Illumina Body Map 2, young vs old
| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
NRF1
|
ENSG00000106459.10 | nuclear respiratory factor 1 |
| Gene | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| NRF1 | hg19_v2_chr7_+_129251531_129251601 | -0.00 | 9.9e-01 | Click! |
| Promoter | Log-likelihood | Transcript | Gene | Gene Info |
|---|---|---|---|---|
| chr19_-_46405861 | 6.44 |
ENST00000322217.5
|
MYPOP
|
Myb-related transcription factor, partner of profilin |
| chr1_+_231473990 | 5.78 |
ENST00000008440.9
|
SPRTN
|
SprT-like N-terminal domain |
| chr6_+_30614886 | 5.51 |
ENST00000376471.4
|
C6orf136
|
chromosome 6 open reading frame 136 |
| chr6_+_30615167 | 5.26 |
ENST00000446773.2
|
C6orf136
|
chromosome 6 open reading frame 136 |
| chr12_-_48551247 | 4.80 |
ENST00000540212.1
ENST00000539528.1 ENST00000536071.1 ENST00000545791.1 |
ASB8
|
ankyrin repeat and SOCS box containing 8 |
| chr19_-_50432711 | 4.65 |
ENST00000597723.1
ENST00000599788.1 ENST00000596217.1 ENST00000593652.1 ENST00000599567.1 ENST00000600935.1 ENST00000596011.1 ENST00000596022.1 ENST00000597295.1 |
NUP62
IL4I1
|
nucleoporin 62kDa interleukin 4 induced 1 |
| chr1_+_231473743 | 4.53 |
ENST00000295050.7
|
SPRTN
|
SprT-like N-terminal domain |
| chr6_+_30614779 | 4.50 |
ENST00000293604.6
ENST00000376473.5 |
C6orf136
|
chromosome 6 open reading frame 136 |
| chr6_+_24403144 | 4.37 |
ENST00000274747.7
ENST00000543597.1 ENST00000535061.1 ENST00000378353.1 ENST00000378386.3 ENST00000443868.2 |
MRS2
|
MRS2 magnesium transporter |
| chr12_-_48551336 | 4.36 |
ENST00000540782.1
|
ASB8
|
ankyrin repeat and SOCS box containing 8 |
| chr5_+_218356 | 4.36 |
ENST00000264932.6
ENST00000504309.1 ENST00000510361.1 |
SDHA
|
succinate dehydrogenase complex, subunit A, flavoprotein (Fp) |
| chr11_-_59436453 | 4.36 |
ENST00000300146.9
|
PATL1
|
protein associated with topoisomerase II homolog 1 (yeast) |
| chr19_-_50432654 | 4.35 |
ENST00000596680.1
ENST00000594673.1 ENST00000597029.1 |
NUP62
|
nucleoporin 62kDa |
| chr6_-_33679452 | 4.24 |
ENST00000374231.4
ENST00000607484.1 ENST00000374214.3 |
UQCC2
|
ubiquinol-cytochrome c reductase complex assembly factor 2 |
| chr7_-_44365216 | 4.21 |
ENST00000358707.3
ENST00000457475.1 ENST00000440254.2 |
CAMK2B
|
calcium/calmodulin-dependent protein kinase II beta |
| chr1_-_231473578 | 4.18 |
ENST00000360394.2
ENST00000366645.1 |
EXOC8
|
exocyst complex component 8 |
| chr1_-_202858227 | 4.12 |
ENST00000367262.3
|
RABIF
|
RAB interacting factor |
| chr17_+_260097 | 4.06 |
ENST00000360127.6
ENST00000571106.1 ENST00000491373.1 |
C17orf97
|
chromosome 17 open reading frame 97 |
| chr19_-_50432782 | 3.94 |
ENST00000413454.1
ENST00000596437.1 ENST00000341114.3 ENST00000595948.1 |
NUP62
IL4I1
|
nucleoporin 62kDa interleukin 4 induced 1 |
| chr12_-_48551366 | 3.93 |
ENST00000535988.1
ENST00000536953.1 ENST00000535055.1 ENST00000317697.3 ENST00000536549.1 |
ASB8
|
ankyrin repeat and SOCS box containing 8 |
| chr16_+_50099852 | 3.86 |
ENST00000299192.7
ENST00000285767.4 |
HEATR3
|
HEAT repeat containing 3 |
| chr7_-_44365020 | 3.71 |
ENST00000395747.2
ENST00000347193.4 ENST00000346990.4 ENST00000258682.6 ENST00000353625.4 ENST00000421607.1 ENST00000424197.1 ENST00000502837.2 ENST00000350811.3 ENST00000395749.2 |
CAMK2B
|
calcium/calmodulin-dependent protein kinase II beta |
| chr8_+_23104130 | 3.71 |
ENST00000313219.7
ENST00000519984.1 |
CHMP7
|
charged multivesicular body protein 7 |
| chr17_-_28257080 | 3.70 |
ENST00000579954.1
ENST00000540801.1 ENST00000269033.3 ENST00000590153.1 ENST00000582084.1 |
SSH2
|
slingshot protein phosphatase 2 |
| chr20_-_35580104 | 3.66 |
ENST00000373694.5
|
SAMHD1
|
SAM domain and HD domain 1 |
| chr16_+_27214802 | 3.62 |
ENST00000380948.2
ENST00000286096.4 |
KDM8
|
lysine (K)-specific demethylase 8 |
| chr2_-_33824336 | 3.61 |
ENST00000431950.1
ENST00000403368.1 ENST00000441530.2 |
FAM98A
|
family with sequence similarity 98, member A |
| chr1_+_26560676 | 3.57 |
ENST00000451429.2
ENST00000252992.4 |
CEP85
|
centrosomal protein 85kDa |
| chr3_+_120315149 | 3.44 |
ENST00000184266.2
|
NDUFB4
|
NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 4, 15kDa |
| chr19_-_40791160 | 3.40 |
ENST00000358335.5
|
AKT2
|
v-akt murine thymoma viral oncogene homolog 2 |
| chr3_+_44379944 | 3.38 |
ENST00000396078.3
ENST00000342649.4 |
TCAIM
|
T cell activation inhibitor, mitochondrial |
| chr19_+_19144666 | 3.37 |
ENST00000535288.1
ENST00000538663.1 |
ARMC6
|
armadillo repeat containing 6 |
| chr20_-_35580240 | 3.35 |
ENST00000262878.4
|
SAMHD1
|
SAM domain and HD domain 1 |
| chr6_+_43543942 | 3.32 |
ENST00000372226.1
ENST00000443535.1 |
POLH
|
polymerase (DNA directed), eta |
| chr11_-_134094420 | 3.30 |
ENST00000526422.1
ENST00000525485.1 |
NCAPD3
|
non-SMC condensin II complex, subunit D3 |
| chr19_+_19144384 | 3.29 |
ENST00000392335.2
ENST00000535612.1 ENST00000537263.1 ENST00000540707.1 ENST00000541725.1 ENST00000269932.6 ENST00000546344.1 ENST00000540792.1 ENST00000536098.1 ENST00000541898.1 ENST00000543877.1 |
ARMC6
|
armadillo repeat containing 6 |
| chr17_+_7387919 | 3.29 |
ENST00000572844.1
|
POLR2A
|
polymerase (RNA) II (DNA directed) polypeptide A, 220kDa |
| chr16_+_28565230 | 3.25 |
ENST00000317058.3
|
CCDC101
|
coiled-coil domain containing 101 |
| chr21_+_47743995 | 3.24 |
ENST00000359568.5
|
PCNT
|
pericentrin |
| chr1_-_47134085 | 3.21 |
ENST00000371937.4
ENST00000574428.1 ENST00000329231.4 |
ATPAF1
|
ATP synthase mitochondrial F1 complex assembly factor 1 |
| chr16_-_188624 | 3.18 |
ENST00000399953.3
|
NPRL3
|
nitrogen permease regulator-like 3 (S. cerevisiae) |
| chr3_+_44379611 | 3.18 |
ENST00000383746.3
ENST00000417237.1 |
TCAIM
|
T cell activation inhibitor, mitochondrial |
| chr6_-_43543702 | 3.17 |
ENST00000265351.7
|
XPO5
|
exportin 5 |
| chr7_+_12250943 | 3.11 |
ENST00000442107.1
|
TMEM106B
|
transmembrane protein 106B |
| chr3_-_135915401 | 3.09 |
ENST00000491050.1
|
MSL2
|
male-specific lethal 2 homolog (Drosophila) |
| chr21_-_38445011 | 3.07 |
ENST00000464265.1
ENST00000399102.1 |
PIGP
|
phosphatidylinositol glycan anchor biosynthesis, class P |
| chr13_-_49107205 | 3.03 |
ENST00000544904.1
ENST00000430805.2 ENST00000544492.1 |
RCBTB2
|
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
| chr3_+_37284824 | 3.02 |
ENST00000431105.1
|
GOLGA4
|
golgin A4 |
| chr19_-_55770311 | 3.02 |
ENST00000412770.2
|
PPP6R1
|
protein phosphatase 6, regulatory subunit 1 |
| chr1_-_47134101 | 2.99 |
ENST00000576409.1
|
ATPAF1
|
ATP synthase mitochondrial F1 complex assembly factor 1 |
| chr3_-_48594248 | 2.98 |
ENST00000545984.1
ENST00000232375.3 ENST00000416568.1 ENST00000383734.2 ENST00000541519.1 ENST00000412035.1 |
PFKFB4
|
6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 4 |
| chr3_+_120315160 | 2.97 |
ENST00000485064.1
ENST00000492739.1 |
NDUFB4
|
NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 4, 15kDa |
| chr9_+_115142217 | 2.96 |
ENST00000398805.3
ENST00000398803.1 ENST00000262542.7 ENST00000539114.1 |
HSDL2
|
hydroxysteroid dehydrogenase like 2 |
| chr6_-_36515177 | 2.94 |
ENST00000229812.7
|
STK38
|
serine/threonine kinase 38 |
| chr16_-_18573396 | 2.92 |
ENST00000543392.1
ENST00000381474.3 ENST00000330537.6 |
NOMO2
|
NODAL modulator 2 |
| chrX_-_129299847 | 2.90 |
ENST00000319908.3
ENST00000287295.3 |
AIFM1
|
apoptosis-inducing factor, mitochondrion-associated, 1 |
| chr13_-_20357110 | 2.89 |
ENST00000427943.1
|
PSPC1
|
paraspeckle component 1 |
| chr9_-_139839064 | 2.88 |
ENST00000325285.3
ENST00000428398.1 |
FBXW5
|
F-box and WD repeat domain containing 5 |
| chr2_+_190526111 | 2.87 |
ENST00000607062.1
ENST00000260952.4 ENST00000425590.1 ENST00000607535.1 ENST00000420250.1 ENST00000606910.1 ENST00000607690.1 ENST00000607829.1 |
ASNSD1
|
asparagine synthetase domain containing 1 |
| chr13_-_49107303 | 2.85 |
ENST00000344532.3
|
RCBTB2
|
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
| chr5_-_96518907 | 2.84 |
ENST00000508447.1
ENST00000283109.3 |
RIOK2
|
RIO kinase 2 |
| chr6_-_35888905 | 2.83 |
ENST00000510290.1
ENST00000423325.2 ENST00000373822.1 |
SRPK1
|
SRSF protein kinase 1 |
| chr7_+_107384579 | 2.82 |
ENST00000222597.2
ENST00000415884.2 |
CBLL1
|
Cbl proto-oncogene-like 1, E3 ubiquitin protein ligase |
| chr8_+_42249346 | 2.81 |
ENST00000392935.3
ENST00000520115.1 ENST00000522069.1 ENST00000522572.1 |
VDAC3
|
voltage-dependent anion channel 3 |
| chr6_-_31619892 | 2.80 |
ENST00000454165.1
ENST00000428326.1 ENST00000452994.1 |
BAG6
|
BCL2-associated athanogene 6 |
| chr17_+_57970469 | 2.80 |
ENST00000443572.2
ENST00000406116.3 ENST00000225577.4 ENST00000393021.3 |
RPS6KB1
|
ribosomal protein S6 kinase, 70kDa, polypeptide 1 |
| chr16_+_16326352 | 2.77 |
ENST00000399336.4
ENST00000263012.6 ENST00000538468.1 |
NOMO3
|
NODAL modulator 3 |
| chr19_-_48867291 | 2.76 |
ENST00000435956.3
|
TMEM143
|
transmembrane protein 143 |
| chr16_-_188600 | 2.75 |
ENST00000399951.3
|
NPRL3
|
nitrogen permease regulator-like 3 (S. cerevisiae) |
| chr8_+_42249418 | 2.73 |
ENST00000521158.1
ENST00000022615.4 |
VDAC3
|
voltage-dependent anion channel 3 |
| chr17_+_43972010 | 2.73 |
ENST00000334239.8
ENST00000446361.3 |
MAPT
|
microtubule-associated protein tau |
| chr10_-_74856608 | 2.72 |
ENST00000307116.2
ENST00000373008.2 ENST00000412021.2 ENST00000394890.2 ENST00000263556.3 ENST00000440381.1 |
P4HA1
|
prolyl 4-hydroxylase, alpha polypeptide I |
| chr21_-_38445470 | 2.70 |
ENST00000399098.1
|
PIGP
|
phosphatidylinositol glycan anchor biosynthesis, class P |
| chr18_-_5295679 | 2.69 |
ENST00000582388.1
|
ZBTB14
|
zinc finger and BTB domain containing 14 |
| chr3_-_135915146 | 2.68 |
ENST00000473093.1
|
MSL2
|
male-specific lethal 2 homolog (Drosophila) |
| chr2_+_103353367 | 2.68 |
ENST00000454536.1
ENST00000409528.1 ENST00000409173.1 |
TMEM182
|
transmembrane protein 182 |
| chr10_-_73611046 | 2.67 |
ENST00000394934.1
ENST00000394936.3 |
PSAP
|
prosaposin |
| chr3_+_52232102 | 2.67 |
ENST00000469224.1
ENST00000394965.2 ENST00000310271.2 ENST00000484952.1 |
ALAS1
|
aminolevulinate, delta-, synthase 1 |
| chr15_-_34629922 | 2.66 |
ENST00000559484.1
ENST00000354181.3 ENST00000558589.1 ENST00000458406.2 |
SLC12A6
|
solute carrier family 12 (potassium/chloride transporter), member 6 |
| chr7_-_44621878 | 2.65 |
ENST00000289577.5
|
TMED4
|
transmembrane emp24 protein transport domain containing 4 |
| chr9_+_79792269 | 2.63 |
ENST00000376634.4
ENST00000376636.3 ENST00000360280.3 |
VPS13A
|
vacuolar protein sorting 13 homolog A (S. cerevisiae) |
| chr5_-_218251 | 2.63 |
ENST00000296824.3
|
CCDC127
|
coiled-coil domain containing 127 |
| chr16_+_8715574 | 2.62 |
ENST00000561758.1
|
METTL22
|
methyltransferase like 22 |
| chr1_+_27561007 | 2.62 |
ENST00000319394.3
|
WDTC1
|
WD and tetratricopeptide repeats 1 |
| chr8_-_141467818 | 2.62 |
ENST00000389327.3
ENST00000438773.2 |
TRAPPC9
|
trafficking protein particle complex 9 |
| chr9_-_124922021 | 2.60 |
ENST00000537618.1
ENST00000373768.3 |
NDUFA8
|
NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 8, 19kDa |
| chr2_-_191885686 | 2.60 |
ENST00000432058.1
|
STAT1
|
signal transducer and activator of transcription 1, 91kDa |
| chr15_-_34630234 | 2.58 |
ENST00000558667.1
ENST00000561120.1 ENST00000559236.1 ENST00000397702.2 |
SLC12A6
|
solute carrier family 12 (potassium/chloride transporter), member 6 |
| chr19_+_42724423 | 2.57 |
ENST00000301215.3
ENST00000597945.1 |
ZNF526
|
zinc finger protein 526 |
| chr5_+_112043186 | 2.57 |
ENST00000509732.1
ENST00000457016.1 ENST00000507379.1 |
APC
|
adenomatous polyposis coli |
| chr17_-_40761375 | 2.56 |
ENST00000543197.1
ENST00000309428.5 |
FAM134C
|
family with sequence similarity 134, member C |
| chr4_+_57845043 | 2.55 |
ENST00000433463.1
ENST00000314595.5 |
POLR2B
|
polymerase (RNA) II (DNA directed) polypeptide B, 140kDa |
| chr15_-_42783303 | 2.54 |
ENST00000565380.1
ENST00000564754.1 |
ZNF106
|
zinc finger protein 106 |
| chr17_+_7210898 | 2.52 |
ENST00000572815.1
|
EIF5A
|
eukaryotic translation initiation factor 5A |
| chr10_+_25305524 | 2.52 |
ENST00000524413.1
ENST00000376356.4 |
THNSL1
|
threonine synthase-like 1 (S. cerevisiae) |
| chr2_-_33824382 | 2.52 |
ENST00000238823.8
|
FAM98A
|
family with sequence similarity 98, member A |
| chr14_+_75230011 | 2.51 |
ENST00000552421.1
ENST00000325680.7 ENST00000238571.3 |
YLPM1
|
YLP motif containing 1 |
| chr4_+_57845024 | 2.50 |
ENST00000431623.2
ENST00000441246.2 |
POLR2B
|
polymerase (RNA) II (DNA directed) polypeptide B, 140kDa |
| chr1_-_176176629 | 2.50 |
ENST00000367669.3
|
RFWD2
|
ring finger and WD repeat domain 2, E3 ubiquitin protein ligase |
| chr17_+_7387677 | 2.49 |
ENST00000322644.6
|
POLR2A
|
polymerase (RNA) II (DNA directed) polypeptide A, 220kDa |
| chr15_-_72565340 | 2.48 |
ENST00000568360.1
|
PARP6
|
poly (ADP-ribose) polymerase family, member 6 |
| chr11_-_1330834 | 2.48 |
ENST00000525159.1
ENST00000317204.6 ENST00000542915.1 ENST00000527938.1 ENST00000530541.1 ENST00000263646.7 |
TOLLIP
|
toll interacting protein |
| chrX_-_129299638 | 2.47 |
ENST00000535724.1
ENST00000346424.2 |
AIFM1
|
apoptosis-inducing factor, mitochondrion-associated, 1 |
| chr9_-_139838986 | 2.46 |
ENST00000443788.1
|
FBXW5
|
F-box and WD repeat domain containing 5 |
| chr19_+_16308659 | 2.46 |
ENST00000590263.1
ENST00000590756.1 ENST00000541844.1 |
AP1M1
|
adaptor-related protein complex 1, mu 1 subunit |
| chr9_+_139839711 | 2.46 |
ENST00000224181.3
|
C8G
|
complement component 8, gamma polypeptide |
| chr4_+_76932375 | 2.45 |
ENST00000513122.1
|
ART3
|
ADP-ribosyltransferase 3 |
| chr12_-_54070098 | 2.45 |
ENST00000394349.3
ENST00000549164.1 |
ATP5G2
|
ATP synthase, H+ transporting, mitochondrial Fo complex, subunit C2 (subunit 9) |
| chr2_+_198570081 | 2.44 |
ENST00000282276.6
|
MARS2
|
methionyl-tRNA synthetase 2, mitochondrial |
| chr22_+_24666763 | 2.44 |
ENST00000437398.1
ENST00000421374.1 ENST00000314328.9 ENST00000541492.1 |
SPECC1L
|
sperm antigen with calponin homology and coiled-coil domains 1-like |
| chr17_+_78075324 | 2.43 |
ENST00000570803.1
|
GAA
|
glucosidase, alpha; acid |
| chr17_+_4736627 | 2.43 |
ENST00000355280.6
ENST00000347992.7 |
MINK1
|
misshapen-like kinase 1 |
| chr9_-_139010696 | 2.43 |
ENST00000418388.1
ENST00000561457.1 |
C9orf69
|
chromosome 9 open reading frame 69 |
| chr19_+_50432400 | 2.43 |
ENST00000423777.2
ENST00000600336.1 ENST00000597227.1 |
ATF5
|
activating transcription factor 5 |
| chr19_-_44124019 | 2.42 |
ENST00000300811.3
|
ZNF428
|
zinc finger protein 428 |
| chr16_+_84733575 | 2.41 |
ENST00000219473.7
ENST00000563892.1 ENST00000562283.1 ENST00000570191.1 ENST00000569038.1 ENST00000570053.1 |
USP10
|
ubiquitin specific peptidase 10 |
| chr13_-_52027134 | 2.41 |
ENST00000311234.4
ENST00000425000.1 ENST00000463928.1 ENST00000442263.3 ENST00000398119.2 |
INTS6
|
integrator complex subunit 6 |
| chr3_+_137906109 | 2.41 |
ENST00000481646.1
ENST00000469044.1 ENST00000491704.1 ENST00000461600.1 |
ARMC8
|
armadillo repeat containing 8 |
| chr3_-_48647470 | 2.40 |
ENST00000203407.5
|
UQCRC1
|
ubiquinol-cytochrome c reductase core protein I |
| chr16_+_14927538 | 2.40 |
ENST00000287667.7
|
NOMO1
|
NODAL modulator 1 |
| chr17_+_3572087 | 2.39 |
ENST00000248378.5
ENST00000397133.2 |
EMC6
|
ER membrane protein complex subunit 6 |
| chr17_-_47755338 | 2.38 |
ENST00000508805.1
ENST00000515508.2 ENST00000451526.2 ENST00000507970.1 |
SPOP
|
speckle-type POZ protein |
| chr16_+_8715536 | 2.38 |
ENST00000563958.1
ENST00000381920.3 ENST00000564554.1 |
METTL22
|
methyltransferase like 22 |
| chr9_+_110045418 | 2.38 |
ENST00000419616.1
|
RAD23B
|
RAD23 homolog B (S. cerevisiae) |
| chr12_+_14518598 | 2.38 |
ENST00000261168.4
ENST00000538511.1 ENST00000545723.1 ENST00000543189.1 ENST00000536444.1 |
ATF7IP
|
activating transcription factor 7 interacting protein |
| chr19_-_42721819 | 2.37 |
ENST00000336034.4
ENST00000598200.1 ENST00000598727.1 ENST00000596251.1 |
DEDD2
|
death effector domain containing 2 |
| chr2_-_37311445 | 2.37 |
ENST00000233099.5
ENST00000354531.2 |
HEATR5B
|
HEAT repeat containing 5B |
| chr12_-_54069856 | 2.36 |
ENST00000602871.1
|
ATP5G2
|
ATP synthase, H+ transporting, mitochondrial Fo complex, subunit C2 (subunit 9) |
| chr12_+_57916584 | 2.35 |
ENST00000546632.1
ENST00000549623.1 ENST00000431731.2 |
MBD6
|
methyl-CpG binding domain protein 6 |
| chr12_-_124457371 | 2.35 |
ENST00000238156.3
ENST00000545037.1 |
CCDC92
|
coiled-coil domain containing 92 |
| chr4_-_56412713 | 2.34 |
ENST00000435527.2
|
CLOCK
|
clock circadian regulator |
| chr20_+_62887139 | 2.34 |
ENST00000609764.1
|
PCMTD2
|
protein-L-isoaspartate (D-aspartate) O-methyltransferase domain containing 2 |
| chr19_+_16308711 | 2.33 |
ENST00000429941.2
ENST00000444449.2 ENST00000589822.1 |
AP1M1
|
adaptor-related protein complex 1, mu 1 subunit |
| chr5_+_79783788 | 2.33 |
ENST00000282226.4
|
FAM151B
|
family with sequence similarity 151, member B |
| chr2_+_26256938 | 2.30 |
ENST00000264710.4
|
RAB10
|
RAB10, member RAS oncogene family |
| chr17_-_27169745 | 2.29 |
ENST00000583307.1
ENST00000581229.1 ENST00000582266.1 ENST00000577376.1 ENST00000577682.1 ENST00000581381.1 ENST00000341217.5 ENST00000581407.1 ENST00000583522.1 |
FAM222B
|
family with sequence similarity 222, member B |
| chr6_-_160148356 | 2.29 |
ENST00000401980.3
ENST00000545162.1 |
SOD2
|
superoxide dismutase 2, mitochondrial |
| chr3_-_52273098 | 2.28 |
ENST00000499914.2
ENST00000305533.5 ENST00000597542.1 |
TWF2
TLR9
|
twinfilin actin-binding protein 2 toll-like receptor 9 |
| chr7_-_150974494 | 2.28 |
ENST00000392811.2
|
SMARCD3
|
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily d, member 3 |
| chr9_+_79792410 | 2.28 |
ENST00000357409.5
|
VPS13A
|
vacuolar protein sorting 13 homolog A (S. cerevisiae) |
| chr6_-_35888824 | 2.27 |
ENST00000361690.3
ENST00000512445.1 |
SRPK1
|
SRSF protein kinase 1 |
| chr17_-_47439437 | 2.27 |
ENST00000430262.2
|
ZNF652
|
zinc finger protein 652 |
| chr19_+_36630855 | 2.26 |
ENST00000589146.1
|
CAPNS1
|
calpain, small subunit 1 |
| chr7_-_6487551 | 2.25 |
ENST00000428902.2
ENST00000421761.2 ENST00000425398.2 ENST00000432248.1 ENST00000297056.6 |
DAGLB
|
diacylglycerol lipase, beta |
| chr6_-_31620149 | 2.25 |
ENST00000435080.1
ENST00000375976.4 ENST00000441054.1 |
BAG6
|
BCL2-associated athanogene 6 |
| chr2_+_216974020 | 2.25 |
ENST00000392132.2
ENST00000417391.1 |
XRCC5
|
X-ray repair complementing defective repair in Chinese hamster cells 5 (double-strand-break rejoining) |
| chr20_+_37101526 | 2.23 |
ENST00000397040.1
|
RALGAPB
|
Ral GTPase activating protein, beta subunit (non-catalytic) |
| chr15_-_65477637 | 2.23 |
ENST00000300107.3
|
CLPX
|
caseinolytic mitochondrial matrix peptidase chaperone subunit |
| chr13_-_20357057 | 2.22 |
ENST00000338910.4
|
PSPC1
|
paraspeckle component 1 |
| chr3_+_133292574 | 2.22 |
ENST00000264993.3
|
CDV3
|
CDV3 homolog (mouse) |
| chr14_+_39583427 | 2.22 |
ENST00000308317.6
ENST00000396249.2 ENST00000250379.8 ENST00000534684.2 ENST00000527381.1 |
GEMIN2
|
gem (nuclear organelle) associated protein 2 |
| chr4_-_1242463 | 2.22 |
ENST00000513420.1
|
CTBP1
|
C-terminal binding protein 1 |
| chr10_-_133795416 | 2.21 |
ENST00000540159.1
ENST00000368636.4 |
BNIP3
|
BCL2/adenovirus E1B 19kDa interacting protein 3 |
| chr4_+_76932326 | 2.21 |
ENST00000513353.1
ENST00000341029.5 |
ART3
|
ADP-ribosyltransferase 3 |
| chr20_+_37101455 | 2.20 |
ENST00000262879.6
ENST00000397042.3 ENST00000397038.1 ENST00000537204.1 |
RALGAPB
|
Ral GTPase activating protein, beta subunit (non-catalytic) |
| chr19_-_40791302 | 2.19 |
ENST00000392038.2
ENST00000578123.1 |
AKT2
|
v-akt murine thymoma viral oncogene homolog 2 |
| chr4_+_7045042 | 2.18 |
ENST00000310074.7
ENST00000512388.1 |
TADA2B
|
transcriptional adaptor 2B |
| chr19_-_48867171 | 2.17 |
ENST00000377431.2
ENST00000436660.2 ENST00000541566.1 |
TMEM143
|
transmembrane protein 143 |
| chr9_+_131580734 | 2.17 |
ENST00000372642.4
|
ENDOG
|
endonuclease G |
| chr7_-_102119342 | 2.16 |
ENST00000393794.3
ENST00000292614.5 |
POLR2J
|
polymerase (RNA) II (DNA directed) polypeptide J, 13.3kDa |
| chr17_-_7518145 | 2.16 |
ENST00000250113.7
ENST00000571597.1 |
FXR2
|
fragile X mental retardation, autosomal homolog 2 |
| chr9_-_138799070 | 2.16 |
ENST00000389532.4
ENST00000409386.3 |
CAMSAP1
|
calmodulin regulated spectrin-associated protein 1 |
| chr16_+_3019552 | 2.16 |
ENST00000572687.1
|
PAQR4
|
progestin and adipoQ receptor family member IV |
| chr16_+_67143828 | 2.16 |
ENST00000563853.2
ENST00000569914.1 ENST00000569600.1 |
C16orf70
|
chromosome 16 open reading frame 70 |
| chrX_-_7066159 | 2.14 |
ENST00000486446.2
ENST00000412827.2 ENST00000424830.2 ENST00000381077.5 ENST00000540122.1 |
HDHD1
|
haloacid dehalogenase-like hydrolase domain containing 1 |
| chr16_-_4401284 | 2.14 |
ENST00000318059.3
|
PAM16
|
presequence translocase-associated motor 16 homolog (S. cerevisiae) |
| chr10_-_27389392 | 2.14 |
ENST00000376087.4
|
ANKRD26
|
ankyrin repeat domain 26 |
| chr3_+_49726932 | 2.13 |
ENST00000327697.6
ENST00000432042.1 ENST00000454491.1 |
RNF123
|
ring finger protein 123 |
| chr1_-_243418650 | 2.13 |
ENST00000522995.1
|
CEP170
|
centrosomal protein 170kDa |
| chr15_-_72564906 | 2.12 |
ENST00000566844.1
|
PARP6
|
poly (ADP-ribose) polymerase family, member 6 |
| chr1_-_160232312 | 2.12 |
ENST00000440682.1
|
DCAF8
|
DDB1 and CUL4 associated factor 8 |
| chr22_+_50247449 | 2.11 |
ENST00000216268.5
|
ZBED4
|
zinc finger, BED-type containing 4 |
| chr12_-_58131931 | 2.11 |
ENST00000547588.1
|
AGAP2
|
ArfGAP with GTPase domain, ankyrin repeat and PH domain 2 |
| chr17_-_66287350 | 2.10 |
ENST00000580666.1
ENST00000583477.1 |
SLC16A6
|
solute carrier family 16, member 6 |
| chr12_+_57623907 | 2.10 |
ENST00000553529.1
ENST00000554310.1 |
SHMT2
|
serine hydroxymethyltransferase 2 (mitochondrial) |
| chr3_+_150321068 | 2.10 |
ENST00000471696.1
ENST00000477889.1 ENST00000485923.1 |
SELT
|
Selenoprotein T |
| chr9_+_139839686 | 2.09 |
ENST00000371634.2
|
C8G
|
complement component 8, gamma polypeptide |
| chr8_-_117886732 | 2.09 |
ENST00000517485.1
|
RAD21
|
RAD21 homolog (S. pombe) |
| chr9_+_71394945 | 2.07 |
ENST00000394264.3
|
FAM122A
|
family with sequence similarity 122A |
| chr10_-_27389320 | 2.07 |
ENST00000436985.2
|
ANKRD26
|
ankyrin repeat domain 26 |
| chr18_-_5296001 | 2.07 |
ENST00000357006.4
|
ZBTB14
|
zinc finger and BTB domain containing 14 |
| chr19_-_2783255 | 2.06 |
ENST00000589251.1
|
SGTA
|
small glutamine-rich tetratricopeptide repeat (TPR)-containing, alpha |
| chr21_+_45553484 | 2.06 |
ENST00000291577.6
ENST00000427803.2 |
C21orf33
|
chromosome 21 open reading frame 33 |
| chr6_+_44095263 | 2.06 |
ENST00000532634.1
|
TMEM63B
|
transmembrane protein 63B |
| chr3_-_38691119 | 2.06 |
ENST00000333535.4
ENST00000413689.1 ENST00000443581.1 ENST00000425664.1 ENST00000451551.2 |
SCN5A
|
sodium channel, voltage-gated, type V, alpha subunit |
| chr17_-_7154984 | 2.05 |
ENST00000574322.1
|
CTDNEP1
|
CTD nuclear envelope phosphatase 1 |
| chr6_-_35888858 | 2.05 |
ENST00000507909.1
|
SRPK1
|
SRSF protein kinase 1 |
| chr14_+_64854958 | 2.05 |
ENST00000555709.2
ENST00000554739.1 ENST00000554768.1 ENST00000216605.8 |
MTHFD1
|
methylenetetrahydrofolate dehydrogenase (NADP+ dependent) 1, methenyltetrahydrofolate cyclohydrolase, formyltetrahydrofolate synthetase |
| chr18_+_74534479 | 2.05 |
ENST00000320610.9
|
ZNF236
|
zinc finger protein 236 |
| chr2_-_182545603 | 2.04 |
ENST00000295108.3
|
NEUROD1
|
neuronal differentiation 1 |
| chr1_-_110052302 | 2.04 |
ENST00000369864.4
ENST00000369862.1 |
AMIGO1
|
adhesion molecule with Ig-like domain 1 |
| chr17_+_43971643 | 2.04 |
ENST00000344290.5
ENST00000262410.5 ENST00000351559.5 ENST00000340799.5 ENST00000535772.1 ENST00000347967.5 |
MAPT
|
microtubule-associated protein tau |
| chr21_+_45553535 | 2.03 |
ENST00000348499.5
ENST00000389690.3 ENST00000449622.1 |
C21orf33
|
chromosome 21 open reading frame 33 |
| chr19_+_56116771 | 2.03 |
ENST00000568956.1
|
ZNF865
|
zinc finger protein 865 |
| chr17_-_49337392 | 2.03 |
ENST00000376381.2
ENST00000586178.1 |
MBTD1
|
mbt domain containing 1 |
| chr2_-_20550416 | 2.03 |
ENST00000403432.1
ENST00000424110.1 |
PUM2
|
pumilio RNA-binding family member 2 |
| chr19_-_10676666 | 2.02 |
ENST00000539027.1
ENST00000543682.1 ENST00000361821.5 ENST00000312962.6 |
KRI1
|
KRI1 homolog (S. cerevisiae) |
| chrX_-_153707246 | 2.02 |
ENST00000407062.1
|
LAGE3
|
L antigen family, member 3 |
| chr16_-_71323617 | 2.02 |
ENST00000563876.1
|
CMTR2
|
cap methyltransferase 2 |
| chr1_+_27561104 | 2.02 |
ENST00000361771.3
|
WDTC1
|
WD and tetratricopeptide repeats 1 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.2 | 12.9 | GO:1903490 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 1.9 | 5.8 | GO:0043181 | vacuolar sequestering(GO:0043181) |
| 1.9 | 5.8 | GO:0001172 | transcription, RNA-templated(GO:0001172) |
| 1.5 | 7.5 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 1.4 | 7.0 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 1.3 | 3.8 | GO:0036451 | cap mRNA methylation(GO:0036451) |
| 1.3 | 6.3 | GO:0019242 | methylglyoxal biosynthetic process(GO:0019242) |
| 1.2 | 3.7 | GO:0060730 | regulation of intestinal epithelial structure maintenance(GO:0060730) |
| 1.2 | 8.1 | GO:0097473 | cellular response to high light intensity(GO:0071486) retinal rod cell apoptotic process(GO:0097473) |
| 1.1 | 3.2 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) |
| 1.0 | 5.2 | GO:0042539 | hypotonic salinity response(GO:0042539) cellular hypotonic salinity response(GO:0071477) |
| 1.0 | 3.1 | GO:0035281 | pre-miRNA export from nucleus(GO:0035281) |
| 1.0 | 5.7 | GO:0015853 | adenine transport(GO:0015853) |
| 0.9 | 9.5 | GO:1904379 | protein localization to cytosolic proteasome complex(GO:1904327) protein localization to cytosolic proteasome complex involved in ERAD pathway(GO:1904379) |
| 0.9 | 5.7 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.9 | 2.8 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.9 | 3.7 | GO:0021966 | corticospinal neuron axon guidance(GO:0021966) |
| 0.9 | 4.5 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.9 | 2.7 | GO:0071629 | cytoplasm-associated proteasomal ubiquitin-dependent protein catabolic process(GO:0071629) |
| 0.9 | 2.7 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.9 | 0.9 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.9 | 2.7 | GO:0051257 | meiotic metaphase I plate congression(GO:0043060) meiotic spindle midzone assembly(GO:0051257) meiotic metaphase plate congression(GO:0051311) |
| 0.9 | 5.4 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) |
| 0.9 | 4.5 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.9 | 4.5 | GO:0006050 | mannosamine metabolic process(GO:0006050) N-acetylmannosamine metabolic process(GO:0006051) |
| 0.8 | 3.4 | GO:0015910 | peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.8 | 3.3 | GO:1903722 | regulation of centriole elongation(GO:1903722) |
| 0.8 | 2.5 | GO:1904924 | negative regulation of mitophagy in response to mitochondrial depolarization(GO:1904924) |
| 0.8 | 2.3 | GO:0048213 | Golgi vesicle prefusion complex stabilization(GO:0048213) |
| 0.8 | 7.7 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.8 | 0.8 | GO:1902954 | regulation of early endosome to recycling endosome transport(GO:1902954) |
| 0.7 | 6.6 | GO:0045905 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.7 | 1.4 | GO:1900365 | positive regulation of mRNA polyadenylation(GO:1900365) |
| 0.7 | 3.5 | GO:0007070 | negative regulation of transcription during mitosis(GO:0007068) negative regulation of transcription from RNA polymerase II promoter during mitosis(GO:0007070) |
| 0.7 | 4.2 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.7 | 2.0 | GO:1901340 | negative regulation of store-operated calcium channel activity(GO:1901340) |
| 0.6 | 2.6 | GO:0046725 | negative regulation by virus of viral protein levels in host cell(GO:0046725) negative regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072308) |
| 0.6 | 1.9 | GO:0015728 | mevalonate transport(GO:0015728) behavioral response to nutrient(GO:0051780) |
| 0.6 | 3.8 | GO:1901859 | negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.6 | 0.6 | GO:1904976 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.6 | 2.5 | GO:0035408 | histone H3-T6 phosphorylation(GO:0035408) |
| 0.6 | 3.7 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.6 | 1.2 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
| 0.6 | 2.4 | GO:1990785 | response to water-immersion restraint stress(GO:1990785) |
| 0.6 | 3.6 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.6 | 6.0 | GO:0019264 | glycine biosynthetic process from serine(GO:0019264) |
| 0.6 | 1.8 | GO:0051102 | DNA ligation involved in DNA recombination(GO:0051102) |
| 0.6 | 3.5 | GO:2000234 | positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.6 | 1.8 | GO:0070407 | oxidation-dependent protein catabolic process(GO:0070407) |
| 0.6 | 1.7 | GO:1990637 | response to prolactin(GO:1990637) |
| 0.6 | 1.7 | GO:1904875 | regulation of DNA ligase activity(GO:1904875) |
| 0.6 | 2.9 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.6 | 1.7 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.6 | 2.3 | GO:1901895 | positive regulation of interferon-alpha biosynthetic process(GO:0045356) negative regulation of calcium-transporting ATPase activity(GO:1901895) |
| 0.6 | 5.7 | GO:0017062 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.6 | 2.8 | GO:0002032 | desensitization of G-protein coupled receptor protein signaling pathway by arrestin(GO:0002032) |
| 0.5 | 2.7 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.5 | 1.6 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.5 | 4.4 | GO:0035977 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) glycoprotein ERAD pathway(GO:0097466) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
| 0.5 | 4.9 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.5 | 1.1 | GO:0036034 | mediator complex assembly(GO:0036034) regulation of mediator complex assembly(GO:2001176) positive regulation of mediator complex assembly(GO:2001178) |
| 0.5 | 0.5 | GO:0046833 | positive regulation of RNA export from nucleus(GO:0046833) |
| 0.5 | 3.6 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.5 | 2.6 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.5 | 0.5 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
| 0.5 | 1.5 | GO:0006433 | prolyl-tRNA aminoacylation(GO:0006433) |
| 0.5 | 1.5 | GO:1903031 | regulation of microtubule plus-end binding(GO:1903031) positive regulation of microtubule plus-end binding(GO:1903033) |
| 0.5 | 2.0 | GO:1902544 | regulation of DNA N-glycosylase activity(GO:1902544) |
| 0.5 | 4.1 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.5 | 1.5 | GO:0003220 | left ventricular cardiac muscle tissue morphogenesis(GO:0003220) cell proliferation involved in heart valve morphogenesis(GO:0003249) regulation of cell proliferation involved in heart valve morphogenesis(GO:0003250) |
| 0.5 | 7.9 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.5 | 2.0 | GO:0006781 | succinyl-CoA pathway(GO:0006781) |
| 0.5 | 1.5 | GO:0006117 | acetaldehyde metabolic process(GO:0006117) |
| 0.5 | 6.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.5 | 2.9 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.5 | 1.4 | GO:0016256 | N-glycan processing to lysosome(GO:0016256) |
| 0.5 | 1.9 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.5 | 0.9 | GO:1902958 | neuron intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036482) positive regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902958) regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903383) negative regulation of hydrogen peroxide-induced neuron intrinsic apoptotic signaling pathway(GO:1903384) |
| 0.5 | 3.7 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.5 | 9.2 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.5 | 2.8 | GO:1904749 | regulation of protein localization to nucleolus(GO:1904749) |
| 0.5 | 3.2 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
| 0.5 | 1.8 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.5 | 2.3 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent response to reactive oxygen species(GO:0001315) regulation of systemic arterial blood pressure by acetylcholine(GO:0003068) vasodilation by acetylcholine involved in regulation of systemic arterial blood pressure(GO:0003069) regulation of systemic arterial blood pressure by neurotransmitter(GO:0003070) age-dependent general metabolic decline(GO:0007571) |
| 0.5 | 1.4 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.5 | 1.4 | GO:0031247 | actin rod assembly(GO:0031247) |
| 0.5 | 2.3 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.5 | 1.4 | GO:1904397 | negative regulation of neuromuscular junction development(GO:1904397) |
| 0.4 | 2.2 | GO:1901536 | negative regulation of DNA demethylation(GO:1901536) |
| 0.4 | 1.3 | GO:0098507 | polynucleotide 5' dephosphorylation(GO:0098507) |
| 0.4 | 1.3 | GO:0061534 | gamma-aminobutyric acid secretion, neurotransmission(GO:0061534) |
| 0.4 | 1.3 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.4 | 4.0 | GO:0090063 | positive regulation of microtubule nucleation(GO:0090063) |
| 0.4 | 3.1 | GO:0021553 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) olfactory nerve development(GO:0021553) |
| 0.4 | 11.4 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.4 | 4.0 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.4 | 7.5 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.4 | 2.2 | GO:0014886 | transition between slow and fast fiber(GO:0014886) |
| 0.4 | 1.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.4 | 1.7 | GO:0097045 | phosphatidylserine exposure on blood platelet(GO:0097045) |
| 0.4 | 2.1 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.4 | 2.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.4 | 2.1 | GO:0086047 | membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
| 0.4 | 2.1 | GO:0009257 | 10-formyltetrahydrofolate biosynthetic process(GO:0009257) |
| 0.4 | 2.9 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
| 0.4 | 2.5 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.4 | 11.4 | GO:0016254 | preassembly of GPI anchor in ER membrane(GO:0016254) |
| 0.4 | 6.4 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.4 | 2.8 | GO:0060356 | leucine import(GO:0060356) |
| 0.4 | 2.0 | GO:1905167 | positive regulation of lysosomal protein catabolic process(GO:1905167) |
| 0.4 | 8.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.4 | 1.5 | GO:0018312 | peptidyl-serine ADP-ribosylation(GO:0018312) |
| 0.4 | 2.7 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.4 | 3.0 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.4 | 1.9 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.4 | 13.5 | GO:0070987 | error-free translesion synthesis(GO:0070987) |
| 0.4 | 3.0 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.4 | 1.5 | GO:1903626 | positive regulation of DNA catabolic process(GO:1903626) |
| 0.4 | 1.1 | GO:0002276 | basophil activation involved in immune response(GO:0002276) |
| 0.4 | 4.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.4 | 1.8 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.4 | 1.8 | GO:0035549 | positive regulation of interferon-beta secretion(GO:0035549) |
| 0.4 | 1.4 | GO:1901143 | insulin catabolic process(GO:1901143) |
| 0.4 | 4.6 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.4 | 3.2 | GO:0031087 | deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.3 | 3.8 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.3 | 1.4 | GO:0016240 | autophagosome docking(GO:0016240) |
| 0.3 | 3.1 | GO:1903756 | regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.3 | 0.3 | GO:0097501 | detoxification of inorganic compound(GO:0061687) stress response to metal ion(GO:0097501) |
| 0.3 | 2.1 | GO:0051792 | medium-chain fatty acid biosynthetic process(GO:0051792) |
| 0.3 | 1.7 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.3 | 1.0 | GO:0071109 | superior temporal gyrus development(GO:0071109) |
| 0.3 | 6.4 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.3 | 0.7 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.3 | 1.7 | GO:1902728 | mineralocorticoid receptor signaling pathway(GO:0031959) positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 0.3 | 1.0 | GO:0034445 | regulation of plasma lipoprotein particle oxidation(GO:0034444) negative regulation of plasma lipoprotein particle oxidation(GO:0034445) |
| 0.3 | 3.6 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.3 | 1.0 | GO:0006154 | adenosine catabolic process(GO:0006154) inosine biosynthetic process(GO:0046103) |
| 0.3 | 1.3 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.3 | 1.0 | GO:0002188 | translation reinitiation(GO:0002188) |
| 0.3 | 1.9 | GO:0015801 | aromatic amino acid transport(GO:0015801) |
| 0.3 | 6.1 | GO:0006089 | lactate metabolic process(GO:0006089) |
| 0.3 | 1.3 | GO:0061763 | multivesicular body-lysosome fusion(GO:0061763) |
| 0.3 | 1.3 | GO:1902528 | regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.3 | 1.3 | GO:0006601 | creatine biosynthetic process(GO:0006601) |
| 0.3 | 6.4 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.3 | 2.5 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.3 | 4.1 | GO:0002441 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.3 | 0.9 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.3 | 5.6 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.3 | 1.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.3 | 0.9 | GO:0060370 | susceptibility to T cell mediated cytotoxicity(GO:0060370) |
| 0.3 | 1.8 | GO:0030037 | actin filament reorganization involved in cell cycle(GO:0030037) |
| 0.3 | 2.5 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.3 | 1.8 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.3 | 0.9 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.3 | 1.8 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.3 | 0.9 | GO:0072365 | regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.3 | 2.1 | GO:0051138 | positive regulation of NK T cell differentiation(GO:0051138) |
| 0.3 | 14.8 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.3 | 6.9 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
| 0.3 | 4.8 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.3 | 0.3 | GO:2000812 | regulation of barbed-end actin filament capping(GO:2000812) |
| 0.3 | 2.4 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.3 | 15.2 | GO:0038202 | TORC1 signaling(GO:0038202) |
| 0.3 | 1.2 | GO:2000298 | regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.3 | 1.8 | GO:0071816 | tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.3 | 6.2 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.3 | 1.2 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.3 | 5.5 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.3 | 1.7 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.3 | 2.3 | GO:0090669 | telomerase RNA stabilization(GO:0090669) |
| 0.3 | 1.4 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
| 0.3 | 3.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
| 0.3 | 1.1 | GO:0006428 | isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.3 | 1.1 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.3 | 0.8 | GO:1901222 | regulation of NIK/NF-kappaB signaling(GO:1901222) |
| 0.3 | 0.8 | GO:0033364 | mast cell secretory granule organization(GO:0033364) |
| 0.3 | 2.8 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.3 | 4.4 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
| 0.3 | 9.3 | GO:0042776 | mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.3 | 7.7 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.3 | 0.5 | GO:1903445 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.3 | 3.0 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.3 | 2.7 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.3 | 1.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.3 | 0.8 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
| 0.3 | 1.1 | GO:2001171 | positive regulation of ATP biosynthetic process(GO:2001171) |
| 0.3 | 0.8 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.3 | 0.8 | GO:1903630 | regulation of aminoacyl-tRNA ligase activity(GO:1903630) |
| 0.3 | 1.1 | GO:0001510 | RNA methylation(GO:0001510) |
| 0.3 | 1.0 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.3 | 0.3 | GO:1903181 | regulation of dopamine biosynthetic process(GO:1903179) positive regulation of dopamine biosynthetic process(GO:1903181) |
| 0.3 | 4.1 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.3 | 1.3 | GO:1904764 | negative regulation of fibril organization(GO:1902904) chaperone-mediated autophagy translocation complex disassembly(GO:1904764) |
| 0.3 | 0.8 | GO:0002101 | tRNA wobble cytosine modification(GO:0002101) |
| 0.3 | 4.1 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.3 | 2.5 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.3 | 6.5 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.3 | 8.3 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.3 | 1.8 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.2 | 0.7 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
| 0.2 | 5.9 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.2 | 8.4 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.2 | 0.7 | GO:1902617 | response to fluoride(GO:1902617) |
| 0.2 | 0.5 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.2 | 1.5 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.2 | 2.4 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.2 | 0.7 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.2 | 3.7 | GO:0006782 | protoporphyrinogen IX biosynthetic process(GO:0006782) |
| 0.2 | 0.7 | GO:2000687 | negative regulation of rubidium ion transport(GO:2000681) negative regulation of rubidium ion transmembrane transporter activity(GO:2000687) |
| 0.2 | 0.5 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.2 | 1.2 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.2 | 3.8 | GO:1904871 | regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) |
| 0.2 | 5.9 | GO:0035646 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.2 | 0.2 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.2 | 1.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.2 | 6.8 | GO:0035635 | entry of bacterium into host cell(GO:0035635) |
| 0.2 | 2.3 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.2 | 1.9 | GO:0046469 | platelet activating factor metabolic process(GO:0046469) |
| 0.2 | 3.0 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.2 | 0.7 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
| 0.2 | 3.0 | GO:0030091 | protein repair(GO:0030091) |
| 0.2 | 0.7 | GO:0033386 | geranylgeranyl diphosphate metabolic process(GO:0033385) geranylgeranyl diphosphate biosynthetic process(GO:0033386) |
| 0.2 | 1.4 | GO:1903507 | negative regulation of nucleic acid-templated transcription(GO:1903507) |
| 0.2 | 1.4 | GO:0030047 | actin modification(GO:0030047) |
| 0.2 | 2.5 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.2 | 5.1 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.2 | 2.4 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 0.2 | 0.7 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.2 | 3.5 | GO:0000717 | nucleotide-excision repair, DNA duplex unwinding(GO:0000717) |
| 0.2 | 2.0 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
| 0.2 | 3.9 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.2 | 8.4 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.2 | 0.9 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.2 | 1.1 | GO:0042113 | B cell activation(GO:0042113) |
| 0.2 | 0.4 | GO:0070585 | protein localization to mitochondrion(GO:0070585) |
| 0.2 | 4.5 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.2 | 2.6 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.2 | 2.1 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
| 0.2 | 1.1 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) ether biosynthetic process(GO:1901503) |
| 0.2 | 1.1 | GO:0085032 | modulation of signal transduction in other organism(GO:0044501) modulation by symbiont of host signal transduction pathway(GO:0052027) modulation of signal transduction in other organism involved in symbiotic interaction(GO:0052250) modulation by symbiont of host I-kappaB kinase/NF-kappaB cascade(GO:0085032) |
| 0.2 | 0.8 | GO:0006421 | asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.2 | 6.9 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.2 | 0.4 | GO:1903721 | regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.2 | 1.2 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.2 | 0.2 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
| 0.2 | 0.6 | GO:0097065 | anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.2 | 2.5 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.2 | 1.0 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.2 | 0.8 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.2 | 1.4 | GO:0097056 | selenocysteinyl-tRNA(Sec) biosynthetic process(GO:0097056) |
| 0.2 | 0.6 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.2 | 2.9 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.2 | 2.9 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.2 | 1.0 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) retrograde trans-synaptic signaling(GO:0098917) |
| 0.2 | 1.2 | GO:2000825 | positive regulation of androgen receptor activity(GO:2000825) |
| 0.2 | 3.4 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.2 | 2.6 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.2 | 1.6 | GO:1904885 | beta-catenin destruction complex assembly(GO:1904885) |
| 0.2 | 1.4 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.2 | 1.6 | GO:0032057 | negative regulation of translational initiation in response to stress(GO:0032057) |
| 0.2 | 2.9 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.2 | 1.8 | GO:0060992 | response to fungicide(GO:0060992) |
| 0.2 | 1.9 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.2 | 1.0 | GO:0046092 | deoxycytidine metabolic process(GO:0046092) |
| 0.2 | 1.9 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.2 | 0.8 | GO:0097069 | cellular response to thyroxine stimulus(GO:0097069) cellular response to L-phenylalanine derivative(GO:1904387) |
| 0.2 | 1.7 | GO:0042791 | 5S class rRNA transcription from RNA polymerase III type 1 promoter(GO:0042791) tRNA transcription from RNA polymerase III promoter(GO:0042797) |
| 0.2 | 2.9 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.2 | 14.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.2 | 1.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.2 | 0.9 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.2 | 1.5 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.2 | 4.5 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.2 | 1.9 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.2 | 1.1 | GO:0093001 | glycolysis from storage polysaccharide through glucose-1-phosphate(GO:0093001) |
| 0.2 | 0.7 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.2 | 1.5 | GO:1901189 | arterial endothelial cell fate commitment(GO:0060844) positive regulation of ephrin receptor signaling pathway(GO:1901189) positive regulation of canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:1901297) positive regulation of canonical Wnt signaling pathway involved in heart development(GO:1905068) |
| 0.2 | 2.4 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.2 | 0.9 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.2 | 4.6 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.2 | 2.0 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
| 0.2 | 3.6 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.2 | 0.7 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
| 0.2 | 0.7 | GO:1990022 | RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.2 | 1.8 | GO:1901409 | positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.2 | 0.4 | GO:0046707 | IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
| 0.2 | 1.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.2 | 0.9 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.2 | 1.7 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.2 | 2.3 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.2 | 1.2 | GO:0003185 | primary heart field specification(GO:0003138) sinoatrial valve development(GO:0003172) sinoatrial valve morphogenesis(GO:0003185) |
| 0.2 | 0.3 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.2 | 3.3 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.2 | 2.9 | GO:0034656 | nucleobase-containing small molecule catabolic process(GO:0034656) |
| 0.2 | 2.9 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
| 0.2 | 0.7 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.2 | 1.4 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.2 | 0.7 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
| 0.2 | 0.7 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.2 | 4.7 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.2 | 0.2 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
| 0.2 | 1.0 | GO:0035063 | nuclear speck organization(GO:0035063) |
| 0.2 | 1.5 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
| 0.2 | 1.5 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.2 | 3.3 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.2 | 0.7 | GO:0016267 | O-glycan processing, core 1(GO:0016267) |
| 0.2 | 1.0 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.2 | 2.1 | GO:0033753 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.2 | 4.5 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.2 | 2.4 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.2 | 1.0 | GO:0030581 | intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.2 | 0.6 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.2 | 0.3 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
| 0.2 | 2.2 | GO:0070911 | global genome nucleotide-excision repair(GO:0070911) |
| 0.2 | 2.7 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.2 | 1.7 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
| 0.2 | 0.5 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.2 | 1.1 | GO:0015742 | alpha-ketoglutarate transport(GO:0015742) |
| 0.2 | 0.3 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.2 | 0.8 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.2 | 0.3 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.1 | 4.5 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
| 0.1 | 0.6 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.1 | 1.6 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.1 | 0.4 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.1 | 0.4 | GO:2000395 | regulation of ubiquitin-dependent endocytosis(GO:2000395) positive regulation of ubiquitin-dependent endocytosis(GO:2000397) |
| 0.1 | 0.6 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.1 | 0.4 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.1 | 0.4 | GO:0033091 | positive regulation of immature T cell proliferation(GO:0033091) |
| 0.1 | 0.4 | GO:0046586 | regulation of calcium-dependent cell-cell adhesion(GO:0046586) |
| 0.1 | 1.3 | GO:0006049 | UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.1 | 1.4 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.1 | 0.9 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.1 | 2.4 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 | 1.8 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
| 0.1 | 1.0 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
| 0.1 | 1.4 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.1 | 0.7 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 | 1.5 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.1 | 0.3 | GO:1990164 | histone H2A phosphorylation(GO:1990164) |
| 0.1 | 0.4 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.1 | 2.8 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.1 | 1.0 | GO:2000567 | memory T cell activation(GO:0035709) regulation of memory T cell activation(GO:2000567) positive regulation of memory T cell activation(GO:2000568) |
| 0.1 | 1.5 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.1 | 0.8 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.1 | 17.5 | GO:0006415 | translational termination(GO:0006415) |
| 0.1 | 1.6 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.1 | 1.0 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.1 | 1.1 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 0.1 | 1.9 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.1 | 0.8 | GO:0072619 | interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 0.1 | 0.4 | GO:0070781 | response to biotin(GO:0070781) |
| 0.1 | 1.9 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 2.3 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
| 0.1 | 2.1 | GO:0015871 | choline transport(GO:0015871) |
| 0.1 | 0.4 | GO:1904719 | excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.1 | 0.9 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.1 | 0.8 | GO:0009048 | dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 | 0.5 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) |
| 0.1 | 0.4 | GO:0032581 | ER-dependent peroxisome organization(GO:0032581) |
| 0.1 | 1.9 | GO:0070071 | proton-transporting two-sector ATPase complex assembly(GO:0070071) |
| 0.1 | 0.9 | GO:0046689 | response to mercury ion(GO:0046689) |
| 0.1 | 1.0 | GO:0002084 | protein depalmitoylation(GO:0002084) |
| 0.1 | 0.9 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.1 | 1.5 | GO:0090208 | positive regulation of triglyceride metabolic process(GO:0090208) |
| 0.1 | 0.8 | GO:0021993 | initiation of neural tube closure(GO:0021993) |
| 0.1 | 1.4 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 | 0.4 | GO:0018283 | metal incorporation into metallo-sulfur cluster(GO:0018282) iron incorporation into metallo-sulfur cluster(GO:0018283) |
| 0.1 | 1.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.1 | 0.8 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 | 1.3 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.1 | 2.4 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
| 0.1 | 0.2 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.1 | 1.7 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 | 13.8 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.1 | 0.5 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 1.1 | GO:0060717 | syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) chorion development(GO:0060717) |
| 0.1 | 1.7 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.1 | 0.4 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
| 0.1 | 0.4 | GO:0061357 | positive regulation of Wnt protein secretion(GO:0061357) |
| 0.1 | 1.4 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.1 | 0.7 | GO:0045903 | positive regulation of translational fidelity(GO:0045903) |
| 0.1 | 1.7 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
| 0.1 | 6.2 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.1 | 0.7 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 | 3.8 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.1 | 5.1 | GO:1903959 | regulation of anion transmembrane transport(GO:1903959) |
| 0.1 | 1.3 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.1 | 0.8 | GO:0090625 | mRNA cleavage involved in gene silencing by siRNA(GO:0090625) |
| 0.1 | 1.1 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
| 0.1 | 0.8 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.1 | 3.1 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.1 | 1.4 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.1 | 0.6 | GO:0032364 | oxygen homeostasis(GO:0032364) |
| 0.1 | 0.9 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
| 0.1 | 0.6 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.1 | 0.2 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
| 0.1 | 0.4 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.1 | 0.6 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.1 | 0.3 | GO:1904562 | phosphatidylinositol 5-phosphate metabolic process(GO:1904562) |
| 0.1 | 0.8 | GO:0098727 | maintenance of cell number(GO:0098727) |
| 0.1 | 1.1 | GO:0071963 | establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.1 | 0.3 | GO:0046356 | acetyl-CoA catabolic process(GO:0046356) |
| 0.1 | 0.9 | GO:0035437 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.1 | 3.3 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.1 | 0.7 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.1 | 0.5 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.1 | 0.8 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.1 | 0.7 | GO:0044381 | glucose import in response to insulin stimulus(GO:0044381) |
| 0.1 | 7.6 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
| 0.1 | 1.0 | GO:0002759 | regulation of antimicrobial humoral response(GO:0002759) |
| 0.1 | 0.5 | GO:0008204 | ergosterol biosynthetic process(GO:0006696) ergosterol metabolic process(GO:0008204) |
| 0.1 | 2.1 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.1 | 1.8 | GO:0051382 | kinetochore assembly(GO:0051382) |
| 0.1 | 3.1 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
| 0.1 | 0.8 | GO:0032006 | regulation of TOR signaling(GO:0032006) |
| 0.1 | 0.4 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.1 | 1.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.1 | 1.3 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 | 0.7 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 | 0.3 | GO:0003163 | sinoatrial node development(GO:0003163) sinoatrial node cell differentiation(GO:0060921) sinoatrial node cell development(GO:0060931) |
| 0.1 | 1.0 | GO:0035897 | proteolysis in other organism(GO:0035897) |
| 0.1 | 3.0 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.1 | 0.2 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
| 0.1 | 1.8 | GO:0048820 | hair follicle maturation(GO:0048820) |
| 0.1 | 0.8 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 1.0 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.1 | 0.3 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.1 | 0.3 | GO:0036333 | hepatocyte homeostasis(GO:0036333) response to tetrachloromethane(GO:1904772) |
| 0.1 | 0.7 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 1.0 | GO:0006065 | UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.1 | 0.3 | GO:0030806 | regulation of cyclic nucleotide catabolic process(GO:0030805) negative regulation of cyclic nucleotide catabolic process(GO:0030806) regulation of cAMP catabolic process(GO:0030820) negative regulation of cAMP catabolic process(GO:0030821) regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) regulation of ERK5 cascade(GO:0070376) negative regulation of ERK5 cascade(GO:0070377) |
| 0.1 | 5.1 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.1 | 0.3 | GO:2000583 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000583) negative regulation of platelet-derived growth factor receptor-alpha signaling pathway(GO:2000584) |
| 0.1 | 5.2 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.1 | 1.1 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 | 3.2 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.1 | 0.6 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.1 | 1.8 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.1 | 0.7 | GO:1903401 | L-lysine transmembrane transport(GO:1903401) |
| 0.1 | 0.6 | GO:0006574 | valine catabolic process(GO:0006574) |
| 0.1 | 1.4 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.1 | 0.2 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.1 | 1.5 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.1 | 1.2 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 | 0.4 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.1 | 1.3 | GO:0055070 | copper ion homeostasis(GO:0055070) |
| 0.1 | 1.2 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.1 | 0.6 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.1 | 0.3 | GO:0006043 | glucosamine catabolic process(GO:0006043) |
| 0.1 | 1.5 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.1 | 0.9 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.1 | 1.5 | GO:0045008 | depyrimidination(GO:0045008) |
| 0.1 | 1.1 | GO:0036065 | fucosylation(GO:0036065) |
| 0.1 | 2.3 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
| 0.1 | 1.5 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.1 | 0.7 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
| 0.1 | 2.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.1 | 10.4 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 | 0.3 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.1 | 0.3 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 | 0.5 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.1 | 7.9 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
| 0.1 | 2.2 | GO:1900271 | regulation of long-term synaptic potentiation(GO:1900271) |
| 0.1 | 1.9 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.1 | 0.9 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
| 0.1 | 1.5 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.1 | 0.6 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 2.7 | GO:0031114 | negative regulation of microtubule depolymerization(GO:0007026) regulation of microtubule depolymerization(GO:0031114) |
| 0.1 | 1.4 | GO:0034205 | beta-amyloid formation(GO:0034205) |
| 0.1 | 1.3 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
| 0.1 | 0.3 | GO:0097327 | response to antineoplastic agent(GO:0097327) |
| 0.1 | 1.7 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 0.7 | GO:0035524 | proline transmembrane transport(GO:0035524) |
| 0.1 | 1.5 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 | 0.2 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
| 0.1 | 1.2 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.1 | 0.2 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.1 | 0.1 | GO:1901660 | calcium ion export(GO:1901660) calcium ion export from cell(GO:1990034) |
| 0.1 | 0.6 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
| 0.1 | 0.9 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
| 0.1 | 0.5 | GO:0002176 | male germ cell proliferation(GO:0002176) germ cell proliferation(GO:0036093) |
| 0.1 | 0.2 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.1 | 0.5 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 | 1.3 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.1 | 1.2 | GO:0036148 | phosphatidylglycerol acyl-chain remodeling(GO:0036148) |
| 0.1 | 1.1 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
| 0.1 | 0.1 | GO:0015680 | intracellular copper ion transport(GO:0015680) |
| 0.1 | 0.8 | GO:0072520 | seminiferous tubule development(GO:0072520) |
| 0.1 | 0.6 | GO:0051096 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.1 | 0.6 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.1 | 0.3 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) fungiform papilla formation(GO:0061198) |
| 0.1 | 5.8 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.1 | 2.1 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.1 | 0.3 | GO:2001141 | regulation of RNA biosynthetic process(GO:2001141) |
| 0.1 | 2.1 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 | 1.5 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.1 | 0.8 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 | 1.8 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.1 | 1.0 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 | 0.1 | GO:1901535 | regulation of DNA demethylation(GO:1901535) |
| 0.1 | 0.4 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.1 | 0.2 | GO:0048210 | Golgi vesicle fusion to target membrane(GO:0048210) |
| 0.1 | 1.2 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.1 | 0.1 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
| 0.1 | 0.7 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.1 | 0.2 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.1 | 0.9 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 0.4 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.1 | 3.7 | GO:0003170 | heart valve development(GO:0003170) |
| 0.1 | 0.3 | GO:0006312 | mitotic recombination(GO:0006312) |
| 0.1 | 1.5 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 | 1.8 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
| 0.1 | 0.1 | GO:0035617 | stress granule disassembly(GO:0035617) |
| 0.1 | 1.1 | GO:0006974 | cellular response to DNA damage stimulus(GO:0006974) |
| 0.1 | 1.9 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
| 0.1 | 0.5 | GO:0031017 | exocrine pancreas development(GO:0031017) |
| 0.1 | 0.7 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.1 | 0.5 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.1 | 2.7 | GO:0071431 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 | 0.5 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.1 | 1.4 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.1 | 0.7 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 | 1.5 | GO:0061157 | mRNA destabilization(GO:0061157) |
| 0.1 | 1.0 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 0.3 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
| 0.1 | 0.5 | GO:1902895 | positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
| 0.1 | 1.9 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.1 | 0.5 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.1 | 16.1 | GO:0016579 | protein deubiquitination(GO:0016579) |
| 0.1 | 3.4 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
| 0.1 | 6.2 | GO:0048208 | vesicle coating(GO:0006901) vesicle targeting, to, from or within Golgi(GO:0048199) vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.1 | 0.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.1 | 0.3 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.1 | 1.4 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.1 | 1.1 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
| 0.1 | 0.6 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.1 | 1.1 | GO:0006265 | DNA topological change(GO:0006265) |
| 0.1 | 0.8 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.1 | 0.5 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.1 | 8.8 | GO:0032434 | regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032434) |
| 0.1 | 0.6 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
| 0.1 | 1.7 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
| 0.1 | 1.4 | GO:1901663 | ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 | 0.9 | GO:0048261 | negative regulation of receptor-mediated endocytosis(GO:0048261) |
| 0.1 | 1.2 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.1 | 0.2 | GO:0001189 | RNA polymerase I transcriptional preinitiation complex assembly(GO:0001188) RNA polymerase I transcriptional preinitiation complex assembly at the promoter for the nuclear large rRNA transcript(GO:0001189) |
| 0.1 | 2.3 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
| 0.1 | 0.6 | GO:0098967 | exocytic insertion of neurotransmitter receptor to plasma membrane(GO:0098881) exocytic insertion of neurotransmitter receptor to postsynaptic membrane(GO:0098967) |
| 0.1 | 3.3 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.1 | 0.4 | GO:0006024 | aminoglycan biosynthetic process(GO:0006023) glycosaminoglycan biosynthetic process(GO:0006024) |
| 0.1 | 0.9 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) |
| 0.1 | 0.4 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.1 | 1.2 | GO:0008228 | opsonization(GO:0008228) |
| 0.1 | 1.0 | GO:0007032 | endosome organization(GO:0007032) |
| 0.1 | 0.5 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.1 | 0.9 | GO:0097242 | beta-amyloid clearance(GO:0097242) |
| 0.1 | 1.4 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 1.4 | GO:0001702 | gastrulation with mouth forming second(GO:0001702) |
| 0.1 | 1.5 | GO:0050687 | negative regulation of defense response to virus(GO:0050687) |
| 0.1 | 0.3 | GO:0000023 | maltose metabolic process(GO:0000023) |
| 0.1 | 0.3 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
| 0.1 | 0.3 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.1 | 1.7 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 | 0.5 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 1.5 | GO:0001556 | oocyte maturation(GO:0001556) |
| 0.1 | 0.9 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.1 | 2.6 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 | 0.3 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.1 | 0.9 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.1 | 0.4 | GO:1903748 | negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.1 | 0.6 | GO:0070266 | necroptotic process(GO:0070266) |
| 0.1 | 0.2 | GO:0008612 | peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.1 | 1.2 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.1 | 0.3 | GO:0044210 | 'de novo' CTP biosynthetic process(GO:0044210) |
| 0.1 | 2.2 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.1 | 0.3 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.1 | 1.4 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.1 | 0.4 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.1 | 0.9 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 1.0 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
| 0.1 | 0.4 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.1 | 1.9 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 | 1.2 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
| 0.1 | 0.7 | GO:1903012 | positive regulation of bone development(GO:1903012) |
| 0.1 | 0.6 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.1 | 2.8 | GO:0009214 | cyclic nucleotide catabolic process(GO:0009214) |
| 0.1 | 0.6 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
| 0.1 | 4.6 | GO:0032418 | lysosome localization(GO:0032418) |
| 0.1 | 0.4 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.1 | 0.6 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 1.5 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.0 | 0.7 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
| 0.0 | 0.2 | GO:0022614 | membrane to membrane docking(GO:0022614) negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.0 | 3.8 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
| 0.0 | 2.8 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.3 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 8.5 | GO:0006479 | protein methylation(GO:0006479) protein alkylation(GO:0008213) |
| 0.0 | 0.3 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.0 | 1.5 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
| 0.0 | 0.7 | GO:0051290 | protein heterotetramerization(GO:0051290) |
| 0.0 | 0.3 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) |
| 0.0 | 0.4 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.6 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.0 | 2.7 | GO:0006342 | chromatin silencing(GO:0006342) |
| 0.0 | 0.2 | GO:0021769 | orbitofrontal cortex development(GO:0021769) |
| 0.0 | 0.6 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.0 | 0.8 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 | 2.0 | GO:1901381 | positive regulation of potassium ion transmembrane transport(GO:1901381) |
| 0.0 | 0.7 | GO:0045778 | positive regulation of osteoblast differentiation(GO:0045669) positive regulation of ossification(GO:0045778) |
| 0.0 | 1.0 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.9 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
| 0.0 | 0.7 | GO:0033540 | fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.0 | 0.8 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.0 | 0.8 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.0 | 1.9 | GO:0016072 | rRNA metabolic process(GO:0016072) |
| 0.0 | 2.3 | GO:0032092 | positive regulation of protein binding(GO:0032092) |
| 0.0 | 0.9 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.0 | 0.3 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.0 | 0.1 | GO:0033320 | UDP-D-xylose metabolic process(GO:0033319) UDP-D-xylose biosynthetic process(GO:0033320) |
| 0.0 | 0.6 | GO:0045019 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.0 | 0.8 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.0 | 1.1 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
| 0.0 | 0.2 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.3 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.0 | 0.9 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.0 | 0.7 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 1.0 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.3 | GO:0046146 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 | 2.0 | GO:0015914 | phospholipid transport(GO:0015914) |
| 0.0 | 0.9 | GO:0048635 | negative regulation of muscle organ development(GO:0048635) |
| 0.0 | 1.4 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.0 | 0.2 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 | 0.3 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.0 | 6.3 | GO:0043123 | positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
| 0.0 | 0.7 | GO:0021772 | olfactory bulb development(GO:0021772) |
| 0.0 | 0.6 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 2.7 | GO:0016573 | histone acetylation(GO:0016573) |
| 0.0 | 0.2 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.0 | 0.9 | GO:0015991 | ATP hydrolysis coupled proton transport(GO:0015991) |
| 0.0 | 3.3 | GO:0030166 | proteoglycan biosynthetic process(GO:0030166) |
| 0.0 | 23.7 | GO:0016567 | protein ubiquitination(GO:0016567) |
| 0.0 | 0.3 | GO:0050812 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.0 | 0.4 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.0 | 0.2 | GO:0044241 | lipid digestion(GO:0044241) |
| 0.0 | 1.2 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.0 | 0.8 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
| 0.0 | 0.4 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 2.0 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
| 0.0 | 1.1 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
| 0.0 | 0.8 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.0 | 0.6 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.0 | 0.6 | GO:1900077 | negative regulation of insulin receptor signaling pathway(GO:0046627) negative regulation of cellular response to insulin stimulus(GO:1900077) |
| 0.0 | 1.7 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 0.7 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.0 | 0.2 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 4.7 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 1.1 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 0.4 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.1 | GO:0060965 | negative regulation of gene silencing by miRNA(GO:0060965) |
| 0.0 | 0.5 | GO:0051168 | nuclear export(GO:0051168) |
| 0.0 | 1.0 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
| 0.0 | 0.3 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.0 | 0.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 | 1.6 | GO:0050729 | positive regulation of inflammatory response(GO:0050729) |
| 0.0 | 0.2 | GO:0050807 | regulation of synapse organization(GO:0050807) |
| 0.0 | 0.5 | GO:0001696 | gastric acid secretion(GO:0001696) |
| 0.0 | 1.2 | GO:0050982 | detection of mechanical stimulus(GO:0050982) |
| 0.0 | 0.7 | GO:0060038 | cardiac muscle cell proliferation(GO:0060038) |
| 0.0 | 1.0 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
| 0.0 | 2.6 | GO:0035383 | acyl-CoA metabolic process(GO:0006637) thioester metabolic process(GO:0035383) |
| 0.0 | 0.8 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 | 4.0 | GO:0015718 | monocarboxylic acid transport(GO:0015718) |
| 0.0 | 0.1 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.0 | 0.3 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 0.3 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.0 | 1.9 | GO:0042752 | regulation of circadian rhythm(GO:0042752) |
| 0.0 | 0.5 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 1.0 | GO:0051057 | positive regulation of small GTPase mediated signal transduction(GO:0051057) |
| 0.0 | 0.2 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 | 0.2 | GO:0030099 | myeloid cell differentiation(GO:0030099) |
| 0.0 | 0.5 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.0 | 0.5 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
| 0.0 | 0.2 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.0 | 0.4 | GO:0032232 | negative regulation of actin filament bundle assembly(GO:0032232) |
| 0.0 | 2.9 | GO:0090316 | positive regulation of intracellular protein transport(GO:0090316) |
| 0.0 | 0.6 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.0 | 0.5 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
| 0.0 | 1.0 | GO:0007595 | lactation(GO:0007595) |
| 0.0 | 1.5 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
| 0.0 | 0.0 | GO:0040019 | positive regulation of embryonic development(GO:0040019) |
| 0.0 | 0.7 | GO:0034199 | activation of protein kinase A activity(GO:0034199) |
| 0.0 | 0.7 | GO:0050690 | regulation of defense response to virus by virus(GO:0050690) |
| 0.0 | 0.4 | GO:0060122 | inner ear receptor stereocilium organization(GO:0060122) |
| 0.0 | 1.4 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.0 | 0.4 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.0 | 0.1 | GO:0043012 | regulation of fusion of sperm to egg plasma membrane(GO:0043012) |
| 0.0 | 0.2 | GO:1900076 | regulation of cellular response to insulin stimulus(GO:1900076) |
| 0.0 | 0.5 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 0.3 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.0 | 0.9 | GO:0051149 | positive regulation of muscle cell differentiation(GO:0051149) |
| 0.0 | 0.8 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
| 0.0 | 0.4 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 | 0.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.3 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.0 | 0.4 | GO:1902808 | positive regulation of cell cycle G1/S phase transition(GO:1902808) |
| 0.0 | 0.5 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.0 | 0.2 | GO:0050951 | sensory perception of temperature stimulus(GO:0050951) |
| 0.0 | 0.6 | GO:0007030 | Golgi organization(GO:0007030) |
| 0.0 | 0.3 | GO:0007614 | short-term memory(GO:0007614) |
| 0.0 | 0.3 | GO:0008214 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
| 0.0 | 0.5 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
| 0.0 | 0.8 | GO:0031100 | organ regeneration(GO:0031100) |
| 0.0 | 0.5 | GO:0051893 | regulation of focal adhesion assembly(GO:0051893) regulation of cell-substrate junction assembly(GO:0090109) |
| 0.0 | 0.1 | GO:0010814 | neuropeptide catabolic process(GO:0010813) substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.0 | 0.0 | GO:0048821 | erythrocyte development(GO:0048821) |
| 0.0 | 0.1 | GO:0009395 | phospholipid catabolic process(GO:0009395) |
| 0.0 | 0.4 | GO:0042795 | snRNA transcription(GO:0009301) snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.4 | GO:0042439 | ethanolamine-containing compound metabolic process(GO:0042439) |
| 0.0 | 1.1 | GO:0090630 | activation of GTPase activity(GO:0090630) |
| 0.0 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.1 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 | 0.1 | GO:0031116 | positive regulation of microtubule polymerization or depolymerization(GO:0031112) positive regulation of microtubule polymerization(GO:0031116) |
| 0.0 | 0.2 | GO:0034629 | cellular protein complex localization(GO:0034629) |
| 0.0 | 0.3 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
| 0.0 | 0.3 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.4 | 19.5 | GO:0005642 | annulate lamellae(GO:0005642) |
| 1.1 | 4.5 | GO:0045283 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
| 1.1 | 4.3 | GO:0005713 | recombination nodule(GO:0005713) |
| 1.0 | 3.1 | GO:0042565 | RNA nuclear export complex(GO:0042565) |
| 1.0 | 5.9 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
| 1.0 | 6.7 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.9 | 2.8 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.8 | 4.2 | GO:0001405 | presequence translocase-associated import motor(GO:0001405) |
| 0.8 | 0.8 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.8 | 9.5 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.7 | 2.9 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.7 | 0.7 | GO:0005712 | chiasma(GO:0005712) |
| 0.7 | 2.7 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.7 | 2.1 | GO:0032302 | MutSbeta complex(GO:0032302) |
| 0.7 | 4.8 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.7 | 3.4 | GO:0071942 | XPC complex(GO:0071942) |
| 0.7 | 7.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.7 | 5.9 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.6 | 1.9 | GO:0005674 | transcription factor TFIIF complex(GO:0005674) |
| 0.6 | 2.6 | GO:0031592 | centrosomal corona(GO:0031592) |
| 0.6 | 4.4 | GO:0032807 | DNA ligase IV complex(GO:0032807) |
| 0.6 | 3.7 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
| 0.6 | 6.2 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.6 | 7.3 | GO:0072487 | MSL complex(GO:0072487) |
| 0.6 | 6.0 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.6 | 5.9 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 0.6 | 8.3 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.5 | 8.6 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.5 | 1.1 | GO:0097165 | nuclear stress granule(GO:0097165) |
| 0.5 | 5.2 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.5 | 17.8 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.5 | 3.0 | GO:0000799 | nuclear condensin complex(GO:0000799) |
| 0.5 | 4.0 | GO:0031415 | NatA complex(GO:0031415) |
| 0.5 | 3.4 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.5 | 1.9 | GO:0043291 | RAVE complex(GO:0043291) |
| 0.5 | 1.5 | GO:0035525 | NF-kappaB p50/p65 complex(GO:0035525) |
| 0.5 | 2.4 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.5 | 8.4 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.5 | 13.8 | GO:0046930 | pore complex(GO:0046930) |
| 0.5 | 2.8 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.4 | 5.4 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.4 | 2.2 | GO:0009368 | endopeptidase Clp complex(GO:0009368) |
| 0.4 | 5.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.4 | 0.9 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.4 | 1.7 | GO:0070938 | contractile ring(GO:0070938) |
| 0.4 | 1.7 | GO:0055087 | Ski complex(GO:0055087) |
| 0.4 | 2.5 | GO:0045323 | interleukin-1 receptor complex(GO:0045323) |
| 0.4 | 2.9 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.4 | 4.5 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.4 | 6.0 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.4 | 0.4 | GO:0097526 | spliceosomal tri-snRNP complex(GO:0097526) |
| 0.4 | 4.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.4 | 0.8 | GO:0044753 | amphisome(GO:0044753) |
| 0.4 | 6.2 | GO:0032039 | integrator complex(GO:0032039) |
| 0.4 | 3.5 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.4 | 6.5 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.4 | 2.9 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.4 | 1.1 | GO:0043614 | multi-eIF complex(GO:0043614) |
| 0.3 | 1.7 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
| 0.3 | 6.5 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.3 | 1.4 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.3 | 1.0 | GO:0030681 | multimeric ribonuclease P complex(GO:0030681) |
| 0.3 | 10.3 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.3 | 1.0 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.3 | 1.0 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.3 | 1.0 | GO:1990298 | mitotic checkpoint complex(GO:0033597) bub1-bub3 complex(GO:1990298) |
| 0.3 | 7.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.3 | 1.9 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.3 | 4.1 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.3 | 2.5 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.3 | 2.4 | GO:0030678 | mitochondrial ribonuclease P complex(GO:0030678) |
| 0.3 | 1.8 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.3 | 0.6 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.3 | 2.9 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.3 | 1.4 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.3 | 1.7 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.3 | 1.6 | GO:0032021 | NELF complex(GO:0032021) |
| 0.3 | 2.2 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.3 | 13.3 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.3 | 0.8 | GO:1902636 | kinociliary basal body(GO:1902636) |
| 0.3 | 5.0 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.3 | 2.3 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.3 | 1.0 | GO:1990796 | photoreceptor cell terminal bouton(GO:1990796) |
| 0.3 | 1.0 | GO:0034271 | phosphatidylinositol 3-kinase complex, class III, type I(GO:0034271) phosphatidylinositol 3-kinase complex, class III, type II(GO:0034272) |
| 0.3 | 13.8 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.2 | 2.0 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.2 | 2.2 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.2 | 2.7 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.2 | 1.2 | GO:0042721 | mitochondrial inner membrane protein insertion complex(GO:0042721) |
| 0.2 | 4.2 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.2 | 0.7 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
| 0.2 | 1.4 | GO:0032044 | DSIF complex(GO:0032044) |
| 0.2 | 1.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.2 | 3.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.2 | 5.6 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.2 | 1.8 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.2 | 4.0 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.2 | 2.5 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.2 | 5.8 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.2 | 1.5 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.2 | 1.3 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.2 | 1.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.2 | 2.8 | GO:0090543 | Flemming body(GO:0090543) |
| 0.2 | 1.3 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
| 0.2 | 2.5 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.2 | 1.0 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.2 | 1.0 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) |
| 0.2 | 0.6 | GO:0008623 | CHRAC(GO:0008623) |
| 0.2 | 2.0 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.2 | 15.2 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.2 | 2.7 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.2 | 1.6 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
| 0.2 | 3.3 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.2 | 0.8 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
| 0.2 | 1.7 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.2 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.2 | 2.3 | GO:0032009 | early phagosome(GO:0032009) |
| 0.2 | 5.3 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.2 | 2.8 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.2 | 6.2 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
| 0.2 | 5.6 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.2 | 2.4 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.2 | 0.6 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.2 | 2.4 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.2 | 1.3 | GO:0098575 | lumenal side of lysosomal membrane(GO:0098575) |
| 0.2 | 0.9 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.2 | 2.1 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) |
| 0.2 | 1.4 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.2 | 1.6 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
| 0.2 | 0.9 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.2 | 7.5 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.2 | 0.7 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.2 | 1.3 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.2 | 12.2 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.2 | 2.5 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.2 | 4.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.2 | 1.1 | GO:1902560 | GMP reductase complex(GO:1902560) |
| 0.2 | 0.6 | GO:0032798 | Swi5-Sfr1 complex(GO:0032798) |
| 0.2 | 4.3 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.2 | 2.9 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.1 | 1.6 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.1 | 5.4 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.1 | 2.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 1.5 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 4.7 | GO:0031305 | intrinsic component of mitochondrial inner membrane(GO:0031304) integral component of mitochondrial inner membrane(GO:0031305) |
| 0.1 | 0.4 | GO:0009330 | DNA topoisomerase complex (ATP-hydrolyzing)(GO:0009330) |
| 0.1 | 3.6 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 1.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 1.7 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.1 | 0.7 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
| 0.1 | 0.6 | GO:0097361 | CIA complex(GO:0097361) |
| 0.1 | 1.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 1.3 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.1 | 1.7 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
| 0.1 | 0.8 | GO:0000235 | astral microtubule(GO:0000235) aster(GO:0005818) |
| 0.1 | 0.4 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.1 | 10.5 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 1.7 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 2.3 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.1 | 1.3 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.1 | 1.3 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.1 | 0.9 | GO:0090661 | box H/ACA scaRNP complex(GO:0072589) box H/ACA telomerase RNP complex(GO:0090661) |
| 0.1 | 1.0 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 0.5 | GO:0031251 | PAN complex(GO:0031251) |
| 0.1 | 3.9 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.1 | 3.0 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.1 | 0.9 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.1 | 8.7 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.1 | 0.6 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.1 | 4.8 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 0.2 | GO:0031379 | RNA-directed RNA polymerase complex(GO:0031379) |
| 0.1 | 0.8 | GO:0033565 | ESCRT-0 complex(GO:0033565) |
| 0.1 | 0.9 | GO:0034688 | integrin alphaM-beta2 complex(GO:0034688) |
| 0.1 | 2.5 | GO:0033202 | Ino80 complex(GO:0031011) DNA helicase complex(GO:0033202) |
| 0.1 | 0.9 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.1 | 0.7 | GO:0005846 | nuclear cap binding complex(GO:0005846) |
| 0.1 | 3.7 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.1 | 1.0 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 2.6 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 1.2 | GO:0033503 | HULC complex(GO:0033503) |
| 0.1 | 0.8 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.1 | 10.2 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.1 | 1.8 | GO:0005840 | ribosome(GO:0005840) |
| 0.1 | 5.5 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.1 | 14.6 | GO:0070821 | tertiary granule membrane(GO:0070821) |
| 0.1 | 0.3 | GO:0000818 | nuclear MIS12/MIND complex(GO:0000818) condensed chromosome inner kinetochore(GO:0000939) |
| 0.1 | 0.3 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 9.5 | GO:0030118 | clathrin coat(GO:0030118) |
| 0.1 | 1.0 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 0.4 | GO:0005965 | protein farnesyltransferase complex(GO:0005965) |
| 0.1 | 0.7 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 5.1 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.1 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.1 | 7.3 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 11.2 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.1 | 0.7 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 0.3 | GO:0019008 | molybdopterin synthase complex(GO:0019008) |
| 0.1 | 1.0 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 9.3 | GO:0005905 | clathrin-coated pit(GO:0005905) |
| 0.1 | 0.8 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 2.2 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.1 | 18.7 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.1 | 1.5 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 0.4 | GO:0036396 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
| 0.1 | 3.9 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.1 | 6.8 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 0.5 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.1 | 1.7 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.1 | 1.2 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.1 | 1.6 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.1 | 0.6 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.1 | 2.0 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.1 | 1.7 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.1 | 0.9 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.1 | 5.9 | GO:0015935 | small ribosomal subunit(GO:0015935) |
| 0.1 | 0.3 | GO:0035370 | UBC13-UEV1A complex(GO:0035370) |
| 0.1 | 0.2 | GO:0005668 | RNA polymerase transcription factor SL1 complex(GO:0005668) |
| 0.1 | 0.7 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.1 | 0.8 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.1 | 0.6 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.1 | 0.7 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.1 | 0.5 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.1 | 1.0 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 1.0 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 0.5 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.1 | 0.3 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.1 | 0.3 | GO:0045120 | pronucleus(GO:0045120) |
| 0.1 | 15.0 | GO:0101002 | ficolin-1-rich granule(GO:0101002) ficolin-1-rich granule lumen(GO:1904813) |
| 0.1 | 1.9 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 0.4 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 5.2 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 0.4 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.1 | 0.6 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.1 | 0.3 | GO:0030891 | VCB complex(GO:0030891) |
| 0.1 | 0.8 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 10.3 | GO:0005814 | centriole(GO:0005814) |
| 0.1 | 1.6 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.1 | 0.6 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 1.0 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 3.6 | GO:1904724 | tertiary granule lumen(GO:1904724) |
| 0.1 | 6.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.1 | 14.1 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
| 0.1 | 3.0 | GO:0016592 | mediator complex(GO:0016592) |
| 0.1 | 2.7 | GO:0098562 | cytoplasmic side of membrane(GO:0098562) |
| 0.1 | 0.9 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.1 | 0.8 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.1 | 9.7 | GO:0016605 | PML body(GO:0016605) |
| 0.1 | 0.9 | GO:0030904 | retromer complex(GO:0030904) |
| 0.1 | 1.4 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.1 | 0.8 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) |
| 0.1 | 124.0 | GO:0005739 | mitochondrion(GO:0005739) |
| 0.1 | 9.7 | GO:0016363 | nuclear matrix(GO:0016363) |
| 0.1 | 1.4 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.2 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.1 | 1.9 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.1 | 1.8 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.1 | 0.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.1 | 3.5 | GO:0032994 | protein-lipid complex(GO:0032994) |
| 0.1 | 1.6 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.1 | 1.5 | GO:0005811 | lipid particle(GO:0005811) |
| 0.1 | 0.1 | GO:0097134 | cyclin E1-CDK2 complex(GO:0097134) |
| 0.0 | 0.3 | GO:0031205 | endoplasmic reticulum Sec complex(GO:0031205) |
| 0.0 | 3.8 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 2.0 | GO:0032809 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
| 0.0 | 0.7 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.3 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.0 | 0.5 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.5 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.5 | GO:0038201 | TOR complex(GO:0038201) |
| 0.0 | 1.0 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.1 | GO:0000806 | Y chromosome(GO:0000806) |
| 0.0 | 2.0 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 4.1 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.4 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.8 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 1.2 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
| 0.0 | 1.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 2.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 2.3 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
| 0.0 | 0.9 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.3 | GO:0043541 | UDP-N-acetylglucosamine transferase complex(GO:0043541) |
| 0.0 | 1.1 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 6.0 | GO:0031902 | late endosome membrane(GO:0031902) |
| 0.0 | 0.9 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.5 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 4.6 | GO:0005770 | late endosome(GO:0005770) |
| 0.0 | 0.3 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 1.8 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.0 | 0.3 | GO:0008287 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
| 0.0 | 2.7 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 0.4 | GO:0030894 | replisome(GO:0030894) |
| 0.0 | 3.4 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.9 | GO:1902711 | GABA-A receptor complex(GO:1902711) |
| 0.0 | 8.4 | GO:0098852 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
| 0.0 | 0.6 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.0 | 0.3 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 1.1 | GO:0031430 | M band(GO:0031430) |
| 0.0 | 0.3 | GO:0005943 | phosphatidylinositol 3-kinase complex, class IA(GO:0005943) |
| 0.0 | 23.0 | GO:0005730 | nucleolus(GO:0005730) |
| 0.0 | 6.1 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.0 | 0.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 1.5 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.7 | GO:0001527 | microfibril(GO:0001527) fibril(GO:0043205) |
| 0.0 | 0.7 | GO:0005795 | Golgi stack(GO:0005795) |
| 0.0 | 0.8 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.0 | 1.6 | GO:0030016 | myofibril(GO:0030016) |
| 0.0 | 1.2 | GO:0035578 | azurophil granule lumen(GO:0035578) |
| 0.0 | 15.9 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
| 0.0 | 0.3 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 5.3 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 0.5 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.0 | 1.6 | GO:0010008 | endosome membrane(GO:0010008) |
| 0.0 | 0.2 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.0 | 3.6 | GO:0005769 | early endosome(GO:0005769) |
| 0.0 | 0.3 | GO:0005774 | vacuolar membrane(GO:0005774) |
| 0.0 | 8.0 | GO:0000139 | Golgi membrane(GO:0000139) |
| 0.0 | 0.3 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.2 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.5 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.7 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 1.5 | GO:0005581 | collagen trimer(GO:0005581) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.1 | 8.6 | GO:0001716 | L-amino-acid oxidase activity(GO:0001716) |
| 1.9 | 5.8 | GO:0003968 | RNA-directed RNA polymerase activity(GO:0003968) |
| 1.5 | 4.5 | GO:0008177 | succinate dehydrogenase (ubiquinone) activity(GO:0008177) |
| 1.5 | 5.8 | GO:0004574 | oligo-1,6-glucosidase activity(GO:0004574) |
| 1.4 | 5.8 | GO:0086062 | voltage-gated sodium channel activity involved in Purkinje myocyte action potential(GO:0086062) |
| 1.3 | 3.8 | GO:0004483 | mRNA (nucleoside-2'-O-)-methyltransferase activity(GO:0004483) |
| 1.3 | 6.3 | GO:0004347 | glucose-6-phosphate isomerase activity(GO:0004347) |
| 1.3 | 2.5 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 1.2 | 3.6 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 1.2 | 4.7 | GO:0099609 | microtubule lateral binding(GO:0099609) |
| 1.1 | 4.5 | GO:0045127 | N-acetylglucosamine kinase activity(GO:0045127) |
| 1.0 | 3.1 | GO:0090631 | pre-miRNA transporter activity(GO:0090631) |
| 1.0 | 6.9 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.9 | 2.8 | GO:0031859 | platelet activating factor receptor binding(GO:0031859) |
| 0.9 | 2.7 | GO:0016749 | 5-aminolevulinate synthase activity(GO:0003870) N-succinyltransferase activity(GO:0016749) |
| 0.9 | 4.4 | GO:0050115 | myosin-light-chain-phosphatase activity(GO:0050115) |
| 0.8 | 2.5 | GO:0005150 | interleukin-1, Type I receptor binding(GO:0005150) |
| 0.8 | 4.0 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.8 | 2.4 | GO:0000224 | peptide-N4-(N-acetyl-beta-glucosaminyl)asparagine amidase activity(GO:0000224) |
| 0.7 | 5.8 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.7 | 9.3 | GO:0015288 | porin activity(GO:0015288) |
| 0.7 | 2.8 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.7 | 8.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.7 | 2.8 | GO:0000822 | inositol hexakisphosphate binding(GO:0000822) |
| 0.7 | 2.1 | GO:0004315 | 3-oxoacyl-[acyl-carrier-protein] synthase activity(GO:0004315) |
| 0.7 | 2.1 | GO:0004487 | methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.7 | 2.1 | GO:0032181 | double-strand/single-strand DNA junction binding(GO:0000406) dinucleotide repeat insertion binding(GO:0032181) |
| 0.7 | 2.0 | GO:0043739 | G/U mismatch-specific uracil-DNA glycosylase activity(GO:0043739) |
| 0.7 | 1.3 | GO:0004651 | polynucleotide 5'-phosphatase activity(GO:0004651) |
| 0.7 | 6.6 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.7 | 2.0 | GO:0016964 | alpha-2 macroglobulin receptor activity(GO:0016964) |
| 0.6 | 1.9 | GO:0015130 | mevalonate transmembrane transporter activity(GO:0015130) |
| 0.6 | 1.9 | GO:0019961 | interferon binding(GO:0019961) |
| 0.6 | 2.5 | GO:0035403 | histone kinase activity (H3-T6 specific)(GO:0035403) |
| 0.6 | 2.4 | GO:0016435 | rRNA (guanine) methyltransferase activity(GO:0016435) |
| 0.6 | 1.8 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.6 | 1.8 | GO:0033149 | FFAT motif binding(GO:0033149) |
| 0.6 | 6.0 | GO:0008732 | glycine hydroxymethyltransferase activity(GO:0004372) threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.6 | 4.8 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.6 | 1.8 | GO:0033677 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) DNA/RNA helicase activity(GO:0033677) |
| 0.6 | 1.8 | GO:0070361 | mitochondrial light strand promoter anti-sense binding(GO:0070361) mitochondrial heavy strand promoter anti-sense binding(GO:0070362) mitochondrial heavy strand promoter sense binding(GO:0070364) |
| 0.6 | 0.6 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.6 | 5.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.6 | 2.3 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.6 | 1.7 | GO:0019778 | Atg12 activating enzyme activity(GO:0019778) Atg8 activating enzyme activity(GO:0019779) |
| 0.6 | 1.7 | GO:0005135 | erythropoietin receptor binding(GO:0005128) interleukin-3 receptor binding(GO:0005135) |
| 0.6 | 11.1 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.5 | 5.4 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.5 | 9.6 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.5 | 3.7 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
| 0.5 | 0.5 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.5 | 1.5 | GO:0004827 | proline-tRNA ligase activity(GO:0004827) |
| 0.5 | 3.6 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.5 | 1.5 | GO:0001003 | polymerase III regulatory region sequence-specific DNA binding(GO:0000992) RNA polymerase III type 1 promoter sequence-specific DNA binding(GO:0001002) RNA polymerase III type 2 promoter sequence-specific DNA binding(GO:0001003) |
| 0.5 | 4.0 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.5 | 4.4 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.5 | 1.9 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.5 | 1.9 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.5 | 1.4 | GO:0031626 | beta-endorphin binding(GO:0031626) |
| 0.5 | 1.4 | GO:0005010 | insulin-like growth factor-activated receptor activity(GO:0005010) |
| 0.5 | 1.8 | GO:0097363 | protein O-GlcNAc transferase activity(GO:0097363) |
| 0.5 | 1.8 | GO:1990190 | peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.5 | 2.3 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.5 | 1.4 | GO:0070260 | tyrosyl-RNA phosphodiesterase activity(GO:0036317) 5'-tyrosyl-DNA phosphodiesterase activity(GO:0070260) |
| 0.5 | 1.4 | GO:0031531 | thyrotropin-releasing hormone receptor binding(GO:0031531) |
| 0.5 | 2.3 | GO:0097677 | STAT family protein binding(GO:0097677) |
| 0.5 | 2.7 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.5 | 1.8 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.4 | 2.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.4 | 13.1 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.4 | 1.7 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.4 | 1.3 | GO:0015068 | amidinotransferase activity(GO:0015067) glycine amidinotransferase activity(GO:0015068) |
| 0.4 | 3.4 | GO:0019826 | oxygen sensor activity(GO:0019826) |
| 0.4 | 5.9 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.4 | 1.7 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.4 | 2.9 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
| 0.4 | 2.5 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.4 | 5.2 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.4 | 6.4 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.4 | 2.0 | GO:0004775 | succinate-CoA ligase (ADP-forming) activity(GO:0004775) |
| 0.4 | 3.9 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.4 | 5.5 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.4 | 1.5 | GO:1990404 | protein ADP-ribosylase activity(GO:1990404) |
| 0.4 | 6.5 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.4 | 3.0 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.4 | 0.7 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.4 | 1.8 | GO:0016428 | tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.4 | 3.3 | GO:0070740 | tubulin-glutamic acid ligase activity(GO:0070740) |
| 0.4 | 4.4 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.4 | 1.4 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.4 | 1.4 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.4 | 1.1 | GO:0010309 | acireductone dioxygenase [iron(II)-requiring] activity(GO:0010309) |
| 0.3 | 2.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.3 | 1.0 | GO:0019781 | NEDD8 activating enzyme activity(GO:0019781) |
| 0.3 | 5.9 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.3 | 1.7 | GO:0004306 | ethanolamine-phosphate cytidylyltransferase activity(GO:0004306) |
| 0.3 | 1.7 | GO:0031208 | POZ domain binding(GO:0031208) |
| 0.3 | 2.0 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.3 | 5.4 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.3 | 3.7 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.3 | 0.3 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.3 | 13.4 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.3 | 2.9 | GO:0019798 | procollagen-proline 4-dioxygenase activity(GO:0004656) procollagen-proline dioxygenase activity(GO:0019798) |
| 0.3 | 1.0 | GO:0008441 | 3'(2'),5'-bisphosphate nucleotidase activity(GO:0008441) |
| 0.3 | 1.3 | GO:0004113 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase activity(GO:0004113) |
| 0.3 | 0.9 | GO:0010340 | carboxyl-O-methyltransferase activity(GO:0010340) protein carboxyl O-methyltransferase activity(GO:0051998) |
| 0.3 | 1.3 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.3 | 0.9 | GO:0071207 | histone pre-mRNA stem-loop binding(GO:0071207) |
| 0.3 | 2.2 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.3 | 0.9 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.3 | 0.9 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.3 | 1.5 | GO:0015140 | malate transmembrane transporter activity(GO:0015140) |
| 0.3 | 3.5 | GO:0010385 | double-stranded methylated DNA binding(GO:0010385) |
| 0.3 | 4.4 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.3 | 3.8 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.3 | 1.2 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
| 0.3 | 2.3 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.3 | 8.5 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.3 | 1.4 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
| 0.3 | 1.1 | GO:0004822 | isoleucine-tRNA ligase activity(GO:0004822) |
| 0.3 | 0.6 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
| 0.3 | 2.2 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.3 | 1.1 | GO:0016531 | copper chaperone activity(GO:0016531) |
| 0.3 | 0.8 | GO:0015439 | heme-transporting ATPase activity(GO:0015439) |
| 0.3 | 1.1 | GO:0004307 | ethanolaminephosphotransferase activity(GO:0004307) |
| 0.3 | 1.8 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.3 | 1.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.3 | 1.3 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 0.3 | 2.9 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.3 | 2.1 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.3 | 3.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.3 | 0.5 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.3 | 1.5 | GO:0015333 | peptide:proton symporter activity(GO:0015333) proton-dependent peptide secondary active transmembrane transporter activity(GO:0022897) |
| 0.2 | 2.2 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.2 | 0.7 | GO:0005298 | proline:sodium symporter activity(GO:0005298) |
| 0.2 | 1.9 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.2 | 1.9 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.2 | 0.7 | GO:0090541 | MIT domain binding(GO:0090541) |
| 0.2 | 2.4 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.2 | 1.4 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.2 | 0.9 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.2 | 1.2 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.2 | 2.6 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.2 | 4.7 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.2 | 1.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.2 | 1.4 | GO:0000179 | rRNA (adenine-N6,N6-)-dimethyltransferase activity(GO:0000179) |
| 0.2 | 7.9 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.2 | 7.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.2 | 1.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.2 | 5.8 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.2 | 1.5 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
| 0.2 | 6.2 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.2 | 2.6 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.2 | 0.6 | GO:0010698 | acetyltransferase activator activity(GO:0010698) |
| 0.2 | 3.2 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.2 | 3.8 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.2 | 3.0 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.2 | 0.4 | GO:0004660 | protein farnesyltransferase activity(GO:0004660) |
| 0.2 | 1.7 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.2 | 1.5 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.2 | 2.7 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.2 | 13.3 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.2 | 1.4 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.2 | 6.5 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.2 | 0.8 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.2 | 5.5 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.2 | 0.6 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
| 0.2 | 2.0 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.2 | 2.8 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.2 | 1.0 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.2 | 1.2 | GO:0039552 | RIG-I binding(GO:0039552) |
| 0.2 | 0.6 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.2 | 0.8 | GO:0033765 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.2 | 2.5 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.2 | 7.9 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.2 | 7.1 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.2 | 2.3 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.2 | 0.8 | GO:0032427 | GBD domain binding(GO:0032427) |
| 0.2 | 0.8 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
| 0.2 | 2.7 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.2 | 2.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.2 | 3.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.2 | 1.7 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.2 | 2.6 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.2 | 5.3 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.2 | 3.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.2 | 0.7 | GO:0047066 | phospholipid-hydroperoxide glutathione peroxidase activity(GO:0047066) |
| 0.2 | 1.3 | GO:0047493 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.2 | 1.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.2 | 4.6 | GO:0019841 | retinol binding(GO:0019841) |
| 0.2 | 0.9 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.2 | 1.5 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.2 | 0.7 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.2 | 1.3 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.2 | 1.3 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.2 | 2.6 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.2 | 0.7 | GO:0016263 | glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase activity(GO:0016263) |
| 0.2 | 1.0 | GO:0004797 | deoxycytidine kinase activity(GO:0004137) thymidine kinase activity(GO:0004797) |
| 0.2 | 0.5 | GO:0048257 | 3'-flap endonuclease activity(GO:0048257) |
| 0.2 | 0.6 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.2 | 0.8 | GO:0008169 | C-methyltransferase activity(GO:0008169) |
| 0.2 | 9.5 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.2 | 1.1 | GO:0016657 | GMP reductase activity(GO:0003920) oxidoreductase activity, acting on NAD(P)H, nitrogenous group as acceptor(GO:0016657) |
| 0.2 | 13.9 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.2 | 0.6 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.2 | 0.5 | GO:0003863 | alpha-ketoacid dehydrogenase activity(GO:0003826) 3-methyl-2-oxobutanoate dehydrogenase (2-methylpropanoyl-transferring) activity(GO:0003863) |
| 0.2 | 0.6 | GO:0016639 | oxidoreductase activity, acting on the CH-NH2 group of donors, NAD or NADP as acceptor(GO:0016639) |
| 0.2 | 0.5 | GO:0097003 | adipokinetic hormone receptor activity(GO:0097003) |
| 0.2 | 1.2 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.2 | 1.5 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.1 | 1.0 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.1 | 0.3 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
| 0.1 | 1.6 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.1 | 0.4 | GO:0015235 | cobalamin transporter activity(GO:0015235) |
| 0.1 | 2.5 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.1 | 0.9 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.1 | 1.3 | GO:0003827 | alpha-1,3-mannosylglycoprotein 2-beta-N-acetylglucosaminyltransferase activity(GO:0003827) |
| 0.1 | 0.3 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.1 | 4.3 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 2.7 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.1 | 0.4 | GO:0047661 | racemase and epimerase activity, acting on amino acids and derivatives(GO:0016855) racemase activity, acting on amino acids and derivatives(GO:0036361) amino-acid racemase activity(GO:0047661) |
| 0.1 | 1.0 | GO:0023025 | MHC class Ib protein complex binding(GO:0023025) MHC class Ib protein binding, via antigen binding groove(GO:0023030) |
| 0.1 | 4.0 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.1 | 0.7 | GO:0004337 | dimethylallyltranstransferase activity(GO:0004161) geranyltranstransferase activity(GO:0004337) |
| 0.1 | 2.0 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.1 | 1.1 | GO:0015526 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 7.2 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.1 | 0.4 | GO:0019948 | SUMO activating enzyme activity(GO:0019948) |
| 0.1 | 0.8 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.1 | 0.4 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.1 | 7.5 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.1 | 0.7 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.1 | 5.3 | GO:0016417 | S-acyltransferase activity(GO:0016417) |
| 0.1 | 0.3 | GO:0070259 | tyrosyl-DNA phosphodiesterase activity(GO:0070259) |
| 0.1 | 0.4 | GO:1904854 | proteasome core complex binding(GO:1904854) |
| 0.1 | 0.8 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.1 | 0.4 | GO:0031071 | cysteine desulfurase activity(GO:0031071) |
| 0.1 | 0.6 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.1 | 1.4 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
| 0.1 | 0.4 | GO:0050211 | procollagen galactosyltransferase activity(GO:0050211) |
| 0.1 | 3.4 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.1 | 1.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.1 | 0.4 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.1 | 1.2 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.1 | 0.4 | GO:0004828 | serine-tRNA ligase activity(GO:0004828) |
| 0.1 | 5.7 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.1 | 0.7 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 39.1 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
| 0.1 | 2.9 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 31.2 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.1 | 2.9 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.4 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.1 | 2.0 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.1 | 2.5 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.1 | 5.5 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
| 0.1 | 1.3 | GO:0019211 | phosphatase activator activity(GO:0019211) |
| 0.1 | 0.6 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 1.3 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.1 | 4.2 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.1 | 16.6 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.1 | 1.5 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.1 | 0.9 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.1 | 5.0 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 1.5 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.1 | 1.1 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
| 0.1 | 1.6 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 24.7 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.1 | 1.0 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
| 0.1 | 1.8 | GO:0031701 | angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
| 0.1 | 9.0 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.1 | 1.8 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 1.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.3 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 1.2 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
| 0.1 | 1.6 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.1 | 0.9 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.1 | 1.0 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.1 | 0.4 | GO:0009374 | biotin binding(GO:0009374) |
| 0.1 | 1.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 0.8 | GO:0043139 | 5'-3' DNA helicase activity(GO:0043139) |
| 0.1 | 4.7 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.1 | 6.0 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.1 | 2.6 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.1 | 2.8 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.1 | 11.4 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.1 | 0.8 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.1 | 5.6 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.1 | 0.3 | GO:0030366 | molybdopterin synthase activity(GO:0030366) |
| 0.1 | 0.8 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.1 | 0.3 | GO:0015616 | DNA translocase activity(GO:0015616) |
| 0.1 | 0.3 | GO:0070336 | flap-structured DNA binding(GO:0070336) |
| 0.1 | 0.3 | GO:0004342 | glucosamine-6-phosphate deaminase activity(GO:0004342) |
| 0.1 | 1.0 | GO:0050544 | icosatetraenoic acid binding(GO:0050543) arachidonic acid binding(GO:0050544) |
| 0.1 | 0.7 | GO:0008312 | 7S RNA binding(GO:0008312) |
| 0.1 | 0.4 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 0.8 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.1 | 1.4 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
| 0.1 | 1.7 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.1 | 3.1 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.1 | 0.4 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.1 | 0.3 | GO:0005137 | interleukin-5 receptor binding(GO:0005137) |
| 0.1 | 3.0 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.1 | 1.2 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.1 | 0.8 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.1 | 1.8 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.1 | 5.4 | GO:0004521 | endoribonuclease activity(GO:0004521) |
| 0.1 | 0.9 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.1 | 0.7 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
| 0.1 | 0.9 | GO:0001851 | complement component C3b binding(GO:0001851) |
| 0.1 | 0.8 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.1 | 0.5 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.1 | 0.2 | GO:0035034 | histone acetyltransferase regulator activity(GO:0035034) |
| 0.1 | 0.9 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.1 | 0.2 | GO:1990259 | protein-glutamine N-methyltransferase activity(GO:0036009) histone-glutamine methyltransferase activity(GO:1990259) |
| 0.1 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 1.2 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 3.0 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.1 | 0.6 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 0.3 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
| 0.1 | 0.8 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 1.0 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.1 | 0.7 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.6 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.1 | 1.5 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.1 | 2.9 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 0.4 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.1 | 0.3 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.1 | 1.4 | GO:0043225 | anion transmembrane-transporting ATPase activity(GO:0043225) |
| 0.1 | 4.9 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.1 | 0.8 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 0.9 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.1 | 0.5 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 0.2 | GO:0097158 | pre-mRNA intronic pyrimidine-rich binding(GO:0097158) |
| 0.1 | 2.0 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.4 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 1.9 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 2.0 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.1 | 1.3 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.1 | 5.2 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
| 0.1 | 1.5 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.1 | 1.9 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.1 | 8.0 | GO:0008276 | protein methyltransferase activity(GO:0008276) |
| 0.1 | 3.0 | GO:0003951 | NAD+ kinase activity(GO:0003951) |
| 0.1 | 3.2 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.1 | 2.5 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.1 | 0.6 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.1 | 2.8 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.1 | 0.5 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.1 | 1.1 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
| 0.1 | 0.4 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.1 | 0.4 | GO:0003998 | acylphosphatase activity(GO:0003998) |
| 0.1 | 5.1 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.1 | 1.5 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
| 0.1 | 1.5 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.1 | 1.2 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.1 | 1.0 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.1 | 1.2 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.1 | 0.4 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.1 | 0.3 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) maltose alpha-glucosidase activity(GO:0032450) |
| 0.1 | 1.9 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.1 | 2.0 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.1 | 19.5 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
| 0.1 | 0.5 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.1 | 0.5 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.1 | 8.1 | GO:0019903 | protein phosphatase binding(GO:0019903) |
| 0.1 | 1.7 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.1 | 1.2 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.1 | 0.3 | GO:0003883 | CTP synthase activity(GO:0003883) |
| 0.1 | 3.3 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.1 | 3.4 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
| 0.1 | 2.2 | GO:0004871 | signal transducer activity(GO:0004871) |
| 0.1 | 0.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.1 | 0.2 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
| 0.1 | 0.3 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.1 | 0.6 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
| 0.1 | 1.9 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.1 | 1.9 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.1 | 2.6 | GO:0008173 | RNA methyltransferase activity(GO:0008173) |
| 0.1 | 1.2 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 6.1 | GO:0051082 | unfolded protein binding(GO:0051082) |
| 0.1 | 1.0 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.1 | 1.7 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
| 0.1 | 1.1 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.1 | 4.8 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.1 | 5.9 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
| 0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 1.8 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.0 | 1.5 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 1.5 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.9 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.0 | 1.1 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 0.2 | GO:0005471 | ATP:ADP antiporter activity(GO:0005471) adenine transmembrane transporter activity(GO:0015207) |
| 0.0 | 1.1 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
| 0.0 | 6.3 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) |
| 0.0 | 1.8 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 0.3 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.0 | 2.1 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.6 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.0 | 1.1 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 1.4 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 1.3 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.9 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.0 | 0.2 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
| 0.0 | 1.2 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.0 | 2.7 | GO:0030295 | protein kinase activator activity(GO:0030295) |
| 0.0 | 0.4 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.7 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
| 0.0 | 1.6 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 3.4 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.7 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.0 | 5.4 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.0 | 19.8 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.0 | 0.1 | GO:0019209 | kinase activator activity(GO:0019209) |
| 0.0 | 0.1 | GO:0048040 | UDP-glucuronate decarboxylase activity(GO:0048040) |
| 0.0 | 0.7 | GO:0016595 | glutamate binding(GO:0016595) |
| 0.0 | 1.0 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.0 | 3.9 | GO:0004721 | phosphoprotein phosphatase activity(GO:0004721) |
| 0.0 | 3.9 | GO:0030165 | PDZ domain binding(GO:0030165) |
| 0.0 | 1.6 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.0 | 0.4 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 3.1 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
| 0.0 | 0.1 | GO:0046921 | glycoprotein 6-alpha-L-fucosyltransferase activity(GO:0008424) alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
| 0.0 | 0.5 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.0 | 1.5 | GO:0043566 | structure-specific DNA binding(GO:0043566) |
| 0.0 | 1.2 | GO:0043531 | ADP binding(GO:0043531) |
| 0.0 | 2.1 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.9 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.7 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.0 | 1.7 | GO:0016303 | 1-phosphatidylinositol-3-kinase activity(GO:0016303) |
| 0.0 | 0.3 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 1.1 | GO:0008289 | lipid binding(GO:0008289) |
| 0.0 | 0.2 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.0 | 0.2 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.4 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.7 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.6 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.0 | 0.1 | GO:0004584 | dolichyl-phosphate-mannose-glycolipid alpha-mannosyltransferase activity(GO:0004584) |
| 0.0 | 0.5 | GO:0030275 | LRR domain binding(GO:0030275) |
| 0.0 | 0.8 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 4.2 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.6 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.2 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.3 | GO:0032451 | demethylase activity(GO:0032451) |
| 0.0 | 0.2 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
| 0.0 | 0.8 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 1.8 | GO:0047485 | protein N-terminus binding(GO:0047485) |
| 0.0 | 0.3 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 1.7 | GO:0003724 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) |
| 0.0 | 1.4 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.0 | 0.4 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
| 0.0 | 2.9 | GO:0019905 | syntaxin binding(GO:0019905) |
| 0.0 | 0.6 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
| 0.0 | 2.1 | GO:0008081 | phosphoric diester hydrolase activity(GO:0008081) |
| 0.0 | 0.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.6 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.5 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 0.4 | GO:0001164 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.0 | 1.3 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
| 0.0 | 0.2 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.2 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.4 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.3 | GO:0003995 | acyl-CoA dehydrogenase activity(GO:0003995) |
| 0.0 | 0.4 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.1 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 0.1 | GO:0015350 | methotrexate transporter activity(GO:0015350) |
| 0.0 | 0.3 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 3.1 | GO:0003682 | chromatin binding(GO:0003682) |
| 0.0 | 0.2 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.0 | 0.1 | GO:0080019 | fatty-acyl-CoA reductase (alcohol-forming) activity(GO:0080019) |
| 0.0 | 0.4 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
| 0.0 | 0.5 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 3.8 | GO:0031625 | ubiquitin protein ligase binding(GO:0031625) |
| 0.0 | 0.2 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.5 | GO:0003684 | damaged DNA binding(GO:0003684) |
| 0.0 | 0.4 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
| 0.0 | 0.9 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.3 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 0.4 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 0.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 1.4 | GO:0016791 | phosphatase activity(GO:0016791) |
| 0.0 | 2.9 | GO:0000287 | magnesium ion binding(GO:0000287) |
| 0.0 | 0.6 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
| 0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.2 | GO:0005080 | protein kinase C binding(GO:0005080) |
| 0.0 | 0.3 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.0 | 6.5 | GO:0003712 | transcription cofactor activity(GO:0003712) |
| 0.0 | 0.4 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.0 | 0.2 | GO:0008047 | enzyme activator activity(GO:0008047) |
| 0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.4 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.6 | GO:0005543 | phospholipid binding(GO:0005543) |
| 0.0 | 0.2 | GO:0005262 | calcium channel activity(GO:0005262) |
| 0.0 | 7.3 | GO:0008270 | zinc ion binding(GO:0008270) |
| 0.0 | 0.9 | GO:0001618 | virus receptor activity(GO:0001618) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.3 | 4.6 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.3 | 9.3 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.3 | 21.4 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.3 | 5.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.3 | 12.5 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.2 | 1.9 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.2 | 0.8 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.2 | 0.9 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.2 | 11.2 | PID ATM PATHWAY | ATM pathway |
| 0.2 | 1.8 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.2 | 5.9 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.1 | 5.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.1 | 3.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 10.8 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 4.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 0.7 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 2.4 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 4.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 3.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 6.9 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.1 | 3.7 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.1 | 7.5 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 4.0 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.1 | 1.2 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.1 | 0.6 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 1.4 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 8.6 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.1 | 2.7 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.1 | 4.6 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.1 | 2.8 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 2.6 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.1 | 5.7 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.1 | 3.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.1 | 3.6 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 2.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.1 | 2.0 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 2.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.1 | 5.1 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.1 | 3.2 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.1 | 0.8 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 0.5 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 3.6 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 4.0 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.1 | 1.7 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.1 | 3.4 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.1 | 4.4 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.1 | 3.9 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.1 | 0.4 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 0.9 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.1 | 1.4 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 2.2 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 3.4 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.0 | 1.2 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 1.7 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 3.9 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 1.1 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.4 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 3.2 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 1.0 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 1.7 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 3.5 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 1.1 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 2.9 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.0 | 0.6 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 3.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 1.9 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 1.2 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 2.1 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 1.5 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 0.7 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 1.8 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.3 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 2.0 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 1.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.8 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 1.0 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 1.0 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 1.0 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.0 | 0.6 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 1.0 | PID E2F PATHWAY | E2F transcription factor network |
| 0.0 | 0.8 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.6 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 0.6 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.2 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.2 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.7 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.3 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.5 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
| 0.0 | 0.2 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.3 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 1.1 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.3 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.6 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.3 | 1.3 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.9 | 3.6 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
| 0.7 | 17.6 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.7 | 10.7 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.5 | 0.5 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.4 | 14.9 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.4 | 9.3 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.4 | 8.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.4 | 23.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.3 | 11.4 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.3 | 9.2 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.3 | 27.0 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.3 | 5.3 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.3 | 0.6 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.3 | 3.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.2 | 5.4 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.2 | 13.8 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.2 | 4.9 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.2 | 2.2 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.2 | 7.2 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.2 | 4.1 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.2 | 4.8 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.2 | 12.2 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.2 | 8.3 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.2 | 1.4 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.2 | 14.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.2 | 2.5 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.2 | 7.5 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.2 | 6.2 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
| 0.2 | 3.4 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.2 | 2.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.2 | 9.2 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.2 | 8.3 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.2 | 2.5 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.2 | 5.9 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.2 | 4.2 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.2 | 5.1 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.2 | 6.1 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.2 | 2.4 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.1 | 0.4 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.1 | 1.7 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
| 0.1 | 3.9 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.1 | 1.5 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.1 | 7.7 | REACTOME NUCLEOTIDE EXCISION REPAIR | Genes involved in Nucleotide Excision Repair |
| 0.1 | 5.0 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
| 0.1 | 0.6 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.1 | 1.8 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 2.3 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
| 0.1 | 1.8 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.1 | 41.4 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.1 | 1.3 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.1 | 9.1 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.1 | 3.7 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 5.2 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.1 | 0.6 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.1 | 4.1 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
| 0.1 | 1.8 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 4.8 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 6.0 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
| 0.1 | 11.3 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.1 | 0.7 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.1 | 0.9 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 2.8 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 1.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.1 | 2.0 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.1 | 3.1 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
| 0.1 | 2.1 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 10.2 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.1 | 0.5 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.1 | 1.7 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.1 | 2.9 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 3.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.1 | 3.0 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
| 0.1 | 0.9 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
| 0.1 | 7.0 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.1 | 1.5 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.1 | 1.0 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.1 | 1.9 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.1 | 0.8 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 4.6 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.1 | 2.4 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.1 | 2.7 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.1 | 1.0 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.1 | 1.9 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
| 0.1 | 0.5 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.1 | 1.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 2.8 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
| 0.1 | 1.7 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 1.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
| 0.1 | 5.0 | REACTOME MEIOSIS | Genes involved in Meiosis |
| 0.1 | 1.5 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.1 | 2.0 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 3.2 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.1 | 1.5 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.1 | 3.4 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.1 | 1.0 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.1 | 4.6 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.1 | 1.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.1 | 0.9 | REACTOME TELOMERE MAINTENANCE | Genes involved in Telomere Maintenance |
| 0.1 | 3.1 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.1 | 2.8 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
| 0.1 | 1.7 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.1 | 1.5 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.1 | 0.2 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.1 | 3.6 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.1 | 6.5 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
| 0.1 | 1.8 | REACTOME PROTEIN FOLDING | Genes involved in Protein folding |
| 0.0 | 1.5 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
| 0.0 | 0.8 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.0 | 4.6 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 3.3 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.2 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 1.7 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.0 | 1.3 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.0 | 1.1 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 3.4 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.0 | 2.4 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
| 0.0 | 0.5 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 1.0 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 7.2 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 1.4 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.0 | 0.9 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 1.3 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.0 | 1.1 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 1.0 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 1.9 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.0 | 3.4 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.0 | 1.6 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.2 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
| 0.0 | 0.6 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 2.8 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.0 | 0.9 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.6 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 1.7 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.1 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.0 | 0.6 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.7 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 1.5 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 1.0 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 0.8 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
| 0.0 | 0.4 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.3 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.6 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.5 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.0 | 0.9 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.8 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.5 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
| 0.0 | 0.9 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.2 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
| 0.0 | 0.1 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.0 | 0.5 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.2 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 0.3 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 2.7 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
| 0.0 | 0.2 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.0 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.5 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |