 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.9 | 1.7 | GO:0030519 | snoRNP binding(GO:0030519) |
0.8 | 3.4 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.8 | 2.5 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.8 | 5.9 | GO:0034432 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) |
0.8 | 3.3 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
0.8 | 3.3 | GO:0030627 | pre-mRNA 5'-splice site binding(GO:0030627) |
0.8 | 6.6 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.8 | 6.5 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.8 | 2.4 | GO:0003870 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
0.8 | 2.4 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.8 | 4.8 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
0.8 | 5.5 | GO:0043734 | DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
0.8 | 3.9 | GO:0042610 | CD8 receptor binding(GO:0042610) |
0.8 | 18.4 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.8 | 3.8 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.8 | 3.8 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.7 | 6.7 | GO:0034452 | dynactin binding(GO:0034452) |
0.7 | 3.0 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.7 | 3.0 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.7 | 4.4 | GO:1990254 | keratin filament binding(GO:1990254) |
0.7 | 5.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.7 | 14.6 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.7 | 2.1 | GO:0031370 | eukaryotic initiation factor 4G binding(GO:0031370) |
0.7 | 4.3 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
0.7 | 2.1 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
0.7 | 2.1 | GO:0003977 | UDP-N-acetylglucosamine diphosphorylase activity(GO:0003977) |
0.7 | 6.2 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.7 | 5.4 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.7 | 2.0 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) phosphoenolpyruvate carboxykinase (GTP) activity(GO:0004613) |
0.7 | 5.3 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.7 | 2.7 | GO:0043199 | sulfate binding(GO:0043199) |
0.7 | 8.6 | GO:0003796 | lysozyme activity(GO:0003796) |
0.7 | 7.9 | GO:0036374 | glutathione hydrolase activity(GO:0036374) |
0.7 | 4.6 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.6 | 6.5 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.6 | 2.6 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.6 | 4.5 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.6 | 3.2 | GO:0016167 | glial cell-derived neurotrophic factor receptor activity(GO:0016167) |
0.6 | 2.5 | GO:0008241 | peptidyl-dipeptidase activity(GO:0008241) |
0.6 | 1.2 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
0.6 | 5.6 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) |
0.6 | 2.5 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.6 | 3.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.6 | 23.2 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.6 | 3.7 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.6 | 6.0 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.6 | 2.4 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.6 | 3.5 | GO:0097643 | amylin receptor activity(GO:0097643) |
0.6 | 2.3 | GO:0003883 | CTP synthase activity(GO:0003883) |
0.6 | 2.3 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
0.6 | 2.3 | GO:0002153 | steroid receptor RNA activator RNA binding(GO:0002153) |
0.6 | 3.4 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.6 | 0.6 | GO:0008967 | phosphoglycolate phosphatase activity(GO:0008967) |
0.6 | 2.8 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.6 | 1.7 | GO:0016509 | long-chain-enoyl-CoA hydratase activity(GO:0016508) long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.6 | 3.4 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.6 | 2.8 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.6 | 1.7 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.6 | 1.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.6 | 1.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.6 | 0.6 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) |
0.5 | 16.4 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.5 | 15.6 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.5 | 5.9 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.5 | 12.9 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.5 | 15.5 | GO:0030515 | snoRNA binding(GO:0030515) |
0.5 | 1.6 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.5 | 5.8 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.5 | 24.1 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.5 | 5.8 | GO:0033691 | sialic acid binding(GO:0033691) |
0.5 | 3.7 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.5 | 13.0 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.5 | 1.0 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
0.5 | 15.5 | GO:0043274 | phospholipase binding(GO:0043274) |
0.5 | 5.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.5 | 4.0 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.5 | 3.0 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.5 | 72.4 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.5 | 18.3 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
0.5 | 10.0 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.5 | 2.9 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
0.5 | 3.8 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.5 | 2.4 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.5 | 3.3 | GO:0043515 | kinetochore binding(GO:0043515) |
0.5 | 10.2 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) |
0.5 | 3.7 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.5 | 1.9 | GO:0008493 | tetracycline transporter activity(GO:0008493) |
0.5 | 2.8 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.5 | 3.7 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.5 | 2.3 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.5 | 4.5 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
0.5 | 1.8 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.5 | 11.7 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) |
0.4 | 1.3 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.4 | 4.9 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.4 | 1.8 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.4 | 1.3 | GO:0098808 | mRNA cap binding(GO:0098808) |
0.4 | 4.4 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.4 | 6.6 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.4 | 12.7 | GO:0008143 | poly(A) binding(GO:0008143) |
0.4 | 4.4 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.4 | 1.3 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.4 | 1.3 | GO:0047696 | beta-adrenergic receptor kinase activity(GO:0047696) |
0.4 | 1.7 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.4 | 2.1 | GO:1990188 | euchromatin binding(GO:1990188) |
0.4 | 1.7 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.4 | 1.3 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
0.4 | 9.6 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.4 | 2.1 | GO:0005124 | scavenger receptor binding(GO:0005124) |
0.4 | 1.2 | GO:0004912 | interleukin-3 receptor activity(GO:0004912) interleukin-3 binding(GO:0019978) |
0.4 | 0.8 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.4 | 1.2 | GO:0004821 | histidine-tRNA ligase activity(GO:0004821) |
0.4 | 2.8 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.4 | 1.2 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.4 | 6.3 | GO:0005522 | profilin binding(GO:0005522) |
0.4 | 5.9 | GO:0031432 | titin binding(GO:0031432) |
0.4 | 12.1 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.4 | 1.6 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.4 | 1.2 | GO:0052596 | tryptamine:oxygen oxidoreductase (deaminating) activity(GO:0052593) aminoacetone:oxygen oxidoreductase(deaminating) activity(GO:0052594) aliphatic-amine oxidase activity(GO:0052595) phenethylamine:oxygen oxidoreductase (deaminating) activity(GO:0052596) |
0.4 | 5.0 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.4 | 11.9 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.4 | 2.3 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.4 | 21.4 | GO:0050699 | WW domain binding(GO:0050699) |
0.4 | 1.5 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) TIR domain binding(GO:0070976) |
0.4 | 2.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.4 | 2.2 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.4 | 2.5 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.4 | 3.9 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.4 | 10.4 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.4 | 2.1 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.4 | 1.1 | GO:0015928 | alpha-L-fucosidase activity(GO:0004560) fucosidase activity(GO:0015928) |
0.4 | 4.6 | GO:0042834 | peptidoglycan binding(GO:0042834) |
0.4 | 1.4 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.3 | 1.7 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.3 | 4.9 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.3 | 4.9 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.3 | 4.5 | GO:1990405 | protein antigen binding(GO:1990405) |
0.3 | 3.8 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.3 | 4.1 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.3 | 0.7 | GO:0097677 | STAT family protein binding(GO:0097677) |
0.3 | 8.4 | GO:0034062 | DNA-directed RNA polymerase activity(GO:0003899) RNA polymerase activity(GO:0034062) |
0.3 | 3.6 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
0.3 | 2.9 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.3 | 2.3 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.3 | 1.0 | GO:0051916 | granulocyte colony-stimulating factor binding(GO:0051916) |
0.3 | 1.6 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.3 | 1.9 | GO:0035671 | enone reductase activity(GO:0035671) |
0.3 | 1.9 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.3 | 5.8 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.3 | 1.6 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.3 | 7.1 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
0.3 | 3.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.3 | 1.3 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.3 | 33.7 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.3 | 4.9 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.3 | 1.2 | GO:0045183 | translation factor activity, non-nucleic acid binding(GO:0045183) |
0.3 | 0.9 | GO:0035717 | chemokine (C-C motif) ligand 7 binding(GO:0035717) |
0.3 | 4.7 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.3 | 1.2 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.3 | 0.9 | GO:0031728 | CCR3 chemokine receptor binding(GO:0031728) |
0.3 | 2.3 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.3 | 2.3 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.3 | 2.6 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.3 | 1.7 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.3 | 0.8 | GO:0005330 | dopamine:sodium symporter activity(GO:0005330) |
0.3 | 3.9 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.3 | 2.5 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
0.3 | 3.4 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.3 | 0.8 | GO:0018169 | ribosomal S6-glutamic acid ligase activity(GO:0018169) |
0.3 | 2.2 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.3 | 2.5 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.3 | 1.1 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.3 | 1.6 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.3 | 0.8 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) |
0.3 | 3.5 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.3 | 5.1 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.3 | 0.5 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
0.3 | 1.6 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.3 | 0.8 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.3 | 2.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.3 | 6.1 | GO:0031005 | filamin binding(GO:0031005) |
0.3 | 4.0 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.3 | 1.6 | GO:0004359 | glutaminase activity(GO:0004359) |
0.3 | 1.3 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.3 | 5.0 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.3 | 1.6 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.3 | 6.5 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.3 | 5.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.3 | 1.8 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.3 | 2.3 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.3 | 5.9 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.3 | 4.1 | GO:0031386 | protein tag(GO:0031386) |
0.3 | 2.8 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.3 | 1.0 | GO:0032356 | oxidized DNA binding(GO:0032356) |
0.3 | 10.3 | GO:0003785 | actin monomer binding(GO:0003785) |
0.2 | 3.2 | GO:0035173 | histone kinase activity(GO:0035173) |
0.2 | 2.0 | GO:0052656 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
0.2 | 1.5 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.2 | 7.2 | GO:0070840 | dynein complex binding(GO:0070840) |
0.2 | 1.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.2 | 1.0 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.2 | 2.2 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.2 | 0.7 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.2 | 2.2 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.2 | 1.2 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
0.2 | 33.9 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
0.2 | 2.4 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.2 | 10.3 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.2 | 1.0 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.2 | 0.7 | GO:0061711 | N(6)-L-threonylcarbamoyladenine synthase(GO:0061711) |
0.2 | 0.5 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.2 | 2.6 | GO:0030274 | LIM domain binding(GO:0030274) |
0.2 | 4.7 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.2 | 1.9 | GO:0060072 | large conductance calcium-activated potassium channel activity(GO:0060072) |
0.2 | 2.6 | GO:0015197 | peptide transporter activity(GO:0015197) |
0.2 | 0.9 | GO:0050436 | microfibril binding(GO:0050436) |
0.2 | 1.1 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.2 | 2.1 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
0.2 | 1.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.2 | 1.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.2 | 2.5 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.2 | 22.1 | GO:0004540 | ribonuclease activity(GO:0004540) |
0.2 | 1.6 | GO:0004782 | sulfinoalanine decarboxylase activity(GO:0004782) |
0.2 | 22.0 | GO:0005518 | collagen binding(GO:0005518) |
0.2 | 15.8 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
0.2 | 0.9 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.2 | 28.2 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.2 | 0.7 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.2 | 2.2 | GO:0019956 | chemokine binding(GO:0019956) |
0.2 | 1.5 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.2 | 1.3 | GO:0010340 | carboxyl-O-methyltransferase activity(GO:0010340) protein carboxyl O-methyltransferase activity(GO:0051998) |
0.2 | 5.9 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.2 | 0.8 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.2 | 1.0 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.2 | 11.2 | GO:0030507 | spectrin binding(GO:0030507) |
0.2 | 3.7 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.2 | 0.8 | GO:0051435 | BH4 domain binding(GO:0051435) |
0.2 | 1.0 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.2 | 0.4 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
0.2 | 2.0 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.2 | 1.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.2 | 4.3 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.2 | 1.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.2 | 1.8 | GO:0030911 | TPR domain binding(GO:0030911) |
0.2 | 3.6 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.2 | 2.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.2 | 11.0 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.2 | 4.4 | GO:0015026 | coreceptor activity(GO:0015026) |
0.2 | 1.2 | GO:0000828 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.2 | 2.9 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.2 | 1.0 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.2 | 0.6 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.2 | 5.5 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.2 | 2.7 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.2 | 0.7 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
0.2 | 0.7 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.2 | 1.5 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.2 | 9.5 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.2 | 1.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.2 | 6.8 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.2 | 2.8 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.2 | 3.2 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.2 | 0.4 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.2 | 0.5 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.2 | 2.1 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.2 | 1.2 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
0.2 | 0.5 | GO:0016015 | morphogen activity(GO:0016015) |
0.2 | 1.7 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.2 | 3.0 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.2 | 2.5 | GO:0008649 | rRNA methyltransferase activity(GO:0008649) |
0.2 | 6.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.2 | 5.2 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.2 | 0.3 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.2 | 1.0 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.2 | 8.9 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.2 | 0.6 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
0.2 | 0.5 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
0.2 | 4.1 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.2 | 1.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.2 | 0.5 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.2 | 9.1 | GO:0008026 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
0.2 | 1.9 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.2 | 3.2 | GO:0070628 | proteasome binding(GO:0070628) |
0.2 | 1.4 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.9 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 1.5 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
0.1 | 0.7 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.1 | 1.9 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.1 | 1.0 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 3.2 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.1 | 1.9 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.1 | 5.2 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 0.9 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 1.9 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 4.8 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.1 | 4.0 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.1 | 0.4 | GO:0030369 | ICAM-3 receptor activity(GO:0030369) |
0.1 | 0.8 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 1.9 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.1 | 0.3 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.1 | 0.9 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.1 | 10.0 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
0.1 | 1.1 | GO:0051861 | glycolipid binding(GO:0051861) |
0.1 | 4.6 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 1.8 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.1 | 0.9 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 1.9 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.1 | 0.4 | GO:0005174 | CD40 receptor binding(GO:0005174) |
0.1 | 5.5 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.1 | 2.4 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.1 | 0.4 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
0.1 | 2.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.1 | 0.7 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.1 | 0.6 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.1 | 0.7 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.4 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 0.6 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.1 | 13.7 | GO:0005178 | integrin binding(GO:0005178) |
0.1 | 5.9 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.1 | 6.3 | GO:0019209 | kinase activator activity(GO:0019209) |
0.1 | 0.5 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.1 | 1.5 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.3 | GO:0086057 | voltage-gated calcium channel activity involved in bundle of His cell action potential(GO:0086057) |
0.1 | 6.7 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.1 | 0.7 | GO:0048019 | receptor antagonist activity(GO:0048019) |
0.1 | 0.7 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.1 | 0.5 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 0.2 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.1 | 1.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.6 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.1 | 1.5 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.1 | 1.4 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.1 | 1.1 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.1 | 2.2 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.1 | 2.1 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.1 | 0.3 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.1 | 3.6 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.1 | 15.7 | GO:0042393 | histone binding(GO:0042393) |
0.1 | 12.6 | GO:0003714 | transcription corepressor activity(GO:0003714) |
0.1 | 9.4 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
0.1 | 2.6 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.1 | 6.6 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.1 | 1.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.3 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.1 | 1.6 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.1 | 0.3 | GO:0002113 | interleukin-33 binding(GO:0002113) |
0.1 | 0.5 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.1 | 0.7 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 0.1 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.1 | 4.0 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.1 | 1.9 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.1 | 2.7 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.1 | 1.6 | GO:0016918 | retinal binding(GO:0016918) |
0.1 | 0.3 | GO:0015152 | glucose-6-phosphate transmembrane transporter activity(GO:0015152) |
0.1 | 0.2 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.1 | 4.8 | GO:0016278 | lysine N-methyltransferase activity(GO:0016278) protein-lysine N-methyltransferase activity(GO:0016279) |
0.1 | 2.5 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
0.1 | 2.0 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
0.1 | 16.7 | GO:0044822 | mRNA binding(GO:0003729) poly(A) RNA binding(GO:0044822) |
0.1 | 0.5 | GO:0001179 | RNA polymerase I transcription factor binding(GO:0001179) inward rectifier potassium channel inhibitor activity(GO:0070320) |
0.1 | 0.3 | GO:0001847 | opsonin receptor activity(GO:0001847) |
0.1 | 2.8 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 0.3 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.1 | 0.6 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 1.4 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 6.7 | GO:0051087 | chaperone binding(GO:0051087) |
0.1 | 0.6 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 1.2 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.1 | 2.6 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 3.1 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
0.1 | 3.4 | GO:0042826 | histone deacetylase binding(GO:0042826) |
0.1 | 2.9 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 1.6 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.1 | 0.3 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
0.1 | 0.3 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.1 | 0.5 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 0.4 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 0.6 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.1 | 27.0 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.1 | 0.6 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.1 | 26.2 | GO:0003682 | chromatin binding(GO:0003682) |
0.1 | 0.3 | GO:0030275 | LRR domain binding(GO:0030275) |
0.1 | 2.8 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.1 | 5.5 | GO:0008013 | beta-catenin binding(GO:0008013) |
0.1 | 0.4 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.1 | 0.1 | GO:0042287 | MHC protein binding(GO:0042287) |
0.1 | 0.8 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.1 | 0.6 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.1 | 2.2 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
0.1 | 0.5 | GO:0031812 | G-protein coupled nucleotide receptor binding(GO:0031811) P2Y1 nucleotide receptor binding(GO:0031812) |
0.1 | 2.6 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.1 | 0.7 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.1 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 0.4 | GO:0001602 | peptide YY receptor activity(GO:0001601) pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 0.6 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
0.1 | 1.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 1.8 | GO:0016876 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.1 | 0.2 | GO:0015526 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.1 | 0.3 | GO:0019808 | polyamine binding(GO:0019808) |
0.1 | 0.2 | GO:0008476 | protein-tyrosine sulfotransferase activity(GO:0008476) |
0.1 | 0.4 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.1 | 0.7 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.1 | 0.7 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.8 | GO:0043236 | laminin binding(GO:0043236) |
0.1 | 0.1 | GO:0008520 | L-ascorbate:sodium symporter activity(GO:0008520) L-ascorbic acid transporter activity(GO:0015229) sodium-dependent L-ascorbate transmembrane transporter activity(GO:0070890) |
0.1 | 0.7 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.1 | 0.3 | GO:0008269 | JAK pathway signal transduction adaptor activity(GO:0008269) |
0.1 | 0.8 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 1.4 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.7 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.7 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
0.0 | 4.2 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.1 | GO:0001729 | ceramide kinase activity(GO:0001729) |
0.0 | 0.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.0 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 1.5 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.0 | 0.0 | GO:0035870 | dITP diphosphatase activity(GO:0035870) |
0.0 | 0.2 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
0.0 | 0.2 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.0 | 0.2 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.3 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.0 | 0.0 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 4.0 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.3 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 1.2 | GO:0019707 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.2 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
0.0 | 0.5 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.5 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.3 | GO:0051870 | methotrexate binding(GO:0051870) |
0.0 | 0.3 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
0.0 | 0.4 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.0 | 1.0 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.8 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 2.0 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 1.3 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 9.9 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
0.0 | 0.2 | GO:0016361 | activin receptor activity, type I(GO:0016361) activin-activated receptor activity(GO:0017002) |
0.0 | 0.8 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 1.4 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.2 | GO:0001968 | fibronectin binding(GO:0001968) |
0.0 | 0.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.0 | 0.1 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
0.0 | 0.5 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.3 | GO:0008276 | protein methyltransferase activity(GO:0008276) |
0.0 | 0.7 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.0 | 0.7 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.5 | GO:0016706 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, 2-oxoglutarate as one donor, and incorporation of one atom each of oxygen into both donors(GO:0016706) |
0.0 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.0 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.0 | 0.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.2 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.1 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) |
0.0 | 0.2 | GO:0004629 | phospholipase C activity(GO:0004629) |
0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.0 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.0 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
0.0 | 0.1 | GO:0022850 | serotonin-gated cation channel activity(GO:0022850) |
0.0 | 0.0 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 68.4 | PID AURORA A PATHWAY | Aurora A signaling |
1.1 | 5.6 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.9 | 34.0 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.8 | 37.4 | PID AURORA B PATHWAY | Aurora B signaling |
0.8 | 13.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.7 | 34.1 | PID PLK1 PATHWAY | PLK1 signaling events |
0.7 | 39.9 | PID ATR PATHWAY | ATR signaling pathway |
0.7 | 32.8 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.6 | 0.6 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.6 | 10.9 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.6 | 2.5 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.5 | 2.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.5 | 25.8 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.5 | 11.4 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.4 | 6.5 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.4 | 15.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.4 | 10.0 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.4 | 28.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.4 | 2.7 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.4 | 23.0 | PID P53 REGULATION PATHWAY | p53 pathway |
0.4 | 40.0 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.4 | 6.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.4 | 17.1 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.4 | 14.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.3 | 19.2 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.3 | 22.0 | PID E2F PATHWAY | E2F transcription factor network |
0.3 | 16.5 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.3 | 5.3 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.3 | 1.4 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.3 | 8.1 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.3 | 14.3 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.3 | 1.3 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.2 | 2.0 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.2 | 2.5 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.2 | 1.0 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.2 | 4.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.2 | 15.4 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.2 | 5.7 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.2 | 7.8 | PID ARF6 PATHWAY | Arf6 signaling events |
0.2 | 2.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.2 | 5.2 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.2 | 6.0 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.2 | 8.4 | PID REELIN PATHWAY | Reelin signaling pathway |
0.2 | 4.4 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.2 | 0.8 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.2 | 4.6 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.2 | 9.6 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.2 | 2.6 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.2 | 12.3 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.2 | 2.3 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.2 | 4.5 | PID ARF 3PATHWAY | Arf1 pathway |
0.2 | 1.8 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.2 | 4.0 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.2 | 4.3 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.2 | 2.1 | PID RHOA PATHWAY | RhoA signaling pathway |
0.2 | 9.2 | PID BMP PATHWAY | BMP receptor signaling |
0.2 | 0.7 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.2 | 2.7 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.2 | 11.3 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.2 | 5.2 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.1 | 3.9 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.1 | 0.7 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.1 | 1.1 | PID ATM PATHWAY | ATM pathway |
0.1 | 7.5 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.1 | 4.5 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.1 | 2.2 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.1 | 3.8 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 5.2 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.1 | 1.0 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 2.7 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.1 | 6.8 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.1 | 3.8 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.1 | 0.3 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 1.7 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.1 | 4.9 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 1.2 | PID BARD1 PATHWAY | BARD1 signaling events |
0.1 | 3.9 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 1.8 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 0.3 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.1 | 0.5 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 1.6 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.1 | 0.5 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.1 | 1.3 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.1 | 0.7 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 1.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 0.5 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.1 | 3.0 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.1 | 1.2 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 2.2 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.1 | 0.7 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.1 | 4.1 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.1 | 0.4 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 3.1 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.1 | 1.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.1 | 0.9 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.1 | 0.3 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.1 | 0.5 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.1 | 0.9 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 2.5 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.1 | 2.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 11.8 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.1 | 4.2 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 0.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.1 | 2.2 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.1 | 0.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 4.9 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 3.7 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.2 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.6 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.4 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 0.6 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.2 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 4.5 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.4 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.3 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.6 | 328.5 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
2.2 | 2.2 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
2.0 | 32.5 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
1.6 | 4.8 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
1.5 | 10.2 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
1.4 | 18.3 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
1.4 | 18.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
1.3 | 12.0 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
1.2 | 29.1 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
1.1 | 41.8 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
1.1 | 22.2 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
1.0 | 21.8 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
1.0 | 15.8 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
1.0 | 15.7 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.9 | 22.6 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.9 | 6.5 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.9 | 29.4 | REACTOME KINESINS | Genes involved in Kinesins |
0.9 | 19.1 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.9 | 9.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.9 | 9.4 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.8 | 50.6 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.8 | 62.5 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.7 | 32.0 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.7 | 21.3 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.7 | 23.1 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.7 | 13.0 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.7 | 11.6 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.7 | 33.1 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.6 | 11.6 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.6 | 14.5 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.6 | 12.9 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.6 | 17.6 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.5 | 12.5 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.5 | 1.6 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
0.5 | 2.6 | REACTOME ORC1 REMOVAL FROM CHROMATIN | Genes involved in Orc1 removal from chromatin |
0.5 | 3.0 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
0.5 | 6.4 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.5 | 11.6 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.5 | 1.9 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.5 | 4.6 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.5 | 6.9 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.5 | 3.2 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.4 | 10.3 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.4 | 9.2 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.4 | 38.5 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.4 | 9.5 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.4 | 0.4 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
0.4 | 2.4 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
0.4 | 1.6 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.4 | 11.2 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
0.4 | 5.4 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.4 | 5.6 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.4 | 7.4 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.4 | 5.9 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.4 | 5.8 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.3 | 4.5 | REACTOME G2 M CHECKPOINTS | Genes involved in G2/M Checkpoints |
0.3 | 5.2 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.3 | 6.9 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.3 | 23.2 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.3 | 29.4 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.3 | 6.0 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.3 | 6.8 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.3 | 6.8 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.3 | 8.7 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.3 | 4.4 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.3 | 4.2 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.3 | 8.7 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.3 | 14.8 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.3 | 12.4 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.3 | 16.2 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.3 | 7.7 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.3 | 1.9 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.3 | 6.1 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.3 | 10.8 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.3 | 3.0 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.3 | 1.9 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.3 | 10.6 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.3 | 2.9 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.3 | 4.7 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
0.3 | 13.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.2 | 23.3 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.2 | 1.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.2 | 6.2 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.2 | 1.8 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.2 | 5.2 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.2 | 4.5 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.2 | 2.8 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.2 | 5.7 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.2 | 8.0 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.2 | 12.5 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.2 | 10.6 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.2 | 5.1 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.2 | 5.2 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.2 | 6.2 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.2 | 7.3 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.2 | 2.7 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.2 | 9.5 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.2 | 3.2 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.2 | 0.7 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.2 | 15.3 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.2 | 7.3 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
0.2 | 4.5 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.2 | 5.2 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.2 | 2.2 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.2 | 4.8 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.2 | 2.8 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.2 | 2.4 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.2 | 1.7 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.2 | 4.4 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.2 | 3.2 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.1 | 1.6 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.1 | 1.0 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.1 | 1.0 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.1 | 2.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 1.9 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.1 | 0.7 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.1 | 4.0 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.1 | 1.8 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.1 | 1.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.1 | 6.0 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 0.8 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.1 | 4.1 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.1 | 1.0 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.1 | 0.5 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.1 | 1.8 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.1 | 1.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.1 | 1.5 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.1 | 0.3 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.1 | 1.1 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.1 | 3.0 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.1 | 1.7 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.1 | 1.7 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 6.4 | REACTOME MITOTIC G2 G2 M PHASES | Genes involved in Mitotic G2-G2/M phases |
0.1 | 1.0 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 1.7 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.1 | 21.2 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.1 | 1.6 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.1 | 1.7 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 5.2 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 10.3 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.1 | 1.1 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.1 | 0.7 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.1 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
0.1 | 1.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.1 | 1.1 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 1.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 0.6 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.1 | 1.8 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 1.8 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 9.1 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.1 | 1.0 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.1 | 1.6 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 1.4 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.1 | 0.5 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.1 | 0.4 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.1 | 2.8 | REACTOME TRANSLATION | Genes involved in Translation |
0.1 | 0.3 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
0.1 | 3.2 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 0.4 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.3 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.7 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 1.1 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.1 | REACTOME DEFENSINS | Genes involved in Defensins |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 0.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.2 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.2 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.0 | 0.1 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.0 | 0.4 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.1 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.2 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |