Project
Illumina Body Map 2, young vs old
Navigation
Downloads
Results for MAFB
Z-value: 2.46
Motif logo
Transcription factors associated with MAFB
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
MAFB
|
ENSG00000204103.2 | MAF bZIP transcription factor B |
Activity-expression correlation:
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| MAFB | hg19_v2_chr20_-_39317868_39317884 | -0.00 | 9.8e-01 | Click! |
Activity profile of MAFB motif
Sorted Z-values of MAFB motif
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr22_+_26565440 | 7.22 |
ENST00000404234.3
ENST00000529632.2 ENST00000360929.3 ENST00000248933.6 ENST00000343706.4 |
SEZ6L
|
seizure related 6 homolog (mouse)-like |
| chr14_-_60337684 | 5.45 |
ENST00000267484.5
|
RTN1
|
reticulon 1 |
| chr17_+_54671047 | 4.48 |
ENST00000332822.4
|
NOG
|
noggin |
| chr3_-_183543301 | 4.47 |
ENST00000318631.3
ENST00000431348.1 |
MAP6D1
|
MAP6 domain containing 1 |
| chr4_-_168155169 | 4.25 |
ENST00000534949.1
ENST00000535728.1 |
SPOCK3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan (testican) 3 |
| chr6_+_11537910 | 4.02 |
ENST00000543875.1
|
TMEM170B
|
transmembrane protein 170B |
| chr4_-_168155577 | 3.81 |
ENST00000541354.1
ENST00000509854.1 ENST00000512681.1 ENST00000421836.2 ENST00000510741.1 ENST00000510403.1 |
SPOCK3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan (testican) 3 |
| chr4_-_168155300 | 3.79 |
ENST00000541637.1
|
SPOCK3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan (testican) 3 |
| chr1_-_109935819 | 3.61 |
ENST00000538502.1
|
SORT1
|
sortilin 1 |
| chr14_-_23876801 | 3.42 |
ENST00000356287.3
|
MYH6
|
myosin, heavy chain 6, cardiac muscle, alpha |
| chr4_-_168155700 | 3.41 |
ENST00000357545.4
ENST00000512648.1 |
SPOCK3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan (testican) 3 |
| chr4_-_168155730 | 3.31 |
ENST00000502330.1
ENST00000357154.3 |
SPOCK3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan (testican) 3 |
| chrX_+_37545012 | 3.25 |
ENST00000378616.3
|
XK
|
X-linked Kx blood group (McLeod syndrome) |
| chr14_+_29236269 | 3.16 |
ENST00000313071.4
|
FOXG1
|
forkhead box G1 |
| chr12_+_101988627 | 3.15 |
ENST00000547405.1
ENST00000452455.2 ENST00000441232.1 ENST00000360610.2 ENST00000392934.3 ENST00000547509.1 ENST00000361685.2 ENST00000549145.1 ENST00000553190.1 |
MYBPC1
|
myosin binding protein C, slow type |
| chr4_-_168155417 | 3.09 |
ENST00000511269.1
ENST00000506697.1 ENST00000512042.1 |
SPOCK3
|
sparc/osteonectin, cwcv and kazal-like domains proteoglycan (testican) 3 |
| chr14_-_91526462 | 2.97 |
ENST00000536315.2
|
RPS6KA5
|
ribosomal protein S6 kinase, 90kDa, polypeptide 5 |
| chr18_+_52385068 | 2.92 |
ENST00000586570.1
|
RAB27B
|
RAB27B, member RAS oncogene family |
| chr6_+_73331776 | 2.82 |
ENST00000370398.1
|
KCNQ5
|
potassium voltage-gated channel, KQT-like subfamily, member 5 |
| chr16_+_7382745 | 2.71 |
ENST00000436368.2
ENST00000311745.5 ENST00000355637.4 ENST00000340209.4 |
RBFOX1
|
RNA binding protein, fox-1 homolog (C. elegans) 1 |
| chr7_+_123295861 | 2.69 |
ENST00000458573.2
ENST00000456238.2 |
LMOD2
|
leiomodin 2 (cardiac) |
| chr18_-_74728998 | 2.63 |
ENST00000359645.3
ENST00000397875.3 ENST00000397869.3 ENST00000578193.1 ENST00000578873.1 ENST00000397866.4 ENST00000528160.1 ENST00000527041.1 ENST00000526111.1 ENST00000397865.5 ENST00000382582.3 |
MBP
|
myelin basic protein |
| chr12_+_101988774 | 2.59 |
ENST00000545503.2
ENST00000536007.1 ENST00000541119.1 ENST00000361466.2 ENST00000551300.1 ENST00000550270.1 |
MYBPC1
|
myosin binding protein C, slow type |
| chr17_+_65040678 | 2.54 |
ENST00000226021.3
|
CACNG1
|
calcium channel, voltage-dependent, gamma subunit 1 |
| chr15_+_51973550 | 2.43 |
ENST00000220478.3
|
SCG3
|
secretogranin III |
| chr2_-_241759622 | 2.40 |
ENST00000320389.7
ENST00000498729.2 |
KIF1A
|
kinesin family member 1A |
| chr2_-_37193606 | 2.39 |
ENST00000379213.2
ENST00000263918.4 |
STRN
|
striatin, calmodulin binding protein |
| chr7_+_73507409 | 2.39 |
ENST00000538333.3
|
LIMK1
|
LIM domain kinase 1 |
| chr19_-_55953704 | 2.38 |
ENST00000416792.1
|
SHISA7
|
shisa family member 7 |
| chr6_+_117586713 | 2.30 |
ENST00000352536.3
ENST00000326274.5 |
VGLL2
|
vestigial like 2 (Drosophila) |
| chr2_-_11810284 | 2.29 |
ENST00000306928.5
|
NTSR2
|
neurotensin receptor 2 |
| chr1_-_17445930 | 2.28 |
ENST00000375486.4
ENST00000375481.1 ENST00000444885.2 |
PADI2
|
peptidyl arginine deiminase, type II |
| chr2_-_220173685 | 2.27 |
ENST00000423636.2
ENST00000442029.1 ENST00000412847.1 |
PTPRN
|
protein tyrosine phosphatase, receptor type, N |
| chrX_+_21392529 | 2.25 |
ENST00000425654.2
ENST00000543067.1 |
CNKSR2
|
connector enhancer of kinase suppressor of Ras 2 |
| chrX_+_21392873 | 2.22 |
ENST00000379510.3
|
CNKSR2
|
connector enhancer of kinase suppressor of Ras 2 |
| chr1_-_182360918 | 2.20 |
ENST00000339526.4
|
GLUL
|
glutamate-ammonia ligase |
| chr1_-_182360498 | 2.19 |
ENST00000417584.2
|
GLUL
|
glutamate-ammonia ligase |
| chr3_+_35681728 | 2.19 |
ENST00000421492.1
ENST00000458225.1 ENST00000337271.5 |
ARPP21
|
cAMP-regulated phosphoprotein, 21kDa |
| chr18_-_74844727 | 2.17 |
ENST00000355994.2
ENST00000579129.1 |
MBP
|
myelin basic protein |
| chr18_-_3880051 | 2.14 |
ENST00000584874.1
|
DLGAP1
|
discs, large (Drosophila) homolog-associated protein 1 |
| chr5_+_31712141 | 2.14 |
ENST00000513910.1
|
PDZD2
|
PDZ domain containing 2 |
| chr15_+_43809797 | 2.13 |
ENST00000399453.1
ENST00000300231.5 |
MAP1A
|
microtubule-associated protein 1A |
| chr5_-_36152031 | 2.13 |
ENST00000296603.4
|
LMBRD2
|
LMBR1 domain containing 2 |
| chr12_-_58131931 | 2.09 |
ENST00000547588.1
|
AGAP2
|
ArfGAP with GTPase domain, ankyrin repeat and PH domain 2 |
| chr5_-_146258291 | 2.08 |
ENST00000394411.4
ENST00000453001.1 |
PPP2R2B
|
protein phosphatase 2, regulatory subunit B, beta |
| chr7_+_95401851 | 2.08 |
ENST00000447467.2
|
DYNC1I1
|
dynein, cytoplasmic 1, intermediate chain 1 |
| chr6_+_73331814 | 2.05 |
ENST00000370392.1
|
KCNQ5
|
potassium voltage-gated channel, KQT-like subfamily, member 5 |
| chr4_-_8073554 | 2.05 |
ENST00000510277.1
|
ABLIM2
|
actin binding LIM protein family, member 2 |
| chr16_+_25703274 | 2.04 |
ENST00000331351.5
|
HS3ST4
|
heparan sulfate (glucosamine) 3-O-sulfotransferase 4 |
| chr16_+_28889801 | 2.03 |
ENST00000395503.4
|
ATP2A1
|
ATPase, Ca++ transporting, cardiac muscle, fast twitch 1 |
| chr16_+_28889703 | 2.02 |
ENST00000357084.3
|
ATP2A1
|
ATPase, Ca++ transporting, cardiac muscle, fast twitch 1 |
| chr1_-_109940550 | 2.02 |
ENST00000256637.6
|
SORT1
|
sortilin 1 |
| chr10_-_115423792 | 2.02 |
ENST00000369360.3
ENST00000360478.3 ENST00000359988.3 ENST00000369358.4 |
NRAP
|
nebulin-related anchoring protein |
| chr3_+_35685113 | 1.99 |
ENST00000419330.1
|
ARPP21
|
cAMP-regulated phosphoprotein, 21kDa |
| chr3_-_10749696 | 1.99 |
ENST00000397077.1
|
ATP2B2
|
ATPase, Ca++ transporting, plasma membrane 2 |
| chr9_+_140033862 | 1.97 |
ENST00000350902.5
ENST00000371550.4 ENST00000371546.4 ENST00000371555.4 ENST00000371553.3 ENST00000371559.4 ENST00000371560.3 |
GRIN1
|
glutamate receptor, ionotropic, N-methyl D-aspartate 1 |
| chrX_-_154688276 | 1.97 |
ENST00000369445.2
|
F8A3
|
coagulation factor VIII-associated 3 |
| chr5_-_107717782 | 1.97 |
ENST00000542267.1
|
FBXL17
|
F-box and leucine-rich repeat protein 17 |
| chr13_-_45768841 | 1.96 |
ENST00000379108.1
|
KCTD4
|
potassium channel tetramerization domain containing 4 |
| chr9_-_101471479 | 1.93 |
ENST00000259455.2
|
GABBR2
|
gamma-aminobutyric acid (GABA) B receptor, 2 |
| chr3_-_42743006 | 1.93 |
ENST00000310417.5
|
HHATL
|
hedgehog acyltransferase-like |
| chr12_-_39837192 | 1.90 |
ENST00000361961.3
ENST00000395670.3 |
KIF21A
|
kinesin family member 21A |
| chr5_-_146258205 | 1.89 |
ENST00000394413.3
|
PPP2R2B
|
protein phosphatase 2, regulatory subunit B, beta |
| chr19_+_4791722 | 1.89 |
ENST00000269856.3
|
FEM1A
|
fem-1 homolog a (C. elegans) |
| chr5_+_7396141 | 1.89 |
ENST00000338316.4
|
ADCY2
|
adenylate cyclase 2 (brain) |
| chr16_-_1843694 | 1.88 |
ENST00000569769.1
|
SPSB3
|
splA/ryanodine receptor domain and SOCS box containing 3 |
| chr6_+_73331520 | 1.87 |
ENST00000342056.2
ENST00000355194.4 |
KCNQ5
|
potassium voltage-gated channel, KQT-like subfamily, member 5 |
| chr6_+_72596604 | 1.86 |
ENST00000348717.5
ENST00000517960.1 ENST00000518273.1 ENST00000522291.1 ENST00000521978.1 ENST00000520567.1 ENST00000264839.7 |
RIMS1
|
regulating synaptic membrane exocytosis 1 |
| chr8_-_92053042 | 1.86 |
ENST00000520014.1
|
TMEM55A
|
transmembrane protein 55A |
| chr17_-_3595042 | 1.85 |
ENST00000552723.1
|
P2RX5
|
purinergic receptor P2X, ligand-gated ion channel, 5 |
| chr3_-_161089289 | 1.85 |
ENST00000497137.1
|
SPTSSB
|
serine palmitoyltransferase, small subunit B |
| chr22_+_29876197 | 1.85 |
ENST00000310624.6
|
NEFH
|
neurofilament, heavy polypeptide |
| chr20_+_57466629 | 1.81 |
ENST00000371081.1
ENST00000338783.6 |
GNAS
|
GNAS complex locus |
| chr2_-_55277436 | 1.81 |
ENST00000354474.6
|
RTN4
|
reticulon 4 |
| chr5_-_146435501 | 1.80 |
ENST00000336640.6
|
PPP2R2B
|
protein phosphatase 2, regulatory subunit B, beta |
| chr17_-_10741762 | 1.79 |
ENST00000580256.2
|
PIRT
|
phosphoinositide-interacting regulator of transient receptor potential channels |
| chr5_-_146435572 | 1.79 |
ENST00000394414.1
|
PPP2R2B
|
protein phosphatase 2, regulatory subunit B, beta |
| chrX_+_21392553 | 1.79 |
ENST00000279451.4
|
CNKSR2
|
connector enhancer of kinase suppressor of Ras 2 |
| chr16_+_56225248 | 1.78 |
ENST00000262493.6
|
GNAO1
|
guanine nucleotide binding protein (G protein), alpha activating activity polypeptide O |
| chr14_+_96342729 | 1.77 |
ENST00000504119.1
|
LINC00617
|
long intergenic non-protein coding RNA 617 |
| chr14_+_91526668 | 1.77 |
ENST00000521334.1
|
C14orf159
|
chromosome 14 open reading frame 159 |
| chr15_+_27112380 | 1.76 |
ENST00000554596.1
|
GABRA5
|
gamma-aminobutyric acid (GABA) A receptor, alpha 5 |
| chr10_+_26505179 | 1.76 |
ENST00000376261.3
|
GAD2
|
glutamate decarboxylase 2 (pancreatic islets and brain, 65kDa) |
| chr16_+_56226405 | 1.76 |
ENST00000565363.1
|
GNAO1
|
guanine nucleotide binding protein (G protein), alpha activating activity polypeptide O |
| chr9_+_108210279 | 1.76 |
ENST00000374716.4
ENST00000374710.3 ENST00000481272.1 ENST00000484973.1 ENST00000394926.3 ENST00000539376.1 |
FSD1L
|
fibronectin type III and SPRY domain containing 1-like |
| chr11_+_123430948 | 1.75 |
ENST00000529432.1
ENST00000534764.1 |
GRAMD1B
|
GRAM domain containing 1B |
| chr1_-_182361327 | 1.75 |
ENST00000331872.6
ENST00000311223.5 |
GLUL
|
glutamate-ammonia ligase |
| chr12_-_58135903 | 1.72 |
ENST00000257897.3
|
AGAP2
|
ArfGAP with GTPase domain, ankyrin repeat and PH domain 2 |
| chr15_+_54305101 | 1.72 |
ENST00000260323.11
ENST00000545554.1 ENST00000537900.1 |
UNC13C
|
unc-13 homolog C (C. elegans) |
| chr19_+_18723660 | 1.71 |
ENST00000262817.3
|
TMEM59L
|
transmembrane protein 59-like |
| chr6_+_150070857 | 1.71 |
ENST00000544496.1
|
PCMT1
|
protein-L-isoaspartate (D-aspartate) O-methyltransferase |
| chr4_-_102268484 | 1.71 |
ENST00000394853.4
|
PPP3CA
|
protein phosphatase 3, catalytic subunit, alpha isozyme |
| chr5_-_176056974 | 1.70 |
ENST00000510387.1
ENST00000506696.1 |
SNCB
|
synuclein, beta |
| chr3_+_16926441 | 1.70 |
ENST00000418129.2
ENST00000396755.2 |
PLCL2
|
phospholipase C-like 2 |
| chr4_-_8073705 | 1.69 |
ENST00000514025.1
|
ABLIM2
|
actin binding LIM protein family, member 2 |
| chr2_+_191745535 | 1.67 |
ENST00000320717.3
|
GLS
|
glutaminase |
| chr18_+_32290218 | 1.65 |
ENST00000348997.5
ENST00000588949.1 ENST00000597599.1 |
DTNA
|
dystrobrevin, alpha |
| chr5_-_138730817 | 1.65 |
ENST00000434752.2
|
PROB1
|
proline-rich basic protein 1 |
| chr1_+_78354243 | 1.64 |
ENST00000294624.8
|
NEXN
|
nexilin (F actin binding protein) |
| chr14_+_96343100 | 1.64 |
ENST00000503525.2
|
LINC00617
|
long intergenic non-protein coding RNA 617 |
| chr6_+_150070831 | 1.63 |
ENST00000367380.5
|
PCMT1
|
protein-L-isoaspartate (D-aspartate) O-methyltransferase |
| chr7_+_154862028 | 1.63 |
ENST00000287907.2
|
HTR5A
|
5-hydroxytryptamine (serotonin) receptor 5A, G protein-coupled |
| chr3_-_10547192 | 1.62 |
ENST00000360273.2
ENST00000343816.4 |
ATP2B2
|
ATPase, Ca++ transporting, plasma membrane 2 |
| chr6_+_71998506 | 1.61 |
ENST00000370435.4
|
OGFRL1
|
opioid growth factor receptor-like 1 |
| chr5_-_78809950 | 1.61 |
ENST00000334082.6
|
HOMER1
|
homer homolog 1 (Drosophila) |
| chr12_-_50297638 | 1.61 |
ENST00000320634.3
|
FAIM2
|
Fas apoptotic inhibitory molecule 2 |
| chr22_-_36013368 | 1.61 |
ENST00000442617.1
ENST00000397326.2 ENST00000397328.1 ENST00000451685.1 |
MB
|
myoglobin |
| chr5_-_107717058 | 1.60 |
ENST00000359660.5
|
FBXL17
|
F-box and leucine-rich repeat protein 17 |
| chr16_+_6069072 | 1.57 |
ENST00000547605.1
ENST00000550418.1 ENST00000553186.1 |
RBFOX1
|
RNA binding protein, fox-1 homolog (C. elegans) 1 |
| chr1_-_241520525 | 1.57 |
ENST00000366565.1
|
RGS7
|
regulator of G-protein signaling 7 |
| chr3_+_160473343 | 1.57 |
ENST00000497343.1
|
PPM1L
|
protein phosphatase, Mg2+/Mn2+ dependent, 1L |
| chr15_+_51973708 | 1.56 |
ENST00000558709.1
|
SCG3
|
secretogranin III |
| chr17_+_40610862 | 1.56 |
ENST00000393829.2
ENST00000546249.1 ENST00000537728.1 ENST00000264649.6 ENST00000585525.1 ENST00000343619.4 ENST00000544137.1 ENST00000589727.1 ENST00000587824.1 |
ATP6V0A1
|
ATPase, H+ transporting, lysosomal V0 subunit a1 |
| chr12_-_81763127 | 1.56 |
ENST00000541017.1
|
PPFIA2
|
protein tyrosine phosphatase, receptor type, f polypeptide (PTPRF), interacting protein (liprin), alpha 2 |
| chr12_-_75603482 | 1.56 |
ENST00000341669.3
ENST00000298972.1 ENST00000350228.2 |
KCNC2
|
potassium voltage-gated channel, Shaw-related subfamily, member 2 |
| chr3_+_54156570 | 1.54 |
ENST00000415676.2
|
CACNA2D3
|
calcium channel, voltage-dependent, alpha 2/delta subunit 3 |
| chr19_+_1452188 | 1.54 |
ENST00000587149.1
|
APC2
|
adenomatosis polyposis coli 2 |
| chr8_-_41655107 | 1.54 |
ENST00000347528.4
ENST00000289734.7 ENST00000379758.2 ENST00000396945.1 ENST00000396942.1 ENST00000352337.4 |
ANK1
|
ankyrin 1, erythrocytic |
| chr4_-_102268708 | 1.54 |
ENST00000525819.1
|
PPP3CA
|
protein phosphatase 3, catalytic subunit, alpha isozyme |
| chr5_+_175298487 | 1.53 |
ENST00000393745.3
|
CPLX2
|
complexin 2 |
| chr16_+_6069664 | 1.53 |
ENST00000422070.4
|
RBFOX1
|
RNA binding protein, fox-1 homolog (C. elegans) 1 |
| chr12_-_75603643 | 1.53 |
ENST00000549446.1
|
KCNC2
|
potassium voltage-gated channel, Shaw-related subfamily, member 2 |
| chr1_-_151778630 | 1.53 |
ENST00000368820.3
|
LINGO4
|
leucine rich repeat and Ig domain containing 4 |
| chr12_-_75603202 | 1.52 |
ENST00000393288.2
|
KCNC2
|
potassium voltage-gated channel, Shaw-related subfamily, member 2 |
| chr5_-_146461027 | 1.52 |
ENST00000394410.2
ENST00000508267.1 ENST00000504198.1 |
PPP2R2B
|
protein phosphatase 2, regulatory subunit B, beta |
| chr12_-_99548524 | 1.52 |
ENST00000549558.2
ENST00000550693.2 ENST00000549493.2 |
ANKS1B
|
ankyrin repeat and sterile alpha motif domain containing 1B |
| chr5_-_142784003 | 1.52 |
ENST00000416954.2
|
NR3C1
|
nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor) |
| chr21_-_48024986 | 1.51 |
ENST00000291700.4
ENST00000367071.4 |
S100B
|
S100 calcium binding protein B |
| chr10_-_134599556 | 1.50 |
ENST00000368592.5
|
NKX6-2
|
NK6 homeobox 2 |
| chr4_+_6784401 | 1.49 |
ENST00000425103.1
ENST00000307659.5 |
KIAA0232
|
KIAA0232 |
| chr3_-_71803474 | 1.49 |
ENST00000448225.1
ENST00000496214.2 |
EIF4E3
|
eukaryotic translation initiation factor 4E family member 3 |
| chr1_+_87170247 | 1.48 |
ENST00000370558.4
|
SH3GLB1
|
SH3-domain GRB2-like endophilin B1 |
| chr3_+_35680339 | 1.48 |
ENST00000450234.1
|
ARPP21
|
cAMP-regulated phosphoprotein, 21kDa |
| chr6_-_143266297 | 1.48 |
ENST00000367603.2
|
HIVEP2
|
human immunodeficiency virus type I enhancer binding protein 2 |
| chrX_+_72223352 | 1.48 |
ENST00000373521.2
ENST00000538388.1 |
PABPC1L2B
|
poly(A) binding protein, cytoplasmic 1-like 2B |
| chr3_-_10547333 | 1.46 |
ENST00000383800.4
|
ATP2B2
|
ATPase, Ca++ transporting, plasma membrane 2 |
| chr1_+_160085567 | 1.46 |
ENST00000392233.3
|
ATP1A2
|
ATPase, Na+/K+ transporting, alpha 2 polypeptide |
| chr7_-_107204706 | 1.46 |
ENST00000393603.2
|
COG5
|
component of oligomeric golgi complex 5 |
| chr18_-_35065710 | 1.45 |
ENST00000589229.1
ENST00000587819.1 |
CELF4
|
CUGBP, Elav-like family member 4 |
| chr3_+_160473996 | 1.45 |
ENST00000498165.1
|
PPM1L
|
protein phosphatase, Mg2+/Mn2+ dependent, 1L |
| chr5_+_61602236 | 1.44 |
ENST00000514082.1
ENST00000407818.3 |
KIF2A
|
kinesin heavy chain member 2A |
| chr1_+_46269248 | 1.44 |
ENST00000361297.2
ENST00000372009.2 |
MAST2
|
microtubule associated serine/threonine kinase 2 |
| chr19_-_46145696 | 1.44 |
ENST00000588172.1
|
EML2
|
echinoderm microtubule associated protein like 2 |
| chr22_-_17602200 | 1.43 |
ENST00000399875.1
|
CECR6
|
cat eye syndrome chromosome region, candidate 6 |
| chr14_-_91526922 | 1.43 |
ENST00000418736.2
ENST00000261991.3 |
RPS6KA5
|
ribosomal protein S6 kinase, 90kDa, polypeptide 5 |
| chr10_+_17686193 | 1.43 |
ENST00000377500.1
|
STAM
|
signal transducing adaptor molecule (SH3 domain and ITAM motif) 1 |
| chr10_-_75423560 | 1.43 |
ENST00000606523.1
|
SYNPO2L
|
synaptopodin 2-like |
| chr12_-_75603236 | 1.42 |
ENST00000540018.1
|
KCNC2
|
potassium voltage-gated channel, Shaw-related subfamily, member 2 |
| chr3_+_54156664 | 1.42 |
ENST00000474759.1
ENST00000288197.5 |
CACNA2D3
|
calcium channel, voltage-dependent, alpha 2/delta subunit 3 |
| chr3_+_49591881 | 1.42 |
ENST00000296452.4
|
BSN
|
bassoon presynaptic cytomatrix protein |
| chr10_+_17686221 | 1.42 |
ENST00000540523.1
|
STAM
|
signal transducing adaptor molecule (SH3 domain and ITAM motif) 1 |
| chr15_+_90544532 | 1.41 |
ENST00000268154.4
|
ZNF710
|
zinc finger protein 710 |
| chr10_+_111765562 | 1.41 |
ENST00000360162.3
|
ADD3
|
adducin 3 (gamma) |
| chr6_-_24877490 | 1.41 |
ENST00000540914.1
ENST00000378023.4 |
FAM65B
|
family with sequence similarity 65, member B |
| chr22_-_17602143 | 1.41 |
ENST00000331437.3
|
CECR6
|
cat eye syndrome chromosome region, candidate 6 |
| chr3_-_71802760 | 1.40 |
ENST00000295612.3
|
EIF4E3
|
eukaryotic translation initiation factor 4E family member 3 |
| chr7_+_95401877 | 1.40 |
ENST00000524053.1
ENST00000324972.6 ENST00000537881.1 ENST00000437599.1 ENST00000359388.4 ENST00000413338.1 |
DYNC1I1
|
dynein, cytoplasmic 1, intermediate chain 1 |
| chr11_+_74459876 | 1.40 |
ENST00000299563.4
|
RNF169
|
ring finger protein 169 |
| chr3_-_13028536 | 1.39 |
ENST00000450726.1
|
IQSEC1
|
IQ motif and Sec7 domain 1 |
| chr10_-_14880002 | 1.39 |
ENST00000465530.1
|
CDNF
|
cerebral dopamine neurotrophic factor |
| chr2_+_241564655 | 1.39 |
ENST00000407714.1
|
GPR35
|
G protein-coupled receptor 35 |
| chr2_-_74601758 | 1.39 |
ENST00000407639.2
ENST00000409438.1 |
DCTN1
|
dynactin 1 |
| chr12_-_99548645 | 1.39 |
ENST00000549025.2
|
ANKS1B
|
ankyrin repeat and sterile alpha motif domain containing 1B |
| chr3_+_37284824 | 1.38 |
ENST00000431105.1
|
GOLGA4
|
golgin A4 |
| chr1_-_13840483 | 1.38 |
ENST00000376085.3
|
LRRC38
|
leucine rich repeat containing 38 |
| chr6_+_99282570 | 1.38 |
ENST00000328345.5
|
POU3F2
|
POU class 3 homeobox 2 |
| chr1_-_102462565 | 1.38 |
ENST00000370103.4
|
OLFM3
|
olfactomedin 3 |
| chr7_-_944631 | 1.36 |
ENST00000453175.2
|
ADAP1
|
ArfGAP with dual PH domains 1 |
| chr4_-_102267953 | 1.36 |
ENST00000523694.2
ENST00000507176.1 |
PPP3CA
|
protein phosphatase 3, catalytic subunit, alpha isozyme |
| chr10_+_17686124 | 1.35 |
ENST00000377524.3
|
STAM
|
signal transducing adaptor molecule (SH3 domain and ITAM motif) 1 |
| chr15_+_51973680 | 1.35 |
ENST00000542355.2
|
SCG3
|
secretogranin III |
| chr14_-_60632011 | 1.35 |
ENST00000554101.1
ENST00000557137.1 |
DHRS7
|
dehydrogenase/reductase (SDR family) member 7 |
| chr13_-_24007815 | 1.34 |
ENST00000382298.3
|
SACS
|
spastic ataxia of Charlevoix-Saguenay (sacsin) |
| chr1_+_167063282 | 1.34 |
ENST00000361200.2
|
DUSP27
|
dual specificity phosphatase 27 (putative) |
| chr6_-_33714667 | 1.34 |
ENST00000293756.4
|
IP6K3
|
inositol hexakisphosphate kinase 3 |
| chr1_-_33642151 | 1.33 |
ENST00000543586.1
|
TRIM62
|
tripartite motif containing 62 |
| chr1_-_31845914 | 1.33 |
ENST00000373713.2
|
FABP3
|
fatty acid binding protein 3, muscle and heart (mammary-derived growth inhibitor) |
| chr5_+_61601965 | 1.33 |
ENST00000401507.3
|
KIF2A
|
kinesin heavy chain member 2A |
| chr10_+_116853091 | 1.32 |
ENST00000526946.1
|
ATRNL1
|
attractin-like 1 |
| chr2_-_193059634 | 1.31 |
ENST00000392314.1
|
TMEFF2
|
transmembrane protein with EGF-like and two follistatin-like domains 2 |
| chr1_+_202317855 | 1.31 |
ENST00000356764.2
|
PPP1R12B
|
protein phosphatase 1, regulatory subunit 12B |
| chr19_+_47421933 | 1.31 |
ENST00000404338.3
|
ARHGAP35
|
Rho GTPase activating protein 35 |
| chr18_+_7231123 | 1.31 |
ENST00000383467.2
|
LRRC30
|
leucine rich repeat containing 30 |
| chr7_-_143059845 | 1.31 |
ENST00000443739.2
|
FAM131B
|
family with sequence similarity 131, member B |
| chr12_+_121088291 | 1.31 |
ENST00000351200.2
|
CABP1
|
calcium binding protein 1 |
| chr17_+_30814707 | 1.30 |
ENST00000584792.1
|
CDK5R1
|
cyclin-dependent kinase 5, regulatory subunit 1 (p35) |
| chr18_-_35145593 | 1.30 |
ENST00000334919.5
ENST00000591282.1 ENST00000588597.1 |
CELF4
|
CUGBP, Elav-like family member 4 |
| chr16_-_70323422 | 1.30 |
ENST00000261772.8
|
AARS
|
alanyl-tRNA synthetase |
| chr8_-_92053212 | 1.30 |
ENST00000285419.3
|
TMEM55A
|
transmembrane protein 55A |
| chr11_-_46142948 | 1.29 |
ENST00000257821.4
|
PHF21A
|
PHD finger protein 21A |
| chr17_-_28257080 | 1.29 |
ENST00000579954.1
ENST00000540801.1 ENST00000269033.3 ENST00000590153.1 ENST00000582084.1 |
SSH2
|
slingshot protein phosphatase 2 |
| chr8_-_33455268 | 1.29 |
ENST00000522982.1
|
DUSP26
|
dual specificity phosphatase 26 (putative) |
| chr11_+_63448918 | 1.29 |
ENST00000341307.2
ENST00000356000.3 ENST00000542238.1 |
RTN3
|
reticulon 3 |
| chr3_-_183979251 | 1.28 |
ENST00000296238.3
|
CAMK2N2
|
calcium/calmodulin-dependent protein kinase II inhibitor 2 |
| chr1_-_11007927 | 1.28 |
ENST00000468348.1
|
C1orf127
|
chromosome 1 open reading frame 127 |
| chr1_+_110082487 | 1.28 |
ENST00000527748.1
|
GPR61
|
G protein-coupled receptor 61 |
| chr11_+_17756279 | 1.27 |
ENST00000265969.6
|
KCNC1
|
potassium voltage-gated channel, Shaw-related subfamily, member 1 |
| chr12_-_49582837 | 1.26 |
ENST00000547939.1
ENST00000546918.1 ENST00000552924.1 |
TUBA1A
|
tubulin, alpha 1a |
| chr10_-_75634326 | 1.26 |
ENST00000322635.3
ENST00000444854.2 ENST00000423381.1 ENST00000322680.3 ENST00000394762.2 |
CAMK2G
|
calcium/calmodulin-dependent protein kinase II gamma |
| chr3_+_85008089 | 1.26 |
ENST00000383699.3
|
CADM2
|
cell adhesion molecule 2 |
Network of associatons between targets according to the STRING database.
First level regulatory network of MAFB
Gene Ontology Analysis
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 6.1 | GO:0006542 | glutamine biosynthetic process(GO:0006542) |
| 1.4 | 4.1 | GO:0031448 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 1.3 | 2.6 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
| 1.3 | 5.2 | GO:1905205 | positive regulation of connective tissue replacement(GO:1905205) |
| 1.3 | 6.4 | GO:0006500 | N-terminal protein palmitoylation(GO:0006500) |
| 0.9 | 7.2 | GO:0038060 | nitric oxide-cGMP-mediated signaling pathway(GO:0038060) |
| 0.9 | 4.5 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.9 | 4.3 | GO:0021586 | pons maturation(GO:0021586) |
| 0.8 | 3.3 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.7 | 2.2 | GO:1900075 | regulation of neuromuscular synaptic transmission(GO:1900073) positive regulation of neuromuscular synaptic transmission(GO:1900075) |
| 0.7 | 2.9 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 0.7 | 4.4 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.7 | 2.9 | GO:1903778 | protein localization to vacuolar membrane(GO:1903778) |
| 0.7 | 2.0 | GO:0046168 | glycerol-3-phosphate catabolic process(GO:0046168) |
| 0.7 | 2.7 | GO:1904049 | negative regulation of spontaneous neurotransmitter secretion(GO:1904049) |
| 0.7 | 4.7 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.6 | 15.5 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.6 | 7.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.6 | 1.8 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.6 | 2.5 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 0.6 | 1.8 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
| 0.6 | 4.3 | GO:0006540 | glutamate decarboxylation to succinate(GO:0006540) |
| 0.6 | 1.8 | GO:1990709 | maintenance of synapse structure(GO:0099558) presynaptic active zone organization(GO:1990709) |
| 0.6 | 1.7 | GO:0061026 | cardiac muscle tissue regeneration(GO:0061026) |
| 0.6 | 2.3 | GO:1901624 | negative regulation of lymphocyte chemotaxis(GO:1901624) |
| 0.6 | 2.3 | GO:1990502 | dense core granule maturation(GO:1990502) |
| 0.6 | 1.7 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.6 | 5.6 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.5 | 3.7 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.5 | 1.5 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.5 | 1.0 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
| 0.5 | 1.5 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
| 0.5 | 1.5 | GO:1902938 | regulation of intracellular calcium activated chloride channel activity(GO:1902938) |
| 0.5 | 1.5 | GO:1903280 | negative regulation of calcium:sodium antiporter activity(GO:1903280) |
| 0.4 | 0.9 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.4 | 1.3 | GO:0019858 | cytosine metabolic process(GO:0019858) |
| 0.4 | 5.2 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.4 | 0.9 | GO:0036146 | cellular response to mycotoxin(GO:0036146) |
| 0.4 | 4.2 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.4 | 1.2 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.4 | 3.3 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.4 | 1.6 | GO:0007206 | phospholipase C-activating G-protein coupled glutamate receptor signaling pathway(GO:0007206) |
| 0.4 | 4.4 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.4 | 1.2 | GO:2000374 | regulation of oxygen metabolic process(GO:2000374) |
| 0.4 | 1.2 | GO:0090222 | centrosome-templated microtubule nucleation(GO:0090222) |
| 0.4 | 1.1 | GO:1905166 | negative regulation of protein catabolic process in the vacuole(GO:1904351) negative regulation of lysosomal protein catabolic process(GO:1905166) |
| 0.4 | 1.1 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.4 | 1.1 | GO:0003220 | left ventricular cardiac muscle tissue morphogenesis(GO:0003220) |
| 0.4 | 10.6 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
| 0.4 | 1.1 | GO:0036496 | regulation of translational initiation by eIF2 alpha dephosphorylation(GO:0036496) |
| 0.4 | 0.4 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.4 | 5.7 | GO:0071688 | striated muscle myosin thick filament assembly(GO:0071688) |
| 0.4 | 1.1 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.3 | 1.0 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.3 | 1.7 | GO:0051083 | 'de novo' cotranslational protein folding(GO:0051083) |
| 0.3 | 1.4 | GO:0016267 | O-glycan processing, core 1(GO:0016267) |
| 0.3 | 2.0 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.3 | 1.4 | GO:0060921 | sinoatrial node development(GO:0003163) sinoatrial node cell differentiation(GO:0060921) |
| 0.3 | 1.0 | GO:0040040 | thermosensory behavior(GO:0040040) |
| 0.3 | 0.3 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.3 | 2.0 | GO:0072752 | cellular response to rapamycin(GO:0072752) |
| 0.3 | 3.3 | GO:0035965 | cardiolipin acyl-chain remodeling(GO:0035965) |
| 0.3 | 1.0 | GO:0098884 | postsynaptic neurotransmitter receptor internalization(GO:0098884) |
| 0.3 | 0.7 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
| 0.3 | 1.9 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.3 | 1.6 | GO:0007198 | adenylate cyclase-inhibiting serotonin receptor signaling pathway(GO:0007198) |
| 0.3 | 12.1 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
| 0.3 | 1.6 | GO:2000639 | regulation of SREBP signaling pathway(GO:2000638) negative regulation of SREBP signaling pathway(GO:2000639) |
| 0.3 | 4.6 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.3 | 0.9 | GO:1901076 | positive regulation of engulfment of apoptotic cell(GO:1901076) |
| 0.3 | 0.9 | GO:0001579 | medium-chain fatty acid transport(GO:0001579) |
| 0.3 | 1.5 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.3 | 2.1 | GO:0051138 | positive regulation of NK T cell differentiation(GO:0051138) |
| 0.3 | 1.2 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
| 0.3 | 1.2 | GO:0072287 | metanephric distal tubule morphogenesis(GO:0072287) |
| 0.3 | 1.8 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.3 | 0.9 | GO:0031548 | regulation of brain-derived neurotrophic factor receptor signaling pathway(GO:0031548) |
| 0.3 | 0.6 | GO:1903059 | regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.3 | 2.6 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
| 0.3 | 3.4 | GO:2000582 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.3 | 0.8 | GO:0045556 | TRAIL biosynthetic process(GO:0045553) regulation of TRAIL biosynthetic process(GO:0045554) positive regulation of TRAIL biosynthetic process(GO:0045556) |
| 0.3 | 6.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.3 | 1.4 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.3 | 3.1 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.3 | 1.9 | GO:2000538 | regulation of cGMP-mediated signaling(GO:0010752) regulation of B cell chemotaxis(GO:2000537) positive regulation of B cell chemotaxis(GO:2000538) |
| 0.3 | 1.1 | GO:0099590 | neurotransmitter receptor internalization(GO:0099590) |
| 0.3 | 0.8 | GO:0045720 | negative regulation of integrin biosynthetic process(GO:0045720) |
| 0.3 | 1.1 | GO:0008628 | hormone-mediated apoptotic signaling pathway(GO:0008628) |
| 0.3 | 0.8 | GO:0031247 | actin rod assembly(GO:0031247) |
| 0.3 | 1.6 | GO:0048686 | regulation of sprouting of injured axon(GO:0048686) regulation of axon extension involved in regeneration(GO:0048690) |
| 0.3 | 1.3 | GO:1903613 | regulation of protein tyrosine phosphatase activity(GO:1903613) positive regulation of protein tyrosine phosphatase activity(GO:1903615) |
| 0.3 | 1.3 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.3 | 0.8 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.3 | 0.3 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.3 | 0.8 | GO:0051685 | maintenance of ER location(GO:0051685) |
| 0.3 | 0.5 | GO:0009062 | fatty acid catabolic process(GO:0009062) monocarboxylic acid catabolic process(GO:0072329) |
| 0.3 | 1.0 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
| 0.3 | 0.8 | GO:0050760 | negative regulation of thymidylate synthase biosynthetic process(GO:0050760) |
| 0.3 | 1.0 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
| 0.3 | 0.5 | GO:2000563 | positive regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000563) |
| 0.3 | 1.0 | GO:0036071 | N-glycan fucosylation(GO:0036071) |
| 0.2 | 1.7 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
| 0.2 | 0.7 | GO:1904428 | negative regulation of tubulin deacetylation(GO:1904428) |
| 0.2 | 1.2 | GO:1905167 | positive regulation of lysosomal protein catabolic process(GO:1905167) |
| 0.2 | 1.2 | GO:0042539 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 0.2 | 0.7 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.2 | 0.7 | GO:0099525 | presynaptic dense core granule exocytosis(GO:0099525) |
| 0.2 | 1.9 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.2 | 1.0 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.2 | 1.2 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.2 | 1.8 | GO:0031022 | nuclear migration along microfilament(GO:0031022) |
| 0.2 | 0.9 | GO:0060133 | somatotropin secreting cell development(GO:0060133) |
| 0.2 | 0.9 | GO:1903445 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.2 | 1.6 | GO:1901526 | positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.2 | 0.9 | GO:1904647 | response to rotenone(GO:1904647) |
| 0.2 | 1.3 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.2 | 2.0 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.2 | 1.5 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.2 | 0.8 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.2 | 0.4 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.2 | 0.6 | GO:1903094 | regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.2 | 0.6 | GO:1904395 | positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 0.2 | 2.9 | GO:1903818 | positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.2 | 1.0 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.2 | 2.6 | GO:0030091 | protein repair(GO:0030091) |
| 0.2 | 1.6 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.2 | 1.2 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.2 | 1.0 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.2 | 0.8 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.2 | 3.0 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.2 | 1.2 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.2 | 0.8 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.2 | 0.6 | GO:0034963 | box C/D snoRNA 3'-end processing(GO:0000494) box C/D snoRNA metabolic process(GO:0033967) box C/D snoRNA processing(GO:0034963) histone glutamine methylation(GO:1990258) |
| 0.2 | 0.6 | GO:0060557 | positive regulation of vitamin metabolic process(GO:0046136) positive regulation of vitamin D biosynthetic process(GO:0060557) positive regulation of calcidiol 1-monooxygenase activity(GO:0060559) |
| 0.2 | 1.8 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.2 | 0.6 | GO:0098939 | dendritic transport of mitochondrion(GO:0098939) anterograde dendritic transport of mitochondrion(GO:0098972) |
| 0.2 | 1.4 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.2 | 0.6 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
| 0.2 | 3.5 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.2 | 0.6 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.2 | 0.6 | GO:0033861 | negative regulation of NAD(P)H oxidase activity(GO:0033861) |
| 0.2 | 0.4 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.2 | 1.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.2 | 2.3 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.2 | 0.9 | GO:1902904 | negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.2 | 0.9 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.2 | 0.4 | GO:2001183 | negative regulation of interleukin-12 secretion(GO:2001183) |
| 0.2 | 0.8 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.2 | 2.8 | GO:0010968 | regulation of microtubule nucleation(GO:0010968) |
| 0.2 | 0.2 | GO:0021896 | forebrain astrocyte differentiation(GO:0021896) forebrain astrocyte development(GO:0021897) |
| 0.2 | 2.8 | GO:0098828 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.2 | 0.7 | GO:0060152 | peroxisome localization(GO:0060151) microtubule-based peroxisome localization(GO:0060152) |
| 0.2 | 0.7 | GO:0032902 | nerve growth factor production(GO:0032902) |
| 0.2 | 0.9 | GO:2000312 | regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.2 | 0.4 | GO:0006429 | leucyl-tRNA aminoacylation(GO:0006429) |
| 0.2 | 0.4 | GO:0033029 | regulation of neutrophil apoptotic process(GO:0033029) |
| 0.2 | 0.7 | GO:0038170 | somatostatin receptor signaling pathway(GO:0038169) somatostatin signaling pathway(GO:0038170) |
| 0.2 | 0.5 | GO:0006433 | glutamyl-tRNA aminoacylation(GO:0006424) prolyl-tRNA aminoacylation(GO:0006433) |
| 0.2 | 0.5 | GO:0061485 | memory T cell proliferation(GO:0061485) |
| 0.2 | 0.4 | GO:0032900 | negative regulation of neurotrophin production(GO:0032900) |
| 0.2 | 0.9 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.2 | 0.5 | GO:0019230 | proprioception(GO:0019230) |
| 0.2 | 1.6 | GO:0031444 | slow-twitch skeletal muscle fiber contraction(GO:0031444) |
| 0.2 | 2.5 | GO:2000553 | positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
| 0.2 | 0.5 | GO:0071109 | superior temporal gyrus development(GO:0071109) |
| 0.2 | 0.9 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.2 | 1.2 | GO:1903385 | regulation of homophilic cell adhesion(GO:1903385) |
| 0.2 | 0.7 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.2 | 0.9 | GO:0003070 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.2 | 1.0 | GO:0071233 | cellular response to leucine(GO:0071233) |
| 0.2 | 0.2 | GO:0072038 | mesenchymal stem cell maintenance involved in nephron morphogenesis(GO:0072038) |
| 0.2 | 0.3 | GO:0097065 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.2 | 1.4 | GO:0030279 | negative regulation of ossification(GO:0030279) |
| 0.2 | 1.2 | GO:0098700 | neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.2 | 0.9 | GO:0071874 | cellular response to norepinephrine stimulus(GO:0071874) |
| 0.2 | 0.8 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.2 | 0.3 | GO:0015960 | diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.2 | 0.5 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.2 | 1.5 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.2 | 0.7 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) negative regulation of neuron projection regeneration(GO:0070571) |
| 0.2 | 0.5 | GO:0072560 | glandular epithelial cell maturation(GO:0002071) type B pancreatic cell maturation(GO:0072560) |
| 0.2 | 0.5 | GO:0043181 | vacuolar sequestering(GO:0043181) |
| 0.2 | 1.0 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.2 | 1.1 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.2 | 0.5 | GO:0006043 | glucosamine catabolic process(GO:0006043) |
| 0.2 | 1.1 | GO:0015798 | myo-inositol transport(GO:0015798) |
| 0.2 | 1.4 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
| 0.2 | 0.6 | GO:0006422 | aspartyl-tRNA aminoacylation(GO:0006422) |
| 0.2 | 0.6 | GO:0016598 | protein arginylation(GO:0016598) |
| 0.2 | 0.9 | GO:0002729 | positive regulation of natural killer cell cytokine production(GO:0002729) |
| 0.2 | 0.6 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
| 0.2 | 0.6 | GO:0061582 | intestinal epithelial cell migration(GO:0061582) |
| 0.2 | 0.8 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.2 | 3.6 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.2 | 0.9 | GO:0093001 | glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.2 | 1.1 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.2 | 1.1 | GO:0060025 | primary heart field specification(GO:0003138) sinoatrial valve development(GO:0003172) sinoatrial valve morphogenesis(GO:0003185) regulation of synaptic activity(GO:0060025) |
| 0.2 | 2.3 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.1 | 0.9 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.1 | 0.6 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.1 | 1.9 | GO:0014809 | regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.1 | 1.0 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.1 | 0.4 | GO:1901340 | negative regulation of store-operated calcium channel activity(GO:1901340) |
| 0.1 | 2.1 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.1 | 1.0 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.1 | 0.4 | GO:0003218 | cardiac left ventricle formation(GO:0003218) |
| 0.1 | 1.0 | GO:2000568 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.1 | 1.2 | GO:0060538 | skeletal muscle organ development(GO:0060538) |
| 0.1 | 1.0 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.1 | 0.3 | GO:0098881 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.1 | 0.4 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.1 | 1.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.1 | 0.7 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.1 | 2.1 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
| 0.1 | 1.7 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.1 | 0.3 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.1 | 0.4 | GO:0044727 | DNA demethylation of male pronucleus(GO:0044727) |
| 0.1 | 0.4 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.1 | 1.5 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.4 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.1 | 0.8 | GO:0098746 | fast, calcium ion-dependent exocytosis of neurotransmitter(GO:0098746) |
| 0.1 | 1.9 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.1 | 7.6 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.1 | 0.4 | GO:0001544 | initiation of primordial ovarian follicle growth(GO:0001544) |
| 0.1 | 1.1 | GO:0048105 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.1 | 1.2 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
| 0.1 | 0.8 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.1 | 0.3 | GO:0000050 | urea cycle(GO:0000050) |
| 0.1 | 0.5 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.1 | 0.3 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
| 0.1 | 0.6 | GO:0030043 | actin filament fragmentation(GO:0030043) |
| 0.1 | 0.6 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 1.3 | GO:0021840 | directional guidance of interneurons involved in migration from the subpallium to the cortex(GO:0021840) chemorepulsion involved in interneuron migration from the subpallium to the cortex(GO:0021842) |
| 0.1 | 5.6 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 | 0.4 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.1 | 0.8 | GO:0006436 | tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.1 | 0.9 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.1 | 0.4 | GO:0070781 | response to biotin(GO:0070781) |
| 0.1 | 3.3 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
| 0.1 | 0.3 | GO:2000468 | negative regulation of late endosome to lysosome transport(GO:1902823) regulation of peroxidase activity(GO:2000468) |
| 0.1 | 0.5 | GO:0072106 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
| 0.1 | 1.5 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.1 | 1.0 | GO:0043314 | negative regulation of neutrophil degranulation(GO:0043314) |
| 0.1 | 1.1 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.1 | 0.9 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 1.0 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.1 | 3.4 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.1 | 0.5 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.1 | 0.4 | GO:0042727 | flavin-containing compound biosynthetic process(GO:0042727) |
| 0.1 | 1.1 | GO:0030242 | pexophagy(GO:0030242) |
| 0.1 | 1.2 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.1 | 1.0 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.1 | 6.1 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 | 0.6 | GO:0070370 | heat acclimation(GO:0010286) cellular heat acclimation(GO:0070370) |
| 0.1 | 0.5 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 0.1 | 0.1 | GO:0021551 | central nervous system morphogenesis(GO:0021551) |
| 0.1 | 0.6 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
| 0.1 | 0.3 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
| 0.1 | 0.7 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.1 | 0.3 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.1 | 0.1 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
| 0.1 | 0.3 | GO:0002188 | translation reinitiation(GO:0002188) |
| 0.1 | 2.6 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 | 1.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
| 0.1 | 0.7 | GO:1902045 | negative regulation of Fas signaling pathway(GO:1902045) |
| 0.1 | 0.9 | GO:1904220 | regulation of serine C-palmitoyltransferase activity(GO:1904220) |
| 0.1 | 2.6 | GO:0035637 | multicellular organismal signaling(GO:0035637) |
| 0.1 | 0.3 | GO:0060711 | labyrinthine layer development(GO:0060711) |
| 0.1 | 2.7 | GO:0007413 | axonal fasciculation(GO:0007413) |
| 0.1 | 0.9 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.1 | 1.4 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.1 | 1.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.1 | 0.3 | GO:0014908 | myotube differentiation involved in skeletal muscle regeneration(GO:0014908) |
| 0.1 | 1.0 | GO:0043144 | snoRNA processing(GO:0043144) |
| 0.1 | 0.3 | GO:0032827 | negative regulation of natural killer cell differentiation(GO:0032824) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) positive regulation of cytolysis in other organism(GO:0051714) |
| 0.1 | 1.0 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 1.2 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.1 | 0.4 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.1 | 0.4 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.1 | 0.4 | GO:1903281 | positive regulation of calcium:sodium antiporter activity(GO:1903281) |
| 0.1 | 1.2 | GO:0046950 | cellular ketone body metabolic process(GO:0046950) ketone body biosynthetic process(GO:0046951) |
| 0.1 | 0.8 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 | 1.3 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.1 | 1.3 | GO:0038007 | netrin-activated signaling pathway(GO:0038007) |
| 0.1 | 0.5 | GO:0000117 | regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.1 | 0.3 | GO:0051311 | meiotic metaphase I plate congression(GO:0043060) meiotic spindle midzone assembly(GO:0051257) meiotic metaphase plate congression(GO:0051311) |
| 0.1 | 0.7 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 2.7 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.1 | 0.8 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.1 | 1.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.1 | 1.0 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.1 | 2.0 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.1 | 0.3 | GO:0032661 | regulation of interleukin-18 production(GO:0032661) |
| 0.1 | 1.8 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
| 0.1 | 0.4 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 | 1.0 | GO:0032100 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
| 0.1 | 1.0 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 | 0.1 | GO:2001293 | malonyl-CoA metabolic process(GO:2001293) |
| 0.1 | 0.9 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
| 0.1 | 1.9 | GO:0050812 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.1 | 0.8 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.1 | 1.3 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.1 | 0.3 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
| 0.1 | 0.3 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.1 | 1.9 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.1 | 0.5 | GO:0032510 | endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.1 | 1.8 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
| 0.1 | 1.0 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
| 0.1 | 1.4 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.1 | 1.3 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.1 | 0.3 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.1 | 0.2 | GO:0035878 | nail development(GO:0035878) |
| 0.1 | 1.1 | GO:1904903 | ESCRT complex disassembly(GO:1904896) ESCRT III complex disassembly(GO:1904903) |
| 0.1 | 1.0 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.1 | 2.2 | GO:0045199 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.1 | 0.4 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 | 1.7 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.1 | 2.2 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.1 | 1.5 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.1 | 1.0 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.1 | 0.4 | GO:2001176 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.1 | 1.6 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.1 | 1.2 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 | 0.6 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 1.1 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 | 0.5 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
| 0.1 | 0.4 | GO:0050777 | negative regulation of immune response(GO:0050777) |
| 0.1 | 6.0 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.1 | 0.3 | GO:0051490 | negative regulation of filopodium assembly(GO:0051490) |
| 0.1 | 3.7 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 | 1.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 | 0.2 | GO:1902525 | regulation of protein monoubiquitination(GO:1902525) |
| 0.1 | 2.6 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.1 | 1.3 | GO:0070296 | sarcoplasmic reticulum calcium ion transport(GO:0070296) |
| 0.1 | 1.4 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.1 | 1.7 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.1 | 1.8 | GO:0016024 | CDP-diacylglycerol biosynthetic process(GO:0016024) |
| 0.1 | 1.4 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 0.8 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.1 | 0.4 | GO:1904566 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.1 | 0.4 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.1 | 0.2 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.1 | 0.5 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.1 | 0.8 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.1 | 0.8 | GO:0002943 | tRNA dihydrouridine synthesis(GO:0002943) |
| 0.1 | 0.7 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.1 | 0.3 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.1 | 0.3 | GO:0046338 | phosphatidylethanolamine catabolic process(GO:0046338) |
| 0.1 | 0.2 | GO:0002101 | tRNA wobble cytosine modification(GO:0002101) RNA repair(GO:0042245) |
| 0.1 | 0.5 | GO:0009217 | purine deoxyribonucleoside triphosphate catabolic process(GO:0009217) |
| 0.1 | 2.9 | GO:0008089 | anterograde axonal transport(GO:0008089) |
| 0.1 | 0.4 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.1 | 1.1 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
| 0.1 | 0.3 | GO:0051066 | dihydrobiopterin metabolic process(GO:0051066) |
| 0.1 | 0.4 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.1 | 0.3 | GO:0060023 | soft palate development(GO:0060023) |
| 0.1 | 1.8 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.1 | 0.4 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.1 | 0.9 | GO:0046959 | habituation(GO:0046959) |
| 0.1 | 0.8 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.1 | 0.8 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.1 | 2.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.1 | 1.5 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.1 | 0.4 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.1 | 1.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.1 | 0.2 | GO:0048203 | vesicle targeting, trans-Golgi to endosome(GO:0048203) |
| 0.1 | 3.2 | GO:0034199 | activation of protein kinase A activity(GO:0034199) |
| 0.1 | 3.2 | GO:0014047 | glutamate secretion(GO:0014047) |
| 0.1 | 1.0 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.1 | 1.0 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
| 0.1 | 0.4 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.1 | 0.1 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.4 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.1 | 0.6 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 1.3 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 0.1 | 2.6 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
| 0.1 | 0.4 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.1 | 0.4 | GO:0010636 | positive regulation of mitochondrial fusion(GO:0010636) |
| 0.1 | 2.7 | GO:0014072 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.1 | 0.9 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
| 0.1 | 0.4 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.1 | 0.8 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
| 0.1 | 0.8 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.1 | 0.1 | GO:0055129 | L-proline biosynthetic process(GO:0055129) |
| 0.1 | 0.6 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.1 | 0.3 | GO:0030473 | nucleokinesis involved in cell motility in cerebral cortex radial glia guided migration(GO:0021817) nuclear migration along microtubule(GO:0030473) |
| 0.1 | 0.8 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.1 | 0.4 | GO:0048867 | ganglion mother cell fate determination(GO:0007402) stem cell fate determination(GO:0048867) |
| 0.1 | 1.0 | GO:0022011 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
| 0.1 | 2.2 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
| 0.1 | 1.0 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
| 0.1 | 1.2 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
| 0.1 | 0.4 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.1 | 1.2 | GO:0038203 | TORC2 signaling(GO:0038203) |
| 0.1 | 0.7 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.1 | 0.2 | GO:0045062 | extrathymic T cell selection(GO:0045062) |
| 0.1 | 0.1 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
| 0.1 | 1.1 | GO:0016239 | positive regulation of macroautophagy(GO:0016239) |
| 0.1 | 0.7 | GO:0033183 | negative regulation of histone ubiquitination(GO:0033183) regulation of histone H2A K63-linked ubiquitination(GO:1901314) negative regulation of histone H2A K63-linked ubiquitination(GO:1901315) |
| 0.1 | 0.2 | GO:0002232 | leukocyte chemotaxis involved in inflammatory response(GO:0002232) cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.1 | 0.5 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
| 0.1 | 1.4 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.9 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.1 | 0.6 | GO:0010265 | SCF complex assembly(GO:0010265) |
| 0.1 | 0.6 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.1 | 0.5 | GO:0014741 | negative regulation of cardiac muscle hypertrophy(GO:0010614) negative regulation of muscle hypertrophy(GO:0014741) |
| 0.1 | 0.6 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.1 | 0.1 | GO:1904017 | cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.1 | 0.2 | GO:0034182 | regulation of maintenance of sister chromatid cohesion(GO:0034091) positive regulation of maintenance of sister chromatid cohesion(GO:0034093) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.1 | 0.4 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.1 | 1.4 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.1 | 0.3 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.1 | 2.2 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
| 0.1 | 0.3 | GO:0010157 | response to chlorate(GO:0010157) |
| 0.1 | 1.3 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.1 | 0.3 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
| 0.1 | 0.2 | GO:0003363 | lamellipodium assembly involved in ameboidal cell migration(GO:0003363) extension of a leading process involved in cell motility in cerebral cortex radial glia guided migration(GO:0021816) |
| 0.1 | 0.2 | GO:0018101 | protein citrullination(GO:0018101) histone citrullination(GO:0036414) |
| 0.1 | 1.0 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 | 0.4 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.1 | 0.6 | GO:1990822 | basic amino acid transmembrane transport(GO:1990822) |
| 0.1 | 2.5 | GO:0046676 | negative regulation of insulin secretion(GO:0046676) |
| 0.1 | 1.6 | GO:0002021 | response to dietary excess(GO:0002021) |
| 0.1 | 0.4 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
| 0.1 | 0.6 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.1 | 0.2 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
| 0.1 | 0.2 | GO:1902530 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.1 | 0.4 | GO:0060356 | leucine import(GO:0060356) |
| 0.1 | 0.3 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.1 | 0.2 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.1 | 1.6 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
| 0.1 | 1.0 | GO:0043383 | negative T cell selection(GO:0043383) |
| 0.1 | 0.2 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.1 | 0.3 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.1 | 0.3 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 1.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.1 | 1.5 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.1 | 0.2 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.1 | 1.2 | GO:0017038 | protein import(GO:0017038) |
| 0.1 | 0.4 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 0.2 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
| 0.1 | 0.5 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.1 | 0.4 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.1 | 0.2 | GO:0019521 | pentose biosynthetic process(GO:0019322) aldonic acid metabolic process(GO:0019520) D-gluconate metabolic process(GO:0019521) |
| 0.1 | 0.4 | GO:1901098 | positive regulation of autophagosome maturation(GO:1901098) |
| 0.1 | 0.8 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
| 0.1 | 2.0 | GO:0007398 | ectoderm development(GO:0007398) |
| 0.1 | 0.2 | GO:0045209 | MAPK phosphatase export from nucleus(GO:0045208) MAPK phosphatase export from nucleus, leptomycin B sensitive(GO:0045209) |
| 0.1 | 0.7 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.1 | 0.5 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
| 0.1 | 1.0 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
| 0.1 | 1.0 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
| 0.1 | 0.1 | GO:0044111 | development involved in symbiotic interaction(GO:0044111) |
| 0.1 | 0.3 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.1 | 0.5 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 4.2 | GO:0045652 | regulation of megakaryocyte differentiation(GO:0045652) |
| 0.1 | 1.5 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.1 | 0.6 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.1 | 0.3 | GO:0097676 | histone H3-K36 dimethylation(GO:0097676) |
| 0.1 | 0.4 | GO:1903786 | mycotoxin catabolic process(GO:0043387) aflatoxin catabolic process(GO:0046223) organic heteropentacyclic compound catabolic process(GO:1901377) regulation of glutathione biosynthetic process(GO:1903786) positive regulation of glutathione biosynthetic process(GO:1903788) |
| 0.1 | 2.1 | GO:1901379 | regulation of potassium ion transmembrane transport(GO:1901379) |
| 0.1 | 0.6 | GO:0019317 | fucose catabolic process(GO:0019317) L-fucose metabolic process(GO:0042354) L-fucose catabolic process(GO:0042355) |
| 0.0 | 0.4 | GO:0042791 | 5S class rRNA transcription from RNA polymerase III type 1 promoter(GO:0042791) tRNA transcription from RNA polymerase III promoter(GO:0042797) |
| 0.0 | 0.4 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
| 0.0 | 0.6 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
| 0.0 | 0.8 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.0 | 0.1 | GO:0051703 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.0 | 1.3 | GO:1903861 | positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.2 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) monoacylglycerol catabolic process(GO:0052651) |
| 0.0 | 1.4 | GO:0032012 | regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 1.2 | GO:0019226 | transmission of nerve impulse(GO:0019226) |
| 0.0 | 0.3 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.6 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.0 | 0.3 | GO:0032345 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 0.0 | 0.1 | GO:1903802 | amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) L-glutamate import(GO:0051938) regulation of amino acid uptake involved in synaptic transmission(GO:0051941) regulation of glutamate uptake involved in transmission of nerve impulse(GO:0051946) regulation of L-glutamate import(GO:1900920) L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
| 0.0 | 0.4 | GO:0002084 | protein depalmitoylation(GO:0002084) |
| 0.0 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.0 | 0.2 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
| 0.0 | 0.7 | GO:0032119 | sequestering of zinc ion(GO:0032119) |
| 0.0 | 0.1 | GO:2000820 | negative regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000820) |
| 0.0 | 7.8 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.0 | 0.7 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.0 | 0.2 | GO:0046075 | dTTP metabolic process(GO:0046075) |
| 0.0 | 0.4 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.0 | 0.2 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.0 | 0.6 | GO:0014059 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
| 0.0 | 0.2 | GO:1903593 | regulation of histamine secretion by mast cell(GO:1903593) |
| 0.0 | 1.8 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 1.2 | GO:0006853 | carnitine shuttle(GO:0006853) |
| 0.0 | 0.1 | GO:0036451 | cap mRNA methylation(GO:0036451) |
| 0.0 | 1.0 | GO:0016048 | detection of temperature stimulus(GO:0016048) |
| 0.0 | 0.4 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.0 | 2.3 | GO:0006007 | glucose catabolic process(GO:0006007) |
| 0.0 | 2.5 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.9 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.8 | GO:0034656 | nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.0 | 1.7 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
| 0.0 | 0.2 | GO:0010734 | protein glutathionylation(GO:0010731) regulation of protein glutathionylation(GO:0010732) negative regulation of protein glutathionylation(GO:0010734) |
| 0.0 | 1.0 | GO:0005980 | glycogen catabolic process(GO:0005980) |
| 0.0 | 0.3 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.1 | GO:0034111 | negative regulation of homotypic cell-cell adhesion(GO:0034111) negative regulation of leukocyte cell-cell adhesion(GO:1903038) |
| 0.0 | 0.3 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.0 | 2.3 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.0 | 0.7 | GO:0043306 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.0 | 0.3 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.0 | 0.4 | GO:1903543 | positive regulation of exosomal secretion(GO:1903543) |
| 0.0 | 1.6 | GO:0019076 | viral release from host cell(GO:0019076) |
| 0.0 | 0.4 | GO:0043486 | histone exchange(GO:0043486) |
| 0.0 | 0.2 | GO:1903588 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.0 | 0.1 | GO:0035508 | positive regulation of myosin-light-chain-phosphatase activity(GO:0035508) |
| 0.0 | 2.2 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 1.0 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.0 | 0.2 | GO:0071934 | thiamine transmembrane transport(GO:0071934) |
| 0.0 | 0.4 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.0 | 0.0 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.0 | 4.4 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
| 0.0 | 0.7 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.0 | 0.4 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.0 | 0.7 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 1.7 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
| 0.0 | 0.5 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 1.0 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 1.0 | GO:0060307 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) |
| 0.0 | 0.9 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.2 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 | 1.0 | GO:1901663 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.0 | 0.3 | GO:0019075 | virus maturation(GO:0019075) |
| 0.0 | 2.9 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
| 0.0 | 0.1 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 0.1 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.0 | 0.5 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 6.0 | GO:0042177 | negative regulation of protein catabolic process(GO:0042177) |
| 0.0 | 0.8 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.0 | 0.1 | GO:0014009 | glial cell proliferation(GO:0014009) regulation of glial cell proliferation(GO:0060251) positive regulation of glial cell proliferation(GO:0060252) |
| 0.0 | 0.2 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.0 | 0.3 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.3 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
| 0.0 | 1.4 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.0 | 0.4 | GO:0007440 | foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
| 0.0 | 0.0 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.0 | 0.4 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.0 | 0.2 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.0 | 0.2 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.0 | 1.1 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.2 | GO:1904381 | Golgi apparatus mannose trimming(GO:1904381) |
| 0.0 | 0.3 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 2.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.3 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 0.3 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.0 | 0.1 | GO:0000961 | negative regulation of mitochondrial RNA catabolic process(GO:0000961) |
| 0.0 | 0.2 | GO:1990564 | protein ufmylation(GO:0071569) protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 | 0.2 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
| 0.0 | 0.5 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
| 0.0 | 2.5 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.0 | 0.2 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.0 | 0.4 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.1 | GO:1905232 | cellular response to L-glutamate(GO:1905232) |
| 0.0 | 4.9 | GO:0002504 | antigen processing and presentation of peptide antigen via MHC class II(GO:0002495) antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002504) |
| 0.0 | 0.6 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 | 0.5 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 | 0.2 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.0 | 0.1 | GO:0071224 | cellular response to peptidoglycan(GO:0071224) |
| 0.0 | 0.9 | GO:0035728 | response to hepatocyte growth factor(GO:0035728) |
| 0.0 | 5.0 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.0 | 0.4 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.0 | 0.3 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
| 0.0 | 0.1 | GO:0051572 | negative regulation of histone H3-K36 methylation(GO:0000415) negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.0 | 0.3 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 | 1.1 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.4 | GO:0009299 | mRNA transcription(GO:0009299) |
| 0.0 | 0.3 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.0 | 1.6 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.8 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.1 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.0 | 0.1 | GO:0060290 | transdifferentiation(GO:0060290) |
| 0.0 | 2.7 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.0 | 0.8 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.3 | GO:0010561 | negative regulation of glycoprotein biosynthetic process(GO:0010561) |
| 0.0 | 0.2 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.0 | 0.5 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.2 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.0 | 0.2 | GO:0071802 | negative regulation of podosome assembly(GO:0071802) |
| 0.0 | 1.1 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.0 | 0.2 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.0 | 0.1 | GO:1904211 | membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.0 | 0.5 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.0 | 0.1 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.0 | 0.3 | GO:0070120 | brainstem development(GO:0003360) ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.0 | 0.1 | GO:0007068 | negative regulation of transcription during mitosis(GO:0007068) negative regulation of transcription from RNA polymerase II promoter during mitosis(GO:0007070) |
| 0.0 | 0.7 | GO:1903959 | regulation of anion transmembrane transport(GO:1903959) |
| 0.0 | 0.5 | GO:1903206 | negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
| 0.0 | 0.2 | GO:0006552 | leucine catabolic process(GO:0006552) |
| 0.0 | 1.3 | GO:0021762 | substantia nigra development(GO:0021762) |
| 0.0 | 0.3 | GO:0014870 | response to muscle inactivity(GO:0014870) response to stimulus involved in regulation of muscle adaptation(GO:0014874) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.0 | 0.4 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.0 | 0.8 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
| 0.0 | 0.2 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.0 | 0.5 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
| 0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 | 0.1 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 | 0.4 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.0 | 0.2 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.2 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.0 | 0.2 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.0 | 0.4 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) |
| 0.0 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.0 | 0.1 | GO:0003335 | corneocyte development(GO:0003335) |
| 0.0 | 0.1 | GO:0000738 | DNA catabolic process, exonucleolytic(GO:0000738) |
| 0.0 | 0.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.3 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.3 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
| 0.0 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 1.7 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
| 0.0 | 0.4 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.0 | 0.2 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 | 0.7 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.3 | GO:0045046 | protein import into peroxisome membrane(GO:0045046) |
| 0.0 | 0.5 | GO:0019054 | modulation by virus of host process(GO:0019054) |
| 0.0 | 0.4 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.3 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.4 | GO:0060632 | regulation of microtubule-based movement(GO:0060632) |
| 0.0 | 0.0 | GO:0015870 | acetylcholine transport(GO:0015870) |
| 0.0 | 0.5 | GO:1900027 | regulation of ruffle assembly(GO:1900027) |
| 0.0 | 0.1 | GO:0090398 | cellular senescence(GO:0090398) |
| 0.0 | 0.1 | GO:0036315 | cellular response to sterol(GO:0036315) |
| 0.0 | 0.3 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.0 | 0.7 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.1 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.0 | 0.1 | GO:0051708 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.0 | 0.0 | GO:1900239 | phenotypic switching(GO:0036166) regulation of phenotypic switching(GO:1900239) |
| 0.0 | 0.3 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 1.0 | GO:0006536 | glutamate metabolic process(GO:0006536) |
| 0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.0 | 1.7 | GO:0016575 | histone deacetylation(GO:0016575) |
| 0.0 | 0.7 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 | 0.3 | GO:0072189 | ureter development(GO:0072189) |
| 0.0 | 0.1 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.0 | 0.2 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.0 | 0.4 | GO:0010761 | fibroblast migration(GO:0010761) |
| 0.0 | 0.3 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 0.0 | 0.3 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.0 | 0.0 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.0 | 0.3 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.0 | 1.0 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 | 0.1 | GO:0061001 | regulation of dendritic spine morphogenesis(GO:0061001) |
| 0.0 | 0.2 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.4 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.0 | 0.3 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.0 | 1.8 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
| 0.0 | 1.9 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
| 0.0 | 0.7 | GO:0006919 | activation of cysteine-type endopeptidase activity involved in apoptotic process(GO:0006919) |
| 0.0 | 0.2 | GO:1901224 | positive regulation of NIK/NF-kappaB signaling(GO:1901224) |
| 0.0 | 1.0 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.0 | 0.3 | GO:0097242 | beta-amyloid clearance(GO:0097242) |
| 0.0 | 1.5 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 0.4 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.0 | 0.0 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.0 | 0.4 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.0 | 0.1 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.0 | 0.3 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.0 | 0.3 | GO:0006222 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.0 | 0.1 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
| 0.0 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.0 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.0 | 1.4 | GO:0042552 | myelination(GO:0042552) |
| 0.0 | 0.3 | GO:0097009 | energy homeostasis(GO:0097009) |
| 0.0 | 0.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.0 | 0.3 | GO:0071402 | cellular response to lipoprotein particle stimulus(GO:0071402) |
| 0.0 | 0.0 | GO:0044803 | multi-organism membrane organization(GO:0044803) |
| 0.0 | 0.4 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
| 0.0 | 0.2 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
| 0.0 | 0.4 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
| 0.0 | 0.3 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
| 0.0 | 0.3 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.0 | 0.3 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 | 0.8 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.0 | 3.6 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
| 0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.0 | 1.1 | GO:0005976 | polysaccharide metabolic process(GO:0005976) |
| 0.0 | 0.2 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.0 | 0.2 | GO:0032481 | positive regulation of type I interferon production(GO:0032481) |
| 0.0 | 0.1 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.0 | 0.1 | GO:1902590 | viral budding via host ESCRT complex(GO:0039702) viral budding(GO:0046755) multi-organism organelle organization(GO:1902590) multi-organism membrane budding(GO:1902592) |
| 0.0 | 0.3 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.1 | GO:0006574 | valine catabolic process(GO:0006574) |
| 0.0 | 0.8 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.1 | GO:0032700 | negative regulation of interleukin-17 production(GO:0032700) |
| 0.0 | 0.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.0 | 0.1 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 | 0.4 | GO:0045921 | positive regulation of exocytosis(GO:0045921) |
| 0.0 | 0.2 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.6 | GO:0035338 | long-chain fatty-acyl-CoA biosynthetic process(GO:0035338) |
| 0.0 | 0.3 | GO:0032922 | circadian regulation of gene expression(GO:0032922) |
| 0.0 | 0.2 | GO:0032875 | regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
| 0.0 | 1.2 | GO:0030148 | sphingolipid biosynthetic process(GO:0030148) |
| 0.0 | 0.4 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.0 | 0.4 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.0 | 0.2 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.0 | 0.1 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.0 | 1.0 | GO:0046324 | regulation of glucose import(GO:0046324) |
| 0.0 | 0.2 | GO:2000758 | positive regulation of histone acetylation(GO:0035066) positive regulation of peptidyl-lysine acetylation(GO:2000758) |
| 0.0 | 3.2 | GO:0010389 | regulation of G2/M transition of mitotic cell cycle(GO:0010389) |
| 0.0 | 0.1 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
| 0.0 | 0.1 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.0 | 0.5 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
| 0.0 | 3.4 | GO:0006413 | translational initiation(GO:0006413) |
| 0.0 | 0.3 | GO:0071377 | cellular response to glucagon stimulus(GO:0071377) |
| 0.0 | 0.2 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
| 0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.0 | 0.2 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
| 0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.2 | GO:0032506 | cytokinetic process(GO:0032506) |
| 0.0 | 0.2 | GO:0032508 | DNA duplex unwinding(GO:0032508) |
| 0.0 | 0.1 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.0 | 0.2 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.0 | 0.1 | GO:0038195 | urokinase plasminogen activator signaling pathway(GO:0038195) |
| 0.0 | 0.0 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) |
| 0.0 | 0.0 | GO:0021903 | rostrocaudal neural tube patterning(GO:0021903) |
| 0.0 | 0.7 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
| 0.0 | 0.0 | GO:0045204 | MAPK export from nucleus(GO:0045204) |
| 0.0 | 0.0 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.0 | 0.3 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.0 | 0.3 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.1 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.0 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.0 | 0.4 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
| 0.0 | 1.3 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.6 | GO:0006378 | mRNA polyadenylation(GO:0006378) |
| 0.0 | 0.2 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.0 | 0.1 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
| 0.0 | 0.2 | GO:0097576 | vacuole fusion(GO:0097576) |
| 0.0 | 0.2 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.0 | 0.1 | GO:0030705 | cytoskeleton-dependent intracellular transport(GO:0030705) |
| 0.0 | 0.1 | GO:0090659 | walking behavior(GO:0090659) |
| 0.0 | 2.4 | GO:0000209 | protein polyubiquitination(GO:0000209) |
| 0.0 | 0.1 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.1 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 1.0 | GO:0097447 | dendritic tree(GO:0097447) |
| 0.8 | 3.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.8 | 7.6 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.7 | 4.6 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.6 | 1.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.5 | 3.9 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.5 | 0.5 | GO:1990425 | ryanodine receptor complex(GO:1990425) |
| 0.5 | 1.9 | GO:0038039 | G-protein coupled receptor heterodimeric complex(GO:0038039) |
| 0.4 | 9.1 | GO:0061202 | clathrin-sculpted gamma-aminobutyric acid transport vesicle(GO:0061200) clathrin-sculpted gamma-aminobutyric acid transport vesicle membrane(GO:0061202) |
| 0.4 | 1.6 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.4 | 6.2 | GO:0099634 | postsynaptic specialization membrane(GO:0099634) |
| 0.4 | 2.9 | GO:0014802 | terminal cisterna(GO:0014802) |
| 0.4 | 1.1 | GO:0098855 | HCN channel complex(GO:0098855) |
| 0.4 | 0.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.4 | 1.4 | GO:0043293 | apoptosome(GO:0043293) |
| 0.3 | 4.8 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.3 | 0.3 | GO:0043614 | multi-eIF complex(GO:0043614) |
| 0.3 | 2.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.3 | 1.0 | GO:0098844 | postsynaptic endocytic zone membrane(GO:0098844) |
| 0.3 | 3.5 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.3 | 0.9 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.3 | 1.2 | GO:0098843 | postsynaptic endocytic zone(GO:0098843) |
| 0.3 | 1.2 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.3 | 2.0 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.3 | 14.8 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.3 | 13.0 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.3 | 13.1 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.3 | 1.1 | GO:0060187 | cell pole(GO:0060187) |
| 0.3 | 2.5 | GO:0044305 | calyx of Held(GO:0044305) |
| 0.2 | 0.2 | GO:0070993 | translation preinitiation complex(GO:0070993) |
| 0.2 | 1.1 | GO:0031166 | integral component of vacuolar membrane(GO:0031166) |
| 0.2 | 1.6 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
| 0.2 | 12.5 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.2 | 2.9 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.2 | 1.0 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.2 | 1.0 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.2 | 5.1 | GO:0097386 | glial cell projection(GO:0097386) |
| 0.2 | 0.6 | GO:0097598 | sperm cytoplasmic droplet(GO:0097598) |
| 0.2 | 0.8 | GO:0097635 | extrinsic component of autophagosome membrane(GO:0097635) |
| 0.2 | 0.6 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.2 | 2.7 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.2 | 2.5 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.2 | 1.0 | GO:1990031 | pinceau fiber(GO:1990031) |
| 0.2 | 7.4 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
| 0.2 | 4.4 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.2 | 2.2 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.2 | 11.6 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.2 | 1.0 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.2 | 1.0 | GO:0070381 | endosome to plasma membrane transport vesicle(GO:0070381) |
| 0.2 | 1.6 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.2 | 5.2 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.2 | 1.3 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
| 0.2 | 2.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.2 | 3.9 | GO:0005845 | mRNA cap binding complex(GO:0005845) |
| 0.2 | 1.0 | GO:0045272 | plasma membrane respiratory chain complex I(GO:0045272) |
| 0.2 | 4.5 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.2 | 7.0 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.2 | 11.5 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.2 | 0.3 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.1 | 0.3 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 7.3 | GO:0031430 | M band(GO:0031430) |
| 0.1 | 0.4 | GO:0039714 | viral factory(GO:0039713) cytoplasmic viral factory(GO:0039714) host cell viral assembly compartment(GO:0072517) |
| 0.1 | 1.0 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 0.7 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 0.8 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.1 | 1.8 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.1 | 1.3 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.1 | 1.0 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.1 | 3.6 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.1 | 0.8 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
| 0.1 | 0.3 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.1 | 2.0 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 0.7 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.1 | 0.5 | GO:0070985 | TFIIK complex(GO:0070985) |
| 0.1 | 3.2 | GO:0031672 | A band(GO:0031672) |
| 0.1 | 1.2 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.1 | 0.9 | GO:0030891 | VCB complex(GO:0030891) |
| 0.1 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
| 0.1 | 4.8 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.1 | 1.4 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.1 | 1.4 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.1 | 2.9 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.1 | 1.0 | GO:0071547 | piP-body(GO:0071547) |
| 0.1 | 1.6 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 0.3 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 0.1 | 7.2 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 0.5 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.1 | 5.1 | GO:0030118 | clathrin coat(GO:0030118) |
| 0.1 | 0.5 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.1 | 4.9 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.1 | 0.3 | GO:0005715 | late recombination nodule(GO:0005715) |
| 0.1 | 0.4 | GO:1990745 | EARP complex(GO:1990745) |
| 0.1 | 1.9 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 0.7 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.1 | 0.6 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.1 | 2.5 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.1 | 0.8 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.1 | 1.7 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.1 | 7.7 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
| 0.1 | 0.3 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.1 | 1.2 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.1 | 0.7 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.1 | 3.2 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.1 | 0.3 | GO:0097444 | spine apparatus(GO:0097444) |
| 0.1 | 2.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.1 | 5.2 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.1 | 2.0 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.1 | 1.4 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 1.9 | GO:0016342 | catenin complex(GO:0016342) |
| 0.1 | 1.8 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.3 | GO:0042025 | host cell nucleus(GO:0042025) |
| 0.1 | 2.4 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 0.2 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
| 0.1 | 1.4 | GO:0045179 | apical cortex(GO:0045179) |
| 0.1 | 0.9 | GO:0016013 | syntrophin complex(GO:0016013) |
| 0.1 | 0.5 | GO:0033176 | proton-transporting V-type ATPase complex(GO:0033176) |
| 0.1 | 0.6 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.1 | 0.8 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.1 | 0.2 | GO:0005953 | CAAX-protein geranylgeranyltransferase complex(GO:0005953) |
| 0.1 | 1.6 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.1 | 3.9 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.1 | 27.7 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.1 | 3.3 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.1 | 0.7 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.1 | 0.2 | GO:0031372 | UBC13-MMS2 complex(GO:0031372) |
| 0.1 | 0.6 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.1 | 1.8 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 0.3 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.9 | GO:0070938 | contractile ring(GO:0070938) |
| 0.1 | 1.1 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.1 | 0.6 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.1 | 1.0 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.1 | 0.3 | GO:1990796 | photoreceptor cell terminal bouton(GO:1990796) |
| 0.1 | 1.0 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 0.6 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 0.8 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.1 | 0.5 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.1 | 0.3 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
| 0.1 | 0.3 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.1 | 0.5 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 3.7 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.1 | 0.3 | GO:0030427 | site of polarized growth(GO:0030427) |
| 0.1 | 0.5 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 0.3 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.1 | 1.5 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.1 | 2.0 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.1 | 0.2 | GO:0016035 | zeta DNA polymerase complex(GO:0016035) |
| 0.1 | 0.6 | GO:0005901 | caveola(GO:0005901) |
| 0.1 | 2.0 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.1 | 0.3 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.1 | 3.2 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.1 | 1.7 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.1 | 0.4 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.8 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.4 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 2.5 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 1.6 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.4 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 1.8 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.2 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.0 | 12.9 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 0.1 | GO:0034518 | RNA cap binding complex(GO:0034518) |
| 0.0 | 3.0 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.0 | 0.5 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.4 | GO:0043190 | ATP-binding cassette (ABC) transporter complex(GO:0043190) |
| 0.0 | 3.3 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.0 | 0.3 | GO:0097013 | phagocytic vesicle lumen(GO:0097013) |
| 0.0 | 7.6 | GO:0031902 | late endosome membrane(GO:0031902) |
| 0.0 | 0.4 | GO:0044754 | autolysosome(GO:0044754) |
| 0.0 | 0.7 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 1.0 | GO:0005861 | troponin complex(GO:0005861) |
| 0.0 | 0.3 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.3 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.0 | 0.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.0 | 1.0 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 3.7 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.4 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 0.8 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.0 | 0.3 | GO:0001740 | Barr body(GO:0001740) |
| 0.0 | 1.4 | GO:0071437 | invadopodium(GO:0071437) |
| 0.0 | 0.8 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 1.2 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 3.7 | GO:0030658 | transport vesicle membrane(GO:0030658) |
| 0.0 | 0.1 | GO:0031906 | late endosome lumen(GO:0031906) |
| 0.0 | 0.3 | GO:0033270 | paranode region of axon(GO:0033270) |
| 0.0 | 0.7 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.3 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.0 | 0.1 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
| 0.0 | 0.5 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 4.2 | GO:0043204 | perikaryon(GO:0043204) |
| 0.0 | 1.3 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 1.2 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.6 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.0 | 0.2 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
| 0.0 | 3.7 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 1.3 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.0 | 0.2 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.4 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 0.1 | GO:0036513 | Derlin-1-VIMP complex(GO:0036502) Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 1.7 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.5 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.3 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 5.5 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.5 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.0 | 0.4 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 1.3 | GO:0030684 | preribosome(GO:0030684) |
| 0.0 | 1.6 | GO:0043197 | dendritic spine(GO:0043197) |
| 0.0 | 0.8 | GO:0043195 | terminal bouton(GO:0043195) |
| 0.0 | 0.4 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.3 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 3.4 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 0.3 | GO:0005840 | ribosome(GO:0005840) |
| 0.0 | 0.2 | GO:0097125 | cyclin B1-CDK1 complex(GO:0097125) |
| 0.0 | 0.7 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.0 | 0.4 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.0 | 0.6 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 5.2 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.0 | 1.1 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 2.4 | GO:0101003 | ficolin-1-rich granule membrane(GO:0101003) |
| 0.0 | 1.7 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 1.1 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.2 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.3 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.4 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.1 | GO:1990876 | cytoplasmic side of nuclear pore(GO:1990876) |
| 0.0 | 0.1 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.6 | GO:0035267 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.0 | 0.4 | GO:0005770 | late endosome(GO:0005770) |
| 0.0 | 0.3 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 9.1 | GO:0043025 | neuronal cell body(GO:0043025) |
| 0.0 | 0.5 | GO:0031011 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.0 | 2.1 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
| 0.0 | 0.3 | GO:0097504 | SMN-Sm protein complex(GO:0034719) Gemini of coiled bodies(GO:0097504) |
| 0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.4 | GO:0098852 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
| 0.0 | 0.6 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.8 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.0 | 0.8 | GO:0016528 | sarcoplasm(GO:0016528) |
| 0.0 | 0.2 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.0 | 1.1 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.8 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 3.5 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 0.1 | GO:0031213 | RSF complex(GO:0031213) |
| 0.0 | 0.5 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.3 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.4 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) ripoptosome(GO:0097342) |
| 0.0 | 0.2 | GO:0044297 | cell body(GO:0044297) |
| 0.0 | 6.7 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
| 0.0 | 1.5 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.0 | 0.2 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.0 | 0.4 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 0.4 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 10.7 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.3 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 0.5 | GO:0002080 | acrosomal membrane(GO:0002080) |
| 0.0 | 0.3 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
| 0.0 | 1.6 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 0.4 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.5 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.2 | GO:0034704 | calcium channel complex(GO:0034704) |
| 0.0 | 2.7 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 1.4 | GO:0030425 | dendrite(GO:0030425) |
| 0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.4 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 0.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 6.4 | GO:0045202 | synapse(GO:0045202) |
| 0.0 | 0.8 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 1.7 | GO:0005875 | microtubule associated complex(GO:0005875) |
| 0.0 | 0.3 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.0 | 0.3 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.1 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 7.8 | GO:0000139 | Golgi membrane(GO:0000139) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 6.1 | GO:0016211 | glutamate-ammonia ligase activity(GO:0004356) ammonia ligase activity(GO:0016211) acid-ammonia (or amide) ligase activity(GO:0016880) |
| 1.1 | 5.6 | GO:0010465 | nerve growth factor receptor activity(GO:0010465) |
| 0.9 | 4.3 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.8 | 2.3 | GO:0016534 | cyclin-dependent protein kinase 5 activator activity(GO:0016534) |
| 0.7 | 0.7 | GO:0005272 | sodium channel activity(GO:0005272) |
| 0.7 | 2.9 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 0.7 | 22.0 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.7 | 2.0 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.6 | 1.9 | GO:0004618 | phosphoglycerate kinase activity(GO:0004618) |
| 0.6 | 1.9 | GO:0031862 | prostanoid receptor binding(GO:0031862) |
| 0.6 | 2.5 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 0.6 | 5.3 | GO:0017018 | myosin phosphatase activity(GO:0017018) |
| 0.5 | 1.6 | GO:0005135 | erythropoietin receptor binding(GO:0005128) interleukin-3 receptor binding(GO:0005135) |
| 0.5 | 7.2 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.5 | 2.5 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.5 | 1.5 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.5 | 3.5 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.5 | 3.0 | GO:1903135 | cupric ion binding(GO:1903135) |
| 0.5 | 4.4 | GO:0042835 | BRE binding(GO:0042835) |
| 0.5 | 3.0 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.5 | 1.9 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.5 | 6.9 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.4 | 1.3 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.4 | 1.3 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.4 | 1.7 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.4 | 1.7 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.4 | 1.2 | GO:0017130 | poly(C) RNA binding(GO:0017130) |
| 0.4 | 1.2 | GO:0016964 | alpha-2 macroglobulin receptor activity(GO:0016964) |
| 0.4 | 1.2 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
| 0.4 | 1.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.4 | 1.9 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.4 | 1.1 | GO:0005365 | myo-inositol transmembrane transporter activity(GO:0005365) |
| 0.4 | 9.3 | GO:0031432 | titin binding(GO:0031432) |
| 0.4 | 1.8 | GO:0004419 | hydroxymethylglutaryl-CoA lyase activity(GO:0004419) |
| 0.4 | 3.2 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.3 | 1.4 | GO:0016263 | glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase activity(GO:0016263) |
| 0.3 | 1.0 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 0.3 | 1.0 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) |
| 0.3 | 1.9 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.3 | 1.0 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.3 | 1.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.3 | 1.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.3 | 2.1 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
| 0.3 | 2.4 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.3 | 1.5 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.3 | 2.7 | GO:0038051 | glucocorticoid receptor activity(GO:0004883) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.3 | 1.8 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
| 0.3 | 1.4 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.3 | 3.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.3 | 2.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.3 | 1.3 | GO:0052839 | inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.3 | 1.3 | GO:0052798 | beta-galactoside alpha-2,3-sialyltransferase activity(GO:0052798) |
| 0.3 | 8.9 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.3 | 1.6 | GO:0022897 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.3 | 1.0 | GO:0070012 | oligopeptidase activity(GO:0070012) |
| 0.3 | 1.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.3 | 0.8 | GO:0015275 | stretch-activated, cation-selective, calcium channel activity(GO:0015275) |
| 0.3 | 1.0 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
| 0.3 | 1.5 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 0.3 | 1.0 | GO:0008424 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.3 | 1.8 | GO:0047820 | D-glutamate cyclase activity(GO:0047820) |
| 0.3 | 8.8 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.2 | 2.9 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.2 | 4.6 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.2 | 2.6 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.2 | 2.2 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.2 | 4.8 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.2 | 1.0 | GO:0016005 | phospholipase A2 activator activity(GO:0016005) |
| 0.2 | 0.7 | GO:0036313 | phosphatidylinositol 3-kinase catalytic subunit binding(GO:0036313) |
| 0.2 | 0.9 | GO:0030226 | apolipoprotein receptor activity(GO:0030226) |
| 0.2 | 1.8 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) C-palmitoyltransferase activity(GO:0016454) |
| 0.2 | 0.7 | GO:0030272 | 5-formyltetrahydrofolate cyclo-ligase activity(GO:0030272) |
| 0.2 | 0.4 | GO:0032396 | HLA-B specific inhibitory MHC class I receptor activity(GO:0030109) inhibitory MHC class I receptor activity(GO:0032396) |
| 0.2 | 7.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.2 | 3.5 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.2 | 1.7 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.2 | 1.1 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.2 | 1.1 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.2 | 1.2 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.2 | 0.8 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.2 | 0.6 | GO:0036009 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.2 | 1.6 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.2 | 1.0 | GO:0008466 | glycogenin glucosyltransferase activity(GO:0008466) |
| 0.2 | 2.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.2 | 0.8 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.2 | 1.7 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.2 | 2.1 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.2 | 0.4 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.2 | 0.5 | GO:0004827 | glutamate-tRNA ligase activity(GO:0004818) proline-tRNA ligase activity(GO:0004827) |
| 0.2 | 4.7 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.2 | 2.0 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.2 | 1.8 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.2 | 1.4 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.2 | 1.6 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.2 | 0.9 | GO:0008267 | poly-glutamine tract binding(GO:0008267) |
| 0.2 | 1.7 | GO:1903136 | cuprous ion binding(GO:1903136) |
| 0.2 | 1.0 | GO:0044736 | acid-sensing ion channel activity(GO:0044736) |
| 0.2 | 5.1 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.2 | 1.4 | GO:0001517 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) |
| 0.2 | 2.0 | GO:0071253 | connexin binding(GO:0071253) |
| 0.2 | 5.6 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.2 | 0.7 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.2 | 0.5 | GO:0004342 | glucosamine-6-phosphate deaminase activity(GO:0004342) |
| 0.2 | 0.6 | GO:0004057 | arginyltransferase activity(GO:0004057) |
| 0.2 | 2.8 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.2 | 0.5 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.2 | 0.8 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.2 | 0.8 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.2 | 1.5 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.2 | 0.8 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.1 | 0.9 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 1.0 | GO:0023030 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.1 | 0.7 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.1 | 0.6 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.1 | 5.9 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 1.0 | GO:0099580 | ion antiporter activity involved in regulation of postsynaptic membrane potential(GO:0099580) |
| 0.1 | 8.1 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.1 | 1.8 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 0.4 | GO:0001147 | transcription termination site sequence-specific DNA binding(GO:0001147) transcription termination site DNA binding(GO:0001160) |
| 0.1 | 0.5 | GO:0019862 | IgA binding(GO:0019862) |
| 0.1 | 1.1 | GO:0052723 | inositol-1,3,4,5,6-pentakisphosphate kinase activity(GO:0000827) inositol hexakisphosphate kinase activity(GO:0000828) inositol heptakisphosphate kinase activity(GO:0000829) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 0.9 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.1 | 0.7 | GO:1904408 | dihydronicotinamide riboside quinone reductase activity(GO:0001512) melatonin binding(GO:1904408) |
| 0.1 | 1.4 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.5 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.1 | 0.5 | GO:0004040 | amidase activity(GO:0004040) |
| 0.1 | 3.2 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
| 0.1 | 0.1 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 0.1 | 1.4 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 0.4 | GO:0033878 | hormone-sensitive lipase activity(GO:0033878) |
| 0.1 | 0.8 | GO:0004830 | tryptophan-tRNA ligase activity(GO:0004830) |
| 0.1 | 0.4 | GO:0038100 | nodal binding(GO:0038100) |
| 0.1 | 0.9 | GO:0051748 | UTP:glucose-1-phosphate uridylyltransferase activity(GO:0003983) UTP-monosaccharide-1-phosphate uridylyltransferase activity(GO:0051748) |
| 0.1 | 0.4 | GO:0004823 | leucine-tRNA ligase activity(GO:0004823) |
| 0.1 | 1.0 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.1 | 0.5 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 0.1 | 1.6 | GO:0043176 | amine binding(GO:0043176) serotonin binding(GO:0051378) |
| 0.1 | 0.6 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.1 | 0.4 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 12.3 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.1 | 0.6 | GO:0016453 | C-acetyltransferase activity(GO:0016453) |
| 0.1 | 3.0 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.1 | 0.2 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.1 | 0.6 | GO:0004572 | mannosyl-oligosaccharide 1,3-1,6-alpha-mannosidase activity(GO:0004572) |
| 0.1 | 1.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.3 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.1 | 0.6 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.1 | 0.6 | GO:0004815 | aspartate-tRNA ligase activity(GO:0004815) |
| 0.1 | 0.9 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.1 | 0.3 | GO:0019948 | SUMO activating enzyme activity(GO:0019948) |
| 0.1 | 0.3 | GO:0004155 | 6,7-dihydropteridine reductase activity(GO:0004155) |
| 0.1 | 0.7 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 0.7 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.1 | 0.4 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.1 | 1.0 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 0.4 | GO:0004102 | choline O-acetyltransferase activity(GO:0004102) |
| 0.1 | 0.4 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.1 | 1.2 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.9 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.1 | 0.8 | GO:0050682 | AF-2 domain binding(GO:0050682) |
| 0.1 | 0.4 | GO:0042954 | lipoprotein transporter activity(GO:0042954) |
| 0.1 | 1.0 | GO:0048039 | ubiquinone binding(GO:0048039) |
| 0.1 | 0.4 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.1 | 0.8 | GO:0004672 | protein kinase activity(GO:0004672) |
| 0.1 | 4.8 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.1 | 0.3 | GO:0008511 | sodium:potassium:chloride symporter activity(GO:0008511) |
| 0.1 | 0.3 | GO:0005169 | neurotrophin TRKB receptor binding(GO:0005169) |
| 0.1 | 4.1 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 0.9 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.1 | 0.3 | GO:0003870 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.1 | 0.3 | GO:0000384 | first spliceosomal transesterification activity(GO:0000384) |
| 0.1 | 1.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.4 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.1 | 0.3 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.1 | 0.7 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 1.6 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.1 | 0.3 | GO:0004803 | transposase activity(GO:0004803) |
| 0.1 | 2.4 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
| 0.1 | 1.2 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.1 | 5.7 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.1 | 2.7 | GO:0019992 | diacylglycerol binding(GO:0019992) |
| 0.1 | 0.7 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.1 | 0.6 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.5 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
| 0.1 | 2.7 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.1 | 3.0 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.1 | 0.8 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 0.6 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.1 | 1.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 6.0 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
| 0.1 | 0.7 | GO:0019158 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.1 | 0.4 | GO:0070905 | serine binding(GO:0070905) |
| 0.1 | 0.3 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) |
| 0.1 | 1.0 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.1 | 4.3 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
| 0.1 | 2.9 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.1 | 0.6 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.2 | GO:0071566 | UFM1 activating enzyme activity(GO:0071566) |
| 0.1 | 0.4 | GO:0050659 | N-acetylgalactosamine 4-sulfate 6-O-sulfotransferase activity(GO:0050659) |
| 0.1 | 2.1 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 0.5 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
| 0.1 | 1.0 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 0.2 | GO:0031762 | alpha-1A adrenergic receptor binding(GO:0031691) follicle-stimulating hormone receptor binding(GO:0031762) |
| 0.1 | 1.4 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.1 | 0.5 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.1 | 1.0 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.1 | 0.2 | GO:0004662 | CAAX-protein geranylgeranyltransferase activity(GO:0004662) |
| 0.1 | 0.4 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.1 | 1.4 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 2.0 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.1 | 1.8 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.1 | 3.0 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.1 | 1.8 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.3 | GO:0004074 | biliverdin reductase activity(GO:0004074) |
| 0.1 | 0.6 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
| 0.1 | 0.7 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.1 | 1.2 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.1 | 0.4 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.1 | 1.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.1 | 0.6 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.1 | 0.6 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 0.6 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
| 0.1 | 0.8 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
| 0.1 | 3.4 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
| 0.1 | 1.9 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 0.9 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.1 | 0.1 | GO:0004935 | adrenergic receptor activity(GO:0004935) |
| 0.1 | 2.7 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.1 | 0.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 0.3 | GO:0017095 | heparan sulfate 6-O-sulfotransferase activity(GO:0017095) |
| 0.1 | 0.8 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.1 | 3.3 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.1 | 0.3 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.1 | 1.2 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.1 | 0.5 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.6 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 0.3 | GO:0033558 | histone deacetylase activity(GO:0004407) protein deacetylase activity(GO:0033558) |
| 0.1 | 1.5 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.1 | 0.6 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 0.7 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.1 | 2.1 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.1 | 0.3 | GO:0003963 | RNA-3'-phosphate cyclase activity(GO:0003963) |
| 0.1 | 0.5 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.1 | 1.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 1.4 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.1 | 0.4 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 3.3 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.1 | 0.9 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.1 | 0.4 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
| 0.1 | 2.4 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 0.2 | GO:0030305 | beta-glucuronidase activity(GO:0004566) heparanase activity(GO:0030305) |
| 0.1 | 0.8 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 2.0 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.1 | 4.7 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.1 | 0.7 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.1 | 0.3 | GO:0015198 | oligopeptide transporter activity(GO:0015198) oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.1 | 2.7 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.1 | 0.2 | GO:0016499 | orexin receptor activity(GO:0016499) |
| 0.1 | 1.0 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.1 | 0.1 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
| 0.1 | 0.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.1 | 0.2 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.1 | 20.7 | GO:0008017 | microtubule binding(GO:0008017) |
| 0.1 | 0.2 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.1 | 0.4 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.1 | 1.4 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.1 | 0.2 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
| 0.1 | 0.6 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.1 | 0.4 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.2 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.0 | 1.1 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 1.0 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 1.2 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.2 | GO:0010736 | serum response element binding(GO:0010736) |
| 0.0 | 0.7 | GO:0035240 | dopamine binding(GO:0035240) |
| 0.0 | 2.6 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.1 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
| 0.0 | 0.2 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.0 | 0.4 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.0 | 4.0 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.0 | 0.2 | GO:0003943 | N-acetylgalactosamine-4-sulfatase activity(GO:0003943) |
| 0.0 | 0.4 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 0.7 | GO:0015386 | potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.8 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.0 | 0.4 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.0 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.1 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.0 | 1.8 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 3.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 5.0 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.0 | 0.6 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 1.4 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.2 | GO:0003875 | ADP-ribosylarginine hydrolase activity(GO:0003875) |
| 0.0 | 0.7 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.0 | 1.4 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.3 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.0 | 4.3 | GO:0005254 | chloride channel activity(GO:0005254) |
| 0.0 | 0.6 | GO:0015278 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 0.0 | 1.6 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.7 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.0 | 0.6 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.0 | 0.7 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 1.6 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.2 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.0 | 0.4 | GO:0070915 | lysophosphatidic acid binding(GO:0035727) lysophosphatidic acid receptor activity(GO:0070915) |
| 0.0 | 0.5 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.2 | GO:0061575 | cyclin-dependent protein serine/threonine kinase activator activity(GO:0061575) |
| 0.0 | 0.6 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.0 | 0.2 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
| 0.0 | 1.6 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) |
| 0.0 | 0.6 | GO:0016887 | ATPase activity(GO:0016887) |
| 0.0 | 0.3 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.0 | 7.0 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.6 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) ADP transmembrane transporter activity(GO:0015217) |
| 0.0 | 1.1 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.4 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.1 | GO:0038131 | neuregulin receptor activity(GO:0038131) |
| 0.0 | 0.4 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.0 | 0.2 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 1.2 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
| 0.0 | 0.2 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.8 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 3.6 | GO:0031072 | heat shock protein binding(GO:0031072) |
| 0.0 | 1.1 | GO:0042171 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) lysophosphatidic acid acyltransferase activity(GO:0042171) lysophospholipid acyltransferase activity(GO:0071617) |
| 0.0 | 0.5 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.0 | 0.8 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 1.0 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.6 | GO:0001087 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
| 0.0 | 0.9 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.3 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.0 | 7.4 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.3 | GO:0003960 | NADPH:quinone reductase activity(GO:0003960) |
| 0.0 | 0.4 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 0.2 | GO:0001641 | group II metabotropic glutamate receptor activity(GO:0001641) |
| 0.0 | 0.2 | GO:0008048 | calcium sensitive guanylate cyclase activator activity(GO:0008048) |
| 0.0 | 1.4 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.0 | 1.7 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.0 | 0.2 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.0 | 0.1 | GO:0004348 | glucosylceramidase activity(GO:0004348) |
| 0.0 | 0.3 | GO:0050543 | icosatetraenoic acid binding(GO:0050543) |
| 0.0 | 0.2 | GO:0052840 | endopolyphosphatase activity(GO:0000298) diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) bis(5'-adenosyl)-hexaphosphatase activity(GO:0034431) bis(5'-adenosyl)-pentaphosphatase activity(GO:0034432) inositol diphosphate tetrakisphosphate diphosphatase activity(GO:0052840) inositol bisdiphosphate tetrakisphosphate diphosphatase activity(GO:0052841) inositol diphosphate pentakisphosphate diphosphatase activity(GO:0052842) inositol-1-diphosphate-2,3,4,5,6-pentakisphosphate diphosphatase activity(GO:0052843) inositol-3-diphosphate-1,2,4,5,6-pentakisphosphate diphosphatase activity(GO:0052844) inositol-5-diphosphate-1,2,3,4,6-pentakisphosphate diphosphatase activity(GO:0052845) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 1-diphosphatase activity(GO:0052846) inositol-1,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052847) inositol-3,5-bisdiphosphate-2,3,4,6-tetrakisphosphate 5-diphosphatase activity(GO:0052848) |
| 0.0 | 3.6 | GO:0044325 | ion channel binding(GO:0044325) |
| 0.0 | 0.4 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.3 | GO:0004117 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) |
| 0.0 | 0.7 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.5 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 1.1 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.0 | 0.6 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.0 | 0.3 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.2 | GO:0030884 | lipid antigen binding(GO:0030882) endogenous lipid antigen binding(GO:0030883) exogenous lipid antigen binding(GO:0030884) |
| 0.0 | 0.9 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.4 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 0.0 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 1.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.4 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 10.5 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.0 | 0.2 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.5 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
| 0.0 | 0.2 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.0 | 0.3 | GO:0070735 | protein-glycine ligase activity(GO:0070735) |
| 0.0 | 0.6 | GO:0030674 | protein binding, bridging(GO:0030674) |
| 0.0 | 0.5 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.2 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) |
| 0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 0.2 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.9 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.0 | 0.2 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.5 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.4 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.0 | 0.7 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) |
| 0.0 | 0.8 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.3 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.3 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.5 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.7 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.4 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.5 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.0 | 1.4 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.0 | 1.7 | GO:0008081 | phosphoric diester hydrolase activity(GO:0008081) |
| 0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 0.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.0 | 0.1 | GO:0045518 | interleukin-22 receptor binding(GO:0045518) |
| 0.0 | 0.1 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
| 0.0 | 0.4 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.2 | GO:0030618 | transforming growth factor beta receptor, pathway-specific cytoplasmic mediator activity(GO:0030618) |
| 0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.5 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.3 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.0 | 0.2 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.0 | 1.6 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.0 | 0.2 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 1.3 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.0 | 0.2 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.2 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.2 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.2 | GO:0005158 | insulin receptor binding(GO:0005158) |
| 0.0 | 1.4 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
| 0.0 | 9.3 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
| 0.0 | 0.4 | GO:0042623 | ATPase activity, coupled(GO:0042623) |
| 0.0 | 0.7 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.3 | GO:1901682 | sulfur compound transmembrane transporter activity(GO:1901682) |
| 0.0 | 2.1 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.2 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.0 | 0.2 | GO:0048019 | receptor antagonist activity(GO:0048019) |
| 0.0 | 0.1 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.6 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.8 | GO:0047485 | protein N-terminus binding(GO:0047485) |
| 0.0 | 0.5 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
| 0.0 | 0.7 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.1 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.5 | GO:0004553 | hydrolase activity, hydrolyzing O-glycosyl compounds(GO:0004553) |
| 0.0 | 0.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.9 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
| 0.0 | 0.1 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 0.6 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 0.2 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.7 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.0 | 0.8 | GO:0005198 | structural molecule activity(GO:0005198) |
| 0.0 | 0.0 | GO:1901375 | acetylcholine transmembrane transporter activity(GO:0005277) acetate ester transmembrane transporter activity(GO:1901375) |
| 0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.1 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.0 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.1 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.0 | 0.2 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.0 | 0.1 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.0 | 0.2 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.0 | 0.3 | GO:0019198 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) transmembrane receptor protein phosphatase activity(GO:0019198) |
Gene overrepresentation in curated gene sets: canonical pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 0.4 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.3 | 0.3 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.2 | 0.6 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.2 | 7.0 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.2 | 5.2 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.2 | 12.5 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.2 | 3.5 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 2.4 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 0.8 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.1 | 5.3 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.1 | 6.8 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.1 | 4.8 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.1 | 8.9 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 6.0 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.1 | 4.8 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.1 | 4.6 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 0.6 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.1 | 6.9 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 1.9 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 10.6 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.1 | 2.8 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.1 | 1.5 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 1.4 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.1 | 2.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.1 | 1.9 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.1 | 3.9 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 2.3 | PID FOXO PATHWAY | FoxO family signaling |
| 0.1 | 0.9 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 3.7 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.1 | 2.4 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.1 | 3.4 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 1.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 2.2 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.0 | 1.8 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 0.3 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 1.5 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 2.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.9 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.0 | 2.1 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 5.0 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 2.1 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 2.8 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 1.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 1.8 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.3 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 2.7 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.0 | 0.9 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.5 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 1.4 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.3 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.0 | 0.6 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 2.7 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 1.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.2 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 1.4 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 1.3 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 1.0 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.0 | 0.5 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.5 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.2 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 1.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.0 | 1.1 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.3 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.7 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.0 | 0.5 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.5 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.3 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 1.8 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.5 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 1.4 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.4 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 0.2 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.6 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.9 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.8 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.0 | 0.9 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 0.3 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.5 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.3 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
Gene overrepresentation in curated gene sets: REACTOME pathways category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 19.8 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.3 | 6.2 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.3 | 10.4 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.2 | 6.4 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.2 | 7.3 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.2 | 6.8 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.2 | 9.3 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.2 | 0.9 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.2 | 10.6 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.2 | 8.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.1 | 2.3 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.1 | 2.9 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 4.1 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.1 | 4.7 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 6.9 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.1 | 3.7 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.1 | 5.6 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
| 0.1 | 3.8 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.1 | 4.7 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.1 | 4.3 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.1 | 1.0 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.1 | 1.9 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.1 | 2.5 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.1 | 1.8 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.1 | 3.6 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.1 | 1.8 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.1 | 3.8 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.1 | 3.3 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.1 | 1.5 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 0.4 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.1 | 1.9 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
| 0.1 | 2.9 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 0.4 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.1 | 2.4 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 6.0 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.1 | 1.6 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 1.7 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 9.3 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.1 | 3.5 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.1 | 0.8 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 1.5 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.1 | 4.4 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.1 | 0.6 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 0.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 1.8 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.1 | 1.3 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.1 | 8.5 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.1 | 1.0 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.1 | 0.4 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.1 | 1.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 3.4 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 1.4 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 3.5 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 0.4 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 1.2 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.0 | 1.8 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.9 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.7 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.5 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.0 | 0.9 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 1.0 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 2.2 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 13.5 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 1.2 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.5 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 1.6 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 4.5 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.0 | 1.6 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.0 | 1.4 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.7 | REACTOME PI3K EVENTS IN ERBB2 SIGNALING | Genes involved in PI3K events in ERBB2 signaling |
| 0.0 | 0.3 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.0 | 1.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 1.5 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 3.0 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 1.0 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 1.3 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.6 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.4 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.6 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.0 | 1.7 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.7 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 5.2 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.2 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.0 | 3.8 | REACTOME TRANSMISSION ACROSS CHEMICAL SYNAPSES | Genes involved in Transmission across Chemical Synapses |
| 0.0 | 0.1 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 0.5 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.4 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.0 | 0.4 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.0 | 0.5 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.6 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 1.1 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
| 0.0 | 0.8 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.5 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 4.0 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.6 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.8 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.9 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 1.3 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 4.4 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.3 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.0 | 0.4 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.5 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.2 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.7 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
| 0.0 | 0.2 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.6 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.0 | 0.6 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.5 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.0 | 1.8 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.0 | 0.5 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.0 | 0.1 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
| 0.0 | 0.2 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 0.9 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.3 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 0.3 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.2 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.9 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.3 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.0 | 0.2 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.0 | 0.7 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
| 0.0 | 1.4 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.3 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |